Bisbee, Cochise County, Arizona, USAi
| Regional Level Types | |
|---|---|
| Bisbee | City |
| Cochise County | County |
| Arizona | State |
| USA | Country |
This page kindly sponsored by Alex Homenuke
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Bisbee | 5,208 (2017) |
Museums in region:
Other Languages:
French:
Bisbee, Comté de Cochise, Arizona, États-Unis
German:
Bisbee, Cochise County, Arizona, Vereinigte Staaten
Italian:
Bisbee, Contea di Cochise, Arizona, Stati Uniti d'America
Russian:
Бисби, Кочис, Аризона, Соединённые Штаты Америки
Simplified Chinese:
比斯比, 科奇斯縣, 亞利桑那州, 美国
Spanish:
Bisbee, Condado de Cochise, Arizona, Estados Unidos
Amharic:
ቢስቢ፥ አሪዞና, ኮቻይስ ካውንቲ፥ አሪዞና, አሪዞና, አሜሪካ
Arabic:
بيسبي, مقاطعة كوتشايز, أريزونا, الولايات المتحدة
Basque:
Bisbee , Cochise konderria, Arizona
Bulgarian:
Бисби, Кочис, Аризона, Съединени американски щати
Catalan:
Bisbee, Arizona, Estats Units d’Amèrica
Cebuano:
Bisbee, Cochise County, Arizona (estado)
Croatian:
Bisbee, Cochise, Arizona, Sjedinjene Američke Države
Dutch:
Bisbee, Cochise County, Arizona (staat), Verenigde Staten
Farsi/Persian:
بیسبی، آریزونا, شهرستان کوچیز، آریزونا, آریزونا, ایالات متحده آمریکا
Haitian:
Bisbee, Arizona, Etazini
Hebrew:
ביסבי, אריזונה, ארצות הברית
Hungarian:
Bisbee, Cochise megye, Arizona, Amerikai Egyesült Államok
Ido:
Bisbee, Arizona, Usa
Japanese:
ビスビー , コチセ郡, アリゾナ州, アメリカ合衆国
Korean:
비즈비, 애리조나주, 미국
Malagasy:
Bisbee, Arizona, Etazonia
Minnan / Hokkien-Taiwanese:
Bisbee
Nauruan:
Bisbee, Arizona, Eben Merika
Newar / Nepal Bhasa:
बिस्बी, एरिजोना, संयुक्त राज्य अमेरिका
Occitan:
Bisbee, Arizòna, Estats Units d'America
Polish:
Bisbee, Hrabstwo Cochise, Arizona, Stany Zjednoczone
Portuguese:
Bisbee, Condado de Cochise, Arizona, Estados Unidos
Romanian:
Bisbee, Comitatul Cochise, Arizona, Statele Unite ale Americii
Serbian:
Бизби, Округ Кочиз, Аризона, Сједињене Америчке Државе
Serbo-Croatian:
Bisbee, Cochise County, Arizona, Sjedinjene Američke Države
Slovenian:
Bisbee, Arizona, Združene države Amerike
Swedish:
Bisbee, Cochise County, Arizona, USA
Turkish:
Bisbee, Cochise Kontluğu, Arizona, Amerika Birleşik Devletleri
Ukrainian:
Бісбі, Кочіс, Аризона, Сполучені Штати Америки
Uzbek (Latin Script):
Bisbee, Arizona, Amerika Qoʻshma Shtatlari
Volapük:
Bisbee, Arizona, Lamerikän
Waray:
Bisbee, Condado han Cochise, Arizona, Estados Unidos
A town founded as a copper, gold, and silver mining town in 1880 and named after Judge Dewitt Bisbee, a financial backer of the area's Copper Queen Mine, the largest claim at the time. Famous copper mining district. The old town was bisected by the Lavender open pit mine and highway 80 runs between the sections, alongside the pit. Old town Bisbee is now a tourist attraction and arts community. The Copper Queen Hotel in the old town is reputedly a haunted building.
New Bisbee is a more recent development S of the old town along highway 92 and the Mexican border. It is the home of the county seat offices.
A selection of classic Bisbee minerals was one of the many displays at the Tucson Gem and Mineral Show 2008.
New Bisbee is a more recent development S of the old town along highway 92 and the Mexican border. It is the home of the county seat offices.
A selection of classic Bisbee minerals was one of the many displays at the Tucson Gem and Mineral Show 2008.
Onac (2025) mentions chalcophanite, cuprite, plattnerite, tenorite, bromargyrite, azurite, malachite, rosasite, chalcanthite, mimetite, and shattuckite to occur in "Bisbee mine caves".
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities296 valid minerals. 7 (TL) - type locality of valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S |
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 References: |
| ⓘ Aikinite Formula: CuPbBiS3 |
| ⓘ Alabandite Formula: MnS |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ Allophane Formula: (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ Altaite Formula: PbTe |
| ⓘ Alunite Formula: KAl3(SO4)2(OH)6 |
| ⓘ Anatase Formula: TiO2 |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 |
| ⓘ Anglesite Formula: PbSO4 Localities: Reported from at least 18 localities in this region. |
| ⓘ Anhydrite Formula: CaSO4 |
| ⓘ Anorthite Formula: Ca(Al2Si2O8) |
| ⓘ Anorthite var. Labradorite Formula: (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ Anthonyite Formula: Cu(OH,Cl)2 · 3H2O Habit: Corroded crystals to 5mm or more Colour: Vivid violet Description: Occurs on the 1300 level. |
| ⓘ Antigorite Formula: Mg3(Si2O5)(OH)4 |
| ⓘ Antlerite Formula: Cu3(SO4)(OH)4 Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Aragonite var. Flos Ferri Formula: CaCO3 Description: Magnificent coralloidal groups of flos ferri in limestone caverns. |
| ⓘ Atacamite Formula: Cu2(OH)3Cl |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 Localities: Reported from at least 6 localities in this region. |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 Localities: Reported from at least 14 localities in this region. Description: Plate 5 from Wilson, Wendell. E.; Bartsch, Joel A.; Mauthner, Mark (2004) Masterpieces of the Mineral World. Houston Museum of Natural Science. [https://www.mindat.org/reference.php?id=18945017] |
| ⓘ Barlowite Formula: Cu4BrF(OH)6 |
| ⓘ Baryte Formula: BaSO4 Localities: Reported from at least 11 localities in this region. Description: Nests in psilomelane. |
| ⓘ Bayldonite Formula: PbCu3(AsO4)2(OH)2 |
| ⓘ Bayleyite Formula: Mg2(UO2)(CO3)3 · 18H2O |
| ⓘ Beaverite-(Cu) Formula: Pb(Fe3+2Cu)(SO4)2(OH)6 |
| ⓘ Beudantite Formula: PbFe3+3(AsO4)(SO4)(OH)6 Localities: Description: Abundant. |
| ⓘ Bílinite Formula: Fe2+Fe3+2(SO4)4 · 22H2O |
| ⓘ Bianchite Formula: Zn(H2O)6(SO4) |
| ⓘ Bindheimite Formula: Pb2Sb2O6O |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ 'Bisbeeite' Formula: (Cu,Mg)SiO3 · nH2O Colour: Blue Description: Occurs as pseudomorphs after shattuckite, which, in turn, is pseudomorphous after malachite. |
| ⓘ Bismite Formula: Bi2O3 |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ Bismutite Formula: (BiO)2CO3 |
| ⓘ Bixbyite-(Mn) Formula: Mn3+2O3 |
| ⓘ Bogdanovite Formula: (Au,Te,Pb)3(Cu,Fe) |
| ⓘ Boothite Formula: Cu2+(H2O)6(SO4) · H2O Habit: As cm-wide clusters of radiating acicular crystals Colour: Light blue Description: Also as small granular masses composed of 1 to 2 mm crystals. |
| ⓘ Bornite Formula: Cu5FeS4 Localities: Reported from at least 31 localities in this region. |
| ⓘ Botallackite Formula: Cu2(OH)3Cl |
| ⓘ Botryogen Formula: MgFe3+(SO4)2(OH) · 7H2O |
| ⓘ Böhmite Formula: AlO(OH) |
| ⓘ Braunite Formula: Mn2+Mn3+6(SiO4)O8 |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 Localities: Reported from at least 10 localities in this region. |
| ⓘ Bromargyrite Formula: AgBr |
| ⓘ Brookite Formula: TiO2 |
| ⓘ Brucite Formula: Mg(OH)2 |
| ⓘ Buttgenbachite Formula: Cu19(NO3)2(OH)32Cl4 · 2H2O |
| ⓘ Calaverite Formula: AuTe2 |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 21 localities in this region. |
| ⓘ 'Campbellite' References: |
| ⓘ Canfieldite Formula: Ag8SnS6 |
| ⓘ Carbonatecyanotrichite Formula: Cu4Al2(CO3,SO4)(OH)12 · 2H2O Localities: Description: Occurs as fibrous, radiating needles in tiny spherules on silicified shaly limestones. |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Celadonite Formula: K(MgFe3+◻)(Si4O10)(OH)2 |
| ⓘ Cerussite Formula: PbCO3 Localities: Reported from at least 7 localities in this region. |
| ⓘ Cesàrolite Formula: PbMn4+3O6(OH)2 |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O |
| ⓘ Chalcoalumite (TL) Formula: CuAl4(SO4)(OH)12 · 3H2O Localities: Reported from at least 6 localities in this region. |
| ⓘ Chalcocite Formula: Cu2S Localities: Reported from at least 32 localities in this region. |
| ⓘ Chalcophanite Formula: ZnMn4+3O7 · 3H2O |
| ⓘ Chalcophyllite Formula: Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 28 localities in this region. |
| ⓘ Chalcosiderite Formula: CuFe3+6(PO4)4(OH)8 · 4H2O |
| ⓘ Chalcostibite Formula: CuSbS2 |
| ⓘ Chamosite Formula: Fe2+5Al(AlSi3O10)(OH)8 |
| ⓘ Chlorargyrite Formula: AgCl |
| ⓘ Chlorargyrite var. Bromine-bearing Chlorargyrite Formula: Ag(Cl,Br) |
| ⓘ 'Chlorite Group' Localities: Habit: Isolated radial sprays; prisms to 1 cm long Description: Occurs cutting an equigranular tonalite. |
| ⓘ 'Chlorite Group var. Delessite' Formula: (Mg,Fe,Fe,Al)(Si,Al)4O10(O,OH)8 |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 Localities: Reported from at least 10 localities in this region. |
| ⓘ Chrysotile Formula: Mg3(Si2O5)(OH)4 |
| ⓘ Cinnabar Formula: HgS |
| ⓘ Claringbullite Formula: Cu4ClF(OH)6 Localities: Habit: Crystals to 6 mm |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 Localities: Description: As a matrix in breccia dikes. |
| ⓘ 'Clinochrysotile' Formula: Mg3(Si2O5)(OH)4 Localities: Description: Scaly, micaceous intergrowths with stevensite. |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Colusite Formula: Cu13VAs3S16 |
| ⓘ Conichalcite Formula: CaCu(AsO4)(OH) Localities: |
| ⓘ Connellite Formula: Cu19(SO4)(OH)32Cl4 · 3H2O Localities: Reported from at least 8 localities in this region. Habit: Acicular Description: Ocurs as crystals in cuprite with paratacamite. |
| ⓘ Copiapite Formula: Fe2+Fe3+4(SO4)6(OH)2 · 20H2O Localities: Tunnel level, Higgins Mine, Bisbee, Cochise County, Arizona, USA Copper Queen Mine, Queen Hill, Bisbee, Cochise County, Arizona, USA Campbell Mine, Bisbee, Cochise County, Arizona, USA Junction Mine, Calumet and Arizona group of claims, Bisbee, Cochise County, Arizona, USA Southwest Mine, Hendricks Gulch, Bisbee, Cochise County, Arizona, USA Description: Occurs as a post-mining product. |
| ⓘ Coquimbite Formula: AlFe3(SO4)6(H2O)12 · 6H2O |
| ⓘ Coronadite Formula: Pb(Mn4+6Mn3+2)O16 |
| ⓘ Cosalite Formula: Pb2Bi2S5 |
| ⓘ Covellite Formula: CuS Localities: Reported from at least 7 localities in this region. |
| ⓘ Crednerite Formula: Cu+Mn3+O2 |
| ⓘ Cryptomelane Formula: K(Mn4+7Mn3+)O16 |
| ⓘ Cuprite Formula: Cu2O Localities: Reported from at least 16 localities in this region. Habit: Modified cubic crystals to 5 cm Description: Transparent crystals. |
| ⓘ Cuprite var. Chalcotrichite Formula: Cu2O |
| ⓘ Cuprocopiapite Formula: Cu2+Fe3+4(SO4)6(OH)2 · 20H2O Description: Occurs on the 1800 level as a post-mining mineral. |
| ⓘ Cupropavonite Formula: Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| ⓘ Cyanotrichite Formula: Cu4Al2(SO4)(OH)12 · 2H2O |
| ⓘ Delafossite Formula: Cu+Fe3+O2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Descloizite Formula: PbZn(VO4)(OH) Localities: Description: Small stalactites several cm long to about 8 mm across at the bases. |
| ⓘ Descloizite var. Copper-bearing Descloizite Formula: Pb(Zn,Cu)VO4OH Localities: Description: Small stalactites several cm long to about 8 mm across at the bases. |
