This page is currently not sponsored. Click here to sponsor this page.
Type:
Other/historical names associated with this locality:
Otjikoto Region
Other Languages:
Afrikaans:
Osjikoto, Namibië
French:
Oshikoto, Namibie
German:
Oshikoto, Namibia
Italian:
Regione di Oshikoto, Namibia
Russian:
Ошикото, Намибия
Simplified Chinese:
奧希科托區, 纳米比亚
Spanish:
Región de Oshikoto, Namibia
Arabic:
إقليم أوشيكوتو, ناميبيا
Bulgarian:
Ошикото, Намибия
Cebuano:
Oshikoto, Namibya
Croatian:
Oshikoto, Namibija
Dutch:
Oshikoto, Namibië
Faroese:
Oshikoto, Namibia
Finnish:
Oshikoto, Namibia
Georgian:
ოშიკოტოს რეგიონი, ნამიბია
Hindi:
ओशीकोतो प्रदेश, नामीबिया
Japanese:
オシコト州, ナミビア
Korean:
오시코토 주, 나미비아
Northern Frisian:
Oshikoto (Regiuun), Namiibia
Norwegian:
Oshikoto (region), Namibia
Polish:
Oshikoto, Namibia
Portuguese:
Oshikoto, Namíbia
Swahili:
Mkoa wa Oshikoto, Namibia
Turkish:
Oshikoto Bölgesi, Namibya
Ukrainian:
Ошикото, Намібія
Urdu:
اوشیکوتو علاقہ, نمیبیا
Western Punjabi:
صوبہ اوشیکوٹو, نمیبیا
Oshikoto is one of the fourteen regions of Namibia, named after Lake Otjikoto. Its capital is Omuthiya. The city of Tsumeb, Otjikoto's capital until 2008, and the towns of Omuthiya and Oniipa are also situated in this region.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities374 valid minerals. 76 (TL) - type locality of valid minerals. 1 (FRL) - first recorded locality of unapproved mineral/variety/etc. 2 erroneous literature entries.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Abellaite Formula: NaPb2(CO3)2(OH) References: Desor, J. (10/2023) SEM-EDS & Raman spectroscopyIdentified by Joy Desor: SEM-EDS, Raman Spectroscopy |
| ⓘ Acanthite Formula: Ag2S |
| ✪ Adamite Formula: Zn2(AsO4)(OH) Description: https://youtu.be/3qgo9po-bT8 A very interesting presentation on the Adamite-Zincolvinite-Olivenite series. References: |
| ⓘ Formula: Zn2(AsO4)(OH) Locality: Tsumeb Mine (Ongopolo Mine), Tsumeb, Oshikoto Region, Namibia - erroneously reported Description: Analysis shows less than 0.1% Cobalt, consequently cannot be regarded as 'cobaltoan' |
| ⓘ Formula: (Zn,Cu)2AsO4OH Locality: Tsumeb Mine (Ongopolo Mine), Tsumeb, Oshikoto Region, Namibia - erroneously reported Description: "Cuprian adamite" is primarily Zincolivenite or close to end-member Adamite. References: |
| ⓘ Agardite-(Ce) Formula: CeCu6(AsO4)3(OH)6 · 3H2O |
| ✪ Alamosite Formula: PbSiO3 Habit: divergent sprays Colour: clear / white Description: “Until the nineteen seventies the presence of lead silicates was unknown at Tsumeb. The first lead silicate specimen, alamosite, was discovered during a photographic session at the collection of W.R. Kahn. A piece of aragonite was to be featured, but the specimen that was photographed was slightly too heavy for aragonite. It was composed of radiating 8 cm spray of bundles of elongated, terminated white crystals up to 4 cm. The luster was also different to the known luster of the carbonate. Further examination gave the surprising result that this aragonite was in fact alamosite. This particular specimen is the best alamosite yet found anywhere. Another great specimen belongs to the collection of the Houston Museum. Tsumeb is the only locality from which crystals of alamosite have been reported, and a total of about 20 specimens have been found. Alamosite is often associated with small green-black spheres of melanotekite.”1
Georg Gebhard, Tsumeb, 1999, p163. References: |
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Algodonite Formula: (Cu1-xAsx) Locality: Tsumeb, Oshikoto Region, Namibia References: |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ Analcime Formula: Na(AlSi2O6) · H2O |
| ⓘ Anatase Formula: TiO2 |
| ⓘ Andyrobertsite (TL) Formula: KCdCu5(AsO4)4(H2AsO4) · 2H2O Type Locality: Habit: na Colour: Blue |
| ⓘ Anglesite Formula: PbSO4 Localities: Description: Some large crystals, over 20cm on edge. |
| ⓘ Anhydrite Formula: CaSO4 References: Chetty, D., Frimmel, H. E. (2000) The role of evaporites in the genesis of base metal sulphide mineralisation in the Northern Platform of the Pan-African Damara Belt, Namibia: geochemical and fluid inclusion evidence from carbonate wall rock alteration. Mineralium Deposita, 35 (4) 364-376 doi:10.1007/s001260050247 |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 References: Chetty, D., Frimmel, H. E. (2000) The role of evaporites in the genesis of base metal sulphide mineralisation in the Northern Platform of the Pan-African Damara Belt, Namibia: geochemical and fluid inclusion evidence from carbonate wall rock alteration. Mineralium Deposita, 35 (4) 364-376 doi:10.1007/s001260050247 |
| ⓘ Anorthoroselite Formula: Ca2Co(AsO4)2 · 2H2O |
| ⓘ Antlerite Formula: Cu3(SO4)(OH)4 |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Aragonite var. Lead-bearing Aragonite Formula: (Ca,Pb)CO3 |
| ⓘ Aragonite var. Zinc-bearing Aragonite Formula: (Ca,Zn)CO3 |
| ⓘ Argutite Formula: GeO2 |
| ⓘ Argyrodite Formula: Ag8GeS6 |
| ⓘ Åkermanite Formula: Ca2Mg[Si2O7] |
| ⓘ Arsenbrackebuschite (TL) Formula: Pb2Fe3+(AsO4)2(OH) Type Locality: References: |
| ⓘ Arsendescloizite (TL) Formula: PbZn(AsO4)(OH) Type Locality: Colour: orange yellow to greenish Description: ound as yellow tabular crystals intergrown in rose-like aggregates in tennantite ore from Tsumeb…associated with willemite, chalcocite, mimetite, quartz and goethite |
| ⓘ Arseniosiderite Formula: Ca2Fe3+3(AsO4)3O2 · 3H2O Habit: radial and granular aggregates Colour: golden-yellow to dark brown Description: Found on specimens from the second oxidation zone, section 49E on the 30th level, in association with carminite, beudantite, anglesite, mimetite, pharmacosiderite and beaverite |
| ⓘ Arsenocrandallite Formula: CaAl3(AsO4)(AsO3OH)(OH)6 |
| ⓘ Arsenogoyazite Formula: SrAl3(AsO4)(AsO3OH)(OH)6 Habit: rhombohedral Colour: milky-white Description: on a single specimen small crystals with quartz and hematite |
| ⓘ Arsenohopeite (TL) Formula: Zn3(AsO4)2 · 4H2O Type Locality: References: Williams, P. A., Hatert, F., Pasero, M., Mills, S. J. (2011) IMA Commission on New Minerals, Nomenclature and Classification (CNMNC) Newsletter 8. Mineralogical Magazine, 75 (2) 289-294 doi:10.1180/minmag.2011.075.2.289 |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Arsentsumebite (TL) Formula: Pb2Cu(AsO4)(SO4)(OH) Type Locality: Description: The most easily recognizable occurrence of arsentsumebite is the emerald- to apple-green crusts on mimetite. Arsentsumebite rims these pseudomorphs, which consists of bayldonite and duftite in the inner part of the host mimetite crystals. The finest specimens of all time were found during the excavation of the 6 level in 1988. Surfaces up to 10 by 5 cm are completely covered by brilliant crystals of arsentsumebite. Crystals are always small, being less than 2 mm. (Gebhard, 1999)
In 1990, workings in the upper levels of the Tsumeb mine produced a quantity of extremely fine azurite specimens. Some specimens are associated with green smithsonite, or have been partially replaced by arsentsumebite. The color combinations are striking, as are the crystals themselves, some of which are nearly 10 cm in length, with excellent luster. ( Mineralogical Record, 1991) |
| ⓘ Arthurite Formula: CuFe3+2(AsO4)2(OH)2 · 4H2O |
| ⓘ Ashoverite Formula: Zn(OH)2 |
| ⓘ Atacamite Formula: Cu2(OH)3Cl |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ Austinite Formula: CaZn(AsO4)(OH) |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 Localities: Habit: elongated crystals Colour: bright blue Description: Some crystals are partially or completely altered to malachite. |
| ⓘ Baileychlore Formula: Zn5Al(AlSi3O10)(OH)8 |
| ✪ Bartelkeite (TL) Formula: Pb(Fe2+Ge)[Ge2O7](OH)2 · H2O Type Locality: |
| ⓘ Baryte Formula: BaSO4 Habit: Tabular Colour: chocolate-brown Description: Occasionally produced chocolate-brown tabular crystals up to 10cm long. |
| ⓘ Bayldonite Formula: PbCu3(AsO4)2(OH)2 |
| ⓘ Beaverite-(Cu) Formula: Pb(Fe3+2Cu)(SO4)2(OH)6 |
| ⓘ Bendadaite Formula: Fe2+Fe3+2(AsO4)2(OH)2 · 4H2O |
| ⓘ Berthierine Formula: (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| ⓘ Berzelianite Formula: Cu2-xSe (x ≈ 0.12) |
| ⓘ Betekhtinite Formula: Pb2(Cu,Fe)22-24S15 References: |
| ⓘ Betpakdalite-CaCa Formula: [Ca2(H2O)17Ca(H2O)6][Mo6+8As5+2Fe3+3O36(OH)] |
| ⓘ Betpakdalite-CaMg (TL) Formula: [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe3+3O36(OH)] Type Locality: References: Williams, P. A., Hatert, F., Pasero, M., Mills, S. J. (2011) New minerals and nomenclature modifications approved in 2011, CNMNC Newsletter No. 10. Mineralogical Magazine, 75 (5) 2549-2561 doi:10.1180/minmag.2011.075.5.2549 Kampf, A. R., Mills, S. J., Rumsey, M. S., Dini, M., Birch, W. D., Spratt, J., Pluth, J. J., Steele, I. M., Jenkins, R. A., Pinch, W. W. (2012) The heteropolymolybdate family: structural relations, nomenclature scheme and new species. Mineralogical Magazine, 76 (5) 1175-1207 doi:10.1180/minmag.2012.076.5.09 |
| ⓘ 'Betpakdalite Group' References: Kampf, A. R., Mills, S. J., Rumsey, M. S., Dini, M., Birch, W. D., Spratt, J., Pluth, J. J., Steele, I. M., Jenkins, R. A., Pinch, W. W. (2012) The heteropolymolybdate family: structural relations, nomenclature scheme and new species. Mineralogical Magazine, 76 (5) 1175-1207 doi:10.1180/minmag.2012.076.5.09 |
| ✪ Beudantite Formula: PbFe3+3(AsO4)(SO4)(OH)6 |
| ✪ Biehlite (TL) Formula: ((Sb,As)O)2[MoO4] Type Locality: |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Bournonite Formula: PbCuSbS3 |
| ⓘ Brianyoungite Formula: Zn3(CO3,SO4)(OH)4 References: |
| ⓘ Briartite Formula: Cu2FeGeS4 |
| ⓘ Brindleyite Formula: (Ni,Al)3(Si,Al)2O5(OH)4 References: |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 |
| ⓘ Brucite Formula: Mg(OH)2 |
| ✪ Brunogeierite (TL) Formula: Ge4+Fe2+2O4 Type Locality: |
| ⓘ Cadsulfohite (TL) Formula: Cd2(SO4)(OH)2 Type Locality: |
| ✪ Calcioandyrobertsite (TL) Formula: KCaCu5(AsO4)4(H2AsO4) · 2H2O Type Locality: |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 6 localities in this region. |
| ⓘ Caledonite Formula: Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ Calvertite (TL) Formula: Cu5Ge0.5S4 Type Locality: |
| ⓘ Carminite Formula: PbFe3+2(AsO4)2(OH)2 |
| ⓘ 'Carnevallite' Formula: Cu3GaS4 References: Fleischer, M.; Nickel, E.H. (1970) New Minerals Names. American Mineralogist, 55 (9-10). p.1810-1818. pp.1811-1812 - (abstract of Geier & Ottemann, 1970) |
| ⓘ Carrollite Formula: CuCo2S4 References: |
| ⓘ Celestine Formula: SrSO4 |
| ⓘ Ceruleite Formula: Cu2Al7(AsO4)4(OH)13 · 11.5H2O Locality: Tsumeb, Oshikoto Region, Namibia |
| ⓘ Cerussite Formula: PbCO3 Localities: Description: Crystals are colourless to white, often transparent, known to be over 30 cm in diameter and several kilos in weight. Rare varieties are coloured red or blue by the presence of copper minerals.
Plate 20/21 from Wilson, Wendell. E.; Bartsch, Joel A.; Mauthner, Mark (2004) Masterpieces of the Mineral World. Houston Museum of Natural Science. [https://www.mindat.org/reference.php?id=18945017] |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalconatronite Formula: Na2Cu(CO3)2 · 3H2O References: Desor, J. (10/2023) SEM-EDS & Raman spectroscopyIdentified by Joy Desor: SEM-EDS, Raman Spectroscopy |
| ⓘ Chalcophanite Formula: ZnMn4+3O7 · 3H2O References: |
| ⓘ Chalcophyllite Formula: Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O References: |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Chenevixite Formula: Cu2Fe3+2(AsO4)2(OH)4 References: |
| ⓘ Chlorargyrite Formula: AgCl References: |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ✪ Chudobaite (TL) Formula: Mg5(AsO4)2(AsO3OH)2 · 10H2O Type Locality: |
| ⓘ Cinnabar Formula: HgS |
| ⓘ Claudetite Formula: As2O3 |
| ⓘ Clausthalite Formula: PbSe References: Desor, J. (03/2024) SEM-EDS Identified by Joy Desor: SEM-EDS |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinoclase Formula: Cu3(AsO4)(OH)3 References: |
| ⓘ Cobalttsumcorite Formula: PbCo2(AsO4)2 · 2H2O |
| ⓘ Colusite Formula: Cu13VAs3S16 |
| ⓘ Conichalcite Formula: CaCu(AsO4)(OH) |
| ⓘ Connellite Formula: Cu19(SO4)(OH)32Cl4 · 3H2O |
| ⓘ Corkite Formula: PbFe3+3(PO4)(SO4)(OH)6 |
| ⓘ Cornwallite Formula: Cu5(AsO4)2(OH)4 Habit: Crystalline crusts Colour: Green Description: Found covering quartz with malachite and bayldonite. |
| ⓘ Coronadite Formula: Pb(Mn4+6Mn3+2)O16 |
| ⓘ Cotunnite Formula: PbCl2 References: |
| ⓘ Covellite Formula: CuS |
| ⓘ Crandallite Formula: CaAl3(PO4)(PO3OH)(OH)6 Locality: Tsumeb, Oshikoto Region, Namibia References: |
| ⓘ Cubanite Formula: CuFe2S3 |
| ⓘ Cuprite Formula: Cu2O |
| ⓘ Cuprite var. Chalcotrichite Formula: Cu2O |
| ⓘ Cupropearceite Formula: [Cu6As2S7][Ag9CuS4] |
| ⓘ Cupropolybasite Formula: [Cu6Sb2S7][Ag9CuS4] |
| ⓘ Davidlloydite (TL) Formula: Zn3(AsO4)2 · 4H2O Type Locality: References: Williams, P. A., Hatert, F., Pasero, M., Mills, S. J. (2011) New minerals and nomenclature modifications approved in 2011, CNMNC Newsletter No. 10. Mineralogical Magazine, 75 (5) 2549-2561 doi:10.1180/minmag.2011.075.5.2549 Hawthorne, Frank C., Cooper, Mark A., Abdu, Yassir A., Ball, Neil A., Back, Malcolm E., Tait, Kim T. (2012) Davidlloydite, ideally Zn3(AsO4)2(H2O)4, a new arsenate mineral from the Tsumeb mine, Otjikoto (Oshikoto) region, Namibia: description and crystal structure. Mineralogical Magazine, 76 (1) 45-57 doi:10.1180/minmag.2012.076.1.45 |
| ⓘ Delafossite Formula: Cu+Fe3+O2 Locality: Tsumeb, Oshikoto Region, Namibia References: now in the Paul Bongaerts collectionIdentified by Steffen Michalski: XRD |
| ⓘ Descloizite Formula: PbZn(VO4)(OH) Localities: Reported from at least 7 localities in this region. Habit: Small spear point and lath-like crystals. Colour: Black, dark grey with a greenish tinge. Fluorescence: Not fluorescent. |
| ⓘ Descloizite var. Copper-bearing Descloizite Formula: Pb(Zn,Cu)VO4OH Fluorescence: Not fluorescent. |
| ⓘ Devilline Formula: CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ Digenite Formula: Cu9S5 |
| ⓘ Dioptase Formula: CuSiO3 · H2O Localities: Description: Plate 30 from Wilson, Wendell. E.; Bartsch, Joel A.; Mauthner, Mark (2004) Masterpieces of the Mineral World. Houston Museum of Natural Science. [https://www.mindat.org/reference.php?id=18945017] |
| ⓘ Djurleite Formula: Cu31S16 References: |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Dolomite var. Cobalt-bearing Dolomite Formula: Ca(Mg,Co)(CO3)2 |
| ⓘ Dolomite var. Zinc-bearing Dolomite Formula: Ca(Mg,Zn)(CO3)2 |
| ⓘ Domeykite Formula: Cu3As |
| ⓘ Dufrénite Formula: Ca0.5Fe2+Fe3+5(PO4)4(OH)6 · 2H2O |
| ⓘ Duftite (TL) Formula: PbCu(AsO4)(OH) Type Locality: Description: Guillemin (1956) proposed that compositions close to end member duftite – PbCu(AsO4)(OH) – are isostructural with descloizite. He called duftites of this composition α-duftite and found that it could readily be synthesised in the laboratory. However, he also found that certain duftites with more than about 20% substitution of calcium for lead were isomorphous with conichalcite and could not be synthesised. He proposed the name β-duftite for these compositions and suggested that β-duftite forms a series with conichalcite.
The distinction between these two “polymorphs” was quite important at Tsumeb in the 1970s and 1980s, because they accounted for a significant proportion of the lead (and to a smaller extent copper) in certain ore types but responded quite differently to the flotation process in the concentrator. Because of this, former Tsumeb Corporation mineralogist John Innes encouraged various technical and academic studies of these minerals. The “duftite problem” has been discussed by several authors, but the most relevant to a simple explanation are as follows:
Jambor et al. (1980) examined a series of calcian duftite and plumbian conichalcite specimens from Tsumeb and concluded that complete solid solution probably exists between the duftite and conichalcite, and they proposed that β-duftite is merely an intermediate in the duftite-conichalcite series (as opposed to a distinct polymorph).
Kharisun et al. (1998) studied the structure of duftite, conichalcite and of intermediate compositions. They agreed with Jambor et al. (1980) that “β-duftite” is not a distinct mineral but rather a composition, or series of compositions, within the duftite-conichalcite series. However, the relationship is not one of simple solid solution; instead, modulated structures comprising domains of different composition occur. This explains why Guillemin (1956) had been unable to synthesise his beta polymorph, but it also indicates that “β-duftite” is not a valid mineral!
Burke (2006) included “duftite-beta” among minerals officially discredited by the IMA.
So much for “β-duftite”, but it is interesting (to us Tsumeb geeks anyway) that Jambor et al. (1980) also demonstrated extensive solid solution between conichalcite and austinite. They noted, though, that no compositions with both Pb>Ca and Zn>Cu had been found at that time, but that any such compositions found in the future would be an “as-yet-undescribed new member of the adelite group”. Such compositions were later found, leading to the description of a new mineral – arsenodescloizite (Keller and Dunn, 1980) for which Tsumeb is the type locality.
My good friend Paul Carr and I’ve recently run about 250 quantitative analyses of Tsumeb duftites, conichalcites and austinites. The compositions are shown in the accompanying chart. Duftite plots in the bottom left quadrant; conichalcite in the bottom right; austinite in the top right, and (much rarer) arsenodescloizite in the top left quadrant. As you can see, a very wide range of compositions are present.
While it's usually possible to identify austinite by visual means, the distinction between conichalcite and duftite is much more difficult. I’ve learned that in the absence of an analysis, it’s much safer to label these things as “duftite / conichalcite series”.
Malcolm Southwood.
References:
Burke, E. A. J. (2006). A mass discreditation of GQN minerals. The Canadian Mineralogist, 44, 1557–1560.
Guillemin, C. (1956). Contribution a la minéralogie des arséniates, phosphates, et vanadates de cuivre. Bulletin de la Société Français Minéralogie et de Cristallographie, 79, 7-95.
Jambor, J.L., Owens, D.R. and Dutrizac, J.E. (1980). Solid solution in the adelite group of arsenates. The Canadian Mineralogist, 18, 191-195.
Kharisun, Taylor, M. R., Bevan, D. J. M. and Pring, A. (1998). The crystal chemistry of duftite, PbCuAsO4(OH) and the beta-duftite problem. Mineralogical Magazine, 62, 121-130. References: |
| ⓘ 'Duftite-alpha' Formula: PbCu(AsO4)(OH) Habit: Distorted crystals with irregular faces. Crystals to 3mm. Colour: Olive to gray-green and dark green Description: Darker and more rare than duftite-beta.
Guillemin (1956) proposed that compositions close to end member duftite – PbCu(AsO4)(OH) – are isostructural with descloizite. He called duftites of this composition α-duftite and found that it could readily be synthesisd in the laboratory. However, he also found that certain duftites with more than about 20% substitution of calcium for lead were isomorphous with conichalcite and could not be synthesised. He proposed the name β-duftite for these compositions and suggested that β-duftite forms a series with conichalcite.
