Långban Mine, Långban Ore District, Filipstad, Värmland County, Swedeni
| Regional Level Types | |
|---|---|
| Långban Mine | Mine (Tourist Attraction) |
| Långban Ore District | Ore Field |
| Filipstad | Municipality |
| Värmland County | County |
| Sweden | Country |
Långban Mine, Långban Ore District, Bergslagen mining district, Sweden
This page kindly sponsored by Knut Eldjarn
Latitude & Longitude (WGS84):
59° 51' 19'' North , 14° 15' 53'' East
Latitude & Longitude (decimal):
Type:
Mine (Tourist Attraction) - last checked 2024
Köppen climate type:
Other Languages:
French:
Långban, Filipstad, Comté de Värmland, Suède
German:
Långban, Filipstad, Värmlands län, Schweden
Swedish:
Långban, Långbans Malmtrakt, Filipstads kommun, Värmlands län, Sverige
Catalan:
Långban, Filipstad, Comtat de Värmland, Suècia
Dutch:
Långban, Filipstad, Värmlands län, Zweden
Norwegian (Nynorsk):
Långban, Filipstad i Sverige, Värmlands län, Sverige
Portuguese:
Långban, Filipstad, Varmlândia, Suécia
Långban is a mine in Värmland in Sweden. It belongs to Filipstad Municipality, with the nearest city being Filipstad, 21 km south. It was systematically mined from 1711 to 1972 but has traces from the 15th century.
It has been described as one of the most mineral-rich places in the world. Over 300 different minerals have been identified in the area, and more than 70 of these have Långban as a type locality. Most mining was done for iron ore and manganese ore. After 1950, only dolomite was extracted.
Långbanshyttan is the name of an adjacent blast furnace and the adjacent house of the factory manager, where the brothers Nils and John Ericsson were born. The furnace was built in the 16th century and used until 1933. It was renovated in 1980-83 and is today a tourist attraction.
Metamorphosed manganese-iron deposit with extremely complex skarns and pegmatites. See also the related deposits of Jakobsberg, Harstigen, and Sjögruvan.
Note: It is prohibited by Swedish law to collect at certain places in Långban.
It has been described as one of the most mineral-rich places in the world. Over 300 different minerals have been identified in the area, and more than 70 of these have Långban as a type locality. Most mining was done for iron ore and manganese ore. After 1950, only dolomite was extracted.
Långbanshyttan is the name of an adjacent blast furnace and the adjacent house of the factory manager, where the brothers Nils and John Ericsson were born. The furnace was built in the 16th century and used until 1933. It was renovated in 1980-83 and is today a tourist attraction.
Metamorphosed manganese-iron deposit with extremely complex skarns and pegmatites. See also the related deposits of Jakobsberg, Harstigen, and Sjögruvan.
Note: It is prohibited by Swedish law to collect at certain places in Långban.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities332 valid minerals. 82 (TL) - type locality of valid minerals. 5 (FRL) - first recorded locality of unapproved mineral/variety/etc.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S |
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ Adelite (TL) Formula: CaMg(AsO4)(OH) Localities: Reported from at least 6 localities in this region. Colour: Pale yellowish grey to sulphur yellow. Description: First described fom Bergsråds sänkning by Sjögren (1891). |
| ⓘ Aegirine Formula: NaFe3+Si2O6 Fluorescence: No fluorescence References: King, Vandall T. (1983) World News on Mineral Occurrences. Rocks & Minerals, 58 (6) 285-288 doi:10.1080/00357529.1983.11767163as manganoan acmite Holtstam, Dan; Langhof, Jörgen; Friis, Henrik; Karlsson, Andreas; Erambert, Muriel (2024) Igelströmite, Fe3+(Sb3+Pb2+)O4, and manganoschafarzikite, Mn2+Sb3+2O4, two new members of the newly established minium group, from the Långban Mn–Fe deposit, Värmland, Sweden. European Journal of Mineralogy, 36 (2). 311-322 doi:10.5194/ejm-36-311-2024 |
| ⓘ Aegirine-augite Formula: (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 |
| ⓘ Aegirine-augite var. Urbanite (FRL) Formula: (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 Type Locality: |
| ⓘ Aikinite Formula: CuPbBiS3 Description: As inclusions in galena |
| ⓘ Akrochordite (TL) Formula: MnMn2Mn2(AsO4)2(OH)4(H2O)4 Localities: Colour: red brown with a peculiar yellowish tint Description: There were at least 3 different finds of akrochordite made at Långban:
Origially found as aggregtes of minuite sub-parallel crystals in small ammount in druses lined with unusually stable pyrochroite crystals and barite crystals. It was found in the "Japan" workings of the Långban mines, at a depth of about 100 meters. The first find consisted of seven specimens (Flink, 1922)
The second type was of a handful of specimens with pale pink aggregates of Akrochordite to 2 mm with Eveite, Brandtite and an unknown Mn-arsenate. (Moore et al.,1989)
A small find was also made on the dumps at the mine in the early 1990s consisting of very small (less than 1 mm) single crystals in fractures. (Knut Eldjarn, 2009) |
| ⓘ Alamosite Formula: PbSiO3 Habit: < 1mm large Colour: White References: |
| ⓘ Albite Formula: Na(AlSi3O8) References: |
| ⓘ Algodonite Formula: (Cu1-xAsx) Description: As microscopic intergrowths with silver and cuprostibite References: |
| ⓘ Allactite Formula: Mn2+7(AsO4)2(OH)8 Localities: Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Collegiegruvan stope, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Japan working, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Skottland stope, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Habit: Prismatic Colour: brownish red |
| ⓘ Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) Habit: Prismatic crystals Colour: Black Description: As small black, poorly developed, prismatic crystals in thin pegmatites cutting the Långban ore. |
| ⓘ Alleghanyite Formula: Mn2+5(SiO4)2(OH)2 Habit: Red patches up to 5 mm across. Colour: Red Description: In hausmannite-bearing dolomite rock |
| ⓘ 'α-Vredenburgite' (FRL) Formula: (Mn,Fe)3O4 Type Locality: |
| ⓘ Altaite Formula: PbTe Description: As myrmekitic intergrowths with galena (Burke 1986). References: |
| ⓘ Aminoffite (TL) Formula: Ca3(BeOH)2Si3O10 Localities: Description: Fluoresces orange in SW UV-light |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5(T8O22)W2 |
| ⓘ Andalusite Formula: Al2(SiO4)O |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 Localities: Dolomite dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Garden dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Hindenburg working, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden The Lake dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden |
| ⓘ Anhydrite Formula: CaSO4 |
| ⓘ Anilite Formula: Cu7S4 References: Identified by Gerhard Möhn and Joy DésorIdentification: XRD, SEM-EDS |
| ⓘ Antigorite Formula: Mg3(Si2O5)(OH)4 References: Metropolis, W.C. (1988) Two Flink unknowns from Långban identified, in Contributed Papers in Specimen Mineralogy: 15th Rochester Mineralogical Symposium. Rocks & Minerals, 63 (6). 456 doi:10.1080/00357529.1988.11761882Unknown #60 ("antigoritlike") = antigorite mixed with calcite |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A References: |
| ⓘ 'Apophyllite Group' Formula: AB4[Si8O20]X · 8H2O Localities: Reported from at least 7 localities in this region. |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Arakiite (TL) Formula: (Zn,Mn2+)(Mn2+,Mg)12(Fe3+,Al)2(As5+O4)2(As3+O3)(OH)23 Localities: |
| ⓘ Armangite (TL) Formula: Mn2+26(AsO3)14(HAsO3)4(CO3) Type Locality: Description: Short prismatic, twinning on {0221}, lamellar, color black, transparent in thin splinters…in calcite-barite veinlets with hematite and unidentified minerals. |
| ⓘ Arseniopleite Formula: NaCaMnMn2(AsO4)3 |
| ⓘ Arsenoclasite (TL) Formula: Mn2+5(AsO4)2(OH)4 Localities: Description: Found associated with sarkinite, adelite, allactite, calcite, dolomite and hausmannite. Crystals are rare, to 5 mm |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ 'Asbestos hedyphane' |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ Awaruite Formula: Ni3Fe Description: as microscopic inclusions |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 |
| ⓘ Baddeleyite Formula: ZrO2 References: |
| ⓘ Banalsite Formula: Na2BaAl4Si4O16 Fluorescence: A weak, reddish violet fluorescense in short-wave UV light. References: |
| ⓘ Barylite (TL) Formula: Be2Ba(Si2O7) Localities: Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Hindenburg working, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Garden dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden England stope, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Skottland stope, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Colour: White Fluorescence: Bluish, rarely orange to yellowish, but many shows no UW at all in SW Description: Often found in tilasite quartz veins(from the hyttsjö granite pegmatites???) Mostly overlooked as feldspar. |
| ⓘ Barysilite Formula: Pb8Mn2+[Si2O7]3 Localities: Norrbotten working, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Japan working, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Lukas working, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden |
| ⓘ Baryte Formula: BaSO4 Localities: Reported from at least 8 localities in this region. |
| ⓘ Barytocalcite Formula: BaCa(CO3)2 |
| ⓘ Bementite Formula: Mn7Si6O15(OH)8 |
| ⓘ Benstonite Formula: Ba6Ca6Mg(CO3)13 |
| ⓘ Bergslagite (TL) Formula: CaBeAsO4(OH) Type Locality: Colour: grey |
| ⓘ Berzeliite (TL) Formula: (NaCa2)Mg2(AsO4)3 Localities: Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Collegiegruvan stope, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Bjelke's shaft dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden England stope, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Garden dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden |
| ⓘ Betekhtinite Formula: Pb2(Cu,Fe)22-24S15 |
| ⓘ Bindheimite Formula: Pb2Sb2O6O |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Biotite var. Manganophyllite' Formula: K(Fe,Mg,Mn)3AlSi3O10(OH)2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ Bixbyite-(Mn) Formula: Mn3+2O3 Localities: Habit: Cubes to 3mm Colour: black Description: with inclusions of "manganophyllite" |
| ⓘ Blatterite Formula: Sb5+3(Mn3+,Fe3+)9(Mn2+,Mg)35(BO3)16O32 |
| ⓘ Blixite (TL) Formula: Pb8O5(OH)2Cl4 Localities: |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Brandtite Formula: Ca2Mn2+(AsO4)2 · 2H2O |
| ⓘ Braunite Formula: Mn2+Mn3+6(SiO4)O8 Localities: Bergsråds sänkning, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Bjelke's shaft dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Bolivia stope, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Skottland stope, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden |
| ⓘ Britvinite (TL) Formula: [Pb7(OH)3F(BO3)2(CO3)][Mg4.5(OH)3(Si5O14)] Type Locality: References: |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 References: Identified by Gerhard Möhn and Joy DésorIdentification: Wet Chemical, SEM-EDS |
| ⓘ Bromellite (TL) Formula: BeO Localities: |
| ⓘ Brucite Formula: Mg(OH)2 |
| ⓘ Brucite var. Manganese-bearing Brucite Formula: Mg(OH)2 |
| ⓘ Brugnatellite ? Formula: Mg6Fe3+(CO3)(OH)13 · 4H2O Description: A sample analyzed by XRd (Uta Müller), further investigation is needed to confirm the identity (Blatter 2003) References: |
| ⓘ Bustamite Formula: CaMn2+(Si2O6) |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 13 localities in this region. |
| ⓘ Calcite var. Manganese-bearing Calcite Formula: (Ca,Mn)CO3 |
| ⓘ Carlfrancisite Formula: Mn2+3(Mn2+,Mg,Fe3+,Al)42[As3+O3]2(As5+O4)4[(Si,As5+)O4]6[(As5+,Si)O4]2(OH)42 |
| ⓘ Caryinite (TL) Formula: (Na,Pb)(Ca,Na)CaMn2+2(AsO4)3 Localities: |
| ⓘ Caryopilite Formula: Mn2+3Si2O5(OH)4 |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Celsian Formula: Ba(Al2Si2O8) |
| ⓘ Cerussite Formula: PbCO3 |
| ⓘ 'Chabazite' |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ 'Chlorite Group' |
| ⓘ Chondrodite Formula: Mg5(SiO4)2F2 Description: It has been found as dull, brown altered masses up 10 cm in size. The core of these aggregates may be unaltered, vitruous orange-brown chondrodite |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinochlore var. Pennine Formula: Mg5Al(AlSi3O10)(OH)8 Description: Socalled "manganpennin" References: |
| ⓘ 'Clinochrysotile' Formula: Mg3(Si2O5)(OH)4 |
| ⓘ Clino-ferro-suenoite Formula: ◻Mn2+2(Fe2+5)(Si8O22)(OH)2 Description: Samples in NHM, London marked as coming from near the village of Långban, cfr. Reece & Redfern (2004). References: |
| ⓘ Clinohumite Formula: Mg9(SiO4)4F2 Description: clinohumite occurs in carbonate veins in hausmannite and phlogopite bearing dolomite. It has been found as red-brown crystals up to one cm in this association. It has also been found in a skarn paragenesis |
| ⓘ 'Clinopyroxene Subgroup' Localities: Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden The Pole dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Hindenburg working, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden The Lake dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Anrikningsverk dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ Cobaltpentlandite Formula: Co9S8 |
| ⓘ Conichalcite Formula: CaCu(AsO4)(OH) |
| ⓘ Cordierite Formula: Mg2Al4Si5O18 |
| ⓘ Covellite Formula: CuS |
| ⓘ Crednerite Formula: Cu+Mn3+O2 |
| ⓘ Cubanite Formula: CuFe2S3 |
| ⓘ Cuprite Formula: Cu2O |
| ⓘ Cuprostibite Formula: Cu2(Sb,Tl) |
| ⓘ Cymrite Formula: BaAl2Si2(O,OH)8 · H2O Fluorescence: Greenish white |
| ⓘ Cyprine ? Formula: Ca19Cu2+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 Description: Only visually identified. References: |
| ⓘ Datolite Formula: CaB(SiO4)(OH) |
| ⓘ Digenite Formula: Cu9S5 |
| ⓘ Diopside Formula: CaMgSi2O6 Localities: Reported from at least 7 localities in this region. |
| ⓘ Diopside var. Schefferite Formula: (Ca,Mn)(Mg,Fe,Mn)Si2O6 Localities: Anrikningsverk dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden The Pole dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden The Lake dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Garden dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden |
| ⓘ Dixenite (TL) Formula: CuMn2+14Fe2+(SiO4)2(As5+O4)(As3+O3)5(OH)6 Type Locality: |
| ⓘ Djurleite Formula: Cu31S16 |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: Reported from at least 11 localities in this region. |
| ⓘ Domeykite Formula: Cu3As |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Ecdemite (TL) Formula: Pb6As3+2O7Cl4 Type Locality: |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Ericssonite (TL) Formula: BaMn2+2Fe3+(Si2O7)O(OH) Type Locality: |
| ⓘ 'Ericssonite-2O' (FRL) Formula: BaMn2+2Fe3+(Si2O7)O(OH) Type Locality: |
| ⓘ Erssonite (TL) Formula: Mg7Fe3+2(OH)18[Ca(H2O)6](SO4)2 · 12H2O Type Locality: References: Miyawaki, Ritsuro, Hatert, Frédéric, Pasero, Marco, Mills, Stuart J. (2021) IMA Commission on New Minerals, Nomenclature and Classification (CNMNC) – Newsletter 61. European Journal of Mineralogy, 33 (3) 299-304 doi:10.5194/ejm-33-299-2021 Zhitova, Elena S., Chukanov, Nikita V., Jonsson, Erik, Pekov, Igor V., Belakovskiy, Dmitry I., Vigasina, Marina F., Zubkova, Natalia V., Van, Konstantin V., Britvin, Sergey N. (2021) Erssonite, CaMg7Fe3+2(OH)18(SO4)2⋅12H2O, a new hydrotalcite-supergroup mineral from Långban, Sweden. Mineralogical Magazine, 85 (5) 817-826 doi:10.1180/mgm.2021.70 |
| ⓘ Eveite (TL) Formula: Mn2+2(AsO4)(OH) Type Locality: References: |
| ⓘ Feitknechtite Formula: Mn3+O(OH) |
| ⓘ Ferri-winchite ? Formula: ◻(NaCa)(Mg4Fe3+)Si8O22(OH)2 Description: Ferri.winchite has been presented based on testing by Manfred Schaeffer. The test method and result has not been revealed. The material occurs as small yellow-brown aggregates resembling richterite. |
| ⓘ Ferro-actinolite Formula: ◻Ca2Fe2+5(Si8O22)(OH)2 |
| ⓘ Ferrorhodonite Formula: CaMn3Fe[Si5O15] References: |
| ⓘ Filipstadite (TL) Formula: (Fe3+0.5Sb5+0.5)Mn2O4 Localities: |
| ⓘ Finnemanite (TL) Formula: Pb5(AsO3)3Cl Localities: Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Garden dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Anrikningsverk dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Hindenburg working, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden |
| ⓘ Flinkite Formula: Mn2+2Mn3+(AsO4)(OH)4 |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ 'Fluorapophyllite' |
| ⓘ Fluorapophyllite-(K) Formula: KCa4(Si8O20)(F,OH) · 8H2O |
| ⓘ Fluorcalcioroméite Formula: (Ca,Na,◻)2Sb5+2(O,OH)6F References: Holtstam, Dan; Langhof, Jörgen; Friis, Henrik; Karlsson, Andreas; Erambert, Muriel (2024) Igelströmite, Fe3+(Sb3+Pb2+)O4, and manganoschafarzikite, Mn2+Sb3+2O4, two new members of the newly established minium group, from the Långban Mn–Fe deposit, Värmland, Sweden. European Journal of Mineralogy, 36 (2). 311-322 doi:10.5194/ejm-36-311-2024 |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ 'Fluornatroroméite' Formula: (Na,Ca)2Sb2(O,OH)6F Description: Composition of the mineral is (Na1.03Ca0.97)2.00(Sb1.83Fe3+0.17)2.00O5.63F1.37 |
| ⓘ 'Fluoro-arfvedsonite' ? Formula: NaNa2(Fe2+4Fe3+)Si8O22F2 |
| ⓘ Forsterite Formula: Mg2(SiO4) |
| ⓘ Franklinite Formula: Zn2+Fe3+2O4 |
| ⓘ Fredrikssonite (TL) Formula: Mg2Mn3+O2(BO3) Localities: Habit: Longprismatic, striated. Colour: Black to brown |
| ✪ Freedite (TL) Formula: Cu+Pb8(AsO3)2O3Cl5 Type Locality: Habit: Fibrous Colour: yellow |
| ⓘ Freieslebenite Formula: AgPbSbS3 |
| ⓘ Friedelite Formula: Mn2+8Si6O15(OH,Cl)10 |
| ⓘ Friisite (TL) Formula: Pb8Al3Si8O27Cl3 Type Locality: |
| ⓘ Gabrielsonite (TL) Formula: PbFe3+(As3+O3)O Type Locality: References: |
| ⓘ Gahnite Formula: ZnAl2O4 |
| ⓘ Galaxite Formula: Mn2+Al2O4 References: |
| ⓘ Galena Formula: PbS Localities: Kongress Dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Garden dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Anrikningsverk dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden |
| ⓘ Ganomalite (TL) Formula: Pb9Ca5Mn(Si2O7)4(SiO4)O Type Locality: Habit: Single crystal masses Colour: Greyish-white References: Nordenskiöld, A. E. (1877) Nya Mineralier från Långban. 6. Ganomalit, in Mineralogiska meddelanden. Geologiska Föreningen i Stockholm Förhandlingar, 3 (12). 382-384 doi:10.1080/11035897709446407 |
| ⓘ Ganophyllite Formula: (K,Na)xMn2+6(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) References: |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 Localities: Anrikningsverk dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Japan working, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Norrbotten working, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden The Pole dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Hindenburg working, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden |
| ⓘ Gasparite-(Ce) Formula: Ce(AsO4) References: |
| ⓘ Gatedalite (TL) Formula: ZrMn2+2Mn3+4SiO12 Type Locality: |
| ⓘ Gedrite Formula: ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| ⓘ Geikielite Formula: MgTiO3 References: |
| ⓘ 'Glauconite' Formula: K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Gonyerite (TL) Formula: Mn2+5Fe3+(Fe3+Si3O10)(OH)8 Localities: Habit: Flaky, rosettes Colour: Golden brown |
| ⓘ Graphite Formula: C |
| ⓘ Greenockite ? Formula: CdS |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 |
| ⓘ Grossular var. Hibschite Formula: Ca3Al2(SiO4)3-x(OH)4x |
| ⓘ Gypsum Formula: CaSO4 · 2H2O References: |
| ⓘ Hancockite Formula: (CaPb)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Harmotome Formula: Ba2(Si12Al4)O32 · 12H2O |
| ⓘ Hausmannite Formula: Mn2+Mn3+2O4 Localities: Reported from at least 10 localities in this region. |
| ⓘ Hedenbergite Formula: CaFe2+Si2O6 References: |
| ⓘ Hedyphane (TL) Formula: Ca2Pb3(AsO4)3Cl Localities: Reported from at least 7 localities in this region. Habit: Masses and veins Colour: Greyish to yellowish to greenish, greasy luster |
| ⓘ 'Hedyphane Group' |
| ⓘ Helvine Formula: Be3Mn2+4(SiO4)3S |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 11 localities in this region. |
| ⓘ Hematite var. Specularite Formula: Fe2O3 References: Holtstam, Dan; Langhof, Jörgen; Friis, Henrik; Karlsson, Andreas; Erambert, Muriel (2024) Igelströmite, Fe3+(Sb3+Pb2+)O4, and manganoschafarzikite, Mn2+Sb3+2O4, two new members of the newly established minium group, from the Långban Mn–Fe deposit, Värmland, Sweden. European Journal of Mineralogy, 36 (2). 311-322 doi:10.5194/ejm-36-311-2024 |
| ⓘ Hematolite Formula: (Mn,Mg,Al,Fe3+)15(As5+O4)2(As3+O3)(OH)23 |
| ⓘ Henritermierite Formula: Ca3Mn3+2(SiO4)2[◻(OH)4] |
| ⓘ Hetaerolite Formula: ZnMn2O4 |
| ⓘ Hiärneite (TL) Formula: Ca2Zr4Mn3+SbTiO16 Type Locality: |
| ⓘ Hisingerite Formula: Fe3+2(Si2O5)(OH)4 · 2H2O |
| ⓘ Hjalmarite (TL) Formula: Na(NaMn)Mg5(Si8O22)(OH)2 Type Locality: Habit: Hjalmarite occurs as short-prismatic subhedral crystals 0.2–1 by 1–5 mm Colour: The macroscopic color is gray-white Description: Hjalmarite was first found in Långban, where it is found in dense Mn-rich skarn associated mainly with rhodonite and quartz. |
| ⓘ Holtstamite Formula: Ca3Al2(SiO4)2[◻(OH)4] Description: Originally identified as henritermierite at the BRGM in France as coming from a new occurrence in Långban Mine, Sweden, but later recognized as a new occurrence of holstamite, instead. |
| ⓘ Hörnesite Formula: Mg3(AsO4)2 · 8H2O |
| ⓘ Hugotibergite (TL) Formula: Ca6CaPb2(Si3O9)2(SO4)2(OH)2(H2O)4 Type Locality: |
| ⓘ Hyalotekite (TL) Formula: (Ba,Pb,K)4(Ca,Y)2(B,Be)2(Si,B)2Si8O28(F,Cl) Type Locality: Habit: Flaky Colour: Colorless to white to grey |
| ⓘ Hydrocerussite (TL) Formula: Pb3(CO3)2(OH)2 Type Locality: References: Nordenskiöld, A. E. (1877) Nya Mineralier från Långban. 4. Hydrocerussit, in Mineralogiska meddelanden. Geologiska Föreningen i Stockholm Förhandlingar, 3 (12). 381-382 doi:10.1080/11035897709446407 Kokkoros, P., Vassiliadis, K. (1953) Röntgenkristallographie von Hydrocerussit. Tschermaks Mineralogische und Petrographische Mitteilungen, 3 (4). 298-304 doi:10.1007/bf01135346 Holtstam, Dan; Langhof, Jörgen; Friis, Henrik; Karlsson, Andreas; Erambert, Muriel (2024) Igelströmite, Fe3+(Sb3+Pb2+)O4, and manganoschafarzikite, Mn2+Sb3+2O4, two new members of the newly established minium group, from the Långban Mn–Fe deposit, Värmland, Sweden. European Journal of Mineralogy, 36 (2). 311-322 doi:10.5194/ejm-36-311-2024 |
| ⓘ 'Hydrohausmannite' (FRL) Type Locality: |
| ⓘ Hydrotalcite Formula: Mg6Al2(CO3)(OH)16 · 4H2O References: |
| ⓘ Hydroxycalcioroméite Formula: (Ca,Sb3+)2(Sb5+,Ti)2O6(OH) Description: Composition of the mineral is (Ca1.39Na0.23Mn0.10Pb0.08Bi0.07)1.87(Sb1.64Ti0.25Fe3+0.11)2.00O6.11OH0.89 |
| ⓘ Hydroxylhedyphane (TL) Formula: Ca2Pb3(AsO4)3(OH) Type Locality: Habit: columnar to fibrous Colour: shades of white Description: Based on Dunn et al (1985) and Biagioni et al (2019) only some of this fibrous/columnar material also knonw as "asbestos hedyphane" has been demonstrated via analyses to be (OH) dominant. Consequently, unanalyzed specimens should be posted under "Hedyphane group". References: Dunn, Pete J., Rouse, Roland C., Nelen, Joseph A. (1985) Hydroxyl-bearing hedyphane from Långban Sweden. Geologiska Föreningen i Stockholm Förhandlingar, 107 (4) 325-327 doi:10.1080/11035898609453084 |
| ⓘ Hyttsjöite (TL) Formula: Pb18Ba2Ca5Mn2+2Fe3+2Si30O90Cl · 6H2O Type Locality: |
| ⓘ Igelströmite (TL) Formula: Fe3+(Sb3+Pb2+)O4 Type Locality: Description: With a good probability, the specimens of the two new minerals originate from the Hindenburg working in the mine, where most of the nadorite specimens of the present type were encountered (Flink, 1923). The label assigned to the igelströmite type sample states the Japan drift, but this might be an error, a mere confusion through the association with Flink's no. 66. Hindenburg was mined for Fe and Mn ore at the 150 m level, from 1916 to 1928 and was finally worked through into the England stope at the 165 m level (Magnusson, 1930). References: Miyawaki, Ritsuro, Hatert, Frédéric, Pasero, Marco, Mills, Stuart J. (2021) Newsletter 62. Mineralogical Magazine, 85 (4) 634-638 doi:10.1180/mgm.2021.62 Holtstam, Dan; Langhof, Jörgen; Friis, Henrik; Karlsson, Andreas; Erambert, Muriel (2024) Igelströmite, Fe3+(Sb3+Pb2+)O4, and manganoschafarzikite, Mn2+Sb3+2O4, two new members of the newly established minium group, from the Långban Mn–Fe deposit, Värmland, Sweden. European Journal of Mineralogy, 36 (2). 311-322 doi:10.5194/ejm-36-311-2024 |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Ilvaite Formula: CaFe3+Fe2+2(Si2O7)O(OH) |
| ⓘ Inesite Formula: Ca2(Mn,Fe)7Si10O28(OH)2 · 5H2O |
| ⓘ Ingersonite (TL) Formula: Ca3Mn2+Sb5+4O14 Localities: |
| ⓘ Jacobsite Formula: Mn2+Fe3+2O4 Localities: Anrikningsverk dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Garden dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden The Pole dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden |
| ⓘ 'Jacobsite-Magnetite Series' |
| ⓘ 'Jacobsite-Q' Formula: Mn2+(Fe3+,Mn3+)2O4 |
| ⓘ Jagoite (TL) Formula: Pb18Fe3+4[Si4(Si,Fe3+)6][Pb4Si16(Si,Fe)4]O82Cl6 Type Locality: References: |
| ⓘ Joesmithite (TL) Formula: Pb2+Ca2(Mg3Fe3+2)(Si6Be2)O22(OH)2 Localities: Habit: Prismatic crystals Colour: Dark Brown |
| ⓘ Johannsenite Formula: CaMn2+Si2O6 |
| ⓘ Johnbaumite Formula: Ca5(AsO4)3(OH) Description: According to Eldjarn (2023) , 30 samples of "svabites" were collected at different spots in the dumps and analyzed with SEM-EDS, of them only 2 were found to be svabite, 2 were turneaureite and the rest johnbaumites. It is not possible to visually distinguish between the three.