| ⓘ Devilline Formula: CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ Diaspore Formula: AlO(OH) |
| ⓘ Dickite Formula: Al2(Si2O5)(OH)4 Colour: White Description: Dense, earthy material cementing massive pyrite. |
| ⓘ Digenite Formula: Cu9S5 |
| ⓘ Diopside Formula: CaMgSi2O6 Description: Grains in unoxidized pyritic ores. References: |
| ⓘ Dioptase Formula: CuSiO3 · H2O |
| ⓘ Djurleite Formula: Cu31S16 |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Dyscrasite Formula: Ag3Sb |
| ⓘ Eddavidite (TL) Formula: Cu12Pb2O15Br2 Localities: |
| ⓘ Edenite Formula: NaCa2Mg5(Si7Al)O22(OH)2 Habit: Fibrous Colour: White to gray |
| ⓘ Emplectite Formula: CuBiS2 |
| ⓘ Enargite Formula: Cu3AsS4 |
| ⓘ Enstatite Formula: Mg2Si2O6 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Epsomite Formula: MgSO4 · 7H2O |
| ⓘ Eugenite Formula: Ag11Hg2 |
| ⓘ Famatinite Formula: Cu3SbS4 |
| ⓘ 'Fayalite-Forsterite Series' |
| ⓘ Felsőbányaite Formula: Al4(SO4)(OH)10 · 4H2O Localities: Colour: White Description: Earthy masses with other aluminum sulphates encrusting silicified limestones and as micro-crystals. |
| ⓘ Ferricopiapite Formula: Fe3+0.67Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ Ferrimolybdite Formula: Fe2(MoO4)3 · nH2O |
| ⓘ Fibroferrite Formula: Fe3+(SO4)(OH) · 5H2O |
| ⓘ Fluorite Formula: CaF2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Fornacite Formula: Pb2Cu(CrO4)(AsO4)(OH) |
| ⓘ 'Freibergite Subgroup' Formula: (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ Furutobeite Formula: (Cu,Ag)6PbS4 |
| ⓘ Galena Formula: PbS Localities: Reported from at least 9 localities in this region. |
| ⓘ Galena var. Silver-bearing Galena Formula: PbS with Ag References: |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Gibbsite Formula: Al(OH)3 |
| ⓘ Goethite Formula: Fe3+O(OH) Localities: Reported from at least 11 localities in this region. |
| ⓘ Goldfieldite Formula: (Cu4◻2)(Cu4Cu+2)Te4S12S |
| ⓘ Gormanite Formula: (Fe2+,Mg)3(Al,Fe3+)4(PO4)4(OH)6 · 2H2O Habit: Rosette aggregates Colour: Dark green Description: In drill core as rosettes in open fractures. References: |
| ⓘ Graemite (TL) Formula: Cu[TeO3] · H2O Localities: Type Locality: Cole Mine, Bisbee, Cochise County, Arizona, USA Description: Occurs on the 1200 level on and replacing teineite embedded in malachite. |
| ⓘ Graphite Formula: C |
| ⓘ Greenockite Formula: CdS |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 Habit: Rounded Description: Rounded crystals in unoxidized pyritic ores. References: |
| ⓘ Groutite Formula: Mn3+O(OH) Habit: Tiny Colour: Dark brownish-black Description: Coats sooty manganese oxides. |
| ⓘ Gunningite Formula: ZnSO4 · H2O |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: Reported from at least 6 localities in this region. |
| ⓘ Gypsum var. Selenite Formula: CaSO4 · 2H2O |
| ⓘ Halloysite Formula: Al2Si2O5(OH)4 · n(H2O) Localities: Description: Occurs in small quantities. |
| ⓘ Halotrichite Formula: Fe2+Al2(SO4)4 · 22H2O |
| ⓘ Hausmannite Formula: Mn2+Mn3+2O4 Localities: Description: Replacing limestone that contains braunite. |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 14 localities in this region. |
| ⓘ Hematite var. Specularite Formula: Fe2O3 |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O |
| ⓘ Henryite (TL) Formula: (Cu,Ag)3+xTe2 , with x ~ 0.40 Type Locality: Campbell Mine, Bisbee, Cochise County, Arizona, USA Description: Very sparingly in sulfide ores. |
| ⓘ Hessite Formula: Ag2Te |
| ⓘ Hetaerolite Formula: ZnMn2O4 Localities: Description: Occurs as splendent, botryoidal & stalactitic masses & coatings. |
| ⓘ Hetaerolite var. Hydrohetaerolite Formula: Zn(Mn,◻)2(O,OH)4 |
| ⓘ Hexahydrite Formula: Mg(H2O)6(SO4) |
| ⓘ Hisingerite Formula: Fe3+2(Si2O5)(OH)4 · 2H2O |
| ⓘ Hocartite Formula: Ag2(Fe2+,Zn)SnS4 |
| ⓘ Hodrušite Formula: Cu8Bi12S22 Habit: Laths to 0.5 mm Colour: Steel-gray Description: Occurs in sulfide ores. |
| ⓘ Hoganite Formula: Cu(CH3COO)2 · H2O |
| ⓘ Hübnerite Formula: MnWO4 |
| ⓘ Hydrobasaluminite Formula: Al4(SO4)(OH)10 · 12-36H2O |
| ⓘ Hydrocerussite Formula: Pb3(CO3)2(OH)2 Localities: Description: Occurs as a coating on cerussite in a quartz-galena vein. |
| ⓘ 'Hydrohalloysite' Formula: Al2Si2O5(OH)4 · 2H2O Description: A product of hydrothermal alteration. |
| ⓘ Hydrokenoralstonite Formula: Na0.5(Al,Mg)2(F,OH)6 · H2O Localities: Description: One specimen found by R. Graeme in a void associated with paratacamite. |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 |
| ⓘ Ilsemannite Formula: Mo3O8 · nH2O |
| ⓘ Iodargyrite Formula: AgI |
| ⓘ 'Iridescent coating' References: |
| ⓘ Jacobsite Formula: Mn2+Fe3+2O4 Description: Occurs as 5 mm blebs in cryptomelane. |
| ⓘ Jalpaite Formula: Ag3CuS2 |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Johannite Formula: Cu(UO2)2(SO4)2(OH)2 · 8H2O Description: Occurs as a post-mining efflorescence. |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 Localities: Reported from at least 6 localities in this region. |
| ⓘ Kettnerite Formula: CaBiCO3OF |
| ⓘ Kësterite Formula: Cu2ZnSnS4 |
| ⓘ Kiddcreekite (TL) Formula: Cu6SnWS8 Localities: Type Locality: Campbell Mine, Bisbee, Cochise County, Arizona, USA Description: Occurs as minute grains in sulfide orebodies. |
| ⓘ Kornelite Formula: Fe2(SO4)3 · 7H2O |
| ⓘ Kostovite Formula: CuAuTe4 |
| ⓘ Krennerite Formula: Au3AgTe8 |
| ⓘ Krupkaite Formula: CuPbBi3S6 |
| ⓘ Ktenasite Formula: ZnCu4(SO4)2(OH)6 · 6H2O |
| ⓘ Kuramite Formula: Cu3SnS4 |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O |
| ⓘ Leadhillite Formula: Pb4(CO3)2(SO4)(OH)2 |
| ⓘ Lepidocrocite Formula: Fe3+O(OH) |
| ⓘ Lime Formula: CaO Description: [NOT A NATURAL MINERAL; Created when limestone in a shaft wall was calcined in an underground fire.] |
| ⓘ 'Limonite' Localities: Reported from at least 25 localities in this region. |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 |
| ⓘ Liroconite Formula: Cu2Al(AsO4)(OH)4 · 4H2O |
| ⓘ Luzonite Formula: Cu3AsS4 Localities: Description: Occurs as massive, fine-grained material. |
| ⓘ Magnesite Formula: MgCO3 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 21 localities in this region. Habit: Botryoidal/mammillary masses. |
| ⓘ 'Manganese Oxides' |
| ⓘ 'Manganese Oxides var. Manganese Dendrites' References: |
| ⓘ Manganite Formula: Mn3+O(OH) |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Matildite Formula: AgBiS2 |
| ⓘ Mawsonite Formula: Cu6Fe2SnS8 |
| ⓘ Meionite Formula: Ca4Al6Si6O24CO3 Description: Occurs on the 500 level in Abrigo Limestone. |
| ⓘ Melanterite Formula: Fe2+(H2O)6(SO4) · H2O Localities: Description: Occurs as a post-mining product. |
| ⓘ Melonite Formula: NiTe2 |
| ⓘ Metatorbernite Formula: Cu(UO2)2(PO4)2 · 8H2O References: |
| ⓘ Metavoltine Formula: K2Na6Fe2+Fe3+6O2(SO4)12 · 18H2O Habit: Minute platelets Colour: Greenish-yellow Description: Vermicular stacks of minute platelets |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Miersite Formula: (Ag,Cu)I Localities: Habit: Small crystals Colour: lemon-yellow |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl |
| ⓘ Minium Formula: Pb3O4 |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Mottramite Formula: PbCu(VO4)(OH) |
| ⓘ Murdochite Formula: Cu12Pb2O15Cl2 |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Nantokite Formula: CuCl |
| ⓘ Native Arsenic Formula: As |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Copper Formula: Cu Localities: Reported from at least 18 localities in this region. Description: Superb crystallized specimen 12.5 cm, year 1960's, in "Ikons" [see references] |
| ⓘ Native Gold Formula: Au Localities: Reported from at least 10 localities in this region. |
| ⓘ Native Gold var. Electrum Formula: (Au,Ag) |
| ⓘ Native Silver Formula: Ag Localities: Reported from at least 7 localities in this region. |
| ⓘ Native Sulphur Formula: S8 Localities: Description: Occurs in cavities left by leaching of galena. |
| ⓘ Native Tellurium Formula: Te |
| ⓘ Natrolite Formula: Na2Al2Si3O10 · 2H2O |
| ⓘ Nekrasovite Formula: Cu26V2(Sn,As,Sb)6S32 |
| ⓘ Neltnerite Formula: CaMn3+6(SiO4)O8 |
| ⓘ Nolanite Formula: V3+8Fe3+2O14(OH)2 References: |
| ⓘ Opal Formula: SiO2 · nH2O References: |
| ⓘ Opal var. Opal-AN Formula: SiO2 · nH2O References: |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Osarizawaite Formula: Pb(Al2Cu2+)(SO4)2(OH)6 |
| ⓘ Paracoquimbite Formula: Fe4(SO4)6(H2O)12 · 6H2O Localities: Colour: Bright pale violet |
| ⓘ Paramelaconite (TL) Formula: Cu+2Cu2+2O3 Localities: Habit: Unusually large crystals with forms: {001}, {101}, & {100}. Description: Occurs in a matrix of goethite. |
| ⓘ Paratacamite Formula: Cu3(Cu,Zn)(OH)6Cl2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Paratellurite Formula: TeO2 |
| ⓘ Pearceite Formula: [Ag6As2S7][Ag9CuS4] |
| ⓘ Petzite Formula: Ag3AuTe2 |
| ⓘ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ Pickeringite Formula: MgAl2(SO4)4 · 22H2O |
| ⓘ Plancheite Formula: Cu8(Si8O22)(OH)4 · H2O |
| ⓘ Plattnerite Formula: PbO2 |
| ⓘ Plumbojarosite Formula: Pb0.5Fe3+3(SO4)2(OH)6 |
| ⓘ Polybasite Formula: [Ag6Sb2S7][Ag9CuS4] |
| ⓘ Powellite Formula: Ca(MoO4) |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 |
| ⓘ Pseudomalachite Formula: Cu5(PO4)2(OH)4 |
| ⓘ 'Psilomelane' Localities: Reported from at least 24 localities in this region. Description: Occurs as float. |
| ⓘ Pyrargyrite Formula: Ag3SbS3 References: |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 38 localities in this region. |
| ⓘ Pyrite var. Gold-bearing Pyrite Formula: FeS2 References: |
| ⓘ Pyrolusite Formula: Mn4+O2 Localities: Colour: Black Description: Occurs sparingly as a soft material. |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl |
| ⓘ Pyrope Formula: Mg3Al2(SiO4)3 |
| ⓘ Pyrophyllite Formula: Al2Si4O10(OH)2 Localities: Description: Occurs commonly in the Sacramento stock. |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 13 localities in this region. |
| ⓘ Quartz var. Agate Formula: SiO2 References: Rolf LuetckeIdentified by Rolf Luetcke: Visual Identification |
| ⓘ Quartz var. Amethyst Formula: SiO2 |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Rammelsbergite Formula: NiAs2 |
| ⓘ Ransomite Formula: CuFe2(SO4)4 · 6H2O Localities: Description: Post-mining mineral in oxidizing portions of pyritic ores. |
| ⓘ Redondite Formula: AlPO4 · 2H2O References: Rob Lavinsky stockIdentification: Dealer/Collection Label |
| ⓘ Rhodochrosite Formula: MnCO3 |
| ⓘ Rhodostannite Formula: Cu+(Fe2+0.5Sn4+1.5)S4 |
| ⓘ Rhomboclase Formula: (H5O2)Fe3+(SO4)2 · 2H2O Localities: Campbell Mine, Bisbee, Cochise County, Arizona, USA Czar Mine, Copper Queen Mine, Queen Hill, Bisbee, Cochise County, Arizona, USA Bisbee, Cochise County, Arizona, USA Copper Queen Mine, Queen Hill, Bisbee, Cochise County, Arizona, USA Junction Mine, Calumet and Arizona group of claims, Bisbee, Cochise County, Arizona, USA |