The distinction between these two “polymorphs” was quite important at Tsumeb in the 1970s and 1980s, because they accounted for a significant proportion of the lead (and to a smaller extent copper) in certain ore types but responded quite differently to the flotation process in the concentrator. Because of this, former Tsumeb Corporation mineralogist John Innes encouraged various technical and academic studies of these minerals. The “duftite problem” has been discussed by several authors, but the most relevant to a simple explanation are as follows:
Jambor et al. (1980) examined a series of calcian duftite and plumbian conichalcite specimens from Tsumeb and concluded that complete solid solution probably exists between the duftite and conichalcite and they proposed that β-duftite is merely an intermediate in the duftite-conichalcite series (as opposed to a distinct polymorph).
Kharisun et al. (1998) studied the structure of duftite, conichalcite and of intermediate compositions. They agreed with Jambor et al. (1980) that “β-duftite” is not a distinct mineral but rather a composition, or series of compositions within the duftite-conichalcite series. However, the relationship is not one of simple solid solution; instead, modulated structures comprising domains of different composition occur. This explains why Guillemin (1956) had been unable to synthesise his beta polymorph, but it also indicates that “β-duftite” is not a valid mineral!
Burke (2006) included “duftite-beta” among minerals officially discredited by the IMA.
So much for “β-duftite”, but its interesting (to us Tsumeb geeks anyway) that Jambor et al. (1980) also demonstrated extensive solid solution between conichalcite and austinite. They noted, though, that no compositions with both Pb>Ca and Zn>Cu had been found at that time, but that any such compositions found in the future would be an “as-yet-undescribed new member of the adelite group”. Such compositions were later found, leading to the description of a new mineral – arsenodescloizite (Keller and Dunn, 1980) for which Tsumeb is the type locality.
My good friend Paul Carr and I’ve recently run about 250 quantitative analyses of Tsumeb duftites, conichalcites and austinites. The compositions are shown in the accompanying chart. Duftite plots in the bottom left quadrant; conichalcite in the bottom right; austinite in the top right, and (much rarer) arsenodescloizite in the top left quadrant. As you can see, a very wide range of compositions are present.
While it's usually possible to identify austinite by visual means, the distinction between conichalcite and duftite is much more difficult. I’ve learned that in the absence of an analysis it’s much safer to label these things as “duftite / conichalcite series”.
Malcolm Southwood.
References:
Burke, E. A. J. (2006). A mass discreditation of GQN minerals. The Canadian Mineralogist, 44, 1557–1560.
Guillemin, C. (1956). Contribution a la minéralogie des arséniates, phosphates, et vanadates de cuivre. Bulletin de la Société Français Minéralogie et de Cristallographie, 79, 7-95
Jambor, J.L., Owens, D.R. and Dutrizac, J.E. (1980). Solid solution in the adelite group of arsenates. The Canadian Mineralogist, 18, 191-195
Kharisun, Taylor, M. R., Bevan, D. J. M. and Pring, A. (1998). The crystal chemistry of duftite, PbCuAsO4(OH) and the beta-duftite problem. Mineralogical Magazine, 62, 121-130 |
| ⓘ Dundasite Formula: PbAl2(CO3)2(OH)4 · H2O |
| ⓘ Dyscrasite Formula: Ag3Sb |
| ⓘ Dzhalindite Formula: In(OH)3 References: |
| ⓘ Edwardsite Formula: Cu3Cd2(SO4)2(OH)6 · 4H2O References: |
| ⓘ Ekatite (TL) Formula: (Fe3+,Fe2+,Zn)12(AsO3)6(AsO3,HSiO4)2(OH)6 Type Locality: |
| ⓘ Elyite Formula: Pb4Cu(SO4)O2(OH)4 · H2O |
| ⓘ Enargite Formula: Cu3AsS4 References: Kamona, A. F., Lévêque, J., Friedrich, G., Haack, U. (1999) Lead isotopes of the carbonate-hosted Kabwe, Tsumeb, and Kipushi Pb-Zn-Cu sulphide deposits in relation to Pan African orogenesis in the Damaran-Lufilian Fold Belt of Central Africa. Mineralium Deposita, 34 (3). 273-283 doi:10.1007/s001260050203 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Erikapohlite (TL) Formula: Cu3(Zn,Cu,Mg)4Ca2(AsO4)6 · 2H2O Type Locality: References: |
| ⓘ Euchroite Formula: Cu2(AsO4)(OH) · 3H2O |
| ⓘ Eugenite Formula: Ag11Hg2 References: |
| ⓘ Eyselite (TL) Formula: Fe3+Ge4+3O7(OH) Type Locality: |
| ⓘ Fahleite (TL) Formula: CaZn5Fe3+2(AsO4)6 · 14H2O Type Locality: |
| ⓘ Famatinite Formula: Cu3SbS4 |
| ⓘ Fayalite Formula: Fe2+2(SiO4) |
| ⓘ 'Fayalite-Forsterite Series' |
| ⓘ Feinglosite (TL) Formula: Pb2Zn(AsO4)2 · H2O Type Locality: |
| ⓘ 'Feldspar Group' |
| ⓘ Ferberite Formula: FeWO4 |
| ⓘ Ferrilotharmeyerite (TL) Formula: CaZnFe3+(AsO4)2(OH) · H2O Type Locality: Description: 32 level, W40 stope. |
| ⓘ Fleischerite (TL) Formula: Pb3Ge(SO4)2(OH)6 · 3H2O Type Locality: Description: Level 6-8. |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Description: Rare but widespread, although sparsely, as an accessory (detrital) mineral in the feldspathic sandstone bodies in the Tsumeb pipe, derrived from the overlying Tschudi Formation.
|
| ⓘ Fluorite Formula: CaF2 Description: In 1996 found as tiny 2mm crystals from the third oxidation zone, colourless and associated with calcite (Gebhard 1999). |
| ⓘ Fornacite Formula: Pb2Cu(CrO4)(AsO4)(OH) Description: Fornacite - With plancheite and dioptase References: |
| ⓘ Fraipontite Formula: (Zn,Al)3((Si,Al)2O5)(OH)4 |
| ⓘ Freedite Formula: Cu+Pb8(AsO3)2O3Cl5 |
| ⓘ Furutobeite Formula: (Cu,Ag)6PbS4 |
| ⓘ Gahnite Formula: ZnAl2O4 |
| ⓘ Gaitite (TL) Formula: Ca2Zn(AsO4)2 · 2H2O Type Locality: |
| ⓘ Galena Formula: PbS Localities: Reported from at least 6 localities in this region. |
| ⓘ Gallite (TL) Formula: CuGaS2 Type Locality: Description: Tsumeb and Kipushi are co-type localities for gallite. |
| ⓘ Gallobeudantite (TL) Formula: PbGa3(AsO4)(SO4)(OH)6 Type Locality: |
| ⓘ Galloplumbogummite (TL) Formula: Pb(Ga,Al,Ge)3(PO4)2(OH)6 Type Locality: References: Williams, P. A., Hatert, F., Pasero, M., Mills, S. J. (2011) New minerals and nomenclature modifications approved in 2011. CNMNC Newsletter No 9. Mineralogical Magazine, 75 (4) 2535-2540 doi:10.1180/minmag.2011.075.4.2535 Schlüter, Jochen, Malcherek, Thomas, Mihailova, Boriana (2014) Galloplumbogummite from Tsumeb, Namibia, a new member of the alunite group with tetravalent charge balance. Neues Jahrbuch für Mineralogie - Abhandlungen Journal of Mineralogy and Geochemistry, 191 (3) 301-309 doi:10.1127/0077-7757/2014/0262 |
| ⓘ Gartrellite Formula: PbCuFe3+(AsO4)2(OH) · H2O |
| ✪ Gebhardite (TL) Formula: Pb8(As2O5)2OCl6 Type Locality: |
| ⓘ Geminite Formula: Cu2+(AsO3OH) · H2O References: Hawthorne, Frank C., Cooper, Mark A., Abdu, Yassir A., Ball, Neil A., Back, Malcolm E., Tait, Kim T. (2012) Davidlloydite, ideally Zn3(AsO4)2(H2O)4, a new arsenate mineral from the Tsumeb mine, Otjikoto (Oshikoto) region, Namibia: description and crystal structure. Mineralogical Magazine, 76 (1) 45-57 doi:10.1180/minmag.2012.076.1.45 |
| ✪ Gerdtremmelite (TL) Formula: (Zn,Fe)(Al,Fe)2(AsO4)(OH)5 Type Locality: Description: From the 44 level. |
| ⓘ Germanite (TL) Formula: Cu13Fe2Ge2S16 Localities: |
| ⓘ Germanocolusite Formula: Cu26V2(Ge,As)6S32 Description: Identified as germanite-3, yellow germanite, vanadium or vanadiun-arsenic germanite, vagearsite References: |
| ⓘ Glaucodot Formula: (Co0.50Fe0.50)AsS |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Gordaite Formula: NaZn4(SO4)(OH)6Cl · 6H2O Description: Mark Feinglos specimen with germanite matrix References: |
| ⓘ Graphite Formula: C |
| ⓘ Gratonite Formula: Pb9As4S15 References: |
| ⓘ Greenockite Formula: CdS |
| ⓘ Gunningite Formula: ZnSO4 · H2O References: |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Halilsarpite Formula: [Mg(H2O)6][CaAs3+2(Fe3+2.67Mo6+0.33)(AsO4)2O7] References: Desor, J. (01/2025) SEM-EDS & SCXRDIdentified by Joy Desor: XRD, SEM-EDS |
| ⓘ Hardystonite Formula: Ca2Zn[Si2O7] |
| ⓘ Hedyphane Formula: Ca2Pb3(AsO4)3Cl |
| ✪ Helmutwinklerite (TL) Formula: PbZn2(AsO4)2 · 2H2O Type Locality: |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Hematite var. Kidney Ore Formula: Fe2O3 Description: Botryoidal hemantite was found on large mimetite crystal, partially pseudomorphosing them.
According to Gebhard, the pocket was found on level 46. |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O |
| ⓘ Hermannroseite (TL) Formula: CaCu(PO4)(OH) Type Locality: |
| ⓘ Heterogenite Formula: Co3+O(OH) Description: Many specimens labeled as being heterogenite from Tsumeb, are in fact misidentified goethite specimens. |
| ⓘ Hidalgoite Formula: PbAl3(AsO4)(SO4)(OH)6 |
| ⓘ Hinsdalite Formula: PbAl3(PO4)(SO4)(OH)6 References: |
| ⓘ Hörnesite Formula: Mg3(AsO4)2 · 8H2O |
| ⓘ Hydrocerussite Formula: Pb3(CO3)2(OH)2 |
| ⓘ Hydroxylapatite Formula: Ca5(PO4)3(OH) |
| ⓘ Hydroxylpyromorphite Formula: Pb5(PO4)3(OH) References: |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 |
| ⓘ Ianbruceite (TL) Formula: Zn2(AsO4)(OH) · 3H2O Type Locality: Description: This is Ianbruceite. References: Williams, P. A., Hatert, F., Pasero, M., Mills, S. J. (2011) New minerals and nomenclature modifications approved in 2011, CNMNC Newsletter No. 10. Mineralogical Magazine, 75 (5) 2549-2561 doi:10.1180/minmag.2011.075.5.2549 Cooper, M. A., Abdu, Y. A., Ball, N. A., Hawthorne, F. C., Back, M. E., Tait, K. T., Schlüter, J., Malcherek, T., Pohl, D., Gebhard, G. (2012) Ianbruceite, ideally [Zn2(OH)(H2O)(AsO4)](H2O)2, a new arsenate mineral from the Tsumeb mine, Otjikoto (Oshikoto) region, Namibia: description and crystal structure. Mineralogical Magazine, 76 (5) 1119-1131 doi:10.1180/minmag.2012.076.5.05 |
| ⓘ Idaite ? Formula: Cu5FeS6 |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Iodargyrite Formula: AgI References: |
| ⓘ Itoite (TL) Formula: Pb3Ge4+(SO4)2O2(OH)2 Type Locality: |
| ✪ Jamesite (TL) Formula: Pb2Zn(Fe2+,Zn)2Fe3+4(AsO4)4(OH)10 Type Locality: |
| ⓘ Jamesonite Formula: Pb4FeSb6S14 Habit: fine needles with tennantite and iron stained carbonate Colour: metallic gray black Fluorescence: none Description: Known as a single specimen, ex RWMW collection, now on display at the Royal Ontario Museum in Toronto. References: |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Jeanbandyite Formula: Fe3+Sn(OH)5O |
| ⓘ Johillerite (TL) Formula: Na(Mg,Zn)3Cu(AsO4)3 Type Locality: |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Karibibite Formula: Fe3+3(As3+O2)4(As3+2O5)(OH) Description: Occurs as pale yellow intertwined fibres on a sample containing leiteite and schneiderhöhnite. |
| ⓘ Karlseifertite (TL) Formula: Pb(Ga2Ge)(AsO4)2(OH)6 Type Locality: References: |
| ⓘ Kasolite Formula: Pb(UO2)(SiO4) · H2O |
| ✪ Kegelite (TL) Formula: Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 Type Locality: References: |
| ⓘ Kësterite Formula: Cu2ZnSnS4 References: |
| ✪ Keyite (TL) Formula: Cu2+3Zn4Cd2(AsO4)6 · 2H2O Type Locality: |
| ⓘ 'K Feldspar' |
| ⓘ Kintoreite Formula: PbFe3(PO4)(PO3OH)(OH)6 |
| ⓘ 'Kintoreite-Segnitite Series' |
| ⓘ Kirschsteinite Formula: CaFe2+(SiO4) |
| ⓘ Koritnigite (TL) Formula: Zn(AsO3OH) · H2O Type Locality: Description: Level 31, pillar E9. |
| ⓘ Köttigite Formula: Zn3(AsO4)2 · 8H2O |
| ⓘ Krieselite (TL) Formula: Al2(GeO4)F2 Type Locality: |
| ⓘ Ktenasite Formula: ZnCu4(SO4)2(OH)6 · 6H2O References: |
| ⓘ Lammerite Formula: Cu3(AsO4)2 |
| ⓘ Lanarkite Formula: Pb2(SO4)O Description: associated with leadhillite, hydrocerussite on bornite, chalcocite & galena matrix. References: |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O |
| ⓘ Larsenite Formula: PbZnSiO4 |
| ⓘ Lauraniite Formula: Cu6Cd2(SO4)2(OH)12 · 5H2O References: |
| ⓘ Lavendulan Formula: NaCaCu5(AsO4)4Cl · 5H2O |
| ⓘ Lavendulan var. Zinclavendulan (FRL) Formula: NaCa(Cu,Zn)5(AsO4)4Cl · 5H2O Type Locality: |
| ⓘ Lazaridisite Formula: Cd3(SO4)3 · 8H2O References: |
| ⓘ 'Lead-bearing Feldspar' Formula: (K,Pb)-(Al,Si)-O |
| ✪ Leadhillite Formula: Pb4(CO3)2(SO4)(OH)2 Description: Plate 49 from Wilson, Wendell. E.; Bartsch, Joel A.; Mauthner, Mark (2004) Masterpieces of the Mineral World. Houston Museum of Natural Science. [https://www.mindat.org/reference.php?id=18945017] References: |
| ⓘ Legrandite Formula: Zn2(AsO4)(OH) · H2O |
| ⓘ Leightonite Formula: K2Ca2Cu(SO4)4 · 2H2O |
| ✪ Leiteite (TL) Formula: Zn(As2O4) Type Locality: |
| ⓘ Lepidocrocite Formula: Fe3+O(OH) |
| ⓘ Libethenite Formula: Cu2(PO4)(OH) References: |
| ⓘ 'Limonite' Habit: Massive, powdery. Colour: Orange to brick-red. Fluorescence: Not fluorescent. Description: Limonite-stained quartz forms the matrix of the vanadium minerals. References: Paul De Bondt collection.Identified by Paul De Bondt: Visual Identification |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 |
| ⓘ Lindackerite Formula: CuCu4(AsO4)2(HAsO4)2 · 9H2O |
| ⓘ Linnaeite Formula: Co2+Co3+2S4 |
| ⓘ Litharge Formula: PbO |
| ⓘ Loughlinite Formula: Na2Mg3Si6O16 · 8H2O |
| ⓘ Ludjibaite Formula: Cu5(PO4)2(OH)4 Habit: Botryoidal Colour: Blue-Green Description: Ref: Peter Tandy, Natural History Museum (London) References: |
| ✪ Ludlockite (TL) Formula: PbFe3+4As3+10O22 Type Locality: Habit: Fibrous Colour: Reddish Description: May be confused with karibibite.