See also messageboard at https://www.mindat.org/mesg-678557.html
|
| ⓘ Julgoldite-(Fe2+) (TL) Formula: Ca2Fe2+Fe3+2[Si2O6OH][SiO4](OH)2(OH) Localities: |
| ⓘ Julgoldite-(Fe3+) (TL) Formula: Ca2Fe3+Fe3+2[Si2O6OH][SiO4](OH)2O Type Locality: |
| ⓘ 'Julgoldite Subgroup' Formula: Ca2XFe3+2[Si2O6(OH)][SiO4](OH)2A Locality: Anrikningsverk dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Description: Euhedral julgoldite and minor ilvaite occurs in radially oriented crystals in an iron skarn ( Nysten 2016) |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 References: |
| ⓘ Katoptrite Formula: (Mn2+,Mg)13(Al,Fe3+)4Sb5+2(SiO4)2O20 |
| ⓘ Kentrolite Formula: Pb2Mn3+2(Si2O7)O2 |
| ⓘ Kinoshitalite Formula: (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| ⓘ Koutekite Formula: Cu5As2 |
| ⓘ Kutnohorite Formula: CaMn2+(CO3)2 |
| ⓘ 'Lamprophanite' References: |
| ⓘ Lanarkite Formula: Pb2(SO4)O |
| ⓘ Langhofite (TL) Formula: Pb2(OH)[WO4(OH)] Type Locality: |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O |
| ⓘ Långbanite (TL) Formula: Mn2+4Mn3+9Sb5+O16(SiO4)2 Localities: |
| ⓘ Långbanshyttanite (TL) Formula: Pb2Mn2Mg(AsO4)2(OH)4 · 6H2O Type Locality: References: Chukanov, Nikita V., Pekov, Igor V., Jonsson, Erik, Zubkova, Natalia V., Filinchuk, Yaroslav E., Belakovskiy, Dmitriy I., Pushcharovsky, Dmitry Y.U. (2011) Långbanshyttanite, a new low-temperature arsenate mineral with a novel structure from Långban, Sweden. European Journal of Mineralogy, 23 (4) 675-681 doi:10.1127/0935-1221/2011/0023-2120 |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O References: |
| ⓘ Lepidocrocite Formula: Fe3+O(OH) References: |
| ⓘ Leucophoenicite Formula: Mn2+7(SiO4)3(OH)2 References: Gatedal, Kjell (n.d.) Personal Communication.1st Jan 1970 |
| ⓘ 'Limonite' References: Holtstam, Dan; Langhof, Jörgen; Friis, Henrik; Karlsson, Andreas; Erambert, Muriel (2024) Igelströmite, Fe3+(Sb3+Pb2+)O4, and manganoschafarzikite, Mn2+Sb3+2O4, two new members of the newly established minium group, from the Långban Mn–Fe deposit, Värmland, Sweden. European Journal of Mineralogy, 36 (2). 311-322 doi:10.5194/ejm-36-311-2024 |
| ⓘ Litharge Formula: PbO |
| ⓘ Lizardite Formula: Mg3(Si2O5)(OH)4 References: |
| ⓘ Löllingite Formula: FeAs2 |
| ⓘ Ludwigite Formula: Mg2Fe3+(BO3)O2 References: Gatedal, Kjell (n.d.) Personal Communication.13th Dec 2007 + Fritz Blatter |
| ✪ Macedonite Formula: PbTiO3 Habit: Usually pseudohexagonal xls Colour: Brown (pseudohexagonal), yellow (cubic) Fluorescence: No fluorescence Description: Nearly always found together with magnetoplumbite-kentrolite-melanotekite, also found in a skarn banded chert and together with vesuvianite-zoisite-titanite-zircon-löllingite-Pb-As-mimetite-cerussite. |
| ⓘ Magnesioferrite Formula: MgFe3+2O4 |
| ⓘ Magnesio-hastingsite Formula: NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| ⓘ Magnesio-hornblende Formula: ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 References: Identified by Gerhard Möhn and Joy DésorIdentification: SEM-EDS |
| ⓘ Magnesiotaaffeite-2N’2S Formula: Mg3Al8BeO16 Habit: Hexagonal platy singel crystals Colour: Brown Description: Crystals up to 3mm in a dolomite rock,even as platy vein fillings. Might be overlooked as mica due to it's similarety. |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 7 localities in this region. |
| ⓘ Magnetite var. Zinc-bearing Magnetite Formula: (Fe,Zn)Fe3O4 References: |
| ⓘ Magnetoplumbite (TL) Formula: PbFe3+12O19 Localities: Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden The Lake dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Amerika stope, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Bolivia stope, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden |
| ⓘ Magnussonite (TL) Formula: Mn2+10(As3+O3)6(OH,Cl)2 Type Locality: Habit: Euhedral crystal > 1mm Colour: Bluish green to pale green Description: 23.16
References: |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Manganarsite (TL) Formula: Mn3(As2O4)(OH)4 Type Locality: |
| ⓘ Manganberzeliite Formula: (NaCa2)Mn2+2(AsO4)3 |
| ⓘ Manganhumite Formula: Mn2+7(SiO4)3(OH)2 Description: is found as a rarity as an ordered intergrowth of sonolite |
| ⓘ Mangani-pargasite (TL) Formula: NaCa2(Mg4Mn3+)(Si6Al2)O22(OH)2 Type Locality: |
| ⓘ Manganite Formula: Mn3+O(OH) |
| ⓘ Manganohörnesite (TL) Formula: Mn2+3(AsO4)2 · 8H2O Type Locality: References: |
| ⓘ Manganoschafarzikite (TL) Formula: MnSb2O4 Type Locality: Description: With a good probability, the specimens of the two new minerals originate from the Hindenburg working in the mine, where most of the nadorite specimens of the present type were encountered (Flink, 1923). The label assigned to the igelströmite type sample states the Japan drift, but this might be an error, a mere confusion through the association with Flink's no. 66. Hindenburg was mined for Fe and Mn ore at the 150 m level, from 1916 to 1928 and was finally worked through into the England stope at the 165 m level (Magnusson, 1930). References: Bosi, Ferdinando, Hatert, Frédéric, Pasero, Marco, Mills, Stuart J. (2023) Newsletter 72. Mineralogical Magazine, 87 (3) 512-518 doi:10.1180/mgm.2023.21 Holtstam, Dan; Langhof, Jörgen; Friis, Henrik; Karlsson, Andreas; Erambert, Muriel (2024) Igelströmite, Fe3+(Sb3+Pb2+)O4, and manganoschafarzikite, Mn2+Sb3+2O4, two new members of the newly established minium group, from the Långban Mn–Fe deposit, Värmland, Sweden. European Journal of Mineralogy, 36 (2). 311-322 doi:10.5194/ejm-36-311-2024 |
| ⓘ Manganosite (TL) Formula: MnO Type Locality: |
| ⓘ Manganostibite Formula: (Mn,Fe)7SbAsO12 Habit: Bean like grains Colour: Black, small crystals brown in thin section. Fluorescence: No UW Description: Found in thin sections together with manganosite.
Found as anhedral crystals less than 0.5mm together with hausmannite, calcite (Gatedal 2003) References: |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Margarosanite Formula: Ca2PbSi3O9 Localities: Bjelke's shaft dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Lukas working, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Bolivia stope, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden |
| ⓘ Marialite Formula: Na4Al3Si9O24Cl References: |
| ⓘ Massicot Formula: PbO |
| ⓘ Melanostibite Formula: Mn2+2Fe3+Sb5+O6 |
| ⓘ Melanotekite (TL) Formula: Pb2Fe3+2(Si2O7)O2 Localities: |
| ⓘ Mendipite Formula: Pb3Cl2O2 References: |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Microcline var. Hyalophane Formula: (K,Ba)[Al(Si,Al)Si2O8] References: |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl |
| ⓘ Minium Formula: Pb3O4 Description: rich earthy masses with native lead References: |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Molybdophyllite (TL) Formula: Pb8Mg9[Si10O28(OH)8O2(CO3)3] · H2O Type Locality: |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) References: |
| ⓘ Monimolite Formula: Pb2Sb5+2O7 |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O Description: brownish grains up to 2 mm References: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Nadorite Formula: PbSbClO2 Localities: Hindenburg working, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Dolomite dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Garden dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden |
| ⓘ Nasonite Formula: Pb6Ca4(Si2O7)3Cl2 |
| ⓘ Native Antimony Formula: Sb |
| ⓘ Native Arsenic Formula: As |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Copper Formula: Cu |
| ⓘ Native Lead Formula: Pb Localities: Garden dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Bulgarien stope, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Bolivia stope, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden |
| ⓘ Native Silver Formula: Ag |
| ⓘ Natrolite Formula: Na2Al2Si3O10 · 2H2O |
| ⓘ Neotocite Formula: (Mn,Fe)SiO3 · H2O (?) |
| ⓘ Nisbite Formula: NiSb2 |
| ⓘ Norsethite Formula: BaMg(CO3)2 |
| ⓘ Olmiite Formula: CaMn2+[SiO3(OH)](OH) |
| ⓘ Opal Formula: SiO2 · nH2O Description: Flink's unknown #75, a reddish brown coating on impure gray marble with botryoids up to 1 mm, is identi
fied as opal, yielding a tridymite X-ray pattern) Metropolis (1988). |
| ⓘ Orpiment Formula: As2S3 |
| ⓘ Orthoclase Formula: K(AlSi3O8) References: |
| ⓘ Orthopinakiolite (TL) Formula: (Mg,Mn2+)2Mn3+(BO3)O2 Localities: |
| ⓘ Oxycalcioroméite Formula: Ca2Sb2O6O |
| ⓘ Oxyplumboroméite Formula: Pb2Sb2O6O |
| ⓘ Pargasite Formula: NaCa2(Mg4Al)(Si6Al2)O22(OH)2 Description: A darkred cherry-red manganian (Mn3+) plumbian pargasite was described by Jonsson & Hålenius (2010). |
| ⓘ Parwelite (TL) Formula: Mn10Sb2As2Si2O24 Type Locality: Description: 10 specimens acquired listed in the database of Riksmusset in Stockholm + a couple of others in priavte collections. References: |
| ⓘ Paulmooreite (TL) Formula: Pb2[As2O5] Type Locality: References: Dunn, Pete J., Peacor, Donald R., Sturman, B. Darko (1979) Paulmooreite, a new lead arsenite mineral from Långban, Sweden. American Mineralogist, 64 (3-4) 352-354 Araki, Takaharu, Moore, Paul B., Brunton, George D. (1980) The crystal structure of paulmooreite, Pb2[As2O5]: dimeric arsenite groups. American Mineralogist, 65 (3-4) 340-345 |
| ⓘ Pectolite Formula: NaCa2Si3O8(OH) |
| ⓘ Pennantite Formula: Mn2+5Al(AlSi3O10)(OH)8 |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 |
| ⓘ Periclase Formula: MgO |
| ⓘ Perite (TL) Formula: PbBiClO2 Type Locality: References: |
| ⓘ Phenakite Formula: Be2SiO4 References: |
| ⓘ 'Phillipsite Subgroup' Formula: (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| ⓘ Philolithite (TL) Formula: Pb12Mn2+(Mg,Mn2+)2(Mn2+,Mg)4(CO3)4(SO4)O6(OH)12Cl4 Type Locality: References: |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 Localities: Dolomite dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Garden dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Anrikningsverk dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Rämsorten workings, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden |
| ⓘ Piemontite Formula: (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| ⓘ Pinakiolite (TL) Formula: (Mg,Mn2+)2Mn3+(BO3)O2 Localities: |
| ⓘ Pinakiolite var. Sb-rich pinakiolite Formula: Mg1.90Mn0.91Sb0.19O2BO3 References: |
| ⓘ Plumbonacrite Formula: Pb5O(OH)2(CO3)3 References: |
| ⓘ Potassic-richterite Formula: K(CaNa)Mg5(Si8O22)(OH)2 |
| ⓘ Powellite Formula: Ca(MoO4) |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 |
| ⓘ Pyrargyrite Formula: Ag3SbS3 |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyroaurite (TL) Formula: Mg6Fe3+2(OH)16[CO3] · 4H2O Localities: |
| ⓘ 'Pyroaurite-2H' (FRL) Formula: Mg6Fe3+2(OH)16(CO3) · 4H2O Type Locality: |
| ⓘ Pyrobelonite (TL) Formula: PbMn2+(VO4)(OH) Localities: Habit: Longprismatic Colour: Deep red Description: Crystals of Pyrobelonite are exremely rare. |
| ⓘ Pyrochroite Formula: Mn(OH)2 |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Pyrophanite Formula: Mn2+TiO3 |
| ⓘ Pyrophyllite Formula: Al2Si4O10(OH)2 |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Quenselite (TL) Formula: PbMnO2(OH) Localities: Habit: Prismatic crystals Colour: Dark Brown |
| ⓘ 'Quintinite-2H' Formula: Mg4Al2(OH)12(CO3) · 3H2O Habit: Hexagonal crystals up to 3 mm, forming aggregates up to 10-15mm with a high reflectance. Colour: Beige to white Description: Found by Urban Strand in an assemblage called "kataspilite" by Igelström (1867), distinct grey aggregates in a dark rock. Later showed to be a mixture of cordierite and scpolite group minerals (Törnebohm 1882). Quintinite-2H is found in cracks in this rock. |
| ⓘ Rammelsbergite Formula: NiAs2 |
| ⓘ Realgar Formula: As4S4 |
| ⓘ Rhodochrosite Formula: MnCO3 |
| ⓘ Rhodonite Formula: CaMn3Mn[Si5O15] |
| ⓘ Richterite (TL) Formula: Na(CaNa)Mg5(Si8O22)(OH)2 Localities: Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Garden dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden The Pole dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden The Lake dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Japan working, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Habit: prismatic Colour: orange-brown, very rare blue Description: Richterite is a relatively common mineral associated with rhodonite and normally found as yellowish to brownish fibrous aggregates and small crystals. Occasionally, larger well-formed crystals several cm long in vugs filled by late calcite |
| ⓘ Richterite var. Astochite Formula: {Na}{Na(Ca,Mn)}{Mg5}(Si8O22)(OH)2 |
| ⓘ Richterite var. Marmairolite Formula: {Na}{Na(Ca,Mn)}{Mg5}(Si8O22)(OH)2 Description: An obsolete name for a Långban variety of richterite. |
| ⓘ Roeblingite Formula: Pb2Ca6Mn2+(Si3O9)2(SO4)2(OH)2 · 4H2O References: |
| ⓘ 'Roméite Group' Formula: A2(Sb5+)2O6Z Localities: Habit: singel crystals Colour: Brown to yellow Fluorescence: No fluorescence Description: Romeite are a more common mineral at Långban than thought due to it's fine grained nature.
Found together with tilasite, hedyphane and all the rare Be minerals, also found in pegmatite together with tourmaline. |
| ⓘ 'Roméite Group var. Atopite' Formula: (Ca,Na)2Sb2(O,F,OH)7 |
| ⓘ Roquesite Formula: CuInS2 References: |
| ⓘ Rouseite (TL) Formula: Pb2Mn2+[AsO3]2 · 2H2O Type Locality: |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Sahlinite (TL) Formula: Pb14(AsO4)2O9Cl4 Type Locality: |
| ⓘ Sarkinite Formula: Mn2+2(AsO4)(OH) Localities: Garden dump, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Skottland stope, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Irland working, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Japan working, Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden |
| ⓘ 'Scapolite' |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Senaite Formula: Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 Habit: Grains Colour: Black Description: Occurres together with hematite in a richterite filled fissures in a vulcanite. References: |
| ⓘ Senarmontite Formula: Sb2O3 References: Holtstam, Dan; Langhof, Jörgen; Friis, Henrik; Karlsson, Andreas; Erambert, Muriel (2024) Igelströmite, Fe3+(Sb3+Pb2+)O4, and manganoschafarzikite, Mn2+Sb3+2O4, two new members of the newly established minium group, from the Långban Mn–Fe deposit, Värmland, Sweden. European Journal of Mineralogy, 36 (2). 311-322 doi:10.5194/ejm-36-311-2024 |
| ⓘ Sepiolite Formula: Mg4(Si6O15)(OH)2 · 6H2O |
| ⓘ Serandite Formula: NaMn2+2Si3O8(OH) |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 Localities: Reported from at least 6 localities in this region. |
| ⓘ Sillimanite Formula: Al2(SiO4)O |
| ⓘ Skogbyite (TL) Formula: Zr(Mg2Mn3+4)SiO12 Type Locality: |
| ⓘ Sonolite Formula: Mn2+9(SiO4)4(OH)2 Description: Sonolite is a late stage fissure mineral in different mineral associations in fissures in both dolomite and hausmannite. It can occur as quite well developed, dark brown crystals up to 9 x 5 mm. |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Spinel Formula: MgAl2O4 Localities: Description: Odd-looking, brownish-red shiny plates of spinel with inclusions of hematite is described by Lorin (2016) |
| ⓘ Spionkopite Formula: Cu39S28 |
| ⓘ Stannoidite Formula: Cu+6Cu2+2(Fe2+,Zn)3Sn2S12 |
| ⓘ Stenhuggarite (TL) Formula: CaFeSb(AsO3)2O Type Locality: References: Fleischer, Michael (1971) New Mineral Names. American Mineralogist, 56 (3-4) 631-640 pp.636-637 - abstract |
| ⓘ Stevensite Formula: (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| ⓘ Stibarsen Formula: AsSb Description: Only to be seen in polished sections References: |
| ⓘ Stibnite Formula: Sb2S3 Description: Very rare at Långban. References: |
| ⓘ 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ Stolzite Formula: Pb(WO4) References: |
| ⓘ Strandite (TL) Formula: Pb3Mn3+4Mn4+3O15 Type Locality: |
| ⓘ Sundiusite (TL) Formula: Pb10(SO4)O8Cl2 Type Locality: |
| ⓘ Svabite Formula: Ca5(AsO4)3F Fluorescence: Showing a yellow fluorescence under short wave UV-light Description: According to Eldjarn (2023), 30 samples of "svabites" showing a yellow fluorescence under short wave UV-light were collected at different spots in the dumps and analyzed with SEM-EDS [analyses performed at the Swedish Museum of National History in Stockholm}, of them only 2 were found to be svabite, 2 were turneaureite and the rest johnbaumites. It is not possible to visually distinguish between the three.