| ⓘ Rickardite Formula: Cu7Te5 |
| ⓘ Roquesite Formula: CuInS2 |
| ⓘ Rosasite Formula: (Cu,Zn)2(CO3)(OH)2 |
| ⓘ Roscoelite Formula: KV3+2(AlSi3O10)(OH)2 |
| ⓘ Römerite Formula: Fe2+Fe3+2(SO4)4 · 14H2O |
| ⓘ Rozenite Formula: FeSO4 · 4H2O Localities: Colour: White Description: Occurs as powdery efflorescences on post-mining assemblages. |
| ⓘ Rucklidgeite Formula: PbBi2Te4 |
| ⓘ Rutile Formula: TiO2 Localities: Description: As an accessory mineral in granite. |
| ⓘ Sanidine Formula: K(AlSi3O8) |
| ⓘ 'Scapolite' |
| ⓘ 'Scapolite var. Wernerite' |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Habit: Nests of small, prismatic crystals. Description: Occurs in muscovite. |
| ⓘ Scorzalite Formula: Fe2+Al2(PO4)2(OH)2 |
| ⓘ Sengierite Formula: Cu2(UO2)2(VO4)2 · 6H2O Description: Initially occurred in one isolated pocket, later more widespread; associated with malachite & disseminated in chalcocite. References: |
| ⓘ Sepiolite Formula: Mg4(Si6O15)(OH)2 · 6H2O |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 |
| ⓘ Shattuckite (TL) Formula: Cu5(Si2O6)2(OH)2 Localities: Type Locality: Shattuck Mine, Bisbee, Cochise County, Arizona, USA Colour: Blue Description: Occurs as pseudomorphs after malachite & as small spherules. |
| ⓘ Siderite Formula: FeCO3 Localities: Reported from at least 6 localities in this region. |
| ⓘ Siderotil Formula: FeSO4 · 5H2O |
| ⓘ 'Silica' |
| ⓘ Smithsonite Formula: ZnCO3 |
| ⓘ Spangolite Formula: Cu6Al(SO4)(OH)12Cl · 3H2O Localities: Description: Spots to 1/8 inch diameter in cuprite-azurite matrix.
Plate 73 from Wilson, Wendell. E.; Bartsch, Joel A.; Mauthner, Mark (2004) Masterpieces of the Mineral World. Houston Museum of Natural Science. [https://www.mindat.org/reference.php?id=18945017] |
| ⓘ Spertiniite Formula: Cu(OH)2 Habit: Scaly structure Colour: Pale blue-green Description: Sparse incrustations with internal scaly structure on matrix of crystalline atacamite. References: |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 10 localities in this region. |
| ⓘ Spionkopite Formula: Cu39S28 |
| ⓘ Stannite Formula: Cu2FeSnS4 |
| ⓘ Stannoidite Formula: Cu+6Cu2+2(Fe2+,Zn)3Sn2S12 Description: As a coating on, or an infilling between pyritic grains; associated with canfieldite. |
| ⓘ Stevensite Formula: (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| ⓘ Stibiconite Formula: Sb3+Sb5+2O6(OH) |
| ⓘ Stolzite Formula: Pb(WO4) |
| ⓘ Stromeyerite Formula: AgCuS |
| ⓘ Stützite Formula: Ag5-xTe3, x = 0.24-0.36 |
| ⓘ Susannite Formula: Pb4(CO3)2(SO4)(OH)2 |
| ⓘ Sylvanite Formula: AgAuTe4 |
| ⓘ Szomolnokite Formula: FeSO4 · H2O |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ Teineite Formula: Cu2+(Te4+O3) · 2H2O |
| ⓘ Tellurite Formula: TeO2 |
| ⓘ Tellurobismuthite Formula: Bi2Te3 |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S |
| ⓘ Tenorite Formula: CuO Localities: Reported from at least 8 localities in this region. Description: With wad in a botryoidal growth lining a natural cavern wall. |
| ⓘ Tenorite var. Geltenorite Formula: CuO |
| ⓘ Tetradymite Formula: Bi2Te2S |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| ⓘ Thomsonite-Ca Formula: NaCa2[Al5Si5O20] · 6H2O |
| ⓘ Tilasite Formula: CaMg(AsO4)F |
| ⓘ Titanite Formula: CaTiO(SiO4) |
| ⓘ Tolbachite Formula: CuCl2 Localities: Colour: Brown Description: Filmy crusts on masses of nantokite. |
| ⓘ Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z Description: Occurs with zircon in Pinal Schist. References: |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 Localities: Description: Occurs on the 500 level in Abrigo Limestone. |
| ⓘ Tungstenite Formula: WS2 References: |
| ⓘ Turquoise Formula: CuAl6(PO4)4(OH)8 · 4H2O |
| ⓘ Tyuyamunite Formula: Ca(UO2)2(VO4)2 · 5-8H2O |
| ⓘ Uraninite Formula: UO2 Localities: Habit: Minute cubes. Description: Occurs as minute crystals along slip planes. |
| ⓘ Uranopilite Formula: (UO2)6(SO4)O2(OH)6 · 14H2O Description: Occurs as a post-mining efflorescence. |
| ⓘ Vanadinite Formula: Pb5(VO4)3Cl |
| ⓘ Variscite Formula: AlPO4 · 2H2O |
| ⓘ Variscite var. Ferrian Variscite Formula: (Al,Fe)PO4 · 2H2O Colour: Pale green Description: As unusual pale green, massive ferrian material. |
| ⓘ Velikite Formula: Cu2HgSnS4 |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 References: |
| ⓘ Volkonskoite Formula: Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| ⓘ Voltaite Formula: K2Fe2+5Fe3+3Al(SO4)12 · 18H2O |
| ⓘ Volynskite Formula: AgBiTe2 |
| ⓘ 'Wad' Localities: Description: With tenorite in a botryoidal growth lining a large natural cavern wall. |
| ⓘ Willemite Formula: Zn2SiO4 Localities: Description: Occurs on the 1,500 foot level. |
| ⓘ Wittichenite Formula: Cu3BiS3 |
| ⓘ Wittichenite var. Silver-bearing Wittichenite Formula: (Cu,Ag)3BiS3 References: |
| ⓘ 'Wolframite Group' Description: Occurs in sulfide ores. |
| ⓘ Wollastonite Formula: Ca3(Si3O9) Localities: Description: Occurs on the 500 level in Abrigo Limestone. |
| ⓘ Wulfenite Formula: Pb(MoO4) Localities: Habit: Brilliant micro-crystals Colour: Colorless |
| ⓘ Yarrowite Formula: Cu9S8 |
| ⓘ Zincobotryogen Formula: (Zn,Mg,Mn2+)Fe3+(SO4)2(OH) · 7H2O |
| ⓘ Zincocopiapite Formula: ZnFe3+4(SO4)6(OH)2 · 18H2O Description: Occurs as a post-mining product. |
| ⓘ Zippeite Formula: K3(UO2)4(SO4)2O3(OH) · 3H2O Description: Occurs as a post-mining efflorescence. |
| ⓘ Zircon Formula: Zr(SiO4) Localities: Description: Occurs in granite. |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) References: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold var. Electrum | 1.AA.05 | (Au,Ag) |
| ⓘ | 1.AA.05 | Au | |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Eugenite | 1.AD.15c | Ag11Hg2 |
| ⓘ | Native Arsenic | 1.CA.05 | As |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| ⓘ | Native Tellurium | 1.CC.10 | Te |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Dyscrasite | 2.AA.35 | Ag3Sb |
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Djurleite | 2.BA.05 | Cu31S16 |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Rickardite | 2.BA.30 | Cu7Te5 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Stromeyerite | 2.BA.40 | AgCuS |
| ⓘ | Jalpaite | 2.BA.45 | Ag3CuS2 |
| ⓘ | Hessite | 2.BA.60 | Ag2Te |
| ⓘ | Henryite (TL) | 2.BA.65 | (Cu,Ag)3+xTe2 , with x ~ 0.40 |
| ⓘ | Stützite | 2.BA.65 | Ag5-xTe3, x = 0.24-0.36 |
| ⓘ | Canfieldite | 2.BA.70 | Ag8SnS6 |
| ⓘ | Petzite | 2.BA.75 | Ag3AuTe2 |
| ⓘ | Bogdanovite | 2.BA.80 | (Au,Te,Pb)3(Cu,Fe) |
| ⓘ | Furutobeite | 2.BE.10 | (Cu,Ag)6PbS4 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Spionkopite | 2.CA.05c | Cu39S28 |
| ⓘ | Yarrowite | 2.CA.05d | Cu9S8 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Roquesite | 2.CB.10a | CuInS2 |
| ⓘ | Hocartite | 2.CB.15a | Ag2(Fe2+,Zn)SnS4 |
| ⓘ | Kësterite | 2.CB.15a | Cu2ZnSnS4 |
| ⓘ | Kuramite | 2.CB.15a | Cu3SnS4 |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Velikite | 2.CB.15a | Cu2HgSnS4 |
| ⓘ | Stannoidite | 2.CB.15c | Cu+6Cu2+2(Fe2+,Zn)3Sn2S12 |
| ⓘ | Mawsonite | 2.CB.20 | Cu6Fe2SnS8 |
| ⓘ | Colusite | 2.CB.30 | Cu13VAs3S16 |
| ⓘ | Nekrasovite | 2.CB.30 | Cu26V2(Sn,As,Sb)6S32 |
| ⓘ | Kiddcreekite (TL) | 2.CB.35a | Cu6SnWS8 |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Alabandite | 2.CD.10 | MnS |
| ⓘ | Altaite | 2.CD.10 | PbTe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | var. Silver-bearing Galena | 2.CD.10 | PbS with Ag |
| ⓘ | Cinnabar | 2.CD.15a | HgS |
| ⓘ | Rhodostannite | 2.DA.10 | Cu+(Fe2+0.5Sn4+1.5)S4 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Tellurobismuthite | 2.DC.05 | Bi2Te3 |
| ⓘ | Tetradymite | 2.DC.05 | Bi2Te2S |
| ⓘ | Sylvanite | 2.EA.05 | AgAuTe4 |
| ⓘ | Calaverite | 2.EA.10 | AuTe2 |
| ⓘ | Kostovite | 2.EA.15 | CuAuTe4 |
| ⓘ | Krennerite | 2.EA.15 | Au3AgTe8 |
| ⓘ | Melonite | 2.EA.20 | NiTe2 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Tungstenite | 2.EA.30 | WS2 |
| ⓘ | Pyrite var. Gold-bearing Pyrite | 2.EB.05a | FeS2 |
| ⓘ | 2.EB.05a | FeS2 | |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Rammelsbergite | 2.EB.15a | NiAs2 |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | Wittichenite | 2.GA.20 | Cu3BiS3 |
| ⓘ | var. Silver-bearing Wittichenite | 2.GA.20 | (Cu,Ag)3BiS3 |
| ⓘ | 'Freibergite Subgroup' | 2.GB.05 | (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ | Goldfieldite | 2.GB.05 | (Cu4◻2)(Cu4Cu+2)Te4S12S |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Pearceite | 2.GB.15 | [Ag6As2S7][Ag9CuS4] |
| ⓘ | Polybasite | 2.GB.15 | [Ag6Sb2S7][Ag9CuS4] |
| ⓘ | Rucklidgeite | 2.GC.40c | PbBi2Te4 |
| ⓘ | Chalcostibite | 2.HA.05 | CuSbS2 |
| ⓘ | Emplectite | 2.HA.05 | CuBiS2 |
| ⓘ | Aikinite | 2.HB.05a | CuPbBiS3 |
| ⓘ | Krupkaite | 2.HB.05a | CuPbBi3S6 |
| ⓘ | Cupropavonite | 2.JA.05a | Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| ⓘ | Hodrušite | 2.JA.10c | Cu8Bi12S22 |
| ⓘ | Matildite | 2.JA.20 | AgBiS2 |
| ⓘ | Volynskite | 2.JA.20 | AgBiTe2 |
| ⓘ | Cosalite | 2.JB.10 | Pb2Bi2S5 |
| ⓘ | Enargite | 2.KA.05 | Cu3AsS4 |
| ⓘ | Famatinite | 2.KA.10 | Cu3SbS4 |
| ⓘ | Luzonite | 2.KA.10 | Cu3AsS4 |
| Group 3 - Halides | |||
| ⓘ | Miersite | 3.AA.05 | (Ag,Cu)I |
| ⓘ | Nantokite | 3.AA.05 | CuCl |
| ⓘ | Iodargyrite | 3.AA.10 | AgI |
| ⓘ | Bromargyrite | 3.AA.15 | AgBr |
| ⓘ | Chlorargyrite | 3.AA.15 | AgCl |
| ⓘ | var. Bromine-bearing Chlorargyrite | 3.AA.15 | Ag(Cl,Br) |
| ⓘ | Tolbachite | 3.AB.05 | CuCl2 |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Hydrokenoralstonite | 3.CF.05 | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| ⓘ | Atacamite | 3.DA.10a | Cu2(OH)3Cl |
| ⓘ | Botallackite | 3.DA.10b | Cu2(OH)3Cl |
| ⓘ | Paratacamite | 3.DA.10c | Cu3(Cu,Zn)(OH)6Cl2 |
| ⓘ | Claringbullite | 3.DA.15 | Cu4ClF(OH)6 |
| ⓘ | Barlowite | 3.DA.15 | Cu4BrF(OH)6 |
| ⓘ | Buttgenbachite | 3.DA.25 | Cu19(NO3)2(OH)32Cl4 · 2H2O |
| ⓘ | Connellite | 3.DA.25 | Cu19(SO4)(OH)32Cl4 · 3H2O |
| ⓘ | Anthonyite | 3.DA.40 | Cu(OH,Cl)2 · 3H2O |
| ⓘ | Murdochite | 3.DB.45 | Cu12Pb2O15Cl2 |
| ⓘ | Eddavidite (TL) | 3.DB.45 | Cu12Pb2O15Br2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Cuprite var. Chalcotrichite | 4.AA.10 | Cu2O |
| ⓘ | 4.AA.10 | Cu2O | |
| ⓘ | Paramelaconite (TL) | 4.AA.15 | Cu+2Cu2+2O3 |
| ⓘ | Crednerite | 4.AB.05 | Cu+Mn3+O2 |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | var. Geltenorite | 4.AB.10 | CuO |
| ⓘ | Delafossite | 4.AB.15 | Cu+Fe3+O2 |
| ⓘ | Lime | 4.AB.25 | CaO |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Jacobsite | 4.BB.05 | Mn2+Fe3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hausmannite | 4.BB.10 | Mn2+Mn3+2O4 |
| ⓘ | Hetaerolite | 4.BB.10 | ZnMn2O4 |