Plate 51 from Wilson, Wendell. E.; Bartsch, Joel A.; Mauthner, Mark (2004) Masterpieces of the Mineral World. Houston Museum of Natural Science. [https://www.mindat.org/reference.php?id=18945017] |
| ⓘ Lukrahnite (TL) Formula: CaCuFe3+(AsO4)2(OH,H2O)2 Type Locality: References: |
| ⓘ Luzonite Formula: Cu3AsS4 |
| ⓘ Macphersonite Formula: Pb4(CO3)2(SO4)(OH)2 |
| ⓘ Maghemite Formula: (Fe3+0.67◻0.33)Fe3+2O4 |
| ⓘ Magnesite Formula: MgCO3 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Maikainite Formula: Cu20(Fe,Cu)6Mo2Ge6S32 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 6 localities in this region. Habit: Frequently as pseudomorphous replacement or partial replacement of azurite crystals, but "primary" malachite is also known. |
| ⓘ 'Manganese Oxides' |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Massicot Formula: PbO |
| ⓘ Mathewrogersite (TL) Formula: Pb7FeAl3GeSi12O36(OH,H2O)6 Type Locality: |
| ⓘ Matlockite Formula: PbFCl |
| ⓘ Mawbyite Formula: PbFe3+2(AsO4)2(OH)2 References: |
| ⓘ Mawsonite Formula: Cu6Fe2SnS8 Description: small inclusions in bornite and tennantite. |
| ⓘ Mcconnellite Formula: CuCrO2 Description: Fe- and Al-bearing. |
| ⓘ Mckinstryite Formula: Ag5-xCu3+xS4 Description: The mineral is associated with an unknown Ag-Hg phase (most likely eugenite), that is under investigation. The identification by SXRD cannot be made, as the phase is very small. A Raman reference of a SXRD microdiffraction confirmed Mckinstryite crystal from the Clara mine, Germany has been used as a reference for the confirmation from Tsumeb. The standardless SEM-EDS data is very consistent with the McKinstryite from the Clara mine and in general with Mckinstryite. References: |
| ✪ Melanotekite Formula: Pb2Fe3+2(Si2O7)O2 |
| ⓘ 'Melilite Group' Formula: Ca2M(XSiO7) |
| ⓘ Mendipite Formula: Pb3Cl2O2 |
| ⓘ Metacinnabar Formula: HgS |
| ⓘ Metazeunerite Formula: Cu(UO2)2(AsO4)2 · 8H2O |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Millerite Formula: NiS |
| ✪ Mimetite Formula: Pb5(AsO4)3Cl Habit: usually prismatic Colour: mainly colorless to yellowish or brownish Description: world class samples (extraordinary crystals, according to the "handbook of mineralogy")
Plate 55 from Wilson, Wendell. E.; Bartsch, Joel A.; Mauthner, Mark (2004) Masterpieces of the Mineral World. Houston Museum of Natural Science. [https://www.mindat.org/reference.php?id=18945017] References: |
| ⓘ 'Mineral GS1 (of Gebhard)' Formula: Zn, Fe, As, O, H |
| ⓘ Minium Formula: Pb3O4 |
| ✪ Minrecordite (TL) Formula: CaZn(CO3)2 Type Locality: |
| ⓘ Mixite Formula: BiCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Molybdofornacite (TL) Formula: Pb2Cu(MoO4,CrO4)(AsO4,PO4)(OH) Type Locality: |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) References: |
| ⓘ Monticellite Formula: CaMg(SiO4) |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ Mottramite Formula: PbCu(VO4)(OH) Localities: Reported from at least 6 localities in this region. |
| ⓘ Munakataite Formula: Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Nadorite Formula: PbSbClO2 Habit: Eight sided or square tabular crystals Colour: Beige Description: Associated with a beudantite-group mineral and chalcoite. |
| ⓘ Namuwite Formula: Zn4(SO4)(OH)6 · 4H2O Colour: sea green Description: Tiny crystals in cavities in galena. |
| ⓘ Nancyrossite (TL) Formula: FeGeO6H5 Type Locality: Description: level 30 |
| ⓘ Native Antimony Formula: Sb |
| ⓘ Native Copper Formula: Cu |
| ⓘ Native Gold Formula: Au Description: Produced as a by-product - http://www.mme.gov.na/gsn/pdf/gold.pdf |
| ⓘ Native Lead Formula: Pb |
| ⓘ Native Silver Formula: Ag |
| ⓘ Native Silver var. Amalgam Formula: (Ag,Hg) |
| ⓘ Native Sulphur Formula: S8 |
| ⓘ Naumannite Formula: Ag2Se References: |
| ⓘ Niedermayrite Formula: CdCu4(SO4)2(OH)6 · 4H2O References: |
| ⓘ O'Danielite (TL) Formula: Na(Zn,Mg)3(AsO4)(AsO3OH)2 Type Locality: References: |
| ⓘ Ojuelaite Formula: ZnFe3+2(AsO4)2(OH)2 · 4H2O |
| ⓘ Olivenite Formula: Cu2(AsO4)(OH) Localities: Description: https://youtu.be/3qgo9po-bT8 A very interesting presentation on the Adamite-Zincolvinite-Olivenite series. |
| ⓘ Olivenite var. Zinc-bearing Olivenite Formula: (Cu,Zn)2(AsO4)(OH) |
| ⓘ Olsacherite Formula: Pb2(Se6+O4)(SO4) References: |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Orthoserpierite Formula: Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| ✪ Otavite (TL) Formula: CdCO3 Type Locality: |
| ✪ Otjisumeite (TL) Formula: PbGe4O9 Type Locality: |
| ✪ Ovamboite (TL) Formula: Cu20(Fe,Cu,Zn)6W2Ge6S32 Type Locality: |
| ⓘ Oxyplumboroméite Formula: Pb2Sb2O6O |
| ⓘ Palygorskite Formula: ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| ✪ Paradamite Formula: Zn2(AsO4)(OH) Description: Paradamite has been found at this location as creamy-white lozenge shaped crystals and as lemon-yellow sheaf like aggregates up to 1 cm. |
| ⓘ Parkinsonite Formula: Pb7MoO9Cl2 |
| ⓘ Parnauite Formula: Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| ⓘ Patrónite ? Formula: VS4 |
| ⓘ Perroudite Formula: Hg5Ag4S5(I,Br)2Cl2 References: Keller, Paul, Lissner, Falk, Schleid, Thomas (2005) Single-crystal structure determination of perroudite, Hg5Ag4S5(I, Br)2Cl2, from Tsumeb (Namibia), and its structural relationships to other sulfide halides of mercury and cinnabar. Neues Jahrbuch für Mineralogie - Abhandlungen, 181 (1) 1-9 doi:10.1127/0077-7757/2005/0181-0004 |
| ⓘ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ Philipsbornite Formula: PbAl3(AsO4)(AsO3OH)(OH)6 References: |
| ⓘ Philipsburgite Formula: Cu5Zn(AsO4)(PO4)(OH)6 · H2O |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 |
| ⓘ Phosgenite Formula: Pb2CO3Cl2 |
| ⓘ Plancheite Formula: Cu8(Si8O22)(OH)4 · H2O |
| ⓘ Plattnerite Formula: PbO2 |
| ⓘ Plumboferrite Formula: Pb[Fe3+10.67Mn2+0.33Pb]O18.33 |
| ⓘ Plumbogummite Formula: PbAl3(PO4)(PO3OH)(OH)6 |
| ⓘ Plumbogummite var. Ga-rich plumbogummite Formula: Pb(Al,Ga)3(PO4)(PO3OH)(OH)6 |
| ⓘ Plumbojarosite Formula: Pb0.5Fe3+3(SO4)2(OH)6 |
| ⓘ Plumboselite (TL) Formula: Pb3O2(SeO3) Type Locality: |
| ⓘ Plumbotsumite (TL) Formula: Pb13(CO3)6(Si10O27) · 3H2O Type Locality: |
| ⓘ Posnjakite Formula: Cu4(SO4)(OH)6 · H2O |
| ⓘ Powellite Formula: Ca(MoO4) |
| ⓘ Prosopite Formula: CaAl2F4[(OH)4-xFx] |
| ✪ Prosperite (TL) Formula: Ca2Zn4(AsO4)4 · H2O Type Locality: |
| ⓘ Pseudomalachite Formula: Cu5(PO4)2(OH)4 |
| ⓘ 'Psilomelane' |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl |
| ⓘ Quartz Formula: SiO2 Localities: Habit: Crystals to 1cm, massive Colour: Milky, gray Description: In veins and country rock. |
| ⓘ Quartz var. Amethyst Formula: SiO2 |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 |
| ✪ Queitite (TL) Formula: Pb4Zn2(SO4)(SiO4)(Si2O7) Type Locality: References: |
| ⓘ Realgar Formula: As4S4 Description: Found as inclusions. |
| ✪ Reinerite (TL) Formula: Zn3(AsO3)2 Type Locality: Description: 23.4 |
| ⓘ Renierite Formula: (Cu+,Zn)11Fe4(Ge4+,As5+)2S16 |
| ⓘ Rhodochrosite Formula: MnCO3 Description: Analysis here https://www.mindat.org/photo-892883.html on Jordi Fabre's specimen photo https://www.mindat.org/photo-313243.html proves rhodochrosite and not to be confused with smithsonite. |
| ⓘ Richardsite ? Formula: Zn2CuGaS4 Description: needs more precise high resolution chemical data. Area where richardsite was found is an exsolution. References: |
| ⓘ Romanèchite Formula: (Ba,H2O)2(Mn4+,Mn3+)5O10 References: |
| ⓘ Rosasite Formula: (Cu,Zn)2(CO3)(OH)2 |
| ⓘ Roxbyite Formula: Cu58S32 |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Saponite Formula: Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| ✪ Schaurteite (TL) Formula: Ca3Ge(SO4)2(OH)6 · 4H2O Type Locality: |
| ⓘ Scheelite Formula: Ca(WO4) |
| ✪ Schneiderhöhnite (TL) Formula: Fe2+Fe3+3As3+5O13 Type Locality: References: |
| ⓘ Schulenbergite Formula: (Cu,Zn)7(SO4)2(OH)10 · 3H2O References: |
| ✪ Schulténite (TL) Formula: Pb(HAsO4) Type Locality: |
| ✪ Scorodite Formula: Fe3+AsO4 · 2H2O |
| ⓘ Scotlandite Formula: PbSO3 Habit: Prismatic Colour: Yellow Description: Found on a specimen of hydrocerussite from the Lead Pocket, 1991, 43 level. |
| ⓘ Segnitite Formula: PbFe3+3AsO4(AsO3OH)(OH)6 |
| ⓘ Seligmannite Formula: PbCuAsS3 |
| ⓘ Senarmontite Formula: Sb2O3 References: |
| ⓘ Sepiolite Formula: Mg4(Si6O15)(OH)2 · 6H2O |
| ⓘ Serpierite Formula: Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| ⓘ Sewardite (TL) Formula: CaFe3+2(AsO4)2(OH)2 Type Locality: Description: occurs as platy to compact anhedral to subhedral masses that do not exceed 0.3 mm in maximum size and are randomly scattered throughout the dark green to black matrix. Sewardite is easily confused with the more common carminite; chemical analysis is required to distinguish the two minerals |
| ⓘ Shattuckite Formula: Cu5(Si2O6)2(OH)2 |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Siderite var. Zinc-bearing Siderite Formula: (Fe,Zn)CO3 References: |
| ✪ Sidpietersite (TL) Formula: Pb2+4(S2O3)O2(OH)2 Type Locality: Description: |
| ⓘ Skorpionite Formula: Ca3Zn2(PO4)2(CO3)(OH)2 · H2O Colour: white Description: Found as white needles to 0.5mm on colourless smithsonite associated with willemite on sphalerite-galena-dolomite-tennantite matrix level 33, stope W80. |
| ✪ Smithsonite Formula: ZnCO3 Description: Plates 71/72 from Wilson, Wendell. E.; Bartsch, Joel A.; Mauthner, Mark (2004) Masterpieces of the Mineral World. Houston Museum of Natural Science. [https://www.mindat.org/reference.php?id=18945017] References: |
| ✪ Söhngeite (TL) Formula: Ga(OH)3 Type Locality: |
| ⓘ Spertiniite Formula: Cu(OH)2 |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Spinel Formula: MgAl2O4 |
| ⓘ Stannite Formula: Cu2FeSnS4 |
| ⓘ Stevensite Formula: (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| ⓘ Stibiconite Formula: Sb3+Sb5+2O6(OH) |
| ⓘ Stibioclaudetite (TL) Formula: AsSbO3 Type Locality: |
| ⓘ Stibnite ? Formula: Sb2S3 Description: See https://www.mindat.org/mesg-513605.html
|
| ✪ Stolzite Formula: Pb(WO4) Colour: light yellow |
| ✪ Stottite (TL) Formula: Fe2+[Ge4+(OH)6] Type Locality: Description: Level 30 = 1000m. |
| ✪ Stranskiite (TL) Formula: Zn2Cu(AsO4)2 Type Locality: |
| ⓘ Stromeyerite Formula: AgCuS |
| ⓘ Sulvanite Formula: Cu3VS4 |
| ⓘ Surite Formula: (Pb,Ca)3(Al,Fe2+,Mg)2((Si,Al)4O10)(CO3)2(OH)2 Description: Subhedral highly viterous, glassy crystals found on Level34, W30 stope, Level 28, W30 stope, Level 39, W30 stope and Level 29, W30 stope known associations are smithsonite, willemite, kegelite, queitite, eyite, goethite, sphalerite, galena, tennantite, calcite, dolomite and kaolinite. |
| ⓘ Susannite Formula: Pb4(CO3)2(SO4)(OH)2 |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ Talmessite Formula: Ca2Mg(AsO4)2 · 2H2O References: |
| ⓘ Tangeite Formula: CaCu(VO4)(OH) |
| ⓘ Tennantite-(Cu) Formula: Cu6(Cu4Cu2)As4S12S References: |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S Localities: Habit: Tetrahedral crystals to 30cm on edge. Colour: Mostly frosted or corroded Description: Pseudomorphs of azurite and malachite after tennantite are found. |
| ⓘ Tennantite-(Zn) Formula: Cu6(Cu4Zn2)As4S12S References: |
| ⓘ Tenorite Formula: CuO |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| ⓘ Thaumasite Formula: Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| ✪ Thometzekite (TL) Formula: PbCu2+2(AsO4)2 · 2H2O Type Locality: |
| ⓘ Tilasite Formula: CaMg(AsO4)F Colour: White |
| ⓘ Titanite Formula: CaTiO(SiO4) Description: Listed in the species list only, as massive and common (page 317). |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ✪ Tsumcorite (TL) Formula: PbZn2(AsO4)2 · 2H2O Type Locality: Habit: Crystals Colour: brown |
| ⓘ Tsumebite (TL) Formula: Pb2Cu(PO4)(SO4)(OH) Type Locality: References: |
| ⓘ Tsumgallite (TL) Formula: GaO(OH) Type Locality: |
| ⓘ Tungstenite Formula: WS2 |
| ⓘ 'UM1970-16-OH:GeMn' Formula: (Mn,Fe)(Ge,Sn)(OH)6 Locality: Tsumeb, Oshikoto Region, Namibia |
| ⓘ Umangite Formula: Cu3Se2 |
| ✪ Vanackerite (TL) Formula: Pb4Cd(AsO4)3Cl Type Locality: |
| ⓘ Vanadinite Formula: Pb5(VO4)3Cl References: |
| ⓘ Vésigniéite Formula: BaCu3(VO4)2(OH)2 |
| ✪ Warikahnite (TL) Formula: Zn3(AsO4)2 · 2H2O Type Locality: Description: 2nd oxidation zone (Pilar E9, 31st level). References: |
| ⓘ Whitlockite Formula: Ca9Mg(PO4)6(PO3OH) |
| ⓘ Wickmanite Formula: Mn2+[Sn(OH)6] Locality: Tsumeb, Oshikoto Region, Namibia |
| ⓘ Wilhelmkleinite (TL) Formula: ZnFe3+2(AsO4)2(OH)2 Type Locality: Description: From the 44 level. References: |
| ✪ Willemite Formula: Zn2SiO4 |
| ⓘ Witherite Formula: BaCO3 Habit: Minute flat pseudohexagonal crystals, massive Colour: mily gray to white or cream colored |
| ⓘ Wroewolfeite Formula: Cu4(SO4)(OH)6 · 2H2O |
| ⓘ Wulfenite Formula: Pb(MoO4) |
| ⓘ Wulfenite var. Chillagite Formula: Pb[(Mo,W)O4] |
| ⓘ Wurtzite Formula: (Zn,Fe)S |
| ⓘ Wüstite Formula: FeO |
| ⓘ Yancowinnaite Formula: PbCuAl(AsO4)2OH · H2O Colour: yellow green Description: EDS: Pb1(Cu^2+_1.07,Zn_0.08,Al3+_0.69,Fe3+_0.20)(AsO4)_1.9(PO4)0.1(OH)_0.85(H_2O)1.15
|
| ⓘ Yvonite Formula: Cu(HAsO4) · 2H2O |
| ⓘ Zharchikhite Formula: AlF(OH)2 |
| ⓘ Zincgartrellite (TL) Formula: PbZn2(AsO4)2(H2O,OH)2 Type Locality: |
| ⓘ Zincobriartite Formula: Cu2(Zn,Fe)(Ge,Ga)S4 |
| ✪ Zincolivenite Formula: CuZn(AsO4)(OH) Description: https://youtu.be/3qgo9po-bT8 A very interesting presentation on the Adamite-Zincolvinite-Olivenite series. |
| ⓘ Zincostottite (TL) Formula: ZnGe(OH)6 Type Locality: |
| ⓘ Zincrosasite (TL) Formula: (Zn,Cu)2(CO3)(OH)2 Type Locality: |
| ✪ Zincroselite (TL) Formula: Ca2Zn(AsO4)2 · 2H2O Type Locality: Colour: white to colorless References: |
| ⓘ Zircon Formula: Zr(SiO4) Description: A mineral from the country rock. |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Silver var. Amalgam | 1.AA.05 | (Ag,Hg) |
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Lead | 1.AA.05 | Pb |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Eugenite | 1.AD.15c | Ag11Hg2 |
| ⓘ | Native Antimony | 1.CA.05 | Sb |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Algodonite | 2.AA.10a | (Cu1-xAsx) |
| ⓘ | Domeykite | 2.AA.10b | Cu3As |
| ⓘ | Dyscrasite | 2.AA.35 | Ag3Sb |
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Djurleite | 2.BA.05 | Cu31S16 |
| ⓘ | Roxbyite | 2.BA.05 | Cu58S32 |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Berzelianite | 2.BA.20 | Cu2-xSe (x ≈ 0.12) |
| ⓘ | Umangite | 2.BA.25 | Cu3Se2 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Mckinstryite | 2.BA.40 | Ag5-xCu3+xS4 |
| ⓘ | Stromeyerite | 2.BA.40 | AgCuS |
| ⓘ | Naumannite | 2.BA.55 | Ag2Se |
| ⓘ | Argyrodite | 2.BA.70 | Ag8GeS6 |
| ⓘ | Betekhtinite | 2.BE.05 | Pb2(Cu,Fe)22-24S15 |
| ⓘ | Furutobeite | 2.BE.10 | (Cu,Ag)6PbS4 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Calvertite (TL) | 2.CA.15 | Cu5Ge0.5S4 |
| ⓘ | Richardsite ? | 2.CB. | Zn2CuGaS4 |
| ⓘ | Metacinnabar | 2.CB.05a | HgS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Gallite (TL) | 2.CB.10a | CuGaS2 |
| ⓘ | Idaite ? | 2.CB.15a | Cu5FeS6 |
| ⓘ | Kësterite | 2.CB.15a | Cu2ZnSnS4 |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Mawsonite | 2.CB.20 | Cu6Fe2SnS8 |
| ⓘ | Colusite | 2.CB.30 | Cu13VAs3S16 |
| ⓘ | Germanite (TL) | 2.CB.30 | Cu13Fe2Ge2S16 |
| ⓘ | Germanocolusite | 2.CB.30 | Cu26V2(Ge,As)6S32 |
| ⓘ | Ovamboite (TL) | 2.CB.30 | Cu20(Fe,Cu,Zn)6W2Ge6S32 |
| ⓘ | Maikainite | 2.CB.30 | Cu20(Fe,Cu)6Mo2Ge6S32 |
| ⓘ | Renierite | 2.CB.35a | (Cu+,Zn)11Fe4(Ge4+,As5+)2S16 |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Wurtzite | 2.CB.45 | (Zn,Fe)S |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Sulvanite | 2.CB.70 | Cu3VS4 |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Clausthalite | 2.CD.10 | PbSe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Cinnabar | 2.CD.15a | HgS |
| ⓘ | Carrollite | 2.DA.05 | CuCo2S4 |
| ⓘ | Linnaeite | 2.DA.05 | Co2+Co3+2S4 |
| ⓘ | Stibnite ? | 2.DB.05 | Sb2S3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Tungstenite | 2.EA.30 | WS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Glaucodot | 2.EB.10c | (Co0.50Fe0.50)AsS |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Patrónite ? | 2.EC.10 | VS4 |
| ⓘ | Realgar | 2.FA.15a | As4S4 |
| ⓘ | Perroudite | 2.FC.20c | Hg5Ag4S5(I,Br)2Cl2 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | Seligmannite | 2.GA.50 | PbCuAsS3 |
| ⓘ | Tennantite-(Cu) | 2.GB. | Cu6(Cu4Cu2)As4S12S |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Tennantite-(Zn) | 2.GB.05 | Cu6(Cu4Zn2)As4S12S |
| ⓘ | Cupropearceite | 2.GB.15 | [Cu6As2S7][Ag9CuS4] |
| ⓘ | Cupropolybasite | 2.GB.15 | [Cu6Sb2S7][Ag9CuS4] |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | Gratonite | 2.JB.55 | Pb9As4S15 |
| ⓘ | Enargite | 2.KA.05 | Cu3AsS4 |