See also messageboard at https://www.mindat.org/mesg-678557.html#678589 References: |
| ⓘ Sverigeite (TL) Formula: NaMnMgSnBe2(SiO4)3(OH) Type Locality: |
| ⓘ Swedenborgite (TL) Formula: NaBe4Sb5+O7 Localities: |
| ⓘ Synadelphite Formula: Mn2+9(As5+O4)2(As3+O3)(OH)9 · 2H2O Description: Along joint planes in dolomite. References: |
| ⓘ Szaibélyite Formula: MgBO2(OH) References: |
| ⓘ Takéuchiite (TL) Formula: (Mg,Mn2+)2(Mn3+,Fe3+)(BO3)O2 Type Locality: |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ Taramellite Formula: Ba4(Fe3+,Ti,Fe2+,Mg)4(B2Si8O27)O2Clx |
| ⓘ Tegengrenite Formula: (Mn3+0.5Sb5+0.5)Mg2O4 |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S |
| ⓘ Tephroite Formula: Mn2+2(SiO4) References: |
| ⓘ Tephroite var. Picrotephroite Formula: (Mn,Mg)2[SiO4] |
| ⓘ Tetraferriphlogopite Formula: KMg3(Si3Fe3+)O10(OH)2 |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| ⓘ Tetrawickmanite Formula: Mn2+[Sn4+(OH)6] Localities: Habit: Pseudocubic crystals with truncated corners or as crystals with pseudooctaedral habit. Some crystals are slightly deformed and rounded and may appera nearly rhombic in appearance Colour: Bright yellow Description: Tungstenian |
| ⓘ Thaumasite Formula: Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| ⓘ Thomsonite-Ca Formula: NaCa2[Al5Si5O20] · 6H2O |
| ⓘ Tilasite (TL) Formula: CaMg(AsO4)F Localities: |
| ⓘ Titanite Formula: CaTiO(SiO4) |
| ⓘ Todorokite Formula: (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Trigonite (TL) Formula: Pb3Mn2+(AsO3)2(HAsO3) Type Locality: Description: 23.12 |
| ⓘ Trimerite Formula: CaMn2+2Be3(SiO4)3 |
| ⓘ Turneaureite (TL) Formula: Ca5(AsO4)3Cl Type Locality: |
| ⓘ 'UM1983-30-AsO:FeHMgMnZn (Also known as Mineral D)' Formula: (Mn,Mg,Fe3+,Al)15(AsO3)(AsO4)2(OH)23 References: Dunn, Pete J., Peacor, Donald R. (1983) A ferric iron equivalent of hematolite from Sterling Hill, New Jersey and Långban, Sweden. Mineralogical Magazine, 47 (344) 381-385 doi:10.1180/minmag.1983.047.344.15 |
| ⓘ 'UM1986-05-AsO:HMn' Formula: Mn3As2O4(OH)4 |
| ⓘ 'UM1986-06-AsO:HMn' Formula: Mn3As2O4(OH)4 |
| ⓘ Uraninite Formula: UO2 References: |
| ⓘ Valentinite Formula: Sb2O3 References: |
| ⓘ Valleriite Formula: (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| ⓘ Vanadinite Formula: Pb5(VO4)3Cl Colour: White Description: As mm grains in feltspare veins |
| ⓘ Vargite (TL) Formula: MnCu2Mn2(AsO4)2(OH)4(H2O)4 Type Locality: |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ Welinite (TL) Formula: Mn2+6(W6+,Mg)2(SiO4)2(O,OH)6 Localities: |
| ⓘ Welshite (TL) Formula: Ca4Mg9Sb3O4[Si6Be3AlFe2O36] Type Locality: |
| ⓘ Wermlandite (TL) Formula: Mg7Al2(OH)18[Ca(H2O)6][SO4]2 · 6H2O Type Locality: |
| ⓘ Wickmanite (TL) Formula: Mn2+[Sn(OH)6] Localities: |
| ⓘ Wiklundite (TL) Formula: Pb2(Mn2+,Zn)3(Fe3+,Mn2+)2(Mn2+,Mg)19(As3+O3)2[(Si,As5+)O4]6(OH)18Cl6 Type Locality: References: Hålenius, U.; Hatert, F.; Pasero, M.; Mills, S. J. (2015) New minerals and nomenclature modifications approved in 2015. Mineralogical Magazine, 79 (5). p.1223-1230. doi:10.1180/minmag.2015.079.5.16 Cooper, Mark A., Hawthorne, Frank C., Langhof, Jörgen, Hålenius, Ulf, Holtstam, Dan (2017) Wiklundite, ideally Pb2[4](Mn2+,Zn)3(Fe3+,Mn2+)2(Mn2+,Mg)19(As3+O3)2[(Si,As5+)O4]6(OH)18Cl6, a new mineral from Långban, Filipstad, Värmland, Sweden: Description and crystal structure. Mineralogical Magazine, 81 (4) 841-855 doi:10.1180/minmag.2016.080.136 |
| ⓘ Willemite Formula: Zn2SiO4 |
| ⓘ Willemite var. Troostite Formula: (Zn,Mn)2SiO4 References: |
| ⓘ Wittichenite Formula: Cu3BiS3 |
| ⓘ Wollastonite Formula: Ca3(Si3O9) |
| ⓘ Xonotlite Formula: Ca6(Si6O17)(OH)2 |
| ⓘ Yangite Formula: PbMnSi3O8 · H2O |
| ⓘ Yarrowite Formula: Cu9S8 |
| ⓘ Zenzénite (TL) Formula: Pb3Fe3+4Mn4+3O15 Type Locality: |
| ⓘ Zircon Formula: Zr(SiO4) |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Lead | 1.AA.05 | Pb |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Awaruite | 1.AE.20 | Ni3Fe |
| ⓘ | Native Antimony | 1.CA.05 | Sb |
| ⓘ | Native Arsenic | 1.CA.05 | As |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Stibarsen | 1.CA.05 | AsSb |
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Algodonite | 2.AA.10a | (Cu1-xAsx) |
| ⓘ | Domeykite | 2.AA.10b | Cu3As |
| ⓘ | Koutekite | 2.AA.10d | Cu5As2 |
| ⓘ | Cuprostibite | 2.AA.20 | Cu2(Sb,Tl) |
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Djurleite | 2.BA.05 | Cu31S16 |
| ⓘ | Anilite | 2.BA.10 | Cu7S4 |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Cobaltpentlandite | 2.BB.15 | Co9S8 |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Betekhtinite | 2.BE.05 | Pb2(Cu,Fe)22-24S15 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Spionkopite | 2.CA.05c | Cu39S28 |
| ⓘ | Yarrowite | 2.CA.05d | Cu9S8 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Roquesite | 2.CB.10a | CuInS2 |
| ⓘ | Stannoidite | 2.CB.15c | Cu+6Cu2+2(Fe2+,Zn)3Sn2S12 |
| ⓘ | Greenockite ? | 2.CB.45 | CdS |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Altaite | 2.CD.10 | PbTe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Nisbite | 2.EB.15a | NiSb2 |
| ⓘ | Rammelsbergite | 2.EB.15a | NiAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Realgar | 2.FA.15a | As4S4 |
| ⓘ | Orpiment | 2.FA.30 | As2S3 |
| ⓘ | Valleriite | 2.FD.30 | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | Wittichenite | 2.GA.20 | Cu3BiS3 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Aikinite | 2.HB.05a | CuPbBiS3 |
| ⓘ | Freieslebenite | 2.JB.15 | AgPbSbS3 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Nadorite | 3.DC.30 | PbSbClO2 |
| ⓘ | Perite (TL) | 3.DC.30 | PbBiClO2 |
| ⓘ | Blixite (TL) | 3.DC.50 | Pb8O5(OH)2Cl4 |
| ⓘ | Ecdemite (TL) | 3.DC.65 | Pb6As3+2O7Cl4 |
| ⓘ | Mendipite | 3.DC.70 | Pb3Cl2O2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Crednerite | 4.AB.05 | Cu+Mn3+O2 |
| ⓘ | Bromellite (TL) | 4.AB.20 | BeO |
| ⓘ | Manganosite (TL) | 4.AB.25 | MnO |
| ⓘ | Periclase | 4.AB.25 | MgO |
| ⓘ | Swedenborgite (TL) | 4.AC.05 | NaBe4Sb5+O7 |
| ⓘ | Litharge | 4.AC.20 | PbO |
| ⓘ | Massicot | 4.AC.25 | PbO |
| ⓘ | Filipstadite (TL) | 4.BB.05 | (Fe3+0.5Sb5+0.5)Mn2O4 |
| ⓘ | Franklinite | 4.BB.05 | Zn2+Fe3+2O4 |
| ⓘ | Gahnite | 4.BB.05 | ZnAl2O4 |
| ⓘ | Galaxite | 4.BB.05 | Mn2+Al2O4 |
| ⓘ | Jacobsite | 4.BB.05 | Mn2+Fe3+2O4 |
| ⓘ | Magnesioferrite | 4.BB.05 | MgFe3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Magnetite var. Zinc-bearing Magnetite | 4.BB.05 | (Fe,Zn)Fe3O4 |
| ⓘ | Hausmannite | 4.BB.10 | Mn2+Mn3+2O4 |
| ⓘ | Hetaerolite | 4.BB.10 | ZnMn2O4 |
| ⓘ | Manganostibite | 4.BB.10 | (Mn,Fe)7SbAsO12 |
| ⓘ | Tegengrenite | 4.BB.20 | (Mn3+0.5Sb5+0.5)Mg2O4 |
| ⓘ | Minium | 4.BD.05 | Pb3O4 |
| ⓘ | Geikielite | 4.CB.05 | MgTiO3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Melanostibite | 4.CB.05 | Mn2+2Fe3+Sb5+O6 |
| ⓘ | Pyrophanite | 4.CB.05 | Mn2+TiO3 |
| ⓘ | Hematite var. Specularite | 4.CB.05 | Fe2O3 |
| ⓘ | Bixbyite-(Mn) | 4.CB.10 | Mn3+2O3 |
| ⓘ | Senarmontite | 4.CB.50 | Sb2O3 |
| ⓘ | Valentinite | 4.CB.55 | Sb2O3 |
| ⓘ | Strandite (TL) | 4.CC. | Pb3Mn3+4Mn4+3O15 |
| ⓘ | Macedonite | 4.CC.35 | PbTiO3 |
| ⓘ | Senaite | 4.CC.40 | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
| ⓘ | Magnetoplumbite (TL) | 4.CC.45 | PbFe3+12O19 |
| ⓘ | Zenzénite (TL) | 4.CC.55 | Pb3Fe3+4Mn4+3O15 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Baddeleyite | 4.DE.35 | ZrO2 |
| ⓘ | 'Roméite Group var. Atopite' | 4.DH. | (Ca,Na)2Sb2(O,F,OH)7 |
| ⓘ | '' | 4.DH. | A2(Sb5+)2O6Z |
| ⓘ | 'Fluornatroroméite' | 4.DH. | (Na,Ca)2Sb2(O,OH)6F |
| ⓘ | Oxyplumboroméite | 4.DH. | Pb2Sb2O6O |
| ⓘ | Bindheimite | 4.DH.20 | Pb2Sb2O6O |
| ⓘ | Hydroxycalcioroméite | 4.DH.20 | (Ca,Sb3+)2(Sb5+,Ti)2O6(OH) |
| ⓘ | Monimolite | 4.DH.20 | Pb2Sb5+2O7 |
| ⓘ | Fluorcalcioroméite | 4.DH.20 | (Ca,Na,◻)2Sb5+2(O,OH)6F |
| ⓘ | Oxycalcioroméite | 4.DH.20 | Ca2Sb2O6O |
| ⓘ | Ingersonite (TL) | 4.DH.40 | Ca3Mn2+Sb5+4O14 |
| ⓘ | Todorokite | 4.DK.10 | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | Hiärneite (TL) | 4.DL.10 | Ca2Zr4Mn3+SbTiO16 |
| ⓘ | Wickmanite (TL) | 4.FC.10 | Mn2+[Sn(OH)6] |
| ⓘ | Tetrawickmanite | 4.FC.15 | Mn2+[Sn4+(OH)6] |
| ⓘ | Magnesiotaaffeite-2N’2S | 4.FC.25 | Mg3Al8BeO16 |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Brucite | 4.FE.05 | Mg(OH)2 |
| ⓘ | Pyrochroite | 4.FE.05 | Mn(OH)2 |
| ⓘ | Brucite var. Manganese-bearing Brucite | 4.FE.05 | Mg(OH)2 |
| ⓘ | Lepidocrocite | 4.FE.15 | Fe3+O(OH) |
| ⓘ | Feitknechtite | 4.FE.25 | Mn3+O(OH) |
| ⓘ | Quenselite (TL) | 4.FE.30 | PbMnO2(OH) |
| ⓘ | Langhofite (TL) | 4.FG.20 | Pb2(OH)[WO4(OH)] |
| ⓘ | Igelströmite (TL) | 4.JA.20 | Fe3+(Sb3+Pb2+)O4 |
| ⓘ | Manganoschafarzikite (TL) | 4.JA.20 | MnSb2O4 |
| ⓘ | Paulmooreite (TL) | 4.JA.50 | Pb2[As2O5] |
| ⓘ | Manganarsite (TL) | 4.JB.10 | Mn3(As2O4)(OH)4 |
| ⓘ | Magnussonite (TL) | 4.JB.15 | Mn2+10(As3+O3)6(OH,Cl)2 |
| ⓘ | Armangite (TL) | 4.JB.20 | Mn2+26(AsO3)14(HAsO3)4(CO3) |
| ⓘ | Stenhuggarite (TL) | 4.JB.35 | CaFeSb(AsO3)2O |
| ⓘ | Trigonite (TL) | 4.JB.40 | Pb3Mn2+(AsO3)2(HAsO3) |
| ⓘ | Finnemanite (TL) | 4.JB.45 | Pb5(AsO3)3Cl |
| ⓘ | Freedite (TL) | 4.JB.65 | Cu+Pb8(AsO3)2O3Cl5 |
| ⓘ | Rouseite (TL) | 4.JC.15 | Pb2Mn2+[AsO3]2 · 2H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | var. Manganese-bearing Calcite | 5.AB.05 | (Ca,Mn)CO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Kutnohorite | 5.AB.10 | CaMn2+(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Norsethite | 5.AB.30 | BaMg(CO3)2 |
| ⓘ | Barytocalcite | 5.AB.45 | BaCa(CO3)2 |
| ⓘ | Benstonite | 5.AB.55 | Ba6Ca6Mg(CO3)13 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Hydrocerussite (TL) | 5.BE.10 | Pb3(CO3)2(OH)2 |
| ⓘ | Plumbonacrite | 5.BE.15 | Pb5O(OH)2(CO3)3 |
| ⓘ | Philolithite (TL) | 5.BF.35 | Pb12Mn2+(Mg,Mn2+)2(Mn2+,Mg)4(CO3)4(SO4)O6(OH)12Cl4 |
| ⓘ | Brugnatellite ? | 5.DA.45 | Mg6Fe3+(CO3)(OH)13 · 4H2O |
| ⓘ | 'Pyroaurite-2H' (TL) | 5.DA.45 | Mg6Fe3+2(OH)16(CO3) · 4H2O |
| ⓘ | Hydrotalcite | 5.DA.50 | Mg6Al2(CO3)(OH)16 · 4H2O |
| ⓘ | Pyroaurite (TL) | 5.DA.50 | Mg6Fe3+2(OH)16[CO3] · 4H2O |
| Group 6 - Borates | |||
| ⓘ | Fredrikssonite (TL) | 6.AB.30 | Mg2Mn3+O2(BO3) |
| ⓘ | Ludwigite | 6.AB.30 | Mg2Fe3+(BO3)O2 |
| ⓘ | Pinakiolite (TL) | 6.AB.35 | (Mg,Mn2+)2Mn3+(BO3)O2 |
| ⓘ | var. Sb-rich pinakiolite | 6.AB.35 | Mg1.90Mn0.91Sb0.19O2BO3 |
| ⓘ | Blatterite | 6.AB.40 | Sb5+3(Mn3+,Fe3+)9(Mn2+,Mg)35(BO3)16O32 |
| ⓘ | Orthopinakiolite (TL) | 6.AB.40 | (Mg,Mn2+)2Mn3+(BO3)O2 |
| ⓘ | Takéuchiite (TL) | 6.AB.40 | (Mg,Mn2+)2(Mn3+,Fe3+)(BO3)O2 |
| ⓘ | Szaibélyite | 6.BA.15 | MgBO2(OH) |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Lanarkite | 7.BD.40 | Pb2(SO4)O |
| ⓘ | Sundiusite (TL) | 7.BD.70 | Pb10(SO4)O8Cl2 |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Wermlandite (TL) | 7.DD.35 | Mg7Al2(OH)18[Ca(H2O)6][SO4]2 · 6H2O |
| ⓘ | Erssonite (TL) | 7.DF. | Mg7Fe3+2(OH)18[Ca(H2O)6](SO4)2 · 12H2O |
| ⓘ | Thaumasite | 7.DG.15 | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| ⓘ | Powellite | 7.GA.05 | Ca(MoO4) |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Stolzite | 7.GA.05 | Pb(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Arseniopleite | 8.AC.10 | NaCaMnMn2(AsO4)3 |
| ⓘ | Caryinite (TL) | 8.AC.10 | (Na,Pb)(Ca,Na)CaMn2+2(AsO4)3 |
| ⓘ | Berzeliite (TL) | 8.AC.25 | (NaCa2)Mg2(AsO4)3 |
| ⓘ | Manganberzeliite | 8.AC.25 | (NaCa2)Mn2+2(AsO4)3 |
| ⓘ | Gasparite-(Ce) | 8.AD.50 | Ce(AsO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Bergslagite (TL) | 8.BA.10 | CaBeAsO4(OH) |
| ⓘ | Tilasite (TL) | 8.BB. | CaMg(AsO4)F |
| ⓘ | Sarkinite | 8.BB.15 | Mn2+2(AsO4)(OH) |
| ⓘ | Eveite (TL) | 8.BB.30 | Mn2+2(AsO4)(OH) |
| ⓘ | Arsenoclasite (TL) | 8.BD.10 | Mn2+5(AsO4)2(OH)4 |
| ⓘ | Parwelite (TL) | 8.BD.15 | Mn10Sb2As2Si2O24 |
| ⓘ | Allactite | 8.BE.30 | Mn2+7(AsO4)2(OH)8 |
| ⓘ | Flinkite | 8.BE.30 | Mn2+2Mn3+(AsO4)(OH)4 |
| ⓘ | Dixenite (TL) | 8.BE.45 | CuMn2+14Fe2+(SiO4)2(As5+O4)(As3+O3)5(OH)6 |
| ⓘ | Hematolite | 8.BE.45 | (Mn,Mg,Al,Fe3+)15(As5+O4)2(As3+O3)(OH)23 |
| ⓘ | Arakiite (TL) | 8.BE.45 | (Zn,Mn2+)(Mn2+,Mg)12(Fe3+,Al)2(As5+O4)2(As3+O3)(OH)23 |
| ⓘ | Carlfrancisite | 8.BE.45 | Mn2+3(Mn2+,Mg,Fe3+,Al)42[As3+O3]2(As5+O4)4[(Si,As5+)O4]6[(As5+,Si)O4]2(OH)42 |
| ⓘ | Synadelphite | 8.BE.50 | Mn2+9(As5+O4)2(As3+O3)(OH)9 · 2H2O |
| ⓘ | Adelite (TL) | 8.BH.35 | CaMg(AsO4)(OH) |
| ⓘ | Conichalcite | 8.BH.35 | CaCu(AsO4)(OH) |
| ⓘ | Gabrielsonite (TL) | 8.BH.35 | PbFe3+(As3+O3)O |
| ⓘ | Pyrobelonite (TL) | 8.BH.40 | PbMn2+(VO4)(OH) |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Hedyphane (TL) | 8.BN.05 | Ca2Pb3(AsO4)3Cl |
| ⓘ | Johnbaumite | 8.BN.05 | Ca5(AsO4)3(OH) |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Svabite | 8.BN.05 | Ca5(AsO4)3F |
| ⓘ | Turneaureite (TL) | 8.BN.05 | Ca5(AsO4)3Cl |
| ⓘ | Vanadinite | 8.BN.05 | Pb5(VO4)3Cl |
| ⓘ | Hydroxylhedyphane (TL) | 8.BN.05 | Ca2Pb3(AsO4)3(OH) |
| ⓘ | Sahlinite (TL) | 8.BO.20 | Pb14(AsO4)2O9Cl4 |
| ⓘ | Wiklundite (TL) | 8.BO.65 | Pb2(Mn2+,Zn)3(Fe3+,Mn2+)2(Mn2+,Mg)19(As3+O3)2[(Si,As5+)O4]6(OH)18Cl6 |
| ⓘ | Hörnesite | 8.CE.40 | Mg3(AsO4)2 · 8H2O |
| ⓘ | Manganohörnesite (TL) | 8.CE.40 | Mn2+3(AsO4)2 · 8H2O |
| ⓘ | Brandtite | 8.CG.10 | Ca2Mn2+(AsO4)2 · 2H2O |
| ⓘ | Vargite (TL) | 8.DD. | MnCu2Mn2(AsO4)2(OH)4(H2O)4 |
| ⓘ | Akrochordite (TL) | 8.DD.10 | MnMn2Mn2(AsO4)2(OH)4(H2O)4 |
| ⓘ | Långbanshyttanite (TL) | 8.DL.30 | Pb2Mn2Mg(AsO4)2(OH)4 · 6H2O |
| Group 9 - Silicates | |||
| ⓘ | Phenakite | 9.AA.05 | Be2SiO4 |
| ⓘ | Willemite | 9.AA.05 | Zn2SiO4 |
| ⓘ | var. Troostite | 9.AA.05 | (Zn,Mn)2SiO4 |
| ⓘ | Trimerite | 9.AB.05 | CaMn2+2Be3(SiO4)3 |
| ⓘ | Forsterite | 9.AC.05 | Mg2(SiO4) |
| ⓘ | Tephroite | 9.AC.05 | Mn2+2(SiO4) |
| ⓘ | var. Picrotephroite | 9.AC.05 | (Mn,Mg)2[SiO4] |
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Henritermierite | 9.AD.25 | Ca3Mn3+2(SiO4)2[◻(OH)4] |
| ⓘ | Grossular var. Hibschite | 9.AD.25 | Ca3Al2(SiO4)3-x(OH)4x |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Holtstamite | 9.AD.25 | Ca3Al2(SiO4)2[◻(OH)4] |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Sverigeite (TL) | 9.AE.15 | NaMnMgSnBe2(SiO4)3(OH) |
| ⓘ | Katoptrite | 9.AE.40 | (Mn2+,Mg)13(Al,Fe3+)4Sb5+2(SiO4)2O20 |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Alleghanyite | 9.AF.45 | Mn2+5(SiO4)2(OH)2 |
| ⓘ | Chondrodite | 9.AF.45 | Mg5(SiO4)2F2 |
| ⓘ | Manganhumite | 9.AF.50 | Mn2+7(SiO4)3(OH)2 |
| ⓘ | Clinohumite | 9.AF.55 | Mg9(SiO4)4F2 |
| ⓘ | Sonolite | 9.AF.55 | Mn2+9(SiO4)4(OH)2 |
| ⓘ | Leucophoenicite | 9.AF.60 | Mn2+7(SiO4)3(OH)2 |
| ⓘ | Welinite (TL) | 9.AF.75 | Mn2+6(W6+,Mg)2(SiO4)2(O,OH)6 |
| ⓘ | Olmiite | 9.AF.90 | CaMn2+[SiO3(OH)](OH) |
| ⓘ | Gatedalite (TL) | 9.AG.02 | ZrMn2+2Mn3+4SiO12 |
| ⓘ | Braunite | 9.AG.05 | Mn2+Mn3+6(SiO4)O8 |
| ⓘ | Skogbyite (TL) | 9.AG.05 | Zr(Mg2Mn3+4)SiO12 |
| ⓘ | Långbanite (TL) | 9.AG.10 | Mn2+4Mn3+9Sb5+O16(SiO4)2 |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Datolite | 9.AJ.20 | CaB(SiO4)(OH) |
| ⓘ | Barylite (TL) | 9.BB.15 | Be2Ba(Si2O7) |
| ⓘ | Barysilite | 9.BC.20 | Pb8Mn2+[Si2O7]3 |
| ⓘ | Ilvaite | 9.BE.07 | CaFe3+Fe2+2(Si2O7)O(OH) |
| ⓘ | Ericssonite (TL) | 9.BE.25 | BaMn2+2Fe3+(Si2O7)O(OH) |
| ⓘ | 'Ericssonite-2O' (TL) | 9.BE.25 | BaMn2+2Fe3+(Si2O7)O(OH) |
| ⓘ | Nasonite | 9.BE.77 | Pb6Ca4(Si2O7)3Cl2 |
| ⓘ | Kentrolite | 9.BE.80 | Pb2Mn3+2(Si2O7)O2 |
| ⓘ | Melanotekite (TL) | 9.BE.80 | Pb2Fe3+2(Si2O7)O2 |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Hancockite | 9.BG.05a | (CaPb)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Piemontite | 9.BG.05a | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Julgoldite-(Fe2+) (TL) | 9.BG.20 | Ca2Fe2+Fe3+2[Si2O6OH][SiO4](OH)2(OH) |