| ⓘ | var. Hydrohetaerolite | 4.BB.10 | Zn(Mn,◻)2(O,OH)4 |
| ⓘ | Minium | 4.BD.05 | Pb3O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | var. Specularite | 4.CB.05 | Fe2O3 |
| ⓘ | Bixbyite-(Mn) | 4.CB.10 | Mn3+2O3 |
| ⓘ | Nolanite | 4.CB.40 | V3+8Fe3+2O14(OH)2 |
| ⓘ | Bismite | 4.CB.60 | Bi2O3 |
| ⓘ | Quartz var. Agate | 4.DA.05 | SiO2 |
| ⓘ | var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | Opal var. Opal-AN | 4.DA.10 | SiO2 · nH2O |
| ⓘ | 4.DA.10 | SiO2 · nH2O | |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Plattnerite | 4.DB.05 | PbO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Hübnerite | 4.DB.30 | MnWO4 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brookite | 4.DD.10 | TiO2 |
| ⓘ | Tellurite | 4.DE.20 | TeO2 |
| ⓘ | Paratellurite | 4.DE.25 | TeO2 |
| ⓘ | Bindheimite | 4.DH.20 | Pb2Sb2O6O |
| ⓘ | Stibiconite | 4.DH.20 | Sb3+Sb5+2O6(OH) |
| ⓘ | Coronadite | 4.DK.05a | Pb(Mn4+6Mn3+2)O16 |
| ⓘ | Cryptomelane | 4.DK.05a | K(Mn4+7Mn3+)O16 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | Spertiniite | 4.FD.05 | Cu(OH)2 |
| ⓘ | Diaspore | 4.FD.10 | AlO(OH) |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| ⓘ | Groutite | 4.FD.10 | Mn3+O(OH) |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Brucite | 4.FE.05 | Mg(OH)2 |
| ⓘ | Gibbsite | 4.FE.10 | Al(OH)3 |
| ⓘ | Böhmite | 4.FE.15 | AlO(OH) |
| ⓘ | Lepidocrocite | 4.FE.15 | Fe3+O(OH) |
| ⓘ | Cesàrolite | 4.FG.10 | PbMn4+3O6(OH)2 |
| ⓘ | Ilsemannite | 4.FJ.15 | Mo3O8 · nH2O |
| ⓘ | Chalcophanite | 4.FL.20 | ZnMn4+3O7 · 3H2O |
| ⓘ | Sengierite | 4.HB.10 | Cu2(UO2)2(VO4)2 · 6H2O |
| ⓘ | Tyuyamunite | 4.HB.25 | Ca(UO2)2(VO4)2 · 5-8H2O |
| ⓘ | Graemite (TL) | 4.JM.15 | Cu[TeO3] · H2O |
| ⓘ | Teineite | 4.JM.20 | Cu2+(Te4+O3) · 2H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Aragonite var. Flos Ferri | 5.AB.15 | CaCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Rosasite | 5.BA.10 | (Cu,Zn)2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Hydrocerussite | 5.BE.10 | Pb3(CO3)2(OH)2 |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| ⓘ | Kettnerite | 5.BE.30 | CaBiCO3OF |
| ⓘ | Leadhillite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Susannite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Bayleyite | 5.ED.05 | Mg2(UO2)(CO3)3 · 18H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Antlerite | 7.BB.15 | Cu3(SO4)(OH)4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Alunite | 7.BC.10 | KAl3(SO4)2(OH)6 |
| ⓘ | Beaverite-(Cu) | 7.BC.10 | Pb(Fe3+2Cu)(SO4)2(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Osarizawaite | 7.BC.10 | Pb(Al2Cu2+)(SO4)2(OH)6 |
| ⓘ | Plumbojarosite | 7.BC.10 | Pb0.5Fe3+3(SO4)2(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Gunningite | 7.CB.05 | ZnSO4 · H2O |
| ⓘ | Szomolnokite | 7.CB.05 | FeSO4 · H2O |
| ⓘ | Rozenite | 7.CB.15 | FeSO4 · 4H2O |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Siderotil | 7.CB.20 | FeSO4 · 5H2O |
| ⓘ | Bianchite | 7.CB.25 | Zn(H2O)6(SO4) |
| ⓘ | Hexahydrite | 7.CB.25 | Mg(H2O)6(SO4) |
| ⓘ | Boothite | 7.CB.35 | Cu2+(H2O)6(SO4) · H2O |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6(SO4) · H2O |
| ⓘ | Epsomite | 7.CB.40 | MgSO4 · 7H2O |
| ⓘ | Coquimbite | 7.CB.55 | AlFe3(SO4)6(H2O)12 · 6H2O |
| ⓘ | Paracoquimbite | 7.CB.55 | Fe4(SO4)6(H2O)12 · 6H2O |
| ⓘ | Rhomboclase | 7.CB.55 | (H5O2)Fe3+(SO4)2 · 2H2O |
| ⓘ | Kornelite | 7.CB.60 | Fe2(SO4)3 · 7H2O |
| ⓘ | Römerite | 7.CB.75 | Fe2+Fe3+2(SO4)4 · 14H2O |
| ⓘ | Ransomite | 7.CB.80 | CuFe2(SO4)4 · 6H2O |
| ⓘ | Bílinite | 7.CB.85 | Fe2+Fe3+2(SO4)4 · 22H2O |
| ⓘ | Halotrichite | 7.CB.85 | Fe2+Al2(SO4)4 · 22H2O |
| ⓘ | Pickeringite | 7.CB.85 | MgAl2(SO4)4 · 22H2O |
| ⓘ | Voltaite | 7.CC.25 | K2Fe2+5Fe3+3Al(SO4)12 · 18H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | var. Selenite | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Copiapite | 7.DB.35 | Fe2+Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ | Cuprocopiapite | 7.DB.35 | Cu2+Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ | Ferricopiapite | 7.DB.35 | Fe3+0.67Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ | Zincocopiapite | 7.DB.35 | ZnFe3+4(SO4)6(OH)2 · 18H2O |
| ⓘ | Fibroferrite | 7.DC.15 | Fe3+(SO4)(OH) · 5H2O |
| ⓘ | Botryogen | 7.DC.25 | MgFe3+(SO4)2(OH) · 7H2O |
| ⓘ | Zincobotryogen | 7.DC.25 | (Zn,Mg,Mn2+)Fe3+(SO4)2(OH) · 7H2O |
| ⓘ | Felsőbányaite | 7.DD.05 | Al4(SO4)(OH)10 · 4H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Spangolite | 7.DD.15 | Cu6Al(SO4)(OH)12Cl · 3H2O |
| ⓘ | Ktenasite | 7.DD.20 | ZnCu4(SO4)2(OH)6 · 6H2O |
| ⓘ | Devilline | 7.DD.30 | CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Chalcoalumite (TL) | 7.DD.75 | CuAl4(SO4)(OH)12 · 3H2O |
| ⓘ | Carbonatecyanotrichite | 7.DE.10 | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| ⓘ | Cyanotrichite | 7.DE.10 | Cu4Al2(SO4)(OH)12 · 2H2O |
| ⓘ | Hydrobasaluminite | 7.DE.60 | Al4(SO4)(OH)10 · 12-36H2O |
| ⓘ | Metavoltine | 7.DF.35 | K2Na6Fe2+Fe3+6O2(SO4)12 · 18H2O |
| ⓘ | Uranopilite | 7.EA.05 | (UO2)6(SO4)O2(OH)6 · 14H2O |
| ⓘ | Johannite | 7.EB.05 | Cu(UO2)2(SO4)2(OH)2 · 8H2O |
| ⓘ | Zippeite | 7.EC.05 | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| ⓘ | Fornacite | 7.FC.10 | Pb2Cu(CrO4)(AsO4)(OH) |
| ⓘ | Powellite | 7.GA.05 | Ca(MoO4) |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Stolzite | 7.GA.05 | Pb(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| ⓘ | Ferrimolybdite | 7.GB.30 | Fe2(MoO4)3 · nH2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Tilasite | 8.BB. | CaMg(AsO4)F |
| ⓘ | Scorzalite | 8.BB.40 | Fe2+Al2(PO4)2(OH)2 |
| ⓘ | Pseudomalachite | 8.BD.05 | Cu5(PO4)2(OH)4 |
| ⓘ | Conichalcite | 8.BH.35 | CaCu(AsO4)(OH) |
| ⓘ | Descloizite var. Copper-bearing Descloizite | 8.BH.40 | Pb(Zn,Cu)VO4OH |
| ⓘ | 8.BH.40 | PbZn(VO4)(OH) | |
| ⓘ | Mottramite | 8.BH.40 | PbCu(VO4)(OH) |
| ⓘ | Bayldonite | 8.BH.45 | PbCu3(AsO4)2(OH)2 |
| ⓘ | Beudantite | 8.BL.05 | PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Vanadinite | 8.BN.05 | Pb5(VO4)3Cl |
| ⓘ | Redondite | 8.CB.X | AlPO4 · 2H2O |
| ⓘ | Variscite | 8.CD.10 | AlPO4 · 2H2O |
| ⓘ | var. Ferrian Variscite | 8.CD.10 | (Al,Fe)PO4 · 2H2O |
| ⓘ | Gormanite | 8.DC.45 | (Fe2+,Mg)3(Al,Fe3+)4(PO4)4(OH)6 · 2H2O |
| ⓘ | Chalcosiderite | 8.DD.15 | CuFe3+6(PO4)4(OH)8 · 4H2O |
| ⓘ | Turquoise | 8.DD.15 | CuAl6(PO4)4(OH)8 · 4H2O |
| ⓘ | Liroconite | 8.DF.20 | Cu2Al(AsO4)(OH)4 · 4H2O |
| ⓘ | Chalcophyllite | 8.DF.30 | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ | Metatorbernite | 8.EB.10 | Cu(UO2)2(PO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Chrysotile | 9.00. | Mg3(Si2O5)(OH)4 |
| ⓘ | Willemite | 9.AA.05 | Zn2SiO4 |
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Pyrope | 9.AD.25 | Mg3Al2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Braunite | 9.AG.05 | Mn2+Mn3+6(SiO4)O8 |
| ⓘ | Neltnerite | 9.AG.05 | CaMn3+6(SiO4)O8 |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Dioptase | 9.CJ.30 | CuSiO3 · H2O |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Enstatite | 9.DA.05 | Mg2Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Shattuckite (TL) | 9.DB.40 | Cu5(Si2O6)2(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Edenite | 9.DE.15 | NaCa2Mg5(Si7Al)O22(OH)2 |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Plancheite | 9.DP.55 | Cu8(Si8O22)(OH)4 · H2O |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Pyrophyllite | 9.EC.10 | Al2Si4O10(OH)2 |
| ⓘ | Celadonite | 9.EC.15 | K(MgFe3+◻)(Si4O10)(OH)2 |
| ⓘ | Muscovite var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Roscoelite | 9.EC.15 | KV3+2(AlSi3O10)(OH)2 |
| ⓘ | Muscovite var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Volkonskoite | 9.EC.40 | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| ⓘ | Stevensite | 9.EC.45 | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| ⓘ | Chamosite | 9.EC.55 | Fe2+5Al(AlSi3O10)(OH)8 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | 'Clinochrysotile' | 9.ED. | Mg3(Si2O5)(OH)4 |
| ⓘ | Dickite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Halloysite | 9.ED.10 | Al2Si2O5(OH)4 · n(H2O) |
| ⓘ | Hisingerite | 9.ED.10 | Fe3+2(Si2O5)(OH)4 · 2H2O |
| ⓘ | 'Hydrohalloysite' | 9.ED.10 | Al2Si2O5(OH)4 · 2H2O |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Allophane | 9.ED.20 | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Sepiolite | 9.EE.25 | Mg4(Si6O15)(OH)2 · 6H2O |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Sanidine | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | var. Labradorite | 9.FA.35 | (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ | Meionite | 9.FB.15 | Ca4Al6Si6O24CO3 |
| ⓘ | Natrolite | 9.GA.05 | Na2Al2Si3O10 · 2H2O |
| ⓘ | Thomsonite-Ca | 9.GA.10 | NaCa2[Al5Si5O20] · 6H2O |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| Group 10 - Organic Compounds | |||
| ⓘ | Hoganite | 10.AA.35 | Cu(CH3COO)2 · H2O |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'var. Delessite' | - | (Mg,Fe,Fe,Al)(Si,Al)4O10(O,OH)8 |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Wad' | - | |
| ⓘ | 'Scapolite var. Wernerite' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Silica' | - | |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Bisbeeite' | - | (Cu,Mg)SiO3 · nH2O |
| ⓘ | 'Manganese Oxides var. Manganese Dendrites' | - | |
| ⓘ | '' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Campbellite' | - | |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ | 'Iridescent coating' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| H | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| H | ⓘ Anthonyite | Cu(OH,Cl)2 · 3H2O |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| H | ⓘ Atacamite | Cu2(OH)3Cl |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| H | ⓘ Bayleyite | Mg2(UO2)(CO3)3 · 18H2O |
| H | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| H | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| H | ⓘ Bianchite | Zn(H2O)6(SO4) |
| H | ⓘ Bílinite | Fe2+Fe23+(SO4)4 · 22H2O |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Böhmite | AlO(OH) |
| H | ⓘ Boothite | Cu2+(H2O)6(SO4) · H2O |
| H | ⓘ Botallackite | Cu2(OH)3Cl |
| H | ⓘ Botryogen | MgFe3+(SO4)2(OH) · 7H2O |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Buttgenbachite | Cu19(NO3)2(OH)32Cl4 · 2H2O |
| H | ⓘ Brucite | Mg(OH)2 |
| H | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| H | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| H | ⓘ Cesàrolite | PbMn34+O6(OH)2 |
| H | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| H | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| H | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| H | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Claringbullite | Cu4ClF(OH)6 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinochrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| H | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| H | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| H | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| H | ⓘ Cuprocopiapite | Cu2+Fe43+(SO4)6(OH)2 · 20H2O |