| ⓘ | Briartite | 2.KA.10 | Cu2FeGeS4 |
| ⓘ | Famatinite | 2.KA.10 | Cu3SbS4 |
| ⓘ | Luzonite | 2.KA.10 | Cu3AsS4 |
| ⓘ | Zincobriartite | 2.KA.10 | Cu2(Zn,Fe)(Ge,Ga)S4 |
| Group 3 - Halides | |||
| ⓘ | Iodargyrite | 3.AA.10 | AgI |
| ⓘ | Chlorargyrite | 3.AA.15 | AgCl |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Cotunnite | 3.AB.85 | PbCl2 |
| ⓘ | Zharchikhite | 3.AC.05 | AlF(OH)2 |
| ⓘ | Prosopite | 3.CD.10 | CaAl2F4[(OH)4-xFx] |
| ⓘ | Atacamite | 3.DA.10a | Cu2(OH)3Cl |
| ⓘ | Connellite | 3.DA.25 | Cu19(SO4)(OH)32Cl4 · 3H2O |
| ⓘ | Parkinsonite | 3.DB.40 | Pb7MoO9Cl2 |
| ⓘ | Matlockite | 3.DC.25 | PbFCl |
| ⓘ | Nadorite | 3.DC.30 | PbSbClO2 |
| ⓘ | Mendipite | 3.DC.70 | Pb3Cl2O2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Cuprite var. Chalcotrichite | 4.AA.10 | Cu2O |
| ⓘ | 4.AA.10 | Cu2O | |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Delafossite | 4.AB.15 | Cu+Fe3+O2 |
| ⓘ | Mcconnellite | 4.AB.15 | CuCrO2 |
| ⓘ | Wüstite | 4.AB.25 | FeO |
| ⓘ | Litharge | 4.AC.20 | PbO |
| ⓘ | Massicot | 4.AC.25 | PbO |
| ⓘ | Gahnite | 4.BB.05 | ZnAl2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Maghemite | 4.BB.15 | (Fe3+0.67◻0.33)Fe3+2O4 |
| ⓘ | Minium | 4.BD.05 | Pb3O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Hematite var. Kidney Ore | 4.CB.05 | Fe2O3 |
| ⓘ | Claudetite | 4.CB.45 | As2O3 |
| ⓘ | Stibioclaudetite (TL) | 4.CB.45 | AsSbO3 |
| ⓘ | Senarmontite | 4.CB.50 | Sb2O3 |
| ⓘ | Plumboferrite | 4.CC.45 | Pb[Fe3+10.67Mn2+0.33Pb]O18.33 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | Argutite | 4.DB.05 | GeO2 |
| ⓘ | Plattnerite | 4.DB.05 | PbO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Ferberite | 4.DB.30 | FeWO4 |
| ⓘ | Biehlite (TL) | 4.DB.60 | ((Sb,As)O)2[MoO4] |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Oxyplumboroméite | 4.DH. | Pb2Sb2O6O |
| ⓘ | Stibiconite | 4.DH.20 | Sb3+Sb5+2O6(OH) |
| ⓘ | Coronadite | 4.DK.05a | Pb(Mn4+6Mn3+2)O16 |
| ⓘ | Romanèchite | 4.DK.10 | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| ⓘ | Eyselite (TL) | 4.DM.20 | Fe3+Ge4+3O7(OH) |
| ⓘ | Ashoverite | 4.FA.10 | Zn(OH)2 |
| ⓘ | Dzhalindite | 4.FC.05 | In(OH)3 |
| ⓘ | Söhngeite (TL) | 4.FC.05 | Ga(OH)3 |
| ⓘ | Wickmanite | 4.FC.10 | Mn2+[Sn(OH)6] |
| ⓘ | Jeanbandyite | 4.FC.15 | Fe3+Sn(OH)5O |
| ⓘ | Stottite (TL) | 4.FC.15 | Fe2+[Ge4+(OH)6] |
| ⓘ | Nancyrossite (TL) | 4.FC.15 | FeGeO6H5 |
| ⓘ | Zincostottite (TL) | 4.FC.15 | ZnGe(OH)6 |
| ⓘ | Spertiniite | 4.FD.05 | Cu(OH)2 |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| ⓘ | Tsumgallite (TL) | 4.FD.10 | GaO(OH) |
| ⓘ | Brucite | 4.FE.05 | Mg(OH)2 |
| ⓘ | Lepidocrocite | 4.FE.15 | Fe3+O(OH) |
| ⓘ | Heterogenite | 4.FE.20 | Co3+O(OH) |
| ⓘ | Chalcophanite | 4.FL.20 | ZnMn4+3O7 · 3H2O |
| ⓘ | Leiteite (TL) | 4.JA.05 | Zn(As2O4) |
| ⓘ | Reinerite (TL) | 4.JA.10 | Zn3(AsO3)2 |
| ⓘ | Karibibite | 4.JA.15 | Fe3+3(As3+O2)4(As3+2O5)(OH) |
| ⓘ | Schneiderhöhnite (TL) | 4.JA.35 | Fe2+Fe3+3As3+5O13 |
| ⓘ | Ludlockite (TL) | 4.JA.45 | PbFe3+4As3+10O22 |
| ⓘ | Gebhardite (TL) | 4.JB.50 | Pb8(As2O5)2OCl6 |
| ⓘ | Freedite | 4.JB.65 | Cu+Pb8(AsO3)2O3Cl5 |
| ⓘ | Ekatite (TL) | 4.JB.75 | (Fe3+,Fe2+,Zn)12(AsO3)6(AsO3,HSiO4)2(OH)6 |
| ⓘ | Scotlandite | 4.JE.20 | PbSO3 |
| ⓘ | Plumboselite (TL) | 4.JG.50 | Pb3O2(SeO3) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Otavite (TL) | 5.AB.05 | CdCO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Siderite var. Zinc-bearing Siderite | 5.AB.05 | (Fe,Zn)CO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite var. Cobalt-bearing Dolomite | 5.AB.10 | Ca(Mg,Co)(CO3)2 |
| ⓘ | 5.AB.10 | CaMg(CO3)2 | |
| ⓘ | Minrecordite (TL) | 5.AB.10 | CaZn(CO3)2 |
| ⓘ | Dolomite var. Zinc-bearing Dolomite | 5.AB.10 | Ca(Mg,Zn)(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Aragonite var. Lead-bearing Aragonite | 5.AB.15 | (Ca,Pb)CO3 |
| ⓘ | Witherite | 5.AB.15 | BaCO3 |
| ⓘ | Aragonite var. Zinc-bearing Aragonite | 5.AB.15 | (Ca,Zn)CO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Rosasite | 5.BA.10 | (Cu,Zn)2(CO3)(OH)2 |
| ⓘ | Zincrosasite (TL) | 5.BA.10 | (Zn,Cu)2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Hydrocerussite | 5.BE.10 | Pb3(CO3)2(OH)2 |
| ⓘ | Phosgenite | 5.BE.20 | Pb2CO3Cl2 |
| ⓘ | Abellaite | 5.BE.X | NaPb2(CO3)2(OH) |
| ⓘ | Brianyoungite | 5.BF.30 | Zn3(CO3,SO4)(OH)4 |
| ⓘ | Leadhillite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Macphersonite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Susannite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Chalconatronite | 5.CB.40 | Na2Cu(CO3)2 · 3H2O |
| ⓘ | Dundasite | 5.DB.10 | PbAl2(CO3)2(OH)4 · H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Celestine | 7.AD.35 | SrSO4 |
| ⓘ | Olsacherite | 7.AD.35 | Pb2(Se6+O4)(SO4) |
| ⓘ | Antlerite | 7.BB.15 | Cu3(SO4)(OH)4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Beaverite-(Cu) | 7.BC.10 | Pb(Fe3+2Cu)(SO4)2(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Plumbojarosite | 7.BC.10 | Pb0.5Fe3+3(SO4)2(OH)6 |
| ⓘ | Karlseifertite (TL) | 7.BC.10 | Pb(Ga2Ge)(AsO4)2(OH)6 |
| ⓘ | Caledonite | 7.BC.50 | Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Munakataite | 7.BC.65 | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| ⓘ | Cadsulfohite (TL) | 7.BD. | Cd2(SO4)(OH)2 |
| ⓘ | Lanarkite | 7.BD.40 | Pb2(SO4)O |
| ⓘ | Itoite (TL) | 7.BD.50 | Pb3Ge4+(SO4)2O2(OH)2 |
| ⓘ | Gunningite | 7.CB.05 | ZnSO4 · H2O |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Lazaridisite | 7.CB.50 | Cd3(SO4)3 · 8H2O |
| ⓘ | Leightonite | 7.CC.70 | K2Ca2Cu(SO4)4 · 2H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Posnjakite | 7.DD.10 | Cu4(SO4)(OH)6 · H2O |
| ⓘ | Wroewolfeite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Ktenasite | 7.DD.20 | ZnCu4(SO4)2(OH)6 · 6H2O |
| ⓘ | Devilline | 7.DD.30 | CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Orthoserpierite | 7.DD.30 | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| ⓘ | Serpierite | 7.DD.30 | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| ⓘ | Niedermayrite | 7.DD.30 | CdCu4(SO4)2(OH)6 · 4H2O |
| ⓘ | Edwardsite | 7.DD.30 | Cu3Cd2(SO4)2(OH)6 · 4H2O |
| ⓘ | Namuwite | 7.DD.50 | Zn4(SO4)(OH)6 · 4H2O |
| ⓘ | Lauraniite | 7.DD.52 | Cu6Cd2(SO4)2(OH)12 · 5H2O |
| ⓘ | Schulenbergite | 7.DD.80 | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| ⓘ | Fleischerite (TL) | 7.DF.25 | Pb3Ge(SO4)2(OH)6 · 3H2O |
| ⓘ | Schaurteite (TL) | 7.DF.25 | Ca3Ge(SO4)2(OH)6 · 4H2O |
| ⓘ | Gordaite | 7.DF.50 | NaZn4(SO4)(OH)6Cl · 6H2O |
| ⓘ | Elyite | 7.DF.65 | Pb4Cu(SO4)O2(OH)4 · H2O |
| ⓘ | Thaumasite | 7.DG.15 | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| ⓘ | Fornacite | 7.FC.10 | Pb2Cu(CrO4)(AsO4)(OH) |
| ⓘ | Molybdofornacite (TL) | 7.FC.10 | Pb2Cu(MoO4,CrO4)(AsO4,PO4)(OH) |
| ⓘ | Powellite | 7.GA.05 | Ca(MoO4) |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Stolzite | 7.GA.05 | Pb(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| ⓘ | var. Chillagite | 7.GA.05 | Pb[(Mo,W)O4] |
| ⓘ | Sidpietersite (TL) | 7.JA.05 | Pb2+4(S2O3)O2(OH)2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Lammerite | 8.AB.30 | Cu3(AsO4)2 |
| ⓘ | Stranskiite (TL) | 8.AB.35 | Zn2Cu(AsO4)2 |
| ⓘ | O'Danielite (TL) | 8.AC.05 | Na(Zn,Mg)3(AsO4)(AsO3OH)2 |
| ⓘ | Erikapohlite (TL) | 8.AC.05 | Cu3(Zn,Cu,Mg)4Ca2(AsO4)6 · 2H2O |
| ⓘ | Johillerite (TL) | 8.AC.10 | Na(Mg,Zn)3Cu(AsO4)3 |
| ⓘ | Whitlockite | 8.AC.45 | Ca9Mg(PO4)6(PO3OH) |
| ⓘ | Schulténite (TL) | 8.AD.30 | Pb(HAsO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Tilasite | 8.BB. | CaMg(AsO4)F |
| ⓘ | Adamite | 8.BB.30 | Zn2(AsO4)(OH) |
| ⓘ | var. Copper-bearing Adamite ? | 8.BB.30 | (Zn,Cu)2AsO4OH |
| ⓘ | Libethenite | 8.BB.30 | Cu2(PO4)(OH) |
| ⓘ | Olivenite | 8.BB.30 | Cu2(AsO4)(OH) |
| ⓘ | var. Zinc-bearing Olivenite | 8.BB.30 | (Cu,Zn)2(AsO4)(OH) |
| ⓘ | Adamite var. Cobalt-bearing Adamite ? | 8.BB.30 | Zn2(AsO4)(OH) |
| ⓘ | Zincolivenite | 8.BB.30 | CuZn(AsO4)(OH) |
| ⓘ | Paradamite | 8.BB.35 | Zn2(AsO4)(OH) |
| ⓘ | Wilhelmkleinite (TL) | 8.BB.40 | ZnFe3+2(AsO4)2(OH)2 |
| ⓘ | Cornwallite | 8.BD.05 | Cu5(AsO4)2(OH)4 |
| ⓘ | Pseudomalachite | 8.BD.05 | Cu5(PO4)2(OH)4 |
| ⓘ | Ludjibaite | 8.BD.25 | Cu5(PO4)2(OH)4 |
| ⓘ | Clinoclase | 8.BE.20 | Cu3(AsO4)(OH)3 |
| ⓘ | Gerdtremmelite (TL) | 8.BE.40 | (Zn,Fe)(Al,Fe)2(AsO4)(OH)5 |
| ⓘ | Arsentsumebite (TL) | 8.BG.05 | Pb2Cu(AsO4)(SO4)(OH) |
| ⓘ | Tsumebite (TL) | 8.BG.05 | Pb2Cu(PO4)(SO4)(OH) |
| ⓘ | Arsenbrackebuschite (TL) | 8.BG.05 | Pb2Fe3+(AsO4)2(OH) |
| ⓘ | Feinglosite (TL) | 8.BG.05 | Pb2Zn(AsO4)2 · H2O |
| ⓘ | Carminite | 8.BH.30 | PbFe3+2(AsO4)2(OH)2 |
| ⓘ | Sewardite (TL) | 8.BH.30 | CaFe3+2(AsO4)2(OH)2 |
| ⓘ | Arsendescloizite (TL) | 8.BH.35 | PbZn(AsO4)(OH) |
| ⓘ | Austinite | 8.BH.35 | CaZn(AsO4)(OH) |
| ⓘ | Conichalcite | 8.BH.35 | CaCu(AsO4)(OH) |
| ⓘ | Duftite (TL) | 8.BH.35 | PbCu(AsO4)(OH) |
| ⓘ | Tangeite | 8.BH.35 | CaCu(VO4)(OH) |
| ⓘ | 'Duftite-alpha' | 8.BH.35 | PbCu(AsO4)(OH) |
| ⓘ | Hermannroseite (TL) | 8.BH.35 | CaCu(PO4)(OH) |
| ⓘ | Descloizite var. Copper-bearing Descloizite | 8.BH.40 | Pb(Zn,Cu)VO4OH |
| ⓘ | 8.BH.40 | PbZn(VO4)(OH) | |
| ⓘ | Mottramite | 8.BH.40 | PbCu(VO4)(OH) |
| ⓘ | Bayldonite | 8.BH.45 | PbCu3(AsO4)2(OH)2 |
| ⓘ | Vésigniéite | 8.BH.45 | BaCu3(VO4)2(OH)2 |
| ⓘ | Jamesite (TL) | 8.BK.25 | Pb2Zn(Fe2+,Zn)2Fe3+4(AsO4)4(OH)10 |
| ⓘ | Beudantite | 8.BL.05 | PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ | Corkite | 8.BL.05 | PbFe3+3(PO4)(SO4)(OH)6 |
| ⓘ | Hidalgoite | 8.BL.05 | PbAl3(AsO4)(SO4)(OH)6 |
| ⓘ | Hinsdalite | 8.BL.05 | PbAl3(PO4)(SO4)(OH)6 |
| ⓘ | Gallobeudantite (TL) | 8.BL.05 | PbGa3(AsO4)(SO4)(OH)6 |
| ⓘ | Arsenogoyazite | 8.BL.10 | SrAl3(AsO4)(AsO3OH)(OH)6 |
| ⓘ | Arsenocrandallite | 8.BL.10 | CaAl3(AsO4)(AsO3OH)(OH)6 |
| ⓘ | Crandallite | 8.BL.10 | CaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Kintoreite | 8.BL.10 | PbFe3(PO4)(PO3OH)(OH)6 |
| ⓘ | Philipsbornite | 8.BL.10 | PbAl3(AsO4)(AsO3OH)(OH)6 |
| ⓘ | Plumbogummite | 8.BL.10 | PbAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Segnitite | 8.BL.10 | PbFe3+3AsO4(AsO3OH)(OH)6 |
| ⓘ | Plumbogummite var. Ga-rich plumbogummite | 8.BL.10 | Pb(Al,Ga)3(PO4)(PO3OH)(OH)6 |
| ⓘ | Galloplumbogummite (TL) | 8.BL.10 | Pb(Ga,Al,Ge)3(PO4)2(OH)6 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Hedyphane | 8.BN.05 | Ca2Pb3(AsO4)3Cl |
| ⓘ | Hydroxylapatite | 8.BN.05 | Ca5(PO4)3(OH) |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Vanadinite | 8.BN.05 | Pb5(VO4)3Cl |
| ⓘ | Hydroxylpyromorphite | 8.BN.05 | Pb5(PO4)3(OH) |
| ⓘ | Vanackerite (TL) | 8.BN.05 | Pb4Cd(AsO4)3Cl |
| ⓘ | Davidlloydite (TL) | 8.CA. | Zn3(AsO4)2 · 4H2O |
| ⓘ | Arsenohopeite (TL) | 8.CA.30 | Zn3(AsO4)2 · 4H2O |
| ⓘ | Warikahnite (TL) | 8.CA.35 | Zn3(AsO4)2 · 2H2O |
| ⓘ | Keyite (TL) | 8.CA.50 | Cu2+3Zn4Cd2(AsO4)6 · 2H2O |
| ⓘ | Prosperite (TL) | 8.CA.60 | Ca2Zn4(AsO4)4 · H2O |
| ⓘ | Koritnigite (TL) | 8.CB.20 | Zn(AsO3OH) · H2O |
| ⓘ | Yvonite | 8.CB.25 | Cu(HAsO4) · 2H2O |
| ⓘ | Geminite | 8.CB.30 | Cu2+(AsO3OH) · H2O |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Chudobaite (TL) | 8.CE.05 | Mg5(AsO4)2(AsO3OH)2 · 10H2O |
| ⓘ | Lindackerite | 8.CE.30 | CuCu4(AsO4)2(HAsO4)2 · 9H2O |
| ⓘ | Hörnesite | 8.CE.40 | Mg3(AsO4)2 · 8H2O |
| ⓘ | Köttigite | 8.CE.40 | Zn3(AsO4)2 · 8H2O |
| ⓘ | Gaitite (TL) | 8.CG.05 | Ca2Zn(AsO4)2 · 2H2O |
| ⓘ | Anorthoroselite | 8.CG.05 | Ca2Co(AsO4)2 · 2H2O |
| ⓘ | Talmessite | 8.CG.05 | Ca2Mg(AsO4)2 · 2H2O |
| ⓘ | Zincroselite (TL) | 8.CG.10 | Ca2Zn(AsO4)2 · 2H2O |
| ⓘ | Ferrilotharmeyerite (TL) | 8.CG.15 | CaZnFe3+(AsO4)2(OH) · H2O |
| ⓘ | Mawbyite | 8.CG.15 | PbFe3+2(AsO4)2(OH)2 |
| ⓘ | Thometzekite (TL) | 8.CG.15 | PbCu2+2(AsO4)2 · 2H2O |
| ⓘ | Tsumcorite (TL) | 8.CG.15 | PbZn2(AsO4)2 · 2H2O |
| ⓘ | Cobalttsumcorite | 8.CG.15 | PbCo2(AsO4)2 · 2H2O |
| ⓘ | Yancowinnaite | 8.CG.15 | PbCuAl(AsO4)2OH · H2O |
| ⓘ | Gartrellite | 8.CG.20 | PbCuFe3+(AsO4)2(OH) · H2O |
| ⓘ | Helmutwinklerite (TL) | 8.CG.20 | PbZn2(AsO4)2 · 2H2O |
| ⓘ | Zincgartrellite (TL) | 8.CG.20 | PbZn2(AsO4)2(H2O,OH)2 |
| ⓘ | Lukrahnite (TL) | 8.CG.20 | CaCuFe3+(AsO4)2(OH,H2O)2 |
| ⓘ | Halilsarpite | 8.CH.05 | [Mg(H2O)6][CaAs3+2(Fe3+2.67Mo6+0.33)(AsO4)2O7] |
| ⓘ | Fahleite (TL) | 8.CH.55 | CaZn5Fe3+2(AsO4)6 · 14H2O |
| ⓘ | Ianbruceite (TL) | 8.DC. | Zn2(AsO4)(OH) · 3H2O |
| ⓘ | Euchroite | 8.DC.07 | Cu2(AsO4)(OH) · 3H2O |
| ⓘ | Legrandite | 8.DC.10 | Zn2(AsO4)(OH) · H2O |
| ⓘ | Arthurite | 8.DC.15 | CuFe3+2(AsO4)2(OH)2 · 4H2O |
| ⓘ | Ojuelaite | 8.DC.15 | ZnFe3+2(AsO4)2(OH)2 · 4H2O |
| ⓘ | Bendadaite | 8.DC.15 | Fe2+Fe3+2(AsO4)2(OH)2 · 4H2O |
| ⓘ | Chenevixite | 8.DD.05 | Cu2Fe3+2(AsO4)2(OH)4 |
| ⓘ | Ceruleite | 8.DE.25 | Cu2Al7(AsO4)4(OH)13 · 11.5H2O |
| ⓘ | Philipsburgite | 8.DE.35 | Cu5Zn(AsO4)(PO4)(OH)6 · H2O |
| ⓘ | Chalcophyllite | 8.DF.30 | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| ⓘ | Parnauite | 8.DF.35 | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| ⓘ | Lavendulan | 8.DG.05 | NaCaCu5(AsO4)4Cl · 5H2O |
| ⓘ | var. Zinclavendulan (TL) | 8.DG.05 | NaCa(Cu,Zn)5(AsO4)4Cl · 5H2O |
| ⓘ | Arseniosiderite | 8.DH.30 | Ca2Fe3+3(AsO4)3O2 · 3H2O |
| ⓘ | Andyrobertsite (TL) | 8.DH.50 | KCdCu5(AsO4)4(H2AsO4) · 2H2O |
| ⓘ | Calcioandyrobertsite (TL) | 8.DH.50 | KCaCu5(AsO4)4(H2AsO4) · 2H2O |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ | Dufrénite | 8.DK.15 | Ca0.5Fe2+Fe3+5(PO4)4(OH)6 · 2H2O |
| ⓘ | Agardite-(Ce) | 8.DL.15 | CeCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ | Mixite | 8.DL.15 | BiCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ | Betpakdalite-CaMg (TL) | 8.DM. | [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe3+3O36(OH)] |
| ⓘ | Betpakdalite-CaCa | 8.DM.15 | [Ca2(H2O)17Ca(H2O)6][Mo6+8As5+2Fe3+3O36(OH)] |
| ⓘ | Skorpionite | 8.DO.45 | Ca3Zn2(PO4)2(CO3)(OH)2 · H2O |
| ⓘ | Metazeunerite | 8.EB.10 | Cu(UO2)2(AsO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Willemite | 9.AA.05 | Zn2SiO4 |
| ⓘ | Larsenite | 9.AB.10 | PbZnSiO4 |
| ⓘ | Fayalite | 9.AC.05 | Fe2+2(SiO4) |
| ⓘ | Kirschsteinite | 9.AC.05 | CaFe2+(SiO4) |
| ⓘ | Monticellite | 9.AC.10 | CaMg(SiO4) |
| ⓘ | Brunogeierite (TL) | 9.AC.15 | Ge4+Fe2+2O4 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Krieselite (TL) | 9.AF.20 | Al2(GeO4)F2 |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Kasolite | 9.AK.15 | Pb(UO2)(SiO4) · H2O |
| ⓘ | Åkermanite | 9.BB.10 | Ca2Mg[Si2O7] |
| ⓘ | Hardystonite | 9.BB.10 | Ca2Zn[Si2O7] |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Melanotekite | 9.BE.80 | Pb2Fe3+2(Si2O7)O2 |
| ⓘ | Queitite (TL) | 9.BF.20 | Pb4Zn2(SO4)(SiO4)(Si2O7) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Dioptase | 9.CJ.30 | CuSiO3 · H2O |
| ⓘ | Mathewrogersite (TL) | 9.CJ.55 | Pb7FeAl3GeSi12O36(OH,H2O)6 |
| ⓘ | Shattuckite | 9.DB.40 | Cu5(Si2O6)2(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Alamosite | 9.DO.20 | PbSiO3 |
| ⓘ | Plancheite | 9.DP.55 | Cu8(Si8O22)(OH)4 · H2O |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Saponite | 9.EC.45 | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ | Stevensite | 9.EC.45 | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| ⓘ | Baileychlore | 9.EC.55 | Zn5Al(AlSi3O10)(OH)8 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Surite | 9.EC.75 | (Pb,Ca)3(Al,Fe2+,Mg)2((Si,Al)4O10)(CO3)2(OH)2 |
| ⓘ | Kegelite (TL) | 9.EC.80 | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Berthierine | 9.ED.15 | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| ⓘ | Brindleyite | 9.ED.15 | (Ni,Al)3(Si,Al)2O5(OH)4 |
| ⓘ | Fraipontite | 9.ED.15 | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Palygorskite | 9.EE.20 | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| ⓘ | Loughlinite | 9.EE.25 | Na2Mg3Si6O16 · 8H2O |
| ⓘ | Sepiolite | 9.EE.25 | Mg4(Si6O15)(OH)2 · 6H2O |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Analcime | 9.GB.05 | Na(AlSi2O6) · H2O |
| ⓘ | Plumbotsumite (TL) | 9.HH.20 | Pb13(CO3)6(Si10O27) · 3H2O |
| ⓘ | Bartelkeite (TL) | 9.J0.10 | Pb(Fe2+Ge)[Ge2O7](OH)2 · H2O |
| ⓘ | Otjisumeite (TL) | 9.J0.15 | PbGe4O9 |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Carnevallite' | - | Cu3GaS4 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Manganese Oxides' | - | |
| ⓘ | 'Melilite Group' | - | Ca2M(XSiO7) |
| ⓘ | 'Betpakdalite Group' | - | |
| ⓘ | 'Kintoreite-Segnitite Series' | - | |
| ⓘ | 'Mineral GS1 (of Gebhard)' | - | Zn, Fe, As, O, H |
| ⓘ | 'UM1970-16-OH:GeMn' | - | (Mn,Fe)(Ge,Sn)(OH)6 |
| ⓘ | 'Lead-bearing Feldspar' | - | (K,Pb)-(Al,Si)-O |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Adamite | Zn2(AsO4)(OH) |
| H | ⓘ Agardite-(Ce) | CeCu6(AsO4)3(OH)6 · 3H2O |
| H | ⓘ Analcime | Na(AlSi2O6) · H2O |
| H | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| H | ⓘ Arsenogoyazite | SrAl3(AsO4)(AsO3OH)(OH)6 |