| ⓘ | Julgoldite-(Fe3+) (TL) | 9.BG.20 | Ca2Fe3+Fe3+2[Si2O6OH][SiO4](OH)2O |
| ⓘ | Ganomalite (TL) | 9.BG.25 | Pb9Ca5Mn(Si2O7)4(SiO4)O |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Cyprine ? | 9.BG.35 | Ca19Cu2+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 |
| ⓘ | Aminoffite (TL) | 9.BH.05 | Ca3(BeOH)2Si3O10 |
| ⓘ | Margarosanite | 9.CA.25 | Ca2PbSi3O9 |
| ⓘ | Roeblingite | 9.CB.05 | Pb2Ca6Mn2+(Si3O9)2(SO4)2(OH)2 · 4H2O |
| ⓘ | Taramellite | 9.CE.20 | Ba4(Fe3+,Ti,Fe2+,Mg)4(B2Si8O27)O2Clx |
| ⓘ | Hyalotekite (TL) | 9.CH.05 | (Ba,Pb,K)4(Ca,Y)2(B,Be)2(Si,B)2Si8O28(F,Cl) |
| ⓘ | Cordierite | 9.CJ.10 | Mg2Al4Si5O18 |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Hedenbergite | 9.DA.15 | CaFe2+Si2O6 |
| ⓘ | Johannsenite | 9.DA.15 | CaMn2+Si2O6 |
| ⓘ | Diopside var. Schefferite | 9.DA.15 | (Ca,Mn)(Mg,Fe,Mn)Si2O6 |
| ⓘ | Aegirine-augite | 9.DA.20 | (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 |
| ⓘ | var. Urbanite (TL) | 9.DA.20 | (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 |
| ⓘ | Aegirine | 9.DA.25 | NaFe3+Si2O6 |
| ⓘ | Gedrite | 9.DD.05 | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Ferro-actinolite | 9.DE.10 | ◻Ca2Fe2+5(Si8O22)(OH)2 |
| ⓘ | Joesmithite (TL) | 9.DE.10 | Pb2+Ca2(Mg3Fe3+2)(Si6Be2)O22(OH)2 |
| ⓘ | Magnesio-hornblende | 9.DE.10 | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Clino-ferro-suenoite | 9.DE.10 | ◻Mn2+2(Fe2+5)(Si8O22)(OH)2 |
| ⓘ | Magnesio-hastingsite | 9.DE.15 | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| ⓘ | Pargasite | 9.DE.15 | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| ⓘ | Mangani-pargasite (TL) | 9.DE.15 | NaCa2(Mg4Mn3+)(Si6Al2)O22(OH)2 |
| ⓘ | Richterite var. Astochite | 9.DE.20 | {Na}{Na(Ca,Mn)}{Mg5}(Si8O22)(OH)2 |
| ⓘ | (TL) | 9.DE.20 | Na(CaNa)Mg5(Si8O22)(OH)2 |
| ⓘ | Potassic-richterite | 9.DE.20 | K(CaNa)Mg5(Si8O22)(OH)2 |
| ⓘ | Richterite var. Marmairolite | 9.DE.20 | {Na}{Na(Ca,Mn)}{Mg5}(Si8O22)(OH)2 |
| ⓘ | Ferri-winchite ? | 9.DE.20 | ◻(NaCa)(Mg4Fe3+)Si8O22(OH)2 |
| ⓘ | Hjalmarite (TL) | 9.DE.20 | Na(NaMn)Mg5(Si8O22)(OH)2 |
| ⓘ | 'Fluoro-arfvedsonite' ? | 9.DE.25 | NaNa2(Fe2+4Fe3+)Si8O22F2 |
| ⓘ | Bustamite | 9.DG.05 | CaMn2+(Si2O6) |
| ⓘ | Pectolite | 9.DG.05 | NaCa2Si3O8(OH) |
| ⓘ | Serandite | 9.DG.05 | NaMn2+2Si3O8(OH) |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Xonotlite | 9.DG.35 | Ca6(Si6O17)(OH)2 |
| ⓘ | Welshite (TL) | 9.DH.40 | Ca4Mg9Sb3O4[Si6Be3AlFe2O36] |
| ⓘ | Ferrorhodonite | 9.DK. | CaMn3Fe[Si5O15] |
| ⓘ | Rhodonite | 9.DK.05 | CaMn3Mn[Si5O15] |
| ⓘ | Inesite | 9.DL.05 | Ca2(Mn,Fe)7Si10O28(OH)2 · 5H2O |
| ⓘ | Alamosite | 9.DO.20 | PbSiO3 |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Fluorapophyllite-(K) | 9.EA.15 | KCa4(Si8O20)(F,OH) · 8H2O |
| ⓘ | Yangite | 9.EA.52 | PbMnSi3O8 · H2O |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Pyrophyllite | 9.EC.10 | Al2Si4O10(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Tetraferriphlogopite | 9.EC.20 | KMg3(Si3Fe3+)O10(OH)2 |
| ⓘ | Kinoshitalite | 9.EC.35 | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Stevensite | 9.EC.45 | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Gonyerite (TL) | 9.EC.55 | Mn2+5Fe3+(Fe3+Si3O10)(OH)8 |
| ⓘ | Pennantite | 9.EC.55 | Mn2+5Al(AlSi3O10)(OH)8 |
| ⓘ | Clinochlore var. Pennine | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | 'Clinochrysotile' | 9.ED. | Mg3(Si2O5)(OH)4 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Hisingerite | 9.ED.10 | Fe3+2(Si2O5)(OH)4 · 2H2O |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Caryopilite | 9.ED.15 | Mn2+3Si2O5(OH)4 |
| ⓘ | Lizardite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Neotocite | 9.ED.20 | (Mn,Fe)SiO3 · H2O (?) |
| ⓘ | Bementite | 9.EE.05 | Mn7Si6O15(OH)8 |
| ⓘ | Friedelite | 9.EE.10 | Mn2+8Si6O15(OH,Cl)10 |
| ⓘ | Sepiolite | 9.EE.25 | Mg4(Si6O15)(OH)2 · 6H2O |
| ⓘ | Cymrite | 9.EG.05 | BaAl2Si2(O,OH)8 · H2O |
| ⓘ | Ganophyllite | 9.EG.30 | (K,Na)xMn2+6(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| ⓘ | Jagoite (TL) | 9.EG.50 | Pb18Fe3+4[Si4(Si,Fe3+)6][Pb4Si16(Si,Fe)4]O82Cl6 |
| ⓘ | Friisite (TL) | 9.EG.50 | Pb8Al3Si8O27Cl3 |
| ⓘ | Hyttsjöite (TL) | 9.EG.60 | Pb18Ba2Ca5Mn2+2Fe3+2Si30O90Cl · 6H2O |
| ⓘ | Britvinite (TL) | 9.EG.70 | [Pb7(OH)3F(BO3)2(CO3)][Mg4.5(OH)3(Si5O14)] |
| ⓘ | Celsian | 9.FA.30 | Ba(Al2Si2O8) |
| ⓘ | Microcline var. Hyalophane | 9.FA.30 | (K,Ba)[Al(Si,Al)Si2O8] |
| ⓘ | 9.FA.30 | K(AlSi3O8) | |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Banalsite | 9.FA.60 | Na2BaAl4Si4O16 |
| ⓘ | Helvine | 9.FB.10 | Be3Mn2+4(SiO4)3S |
| ⓘ | Marialite | 9.FB.15 | Na4Al3Si9O24Cl |
| ⓘ | Natrolite | 9.GA.05 | Na2Al2Si3O10 · 2H2O |
| ⓘ | Thomsonite-Ca | 9.GA.10 | NaCa2[Al5Si5O20] · 6H2O |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| ⓘ | Harmotome | 9.GC.10 | Ba2(Si12Al4)O32 · 12H2O |
| ⓘ | Molybdophyllite (TL) | 9.HH.25 | Pb8Mg9[Si10O28(OH)8O2(CO3)3] · H2O |
| Unclassified | |||
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Apophyllite Group' | - | AB4[Si8O20]X · 8H2O |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chabazite' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Glauconite' | - | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| ⓘ | 'Jacobsite-Q' | - | Mn2+(Fe3+,Mn3+)2O4 |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Biotite var. Manganophyllite' | - | K(Fe,Mg,Mn)3AlSi3O10(OH)2 |
| ⓘ | 'Phillipsite Subgroup' | - | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| ⓘ | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Clinopyroxene Subgroup' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Jacobsite-Magnetite Series' | - | |
| ⓘ | 'Hydrohausmannite' (TL) | - | |
| ⓘ | 'α-Vredenburgite' (TL) | - | (Mn,Fe)3O4 |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Lamprophanite' | - | |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Quintinite-2H' | - | Mg4Al2(OH)12(CO3) · 3H2O |
| ⓘ | 'Fluorapophyllite' | - | |
| ⓘ | 'Julgoldite Subgroup' | - | Ca2XFe3+2[Si2O6(OH)][SiO4](OH)2A |
| ⓘ | 'Hedyphane Group' | - | |
| ⓘ | 'UM1983-30-AsO:FeHMgMnZn (Also known as Mineral D)' | - | (Mn,Mg,Fe3+,Al)15(AsO3)(AsO4)2(OH)23 |
| ⓘ | 'UM1986-05-AsO:HMn' | - | Mn3As2O4(OH)4 |
| ⓘ | 'UM1986-06-AsO:HMn' | - | Mn3As2O4(OH)4 |
| ⓘ | 'Asbestos hedyphane' | - | |
| ⓘ | Hugotibergite (TL) | - | Ca6CaPb2(Si3O9)2(SO4)2(OH)2(H2O)4 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Adelite | CaMg(AsO4)(OH) |
| H | ⓘ Akrochordite | MnMn2Mn2(AsO4)2(OH)4(H2O)4 |
| H | ⓘ Allactite | Mn72+(AsO4)2(OH)8 |
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Alleghanyite | Mn52+(SiO4)2(OH)2 |
| H | ⓘ Aminoffite | Ca3(BeOH)2Si3O10 |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Apophyllite Group | AB4[Si8O20]X · 8H2O |
| H | ⓘ Armangite | Mn262+(AsO3)14(HAsO3)4(CO3) |
| H | ⓘ Arsenoclasite | Mn52+(AsO4)2(OH)4 |
| H | ⓘ Richterite var. Astochite | {Na}{Na(Ca,Mn)}{Mg5}(Si8O22)(OH)2 |
| H | ⓘ Roméite Group var. Atopite | (Ca,Na)2Sb2(O,F,OH)7 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Bementite | Mn7Si6O15(OH)8 |
| H | ⓘ Bergslagite | CaBeAsO4(OH) |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Blixite | Pb8O5(OH)2Cl4 |
| H | ⓘ Brandtite | Ca2Mn2+(AsO4)2 · 2H2O |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Brugnatellite | Mg6Fe3+(CO3)(OH)13 · 4H2O |
| H | ⓘ Brucite | Mg(OH)2 |
| H | ⓘ Caryopilite | Mn32+Si2O5(OH)4 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinochrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| H | ⓘ Cymrite | BaAl2Si2(O,OH)8 · H2O |
| H | ⓘ Dixenite | CuMn142+Fe2+(SiO4)2(As5+O4)(As3+O3)5(OH)6 |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Datolite | CaB(SiO4)(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Ericssonite | BaMn22+Fe3+(Si2O7)O(OH) |
| H | ⓘ Eveite | Mn22+(AsO4)(OH) |
| H | ⓘ Feitknechtite | Mn3+O(OH) |
| H | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| H | ⓘ Flinkite | Mn22+Mn3+(AsO4)(OH)4 |
| H | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| H | ⓘ Friedelite | Mn82+Si6O15(OH,Cl)10 |
| H | ⓘ Ganophyllite | (K,Na)xMn62+(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| H | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| H | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gonyerite | Mn52+Fe3+(Fe3+Si3O10)(OH)8 |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hancockite | (CaPb)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| H | ⓘ Hematolite | (Mn,Mg,Al,Fe3+)15(As5+O4)2(As3+O3)(OH)23 |
| H | ⓘ Henritermierite | Ca3Mn23+(SiO4)2[◻(OH)4] |
| H | ⓘ Grossular var. Hibschite | Ca3Al2(SiO4)3-x(OH)4x |
| H | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| H | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| H | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| H | ⓘ Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| H | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| H | ⓘ Inesite | Ca2(Mn,Fe)7Si10O28(OH)2 · 5H2O |
| H | ⓘ Joesmithite | Pb2+Ca2(Mg3Fe23+)(Si6Be2)O22(OH)2 |
| H | ⓘ Johnbaumite | Ca5(AsO4)3(OH) |
| H | ⓘ Julgoldite-(Fe2+) | Ca2Fe2+Fe23+[Si2O6OH][SiO4](OH)2(OH) |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Lepidocrocite | Fe3+O(OH) |
| H | ⓘ Leucophoenicite | Mn72+(SiO4)3(OH)2 |
| H | ⓘ Hydroxycalcioroméite | (Ca,Sb3+)2(Sb5+,Ti)2O6(OH) |
| H | ⓘ Lizardite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Manganarsite | Mn3(As2O4)(OH)4 |
| H | ⓘ Manganhumite | Mn72+(SiO4)3(OH)2 |
| H | ⓘ Biotite var. Manganophyllite | K(Fe,Mg,Mn)3AlSi3O10(OH)2 |
| H | ⓘ Magnesio-hastingsite | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| H | ⓘ Manganohörnesite | Mn32+(AsO4)2 · 8H2O |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| H | ⓘ Magnussonite | Mn102+(As3+O3)6(OH,Cl)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Molybdophyllite | Pb8Mg9[Si10O28(OH)8O2(CO3)3] · H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Neotocite | (Mn,Fe)SiO3 · H2O (?) |
| H | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Ericssonite-2O | BaMn22+Fe3+(Si2O7)O(OH) |
| H | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| H | ⓘ Pectolite | NaCa2Si3O8(OH) |
| H | ⓘ Pennantite | Mn52+Al(AlSi3O10)(OH)8 |
| H | ⓘ Phillipsite Subgroup | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Plumbonacrite | Pb5O(OH)2(CO3)3 |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Pyrobelonite | PbMn2+(VO4)(OH) |
| H | ⓘ Pyrochroite | Mn(OH)2 |
| H | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| H | ⓘ Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| H | ⓘ Quenselite | PbMnO2(OH) |
| H | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| H | ⓘ Roeblingite | Pb2Ca6Mn2+(Si3O9)2(SO4)2(OH)2 · 4H2O |
| H | ⓘ Rouseite | Pb2Mn2+[AsO3]2 · 2H2O |
| H | ⓘ Sarkinite | Mn22+(AsO4)(OH) |
| H | ⓘ Senaite | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
| H | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| H | ⓘ Serandite | NaMn22+Si3O8(OH) |
| H | ⓘ Pyroaurite-2H | Mg6Fe23+(OH)16(CO3) · 4H2O |
| H | ⓘ Sonolite | Mn92+(SiO4)4(OH)2 |
| H | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| H | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | ⓘ Sverigeite | NaMnMgSnBe2(SiO4)3(OH) |
| H | ⓘ Synadelphite | Mn92+(As5+O4)2(As3+O3)(OH)9 · 2H2O |
| H | ⓘ Szaibélyite | MgBO2(OH) |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Tetraferriphlogopite | KMg3(Si3Fe3+)O10(OH)2 |
| H | ⓘ Tetrawickmanite | Mn2+[Sn4+(OH)6] |
| H | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| H | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| H | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Trigonite | Pb3Mn2+(AsO3)2(HAsO3) |
| H | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Welinite | Mn62+(W6+,Mg)2(SiO4)2(O,OH)6 |
| H | ⓘ Wermlandite | Mg7Al2(OH)18[Ca(H2O)6][SO4]2 · 6H2O |
| H | ⓘ Wickmanite | Mn2+[Sn(OH)6] |
| H | ⓘ Xonotlite | Ca6(Si6O17)(OH)2 |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Arakiite | (Zn,Mn2+)(Mn2+,Mg)12(Fe3+,Al)2(As5+O4)2(As3+O3)(OH)23 |
| H | ⓘ Hyttsjöite | Pb18Ba2Ca5Mn22+Fe23+Si30O90Cl · 6H2O |
| H | ⓘ Julgoldite-(Fe3+) | Ca2Fe3+Fe23+[Si2O6OH][SiO4](OH)2O |
| H | ⓘ Philolithite | Pb12Mn2+(Mg,Mn2+)2(Mn2+,Mg)4(CO3)4(SO4)O6(OH)12Cl4 |
| H | ⓘ Potassic-richterite | K(CaNa)Mg5(Si8O22)(OH)2 |
| H | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Richterite var. Marmairolite | {Na}{Na(Ca,Mn)}{Mg5}(Si8O22)(OH)2 |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Ferri-winchite | ◻(NaCa)(Mg4Fe3+)Si8O22(OH)2 |
| H | ⓘ Holtstamite | Ca3Al2(SiO4)2[◻(OH)4] |
| H | ⓘ Olmiite | CaMn2+[SiO3(OH)](OH) |
| H | ⓘ Britvinite | [Pb7(OH)3F(BO3)2(CO3)][Mg4.5(OH)3(Si5O14)] |
| H | ⓘ Quintinite-2H | Mg4Al2(OH)12(CO3) · 3H2O |
| H | ⓘ Julgoldite Subgroup | Ca2XFe23+[Si2O6(OH)][SiO4](OH)2A |
| H | ⓘ Fluornatroroméite | (Na,Ca)2Sb2(O,OH)6F |
| H | ⓘ Fluorcalcioroméite | (Ca,Na,◻)2Sb25+(O,OH)6F |
| H | ⓘ Långbanshyttanite | Pb2Mn2Mg(AsO4)2(OH)4 · 6H2O |
| H | ⓘ Carlfrancisite | Mn32+(Mn2+,Mg,Fe3+,Al)42[As3+O3]2(As5+O4)4[(Si,As5+)O4]6[(As5+,Si)O4]2(OH)42 |
| H | ⓘ Yangite | PbMnSi3O8 · H2O |
| H | ⓘ Cyprine | Ca19Cu2+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 |
| H | ⓘ Wiklundite | Pb2(Mn2+,Zn)3(Fe3+,Mn2+)2(Mn2+,Mg)19(As3+O3)2[(Si,As5+)O4]6(OH)18Cl6 |
| H | ⓘ Hydroxylhedyphane | Ca2Pb3(AsO4)3(OH) |
| H | ⓘ UM1983-30-AsO:FeHMgMnZn (Also known as Mineral D) | (Mn,Mg,Fe3+,Al)15(AsO3)(AsO4)2(OH)23 |
| H | ⓘ UM1986-05-AsO:HMn | Mn3As2O4(OH)4 |
| H | ⓘ UM1986-06-AsO:HMn | Mn3As2O4(OH)4 |
| H | ⓘ Clino-ferro-suenoite | ◻Mn22+(Fe52+)(Si8O22)(OH)2 |
| H | ⓘ Brucite var. Manganese-bearing Brucite | Mg(OH)2 |
| H | ⓘ Hjalmarite | Na(NaMn)Mg5(Si8O22)(OH)2 |
| H | ⓘ Mangani-pargasite | NaCa2(Mg4Mn3+)(Si6Al2)O22(OH)2 |
| H | ⓘ Langhofite | Pb2(OH)[WO4(OH)] |
| H | ⓘ Vargite | MnCu2Mn2(AsO4)2(OH)4(H2O)4 |
| H | ⓘ Erssonite | Mg7Fe23+(OH)18[Ca(H2O)6](SO4)2 · 12H2O |
| H | ⓘ Hugotibergite | Ca6CaPb2(Si3O9)2(SO4)2(OH)2(H2O)4 |
| Be | Beryllium | |
| Be | ⓘ Aminoffite | Ca3(BeOH)2Si3O10 |
| Be | ⓘ Barylite | Be2Ba(Si2O7) |
| Be | ⓘ Bergslagite | CaBeAsO4(OH) |
| Be | ⓘ Bromellite | BeO |
| Be | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Be | ⓘ Hyalotekite | (Ba,Pb,K)4(Ca,Y)2(B,Be)2(Si,B)2Si8O28(F,Cl) |
| Be | ⓘ Joesmithite | Pb2+Ca2(Mg3Fe23+)(Si6Be2)O22(OH)2 |
| Be | ⓘ Phenakite | Be2SiO4 |
| Be | ⓘ Sverigeite | NaMnMgSnBe2(SiO4)3(OH) |
| Be | ⓘ Swedenborgite | NaBe4Sb5+O7 |
| Be | ⓘ Magnesiotaaffeite-2N’2S | Mg3Al8BeO16 |
| Be | ⓘ Trimerite | CaMn22+Be3(SiO4)3 |
| Be | ⓘ Welshite | Ca4Mg9Sb3O4[Si6Be3AlFe2O36] |
| B | Boron | |
| B | ⓘ Blatterite | Sb35+(Mn3+,Fe3+)9(Mn2+,Mg)35(BO3)16O32 |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Datolite | CaB(SiO4)(OH) |
| B | ⓘ Fredrikssonite | Mg2Mn3+O2(BO3) |
| B | ⓘ Hyalotekite | (Ba,Pb,K)4(Ca,Y)2(B,Be)2(Si,B)2Si8O28(F,Cl) |
| B | ⓘ Ludwigite | Mg2Fe3+(BO3)O2 |
| B | ⓘ Orthopinakiolite | (Mg,Mn2+)2Mn3+(BO3)O2 |
| B | ⓘ Pinakiolite | (Mg,Mn2+)2Mn3+(BO3)O2 |
| B | ⓘ Szaibélyite | MgBO2(OH) |
| B | ⓘ Takéuchiite | (Mg,Mn2+)2(Mn3+,Fe3+)(BO3)O2 |
| B | ⓘ Taramellite | Ba4(Fe3+,Ti,Fe2+,Mg)4(B2Si8O27)O2Clx |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| B | ⓘ Britvinite | [Pb7(OH)3F(BO3)2(CO3)][Mg4.5(OH)3(Si5O14)] |
| B | ⓘ Pinakiolite var. Sb-rich pinakiolite | Mg1.90Mn0.91Sb0.19O2BO3 |
| C | Carbon | |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Armangite | Mn262+(AsO3)14(HAsO3)4(CO3) |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Barytocalcite | BaCa(CO3)2 |
| C | ⓘ Benstonite | Ba6Ca6Mg(CO3)13 |