| H | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| H | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| H | ⓘ Chlorite Group var. Delessite | (Mg,Fe,Fe,Al)(Si,Al)4O10(O,OH)8 |
| H | ⓘ Descloizite | PbZn(VO4)(OH) |
| H | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Diaspore | AlO(OH) |
| H | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| H | ⓘ Dioptase | CuSiO3 · H2O |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Epsomite | MgSO4 · 7H2O |
| H | ⓘ Felsőbányaite | Al4(SO4)(OH)10 · 4H2O |
| H | ⓘ Ferricopiapite | Fe3+0.67Fe43+(SO4)6(OH)2 · 20H2O |
| H | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| H | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| H | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| H | ⓘ Gibbsite | Al(OH)3 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gormanite | (Fe2+,Mg)3(Al,Fe3+)4(PO4)4(OH)6 · 2H2O |
| H | ⓘ Graemite | Cu[TeO3] · H2O |
| H | ⓘ Groutite | Mn3+O(OH) |
| H | ⓘ Gunningite | ZnSO4 · H2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| H | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| H | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| H | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| H | ⓘ Hydrobasaluminite | Al4(SO4)(OH)10 · 12-36H2O |
| H | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| H | ⓘ Hetaerolite var. Hydrohetaerolite | Zn(Mn,◻)2(O,OH)4 |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Ilsemannite | Mo3O8 · nH2O |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Johannite | Cu(UO2)2(SO4)2(OH)2 · 8H2O |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Kornelite | Fe2(SO4)3 · 7H2O |
| H | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Lepidocrocite | Fe3+O(OH) |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| H | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| H | ⓘ Metavoltine | K2Na6Fe2+Fe63+O2(SO4)12 · 18H2O |
| H | ⓘ Mottramite | PbCu(VO4)(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Nolanite | V83+Fe23+O14(OH)2 |
| H | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| H | ⓘ Paracoquimbite | Fe4(SO4)6(H2O)12 · 6H2O |
| H | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| H | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| H | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| H | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| H | ⓘ Hydrokenoralstonite | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| H | ⓘ Ransomite | CuFe2(SO4)4 · 6H2O |
| H | ⓘ Rhomboclase | (H5O2)Fe3+(SO4)2 · 2H2O |
| H | ⓘ Römerite | Fe2+Fe23+(SO4)4 · 14H2O |
| H | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| H | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| H | ⓘ Rozenite | FeSO4 · 4H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| H | ⓘ Sengierite | Cu2(UO2)2(VO4)2 · 6H2O |
| H | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| H | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| H | ⓘ Siderotil | FeSO4 · 5H2O |
| H | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| H | ⓘ Spertiniite | Cu(OH)2 |
| H | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| H | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| H | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Szomolnokite | FeSO4 · H2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Teineite | Cu2+(Te4+O3) · 2H2O |
| H | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| H | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| H | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| H | ⓘ Uranopilite | (UO2)6(SO4)O2(OH)6 · 14H2O |
| H | ⓘ Variscite | AlPO4 · 2H2O |
| H | ⓘ Volkonskoite | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| H | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Zincobotryogen | (Zn,Mg,Mn2+)Fe3+(SO4)2(OH) · 7H2O |
| H | ⓘ Zincocopiapite | ZnFe43+(SO4)6(OH)2 · 18H2O |
| H | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Hydrohalloysite | Al2Si2O5(OH)4 · 2H2O |
| H | ⓘ Hoganite | Cu(CH3COO)2 · H2O |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Variscite var. Ferrian Variscite | (Al,Fe)PO4 · 2H2O |
| H | ⓘ Bisbeeite | (Cu,Mg)SiO3 · nH2O |
| H | ⓘ Redondite | AlPO4 · 2H2O |
| H | ⓘ Barlowite | Cu4BrF(OH)6 |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Bayleyite | Mg2(UO2)(CO3)3 · 18H2O |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Kettnerite | CaBiCO3OF |
| C | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Scapolite var. Wernerite | |
| C | ⓘ Aragonite var. Flos Ferri | CaCO3 |
| C | ⓘ Hoganite | Cu(CH3COO)2 · H2O |
| N | Nitrogen | |
| N | ⓘ Buttgenbachite | Cu19(NO3)2(OH)32Cl4 · 2H2O |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Quartz var. Agate | SiO2 |
| O | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| O | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Anthonyite | Cu(OH,Cl)2 · 3H2O |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Atacamite | Cu2(OH)3Cl |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| O | ⓘ Bayleyite | Mg2(UO2)(CO3)3 · 18H2O |
| O | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| O | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| O | ⓘ Bianchite | Zn(H2O)6(SO4) |
| O | ⓘ Bílinite | Fe2+Fe23+(SO4)4 · 22H2O |
| O | ⓘ Bindheimite | Pb2Sb2O6O |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bismite | Bi2O3 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Bixbyite-(Mn) | Mn23+O3 |
| O | ⓘ Böhmite | AlO(OH) |
| O | ⓘ Boothite | Cu2+(H2O)6(SO4) · H2O |
| O | ⓘ Botallackite | Cu2(OH)3Cl |
| O | ⓘ Botryogen | MgFe3+(SO4)2(OH) · 7H2O |
| O | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Brookite | TiO2 |
| O | ⓘ Buttgenbachite | Cu19(NO3)2(OH)32Cl4 · 2H2O |
| O | ⓘ Brucite | Mg(OH)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Cesàrolite | PbMn34+O6(OH)2 |
| O | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| O | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| O | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| O | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| O | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Claringbullite | Cu4ClF(OH)6 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinochrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| O | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| O | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| O | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| O | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| O | ⓘ Crednerite | Cu+Mn3+O2 |
| O | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Cuprocopiapite | Cu2+Fe43+(SO4)6(OH)2 · 20H2O |
| O | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| O | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| O | ⓘ Delafossite | Cu+Fe3+O2 |
| O | ⓘ Chlorite Group var. Delessite | (Mg,Fe,Fe,Al)(Si,Al)4O10(O,OH)8 |
| O | ⓘ Descloizite | PbZn(VO4)(OH) |
| O | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Diaspore | AlO(OH) |
| O | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dioptase | CuSiO3 · H2O |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| O | ⓘ Enstatite | Mg2Si2O6 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Epsomite | MgSO4 · 7H2O |
| O | ⓘ Felsőbányaite | Al4(SO4)(OH)10 · 4H2O |
| O | ⓘ Ferricopiapite | Fe3+0.67Fe43+(SO4)6(OH)2 · 20H2O |
| O | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| O | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| O | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| O | ⓘ Gibbsite | Al(OH)3 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gormanite | (Fe2+,Mg)3(Al,Fe3+)4(PO4)4(OH)6 · 2H2O |
| O | ⓘ Graemite | Cu[TeO3] · H2O |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Groutite | Mn3+O(OH) |
| O | ⓘ Gunningite | ZnSO4 · H2O |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| O | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| O | ⓘ Hausmannite | Mn2+Mn23+O4 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Hetaerolite | ZnMn2O4 |
| O | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| O | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| O | ⓘ Hübnerite | MnWO4 |
| O | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| O | ⓘ Hydrobasaluminite | Al4(SO4)(OH)10 · 12-36H2O |
| O | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| O | ⓘ Hetaerolite var. Hydrohetaerolite | Zn(Mn,◻)2(O,OH)4 |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilsemannite | Mo3O8 · nH2O |
| O | ⓘ Jacobsite | Mn2+Fe23+O4 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Johannite | Cu(UO2)2(SO4)2(OH)2 · 8H2O |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kettnerite | CaBiCO3OF |
| O | ⓘ Kornelite | Fe2(SO4)3 · 7H2O |
| O | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| O | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Lepidocrocite | Fe3+O(OH) |
| O | ⓘ Lime | CaO |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| O | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| O | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| O | ⓘ Metavoltine | K2Na6Fe2+Fe63+O2(SO4)12 · 18H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Minium | Pb3O4 |
| O | ⓘ Mottramite | PbCu(VO4)(OH) |
| O | ⓘ Murdochite | Cu12Pb2O15Cl2 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Neltnerite | CaMn63+(SiO4)O8 |
| O | ⓘ Nolanite | V83+Fe23+O14(OH)2 |
| O | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| O | ⓘ Paracoquimbite | Fe4(SO4)6(H2O)12 · 6H2O |
| O | ⓘ Paramelaconite | Cu2+Cu22+O3 |
| O | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| O | ⓘ Paratellurite | TeO2 |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| O | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| O | ⓘ Plattnerite | PbO2 |
| O | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| O | ⓘ Powellite | Ca(MoO4) |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| O | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Hydrokenoralstonite | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| O | ⓘ Ransomite | CuFe2(SO4)4 · 6H2O |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rhomboclase | (H5O2)Fe3+(SO4)2 · 2H2O |
| O | ⓘ Römerite | Fe2+Fe23+(SO4)4 · 14H2O |
| O | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| O | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| O | ⓘ Rozenite | FeSO4 · 4H2O |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Sanidine | K(AlSi3O8) |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| O | ⓘ Sengierite | Cu2(UO2)2(VO4)2 · 6H2O |