| H | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| H | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| H | ⓘ Arsenocrandallite | CaAl3(AsO4)(AsO3OH)(OH)6 |
| H | ⓘ Arsentsumebite | Pb2Cu(AsO4)(SO4)(OH) |
| H | ⓘ Arthurite | CuFe23+(AsO4)2(OH)2 · 4H2O |
| H | ⓘ Atacamite | Cu2(OH)3Cl |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Austinite | CaZn(AsO4)(OH) |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Ashoverite | Zn(OH)2 |
| H | ⓘ Baileychlore | Zn5Al(AlSi3O10)(OH)8 |
| H | ⓘ Bartelkeite | Pb(Fe2+Ge)[Ge2O7](OH)2 · H2O |
| H | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| H | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| H | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| H | ⓘ Betpakdalite-CaCa | [Ca2(H2O)17Ca(H2O)6][Mo86+As25+Fe33+O36(OH)] |
| H | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| H | ⓘ Brindleyite | (Ni,Al)3(Si,Al)2O5(OH)4 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Brucite | Mg(OH)2 |
| H | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| H | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| H | ⓘ Ceruleite | Cu2Al7(AsO4)4(OH)13 · 11.5H2O |
| H | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| H | ⓘ Chalconatronite | Na2Cu(CO3)2 · 3H2O |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| H | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Chudobaite | Mg5(AsO4)2(AsO3OH)2 · 10H2O |
| H | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| H | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| H | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| H | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| H | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Adamite var. Copper-bearing Adamite | (Zn,Cu)2AsO4OH |
| H | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| H | ⓘ Descloizite | PbZn(VO4)(OH) |
| H | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Dioptase | CuSiO3 · H2O |
| H | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| H | ⓘ Duftite | PbCu(AsO4)(OH) |
| H | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| H | ⓘ Dzhalindite | In(OH)3 |
| H | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Euchroite | Cu2(AsO4)(OH) · 3H2O |
| H | ⓘ Fahleite | CaZn5Fe23+(AsO4)6 · 14H2O |
| H | ⓘ Ferrilotharmeyerite | CaZnFe3+(AsO4)2(OH) · H2O |
| H | ⓘ Fleischerite | Pb3Ge(SO4)2(OH)6 · 3H2O |
| H | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| H | ⓘ Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| H | ⓘ Gaitite | Ca2Zn(AsO4)2 · 2H2O |
| H | ⓘ Gartrellite | PbCuFe3+(AsO4)2(OH) · H2O |
| H | ⓘ Geminite | Cu2+(AsO3OH) · H2O |
| H | ⓘ Gerdtremmelite | (Zn,Fe)(Al,Fe)2(AsO4)(OH)5 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gunningite | ZnSO4 · H2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Helmutwinklerite | PbZn2(AsO4)2 · 2H2O |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Heterogenite | Co3+O(OH) |
| H | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| H | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| H | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| H | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| H | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Itoite | Pb3Ge4+(SO4)2O2(OH)2 |
| H | ⓘ Jamesite | Pb2Zn(Fe2+,Zn)2Fe43+(AsO4)4(OH)10 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Jeanbandyite | Fe3+Sn(OH)5O |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Karibibite | Fe33+(As3+O2)4(As23+O5)(OH) |
| H | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| H | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| H | ⓘ Keyite | Cu32+Zn4Cd2(AsO4)6 · 2H2O |
| H | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Koritnigite | Zn(AsO3OH) · H2O |
| H | ⓘ Köttigite | Zn3(AsO4)2 · 8H2O |
| H | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| H | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Legrandite | Zn2(AsO4)(OH) · H2O |
| H | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| H | ⓘ Lepidocrocite | Fe3+O(OH) |
| H | ⓘ Libethenite | Cu2(PO4)(OH) |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Lindackerite | CuCu4(AsO4)2(HAsO4)2 · 9H2O |
| H | ⓘ Loughlinite | Na2Mg3Si6O16 · 8H2O |
| H | ⓘ Ludjibaite | Cu5(PO4)2(OH)4 |
| H | ⓘ Macphersonite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Mathewrogersite | Pb7FeAl3GeSi12O36(OH,H2O)6 |
| H | ⓘ Mawbyite | PbFe23+(AsO4)2(OH)2 |
| H | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| H | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| H | ⓘ Molybdofornacite | Pb2Cu(MoO4,CrO4)(AsO4,PO4)(OH) |
| H | ⓘ Mottramite | PbCu(VO4)(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Namuwite | Zn4(SO4)(OH)6 · 4H2O |
| H | ⓘ O'Danielite | Na(Zn,Mg)3(AsO4)(AsO3OH)2 |
| H | ⓘ Ojuelaite | ZnFe23+(AsO4)2(OH)2 · 4H2O |
| H | ⓘ Olivenite | Cu2(AsO4)(OH) |
| H | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| H | ⓘ Paradamite | Zn2(AsO4)(OH) |
| H | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| H | ⓘ Philipsburgite | Cu5Zn(AsO4)(PO4)(OH)6 · H2O |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Plumbotsumite | Pb13(CO3)6(Si10O27) · 3H2O |
| H | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| H | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| H | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| H | ⓘ Prosopite | CaAl2F4[(OH)4-xFx] |
| H | ⓘ Prosperite | Ca2Zn4(AsO4)4 · H2O |
| H | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| H | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| H | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| H | ⓘ Anorthoroselite | Ca2Co(AsO4)2 · 2H2O |
| H | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| H | ⓘ Schaurteite | Ca3Ge(SO4)2(OH)6 · 4H2O |
| H | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| H | ⓘ Schulténite | Pb(HAsO4) |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| H | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| H | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| H | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| H | ⓘ Söhngeite | Ga(OH)3 |
| H | ⓘ Spertiniite | Cu(OH)2 |
| H | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| H | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| H | ⓘ Stottite | Fe2+[Ge4+(OH)6] |
| H | ⓘ Surite | (Pb,Ca)3(Al,Fe2+,Mg)2((Si,Al)4O10)(CO3)2(OH)2 |
| H | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Talmessite | Ca2Mg(AsO4)2 · 2H2O |
| H | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| H | ⓘ Thometzekite | PbCu22+(AsO4)2 · 2H2O |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Tsumcorite | PbZn2(AsO4)2 · 2H2O |
| H | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| H | ⓘ Tangeite | CaCu(VO4)(OH) |
| H | ⓘ Vésigniéite | BaCu3(VO4)2(OH)2 |
| H | ⓘ Warikahnite | Zn3(AsO4)2 · 2H2O |
| H | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| H | ⓘ Wickmanite | Mn2+[Sn(OH)6] |
| H | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Zharchikhite | AlF(OH)2 |
| H | ⓘ Olivenite var. Zinc-bearing Olivenite | (Cu,Zn)2(AsO4)(OH) |
| H | ⓘ Zincrosasite | (Zn,Cu)2(CO3)(OH)2 |
| H | ⓘ Zincroselite | Ca2Zn(AsO4)2 · 2H2O |
| H | ⓘ Duftite-alpha | PbCu(AsO4)(OH) |
| H | ⓘ Andyrobertsite | KCdCu5(AsO4)4(H2AsO4) · 2H2O |
| H | ⓘ Arsenbrackebuschite | Pb2Fe3+(AsO4)2(OH) |
| H | ⓘ Calcioandyrobertsite | KCaCu5(AsO4)4(H2AsO4) · 2H2O |
| H | ⓘ Feinglosite | Pb2Zn(AsO4)2 · H2O |
| H | ⓘ Gallobeudantite | PbGa3(AsO4)(SO4)(OH)6 |
| H | ⓘ Gordaite | NaZn4(SO4)(OH)6Cl · 6H2O |
| H | ⓘ Zincgartrellite | PbZn2(AsO4)2(H2O,OH)2 |
| H | ⓘ Ekatite | (Fe3+,Fe2+,Zn)12(AsO3)6(AsO3,HSiO4)2(OH)6 |
| H | ⓘ Cobalttsumcorite | PbCo2(AsO4)2 · 2H2O |
| H | ⓘ Niedermayrite | CdCu4(SO4)2(OH)6 · 4H2O |
| H | ⓘ Sidpietersite | Pb42+(S2O3)O2(OH)2 |
| H | ⓘ Wilhelmkleinite | ZnFe23+(AsO4)2(OH)2 |
| H | ⓘ Yvonite | Cu(HAsO4) · 2H2O |
| H | ⓘ Lavendulan var. Zinclavendulan | NaCa(Cu,Zn)5(AsO4)4Cl · 5H2O |
| H | ⓘ Adamite var. Cobalt-bearing Adamite | Zn2(AsO4)(OH) |
| H | ⓘ Lukrahnite | CaCuFe3+(AsO4)2(OH,H2O)2 |
| H | ⓘ Sewardite | CaFe23+(AsO4)2(OH)2 |
| H | ⓘ Tsumgallite | GaO(OH) |
| H | ⓘ Eyselite | Fe3+Ge34+O7(OH) |
| H | ⓘ Skorpionite | Ca3Zn2(PO4)2(CO3)(OH)2 · H2O |
| H | ⓘ Zincolivenite | CuZn(AsO4)(OH) |
| H | ⓘ Hydroxylpyromorphite | Pb5(PO4)3(OH) |
| H | ⓘ Bendadaite | Fe2+Fe23+(AsO4)2(OH)2 · 4H2O |
| H | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| H | ⓘ Edwardsite | Cu3Cd2(SO4)2(OH)6 · 4H2O |
| H | ⓘ Kintoreite-Segnitite Series | |
| H | ⓘ Plumbogummite var. Ga-rich plumbogummite | Pb(Al,Ga)3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Hermannroseite | CaCu(PO4)(OH) |
| H | ⓘ Yancowinnaite | PbCuAl(AsO4)2OH · H2O |
| H | ⓘ Arsenohopeite | Zn3(AsO4)2 · 4H2O |
| H | ⓘ Betpakdalite-CaMg | [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe33+O36(OH)] |
| H | ⓘ Davidlloydite | Zn3(AsO4)2 · 4H2O |
| H | ⓘ Ianbruceite | Zn2(AsO4)(OH) · 3H2O |
| H | ⓘ Lazaridisite | Cd3(SO4)3 · 8H2O |
| H | ⓘ Erikapohlite | Cu3(Zn,Cu,Mg)4Ca2(AsO4)6 · 2H2O |
| H | ⓘ Galloplumbogummite | Pb(Ga,Al,Ge)3(PO4)2(OH)6 |
| H | ⓘ Abellaite | NaPb2(CO3)2(OH) |
| H | ⓘ Mineral GS1 (of Gebhard) | Zn, Fe, As, O, H |
| H | ⓘ UM1970-16-OH:GeMn | (Mn,Fe)(Ge,Sn)(OH)6 |
| H | ⓘ Halilsarpite | [Mg(H2O)6][CaAs23+(Fe3+2.67Mo6+0.33)(AsO4)2O7] |
| H | ⓘ Lauraniite | Cu6Cd2(SO4)2(OH)12 · 5H2O |
| H | ⓘ Karlseifertite | Pb(Ga2Ge)(AsO4)2(OH)6 |
| H | ⓘ Nancyrossite | FeGeO6H5 |
| H | ⓘ Zincostottite | ZnGe(OH)6 |
| H | ⓘ Cadsulfohite | Cd2(SO4)(OH)2 |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Chalconatronite | Na2Cu(CO3)2 · 3H2O |
| C | ⓘ Dolomite var. Cobalt-bearing Dolomite | Ca(Mg,Co)(CO3)2 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| C | ⓘ Graphite | C |
| C | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| C | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Macphersonite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Minrecordite | CaZn(CO3)2 |
| C | ⓘ Otavite | CdCO3 |
| C | ⓘ Phosgenite | Pb2CO3Cl2 |
| C | ⓘ Plumbotsumite | Pb13(CO3)6(Si10O27) · 3H2O |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Surite | (Pb,Ca)3(Al,Fe2+,Mg)2((Si,Al)4O10)(CO3)2(OH)2 |
| C | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Aragonite var. Lead-bearing Aragonite | (Ca,Pb)CO3 |
| C | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| C | ⓘ Witherite | BaCO3 |
| C | ⓘ Zincrosasite | (Zn,Cu)2(CO3)(OH)2 |
| C | ⓘ Dolomite var. Zinc-bearing Dolomite | Ca(Mg,Zn)(CO3)2 |
| C | ⓘ Siderite var. Zinc-bearing Siderite | (Fe,Zn)CO3 |
| C | ⓘ Aragonite var. Zinc-bearing Aragonite | (Ca,Zn)CO3 |
| C | ⓘ Skorpionite | Ca3Zn2(PO4)2(CO3)(OH)2 · H2O |
| C | ⓘ Abellaite | NaPb2(CO3)2(OH) |
| O | Oxygen | |
| O | ⓘ Adamite | Zn2(AsO4)(OH) |
| O | ⓘ Agardite-(Ce) | CeCu6(AsO4)3(OH)6 · 3H2O |
| O | ⓘ Åkermanite | Ca2Mg[Si2O7] |
| O | ⓘ Alamosite | PbSiO3 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Analcime | Na(AlSi2O6) · H2O |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| O | ⓘ Arsenogoyazite | SrAl3(AsO4)(AsO3OH)(OH)6 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Argutite | GeO2 |
| O | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| O | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| O | ⓘ Arsenocrandallite | CaAl3(AsO4)(AsO3OH)(OH)6 |
| O | ⓘ Arsentsumebite | Pb2Cu(AsO4)(SO4)(OH) |
| O | ⓘ Arthurite | CuFe23+(AsO4)2(OH)2 · 4H2O |
| O | ⓘ Atacamite | Cu2(OH)3Cl |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Austinite | CaZn(AsO4)(OH) |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Ashoverite | Zn(OH)2 |
| O | ⓘ Baileychlore | Zn5Al(AlSi3O10)(OH)8 |
| O | ⓘ Bartelkeite | Pb(Fe2+Ge)[Ge2O7](OH)2 · H2O |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| O | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| O | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| O | ⓘ Betpakdalite-CaCa | [Ca2(H2O)17Ca(H2O)6][Mo86+As25+Fe33+O36(OH)] |
| O | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| O | ⓘ Brindleyite | (Ni,Al)3(Si,Al)2O5(OH)4 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Brunogeierite | Ge4+Fe22+O4 |
| O | ⓘ Brucite | Mg(OH)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| O | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| O | ⓘ Celestine | SrSO4 |
| O | ⓘ Ceruleite | Cu2Al7(AsO4)4(OH)13 · 11.5H2O |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| O | ⓘ Chalconatronite | Na2Cu(CO3)2 · 3H2O |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| O | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| O | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Chudobaite | Mg5(AsO4)2(AsO3OH)2 · 10H2O |
| O | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| O | ⓘ Claudetite | As2O3 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Dolomite var. Cobalt-bearing Dolomite | Ca(Mg,Co)(CO3)2 |
| O | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| O | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| O | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| O | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| O | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| O | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Adamite var. Copper-bearing Adamite | (Zn,Cu)2AsO4OH |
| O | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| O | ⓘ Delafossite | Cu+Fe3+O2 |
| O | ⓘ Descloizite | PbZn(VO4)(OH) |
| O | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Dioptase | CuSiO3 · H2O |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| O | ⓘ Duftite | PbCu(AsO4)(OH) |
| O | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| O | ⓘ Dzhalindite | In(OH)3 |
| O | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Euchroite | Cu2(AsO4)(OH) · 3H2O |
| O | ⓘ Fahleite | CaZn5Fe23+(AsO4)6 · 14H2O |
| O | ⓘ Fayalite | Fe22+(SiO4) |
| O | ⓘ Ferberite | FeWO4 |
| O | ⓘ Ferrilotharmeyerite | CaZnFe3+(AsO4)2(OH) · H2O |
| O | ⓘ Fleischerite | Pb3Ge(SO4)2(OH)6 · 3H2O |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| O | ⓘ Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| O | ⓘ Freedite | Cu+Pb8(AsO3)2O3Cl5 |
| O | ⓘ Gahnite | ZnAl2O4 |
| O | ⓘ Gaitite | Ca2Zn(AsO4)2 · 2H2O |
| O | ⓘ Gartrellite | PbCuFe3+(AsO4)2(OH) · H2O |
| O | ⓘ Gebhardite | Pb8(As2O5)2OCl6 |
| O | ⓘ Geminite | Cu2+(AsO3OH) · H2O |
| O | ⓘ Gerdtremmelite | (Zn,Fe)(Al,Fe)2(AsO4)(OH)5 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gunningite | ZnSO4 · H2O |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hardystonite | Ca2Zn[Si2O7] |
| O | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| O | ⓘ Helmutwinklerite | PbZn2(AsO4)2 · 2H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Heterogenite | Co3+O(OH) |
| O | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| O | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| O | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| O | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| O | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Itoite | Pb3Ge4+(SO4)2O2(OH)2 |
| O | ⓘ Jamesite | Pb2Zn(Fe2+,Zn)2Fe43+(AsO4)4(OH)10 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Jeanbandyite | Fe3+Sn(OH)5O |
| O | ⓘ Johillerite | Na(Mg,Zn)3Cu(AsO4)3 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Karibibite | Fe33+(As3+O2)4(As23+O5)(OH) |
| O | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| O | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| O | ⓘ Keyite | Cu32+Zn4Cd2(AsO4)6 · 2H2O |
| O | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Kirschsteinite | CaFe2+(SiO4) |
| O | ⓘ Koritnigite | Zn(AsO3OH) · H2O |
| O | ⓘ Köttigite | Zn3(AsO4)2 · 8H2O |
| O | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| O | ⓘ Lammerite | Cu3(AsO4)2 |
| O | ⓘ Lanarkite | Pb2(SO4)O |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Larsenite | PbZnSiO4 |
| O | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| O | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Legrandite | Zn2(AsO4)(OH) · H2O |
| O | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| O | ⓘ Leiteite | Zn(As2O4) |
| O | ⓘ Lepidocrocite | Fe3+O(OH) |
| O | ⓘ Libethenite | Cu2(PO4)(OH) |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Lindackerite | CuCu4(AsO4)2(HAsO4)2 · 9H2O |
| O | ⓘ Loughlinite | Na2Mg3Si6O16 · 8H2O |
| O | ⓘ Ludjibaite | Cu5(PO4)2(OH)4 |
| O | ⓘ Ludlockite | PbFe43+As103+O22 |
| O | ⓘ Litharge | PbO |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Macphersonite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Maghemite | (Fe3+0.67◻0.33)Fe23+O4 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Massicot | PbO |
| O | ⓘ Mathewrogersite | Pb7FeAl3GeSi12O36(OH,H2O)6 |
| O | ⓘ Mawbyite | PbFe23+(AsO4)2(OH)2 |
| O | ⓘ Mcconnellite | CuCrO2 |
| O | ⓘ Melanotekite | Pb2Fe23+(Si2O7)O2 |
| O | ⓘ Mendipite | Pb3Cl2O2 |
| O | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Minium | Pb3O4 |
| O | ⓘ Minrecordite | CaZn(CO3)2 |