| C | ⓘ Brugnatellite | Mg6Fe3+(CO3)(OH)13 · 4H2O |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| C | ⓘ Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| C | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| C | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Molybdophyllite | Pb8Mg9[Si10O28(OH)8O2(CO3)3] · H2O |
| C | ⓘ Norsethite | BaMg(CO3)2 |
| C | ⓘ Plumbonacrite | Pb5O(OH)2(CO3)3 |
| C | ⓘ Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Pyroaurite-2H | Mg6Fe23+(OH)16(CO3) · 4H2O |
| C | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| C | ⓘ Philolithite | Pb12Mn2+(Mg,Mn2+)2(Mn2+,Mg)4(CO3)4(SO4)O6(OH)12Cl4 |
| C | ⓘ Britvinite | [Pb7(OH)3F(BO3)2(CO3)][Mg4.5(OH)3(Si5O14)] |
| C | ⓘ Quintinite-2H | Mg4Al2(OH)12(CO3) · 3H2O |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Adelite | CaMg(AsO4)(OH) |
| O | ⓘ Aegirine | NaFe3+Si2O6 |
| O | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| O | ⓘ Akrochordite | MnMn2Mn2(AsO4)2(OH)4(H2O)4 |
| O | ⓘ Alamosite | PbSiO3 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allactite | Mn72+(AsO4)2(OH)8 |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Alleghanyite | Mn52+(SiO4)2(OH)2 |
| O | ⓘ Aminoffite | Ca3(BeOH)2Si3O10 |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Apophyllite Group | AB4[Si8O20]X · 8H2O |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Armangite | Mn262+(AsO3)14(HAsO3)4(CO3) |
| O | ⓘ Arseniopleite | NaCaMnMn2(AsO4)3 |
| O | ⓘ Arsenoclasite | Mn52+(AsO4)2(OH)4 |
| O | ⓘ Richterite var. Astochite | {Na}{Na(Ca,Mn)}{Mg5}(Si8O22)(OH)2 |
| O | ⓘ Roméite Group var. Atopite | (Ca,Na)2Sb2(O,F,OH)7 |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Barytocalcite | BaCa(CO3)2 |
| O | ⓘ Baddeleyite | ZrO2 |
| O | ⓘ Banalsite | Na2BaAl4Si4O16 |
| O | ⓘ Barylite | Be2Ba(Si2O7) |
| O | ⓘ Barysilite | Pb8Mn2+[Si2O7]3 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bementite | Mn7Si6O15(OH)8 |
| O | ⓘ Benstonite | Ba6Ca6Mg(CO3)13 |
| O | ⓘ Bergslagite | CaBeAsO4(OH) |
| O | ⓘ Berzeliite | (NaCa2)Mg2(AsO4)3 |
| O | ⓘ Bindheimite | Pb2Sb2O6O |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bixbyite-(Mn) | Mn23+O3 |
| O | ⓘ Blatterite | Sb35+(Mn3+,Fe3+)9(Mn2+,Mg)35(BO3)16O32 |
| O | ⓘ Blixite | Pb8O5(OH)2Cl4 |
| O | ⓘ Brandtite | Ca2Mn2+(AsO4)2 · 2H2O |
| O | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Bromellite | BeO |
| O | ⓘ Brugnatellite | Mg6Fe3+(CO3)(OH)13 · 4H2O |
| O | ⓘ Bustamite | CaMn2+(Si2O6) |
| O | ⓘ Brucite | Mg(OH)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Caryinite | (Na,Pb)(Ca,Na)CaMn22+(AsO4)3 |
| O | ⓘ Caryopilite | Mn32+Si2O5(OH)4 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Celsian | Ba(Al2Si2O8) |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinochrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| O | ⓘ Cordierite | Mg2Al4Si5O18 |
| O | ⓘ Crednerite | Cu+Mn3+O2 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Cymrite | BaAl2Si2(O,OH)8 · H2O |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dixenite | CuMn142+Fe2+(SiO4)2(As5+O4)(As3+O3)5(OH)6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Datolite | CaB(SiO4)(OH) |
| O | ⓘ Ecdemite | Pb6As23+O7Cl4 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Ericssonite | BaMn22+Fe3+(Si2O7)O(OH) |
| O | ⓘ Eveite | Mn22+(AsO4)(OH) |
| O | ⓘ Feitknechtite | Mn3+O(OH) |
| O | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| O | ⓘ Filipstadite | (Fe3+0.5Sb5+0.5)Mn2O4 |
| O | ⓘ Finnemanite | Pb5(AsO3)3Cl |
| O | ⓘ Flinkite | Mn22+Mn3+(AsO4)(OH)4 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| O | ⓘ Forsterite | Mg2(SiO4) |
| O | ⓘ Franklinite | Zn2+Fe23+O4 |
| O | ⓘ Fredrikssonite | Mg2Mn3+O2(BO3) |
| O | ⓘ Freedite | Cu+Pb8(AsO3)2O3Cl5 |
| O | ⓘ Friedelite | Mn82+Si6O15(OH,Cl)10 |
| O | ⓘ Gabrielsonite | PbFe3+(As3+O3)O |
| O | ⓘ Gahnite | ZnAl2O4 |
| O | ⓘ Galaxite | Mn2+Al2O4 |
| O | ⓘ Ganomalite | Pb9Ca5Mn(Si2O7)4(SiO4)O |
| O | ⓘ Ganophyllite | (K,Na)xMn62+(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| O | ⓘ Gasparite-(Ce) | Ce(AsO4) |
| O | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| O | ⓘ Geikielite | MgTiO3 |
| O | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gonyerite | Mn52+Fe3+(Fe3+Si3O10)(OH)8 |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hancockite | (CaPb)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| O | ⓘ Hausmannite | Mn2+Mn23+O4 |
| O | ⓘ Hedenbergite | CaFe2+Si2O6 |
| O | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| O | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hematolite | (Mn,Mg,Al,Fe3+)15(As5+O4)2(As3+O3)(OH)23 |
| O | ⓘ Henritermierite | Ca3Mn23+(SiO4)2[◻(OH)4] |
| O | ⓘ Hetaerolite | ZnMn2O4 |
| O | ⓘ Grossular var. Hibschite | Ca3Al2(SiO4)3-x(OH)4x |
| O | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| O | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| O | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| O | ⓘ Hyalotekite | (Ba,Pb,K)4(Ca,Y)2(B,Be)2(Si,B)2Si8O28(F,Cl) |
| O | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| O | ⓘ Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| O | ⓘ Inesite | Ca2(Mn,Fe)7Si10O28(OH)2 · 5H2O |
| O | ⓘ Ingersonite | Ca3Mn2+Sb45+O14 |
| O | ⓘ Jacobsite-Q | Mn2+(Fe3+,Mn3+)2O4 |
| O | ⓘ Jacobsite | Mn2+Fe23+O4 |
| O | ⓘ Jagoite | Pb18Fe43+[Si4(Si,Fe3+)6][Pb4Si16(Si,Fe)4]O82Cl6 |
| O | ⓘ Joesmithite | Pb2+Ca2(Mg3Fe23+)(Si6Be2)O22(OH)2 |
| O | ⓘ Johannsenite | CaMn2+Si2O6 |
| O | ⓘ Johnbaumite | Ca5(AsO4)3(OH) |
| O | ⓘ Julgoldite-(Fe2+) | Ca2Fe2+Fe23+[Si2O6OH][SiO4](OH)2(OH) |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Katoptrite | (Mn2+,Mg)13(Al,Fe3+)4Sb25+(SiO4)2O20 |
| O | ⓘ Kentrolite | Pb2Mn23+(Si2O7)O2 |
| O | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| O | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| O | ⓘ Lanarkite | Pb2(SO4)O |
| O | ⓘ Långbanite | Mn42+Mn93+Sb5+O16(SiO4)2 |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Lepidocrocite | Fe3+O(OH) |
| O | ⓘ Leucophoenicite | Mn72+(SiO4)3(OH)2 |
| O | ⓘ Hydroxycalcioroméite | (Ca,Sb3+)2(Sb5+,Ti)2O6(OH) |
| O | ⓘ Lizardite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Ludwigite | Mg2Fe3+(BO3)O2 |
| O | ⓘ Litharge | PbO |
| O | ⓘ Manganarsite | Mn3(As2O4)(OH)4 |
| O | ⓘ Manganhumite | Mn72+(SiO4)3(OH)2 |
| O | ⓘ Biotite var. Manganophyllite | K(Fe,Mg,Mn)3AlSi3O10(OH)2 |
| O | ⓘ Manganberzeliite | (NaCa2)Mn22+(AsO4)3 |
| O | ⓘ Magnesio-hastingsite | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| O | ⓘ Manganohörnesite | Mn32+(AsO4)2 · 8H2O |
| O | ⓘ Magnesioferrite | MgFe23+O4 |
| O | ⓘ Manganosite | MnO |
| O | ⓘ Macedonite | PbTiO3 |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| O | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| O | ⓘ Manganostibite | (Mn,Fe)7SbAsO12 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Magnetoplumbite | PbFe123+O19 |
| O | ⓘ Magnussonite | Mn102+(As3+O3)6(OH,Cl)2 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Margarosanite | Ca2PbSi3O9 |
| O | ⓘ Marialite | Na4Al3Si9O24Cl |
| O | ⓘ Massicot | PbO |
| O | ⓘ Melanostibite | Mn22+Fe3+Sb5+O6 |
| O | ⓘ Melanotekite | Pb2Fe23+(Si2O7)O2 |
| O | ⓘ Mendipite | Pb3Cl2O2 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Minium | Pb3O4 |
| O | ⓘ Molybdophyllite | Pb8Mg9[Si10O28(OH)8O2(CO3)3] · H2O |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Monimolite | Pb2Sb25+O7 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Nadorite | PbSbClO2 |
| O | ⓘ Nasonite | Pb6Ca4(Si2O7)3Cl2 |
| O | ⓘ Neotocite | (Mn,Fe)SiO3 · H2O (?) |
| O | ⓘ Norsethite | BaMg(CO3)2 |
| O | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Ericssonite-2O | BaMn22+Fe3+(Si2O7)O(OH) |
| O | ⓘ Orthopinakiolite | (Mg,Mn2+)2Mn3+(BO3)O2 |
| O | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| O | ⓘ Parwelite | Mn10Sb2As2Si2O24 |
| O | ⓘ Paulmooreite | Pb2[As2O5] |
| O | ⓘ Pectolite | NaCa2Si3O8(OH) |
| O | ⓘ Pennantite | Mn52+Al(AlSi3O10)(OH)8 |
| O | ⓘ Periclase | MgO |
| O | ⓘ Perite | PbBiClO2 |
| O | ⓘ Phenakite | Be2SiO4 |
| O | ⓘ Phillipsite Subgroup | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Pinakiolite | (Mg,Mn2+)2Mn3+(BO3)O2 |
| O | ⓘ Plumbonacrite | Pb5O(OH)2(CO3)3 |
| O | ⓘ Powellite | Ca(MoO4) |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pyrobelonite | PbMn2+(VO4)(OH) |
| O | ⓘ Pyrochroite | Mn(OH)2 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyrophanite | Mn2+TiO3 |
| O | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| O | ⓘ Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Quenselite | PbMnO2(OH) |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| O | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| O | ⓘ Roeblingite | Pb2Ca6Mn2+(Si3O9)2(SO4)2(OH)2 · 4H2O |
| O | ⓘ Roméite Group | A2(Sb5+)2O6Z |
| O | ⓘ Rouseite | Pb2Mn2+[AsO3]2 · 2H2O |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Sahlinite | Pb14(AsO4)2O9Cl4 |
| O | ⓘ Sarkinite | Mn22+(AsO4)(OH) |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Diopside var. Schefferite | (Ca,Mn)(Mg,Fe,Mn)Si2O6 |
| O | ⓘ Senaite | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
| O | ⓘ Senarmontite | Sb2O3 |
| O | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| O | ⓘ Serandite | NaMn22+Si3O8(OH) |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Pyroaurite-2H | Mg6Fe23+(OH)16(CO3) · 4H2O |
| O | ⓘ Sonolite | Mn92+(SiO4)4(OH)2 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Stenhuggarite | CaFeSb(AsO3)2O |
| O | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| O | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | ⓘ Stolzite | Pb(WO4) |
| O | ⓘ Sundiusite | Pb10(SO4)O8Cl2 |
| O | ⓘ Svabite | Ca5(AsO4)3F |
| O | ⓘ Sverigeite | NaMnMgSnBe2(SiO4)3(OH) |
| O | ⓘ Swedenborgite | NaBe4Sb5+O7 |
| O | ⓘ Synadelphite | Mn92+(As5+O4)2(As3+O3)(OH)9 · 2H2O |
| O | ⓘ Szaibélyite | MgBO2(OH) |
| O | ⓘ Magnesiotaaffeite-2N’2S | Mg3Al8BeO16 |
| O | ⓘ Takéuchiite | (Mg,Mn2+)2(Mn3+,Fe3+)(BO3)O2 |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Taramellite | Ba4(Fe3+,Ti,Fe2+,Mg)4(B2Si8O27)O2Clx |
| O | ⓘ Tephroite | Mn22+(SiO4) |
| O | ⓘ Tetraferriphlogopite | KMg3(Si3Fe3+)O10(OH)2 |
| O | ⓘ Tetrawickmanite | Mn2+[Sn4+(OH)6] |
| O | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| O | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| O | ⓘ Tilasite | CaMg(AsO4)F |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Trigonite | Pb3Mn2+(AsO3)2(HAsO3) |
| O | ⓘ Trimerite | CaMn22+Be3(SiO4)3 |
| O | ⓘ Turneaureite | Ca5(AsO4)3Cl |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Valentinite | Sb2O3 |
| O | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| O | ⓘ Vanadinite | Pb5(VO4)3Cl |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Welinite | Mn62+(W6+,Mg)2(SiO4)2(O,OH)6 |
| O | ⓘ Welshite | Ca4Mg9Sb3O4[Si6Be3AlFe2O36] |
| O | ⓘ Wermlandite | Mg7Al2(OH)18[Ca(H2O)6][SO4]2 · 6H2O |
| O | ⓘ Wickmanite | Mn2+[Sn(OH)6] |
| O | ⓘ Willemite | Zn2SiO4 |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Xonotlite | Ca6(Si6O17)(OH)2 |
| O | ⓘ Zenzénite | Pb3Fe43+Mn34+O15 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Hematite var. Specularite | Fe2O3 |
| O | ⓘ Willemite var. Troostite | (Zn,Mn)2SiO4 |
| O | ⓘ Arakiite | (Zn,Mn2+)(Mn2+,Mg)12(Fe3+,Al)2(As5+O4)2(As3+O3)(OH)23 |
| O | ⓘ Hiärneite | Ca2Zr4Mn3+SbTiO16 |
| O | ⓘ Hyttsjöite | Pb18Ba2Ca5Mn22+Fe23+Si30O90Cl · 6H2O |
| O | ⓘ Tegengrenite | (Mn3+0.5Sb5+0.5)Mg2O4 |
| O | ⓘ Julgoldite-(Fe3+) | Ca2Fe3+Fe23+[Si2O6OH][SiO4](OH)2O |
| O | ⓘ Philolithite | Pb12Mn2+(Mg,Mn2+)2(Mn2+,Mg)4(CO3)4(SO4)O6(OH)12Cl4 |
| O | ⓘ Potassic-richterite | K(CaNa)Mg5(Si8O22)(OH)2 |
| O | ⓘ Jacobsite-Magnetite Series | |
| O | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ α-Vredenburgite | (Mn,Fe)3O4 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Richterite var. Marmairolite | {Na}{Na(Ca,Mn)}{Mg5}(Si8O22)(OH)2 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Tephroite var. Picrotephroite | (Mn,Mg)2[SiO4] |
| O | ⓘ Aegirine-augite var. Urbanite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Ferri-winchite | ◻(NaCa)(Mg4Fe3+)Si8O22(OH)2 |
| O | ⓘ Holtstamite | Ca3Al2(SiO4)2[◻(OH)4] |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Olmiite | CaMn2+[SiO3(OH)](OH) |
| O | ⓘ Britvinite | [Pb7(OH)3F(BO3)2(CO3)][Mg4.5(OH)3(Si5O14)] |
| O | ⓘ Quintinite-2H | Mg4Al2(OH)12(CO3) · 3H2O |
| O | ⓘ Julgoldite Subgroup | Ca2XFe23+[Si2O6(OH)][SiO4](OH)2A |
| O | ⓘ Fluornatroroméite | (Na,Ca)2Sb2(O,OH)6F |
| O | ⓘ Fluorcalcioroméite | (Ca,Na,◻)2Sb25+(O,OH)6F |
| O | ⓘ Oxycalcioroméite | Ca2Sb2O6O |
| O | ⓘ Långbanshyttanite | Pb2Mn2Mg(AsO4)2(OH)4 · 6H2O |
| O | ⓘ Carlfrancisite | Mn32+(Mn2+,Mg,Fe3+,Al)42[As3+O3]2(As5+O4)4[(Si,As5+)O4]6[(As5+,Si)O4]2(OH)42 |
| O | ⓘ Fluoro-arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22F2 |
| O | ⓘ Yangite | PbMnSi3O8 · H2O |
| O | ⓘ Oxyplumboroméite | Pb2Sb2O6O |
| O | ⓘ Gatedalite | ZrMn22+Mn43+SiO12 |
| O | ⓘ Cyprine | Ca19Cu2+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 |
| O | ⓘ Wiklundite | Pb2(Mn2+,Zn)3(Fe3+,Mn2+)2(Mn2+,Mg)19(As3+O3)2[(Si,As5+)O4]6(OH)18Cl6 |
| O | ⓘ Hydroxylhedyphane | Ca2Pb3(AsO4)3(OH) |
| O | ⓘ UM1983-30-AsO:FeHMgMnZn (Also known as Mineral D) | (Mn,Mg,Fe3+,Al)15(AsO3)(AsO4)2(OH)23 |
| O | ⓘ UM1986-05-AsO:HMn | Mn3As2O4(OH)4 |
| O | ⓘ UM1986-06-AsO:HMn | Mn3As2O4(OH)4 |
| O | ⓘ Ferrorhodonite | CaMn3Fe[Si5O15] |
| O | ⓘ Pinakiolite var. Sb-rich pinakiolite | Mg1.90Mn0.91Sb0.19O2BO3 |
| O | ⓘ Clino-ferro-suenoite | ◻Mn22+(Fe52+)(Si8O22)(OH)2 |
| O | ⓘ Brucite var. Manganese-bearing Brucite | Mg(OH)2 |
| O | ⓘ Hjalmarite | Na(NaMn)Mg5(Si8O22)(OH)2 |
| O | ⓘ Mangani-pargasite | NaCa2(Mg4Mn3+)(Si6Al2)O22(OH)2 |
| O | ⓘ Langhofite | Pb2(OH)[WO4(OH)] |
| O | ⓘ Vargite | MnCu2Mn2(AsO4)2(OH)4(H2O)4 |
| O | ⓘ Erssonite | Mg7Fe23+(OH)18[Ca(H2O)6](SO4)2 · 12H2O |
| O | ⓘ Igelströmite | Fe3+(Sb3+Pb2+)O4 |
| O | ⓘ Magnetite var. Zinc-bearing Magnetite | (Fe,Zn)Fe3O4 |
| O | ⓘ Manganoschafarzikite | MnSb2O4 |
| O | ⓘ Skogbyite | Zr(Mg2Mn43+)SiO12 |
| O | ⓘ Friisite | Pb8Al3Si8O27Cl3 |
| O | ⓘ Strandite | Pb3Mn43+Mn34+O15 |
| O | ⓘ Hugotibergite | Ca6CaPb2(Si3O9)2(SO4)2(OH)2(H2O)4 |
| F | Fluorine | |
| F | ⓘ Roméite Group var. Atopite | (Ca,Na)2Sb2(O,F,OH)7 |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| F | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Hyalotekite | (Ba,Pb,K)4(Ca,Y)2(B,Be)2(Si,B)2Si8O28(F,Cl) |
| F | ⓘ Svabite | Ca5(AsO4)3F |
| F | ⓘ Tilasite | CaMg(AsO4)F |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Britvinite | [Pb7(OH)3F(BO3)2(CO3)][Mg4.5(OH)3(Si5O14)] |
| F | ⓘ Fluornatroroméite | (Na,Ca)2Sb2(O,OH)6F |
| F | ⓘ Fluorcalcioroméite | (Ca,Na,◻)2Sb25+(O,OH)6F |
| F | ⓘ Fluoro-arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22F2 |
| Na | Sodium | |
| Na | ⓘ Aegirine | NaFe3+Si2O6 |
| Na | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Arseniopleite | NaCaMnMn2(AsO4)3 |
| Na | ⓘ Richterite var. Astochite | {Na}{Na(Ca,Mn)}{Mg5}(Si8O22)(OH)2 |
| Na | ⓘ Roméite Group var. Atopite | (Ca,Na)2Sb2(O,F,OH)7 |
| Na | ⓘ Banalsite | Na2BaAl4Si4O16 |
| Na | ⓘ Berzeliite | (NaCa2)Mg2(AsO4)3 |
| Na | ⓘ Caryinite | (Na,Pb)(Ca,Na)CaMn22+(AsO4)3 |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Ganophyllite | (K,Na)xMn62+(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| Na | ⓘ Manganberzeliite | (NaCa2)Mn22+(AsO4)3 |