| O | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| O | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| O | ⓘ Siderotil | FeSO4 · 5H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| O | ⓘ Spertiniite | Cu(OH)2 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| O | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| O | ⓘ Stolzite | Pb(WO4) |
| O | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Szomolnokite | FeSO4 · H2O |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Teineite | Cu2+(Te4+O3) · 2H2O |
| O | ⓘ Tellurite | TeO2 |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| O | ⓘ Tilasite | CaMg(AsO4)F |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| O | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Uranopilite | (UO2)6(SO4)O2(OH)6 · 14H2O |
| O | ⓘ Vanadinite | Pb5(VO4)3Cl |
| O | ⓘ Variscite | AlPO4 · 2H2O |
| O | ⓘ Volkonskoite | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| O | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Scapolite var. Wernerite | |
| O | ⓘ Willemite | Zn2SiO4 |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Zincobotryogen | (Zn,Mg,Mn2+)Fe3+(SO4)2(OH) · 7H2O |
| O | ⓘ Zincocopiapite | ZnFe43+(SO4)6(OH)2 · 18H2O |
| O | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| O | ⓘ Hematite var. Specularite | Fe2O3 |
| O | ⓘ Aragonite var. Flos Ferri | CaCO3 |
| O | ⓘ Fayalite-Forsterite Series | |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Tenorite var. Geltenorite | CuO |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Hydrohalloysite | Al2Si2O5(OH)4 · 2H2O |
| O | ⓘ Hoganite | Cu(CH3COO)2 · H2O |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Variscite var. Ferrian Variscite | (Al,Fe)PO4 · 2H2O |
| O | ⓘ Bisbeeite | (Cu,Mg)SiO3 · nH2O |
| O | ⓘ Redondite | AlPO4 · 2H2O |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Barlowite | Cu4BrF(OH)6 |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| O | ⓘ Eddavidite | Cu12Pb2O15Br2 |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Claringbullite | Cu4ClF(OH)6 |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Kettnerite | CaBiCO3OF |
| F | ⓘ Hydrokenoralstonite | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| F | ⓘ Tilasite | CaMg(AsO4)F |
| F | ⓘ Barlowite | Cu4BrF(OH)6 |
| Na | Sodium | |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Na | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Na | ⓘ Metavoltine | K2Na6Fe2+Fe63+O2(SO4)12 · 18H2O |
| Na | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Na | ⓘ Hydrokenoralstonite | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| Na | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| Na | ⓘ Scapolite var. Wernerite | |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Bayleyite | Mg2(UO2)(CO3)3 · 18H2O |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Botryogen | MgFe3+(SO4)2(OH) · 7H2O |
| Mg | ⓘ Brucite | Mg(OH)2 |
| Mg | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Mg | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Clinochrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Chlorite Group var. Delessite | (Mg,Fe,Fe,Al)(Si,Al)4O10(O,OH)8 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Mg | ⓘ Enstatite | Mg2Si2O6 |
| Mg | ⓘ Epsomite | MgSO4 · 7H2O |
| Mg | ⓘ Gormanite | (Fe2+,Mg)3(Al,Fe3+)4(PO4)4(OH)6 · 2H2O |
| Mg | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| Mg | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Mg | ⓘ Hydrokenoralstonite | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| Mg | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Mg | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tilasite | CaMg(AsO4)F |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Volkonskoite | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Mg | ⓘ Fayalite-Forsterite Series | |
| Mg | ⓘ Bisbeeite | (Cu,Mg)SiO3 · nH2O |
| Al | Aluminium | |
| Al | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Al | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Böhmite | AlO(OH) |
| Al | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| Al | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| Al | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Al | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| Al | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| Al | ⓘ Chlorite Group var. Delessite | (Mg,Fe,Fe,Al)(Si,Al)4O10(O,OH)8 |
| Al | ⓘ Diaspore | AlO(OH) |
| Al | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Felsőbányaite | Al4(SO4)(OH)10 · 4H2O |
| Al | ⓘ Gibbsite | Al(OH)3 |
| Al | ⓘ Gormanite | (Fe2+,Mg)3(Al,Fe3+)4(PO4)4(OH)6 · 2H2O |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| Al | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| Al | ⓘ Hydrobasaluminite | Al4(SO4)(OH)10 · 12-36H2O |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| Al | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| Al | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Al | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Al | ⓘ Hydrokenoralstonite | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| Al | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| Al | ⓘ Sanidine | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| Al | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| Al | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| Al | ⓘ Variscite | AlPO4 · 2H2O |
| Al | ⓘ Volkonskoite | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| Al | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Scapolite var. Wernerite | |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Hydrohalloysite | Al2Si2O5(OH)4 · 2H2O |
| Al | ⓘ Variscite var. Ferrian Variscite | (Al,Fe)PO4 · 2H2O |
| Al | ⓘ Redondite | AlPO4 · 2H2O |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Quartz var. Agate | SiO2 |
| Si | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Si | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Si | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinochrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Chlorite Group var. Delessite | (Mg,Fe,Fe,Al)(Si,Al)4O10(O,OH)8 |
| Si | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dioptase | CuSiO3 · H2O |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Si | ⓘ Enstatite | Mg2Si2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Si | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Neltnerite | CaMn63+(SiO4)O8 |
| Si | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Si | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| Si | ⓘ Sanidine | K(AlSi3O8) |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Si | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Volkonskoite | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Scapolite var. Wernerite | |
| Si | ⓘ Willemite | Zn2SiO4 |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Fayalite-Forsterite Series | |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Hydrohalloysite | Al2Si2O5(OH)4 · 2H2O |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Bisbeeite | (Cu,Mg)SiO3 · nH2O |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| P | ⓘ Gormanite | (Fe2+,Mg)3(Al,Fe3+)4(PO4)4(OH)6 · 2H2O |
| P | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| P | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| P | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| P | ⓘ Variscite | AlPO4 · 2H2O |
| P | ⓘ Variscite var. Ferrian Variscite | (Al,Fe)PO4 · 2H2O |
| P | ⓘ Redondite | AlPO4 · 2H2O |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Aikinite | CuPbBiS3 |
| S | ⓘ Alabandite | MnS |
| S | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| S | ⓘ Pyrite var. Gold-bearing Pyrite | FeS2 |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| S | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| S | ⓘ Bianchite | Zn(H2O)6(SO4) |
| S | ⓘ Bílinite | Fe2+Fe23+(SO4)4 · 22H2O |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Boothite | Cu2+(H2O)6(SO4) · H2O |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Botryogen | MgFe3+(SO4)2(OH) · 7H2O |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Canfieldite | Ag8SnS6 |
| S | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| S | ⓘ Chalcostibite | CuSbS2 |
| S | ⓘ Cinnabar | HgS |
| S | ⓘ Colusite | Cu13VAs3S16 |
| S | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| S | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| S | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| S | ⓘ Cosalite | Pb2Bi2S5 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cuprocopiapite | Cu2+Fe43+(SO4)6(OH)2 · 20H2O |
| S | ⓘ Cupropavonite | Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| S | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| S | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Djurleite | Cu31S16 |
| S | ⓘ Emplectite | CuBiS2 |
| S | ⓘ Enargite | Cu3AsS4 |
| S | ⓘ Epsomite | MgSO4 · 7H2O |
| S | ⓘ Famatinite | Cu3SbS4 |
| S | ⓘ Felsőbányaite | Al4(SO4)(OH)10 · 4H2O |
| S | ⓘ Ferricopiapite | Fe3+0.67Fe43+(SO4)6(OH)2 · 20H2O |
| S | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| S | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| S | ⓘ Furutobeite | (Cu,Ag)6PbS4 |
| S | ⓘ Galena | PbS |
| S | ⓘ Goldfieldite | (Cu4◻2)(Cu4Cu2+)Te4S12S |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Gunningite | ZnSO4 · H2O |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| S | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| S | ⓘ Hocartite | Ag2(Fe2+,Zn)SnS4 |
| S | ⓘ Hodrušite | Cu8Bi12S22 |
| S | ⓘ Hydrobasaluminite | Al4(SO4)(OH)10 · 12-36H2O |
| S | ⓘ Jalpaite | Ag3CuS2 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Johannite | Cu(UO2)2(SO4)2(OH)2 · 8H2O |
| S | ⓘ Kësterite | Cu2ZnSnS4 |
| S | ⓘ Kiddcreekite | Cu6SnWS8 |
| S | ⓘ Kornelite | Fe2(SO4)3 · 7H2O |
| S | ⓘ Krupkaite | CuPbBi3S6 |
| S | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| S | ⓘ Kuramite | Cu3SnS4 |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Luzonite | Cu3AsS4 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Matildite | AgBiS2 |
| S | ⓘ Mawsonite | Cu6Fe2SnS8 |
| S | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| S | ⓘ Metavoltine | K2Na6Fe2+Fe63+O2(SO4)12 · 18H2O |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Nekrasovite | Cu26V2(Sn,As,Sb)6S32 |
| S | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| S | ⓘ Paracoquimbite | Fe4(SO4)6(H2O)12 · 6H2O |
| S | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| S | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| S | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| S | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Ransomite | CuFe2(SO4)4 · 6H2O |
| S | ⓘ Rhodostannite | Cu+(Fe2+0.5Sn4+1.5)S4 |
| S | ⓘ Rhomboclase | (H5O2)Fe3+(SO4)2 · 2H2O |