| O | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| O | ⓘ Molybdofornacite | Pb2Cu(MoO4,CrO4)(AsO4,PO4)(OH) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Monticellite | CaMg(SiO4) |
| O | ⓘ Mottramite | PbCu(VO4)(OH) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Nadorite | PbSbClO2 |
| O | ⓘ Namuwite | Zn4(SO4)(OH)6 · 4H2O |
| O | ⓘ O'Danielite | Na(Zn,Mg)3(AsO4)(AsO3OH)2 |
| O | ⓘ Ojuelaite | ZnFe23+(AsO4)2(OH)2 · 4H2O |
| O | ⓘ Olivenite | Cu2(AsO4)(OH) |
| O | ⓘ Olsacherite | Pb2(Se6+O4)(SO4) |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Otavite | CdCO3 |
| O | ⓘ Otjisumeite | PbGe4O9 |
| O | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| O | ⓘ Paradamite | Zn2(AsO4)(OH) |
| O | ⓘ Parkinsonite | Pb7MoO9Cl2 |
| O | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| O | ⓘ Philipsburgite | Cu5Zn(AsO4)(PO4)(OH)6 · H2O |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Phosgenite | Pb2CO3Cl2 |
| O | ⓘ Plumbotsumite | Pb13(CO3)6(Si10O27) · 3H2O |
| O | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| O | ⓘ Plattnerite | PbO2 |
| O | ⓘ Plumboferrite | Pb[Fe3+10.67Mn2+0.33Pb]O18.33 |
| O | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| O | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| O | ⓘ Powellite | Ca(MoO4) |
| O | ⓘ Prosopite | CaAl2F4[(OH)4-xFx] |
| O | ⓘ Prosperite | Ca2Zn4(AsO4)4 · H2O |
| O | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Queitite | Pb4Zn2(SO4)(SiO4)(Si2O7) |
| O | ⓘ Reinerite | Zn3(AsO3)2 |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| O | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| O | ⓘ Anorthoroselite | Ca2Co(AsO4)2 · 2H2O |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| O | ⓘ Schaurteite | Ca3Ge(SO4)2(OH)6 · 4H2O |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schneiderhöhnite | Fe2+Fe33+As53+O13 |
| O | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| O | ⓘ Schulténite | Pb(HAsO4) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Scotlandite | PbSO3 |
| O | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| O | ⓘ Senarmontite | Sb2O3 |
| O | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| O | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| O | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Söhngeite | Ga(OH)3 |
| O | ⓘ Spertiniite | Cu(OH)2 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| O | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| O | ⓘ Stolzite | Pb(WO4) |
| O | ⓘ Stottite | Fe2+[Ge4+(OH)6] |
| O | ⓘ Stranskiite | Zn2Cu(AsO4)2 |
| O | ⓘ Surite | (Pb,Ca)3(Al,Fe2+,Mg)2((Si,Al)4O10)(CO3)2(OH)2 |
| O | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Talmessite | Ca2Mg(AsO4)2 · 2H2O |
| O | ⓘ Aragonite var. Lead-bearing Aragonite | (Ca,Pb)CO3 |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| O | ⓘ Thometzekite | PbCu22+(AsO4)2 · 2H2O |
| O | ⓘ Tilasite | CaMg(AsO4)F |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Tsumcorite | PbZn2(AsO4)2 · 2H2O |
| O | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| O | ⓘ Tangeite | CaCu(VO4)(OH) |
| O | ⓘ Vanadinite | Pb5(VO4)3Cl |
| O | ⓘ Vésigniéite | BaCu3(VO4)2(OH)2 |
| O | ⓘ Warikahnite | Zn3(AsO4)2 · 2H2O |
| O | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| O | ⓘ Wickmanite | Mn2+[Sn(OH)6] |
| O | ⓘ Willemite | Zn2SiO4 |
| O | ⓘ Witherite | BaCO3 |
| O | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Wüstite | FeO |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Zharchikhite | AlF(OH)2 |
| O | ⓘ Olivenite var. Zinc-bearing Olivenite | (Cu,Zn)2(AsO4)(OH) |
| O | ⓘ Zincrosasite | (Zn,Cu)2(CO3)(OH)2 |
| O | ⓘ Zincroselite | Ca2Zn(AsO4)2 · 2H2O |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Duftite-alpha | PbCu(AsO4)(OH) |
| O | ⓘ Hematite var. Kidney Ore | Fe2O3 |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Andyrobertsite | KCdCu5(AsO4)4(H2AsO4) · 2H2O |
| O | ⓘ Arsenbrackebuschite | Pb2Fe3+(AsO4)2(OH) |
| O | ⓘ Calcioandyrobertsite | KCaCu5(AsO4)4(H2AsO4) · 2H2O |
| O | ⓘ Feinglosite | Pb2Zn(AsO4)2 · H2O |
| O | ⓘ Gallobeudantite | PbGa3(AsO4)(SO4)(OH)6 |
| O | ⓘ Gordaite | NaZn4(SO4)(OH)6Cl · 6H2O |
| O | ⓘ Zincgartrellite | PbZn2(AsO4)2(H2O,OH)2 |
| O | ⓘ Ekatite | (Fe3+,Fe2+,Zn)12(AsO3)6(AsO3,HSiO4)2(OH)6 |
| O | ⓘ Cobalttsumcorite | PbCo2(AsO4)2 · 2H2O |
| O | ⓘ Niedermayrite | CdCu4(SO4)2(OH)6 · 4H2O |
| O | ⓘ Sidpietersite | Pb42+(S2O3)O2(OH)2 |
| O | ⓘ Wilhelmkleinite | ZnFe23+(AsO4)2(OH)2 |
| O | ⓘ Yvonite | Cu(HAsO4) · 2H2O |
| O | ⓘ Lavendulan var. Zinclavendulan | NaCa(Cu,Zn)5(AsO4)4Cl · 5H2O |
| O | ⓘ Adamite var. Cobalt-bearing Adamite | Zn2(AsO4)(OH) |
| O | ⓘ Biehlite | ((Sb,As)O)2[MoO4] |
| O | ⓘ Dolomite var. Zinc-bearing Dolomite | Ca(Mg,Zn)(CO3)2 |
| O | ⓘ Fayalite-Forsterite Series | |
| O | ⓘ Wulfenite var. Chillagite | Pb[(Mo,W)O4] |
| O | ⓘ Lukrahnite | CaCuFe3+(AsO4)2(OH,H2O)2 |
| O | ⓘ Sewardite | CaFe23+(AsO4)2(OH)2 |
| O | ⓘ Siderite var. Zinc-bearing Siderite | (Fe,Zn)CO3 |
| O | ⓘ Tsumgallite | GaO(OH) |
| O | ⓘ Eyselite | Fe3+Ge34+O7(OH) |
| O | ⓘ Aragonite var. Zinc-bearing Aragonite | (Ca,Zn)CO3 |
| O | ⓘ Skorpionite | Ca3Zn2(PO4)2(CO3)(OH)2 · H2O |
| O | ⓘ Krieselite | Al2(GeO4)F2 |
| O | ⓘ Melilite Group | Ca2M(XSiO7) |
| O | ⓘ Zincolivenite | CuZn(AsO4)(OH) |
| O | ⓘ Hydroxylpyromorphite | Pb5(PO4)3(OH) |
| O | ⓘ Bendadaite | Fe2+Fe23+(AsO4)2(OH)2 · 4H2O |
| O | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| O | ⓘ Stibioclaudetite | AsSbO3 |
| O | ⓘ Edwardsite | Cu3Cd2(SO4)2(OH)6 · 4H2O |
| O | ⓘ Kintoreite-Segnitite Series | |
| O | ⓘ Plumbogummite var. Ga-rich plumbogummite | Pb(Al,Ga)3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Hermannroseite | CaCu(PO4)(OH) |
| O | ⓘ Plumboselite | Pb3O2(SeO3) |
| O | ⓘ Yancowinnaite | PbCuAl(AsO4)2OH · H2O |
| O | ⓘ Arsenohopeite | Zn3(AsO4)2 · 4H2O |
| O | ⓘ Betpakdalite-CaMg | [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe33+O36(OH)] |
| O | ⓘ Davidlloydite | Zn3(AsO4)2 · 4H2O |
| O | ⓘ Ianbruceite | Zn2(AsO4)(OH) · 3H2O |
| O | ⓘ Vanackerite | Pb4Cd(AsO4)3Cl |
| O | ⓘ Lazaridisite | Cd3(SO4)3 · 8H2O |
| O | ⓘ Erikapohlite | Cu3(Zn,Cu,Mg)4Ca2(AsO4)6 · 2H2O |
| O | ⓘ Galloplumbogummite | Pb(Ga,Al,Ge)3(PO4)2(OH)6 |
| O | ⓘ Oxyplumboroméite | Pb2Sb2O6O |
| O | ⓘ Abellaite | NaPb2(CO3)2(OH) |
| O | ⓘ Mineral GS1 (of Gebhard) | Zn, Fe, As, O, H |
| O | ⓘ UM1970-16-OH:GeMn | (Mn,Fe)(Ge,Sn)(OH)6 |
| O | ⓘ Lead-bearing Feldspar | (K,Pb)-(Al,Si)-O |
| O | ⓘ Halilsarpite | [Mg(H2O)6][CaAs23+(Fe3+2.67Mo6+0.33)(AsO4)2O7] |
| O | ⓘ Lauraniite | Cu6Cd2(SO4)2(OH)12 · 5H2O |
| O | ⓘ Karlseifertite | Pb(Ga2Ge)(AsO4)2(OH)6 |
| O | ⓘ Nancyrossite | FeGeO6H5 |
| O | ⓘ Zincostottite | ZnGe(OH)6 |
| O | ⓘ Cadsulfohite | Cd2(SO4)(OH)2 |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Matlockite | PbFCl |
| F | ⓘ Prosopite | CaAl2F4[(OH)4-xFx] |
| F | ⓘ Tilasite | CaMg(AsO4)F |
| F | ⓘ Zharchikhite | AlF(OH)2 |
| F | ⓘ Krieselite | Al2(GeO4)F2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Na | ⓘ Chalconatronite | Na2Cu(CO3)2 · 3H2O |
| Na | ⓘ Johillerite | Na(Mg,Zn)3Cu(AsO4)3 |
| Na | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Na | ⓘ Loughlinite | Na2Mg3Si6O16 · 8H2O |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ O'Danielite | Na(Zn,Mg)3(AsO4)(AsO3OH)2 |
| Na | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| Na | ⓘ Gordaite | NaZn4(SO4)(OH)6Cl · 6H2O |
| Na | ⓘ Lavendulan var. Zinclavendulan | NaCa(Cu,Zn)5(AsO4)4Cl · 5H2O |
| Na | ⓘ Abellaite | NaPb2(CO3)2(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Åkermanite | Ca2Mg[Si2O7] |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Brucite | Mg(OH)2 |
| Mg | ⓘ Chudobaite | Mg5(AsO4)2(AsO3OH)2 · 10H2O |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Dolomite var. Cobalt-bearing Dolomite | Ca(Mg,Co)(CO3)2 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| Mg | ⓘ Johillerite | Na(Mg,Zn)3Cu(AsO4)3 |
| Mg | ⓘ Loughlinite | Na2Mg3Si6O16 · 8H2O |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Monticellite | CaMg(SiO4) |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ O'Danielite | Na(Zn,Mg)3(AsO4)(AsO3OH)2 |
| Mg | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Mg | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| Mg | ⓘ Surite | (Pb,Ca)3(Al,Fe2+,Mg)2((Si,Al)4O10)(CO3)2(OH)2 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Talmessite | Ca2Mg(AsO4)2 · 2H2O |
| Mg | ⓘ Tilasite | CaMg(AsO4)F |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| Mg | ⓘ Dolomite var. Zinc-bearing Dolomite | Ca(Mg,Zn)(CO3)2 |
| Mg | ⓘ Fayalite-Forsterite Series | |
| Mg | ⓘ Betpakdalite-CaMg | [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe33+O36(OH)] |
| Mg | ⓘ Erikapohlite | Cu3(Zn,Cu,Mg)4Ca2(AsO4)6 · 2H2O |
| Mg | ⓘ Halilsarpite | [Mg(H2O)6][CaAs23+(Fe3+2.67Mo6+0.33)(AsO4)2O7] |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Al | ⓘ Arsenogoyazite | SrAl3(AsO4)(AsO3OH)(OH)6 |
| Al | ⓘ Arsenocrandallite | CaAl3(AsO4)(AsO3OH)(OH)6 |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Baileychlore | Zn5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Brindleyite | (Ni,Al)3(Si,Al)2O5(OH)4 |
| Al | ⓘ Ceruleite | Cu2Al7(AsO4)4(OH)13 · 11.5H2O |
| Al | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| Al | ⓘ Gahnite | ZnAl2O4 |
| Al | ⓘ Gerdtremmelite | (Zn,Fe)(Al,Fe)2(AsO4)(OH)5 |
| Al | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| Al | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| Al | ⓘ Mathewrogersite | Pb7FeAl3GeSi12O36(OH,H2O)6 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Al | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Prosopite | CaAl2F4[(OH)4-xFx] |
| Al | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Surite | (Pb,Ca)3(Al,Fe2+,Mg)2((Si,Al)4O10)(CO3)2(OH)2 |
| Al | ⓘ Zharchikhite | AlF(OH)2 |
| Al | ⓘ Krieselite | Al2(GeO4)F2 |
| Al | ⓘ Plumbogummite var. Ga-rich plumbogummite | Pb(Al,Ga)3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Yancowinnaite | PbCuAl(AsO4)2OH · H2O |
| Al | ⓘ Galloplumbogummite | Pb(Ga,Al,Ge)3(PO4)2(OH)6 |
| Al | ⓘ Lead-bearing Feldspar | (K,Pb)-(Al,Si)-O |
| Si | Silicon | |
| Si | ⓘ Åkermanite | Ca2Mg[Si2O7] |
| Si | ⓘ Alamosite | PbSiO3 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Baileychlore | Zn5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Brindleyite | (Ni,Al)3(Si,Al)2O5(OH)4 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Dioptase | CuSiO3 · H2O |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Fayalite | Fe22+(SiO4) |
| Si | ⓘ Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| Si | ⓘ Hardystonite | Ca2Zn[Si2O7] |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| Si | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| Si | ⓘ Kirschsteinite | CaFe2+(SiO4) |
| Si | ⓘ Larsenite | PbZnSiO4 |
| Si | ⓘ Loughlinite | Na2Mg3Si6O16 · 8H2O |
| Si | ⓘ Mathewrogersite | Pb7FeAl3GeSi12O36(OH,H2O)6 |
| Si | ⓘ Melanotekite | Pb2Fe23+(Si2O7)O2 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Monticellite | CaMg(SiO4) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Plumbotsumite | Pb13(CO3)6(Si10O27) · 3H2O |
| Si | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Queitite | Pb4Zn2(SO4)(SiO4)(Si2O7) |
| Si | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Si | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Si | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| Si | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| Si | ⓘ Surite | (Pb,Ca)3(Al,Fe2+,Mg)2((Si,Al)4O10)(CO3)2(OH)2 |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Willemite | Zn2SiO4 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Ekatite | (Fe3+,Fe2+,Zn)12(AsO3)6(AsO3,HSiO4)2(OH)6 |
| Si | ⓘ Fayalite-Forsterite Series | |
| Si | ⓘ Melilite Group | Ca2M(XSiO7) |
| Si | ⓘ Lead-bearing Feldspar | (K,Pb)-(Al,Si)-O |
| P | Phosphorus | |
| P | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| P | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| P | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| P | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Libethenite | Cu2(PO4)(OH) |
| P | ⓘ Ludjibaite | Cu5(PO4)2(OH)4 |
| P | ⓘ Molybdofornacite | Pb2Cu(MoO4,CrO4)(AsO4,PO4)(OH) |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Philipsburgite | Cu5Zn(AsO4)(PO4)(OH)6 · H2O |
| P | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| P | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| P | ⓘ Skorpionite | Ca3Zn2(PO4)2(CO3)(OH)2 · H2O |
| P | ⓘ Hydroxylpyromorphite | Pb5(PO4)3(OH) |
| P | ⓘ Kintoreite-Segnitite Series | |
| P | ⓘ Plumbogummite var. Ga-rich plumbogummite | Pb(Al,Ga)3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Hermannroseite | CaCu(PO4)(OH) |
| P | ⓘ Galloplumbogummite | Pb(Ga,Al,Ge)3(PO4)2(OH)6 |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Argyrodite | Ag8GeS6 |
| S | ⓘ Arsentsumebite | Pb2Cu(AsO4)(SO4)(OH) |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| S | ⓘ Betekhtinite | Pb2(Cu,Fe)22-24S15 |
| S | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| S | ⓘ Briartite | Cu2FeGeS4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| S | ⓘ Carrollite | CuCo2S4 |
| S | ⓘ Celestine | SrSO4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| S | ⓘ Cinnabar | HgS |
| S | ⓘ Colusite | Cu13VAs3S16 |
| S | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| S | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Djurleite | Cu31S16 |
| S | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| S | ⓘ Enargite | Cu3AsS4 |
| S | ⓘ Famatinite | Cu3SbS4 |
| S | ⓘ Fleischerite | Pb3Ge(SO4)2(OH)6 · 3H2O |
| S | ⓘ Furutobeite | (Cu,Ag)6PbS4 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gallite | CuGaS2 |
| S | ⓘ Germanite | Cu13Fe2Ge2S16 |
| S | ⓘ Germanocolusite | Cu26V2(Ge,As)6S32 |
| S | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| S | ⓘ Gratonite | Pb9As4S15 |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Gunningite | ZnSO4 · H2O |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| S | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| S | ⓘ Idaite | Cu5FeS6 |
| S | ⓘ Itoite | Pb3Ge4+(SO4)2O2(OH)2 |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| S | ⓘ Kësterite | Cu2ZnSnS4 |
| S | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| S | ⓘ Lanarkite | Pb2(SO4)O |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Linnaeite | Co2+Co23+S4 |
| S | ⓘ Luzonite | Cu3AsS4 |
| S | ⓘ Macphersonite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Mawsonite | Cu6Fe2SnS8 |
| S | ⓘ Mckinstryite | Ag5-xCu3+xS4 |
| S | ⓘ Metacinnabar | HgS |
| S | ⓘ Millerite | NiS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Namuwite | Zn4(SO4)(OH)6 · 4H2O |
| S | ⓘ Olsacherite | Pb2(Se6+O4)(SO4) |
| S | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| S | ⓘ Patrónite | VS4 |
| S | ⓘ Perroudite | Hg5Ag4S5(I,Br)2Cl2 |
| S | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| S | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Queitite | Pb4Zn2(SO4)(SiO4)(Si2O7) |
| S | ⓘ Realgar | As4S4 |
| S | ⓘ Renierite | (Cu+,Zn)11Fe4(Ge4+,As5+)2S16 |
| S | ⓘ Roxbyite | Cu58S32 |
| S | ⓘ Schaurteite | Ca3Ge(SO4)2(OH)6 · 4H2O |
| S | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| S | ⓘ Scotlandite | PbSO3 |
| S | ⓘ Seligmannite | PbCuAsS3 |
| S | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stannite | Cu2FeSnS4 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Stromeyerite | AgCuS |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Sulvanite | Cu3VS4 |
| S | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| S | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| S | ⓘ Tungstenite | WS2 |
| S | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Wurtzite | (Zn,Fe)S |
| S | ⓘ Gallobeudantite | PbGa3(AsO4)(SO4)(OH)6 |
| S | ⓘ Gordaite | NaZn4(SO4)(OH)6Cl · 6H2O |
| S | ⓘ Niedermayrite | CdCu4(SO4)2(OH)6 · 4H2O |
| S | ⓘ Sidpietersite | Pb42+(S2O3)O2(OH)2 |
| S | ⓘ Carnevallite | Cu3GaS4 |
| S | ⓘ Ovamboite | Cu20(Fe,Cu,Zn)6W2Ge6S32 |
| S | ⓘ Maikainite | Cu20(Fe,Cu)6Mo2Ge6S32 |
| S | ⓘ Calvertite | Cu5Ge0.5S4 |
| S | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| S | ⓘ Cupropearceite | [Cu6As2S7][Ag9CuS4] |
| S | ⓘ Cupropolybasite | [Cu6Sb2S7][Ag9CuS4] |
| S | ⓘ Edwardsite | Cu3Cd2(SO4)2(OH)6 · 4H2O |
| S | ⓘ Lazaridisite | Cd3(SO4)3 · 8H2O |
| S | ⓘ Zincobriartite | Cu2(Zn,Fe)(Ge,Ga)S4 |
| S | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| S | ⓘ Lauraniite | Cu6Cd2(SO4)2(OH)12 · 5H2O |
| S | ⓘ Richardsite | Zn2CuGaS4 |
| S | ⓘ Tennantite-(Cu) | Cu6(Cu4Cu2)As4S12S |
| S | ⓘ Cadsulfohite | Cd2(SO4)(OH)2 |
| Cl | Chlorine | |
| Cl | ⓘ Atacamite | Cu2(OH)3Cl |
| Cl | ⓘ Chlorargyrite | AgCl |
| Cl | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cl | ⓘ Cotunnite | PbCl2 |