| Na | ⓘ Magnesio-hastingsite | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| Na | ⓘ Marialite | Na4Al3Si9O24Cl |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Na | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Na | ⓘ Pectolite | NaCa2Si3O8(OH) |
| Na | ⓘ Phillipsite Subgroup | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| Na | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| Na | ⓘ Serandite | NaMn22+Si3O8(OH) |
| Na | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| Na | ⓘ Sverigeite | NaMnMgSnBe2(SiO4)3(OH) |
| Na | ⓘ Swedenborgite | NaBe4Sb5+O7 |
| Na | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| Na | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Na | ⓘ Potassic-richterite | K(CaNa)Mg5(Si8O22)(OH)2 |
| Na | ⓘ Richterite var. Marmairolite | {Na}{Na(Ca,Mn)}{Mg5}(Si8O22)(OH)2 |
| Na | ⓘ Aegirine-augite var. Urbanite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Na | ⓘ Ferri-winchite | ◻(NaCa)(Mg4Fe3+)Si8O22(OH)2 |
| Na | ⓘ Fluornatroroméite | (Na,Ca)2Sb2(O,OH)6F |
| Na | ⓘ Fluorcalcioroméite | (Ca,Na,◻)2Sb25+(O,OH)6F |
| Na | ⓘ Fluoro-arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22F2 |
| Na | ⓘ Hjalmarite | Na(NaMn)Mg5(Si8O22)(OH)2 |
| Na | ⓘ Mangani-pargasite | NaCa2(Mg4Mn3+)(Si6Al2)O22(OH)2 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Adelite | CaMg(AsO4)(OH) |
| Mg | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Richterite var. Astochite | {Na}{Na(Ca,Mn)}{Mg5}(Si8O22)(OH)2 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Benstonite | Ba6Ca6Mg(CO3)13 |
| Mg | ⓘ Berzeliite | (NaCa2)Mg2(AsO4)3 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Blatterite | Sb35+(Mn3+,Fe3+)9(Mn2+,Mg)35(BO3)16O32 |
| Mg | ⓘ Brugnatellite | Mg6Fe3+(CO3)(OH)13 · 4H2O |
| Mg | ⓘ Brucite | Mg(OH)2 |
| Mg | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Clinochrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| Mg | ⓘ Cordierite | Mg2Al4Si5O18 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Forsterite | Mg2(SiO4) |
| Mg | ⓘ Fredrikssonite | Mg2Mn3+O2(BO3) |
| Mg | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Mg | ⓘ Geikielite | MgTiO3 |
| Mg | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Mg | ⓘ Hematolite | (Mn,Mg,Al,Fe3+)15(As5+O4)2(As3+O3)(OH)23 |
| Mg | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| Mg | ⓘ Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| Mg | ⓘ Joesmithite | Pb2+Ca2(Mg3Fe23+)(Si6Be2)O22(OH)2 |
| Mg | ⓘ Katoptrite | (Mn2+,Mg)13(Al,Fe3+)4Sb25+(SiO4)2O20 |
| Mg | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Mg | ⓘ Lizardite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Ludwigite | Mg2Fe3+(BO3)O2 |
| Mg | ⓘ Biotite var. Manganophyllite | K(Fe,Mg,Mn)3AlSi3O10(OH)2 |
| Mg | ⓘ Magnesio-hastingsite | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| Mg | ⓘ Magnesioferrite | MgFe23+O4 |
| Mg | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Mg | ⓘ Molybdophyllite | Pb8Mg9[Si10O28(OH)8O2(CO3)3] · H2O |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Norsethite | BaMg(CO3)2 |
| Mg | ⓘ Orthopinakiolite | (Mg,Mn2+)2Mn3+(BO3)O2 |
| Mg | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Mg | ⓘ Periclase | MgO |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Pinakiolite | (Mg,Mn2+)2Mn3+(BO3)O2 |
| Mg | ⓘ Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| Mg | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Diopside var. Schefferite | (Ca,Mn)(Mg,Fe,Mn)Si2O6 |
| Mg | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Mg | ⓘ Pyroaurite-2H | Mg6Fe23+(OH)16(CO3) · 4H2O |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| Mg | ⓘ Sverigeite | NaMnMgSnBe2(SiO4)3(OH) |
| Mg | ⓘ Szaibélyite | MgBO2(OH) |
| Mg | ⓘ Magnesiotaaffeite-2N’2S | Mg3Al8BeO16 |
| Mg | ⓘ Takéuchiite | (Mg,Mn2+)2(Mn3+,Fe3+)(BO3)O2 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Taramellite | Ba4(Fe3+,Ti,Fe2+,Mg)4(B2Si8O27)O2Clx |
| Mg | ⓘ Tetraferriphlogopite | KMg3(Si3Fe3+)O10(OH)2 |
| Mg | ⓘ Tilasite | CaMg(AsO4)F |
| Mg | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Mg | ⓘ Welinite | Mn62+(W6+,Mg)2(SiO4)2(O,OH)6 |
| Mg | ⓘ Welshite | Ca4Mg9Sb3O4[Si6Be3AlFe2O36] |
| Mg | ⓘ Wermlandite | Mg7Al2(OH)18[Ca(H2O)6][SO4]2 · 6H2O |
| Mg | ⓘ Arakiite | (Zn,Mn2+)(Mn2+,Mg)12(Fe3+,Al)2(As5+O4)2(As3+O3)(OH)23 |
| Mg | ⓘ Tegengrenite | (Mn3+0.5Sb5+0.5)Mg2O4 |
| Mg | ⓘ Philolithite | Pb12Mn2+(Mg,Mn2+)2(Mn2+,Mg)4(CO3)4(SO4)O6(OH)12Cl4 |
| Mg | ⓘ Potassic-richterite | K(CaNa)Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Richterite var. Marmairolite | {Na}{Na(Ca,Mn)}{Mg5}(Si8O22)(OH)2 |
| Mg | ⓘ Tephroite var. Picrotephroite | (Mn,Mg)2[SiO4] |
| Mg | ⓘ Aegirine-augite var. Urbanite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Mg | ⓘ Ferri-winchite | ◻(NaCa)(Mg4Fe3+)Si8O22(OH)2 |
| Mg | ⓘ Britvinite | [Pb7(OH)3F(BO3)2(CO3)][Mg4.5(OH)3(Si5O14)] |
| Mg | ⓘ Quintinite-2H | Mg4Al2(OH)12(CO3) · 3H2O |
| Mg | ⓘ Långbanshyttanite | Pb2Mn2Mg(AsO4)2(OH)4 · 6H2O |
| Mg | ⓘ Carlfrancisite | Mn32+(Mn2+,Mg,Fe3+,Al)42[As3+O3]2(As5+O4)4[(Si,As5+)O4]6[(As5+,Si)O4]2(OH)42 |
| Mg | ⓘ Cyprine | Ca19Cu2+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 |
| Mg | ⓘ Wiklundite | Pb2(Mn2+,Zn)3(Fe3+,Mn2+)2(Mn2+,Mg)19(As3+O3)2[(Si,As5+)O4]6(OH)18Cl6 |
| Mg | ⓘ UM1983-30-AsO:FeHMgMnZn (Also known as Mineral D) | (Mn,Mg,Fe3+,Al)15(AsO3)(AsO4)2(OH)23 |
| Mg | ⓘ Pinakiolite var. Sb-rich pinakiolite | Mg1.90Mn0.91Sb0.19O2BO3 |
| Mg | ⓘ Brucite var. Manganese-bearing Brucite | Mg(OH)2 |
| Mg | ⓘ Hjalmarite | Na(NaMn)Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Mangani-pargasite | NaCa2(Mg4Mn3+)(Si6Al2)O22(OH)2 |
| Mg | ⓘ Erssonite | Mg7Fe23+(OH)18[Ca(H2O)6](SO4)2 · 12H2O |
| Mg | ⓘ Skogbyite | Zr(Mg2Mn43+)SiO12 |
| Al | Aluminium | |
| Al | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Banalsite | Na2BaAl4Si4O16 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Celsian | Ba(Al2Si2O8) |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Cordierite | Mg2Al4Si5O18 |
| Al | ⓘ Cymrite | BaAl2Si2(O,OH)8 · H2O |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Gahnite | ZnAl2O4 |
| Al | ⓘ Galaxite | Mn2+Al2O4 |
| Al | ⓘ Ganophyllite | (K,Na)xMn62+(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| Al | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Al | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Hancockite | (CaPb)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Al | ⓘ Hematolite | (Mn,Mg,Al,Fe3+)15(As5+O4)2(As3+O3)(OH)23 |
| Al | ⓘ Grossular var. Hibschite | Ca3Al2(SiO4)3-x(OH)4x |
| Al | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Al | ⓘ Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Katoptrite | (Mn2+,Mg)13(Al,Fe3+)4Sb25+(SiO4)2O20 |
| Al | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Biotite var. Manganophyllite | K(Fe,Mg,Mn)3AlSi3O10(OH)2 |
| Al | ⓘ Magnesio-hastingsite | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| Al | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Al | ⓘ Marialite | Na4Al3Si9O24Cl |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Al | ⓘ Pennantite | Mn52+Al(AlSi3O10)(OH)8 |
| Al | ⓘ Phillipsite Subgroup | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | ⓘ Magnesiotaaffeite-2N’2S | Mg3Al8BeO16 |
| Al | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| Al | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Welshite | Ca4Mg9Sb3O4[Si6Be3AlFe2O36] |
| Al | ⓘ Wermlandite | Mg7Al2(OH)18[Ca(H2O)6][SO4]2 · 6H2O |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Arakiite | (Zn,Mn2+)(Mn2+,Mg)12(Fe3+,Al)2(As5+O4)2(As3+O3)(OH)23 |
| Al | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Aegirine-augite var. Urbanite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Al | ⓘ Holtstamite | Ca3Al2(SiO4)2[◻(OH)4] |
| Al | ⓘ Quintinite-2H | Mg4Al2(OH)12(CO3) · 3H2O |
| Al | ⓘ Carlfrancisite | Mn32+(Mn2+,Mg,Fe3+,Al)42[As3+O3]2(As5+O4)4[(Si,As5+)O4]6[(As5+,Si)O4]2(OH)42 |
| Al | ⓘ Cyprine | Ca19Cu2+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 |
| Al | ⓘ UM1983-30-AsO:FeHMgMnZn (Also known as Mineral D) | (Mn,Mg,Fe3+,Al)15(AsO3)(AsO4)2(OH)23 |
| Al | ⓘ Mangani-pargasite | NaCa2(Mg4Mn3+)(Si6Al2)O22(OH)2 |
| Al | ⓘ Friisite | Pb8Al3Si8O27Cl3 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Aegirine | NaFe3+Si2O6 |
| Si | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Si | ⓘ Alamosite | PbSiO3 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Alleghanyite | Mn52+(SiO4)2(OH)2 |
| Si | ⓘ Aminoffite | Ca3(BeOH)2Si3O10 |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Apophyllite Group | AB4[Si8O20]X · 8H2O |
| Si | ⓘ Richterite var. Astochite | {Na}{Na(Ca,Mn)}{Mg5}(Si8O22)(OH)2 |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Banalsite | Na2BaAl4Si4O16 |
| Si | ⓘ Barylite | Be2Ba(Si2O7) |
| Si | ⓘ Barysilite | Pb8Mn2+[Si2O7]3 |
| Si | ⓘ Bementite | Mn7Si6O15(OH)8 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Si | ⓘ Bustamite | CaMn2+(Si2O6) |
| Si | ⓘ Caryopilite | Mn32+Si2O5(OH)4 |
| Si | ⓘ Celsian | Ba(Al2Si2O8) |
| Si | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinochrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Cordierite | Mg2Al4Si5O18 |
| Si | ⓘ Cymrite | BaAl2Si2(O,OH)8 · H2O |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dixenite | CuMn142+Fe2+(SiO4)2(As5+O4)(As3+O3)5(OH)6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Datolite | CaB(SiO4)(OH) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Ericssonite | BaMn22+Fe3+(Si2O7)O(OH) |
| Si | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| Si | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| Si | ⓘ Forsterite | Mg2(SiO4) |
| Si | ⓘ Friedelite | Mn82+Si6O15(OH,Cl)10 |
| Si | ⓘ Ganomalite | Pb9Ca5Mn(Si2O7)4(SiO4)O |
| Si | ⓘ Ganophyllite | (K,Na)xMn62+(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| Si | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Si | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Si | ⓘ Gonyerite | Mn52+Fe3+(Fe3+Si3O10)(OH)8 |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Hancockite | (CaPb)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Si | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Si | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Si | ⓘ Henritermierite | Ca3Mn23+(SiO4)2[◻(OH)4] |
| Si | ⓘ Grossular var. Hibschite | Ca3Al2(SiO4)3-x(OH)4x |
| Si | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Si | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Si | ⓘ Hyalotekite | (Ba,Pb,K)4(Ca,Y)2(B,Be)2(Si,B)2Si8O28(F,Cl) |
| Si | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Si | ⓘ Inesite | Ca2(Mn,Fe)7Si10O28(OH)2 · 5H2O |
| Si | ⓘ Jagoite | Pb18Fe43+[Si4(Si,Fe3+)6][Pb4Si16(Si,Fe)4]O82Cl6 |
| Si | ⓘ Joesmithite | Pb2+Ca2(Mg3Fe23+)(Si6Be2)O22(OH)2 |
| Si | ⓘ Johannsenite | CaMn2+Si2O6 |
| Si | ⓘ Julgoldite-(Fe2+) | Ca2Fe2+Fe23+[Si2O6OH][SiO4](OH)2(OH) |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Katoptrite | (Mn2+,Mg)13(Al,Fe3+)4Sb25+(SiO4)2O20 |
| Si | ⓘ Kentrolite | Pb2Mn23+(Si2O7)O2 |
| Si | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Si | ⓘ Långbanite | Mn42+Mn93+Sb5+O16(SiO4)2 |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Leucophoenicite | Mn72+(SiO4)3(OH)2 |
| Si | ⓘ Lizardite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Manganhumite | Mn72+(SiO4)3(OH)2 |
| Si | ⓘ Biotite var. Manganophyllite | K(Fe,Mg,Mn)3AlSi3O10(OH)2 |
| Si | ⓘ Magnesio-hastingsite | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| Si | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Si | ⓘ Margarosanite | Ca2PbSi3O9 |
| Si | ⓘ Marialite | Na4Al3Si9O24Cl |
| Si | ⓘ Melanotekite | Pb2Fe23+(Si2O7)O2 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Molybdophyllite | Pb8Mg9[Si10O28(OH)8O2(CO3)3] · H2O |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Nasonite | Pb6Ca4(Si2O7)3Cl2 |
| Si | ⓘ Neotocite | (Mn,Fe)SiO3 · H2O (?) |
| Si | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Ericssonite-2O | BaMn22+Fe3+(Si2O7)O(OH) |
| Si | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Si | ⓘ Parwelite | Mn10Sb2As2Si2O24 |
| Si | ⓘ Pectolite | NaCa2Si3O8(OH) |
| Si | ⓘ Pennantite | Mn52+Al(AlSi3O10)(OH)8 |
| Si | ⓘ Phenakite | Be2SiO4 |
| Si | ⓘ Phillipsite Subgroup | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Si | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| Si | ⓘ Roeblingite | Pb2Ca6Mn2+(Si3O9)2(SO4)2(OH)2 · 4H2O |
| Si | ⓘ Diopside var. Schefferite | (Ca,Mn)(Mg,Fe,Mn)Si2O6 |
| Si | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Si | ⓘ Serandite | NaMn22+Si3O8(OH) |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Sonolite | Mn92+(SiO4)4(OH)2 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| Si | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | ⓘ Sverigeite | NaMnMgSnBe2(SiO4)3(OH) |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Taramellite | Ba4(Fe3+,Ti,Fe2+,Mg)4(B2Si8O27)O2Clx |
| Si | ⓘ Tephroite | Mn22+(SiO4) |
| Si | ⓘ Tetraferriphlogopite | KMg3(Si3Fe3+)O10(OH)2 |
| Si | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| Si | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Trimerite | CaMn22+Be3(SiO4)3 |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Welinite | Mn62+(W6+,Mg)2(SiO4)2(O,OH)6 |
| Si | ⓘ Welshite | Ca4Mg9Sb3O4[Si6Be3AlFe2O36] |
| Si | ⓘ Willemite | Zn2SiO4 |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Xonotlite | Ca6(Si6O17)(OH)2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Willemite var. Troostite | (Zn,Mn)2SiO4 |
| Si | ⓘ Hyttsjöite | Pb18Ba2Ca5Mn22+Fe23+Si30O90Cl · 6H2O |
| Si | ⓘ Julgoldite-(Fe3+) | Ca2Fe3+Fe23+[Si2O6OH][SiO4](OH)2O |
| Si | ⓘ Potassic-richterite | K(CaNa)Mg5(Si8O22)(OH)2 |
| Si | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Richterite var. Marmairolite | {Na}{Na(Ca,Mn)}{Mg5}(Si8O22)(OH)2 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Tephroite var. Picrotephroite | (Mn,Mg)2[SiO4] |
| Si | ⓘ Aegirine-augite var. Urbanite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Ferri-winchite | ◻(NaCa)(Mg4Fe3+)Si8O22(OH)2 |
| Si | ⓘ Holtstamite | Ca3Al2(SiO4)2[◻(OH)4] |
| Si | ⓘ Olmiite | CaMn2+[SiO3(OH)](OH) |
| Si | ⓘ Britvinite | [Pb7(OH)3F(BO3)2(CO3)][Mg4.5(OH)3(Si5O14)] |
| Si | ⓘ Julgoldite Subgroup | Ca2XFe23+[Si2O6(OH)][SiO4](OH)2A |
| Si | ⓘ Carlfrancisite | Mn32+(Mn2+,Mg,Fe3+,Al)42[As3+O3]2(As5+O4)4[(Si,As5+)O4]6[(As5+,Si)O4]2(OH)42 |
| Si | ⓘ Fluoro-arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22F2 |
| Si | ⓘ Yangite | PbMnSi3O8 · H2O |
| Si | ⓘ Gatedalite | ZrMn22+Mn43+SiO12 |
| Si | ⓘ Cyprine | Ca19Cu2+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 |
| Si | ⓘ Wiklundite | Pb2(Mn2+,Zn)3(Fe3+,Mn2+)2(Mn2+,Mg)19(As3+O3)2[(Si,As5+)O4]6(OH)18Cl6 |
| Si | ⓘ Ferrorhodonite | CaMn3Fe[Si5O15] |
| Si | ⓘ Clino-ferro-suenoite | ◻Mn22+(Fe52+)(Si8O22)(OH)2 |
| Si | ⓘ Hjalmarite | Na(NaMn)Mg5(Si8O22)(OH)2 |
| Si | ⓘ Mangani-pargasite | NaCa2(Mg4Mn3+)(Si6Al2)O22(OH)2 |
| Si | ⓘ Skogbyite | Zr(Mg2Mn43+)SiO12 |
| Si | ⓘ Friisite | Pb8Al3Si8O27Cl3 |
| Si | ⓘ Hugotibergite | Ca6CaPb2(Si3O9)2(SO4)2(OH)2(H2O)4 |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Aikinite | CuPbBiS3 |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Anilite | Cu7S4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Betekhtinite | Pb2(Cu,Fe)22-24S15 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Cobaltpentlandite | Co9S8 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Djurleite | Cu31S16 |
| S | ⓘ Freieslebenite | AgPbSbS3 |
| S | ⓘ Galena | PbS |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| S | ⓘ Lanarkite | Pb2(SO4)O |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Orpiment | As2S3 |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Realgar | As4S4 |