| S | ⓘ Römerite | Fe2+Fe23+(SO4)4 · 14H2O |
| S | ⓘ Roquesite | CuInS2 |
| S | ⓘ Rozenite | FeSO4 · 4H2O |
| S | ⓘ Siderotil | FeSO4 · 5H2O |
| S | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Spionkopite | Cu39S28 |
| S | ⓘ Stannite | Cu2FeSnS4 |
| S | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| S | ⓘ Stromeyerite | AgCuS |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Szomolnokite | FeSO4 · H2O |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetradymite | Bi2Te2S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Tungstenite | WS2 |
| S | ⓘ Uranopilite | (UO2)6(SO4)O2(OH)6 · 14H2O |
| S | ⓘ Velikite | Cu2HgSnS4 |
| S | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| S | ⓘ Wittichenite | Cu3BiS3 |
| S | ⓘ Yarrowite | Cu9S8 |
| S | ⓘ Zincobotryogen | (Zn,Mg,Mn2+)Fe3+(SO4)2(OH) · 7H2O |
| S | ⓘ Zincocopiapite | ZnFe43+(SO4)6(OH)2 · 18H2O |
| S | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| S | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| S | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| S | ⓘ Wittichenite var. Silver-bearing Wittichenite | (Cu,Ag)3BiS3 |
| Cl | Chlorine | |
| Cl | ⓘ Anthonyite | Cu(OH,Cl)2 · 3H2O |
| Cl | ⓘ Atacamite | Cu2(OH)3Cl |
| Cl | ⓘ Botallackite | Cu2(OH)3Cl |
| Cl | ⓘ Buttgenbachite | Cu19(NO3)2(OH)32Cl4 · 2H2O |
| Cl | ⓘ Chlorargyrite | AgCl |
| Cl | ⓘ Claringbullite | Cu4ClF(OH)6 |
| Cl | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cl | ⓘ Chlorargyrite var. Bromine-bearing Chlorargyrite | Ag(Cl,Br) |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Murdochite | Cu12Pb2O15Cl2 |
| Cl | ⓘ Nantokite | CuCl |
| Cl | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| Cl | ⓘ Tolbachite | CuCl2 |
| Cl | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cl | ⓘ Scapolite var. Wernerite | |
| K | Potassium | |
| K | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| K | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Metavoltine | K2Na6Fe2+Fe63+O2(SO4)12 · 18H2O |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| K | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| K | ⓘ Sanidine | K(AlSi3O8) |
| K | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| K | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Ca | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Kettnerite | CaBiCO3OF |
| Ca | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Lime | CaO |
| Ca | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Ca | ⓘ Neltnerite | CaMn63+(SiO4)O8 |
| Ca | ⓘ Powellite | Ca(MoO4) |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| Ca | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| Ca | ⓘ Tilasite | CaMg(AsO4)F |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| Ca | ⓘ Volkonskoite | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Scapolite var. Wernerite | |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| Ca | ⓘ Aragonite var. Flos Ferri | CaCO3 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brookite | TiO2 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| V | Vanadium | |
| V | ⓘ Colusite | Cu13VAs3S16 |
| V | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| V | ⓘ Descloizite | PbZn(VO4)(OH) |
| V | ⓘ Mottramite | PbCu(VO4)(OH) |
| V | ⓘ Nekrasovite | Cu26V2(Sn,As,Sb)6S32 |
| V | ⓘ Nolanite | V83+Fe23+O14(OH)2 |
| V | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| V | ⓘ Sengierite | Cu2(UO2)2(VO4)2 · 6H2O |
| V | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| V | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Cr | ⓘ Volkonskoite | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| Mn | Manganese | |
| Mn | ⓘ Alabandite | MnS |
| Mn | ⓘ Bixbyite-(Mn) | Mn23+O3 |
| Mn | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Mn | ⓘ Cesàrolite | PbMn34+O6(OH)2 |
| Mn | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| Mn | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Mn | ⓘ Crednerite | Cu+Mn3+O2 |
| Mn | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| Mn | ⓘ Groutite | Mn3+O(OH) |
| Mn | ⓘ Hausmannite | Mn2+Mn23+O4 |
| Mn | ⓘ Hetaerolite | ZnMn2O4 |
| Mn | ⓘ Hübnerite | MnWO4 |
| Mn | ⓘ Hetaerolite var. Hydrohetaerolite | Zn(Mn,◻)2(O,OH)4 |
| Mn | ⓘ Jacobsite | Mn2+Fe23+O4 |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Neltnerite | CaMn63+(SiO4)O8 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Pyrite var. Gold-bearing Pyrite | FeS2 |
| Fe | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Fe | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Fe | ⓘ Bílinite | Fe2+Fe23+(SO4)4 · 22H2O |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bogdanovite | (Au,Te,Pb)3(Cu,Fe) |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Botryogen | MgFe3+(SO4)2(OH) · 7H2O |
| Fe | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Fe | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| Fe | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| Fe | ⓘ Cuprocopiapite | Cu2+Fe43+(SO4)6(OH)2 · 20H2O |
| Fe | ⓘ Delafossite | Cu+Fe3+O2 |
| Fe | ⓘ Chlorite Group var. Delessite | (Mg,Fe,Fe,Al)(Si,Al)4O10(O,OH)8 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ferricopiapite | Fe3+0.67Fe43+(SO4)6(OH)2 · 20H2O |
| Fe | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Fe | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Gormanite | (Fe2+,Mg)3(Al,Fe3+)4(PO4)4(OH)6 · 2H2O |
| Fe | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Fe | ⓘ Hocartite | Ag2(Fe2+,Zn)SnS4 |
| Fe | ⓘ Jacobsite | Mn2+Fe23+O4 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Kornelite | Fe2(SO4)3 · 7H2O |
| Fe | ⓘ Lepidocrocite | Fe3+O(OH) |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| Fe | ⓘ Metavoltine | K2Na6Fe2+Fe63+O2(SO4)12 · 18H2O |
| Fe | ⓘ Nolanite | V83+Fe23+O14(OH)2 |
| Fe | ⓘ Paracoquimbite | Fe4(SO4)6(H2O)12 · 6H2O |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Ransomite | CuFe2(SO4)4 · 6H2O |
| Fe | ⓘ Rhodostannite | Cu+(Fe2+0.5Sn4+1.5)S4 |
| Fe | ⓘ Rhomboclase | (H5O2)Fe3+(SO4)2 · 2H2O |
| Fe | ⓘ Römerite | Fe2+Fe23+(SO4)4 · 14H2O |
| Fe | ⓘ Rozenite | FeSO4 · 4H2O |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| Fe | ⓘ Siderotil | FeSO4 · 5H2O |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Fe | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Fe | ⓘ Szomolnokite | FeSO4 · H2O |
| Fe | ⓘ Volkonskoite | Ca0.3(Cr,Mg,Fe)2((Si,Al)4O10)(OH)2 · 4H2O |
| Fe | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Zincobotryogen | (Zn,Mg,Mn2+)Fe3+(SO4)2(OH) · 7H2O |
| Fe | ⓘ Zincocopiapite | ZnFe43+(SO4)6(OH)2 · 18H2O |
| Fe | ⓘ Hematite var. Specularite | Fe2O3 |
| Fe | ⓘ Fayalite-Forsterite Series | |
| Fe | ⓘ Variscite var. Ferrian Variscite | (Al,Fe)PO4 · 2H2O |
| Ni | Nickel | |
| Ni | ⓘ Melonite | NiTe2 |
| Ni | ⓘ Rammelsbergite | NiAs2 |
| Cu | Copper | |
| Cu | ⓘ Aikinite | CuPbBiS3 |
| Cu | ⓘ Anthonyite | Cu(OH,Cl)2 · 3H2O |
| Cu | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| Cu | ⓘ Atacamite | Cu2(OH)3Cl |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| Cu | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Cu | ⓘ Bogdanovite | (Au,Te,Pb)3(Cu,Fe) |
| Cu | ⓘ Boothite | Cu2+(H2O)6(SO4) · H2O |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Botallackite | Cu2(OH)3Cl |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Buttgenbachite | Cu19(NO3)2(OH)32Cl4 · 2H2O |
| Cu | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| Cu | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| Cu | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Cu | ⓘ Chalcostibite | CuSbS2 |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Claringbullite | Cu4ClF(OH)6 |
| Cu | ⓘ Colusite | Cu13VAs3S16 |
| Cu | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Cu | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Crednerite | Cu+Mn3+O2 |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Cuprocopiapite | Cu2+Fe43+(SO4)6(OH)2 · 20H2O |
| Cu | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| Cu | ⓘ Cupropavonite | Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| Cu | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Delafossite | Cu+Fe3+O2 |
| Cu | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Dioptase | CuSiO3 · H2O |
| Cu | ⓘ Djurleite | Cu31S16 |
| Cu | ⓘ Emplectite | CuBiS2 |
| Cu | ⓘ Enargite | Cu3AsS4 |
| Cu | ⓘ Famatinite | Cu3SbS4 |
| Cu | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Cu | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Cu | ⓘ Furutobeite | (Cu,Ag)6PbS4 |
| Cu | ⓘ Goldfieldite | (Cu4◻2)(Cu4Cu2+)Te4S12S |
| Cu | ⓘ Graemite | Cu[TeO3] · H2O |
| Cu | ⓘ Hodrušite | Cu8Bi12S22 |
| Cu | ⓘ Henryite | (Cu,Ag)3+xTe2 , with x ~ 0.40 |
| Cu | ⓘ Jalpaite | Ag3CuS2 |
| Cu | ⓘ Johannite | Cu(UO2)2(SO4)2(OH)2 · 8H2O |
| Cu | ⓘ Kësterite | Cu2ZnSnS4 |
| Cu | ⓘ Kiddcreekite | Cu6SnWS8 |
| Cu | ⓘ Kostovite | CuAuTe4 |
| Cu | ⓘ Krupkaite | CuPbBi3S6 |
| Cu | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| Cu | ⓘ Kuramite | Cu3SnS4 |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| Cu | ⓘ Luzonite | Cu3AsS4 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Cu | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| Cu | ⓘ Miersite | (Ag,Cu)I |
| Cu | ⓘ Mottramite | PbCu(VO4)(OH) |
| Cu | ⓘ Murdochite | Cu12Pb2O15Cl2 |
| Cu | ⓘ Nantokite | CuCl |
| Cu | ⓘ Nekrasovite | Cu26V2(Sn,As,Sb)6S32 |
| Cu | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| Cu | ⓘ Paramelaconite | Cu2+Cu22+O3 |
| Cu | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Cu | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| Cu | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| Cu | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Cu | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| Cu | ⓘ Ransomite | CuFe2(SO4)4 · 6H2O |
| Cu | ⓘ Rhodostannite | Cu+(Fe2+0.5Sn4+1.5)S4 |
| Cu | ⓘ Rickardite | Cu7Te5 |
| Cu | ⓘ Roquesite | CuInS2 |
| Cu | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Cu | ⓘ Sengierite | Cu2(UO2)2(VO4)2 · 6H2O |
| Cu | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| Cu | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| Cu | ⓘ Spertiniite | Cu(OH)2 |
| Cu | ⓘ Spionkopite | Cu39S28 |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Cu | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Cu | ⓘ Stromeyerite | AgCuS |
| Cu | ⓘ Teineite | Cu2+(Te4+O3) · 2H2O |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Tolbachite | CuCl2 |
| Cu | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Cu | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| Cu | ⓘ Velikite | Cu2HgSnS4 |
| Cu | ⓘ Wittichenite | Cu3BiS3 |
| Cu | ⓘ Yarrowite | Cu9S8 |
| Cu | ⓘ Tenorite var. Geltenorite | CuO |
| Cu | ⓘ Hoganite | Cu(CH3COO)2 · H2O |
| Cu | ⓘ Wittichenite var. Silver-bearing Wittichenite | (Cu,Ag)3BiS3 |