| Cl | ⓘ Freedite | Cu+Pb8(AsO3)2O3Cl5 |
| Cl | ⓘ Gebhardite | Pb8(As2O5)2OCl6 |
| Cl | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| Cl | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Cl | ⓘ Matlockite | PbFCl |
| Cl | ⓘ Mendipite | Pb3Cl2O2 |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Nadorite | PbSbClO2 |
| Cl | ⓘ Parkinsonite | Pb7MoO9Cl2 |
| Cl | ⓘ Perroudite | Hg5Ag4S5(I,Br)2Cl2 |
| Cl | ⓘ Phosgenite | Pb2CO3Cl2 |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cl | ⓘ Gordaite | NaZn4(SO4)(OH)6Cl · 6H2O |
| Cl | ⓘ Lavendulan var. Zinclavendulan | NaCa(Cu,Zn)5(AsO4)4Cl · 5H2O |
| Cl | ⓘ Vanackerite | Pb4Cd(AsO4)3Cl |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Andyrobertsite | KCdCu5(AsO4)4(H2AsO4) · 2H2O |
| K | ⓘ Calcioandyrobertsite | KCaCu5(AsO4)4(H2AsO4) · 2H2O |
| K | ⓘ Lead-bearing Feldspar | (K,Pb)-(Al,Si)-O |
| Ca | Calcium | |
| Ca | ⓘ Åkermanite | Ca2Mg[Si2O7] |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Ca | ⓘ Arsenocrandallite | CaAl3(AsO4)(AsO3OH)(OH)6 |
| Ca | ⓘ Austinite | CaZn(AsO4)(OH) |
| Ca | ⓘ Betpakdalite-CaCa | [Ca2(H2O)17Ca(H2O)6][Mo86+As25+Fe33+O36(OH)] |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Dolomite var. Cobalt-bearing Dolomite | Ca(Mg,Co)(CO3)2 |
| Ca | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Ca | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Ca | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fahleite | CaZn5Fe23+(AsO4)6 · 14H2O |
| Ca | ⓘ Ferrilotharmeyerite | CaZnFe3+(AsO4)2(OH) · H2O |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gaitite | Ca2Zn(AsO4)2 · 2H2O |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Hardystonite | Ca2Zn[Si2O7] |
| Ca | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| Ca | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| Ca | ⓘ Kirschsteinite | CaFe2+(SiO4) |
| Ca | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Ca | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| Ca | ⓘ Minrecordite | CaZn(CO3)2 |
| Ca | ⓘ Monticellite | CaMg(SiO4) |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Powellite | Ca(MoO4) |
| Ca | ⓘ Prosopite | CaAl2F4[(OH)4-xFx] |
| Ca | ⓘ Prosperite | Ca2Zn4(AsO4)4 · H2O |
| Ca | ⓘ Anorthoroselite | Ca2Co(AsO4)2 · 2H2O |
| Ca | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Ca | ⓘ Schaurteite | Ca3Ge(SO4)2(OH)6 · 4H2O |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| Ca | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| Ca | ⓘ Surite | (Pb,Ca)3(Al,Fe2+,Mg)2((Si,Al)4O10)(CO3)2(OH)2 |
| Ca | ⓘ Talmessite | Ca2Mg(AsO4)2 · 2H2O |
| Ca | ⓘ Aragonite var. Lead-bearing Aragonite | (Ca,Pb)CO3 |
| Ca | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| Ca | ⓘ Tilasite | CaMg(AsO4)F |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Tangeite | CaCu(VO4)(OH) |
| Ca | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| Ca | ⓘ Zincroselite | Ca2Zn(AsO4)2 · 2H2O |
| Ca | ⓘ Calcioandyrobertsite | KCaCu5(AsO4)4(H2AsO4) · 2H2O |
| Ca | ⓘ Lavendulan var. Zinclavendulan | NaCa(Cu,Zn)5(AsO4)4Cl · 5H2O |
| Ca | ⓘ Dolomite var. Zinc-bearing Dolomite | Ca(Mg,Zn)(CO3)2 |
| Ca | ⓘ Lukrahnite | CaCuFe3+(AsO4)2(OH,H2O)2 |
| Ca | ⓘ Sewardite | CaFe23+(AsO4)2(OH)2 |
| Ca | ⓘ Aragonite var. Zinc-bearing Aragonite | (Ca,Zn)CO3 |
| Ca | ⓘ Skorpionite | Ca3Zn2(PO4)2(CO3)(OH)2 · H2O |
| Ca | ⓘ Melilite Group | Ca2M(XSiO7) |
| Ca | ⓘ Hermannroseite | CaCu(PO4)(OH) |
| Ca | ⓘ Betpakdalite-CaMg | [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe33+O36(OH)] |
| Ca | ⓘ Erikapohlite | Cu3(Zn,Cu,Mg)4Ca2(AsO4)6 · 2H2O |
| Ca | ⓘ Halilsarpite | [Mg(H2O)6][CaAs23+(Fe3+2.67Mo6+0.33)(AsO4)2O7] |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| V | Vanadium | |
| V | ⓘ Colusite | Cu13VAs3S16 |
| V | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| V | ⓘ Descloizite | PbZn(VO4)(OH) |
| V | ⓘ Germanocolusite | Cu26V2(Ge,As)6S32 |
| V | ⓘ Mottramite | PbCu(VO4)(OH) |
| V | ⓘ Patrónite | VS4 |
| V | ⓘ Sulvanite | Cu3VS4 |
| V | ⓘ Tangeite | CaCu(VO4)(OH) |
| V | ⓘ Vanadinite | Pb5(VO4)3Cl |
| V | ⓘ Vésigniéite | BaCu3(VO4)2(OH)2 |
| Cr | Chromium | |
| Cr | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Cr | ⓘ Mcconnellite | CuCrO2 |
| Cr | ⓘ Molybdofornacite | Pb2Cu(MoO4,CrO4)(AsO4,PO4)(OH) |
| Mn | Manganese | |
| Mn | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| Mn | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Mn | ⓘ Plumboferrite | Pb[Fe3+10.67Mn2+0.33Pb]O18.33 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Mn | ⓘ Wickmanite | Mn2+[Sn(OH)6] |
| Mn | ⓘ UM1970-16-OH:GeMn | (Mn,Fe)(Ge,Sn)(OH)6 |
| Fe | Iron | |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Fe | ⓘ Arthurite | CuFe23+(AsO4)2(OH)2 · 4H2O |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Bartelkeite | Pb(Fe2+Ge)[Ge2O7](OH)2 · H2O |
| Fe | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Fe | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| Fe | ⓘ Betekhtinite | Pb2(Cu,Fe)22-24S15 |
| Fe | ⓘ Betpakdalite-CaCa | [Ca2(H2O)17Ca(H2O)6][Mo86+As25+Fe33+O36(OH)] |
| Fe | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Briartite | Cu2FeGeS4 |
| Fe | ⓘ Brunogeierite | Ge4+Fe22+O4 |
| Fe | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| Fe | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Delafossite | Cu+Fe3+O2 |
| Fe | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Fahleite | CaZn5Fe23+(AsO4)6 · 14H2O |
| Fe | ⓘ Fayalite | Fe22+(SiO4) |
| Fe | ⓘ Ferberite | FeWO4 |
| Fe | ⓘ Ferrilotharmeyerite | CaZnFe3+(AsO4)2(OH) · H2O |
| Fe | ⓘ Gartrellite | PbCuFe3+(AsO4)2(OH) · H2O |
| Fe | ⓘ Gerdtremmelite | (Zn,Fe)(Al,Fe)2(AsO4)(OH)5 |
| Fe | ⓘ Germanite | Cu13Fe2Ge2S16 |
| Fe | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Idaite | Cu5FeS6 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Jamesite | Pb2Zn(Fe2+,Zn)2Fe43+(AsO4)4(OH)10 |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Jeanbandyite | Fe3+Sn(OH)5O |
| Fe | ⓘ Karibibite | Fe33+(As3+O2)4(As23+O5)(OH) |
| Fe | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| Fe | ⓘ Kirschsteinite | CaFe2+(SiO4) |
| Fe | ⓘ Lepidocrocite | Fe3+O(OH) |
| Fe | ⓘ Ludlockite | PbFe43+As103+O22 |
| Fe | ⓘ Maghemite | (Fe3+0.67◻0.33)Fe23+O4 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Mathewrogersite | Pb7FeAl3GeSi12O36(OH,H2O)6 |
| Fe | ⓘ Mawbyite | PbFe23+(AsO4)2(OH)2 |
| Fe | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Fe | ⓘ Melanotekite | Pb2Fe23+(Si2O7)O2 |
| Fe | ⓘ Ojuelaite | ZnFe23+(AsO4)2(OH)2 · 4H2O |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Plumboferrite | Pb[Fe3+10.67Mn2+0.33Pb]O18.33 |
| Fe | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Renierite | (Cu+,Zn)11Fe4(Ge4+,As5+)2S16 |
| Fe | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Fe | ⓘ Schneiderhöhnite | Fe2+Fe33+As53+O13 |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Fe | ⓘ Stottite | Fe2+[Ge4+(OH)6] |
| Fe | ⓘ Surite | (Pb,Ca)3(Al,Fe2+,Mg)2((Si,Al)4O10)(CO3)2(OH)2 |
| Fe | ⓘ Wüstite | FeO |
| Fe | ⓘ Wurtzite | (Zn,Fe)S |
| Fe | ⓘ Hematite var. Kidney Ore | Fe2O3 |
| Fe | ⓘ Arsenbrackebuschite | Pb2Fe3+(AsO4)2(OH) |
| Fe | ⓘ Ekatite | (Fe3+,Fe2+,Zn)12(AsO3)6(AsO3,HSiO4)2(OH)6 |
| Fe | ⓘ Wilhelmkleinite | ZnFe23+(AsO4)2(OH)2 |
| Fe | ⓘ Fayalite-Forsterite Series | |
| Fe | ⓘ Lukrahnite | CaCuFe3+(AsO4)2(OH,H2O)2 |
| Fe | ⓘ Sewardite | CaFe23+(AsO4)2(OH)2 |
| Fe | ⓘ Siderite var. Zinc-bearing Siderite | (Fe,Zn)CO3 |
| Fe | ⓘ Ovamboite | Cu20(Fe,Cu,Zn)6W2Ge6S32 |
| Fe | ⓘ Eyselite | Fe3+Ge34+O7(OH) |
| Fe | ⓘ Maikainite | Cu20(Fe,Cu)6Mo2Ge6S32 |
| Fe | ⓘ Bendadaite | Fe2+Fe23+(AsO4)2(OH)2 · 4H2O |
| Fe | ⓘ Kintoreite-Segnitite Series | |
| Fe | ⓘ Betpakdalite-CaMg | [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe33+O36(OH)] |
| Fe | ⓘ Zincobriartite | Cu2(Zn,Fe)(Ge,Ga)S4 |
| Fe | ⓘ Mineral GS1 (of Gebhard) | Zn, Fe, As, O, H |
| Fe | ⓘ UM1970-16-OH:GeMn | (Mn,Fe)(Ge,Sn)(OH)6 |
| Fe | ⓘ Halilsarpite | [Mg(H2O)6][CaAs23+(Fe3+2.67Mo6+0.33)(AsO4)2O7] |
| Fe | ⓘ Nancyrossite | FeGeO6H5 |
| Co | Cobalt | |
| Co | ⓘ Carrollite | CuCo2S4 |
| Co | ⓘ Dolomite var. Cobalt-bearing Dolomite | Ca(Mg,Co)(CO3)2 |
| Co | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Co | ⓘ Heterogenite | Co3+O(OH) |
| Co | ⓘ Linnaeite | Co2+Co23+S4 |
| Co | ⓘ Anorthoroselite | Ca2Co(AsO4)2 · 2H2O |
| Co | ⓘ Cobalttsumcorite | PbCo2(AsO4)2 · 2H2O |
| Ni | Nickel | |
| Ni | ⓘ Brindleyite | (Ni,Al)3(Si,Al)2O5(OH)4 |
| Ni | ⓘ Millerite | NiS |
| Cu | Copper | |
| Cu | ⓘ Agardite-(Ce) | CeCu6(AsO4)3(OH)6 · 3H2O |
| Cu | ⓘ Algodonite | (Cu1-xAsx) |
| Cu | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| Cu | ⓘ Arsentsumebite | Pb2Cu(AsO4)(SO4)(OH) |
| Cu | ⓘ Arthurite | CuFe23+(AsO4)2(OH)2 · 4H2O |
| Cu | ⓘ Atacamite | Cu2(OH)3Cl |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| Cu | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Cu | ⓘ Berzelianite | Cu2-xSe (x ≈ 0.12) |
| Cu | ⓘ Betekhtinite | Pb2(Cu,Fe)22-24S15 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Briartite | Cu2FeGeS4 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Cu | ⓘ Carrollite | CuCo2S4 |
| Cu | ⓘ Ceruleite | Cu2Al7(AsO4)4(OH)13 · 11.5H2O |
| Cu | ⓘ Chalconatronite | Na2Cu(CO3)2 · 3H2O |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| Cu | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Cu | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| Cu | ⓘ Colusite | Cu13VAs3S16 |
| Cu | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Cu | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cu | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Adamite var. Copper-bearing Adamite | (Zn,Cu)2AsO4OH |
| Cu | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Delafossite | Cu+Fe3+O2 |
| Cu | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Dioptase | CuSiO3 · H2O |
| Cu | ⓘ Djurleite | Cu31S16 |
| Cu | ⓘ Domeykite | Cu3As |
| Cu | ⓘ Duftite | PbCu(AsO4)(OH) |
| Cu | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| Cu | ⓘ Enargite | Cu3AsS4 |
| Cu | ⓘ Euchroite | Cu2(AsO4)(OH) · 3H2O |
| Cu | ⓘ Famatinite | Cu3SbS4 |
| Cu | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Cu | ⓘ Freedite | Cu+Pb8(AsO3)2O3Cl5 |
| Cu | ⓘ Furutobeite | (Cu,Ag)6PbS4 |
| Cu | ⓘ Gallite | CuGaS2 |
| Cu | ⓘ Gartrellite | PbCuFe3+(AsO4)2(OH) · H2O |
| Cu | ⓘ Geminite | Cu2+(AsO3OH) · H2O |
| Cu | ⓘ Germanite | Cu13Fe2Ge2S16 |
| Cu | ⓘ Germanocolusite | Cu26V2(Ge,As)6S32 |
| Cu | ⓘ Idaite | Cu5FeS6 |
| Cu | ⓘ Johillerite | Na(Mg,Zn)3Cu(AsO4)3 |
| Cu | ⓘ Kësterite | Cu2ZnSnS4 |
| Cu | ⓘ Keyite | Cu32+Zn4Cd2(AsO4)6 · 2H2O |
| Cu | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| Cu | ⓘ Lammerite | Cu3(AsO4)2 |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Cu | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| Cu | ⓘ Libethenite | Cu2(PO4)(OH) |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Lindackerite | CuCu4(AsO4)2(HAsO4)2 · 9H2O |
| Cu | ⓘ Ludjibaite | Cu5(PO4)2(OH)4 |
| Cu | ⓘ Luzonite | Cu3AsS4 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Cu | ⓘ Mcconnellite | CuCrO2 |
| Cu | ⓘ Mckinstryite | Ag5-xCu3+xS4 |
| Cu | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| Cu | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| Cu | ⓘ Molybdofornacite | Pb2Cu(MoO4,CrO4)(AsO4,PO4)(OH) |
| Cu | ⓘ Mottramite | PbCu(VO4)(OH) |
| Cu | ⓘ Olivenite | Cu2(AsO4)(OH) |
| Cu | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| Cu | ⓘ Philipsburgite | Cu5Zn(AsO4)(PO4)(OH)6 · H2O |
| Cu | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| Cu | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| Cu | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| Cu | ⓘ Renierite | (Cu+,Zn)11Fe4(Ge4+,As5+)2S16 |
| Cu | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Cu | ⓘ Roxbyite | Cu58S32 |
| Cu | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| Cu | ⓘ Seligmannite | PbCuAsS3 |
| Cu | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| Cu | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| Cu | ⓘ Spertiniite | Cu(OH)2 |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Cu | ⓘ Stranskiite | Zn2Cu(AsO4)2 |
| Cu | ⓘ Stromeyerite | AgCuS |
| Cu | ⓘ Sulvanite | Cu3VS4 |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Thometzekite | PbCu22+(AsO4)2 · 2H2O |
| Cu | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| Cu | ⓘ Tangeite | CaCu(VO4)(OH) |
| Cu | ⓘ Umangite | Cu3Se2 |
| Cu | ⓘ Vésigniéite | BaCu3(VO4)2(OH)2 |
| Cu | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Olivenite var. Zinc-bearing Olivenite | (Cu,Zn)2(AsO4)(OH) |
| Cu | ⓘ Zincrosasite | (Zn,Cu)2(CO3)(OH)2 |
| Cu | ⓘ Duftite-alpha | PbCu(AsO4)(OH) |
| Cu | ⓘ Andyrobertsite | KCdCu5(AsO4)4(H2AsO4) · 2H2O |
| Cu | ⓘ Calcioandyrobertsite | KCaCu5(AsO4)4(H2AsO4) · 2H2O |
| Cu | ⓘ Niedermayrite | CdCu4(SO4)2(OH)6 · 4H2O |
| Cu | ⓘ Yvonite | Cu(HAsO4) · 2H2O |
| Cu | ⓘ Lavendulan var. Zinclavendulan | NaCa(Cu,Zn)5(AsO4)4Cl · 5H2O |
| Cu | ⓘ Carnevallite | Cu3GaS4 |
| Cu | ⓘ Lukrahnite | CaCuFe3+(AsO4)2(OH,H2O)2 |
| Cu | ⓘ Ovamboite | Cu20(Fe,Cu,Zn)6W2Ge6S32 |
| Cu | ⓘ Maikainite | Cu20(Fe,Cu)6Mo2Ge6S32 |
| Cu | ⓘ Calvertite | Cu5Ge0.5S4 |
| Cu | ⓘ Zincolivenite | CuZn(AsO4)(OH) |
| Cu | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| Cu | ⓘ Cupropearceite | [Cu6As2S7][Ag9CuS4] |
| Cu | ⓘ Cupropolybasite | [Cu6Sb2S7][Ag9CuS4] |
| Cu | ⓘ Edwardsite | Cu3Cd2(SO4)2(OH)6 · 4H2O |
| Cu | ⓘ Hermannroseite | CaCu(PO4)(OH) |
| Cu | ⓘ Yancowinnaite | PbCuAl(AsO4)2OH · H2O |
| Cu | ⓘ Erikapohlite | Cu3(Zn,Cu,Mg)4Ca2(AsO4)6 · 2H2O |
| Cu | ⓘ Zincobriartite | Cu2(Zn,Fe)(Ge,Ga)S4 |
| Cu | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| Cu | ⓘ Lauraniite | Cu6Cd2(SO4)2(OH)12 · 5H2O |
| Cu | ⓘ Richardsite | Zn2CuGaS4 |
| Cu | ⓘ Tennantite-(Cu) | Cu6(Cu4Cu2)As4S12S |
| Zn | Zinc | |
| Zn | ⓘ Adamite | Zn2(AsO4)(OH) |
| Zn | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Austinite | CaZn(AsO4)(OH) |
| Zn | ⓘ Ashoverite | Zn(OH)2 |
| Zn | ⓘ Baileychlore | Zn5Al(AlSi3O10)(OH)8 |
| Zn | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| Zn | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| Zn | ⓘ Adamite var. Copper-bearing Adamite | (Zn,Cu)2AsO4OH |
| Zn | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| Zn | ⓘ Descloizite | PbZn(VO4)(OH) |
| Zn | ⓘ Fahleite | CaZn5Fe23+(AsO4)6 · 14H2O |
| Zn | ⓘ Ferrilotharmeyerite | CaZnFe3+(AsO4)2(OH) · H2O |
| Zn | ⓘ Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| Zn | ⓘ Gahnite | ZnAl2O4 |
| Zn | ⓘ Gaitite | Ca2Zn(AsO4)2 · 2H2O |
| Zn | ⓘ Gerdtremmelite | (Zn,Fe)(Al,Fe)2(AsO4)(OH)5 |
| Zn | ⓘ Gunningite | ZnSO4 · H2O |
| Zn | ⓘ Hardystonite | Ca2Zn[Si2O7] |
| Zn | ⓘ Helmutwinklerite | PbZn2(AsO4)2 · 2H2O |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Jamesite | Pb2Zn(Fe2+,Zn)2Fe43+(AsO4)4(OH)10 |
| Zn | ⓘ Johillerite | Na(Mg,Zn)3Cu(AsO4)3 |
| Zn | ⓘ Kësterite | Cu2ZnSnS4 |
| Zn | ⓘ Keyite | Cu32+Zn4Cd2(AsO4)6 · 2H2O |
| Zn | ⓘ Koritnigite | Zn(AsO3OH) · H2O |
| Zn | ⓘ Köttigite | Zn3(AsO4)2 · 8H2O |
| Zn | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| Zn | ⓘ Larsenite | PbZnSiO4 |
| Zn | ⓘ Legrandite | Zn2(AsO4)(OH) · H2O |
| Zn | ⓘ Leiteite | Zn(As2O4) |
| Zn | ⓘ Minrecordite | CaZn(CO3)2 |
| Zn | ⓘ Namuwite | Zn4(SO4)(OH)6 · 4H2O |
| Zn | ⓘ O'Danielite | Na(Zn,Mg)3(AsO4)(AsO3OH)2 |
| Zn | ⓘ Ojuelaite | ZnFe23+(AsO4)2(OH)2 · 4H2O |
| Zn | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Zn | ⓘ Paradamite | Zn2(AsO4)(OH) |
| Zn | ⓘ Philipsburgite | Cu5Zn(AsO4)(PO4)(OH)6 · H2O |
| Zn | ⓘ Prosperite | Ca2Zn4(AsO4)4 · H2O |
| Zn | ⓘ Queitite | Pb4Zn2(SO4)(SiO4)(Si2O7) |
| Zn | ⓘ Reinerite | Zn3(AsO3)2 |
| Zn | ⓘ Renierite | (Cu+,Zn)11Fe4(Ge4+,As5+)2S16 |
| Zn | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Zn | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| Zn | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Stranskiite | Zn2Cu(AsO4)2 |
| Zn | ⓘ Tsumcorite | PbZn2(AsO4)2 · 2H2O |
| Zn | ⓘ Warikahnite | Zn3(AsO4)2 · 2H2O |
| Zn | ⓘ Willemite | Zn2SiO4 |
| Zn | ⓘ Wurtzite | (Zn,Fe)S |
| Zn | ⓘ Olivenite var. Zinc-bearing Olivenite | (Cu,Zn)2(AsO4)(OH) |
| Zn | ⓘ Zincrosasite | (Zn,Cu)2(CO3)(OH)2 |
| Zn | ⓘ Zincroselite | Ca2Zn(AsO4)2 · 2H2O |
| Zn | ⓘ Feinglosite | Pb2Zn(AsO4)2 · H2O |
| Zn | ⓘ Gordaite | NaZn4(SO4)(OH)6Cl · 6H2O |
| Zn | ⓘ Zincgartrellite | PbZn2(AsO4)2(H2O,OH)2 |
| Zn | ⓘ Ekatite | (Fe3+,Fe2+,Zn)12(AsO3)6(AsO3,HSiO4)2(OH)6 |
| Zn | ⓘ Wilhelmkleinite | ZnFe23+(AsO4)2(OH)2 |
| Zn | ⓘ Lavendulan var. Zinclavendulan | NaCa(Cu,Zn)5(AsO4)4Cl · 5H2O |
| Zn | ⓘ Adamite var. Cobalt-bearing Adamite | Zn2(AsO4)(OH) |
| Zn | ⓘ Dolomite var. Zinc-bearing Dolomite | Ca(Mg,Zn)(CO3)2 |
| Zn | ⓘ Siderite var. Zinc-bearing Siderite | (Fe,Zn)CO3 |
| Zn | ⓘ Ovamboite | Cu20(Fe,Cu,Zn)6W2Ge6S32 |