| S | ⓘ Roeblingite | Pb2Ca6Mn2+(Si3O9)2(SO4)2(OH)2 · 4H2O |
| S | ⓘ Roquesite | CuInS2 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Spionkopite | Cu39S28 |
| S | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Sundiusite | Pb10(SO4)O8Cl2 |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| S | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| S | ⓘ Wermlandite | Mg7Al2(OH)18[Ca(H2O)6][SO4]2 · 6H2O |
| S | ⓘ Wittichenite | Cu3BiS3 |
| S | ⓘ Yarrowite | Cu9S8 |
| S | ⓘ Philolithite | Pb12Mn2+(Mg,Mn2+)2(Mn2+,Mg)4(CO3)4(SO4)O6(OH)12Cl4 |
| S | ⓘ Erssonite | Mg7Fe23+(OH)18[Ca(H2O)6](SO4)2 · 12H2O |
| S | ⓘ Hugotibergite | Ca6CaPb2(Si3O9)2(SO4)2(OH)2(H2O)4 |
| Cl | Chlorine | |
| Cl | ⓘ Blixite | Pb8O5(OH)2Cl4 |
| Cl | ⓘ Ecdemite | Pb6As23+O7Cl4 |
| Cl | ⓘ Finnemanite | Pb5(AsO3)3Cl |
| Cl | ⓘ Freedite | Cu+Pb8(AsO3)2O3Cl5 |
| Cl | ⓘ Friedelite | Mn82+Si6O15(OH,Cl)10 |
| Cl | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| Cl | ⓘ Hyalotekite | (Ba,Pb,K)4(Ca,Y)2(B,Be)2(Si,B)2Si8O28(F,Cl) |
| Cl | ⓘ Jagoite | Pb18Fe43+[Si4(Si,Fe3+)6][Pb4Si16(Si,Fe)4]O82Cl6 |
| Cl | ⓘ Magnussonite | Mn102+(As3+O3)6(OH,Cl)2 |
| Cl | ⓘ Marialite | Na4Al3Si9O24Cl |
| Cl | ⓘ Mendipite | Pb3Cl2O2 |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Nadorite | PbSbClO2 |
| Cl | ⓘ Nasonite | Pb6Ca4(Si2O7)3Cl2 |
| Cl | ⓘ Perite | PbBiClO2 |
| Cl | ⓘ Sahlinite | Pb14(AsO4)2O9Cl4 |
| Cl | ⓘ Sundiusite | Pb10(SO4)O8Cl2 |
| Cl | ⓘ Taramellite | Ba4(Fe3+,Ti,Fe2+,Mg)4(B2Si8O27)O2Clx |
| Cl | ⓘ Turneaureite | Ca5(AsO4)3Cl |
| Cl | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cl | ⓘ Hyttsjöite | Pb18Ba2Ca5Mn22+Fe23+Si30O90Cl · 6H2O |
| Cl | ⓘ Philolithite | Pb12Mn2+(Mg,Mn2+)2(Mn2+,Mg)4(CO3)4(SO4)O6(OH)12Cl4 |
| Cl | ⓘ Wiklundite | Pb2(Mn2+,Zn)3(Fe3+,Mn2+)2(Mn2+,Mg)19(As3+O3)2[(Si,As5+)O4]6(OH)18Cl6 |
| Cl | ⓘ Friisite | Pb8Al3Si8O27Cl3 |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| K | ⓘ Ganophyllite | (K,Na)xMn62+(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| K | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| K | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| K | ⓘ Hyalotekite | (Ba,Pb,K)4(Ca,Y)2(B,Be)2(Si,B)2Si8O28(F,Cl) |
| K | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| K | ⓘ Biotite var. Manganophyllite | K(Fe,Mg,Mn)3AlSi3O10(OH)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Phillipsite Subgroup | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Tetraferriphlogopite | KMg3(Si3Fe3+)O10(OH)2 |
| K | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| K | ⓘ Potassic-richterite | K(CaNa)Mg5(Si8O22)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Adelite | CaMg(AsO4)(OH) |
| Ca | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Aminoffite | Ca3(BeOH)2Si3O10 |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Arseniopleite | NaCaMnMn2(AsO4)3 |
| Ca | ⓘ Richterite var. Astochite | {Na}{Na(Ca,Mn)}{Mg5}(Si8O22)(OH)2 |
| Ca | ⓘ Roméite Group var. Atopite | (Ca,Na)2Sb2(O,F,OH)7 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Barytocalcite | BaCa(CO3)2 |
| Ca | ⓘ Benstonite | Ba6Ca6Mg(CO3)13 |
| Ca | ⓘ Bergslagite | CaBeAsO4(OH) |
| Ca | ⓘ Berzeliite | (NaCa2)Mg2(AsO4)3 |
| Ca | ⓘ Brandtite | Ca2Mn2+(AsO4)2 · 2H2O |
| Ca | ⓘ Bustamite | CaMn2+(Si2O6) |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Caryinite | (Na,Pb)(Ca,Na)CaMn22+(AsO4)3 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Datolite | CaB(SiO4)(OH) |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Ganomalite | Pb9Ca5Mn(Si2O7)4(SiO4)O |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Hancockite | (CaPb)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Ca | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| Ca | ⓘ Henritermierite | Ca3Mn23+(SiO4)2[◻(OH)4] |
| Ca | ⓘ Grossular var. Hibschite | Ca3Al2(SiO4)3-x(OH)4x |
| Ca | ⓘ Hyalotekite | (Ba,Pb,K)4(Ca,Y)2(B,Be)2(Si,B)2Si8O28(F,Cl) |
| Ca | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Ca | ⓘ Inesite | Ca2(Mn,Fe)7Si10O28(OH)2 · 5H2O |
| Ca | ⓘ Ingersonite | Ca3Mn2+Sb45+O14 |
| Ca | ⓘ Joesmithite | Pb2+Ca2(Mg3Fe23+)(Si6Be2)O22(OH)2 |
| Ca | ⓘ Johannsenite | CaMn2+Si2O6 |
| Ca | ⓘ Johnbaumite | Ca5(AsO4)3(OH) |
| Ca | ⓘ Julgoldite-(Fe2+) | Ca2Fe2+Fe23+[Si2O6OH][SiO4](OH)2(OH) |
| Ca | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Hydroxycalcioroméite | (Ca,Sb3+)2(Sb5+,Ti)2O6(OH) |
| Ca | ⓘ Manganberzeliite | (NaCa2)Mn22+(AsO4)3 |
| Ca | ⓘ Magnesio-hastingsite | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Ca | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Ca | ⓘ Margarosanite | Ca2PbSi3O9 |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Nasonite | Pb6Ca4(Si2O7)3Cl2 |
| Ca | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Pectolite | NaCa2Si3O8(OH) |
| Ca | ⓘ Phillipsite Subgroup | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| Ca | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Powellite | Ca(MoO4) |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Ca | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Roeblingite | Pb2Ca6Mn2+(Si3O9)2(SO4)2(OH)2 · 4H2O |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Diopside var. Schefferite | (Ca,Mn)(Mg,Fe,Mn)Si2O6 |
| Ca | ⓘ Stenhuggarite | CaFeSb(AsO3)2O |
| Ca | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| Ca | ⓘ Svabite | Ca5(AsO4)3F |
| Ca | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| Ca | ⓘ Thomsonite-Ca | NaCa2[Al5Si5O20] · 6H2O |
| Ca | ⓘ Tilasite | CaMg(AsO4)F |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Trimerite | CaMn22+Be3(SiO4)3 |
| Ca | ⓘ Turneaureite | Ca5(AsO4)3Cl |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Welshite | Ca4Mg9Sb3O4[Si6Be3AlFe2O36] |
| Ca | ⓘ Wermlandite | Mg7Al2(OH)18[Ca(H2O)6][SO4]2 · 6H2O |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Xonotlite | Ca6(Si6O17)(OH)2 |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Hiärneite | Ca2Zr4Mn3+SbTiO16 |
| Ca | ⓘ Hyttsjöite | Pb18Ba2Ca5Mn22+Fe23+Si30O90Cl · 6H2O |
| Ca | ⓘ Julgoldite-(Fe3+) | Ca2Fe3+Fe23+[Si2O6OH][SiO4](OH)2O |
| Ca | ⓘ Potassic-richterite | K(CaNa)Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Richterite var. Marmairolite | {Na}{Na(Ca,Mn)}{Mg5}(Si8O22)(OH)2 |
| Ca | ⓘ Aegirine-augite var. Urbanite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Ca | ⓘ Ferri-winchite | ◻(NaCa)(Mg4Fe3+)Si8O22(OH)2 |
| Ca | ⓘ Holtstamite | Ca3Al2(SiO4)2[◻(OH)4] |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ca | ⓘ Olmiite | CaMn2+[SiO3(OH)](OH) |
| Ca | ⓘ Julgoldite Subgroup | Ca2XFe23+[Si2O6(OH)][SiO4](OH)2A |
| Ca | ⓘ Fluornatroroméite | (Na,Ca)2Sb2(O,OH)6F |
| Ca | ⓘ Fluorcalcioroméite | (Ca,Na,◻)2Sb25+(O,OH)6F |
| Ca | ⓘ Oxycalcioroméite | Ca2Sb2O6O |
| Ca | ⓘ Cyprine | Ca19Cu2+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 |
| Ca | ⓘ Hydroxylhedyphane | Ca2Pb3(AsO4)3(OH) |
| Ca | ⓘ Ferrorhodonite | CaMn3Fe[Si5O15] |
| Ca | ⓘ Mangani-pargasite | NaCa2(Mg4Mn3+)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Erssonite | Mg7Fe23+(OH)18[Ca(H2O)6](SO4)2 · 12H2O |
| Ca | ⓘ Hugotibergite | Ca6CaPb2(Si3O9)2(SO4)2(OH)2(H2O)4 |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Geikielite | MgTiO3 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Hydroxycalcioroméite | (Ca,Sb3+)2(Sb5+,Ti)2O6(OH) |
| Ti | ⓘ Macedonite | PbTiO3 |
| Ti | ⓘ Pyrophanite | Mn2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Senaite | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
| Ti | ⓘ Taramellite | Ba4(Fe3+,Ti,Fe2+,Mg)4(B2Si8O27)O2Clx |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Ti | ⓘ Hiärneite | Ca2Zr4Mn3+SbTiO16 |
| V | Vanadium | |
| V | ⓘ Pyrobelonite | PbMn2+(VO4)(OH) |
| V | ⓘ Senaite | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
| V | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cr | Chromium | |
| Cr | ⓘ Senaite | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
| Mn | Manganese | |
| Mn | ⓘ Akrochordite | MnMn2Mn2(AsO4)2(OH)4(H2O)4 |
| Mn | ⓘ Allactite | Mn72+(AsO4)2(OH)8 |
| Mn | ⓘ Alleghanyite | Mn52+(SiO4)2(OH)2 |
| Mn | ⓘ Armangite | Mn262+(AsO3)14(HAsO3)4(CO3) |
| Mn | ⓘ Arseniopleite | NaCaMnMn2(AsO4)3 |
| Mn | ⓘ Arsenoclasite | Mn52+(AsO4)2(OH)4 |
| Mn | ⓘ Richterite var. Astochite | {Na}{Na(Ca,Mn)}{Mg5}(Si8O22)(OH)2 |
| Mn | ⓘ Barysilite | Pb8Mn2+[Si2O7]3 |
| Mn | ⓘ Bementite | Mn7Si6O15(OH)8 |
| Mn | ⓘ Bixbyite-(Mn) | Mn23+O3 |
| Mn | ⓘ Blatterite | Sb35+(Mn3+,Fe3+)9(Mn2+,Mg)35(BO3)16O32 |
| Mn | ⓘ Brandtite | Ca2Mn2+(AsO4)2 · 2H2O |
| Mn | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Mn | ⓘ Bustamite | CaMn2+(Si2O6) |
| Mn | ⓘ Caryinite | (Na,Pb)(Ca,Na)CaMn22+(AsO4)3 |
| Mn | ⓘ Caryopilite | Mn32+Si2O5(OH)4 |
| Mn | ⓘ Crednerite | Cu+Mn3+O2 |
| Mn | ⓘ Dixenite | CuMn142+Fe2+(SiO4)2(As5+O4)(As3+O3)5(OH)6 |
| Mn | ⓘ Ericssonite | BaMn22+Fe3+(Si2O7)O(OH) |
| Mn | ⓘ Eveite | Mn22+(AsO4)(OH) |
| Mn | ⓘ Feitknechtite | Mn3+O(OH) |
| Mn | ⓘ Filipstadite | (Fe3+0.5Sb5+0.5)Mn2O4 |
| Mn | ⓘ Flinkite | Mn22+Mn3+(AsO4)(OH)4 |
| Mn | ⓘ Fredrikssonite | Mg2Mn3+O2(BO3) |
| Mn | ⓘ Friedelite | Mn82+Si6O15(OH,Cl)10 |
| Mn | ⓘ Galaxite | Mn2+Al2O4 |
| Mn | ⓘ Ganomalite | Pb9Ca5Mn(Si2O7)4(SiO4)O |
| Mn | ⓘ Ganophyllite | (K,Na)xMn62+(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| Mn | ⓘ Gonyerite | Mn52+Fe3+(Fe3+Si3O10)(OH)8 |
| Mn | ⓘ Hausmannite | Mn2+Mn23+O4 |
| Mn | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Mn | ⓘ Hematolite | (Mn,Mg,Al,Fe3+)15(As5+O4)2(As3+O3)(OH)23 |
| Mn | ⓘ Henritermierite | Ca3Mn23+(SiO4)2[◻(OH)4] |
| Mn | ⓘ Hetaerolite | ZnMn2O4 |
| Mn | ⓘ Inesite | Ca2(Mn,Fe)7Si10O28(OH)2 · 5H2O |
| Mn | ⓘ Ingersonite | Ca3Mn2+Sb45+O14 |
| Mn | ⓘ Jacobsite-Q | Mn2+(Fe3+,Mn3+)2O4 |
| Mn | ⓘ Jacobsite | Mn2+Fe23+O4 |
| Mn | ⓘ Johannsenite | CaMn2+Si2O6 |
| Mn | ⓘ Katoptrite | (Mn2+,Mg)13(Al,Fe3+)4Sb25+(SiO4)2O20 |
| Mn | ⓘ Kentrolite | Pb2Mn23+(Si2O7)O2 |
| Mn | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| Mn | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Mn | ⓘ Långbanite | Mn42+Mn93+Sb5+O16(SiO4)2 |
| Mn | ⓘ Leucophoenicite | Mn72+(SiO4)3(OH)2 |
| Mn | ⓘ Manganarsite | Mn3(As2O4)(OH)4 |
| Mn | ⓘ Manganhumite | Mn72+(SiO4)3(OH)2 |
| Mn | ⓘ Biotite var. Manganophyllite | K(Fe,Mg,Mn)3AlSi3O10(OH)2 |
| Mn | ⓘ Manganberzeliite | (NaCa2)Mn22+(AsO4)3 |
| Mn | ⓘ Manganohörnesite | Mn32+(AsO4)2 · 8H2O |
| Mn | ⓘ Manganosite | MnO |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Mn | ⓘ Manganostibite | (Mn,Fe)7SbAsO12 |
| Mn | ⓘ Magnussonite | Mn102+(As3+O3)6(OH,Cl)2 |
| Mn | ⓘ Melanostibite | Mn22+Fe3+Sb5+O6 |
| Mn | ⓘ Neotocite | (Mn,Fe)SiO3 · H2O (?) |
| Mn | ⓘ Ericssonite-2O | BaMn22+Fe3+(Si2O7)O(OH) |
| Mn | ⓘ Orthopinakiolite | (Mg,Mn2+)2Mn3+(BO3)O2 |
| Mn | ⓘ Parwelite | Mn10Sb2As2Si2O24 |
| Mn | ⓘ Pennantite | Mn52+Al(AlSi3O10)(OH)8 |
| Mn | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Mn | ⓘ Pinakiolite | (Mg,Mn2+)2Mn3+(BO3)O2 |
| Mn | ⓘ Pyrobelonite | PbMn2+(VO4)(OH) |
| Mn | ⓘ Pyrochroite | Mn(OH)2 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Pyrophanite | Mn2+TiO3 |
| Mn | ⓘ Quenselite | PbMnO2(OH) |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Mn | ⓘ Roeblingite | Pb2Ca6Mn2+(Si3O9)2(SO4)2(OH)2 · 4H2O |
| Mn | ⓘ Rouseite | Pb2Mn2+[AsO3]2 · 2H2O |
| Mn | ⓘ Sarkinite | Mn22+(AsO4)(OH) |
| Mn | ⓘ Diopside var. Schefferite | (Ca,Mn)(Mg,Fe,Mn)Si2O6 |
| Mn | ⓘ Senaite | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
| Mn | ⓘ Serandite | NaMn22+Si3O8(OH) |
| Mn | ⓘ Sonolite | Mn92+(SiO4)4(OH)2 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Sverigeite | NaMnMgSnBe2(SiO4)3(OH) |
| Mn | ⓘ Synadelphite | Mn92+(As5+O4)2(As3+O3)(OH)9 · 2H2O |
| Mn | ⓘ Takéuchiite | (Mg,Mn2+)2(Mn3+,Fe3+)(BO3)O2 |
| Mn | ⓘ Tephroite | Mn22+(SiO4) |
| Mn | ⓘ Tetrawickmanite | Mn2+[Sn4+(OH)6] |
| Mn | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mn | ⓘ Trigonite | Pb3Mn2+(AsO3)2(HAsO3) |
| Mn | ⓘ Trimerite | CaMn22+Be3(SiO4)3 |
| Mn | ⓘ Welinite | Mn62+(W6+,Mg)2(SiO4)2(O,OH)6 |
| Mn | ⓘ Wickmanite | Mn2+[Sn(OH)6] |
| Mn | ⓘ Zenzénite | Pb3Fe43+Mn34+O15 |
| Mn | ⓘ Willemite var. Troostite | (Zn,Mn)2SiO4 |
| Mn | ⓘ Arakiite | (Zn,Mn2+)(Mn2+,Mg)12(Fe3+,Al)2(As5+O4)2(As3+O3)(OH)23 |
| Mn | ⓘ Hiärneite | Ca2Zr4Mn3+SbTiO16 |
| Mn | ⓘ Hyttsjöite | Pb18Ba2Ca5Mn22+Fe23+Si30O90Cl · 6H2O |
| Mn | ⓘ Tegengrenite | (Mn3+0.5Sb5+0.5)Mg2O4 |
| Mn | ⓘ Philolithite | Pb12Mn2+(Mg,Mn2+)2(Mn2+,Mg)4(CO3)4(SO4)O6(OH)12Cl4 |
| Mn | ⓘ Jacobsite-Magnetite Series | |
| Mn | ⓘ α-Vredenburgite | (Mn,Fe)3O4 |
| Mn | ⓘ Richterite var. Marmairolite | {Na}{Na(Ca,Mn)}{Mg5}(Si8O22)(OH)2 |
| Mn | ⓘ Tephroite var. Picrotephroite | (Mn,Mg)2[SiO4] |
| Mn | ⓘ Olmiite | CaMn2+[SiO3(OH)](OH) |
| Mn | ⓘ Långbanshyttanite | Pb2Mn2Mg(AsO4)2(OH)4 · 6H2O |
| Mn | ⓘ Carlfrancisite | Mn32+(Mn2+,Mg,Fe3+,Al)42[As3+O3]2(As5+O4)4[(Si,As5+)O4]6[(As5+,Si)O4]2(OH)42 |
| Mn | ⓘ Yangite | PbMnSi3O8 · H2O |
| Mn | ⓘ Gatedalite | ZrMn22+Mn43+SiO12 |
| Mn | ⓘ Wiklundite | Pb2(Mn2+,Zn)3(Fe3+,Mn2+)2(Mn2+,Mg)19(As3+O3)2[(Si,As5+)O4]6(OH)18Cl6 |
| Mn | ⓘ UM1983-30-AsO:FeHMgMnZn (Also known as Mineral D) | (Mn,Mg,Fe3+,Al)15(AsO3)(AsO4)2(OH)23 |
| Mn | ⓘ UM1986-05-AsO:HMn | Mn3As2O4(OH)4 |
| Mn | ⓘ UM1986-06-AsO:HMn | Mn3As2O4(OH)4 |
| Mn | ⓘ Ferrorhodonite | CaMn3Fe[Si5O15] |
| Mn | ⓘ Pinakiolite var. Sb-rich pinakiolite | Mg1.90Mn0.91Sb0.19O2BO3 |
| Mn | ⓘ Clino-ferro-suenoite | ◻Mn22+(Fe52+)(Si8O22)(OH)2 |
| Mn | ⓘ Hjalmarite | Na(NaMn)Mg5(Si8O22)(OH)2 |
| Mn | ⓘ Mangani-pargasite | NaCa2(Mg4Mn3+)(Si6Al2)O22(OH)2 |
| Mn | ⓘ Vargite | MnCu2Mn2(AsO4)2(OH)4(H2O)4 |
| Mn | ⓘ Manganoschafarzikite | MnSb2O4 |
| Mn | ⓘ Skogbyite | Zr(Mg2Mn43+)SiO12 |
| Mn | ⓘ Strandite | Pb3Mn43+Mn34+O15 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Aegirine | NaFe3+Si2O6 |
| Fe | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Awaruite | Ni3Fe |
| Fe | ⓘ Betekhtinite | Pb2(Cu,Fe)22-24S15 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Blatterite | Sb35+(Mn3+,Fe3+)9(Mn2+,Mg)35(BO3)16O32 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Brugnatellite | Mg6Fe3+(CO3)(OH)13 · 4H2O |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Dixenite | CuMn142+Fe2+(SiO4)2(As5+O4)(As3+O3)5(OH)6 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ericssonite | BaMn22+Fe3+(Si2O7)O(OH) |
| Fe | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| Fe | ⓘ Filipstadite | (Fe3+0.5Sb5+0.5)Mn2O4 |
| Fe | ⓘ Franklinite | Zn2+Fe23+O4 |
| Fe | ⓘ Gabrielsonite | PbFe3+(As3+O3)O |
| Fe | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Gonyerite | Mn52+Fe3+(Fe3+Si3O10)(OH)8 |
| Fe | ⓘ Hancockite | (CaPb)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hematolite | (Mn,Mg,Al,Fe3+)15(As5+O4)2(As3+O3)(OH)23 |
| Fe | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Fe | ⓘ Inesite | Ca2(Mn,Fe)7Si10O28(OH)2 · 5H2O |
| Fe | ⓘ Jacobsite-Q | Mn2+(Fe3+,Mn3+)2O4 |
| Fe | ⓘ Jacobsite | Mn2+Fe23+O4 |
| Fe | ⓘ Jagoite | Pb18Fe43+[Si4(Si,Fe3+)6][Pb4Si16(Si,Fe)4]O82Cl6 |
| Fe | ⓘ Joesmithite | Pb2+Ca2(Mg3Fe23+)(Si6Be2)O22(OH)2 |
| Fe | ⓘ Julgoldite-(Fe2+) | Ca2Fe2+Fe23+[Si2O6OH][SiO4](OH)2(OH) |
| Fe | ⓘ Katoptrite | (Mn2+,Mg)13(Al,Fe3+)4Sb25+(SiO4)2O20 |
| Fe | ⓘ Lepidocrocite | Fe3+O(OH) |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Ludwigite | Mg2Fe3+(BO3)O2 |
| Fe | ⓘ Biotite var. Manganophyllite | K(Fe,Mg,Mn)3AlSi3O10(OH)2 |
| Fe | ⓘ Magnesio-hastingsite | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| Fe | ⓘ Magnesioferrite | MgFe23+O4 |