| Cu | ⓘ Bisbeeite | (Cu,Mg)SiO3 · nH2O |
| Cu | ⓘ Barlowite | Cu4BrF(OH)6 |
| Cu | ⓘ Eddavidite | Cu12Pb2O15Br2 |
| Zn | Zinc | |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Bianchite | Zn(H2O)6(SO4) |
| Zn | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| Zn | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| Zn | ⓘ Descloizite | PbZn(VO4)(OH) |
| Zn | ⓘ Gunningite | ZnSO4 · H2O |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hetaerolite | ZnMn2O4 |
| Zn | ⓘ Hocartite | Ag2(Fe2+,Zn)SnS4 |
| Zn | ⓘ Hetaerolite var. Hydrohetaerolite | Zn(Mn,◻)2(O,OH)4 |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Kësterite | Cu2ZnSnS4 |
| Zn | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| Zn | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Zn | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Zn | ⓘ Willemite | Zn2SiO4 |
| Zn | ⓘ Zincobotryogen | (Zn,Mg,Mn2+)Fe3+(SO4)2(OH) · 7H2O |
| Zn | ⓘ Zincocopiapite | ZnFe43+(SO4)6(OH)2 · 18H2O |
| As | Arsenic | |
| As | ⓘ Native Arsenic | As |
| As | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| As | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| As | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| As | ⓘ Colusite | Cu13VAs3S16 |
| As | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| As | ⓘ Enargite | Cu3AsS4 |
| As | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| As | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| As | ⓘ Luzonite | Cu3AsS4 |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Nekrasovite | Cu26V2(Sn,As,Sb)6S32 |
| As | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Rammelsbergite | NiAs2 |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Tilasite | CaMg(AsO4)F |
| Br | Bromine | |
| Br | ⓘ Bromargyrite | AgBr |
| Br | ⓘ Chlorargyrite var. Bromine-bearing Chlorargyrite | Ag(Cl,Br) |
| Br | ⓘ Barlowite | Cu4BrF(OH)6 |
| Br | ⓘ Eddavidite | Cu12Pb2O15Br2 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Mo | ⓘ Ilsemannite | Mo3O8 · nH2O |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Powellite | Ca(MoO4) |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Bromargyrite | AgBr |
| Ag | ⓘ Canfieldite | Ag8SnS6 |
| Ag | ⓘ Chlorargyrite | AgCl |
| Ag | ⓘ Cupropavonite | Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| Ag | ⓘ Dyscrasite | Ag3Sb |
| Ag | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Ag | ⓘ Chlorargyrite var. Bromine-bearing Chlorargyrite | Ag(Cl,Br) |
| Ag | ⓘ Eugenite | Ag11Hg2 |
| Ag | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Ag | ⓘ Furutobeite | (Cu,Ag)6PbS4 |
| Ag | ⓘ Hessite | Ag2Te |
| Ag | ⓘ Hocartite | Ag2(Fe2+,Zn)SnS4 |
| Ag | ⓘ Henryite | (Cu,Ag)3+xTe2 , with x ~ 0.40 |
| Ag | ⓘ Iodargyrite | AgI |
| Ag | ⓘ Jalpaite | Ag3CuS2 |
| Ag | ⓘ Krennerite | Au3AgTe8 |
| Ag | ⓘ Matildite | AgBiS2 |
| Ag | ⓘ Miersite | (Ag,Cu)I |
| Ag | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| Ag | ⓘ Petzite | Ag3AuTe2 |
| Ag | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Stromeyerite | AgCuS |
| Ag | ⓘ Stützite | Ag5-xTe3, x = 0.24-0.36 |
| Ag | ⓘ Sylvanite | AgAuTe4 |
| Ag | ⓘ Volynskite | AgBiTe2 |
| Ag | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Ag | ⓘ Wittichenite var. Silver-bearing Wittichenite | (Cu,Ag)3BiS3 |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| In | Indium | |
| In | ⓘ Roquesite | CuInS2 |
| Sn | Tin | |
| Sn | ⓘ Canfieldite | Ag8SnS6 |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Hocartite | Ag2(Fe2+,Zn)SnS4 |
| Sn | ⓘ Kësterite | Cu2ZnSnS4 |
| Sn | ⓘ Kiddcreekite | Cu6SnWS8 |
| Sn | ⓘ Kuramite | Cu3SnS4 |
| Sn | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Sn | ⓘ Nekrasovite | Cu26V2(Sn,As,Sb)6S32 |
| Sn | ⓘ Rhodostannite | Cu+(Fe2+0.5Sn4+1.5)S4 |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sn | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Sn | ⓘ Velikite | Cu2HgSnS4 |
| Sb | Antimony | |
| Sb | ⓘ Bindheimite | Pb2Sb2O6O |
| Sb | ⓘ Chalcostibite | CuSbS2 |
| Sb | ⓘ Dyscrasite | Ag3Sb |
| Sb | ⓘ Famatinite | Cu3SbS4 |
| Sb | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Sb | ⓘ Nekrasovite | Cu26V2(Sn,As,Sb)6S32 |
| Sb | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Te | Tellurium | |
| Te | ⓘ Altaite | PbTe |
| Te | ⓘ Bogdanovite | (Au,Te,Pb)3(Cu,Fe) |
| Te | ⓘ Calaverite | AuTe2 |
| Te | ⓘ Goldfieldite | (Cu4◻2)(Cu4Cu2+)Te4S12S |
| Te | ⓘ Graemite | Cu[TeO3] · H2O |
| Te | ⓘ Hessite | Ag2Te |
| Te | ⓘ Henryite | (Cu,Ag)3+xTe2 , with x ~ 0.40 |
| Te | ⓘ Kostovite | CuAuTe4 |
| Te | ⓘ Krennerite | Au3AgTe8 |
| Te | ⓘ Melonite | NiTe2 |
| Te | ⓘ Paratellurite | TeO2 |
| Te | ⓘ Petzite | Ag3AuTe2 |
| Te | ⓘ Rickardite | Cu7Te5 |
| Te | ⓘ Rucklidgeite | PbBi2Te4 |
| Te | ⓘ Stützite | Ag5-xTe3, x = 0.24-0.36 |
| Te | ⓘ Sylvanite | AgAuTe4 |
| Te | ⓘ Teineite | Cu2+(Te4+O3) · 2H2O |
| Te | ⓘ Tellurite | TeO2 |
| Te | ⓘ Native Tellurium | Te |
| Te | ⓘ Tellurobismuthite | Bi2Te3 |
| Te | ⓘ Tetradymite | Bi2Te2S |
| Te | ⓘ Volynskite | AgBiTe2 |
| I | Iodine | |
| I | ⓘ Iodargyrite | AgI |
| I | ⓘ Miersite | (Ag,Cu)I |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| W | Tungsten | |
| W | ⓘ Hübnerite | MnWO4 |
| W | ⓘ Kiddcreekite | Cu6SnWS8 |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Stolzite | Pb(WO4) |
| W | ⓘ Tungstenite | WS2 |
| Au | Gold | |
| Au | ⓘ Bogdanovite | (Au,Te,Pb)3(Cu,Fe) |
| Au | ⓘ Calaverite | AuTe2 |
| Au | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Au | ⓘ Native Gold | Au |
| Au | ⓘ Kostovite | CuAuTe4 |
| Au | ⓘ Krennerite | Au3AgTe8 |
| Au | ⓘ Petzite | Ag3AuTe2 |
| Au | ⓘ Sylvanite | AgAuTe4 |
| Hg | Mercury | |
| Hg | ⓘ Cinnabar | HgS |
| Hg | ⓘ Eugenite | Ag11Hg2 |
| Hg | ⓘ Velikite | Cu2HgSnS4 |
| Pb | Lead | |
| Pb | ⓘ Aikinite | CuPbBiS3 |
| Pb | ⓘ Altaite | PbTe |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| Pb | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Pb | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Bindheimite | Pb2Sb2O6O |
| Pb | ⓘ Bogdanovite | (Au,Te,Pb)3(Cu,Fe) |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Cesàrolite | PbMn34+O6(OH)2 |
| Pb | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Pb | ⓘ Cosalite | Pb2Bi2S5 |
| Pb | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| Pb | ⓘ Cupropavonite | Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| Pb | ⓘ Descloizite | PbZn(VO4)(OH) |
| Pb | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Pb | ⓘ Furutobeite | (Cu,Ag)6PbS4 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| Pb | ⓘ Krupkaite | CuPbBi3S6 |
| Pb | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Minium | Pb3O4 |
| Pb | ⓘ Mottramite | PbCu(VO4)(OH) |
| Pb | ⓘ Murdochite | Cu12Pb2O15Cl2 |
| Pb | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| Pb | ⓘ Plattnerite | PbO2 |
| Pb | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Rucklidgeite | PbBi2Te4 |
| Pb | ⓘ Stolzite | Pb(WO4) |
| Pb | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Pb | ⓘ Eddavidite | Cu12Pb2O15Br2 |
| Bi | Bismuth | |
| Bi | ⓘ Aikinite | CuPbBiS3 |
| Bi | ⓘ Bismite | Bi2O3 |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Cosalite | Pb2Bi2S5 |
| Bi | ⓘ Cupropavonite | Cu0.9Ag0.5Pb0.6Bi2.5S5 |
| Bi | ⓘ Emplectite | CuBiS2 |
| Bi | ⓘ Hodrušite | Cu8Bi12S22 |
| Bi | ⓘ Kettnerite | CaBiCO3OF |
| Bi | ⓘ Krupkaite | CuPbBi3S6 |
| Bi | ⓘ Matildite | AgBiS2 |
| Bi | ⓘ Rucklidgeite | PbBi2Te4 |
| Bi | ⓘ Tellurobismuthite | Bi2Te3 |
| Bi | ⓘ Tetradymite | Bi2Te2S |
| Bi | ⓘ Volynskite | AgBiTe2 |
| Bi | ⓘ Wittichenite | Cu3BiS3 |
| Bi | ⓘ Wittichenite var. Silver-bearing Wittichenite | (Cu,Ag)3BiS3 |
| U | Uranium | |
| U | ⓘ Bayleyite | Mg2(UO2)(CO3)3 · 18H2O |
| U | ⓘ Johannite | Cu(UO2)2(SO4)2(OH)2 · 8H2O |
| U | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| U | ⓘ Sengierite | Cu2(UO2)2(VO4)2 · 6H2O |
| U | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| U | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Uranopilite | (UO2)6(SO4)O2(OH)6 · 14H2O |
| U | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Bisbee,_Arizona |
|---|---|
| Wikidata ID: | Q79720 |
| GeoNames ID: | 5284905 |
Mindat Articles
From Biologist to Mineral Collector by Rolf LuetckeJack Hanley mine stories by Rolf Luetcke
Some Underground Experiences in Bisbee Arizona by Rolf Luetcke
Localities in this Region
- Arizona
- Cochise County
- Bisbee
- Atlanta Mine
- Atlas claim
- Bay State Mine
- Bisbee SE No. 1 Limestone occurrence
- Black Jack Mine
- Bounty Mine
- Brewery Gulch
- Calumet and Arizona group of claims
- Campbell Mine
- Cave Mine
- Cochise Project
- Cochise property
- Cole Mine
- Copper King Mine
- Copper Prince Mine
- Copperopolis Mine
- Crown King claim
- Dallas Mine
- Danville-Hanchetta claims
- Denn Mine
- Dreadnaught Mine
- Dubacher Canyon
- Escabrosa Ridge
- Galena Mine
- Garfield Mine
- Gold Gulch
- Gold Hill
- Bisbee
- Cochise County
- Arizona
- Cochise County
- Bisbee
- Gold Hill
- Hendricks Gulch
- Higgins Mine
- Ivanhoe Mine
- John D. Jr. claim
- Juniper Flats
- Lavender Pit
- ⭔Lavender pit area
- ⭔Lowell
- Lowell Mine
- Mammoth claim
- Marquette Mine
- Neptune Mine
- New York Mine
- Northwest of Bisbee
- Ohio Mine
- Queen Hill
- Ramsey Canyon
- Sacramento Hill
- Saginaw Mine
- Shattuck Mine
- Sunrise Shaft
- Superior Mine
- W.M.A. claim
- Wade Hampton Mine
- ⭔Warren
- Waterloo Mine
- White Tail Deer Mine
- Wolverine Mine
- Bisbee
- Cochise County
Other Regions, Features and Areas that Intersect
North AmericaContinent
- Sonoran DesertDesert
North America PlateTectonic Plate
- Basin and Range BasinsBasin
- Mazatzal DomainDomain
- Pedregosa BasinBasin
- Southern Basin and RangeWide Rift
USA
- Arizona
- Cochise County
- Mule MountainsMountain Range
- Warren Mining DistrictMining District
- Cochise County
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Bannister, F. A., Hey, Max H., Claringbull, G. F. (1950) Connellite, buttgenbachite, and tallingite. Mineralogical Magazine and Journal of the Mineralogical Society, 29 (211) 280-286 doi:10.1180/minmag.1950.029.211.04 [referring to connellite/'ceruleofibrite' from Bisbee]
Frondel, Clifford (1958) Systematic mineralogy of uranium and thorium. Bulletin 1064. US Geological Survey doi:10.3133/b1064
Pierce, Larry, Buseck, Peter R. (1978) Superstructuring in the bornite-digenite series: a high-resolution electron microscopy study. American Mineralogist, 63 (1-2) 1-16
Stegen, R.J., Wright, E., Bryant, D.G. (2005) Field Guide to the Warren (Bisbee) Mining District, Cochise County, Arizona - Guidebook for the Arizona Geological Society Spring Field Trip, April 30, 2005. Arizona Geological Society.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesArticlesLocalities in RegionOther RegionsReferences
Bisbee, Cochise County, Arizona, USA