| Zn | ⓘ Aragonite var. Zinc-bearing Aragonite | (Ca,Zn)CO3 |
| Zn | ⓘ Skorpionite | Ca3Zn2(PO4)2(CO3)(OH)2 · H2O |
| Zn | ⓘ Zincolivenite | CuZn(AsO4)(OH) |
| Zn | ⓘ Arsenohopeite | Zn3(AsO4)2 · 4H2O |
| Zn | ⓘ Davidlloydite | Zn3(AsO4)2 · 4H2O |
| Zn | ⓘ Ianbruceite | Zn2(AsO4)(OH) · 3H2O |
| Zn | ⓘ Erikapohlite | Cu3(Zn,Cu,Mg)4Ca2(AsO4)6 · 2H2O |
| Zn | ⓘ Zincobriartite | Cu2(Zn,Fe)(Ge,Ga)S4 |
| Zn | ⓘ Mineral GS1 (of Gebhard) | Zn, Fe, As, O, H |
| Zn | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| Zn | ⓘ Richardsite | Zn2CuGaS4 |
| Zn | ⓘ Zincostottite | ZnGe(OH)6 |
| Ga | Gallium | |
| Ga | ⓘ Gallite | CuGaS2 |
| Ga | ⓘ Söhngeite | Ga(OH)3 |
| Ga | ⓘ Gallobeudantite | PbGa3(AsO4)(SO4)(OH)6 |
| Ga | ⓘ Carnevallite | Cu3GaS4 |
| Ga | ⓘ Tsumgallite | GaO(OH) |
| Ga | ⓘ Plumbogummite var. Ga-rich plumbogummite | Pb(Al,Ga)3(PO4)(PO3OH)(OH)6 |
| Ga | ⓘ Galloplumbogummite | Pb(Ga,Al,Ge)3(PO4)2(OH)6 |
| Ga | ⓘ Zincobriartite | Cu2(Zn,Fe)(Ge,Ga)S4 |
| Ga | ⓘ Richardsite | Zn2CuGaS4 |
| Ga | ⓘ Karlseifertite | Pb(Ga2Ge)(AsO4)2(OH)6 |
| Ge | Germanium | |
| Ge | ⓘ Argutite | GeO2 |
| Ge | ⓘ Argyrodite | Ag8GeS6 |
| Ge | ⓘ Bartelkeite | Pb(Fe2+Ge)[Ge2O7](OH)2 · H2O |
| Ge | ⓘ Briartite | Cu2FeGeS4 |
| Ge | ⓘ Brunogeierite | Ge4+Fe22+O4 |
| Ge | ⓘ Fleischerite | Pb3Ge(SO4)2(OH)6 · 3H2O |
| Ge | ⓘ Germanite | Cu13Fe2Ge2S16 |
| Ge | ⓘ Germanocolusite | Cu26V2(Ge,As)6S32 |
| Ge | ⓘ Itoite | Pb3Ge4+(SO4)2O2(OH)2 |
| Ge | ⓘ Mathewrogersite | Pb7FeAl3GeSi12O36(OH,H2O)6 |
| Ge | ⓘ Otjisumeite | PbGe4O9 |
| Ge | ⓘ Renierite | (Cu+,Zn)11Fe4(Ge4+,As5+)2S16 |
| Ge | ⓘ Schaurteite | Ca3Ge(SO4)2(OH)6 · 4H2O |
| Ge | ⓘ Stottite | Fe2+[Ge4+(OH)6] |
| Ge | ⓘ Ovamboite | Cu20(Fe,Cu,Zn)6W2Ge6S32 |
| Ge | ⓘ Eyselite | Fe3+Ge34+O7(OH) |
| Ge | ⓘ Krieselite | Al2(GeO4)F2 |
| Ge | ⓘ Maikainite | Cu20(Fe,Cu)6Mo2Ge6S32 |
| Ge | ⓘ Calvertite | Cu5Ge0.5S4 |
| Ge | ⓘ Galloplumbogummite | Pb(Ga,Al,Ge)3(PO4)2(OH)6 |
| Ge | ⓘ Zincobriartite | Cu2(Zn,Fe)(Ge,Ga)S4 |
| Ge | ⓘ UM1970-16-OH:GeMn | (Mn,Fe)(Ge,Sn)(OH)6 |
| Ge | ⓘ Karlseifertite | Pb(Ga2Ge)(AsO4)2(OH)6 |
| Ge | ⓘ Nancyrossite | FeGeO6H5 |
| Ge | ⓘ Zincostottite | ZnGe(OH)6 |
| As | Arsenic | |
| As | ⓘ Adamite | Zn2(AsO4)(OH) |
| As | ⓘ Agardite-(Ce) | CeCu6(AsO4)3(OH)6 · 3H2O |
| As | ⓘ Algodonite | (Cu1-xAsx) |
| As | ⓘ Arsenogoyazite | SrAl3(AsO4)(AsO3OH)(OH)6 |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| As | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| As | ⓘ Arsenocrandallite | CaAl3(AsO4)(AsO3OH)(OH)6 |
| As | ⓘ Arsentsumebite | Pb2Cu(AsO4)(SO4)(OH) |
| As | ⓘ Arthurite | CuFe23+(AsO4)2(OH)2 · 4H2O |
| As | ⓘ Austinite | CaZn(AsO4)(OH) |
| As | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| As | ⓘ Betpakdalite-CaCa | [Ca2(H2O)17Ca(H2O)6][Mo86+As25+Fe33+O36(OH)] |
| As | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| As | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| As | ⓘ Ceruleite | Cu2Al7(AsO4)4(OH)13 · 11.5H2O |
| As | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| As | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| As | ⓘ Chudobaite | Mg5(AsO4)2(AsO3OH)2 · 10H2O |
| As | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| As | ⓘ Claudetite | As2O3 |
| As | ⓘ Colusite | Cu13VAs3S16 |
| As | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| As | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| As | ⓘ Adamite var. Copper-bearing Adamite | (Zn,Cu)2AsO4OH |
| As | ⓘ Domeykite | Cu3As |
| As | ⓘ Duftite | PbCu(AsO4)(OH) |
| As | ⓘ Enargite | Cu3AsS4 |
| As | ⓘ Euchroite | Cu2(AsO4)(OH) · 3H2O |
| As | ⓘ Fahleite | CaZn5Fe23+(AsO4)6 · 14H2O |
| As | ⓘ Ferrilotharmeyerite | CaZnFe3+(AsO4)2(OH) · H2O |
| As | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| As | ⓘ Freedite | Cu+Pb8(AsO3)2O3Cl5 |
| As | ⓘ Gaitite | Ca2Zn(AsO4)2 · 2H2O |
| As | ⓘ Gartrellite | PbCuFe3+(AsO4)2(OH) · H2O |
| As | ⓘ Gebhardite | Pb8(As2O5)2OCl6 |
| As | ⓘ Geminite | Cu2+(AsO3OH) · H2O |
| As | ⓘ Gerdtremmelite | (Zn,Fe)(Al,Fe)2(AsO4)(OH)5 |
| As | ⓘ Germanocolusite | Cu26V2(Ge,As)6S32 |
| As | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| As | ⓘ Gratonite | Pb9As4S15 |
| As | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| As | ⓘ Helmutwinklerite | PbZn2(AsO4)2 · 2H2O |
| As | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| As | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| As | ⓘ Jamesite | Pb2Zn(Fe2+,Zn)2Fe43+(AsO4)4(OH)10 |
| As | ⓘ Johillerite | Na(Mg,Zn)3Cu(AsO4)3 |
| As | ⓘ Karibibite | Fe33+(As3+O2)4(As23+O5)(OH) |
| As | ⓘ Keyite | Cu32+Zn4Cd2(AsO4)6 · 2H2O |
| As | ⓘ Koritnigite | Zn(AsO3OH) · H2O |
| As | ⓘ Köttigite | Zn3(AsO4)2 · 8H2O |
| As | ⓘ Lammerite | Cu3(AsO4)2 |
| As | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| As | ⓘ Legrandite | Zn2(AsO4)(OH) · H2O |
| As | ⓘ Leiteite | Zn(As2O4) |
| As | ⓘ Lindackerite | CuCu4(AsO4)2(HAsO4)2 · 9H2O |
| As | ⓘ Ludlockite | PbFe43+As103+O22 |
| As | ⓘ Luzonite | Cu3AsS4 |
| As | ⓘ Mawbyite | PbFe23+(AsO4)2(OH)2 |
| As | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| As | ⓘ Molybdofornacite | Pb2Cu(MoO4,CrO4)(AsO4,PO4)(OH) |
| As | ⓘ O'Danielite | Na(Zn,Mg)3(AsO4)(AsO3OH)2 |
| As | ⓘ Ojuelaite | ZnFe23+(AsO4)2(OH)2 · 4H2O |
| As | ⓘ Olivenite | Cu2(AsO4)(OH) |
| As | ⓘ Paradamite | Zn2(AsO4)(OH) |
| As | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| As | ⓘ Philipsburgite | Cu5Zn(AsO4)(PO4)(OH)6 · H2O |
| As | ⓘ Prosperite | Ca2Zn4(AsO4)4 · H2O |
| As | ⓘ Realgar | As4S4 |
| As | ⓘ Reinerite | Zn3(AsO3)2 |
| As | ⓘ Renierite | (Cu+,Zn)11Fe4(Ge4+,As5+)2S16 |
| As | ⓘ Anorthoroselite | Ca2Co(AsO4)2 · 2H2O |
| As | ⓘ Schneiderhöhnite | Fe2+Fe33+As53+O13 |
| As | ⓘ Schulténite | Pb(HAsO4) |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| As | ⓘ Seligmannite | PbCuAsS3 |
| As | ⓘ Stranskiite | Zn2Cu(AsO4)2 |
| As | ⓘ Talmessite | Ca2Mg(AsO4)2 · 2H2O |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Thometzekite | PbCu22+(AsO4)2 · 2H2O |
| As | ⓘ Tilasite | CaMg(AsO4)F |
| As | ⓘ Tsumcorite | PbZn2(AsO4)2 · 2H2O |
| As | ⓘ Warikahnite | Zn3(AsO4)2 · 2H2O |
| As | ⓘ Olivenite var. Zinc-bearing Olivenite | (Cu,Zn)2(AsO4)(OH) |
| As | ⓘ Zincroselite | Ca2Zn(AsO4)2 · 2H2O |
| As | ⓘ Duftite-alpha | PbCu(AsO4)(OH) |
| As | ⓘ Andyrobertsite | KCdCu5(AsO4)4(H2AsO4) · 2H2O |
| As | ⓘ Arsenbrackebuschite | Pb2Fe3+(AsO4)2(OH) |
| As | ⓘ Calcioandyrobertsite | KCaCu5(AsO4)4(H2AsO4) · 2H2O |
| As | ⓘ Feinglosite | Pb2Zn(AsO4)2 · H2O |
| As | ⓘ Gallobeudantite | PbGa3(AsO4)(SO4)(OH)6 |
| As | ⓘ Zincgartrellite | PbZn2(AsO4)2(H2O,OH)2 |
| As | ⓘ Ekatite | (Fe3+,Fe2+,Zn)12(AsO3)6(AsO3,HSiO4)2(OH)6 |
| As | ⓘ Cobalttsumcorite | PbCo2(AsO4)2 · 2H2O |
| As | ⓘ Wilhelmkleinite | ZnFe23+(AsO4)2(OH)2 |
| As | ⓘ Yvonite | Cu(HAsO4) · 2H2O |
| As | ⓘ Lavendulan var. Zinclavendulan | NaCa(Cu,Zn)5(AsO4)4Cl · 5H2O |
| As | ⓘ Adamite var. Cobalt-bearing Adamite | Zn2(AsO4)(OH) |
| As | ⓘ Biehlite | ((Sb,As)O)2[MoO4] |
| As | ⓘ Lukrahnite | CaCuFe3+(AsO4)2(OH,H2O)2 |
| As | ⓘ Sewardite | CaFe23+(AsO4)2(OH)2 |
| As | ⓘ Zincolivenite | CuZn(AsO4)(OH) |
| As | ⓘ Bendadaite | Fe2+Fe23+(AsO4)2(OH)2 · 4H2O |
| As | ⓘ Stibioclaudetite | AsSbO3 |
| As | ⓘ Cupropearceite | [Cu6As2S7][Ag9CuS4] |
| As | ⓘ Kintoreite-Segnitite Series | |
| As | ⓘ Yancowinnaite | PbCuAl(AsO4)2OH · H2O |
| As | ⓘ Arsenohopeite | Zn3(AsO4)2 · 4H2O |
| As | ⓘ Betpakdalite-CaMg | [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe33+O36(OH)] |
| As | ⓘ Davidlloydite | Zn3(AsO4)2 · 4H2O |
| As | ⓘ Ianbruceite | Zn2(AsO4)(OH) · 3H2O |
| As | ⓘ Vanackerite | Pb4Cd(AsO4)3Cl |
| As | ⓘ Erikapohlite | Cu3(Zn,Cu,Mg)4Ca2(AsO4)6 · 2H2O |
| As | ⓘ Mineral GS1 (of Gebhard) | Zn, Fe, As, O, H |
| As | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| As | ⓘ Halilsarpite | [Mg(H2O)6][CaAs23+(Fe3+2.67Mo6+0.33)(AsO4)2O7] |
| As | ⓘ Tennantite-(Cu) | Cu6(Cu4Cu2)As4S12S |
| As | ⓘ Karlseifertite | Pb(Ga2Ge)(AsO4)2(OH)6 |
| Se | Selenium | |
| Se | ⓘ Berzelianite | Cu2-xSe (x ≈ 0.12) |
| Se | ⓘ Clausthalite | PbSe |
| Se | ⓘ Naumannite | Ag2Se |
| Se | ⓘ Olsacherite | Pb2(Se6+O4)(SO4) |
| Se | ⓘ Umangite | Cu3Se2 |
| Se | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| Se | ⓘ Plumboselite | Pb3O2(SeO3) |
| Br | Bromine | |
| Br | ⓘ Perroudite | Hg5Ag4S5(I,Br)2Cl2 |
| Sr | Strontium | |
| Sr | ⓘ Arsenogoyazite | SrAl3(AsO4)(AsO3OH)(OH)6 |
| Sr | ⓘ Celestine | SrSO4 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Betpakdalite-CaCa | [Ca2(H2O)17Ca(H2O)6][Mo86+As25+Fe33+O36(OH)] |
| Mo | ⓘ Molybdofornacite | Pb2Cu(MoO4,CrO4)(AsO4,PO4)(OH) |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Parkinsonite | Pb7MoO9Cl2 |
| Mo | ⓘ Powellite | Ca(MoO4) |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Mo | ⓘ Biehlite | ((Sb,As)O)2[MoO4] |
| Mo | ⓘ Wulfenite var. Chillagite | Pb[(Mo,W)O4] |
| Mo | ⓘ Maikainite | Cu20(Fe,Cu)6Mo2Ge6S32 |
| Mo | ⓘ Betpakdalite-CaMg | [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe33+O36(OH)] |
| Mo | ⓘ Halilsarpite | [Mg(H2O)6][CaAs23+(Fe3+2.67Mo6+0.33)(AsO4)2O7] |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Native Silver var. Amalgam | (Ag,Hg) |
| Ag | ⓘ Argyrodite | Ag8GeS6 |
| Ag | ⓘ Chlorargyrite | AgCl |
| Ag | ⓘ Dyscrasite | Ag3Sb |
| Ag | ⓘ Eugenite | Ag11Hg2 |
| Ag | ⓘ Furutobeite | (Cu,Ag)6PbS4 |
| Ag | ⓘ Iodargyrite | AgI |
| Ag | ⓘ Mckinstryite | Ag5-xCu3+xS4 |
| Ag | ⓘ Naumannite | Ag2Se |
| Ag | ⓘ Perroudite | Hg5Ag4S5(I,Br)2Cl2 |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Stromeyerite | AgCuS |
| Ag | ⓘ Cupropearceite | [Cu6As2S7][Ag9CuS4] |
| Ag | ⓘ Cupropolybasite | [Cu6Sb2S7][Ag9CuS4] |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| Cd | ⓘ Keyite | Cu32+Zn4Cd2(AsO4)6 · 2H2O |
| Cd | ⓘ Otavite | CdCO3 |
| Cd | ⓘ Andyrobertsite | KCdCu5(AsO4)4(H2AsO4) · 2H2O |
| Cd | ⓘ Niedermayrite | CdCu4(SO4)2(OH)6 · 4H2O |
| Cd | ⓘ Edwardsite | Cu3Cd2(SO4)2(OH)6 · 4H2O |
| Cd | ⓘ Vanackerite | Pb4Cd(AsO4)3Cl |
| Cd | ⓘ Lazaridisite | Cd3(SO4)3 · 8H2O |
| Cd | ⓘ Lauraniite | Cu6Cd2(SO4)2(OH)12 · 5H2O |
| Cd | ⓘ Cadsulfohite | Cd2(SO4)(OH)2 |
| In | Indium | |
| In | ⓘ Dzhalindite | In(OH)3 |
| Sn | Tin | |
| Sn | ⓘ Jeanbandyite | Fe3+Sn(OH)5O |
| Sn | ⓘ Kësterite | Cu2ZnSnS4 |
| Sn | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sn | ⓘ Wickmanite | Mn2+[Sn(OH)6] |
| Sn | ⓘ UM1970-16-OH:GeMn | (Mn,Fe)(Ge,Sn)(OH)6 |
| Sb | Antimony | |
| Sb | ⓘ Native Antimony | Sb |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Dyscrasite | Ag3Sb |
| Sb | ⓘ Famatinite | Cu3SbS4 |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Nadorite | PbSbClO2 |
| Sb | ⓘ Senarmontite | Sb2O3 |
| Sb | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Biehlite | ((Sb,As)O)2[MoO4] |
| Sb | ⓘ Stibioclaudetite | AsSbO3 |
| Sb | ⓘ Cupropolybasite | [Cu6Sb2S7][Ag9CuS4] |
| Sb | ⓘ Oxyplumboroméite | Pb2Sb2O6O |
| I | Iodine | |
| I | ⓘ Iodargyrite | AgI |
| I | ⓘ Perroudite | Hg5Ag4S5(I,Br)2Cl2 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Ba | ⓘ Vésigniéite | BaCu3(VO4)2(OH)2 |
| Ba | ⓘ Witherite | BaCO3 |
| Ce | Cerium | |
| Ce | ⓘ Agardite-(Ce) | CeCu6(AsO4)3(OH)6 · 3H2O |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| W | Tungsten | |
| W | ⓘ Ferberite | FeWO4 |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Stolzite | Pb(WO4) |
| W | ⓘ Tungstenite | WS2 |
| W | ⓘ Wulfenite var. Chillagite | Pb[(Mo,W)O4] |
| W | ⓘ Ovamboite | Cu20(Fe,Cu,Zn)6W2Ge6S32 |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Hg | Mercury | |
| Hg | ⓘ Native Silver var. Amalgam | (Ag,Hg) |
| Hg | ⓘ Cinnabar | HgS |
| Hg | ⓘ Eugenite | Ag11Hg2 |
| Hg | ⓘ Metacinnabar | HgS |
| Hg | ⓘ Perroudite | Hg5Ag4S5(I,Br)2Cl2 |
| Pb | Lead | |
| Pb | ⓘ Alamosite | PbSiO3 |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| Pb | ⓘ Arsentsumebite | Pb2Cu(AsO4)(SO4)(OH) |
| Pb | ⓘ Bartelkeite | Pb(Fe2+Ge)[Ge2O7](OH)2 · H2O |
| Pb | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| Pb | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Pb | ⓘ Betekhtinite | Pb2(Cu,Fe)22-24S15 |
| Pb | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Pb | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Clausthalite | PbSe |
| Pb | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| Pb | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Pb | ⓘ Cotunnite | PbCl2 |
| Pb | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| Pb | ⓘ Descloizite | PbZn(VO4)(OH) |
| Pb | ⓘ Duftite | PbCu(AsO4)(OH) |
| Pb | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| Pb | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| Pb | ⓘ Fleischerite | Pb3Ge(SO4)2(OH)6 · 3H2O |
| Pb | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Pb | ⓘ Freedite | Cu+Pb8(AsO3)2O3Cl5 |
| Pb | ⓘ Furutobeite | (Cu,Ag)6PbS4 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Gartrellite | PbCuFe3+(AsO4)2(OH) · H2O |
| Pb | ⓘ Gebhardite | Pb8(As2O5)2OCl6 |
| Pb | ⓘ Gratonite | Pb9As4S15 |
| Pb | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| Pb | ⓘ Helmutwinklerite | PbZn2(AsO4)2 · 2H2O |
| Pb | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| Pb | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| Pb | ⓘ Itoite | Pb3Ge4+(SO4)2O2(OH)2 |
| Pb | ⓘ Jamesite | Pb2Zn(Fe2+,Zn)2Fe43+(AsO4)4(OH)10 |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| Pb | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| Pb | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| Pb | ⓘ Lanarkite | Pb2(SO4)O |
| Pb | ⓘ Larsenite | PbZnSiO4 |
| Pb | ⓘ Native Lead | Pb |
| Pb | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Ludlockite | PbFe43+As103+O22 |
| Pb | ⓘ Litharge | PbO |
| Pb | ⓘ Macphersonite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Massicot | PbO |
| Pb | ⓘ Mathewrogersite | Pb7FeAl3GeSi12O36(OH,H2O)6 |
| Pb | ⓘ Matlockite | PbFCl |
| Pb | ⓘ Mawbyite | PbFe23+(AsO4)2(OH)2 |
| Pb | ⓘ Melanotekite | Pb2Fe23+(Si2O7)O2 |
| Pb | ⓘ Mendipite | Pb3Cl2O2 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Minium | Pb3O4 |
| Pb | ⓘ Molybdofornacite | Pb2Cu(MoO4,CrO4)(AsO4,PO4)(OH) |
| Pb | ⓘ Mottramite | PbCu(VO4)(OH) |
| Pb | ⓘ Nadorite | PbSbClO2 |
| Pb | ⓘ Olsacherite | Pb2(Se6+O4)(SO4) |
| Pb | ⓘ Otjisumeite | PbGe4O9 |
| Pb | ⓘ Parkinsonite | Pb7MoO9Cl2 |
| Pb | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| Pb | ⓘ Phosgenite | Pb2CO3Cl2 |
| Pb | ⓘ Plumbotsumite | Pb13(CO3)6(Si10O27) · 3H2O |
| Pb | ⓘ Plattnerite | PbO2 |
| Pb | ⓘ Plumboferrite | Pb[Fe3+10.67Mn2+0.33Pb]O18.33 |
| Pb | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Pb | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Queitite | Pb4Zn2(SO4)(SiO4)(Si2O7) |
| Pb | ⓘ Schulténite | Pb(HAsO4) |
| Pb | ⓘ Scotlandite | PbSO3 |
| Pb | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| Pb | ⓘ Seligmannite | PbCuAsS3 |
| Pb | ⓘ Stolzite | Pb(WO4) |
| Pb | ⓘ Surite | (Pb,Ca)3(Al,Fe2+,Mg)2((Si,Al)4O10)(CO3)2(OH)2 |
| Pb | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Aragonite var. Lead-bearing Aragonite | (Ca,Pb)CO3 |
| Pb | ⓘ Thometzekite | PbCu22+(AsO4)2 · 2H2O |
| Pb | ⓘ Tsumcorite | PbZn2(AsO4)2 · 2H2O |
| Pb | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| Pb | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Duftite-alpha | PbCu(AsO4)(OH) |
| Pb | ⓘ Arsenbrackebuschite | Pb2Fe3+(AsO4)2(OH) |
| Pb | ⓘ Feinglosite | Pb2Zn(AsO4)2 · H2O |
| Pb | ⓘ Gallobeudantite | PbGa3(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Zincgartrellite | PbZn2(AsO4)2(H2O,OH)2 |
| Pb | ⓘ Cobalttsumcorite | PbCo2(AsO4)2 · 2H2O |
| Pb | ⓘ Sidpietersite | Pb42+(S2O3)O2(OH)2 |
| Pb | ⓘ Wulfenite var. Chillagite | Pb[(Mo,W)O4] |
| Pb | ⓘ Hydroxylpyromorphite | Pb5(PO4)3(OH) |
| Pb | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| Pb | ⓘ Kintoreite-Segnitite Series | |
| Pb | ⓘ Plumbogummite var. Ga-rich plumbogummite | Pb(Al,Ga)3(PO4)(PO3OH)(OH)6 |
| Pb | ⓘ Plumboselite | Pb3O2(SeO3) |
| Pb | ⓘ Yancowinnaite | PbCuAl(AsO4)2OH · H2O |
| Pb | ⓘ Vanackerite | Pb4Cd(AsO4)3Cl |
| Pb | ⓘ Galloplumbogummite | Pb(Ga,Al,Ge)3(PO4)2(OH)6 |
| Pb | ⓘ Oxyplumboroméite | Pb2Sb2O6O |
| Pb | ⓘ Abellaite | NaPb2(CO3)2(OH) |
| Pb | ⓘ Lead-bearing Feldspar | (K,Pb)-(Al,Si)-O |
| Pb | ⓘ Karlseifertite | Pb(Ga2Ge)(AsO4)2(OH)6 |
| Bi | Bismuth | |
| Bi | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| U | Uranium | |
| U | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| U | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Oshikoto_Region |
|---|---|
| Wikidata ID: | Q876512 |
| GeoNames ID: | 3371208 |
Localities in this Region
Other Regions, Features and Areas that Intersect
AfricaContinent
African PlateTectonic Plate
- Angola Interior basinBasin
- Congo Craton
- Angolan ShieldShield
- Kamanjab InlierShield
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions
Oshikoto Region, Namibia