| Fe | ⓘ Manganostibite | (Mn,Fe)7SbAsO12 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Magnetoplumbite | PbFe123+O19 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Melanostibite | Mn22+Fe3+Sb5+O6 |
| Fe | ⓘ Melanotekite | Pb2Fe23+(Si2O7)O2 |
| Fe | ⓘ Neotocite | (Mn,Fe)SiO3 · H2O (?) |
| Fe | ⓘ Ericssonite-2O | BaMn22+Fe3+(Si2O7)O(OH) |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| Fe | ⓘ Diopside var. Schefferite | (Ca,Mn)(Mg,Fe,Mn)Si2O6 |
| Fe | ⓘ Senaite | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
| Fe | ⓘ Pyroaurite-2H | Mg6Fe23+(OH)16(CO3) · 4H2O |
| Fe | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Fe | ⓘ Stenhuggarite | CaFeSb(AsO3)2O |
| Fe | ⓘ Takéuchiite | (Mg,Mn2+)2(Mn3+,Fe3+)(BO3)O2 |
| Fe | ⓘ Taramellite | Ba4(Fe3+,Ti,Fe2+,Mg)4(B2Si8O27)O2Clx |
| Fe | ⓘ Tetraferriphlogopite | KMg3(Si3Fe3+)O10(OH)2 |
| Fe | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Welshite | Ca4Mg9Sb3O4[Si6Be3AlFe2O36] |
| Fe | ⓘ Zenzénite | Pb3Fe43+Mn34+O15 |
| Fe | ⓘ Hematite var. Specularite | Fe2O3 |
| Fe | ⓘ Arakiite | (Zn,Mn2+)(Mn2+,Mg)12(Fe3+,Al)2(As5+O4)2(As3+O3)(OH)23 |
| Fe | ⓘ Hyttsjöite | Pb18Ba2Ca5Mn22+Fe23+Si30O90Cl · 6H2O |
| Fe | ⓘ Julgoldite-(Fe3+) | Ca2Fe3+Fe23+[Si2O6OH][SiO4](OH)2O |
| Fe | ⓘ Jacobsite-Magnetite Series | |
| Fe | ⓘ α-Vredenburgite | (Mn,Fe)3O4 |
| Fe | ⓘ Aegirine-augite var. Urbanite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Fe | ⓘ Ferri-winchite | ◻(NaCa)(Mg4Fe3+)Si8O22(OH)2 |
| Fe | ⓘ Julgoldite Subgroup | Ca2XFe23+[Si2O6(OH)][SiO4](OH)2A |
| Fe | ⓘ Carlfrancisite | Mn32+(Mn2+,Mg,Fe3+,Al)42[As3+O3]2(As5+O4)4[(Si,As5+)O4]6[(As5+,Si)O4]2(OH)42 |
| Fe | ⓘ Fluoro-arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22F2 |
| Fe | ⓘ Wiklundite | Pb2(Mn2+,Zn)3(Fe3+,Mn2+)2(Mn2+,Mg)19(As3+O3)2[(Si,As5+)O4]6(OH)18Cl6 |
| Fe | ⓘ UM1983-30-AsO:FeHMgMnZn (Also known as Mineral D) | (Mn,Mg,Fe3+,Al)15(AsO3)(AsO4)2(OH)23 |
| Fe | ⓘ Ferrorhodonite | CaMn3Fe[Si5O15] |
| Fe | ⓘ Clino-ferro-suenoite | ◻Mn22+(Fe52+)(Si8O22)(OH)2 |
| Fe | ⓘ Erssonite | Mg7Fe23+(OH)18[Ca(H2O)6](SO4)2 · 12H2O |
| Fe | ⓘ Igelströmite | Fe3+(Sb3+Pb2+)O4 |
| Fe | ⓘ Magnetite var. Zinc-bearing Magnetite | (Fe,Zn)Fe3O4 |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Cobaltpentlandite | Co9S8 |
| Ni | Nickel | |
| Ni | ⓘ Awaruite | Ni3Fe |
| Ni | ⓘ Nisbite | NiSb2 |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Rammelsbergite | NiAs2 |
| Cu | Copper | |
| Cu | ⓘ Aikinite | CuPbBiS3 |
| Cu | ⓘ Algodonite | (Cu1-xAsx) |
| Cu | ⓘ Anilite | Cu7S4 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Betekhtinite | Pb2(Cu,Fe)22-24S15 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Crednerite | Cu+Mn3+O2 |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Cuprostibite | Cu2(Sb,Tl) |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Dixenite | CuMn142+Fe2+(SiO4)2(As5+O4)(As3+O3)5(OH)6 |
| Cu | ⓘ Djurleite | Cu31S16 |
| Cu | ⓘ Domeykite | Cu3As |
| Cu | ⓘ Freedite | Cu+Pb8(AsO3)2O3Cl5 |
| Cu | ⓘ Koutekite | Cu5As2 |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Roquesite | CuInS2 |
| Cu | ⓘ Spionkopite | Cu39S28 |
| Cu | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Cu | ⓘ Wittichenite | Cu3BiS3 |
| Cu | ⓘ Yarrowite | Cu9S8 |
| Cu | ⓘ Cyprine | Ca19Cu2+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 |
| Cu | ⓘ Vargite | MnCu2Mn2(AsO4)2(OH)4(H2O)4 |
| Zn | Zinc | |
| Zn | ⓘ Franklinite | Zn2+Fe23+O4 |
| Zn | ⓘ Gahnite | ZnAl2O4 |
| Zn | ⓘ Hetaerolite | ZnMn2O4 |
| Zn | ⓘ Senaite | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Zn | ⓘ Willemite | Zn2SiO4 |
| Zn | ⓘ Willemite var. Troostite | (Zn,Mn)2SiO4 |
| Zn | ⓘ Arakiite | (Zn,Mn2+)(Mn2+,Mg)12(Fe3+,Al)2(As5+O4)2(As3+O3)(OH)23 |
| Zn | ⓘ Wiklundite | Pb2(Mn2+,Zn)3(Fe3+,Mn2+)2(Mn2+,Mg)19(As3+O3)2[(Si,As5+)O4]6(OH)18Cl6 |
| Zn | ⓘ Magnetite var. Zinc-bearing Magnetite | (Fe,Zn)Fe3O4 |
| As | Arsenic | |
| As | ⓘ Adelite | CaMg(AsO4)(OH) |
| As | ⓘ Akrochordite | MnMn2Mn2(AsO4)2(OH)4(H2O)4 |
| As | ⓘ Algodonite | (Cu1-xAsx) |
| As | ⓘ Allactite | Mn72+(AsO4)2(OH)8 |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Armangite | Mn262+(AsO3)14(HAsO3)4(CO3) |
| As | ⓘ Native Arsenic | As |
| As | ⓘ Arseniopleite | NaCaMnMn2(AsO4)3 |
| As | ⓘ Arsenoclasite | Mn52+(AsO4)2(OH)4 |
| As | ⓘ Bergslagite | CaBeAsO4(OH) |
| As | ⓘ Berzeliite | (NaCa2)Mg2(AsO4)3 |
| As | ⓘ Brandtite | Ca2Mn2+(AsO4)2 · 2H2O |
| As | ⓘ Caryinite | (Na,Pb)(Ca,Na)CaMn22+(AsO4)3 |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| As | ⓘ Dixenite | CuMn142+Fe2+(SiO4)2(As5+O4)(As3+O3)5(OH)6 |
| As | ⓘ Domeykite | Cu3As |
| As | ⓘ Ecdemite | Pb6As23+O7Cl4 |
| As | ⓘ Eveite | Mn22+(AsO4)(OH) |
| As | ⓘ Finnemanite | Pb5(AsO3)3Cl |
| As | ⓘ Flinkite | Mn22+Mn3+(AsO4)(OH)4 |
| As | ⓘ Freedite | Cu+Pb8(AsO3)2O3Cl5 |
| As | ⓘ Gabrielsonite | PbFe3+(As3+O3)O |
| As | ⓘ Gasparite-(Ce) | Ce(AsO4) |
| As | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| As | ⓘ Hematolite | (Mn,Mg,Al,Fe3+)15(As5+O4)2(As3+O3)(OH)23 |
| As | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| As | ⓘ Johnbaumite | Ca5(AsO4)3(OH) |
| As | ⓘ Koutekite | Cu5As2 |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Manganarsite | Mn3(As2O4)(OH)4 |
| As | ⓘ Manganberzeliite | (NaCa2)Mn22+(AsO4)3 |
| As | ⓘ Manganohörnesite | Mn32+(AsO4)2 · 8H2O |
| As | ⓘ Manganostibite | (Mn,Fe)7SbAsO12 |
| As | ⓘ Magnussonite | Mn102+(As3+O3)6(OH,Cl)2 |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Orpiment | As2S3 |
| As | ⓘ Parwelite | Mn10Sb2As2Si2O24 |
| As | ⓘ Paulmooreite | Pb2[As2O5] |
| As | ⓘ Rammelsbergite | NiAs2 |
| As | ⓘ Realgar | As4S4 |
| As | ⓘ Rouseite | Pb2Mn2+[AsO3]2 · 2H2O |
| As | ⓘ Sahlinite | Pb14(AsO4)2O9Cl4 |
| As | ⓘ Sarkinite | Mn22+(AsO4)(OH) |
| As | ⓘ Stenhuggarite | CaFeSb(AsO3)2O |
| As | ⓘ Stibarsen | AsSb |
| As | ⓘ Svabite | Ca5(AsO4)3F |
| As | ⓘ Synadelphite | Mn92+(As5+O4)2(As3+O3)(OH)9 · 2H2O |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Tilasite | CaMg(AsO4)F |
| As | ⓘ Trigonite | Pb3Mn2+(AsO3)2(HAsO3) |
| As | ⓘ Turneaureite | Ca5(AsO4)3Cl |
| As | ⓘ Arakiite | (Zn,Mn2+)(Mn2+,Mg)12(Fe3+,Al)2(As5+O4)2(As3+O3)(OH)23 |
| As | ⓘ Långbanshyttanite | Pb2Mn2Mg(AsO4)2(OH)4 · 6H2O |
| As | ⓘ Carlfrancisite | Mn32+(Mn2+,Mg,Fe3+,Al)42[As3+O3]2(As5+O4)4[(Si,As5+)O4]6[(As5+,Si)O4]2(OH)42 |
| As | ⓘ Wiklundite | Pb2(Mn2+,Zn)3(Fe3+,Mn2+)2(Mn2+,Mg)19(As3+O3)2[(Si,As5+)O4]6(OH)18Cl6 |
| As | ⓘ Hydroxylhedyphane | Ca2Pb3(AsO4)3(OH) |
| As | ⓘ UM1983-30-AsO:FeHMgMnZn (Also known as Mineral D) | (Mn,Mg,Fe3+,Al)15(AsO3)(AsO4)2(OH)23 |
| As | ⓘ UM1986-05-AsO:HMn | Mn3As2O4(OH)4 |
| As | ⓘ UM1986-06-AsO:HMn | Mn3As2O4(OH)4 |
| As | ⓘ Vargite | MnCu2Mn2(AsO4)2(OH)4(H2O)4 |
| Sr | Strontium | |
| Sr | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Y | Yttrium | |
| Y | ⓘ Hyalotekite | (Ba,Pb,K)4(Ca,Y)2(B,Be)2(Si,B)2Si8O28(F,Cl) |
| Y | ⓘ Senaite | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
| Zr | Zirconium | |
| Zr | ⓘ Baddeleyite | ZrO2 |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Zr | ⓘ Hiärneite | Ca2Zr4Mn3+SbTiO16 |
| Zr | ⓘ Gatedalite | ZrMn22+Mn43+SiO12 |
| Zr | ⓘ Skogbyite | Zr(Mg2Mn43+)SiO12 |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Powellite | Ca(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Freieslebenite | AgPbSbS3 |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Native Silver | Ag |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| In | Indium | |
| In | ⓘ Roquesite | CuInS2 |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Sn | ⓘ Sverigeite | NaMnMgSnBe2(SiO4)3(OH) |
| Sn | ⓘ Tetrawickmanite | Mn2+[Sn4+(OH)6] |
| Sn | ⓘ Wickmanite | Mn2+[Sn(OH)6] |
| Sb | Antimony | |
| Sb | ⓘ Native Antimony | Sb |
| Sb | ⓘ Roméite Group var. Atopite | (Ca,Na)2Sb2(O,F,OH)7 |
| Sb | ⓘ Bindheimite | Pb2Sb2O6O |
| Sb | ⓘ Blatterite | Sb35+(Mn3+,Fe3+)9(Mn2+,Mg)35(BO3)16O32 |
| Sb | ⓘ Cuprostibite | Cu2(Sb,Tl) |
| Sb | ⓘ Filipstadite | (Fe3+0.5Sb5+0.5)Mn2O4 |
| Sb | ⓘ Freieslebenite | AgPbSbS3 |
| Sb | ⓘ Ingersonite | Ca3Mn2+Sb45+O14 |
| Sb | ⓘ Katoptrite | (Mn2+,Mg)13(Al,Fe3+)4Sb25+(SiO4)2O20 |
| Sb | ⓘ Långbanite | Mn42+Mn93+Sb5+O16(SiO4)2 |
| Sb | ⓘ Hydroxycalcioroméite | (Ca,Sb3+)2(Sb5+,Ti)2O6(OH) |
| Sb | ⓘ Manganostibite | (Mn,Fe)7SbAsO12 |
| Sb | ⓘ Melanostibite | Mn22+Fe3+Sb5+O6 |
| Sb | ⓘ Monimolite | Pb2Sb25+O7 |
| Sb | ⓘ Nadorite | PbSbClO2 |
| Sb | ⓘ Nisbite | NiSb2 |
| Sb | ⓘ Parwelite | Mn10Sb2As2Si2O24 |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Roméite Group | A2(Sb5+)2O6Z |
| Sb | ⓘ Senarmontite | Sb2O3 |
| Sb | ⓘ Stenhuggarite | CaFeSb(AsO3)2O |
| Sb | ⓘ Stibarsen | AsSb |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Swedenborgite | NaBe4Sb5+O7 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Valentinite | Sb2O3 |
| Sb | ⓘ Welshite | Ca4Mg9Sb3O4[Si6Be3AlFe2O36] |
| Sb | ⓘ Hiärneite | Ca2Zr4Mn3+SbTiO16 |
| Sb | ⓘ Tegengrenite | (Mn3+0.5Sb5+0.5)Mg2O4 |
| Sb | ⓘ Fluornatroroméite | (Na,Ca)2Sb2(O,OH)6F |
| Sb | ⓘ Fluorcalcioroméite | (Ca,Na,◻)2Sb25+(O,OH)6F |
| Sb | ⓘ Oxycalcioroméite | Ca2Sb2O6O |
| Sb | ⓘ Oxyplumboroméite | Pb2Sb2O6O |
| Sb | ⓘ Pinakiolite var. Sb-rich pinakiolite | Mg1.90Mn0.91Sb0.19O2BO3 |
| Sb | ⓘ Igelströmite | Fe3+(Sb3+Pb2+)O4 |
| Sb | ⓘ Manganoschafarzikite | MnSb2O4 |
| Te | Tellurium | |
| Te | ⓘ Altaite | PbTe |
| Ba | Barium | |
| Ba | ⓘ Barytocalcite | BaCa(CO3)2 |
| Ba | ⓘ Banalsite | Na2BaAl4Si4O16 |
| Ba | ⓘ Barylite | Be2Ba(Si2O7) |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Benstonite | Ba6Ca6Mg(CO3)13 |
| Ba | ⓘ Celsian | Ba(Al2Si2O8) |
| Ba | ⓘ Cymrite | BaAl2Si2(O,OH)8 · H2O |
| Ba | ⓘ Ericssonite | BaMn22+Fe3+(Si2O7)O(OH) |
| Ba | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Ba | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Ba | ⓘ Hyalotekite | (Ba,Pb,K)4(Ca,Y)2(B,Be)2(Si,B)2Si8O28(F,Cl) |
| Ba | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Ba | ⓘ Norsethite | BaMg(CO3)2 |
| Ba | ⓘ Ericssonite-2O | BaMn22+Fe3+(Si2O7)O(OH) |
| Ba | ⓘ Phillipsite Subgroup | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| Ba | ⓘ Taramellite | Ba4(Fe3+,Ti,Fe2+,Mg)4(B2Si8O27)O2Clx |
| Ba | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Ba | ⓘ Hyttsjöite | Pb18Ba2Ca5Mn22+Fe23+Si30O90Cl · 6H2O |
| Ce | Cerium | |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ce | ⓘ Gasparite-(Ce) | Ce(AsO4) |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Stolzite | Pb(WO4) |
| W | ⓘ Welinite | Mn62+(W6+,Mg)2(SiO4)2(O,OH)6 |
| W | ⓘ Langhofite | Pb2(OH)[WO4(OH)] |
| Tl | Thallium | |
| Tl | ⓘ Cuprostibite | Cu2(Sb,Tl) |
| Pb | Lead | |
| Pb | ⓘ Aikinite | CuPbBiS3 |
| Pb | ⓘ Alamosite | PbSiO3 |
| Pb | ⓘ Altaite | PbTe |
| Pb | ⓘ Barysilite | Pb8Mn2+[Si2O7]3 |
| Pb | ⓘ Betekhtinite | Pb2(Cu,Fe)22-24S15 |
| Pb | ⓘ Bindheimite | Pb2Sb2O6O |
| Pb | ⓘ Blixite | Pb8O5(OH)2Cl4 |
| Pb | ⓘ Caryinite | (Na,Pb)(Ca,Na)CaMn22+(AsO4)3 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Ecdemite | Pb6As23+O7Cl4 |
| Pb | ⓘ Finnemanite | Pb5(AsO3)3Cl |
| Pb | ⓘ Freedite | Cu+Pb8(AsO3)2O3Cl5 |
| Pb | ⓘ Freieslebenite | AgPbSbS3 |
| Pb | ⓘ Gabrielsonite | PbFe3+(As3+O3)O |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Ganomalite | Pb9Ca5Mn(Si2O7)4(SiO4)O |
| Pb | ⓘ Hancockite | (CaPb)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Pb | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| Pb | ⓘ Hyalotekite | (Ba,Pb,K)4(Ca,Y)2(B,Be)2(Si,B)2Si8O28(F,Cl) |
| Pb | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| Pb | ⓘ Jagoite | Pb18Fe43+[Si4(Si,Fe3+)6][Pb4Si16(Si,Fe)4]O82Cl6 |
| Pb | ⓘ Joesmithite | Pb2+Ca2(Mg3Fe23+)(Si6Be2)O22(OH)2 |
| Pb | ⓘ Kentrolite | Pb2Mn23+(Si2O7)O2 |
| Pb | ⓘ Lanarkite | Pb2(SO4)O |
| Pb | ⓘ Native Lead | Pb |
| Pb | ⓘ Litharge | PbO |
| Pb | ⓘ Macedonite | PbTiO3 |
| Pb | ⓘ Magnetoplumbite | PbFe123+O19 |
| Pb | ⓘ Margarosanite | Ca2PbSi3O9 |
| Pb | ⓘ Massicot | PbO |
| Pb | ⓘ Melanotekite | Pb2Fe23+(Si2O7)O2 |
| Pb | ⓘ Mendipite | Pb3Cl2O2 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Minium | Pb3O4 |
| Pb | ⓘ Molybdophyllite | Pb8Mg9[Si10O28(OH)8O2(CO3)3] · H2O |
| Pb | ⓘ Monimolite | Pb2Sb25+O7 |
| Pb | ⓘ Nadorite | PbSbClO2 |
| Pb | ⓘ Nasonite | Pb6Ca4(Si2O7)3Cl2 |
| Pb | ⓘ Paulmooreite | Pb2[As2O5] |
| Pb | ⓘ Perite | PbBiClO2 |
| Pb | ⓘ Plumbonacrite | Pb5O(OH)2(CO3)3 |
| Pb | ⓘ Pyrobelonite | PbMn2+(VO4)(OH) |
| Pb | ⓘ Quenselite | PbMnO2(OH) |
| Pb | ⓘ Roeblingite | Pb2Ca6Mn2+(Si3O9)2(SO4)2(OH)2 · 4H2O |
| Pb | ⓘ Rouseite | Pb2Mn2+[AsO3]2 · 2H2O |
| Pb | ⓘ Sahlinite | Pb14(AsO4)2O9Cl4 |
| Pb | ⓘ Senaite | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
| Pb | ⓘ Stolzite | Pb(WO4) |
| Pb | ⓘ Sundiusite | Pb10(SO4)O8Cl2 |
| Pb | ⓘ Trigonite | Pb3Mn2+(AsO3)2(HAsO3) |
| Pb | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Pb | ⓘ Zenzénite | Pb3Fe43+Mn34+O15 |
| Pb | ⓘ Hyttsjöite | Pb18Ba2Ca5Mn22+Fe23+Si30O90Cl · 6H2O |
| Pb | ⓘ Philolithite | Pb12Mn2+(Mg,Mn2+)2(Mn2+,Mg)4(CO3)4(SO4)O6(OH)12Cl4 |
| Pb | ⓘ Britvinite | [Pb7(OH)3F(BO3)2(CO3)][Mg4.5(OH)3(Si5O14)] |
| Pb | ⓘ Långbanshyttanite | Pb2Mn2Mg(AsO4)2(OH)4 · 6H2O |
| Pb | ⓘ Yangite | PbMnSi3O8 · H2O |
| Pb | ⓘ Oxyplumboroméite | Pb2Sb2O6O |
| Pb | ⓘ Wiklundite | Pb2(Mn2+,Zn)3(Fe3+,Mn2+)2(Mn2+,Mg)19(As3+O3)2[(Si,As5+)O4]6(OH)18Cl6 |
| Pb | ⓘ Hydroxylhedyphane | Ca2Pb3(AsO4)3(OH) |
| Pb | ⓘ Langhofite | Pb2(OH)[WO4(OH)] |
| Pb | ⓘ Igelströmite | Fe3+(Sb3+Pb2+)O4 |
| Pb | ⓘ Friisite | Pb8Al3Si8O27Cl3 |
| Pb | ⓘ Strandite | Pb3Mn43+Mn34+O15 |
| Pb | ⓘ Hugotibergite | Ca6CaPb2(Si3O9)2(SO4)2(OH)2(H2O)4 |
| Bi | Bismuth | |
| Bi | ⓘ Aikinite | CuPbBiS3 |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Perite | PbBiClO2 |
| Bi | ⓘ Wittichenite | Cu3BiS3 |
| U | Uranium | |
| U | ⓘ Senaite | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
| U | ⓘ Uraninite | UO2 |
Geochronology
Mineralization age: Paleoproterozoic : 1791 ± 2 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | ||||||
|---|---|---|---|---|---|---|---|
| Precambrian | |||||||
| Proterozoic | |||||||
| Paleoproterozoic | |||||||
| Statherian |
| ||||||
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/L%C3%A5ngban |
|---|---|
| Wikidata ID: | Q1002624 |
Localities in this Region
- Värmland County
- Filipstad
- Långban Ore District
- Filipstad
- Värmland County
- Filipstad
- Långban Ore District
- Filipstad
Other Regions, Features and Areas containing this locality
Eurasian PlateTectonic Plate
- Baltic Shield
- Sveconorwegian BeltShield
EuropeContinent
ScandinaviaRegion
Sweden
- Bergslagen mining districtMining District
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Sjögren, Ant. (1886) Mineralogiska notiser XII. Fynd af allaktit i Långbans grufvor. Geologiska Föreningen i Stockholm Förhandlingar, 8 (6) 473-474 doi:10.1080/11035898609442428
Sjögren, Hj. (1891) Bidrag till Sveriges mineralogi 3. Geologiska Föreningen i Stockholm Förhandlingar, 13 (7) 781-796 doi:10.1080/11035899109445851
Sjögren, Hj. (1895) Preliminära meddelanden om några undersökningar på svenska mineral. Geologiska Föreningen i Stockholm Förhandlingar, 17 (3). 267-318 doi:10.1080/11035899509442303
Sjögren, Hj. (1910) The Långban mines. Geologiska Föreningen i Stockholm Förhandlingar, 32 (5) 1295-1325 doi:10.1080/11035891009442327
Flink, Gustaf (1920) Trigonit och Dixenit, två nya mineral från Långbanshytte gruvor. Geologiska Föreningen i Stockholm Förhandlingar, 42 (7) 436-452 doi:10.1080/11035892009444477
von Eckermann, Harry (1927) A new Manganese-Chlorite from Långban. Geologiska Föreningen i Stockholm Förhandlingar, 49 (3) 450-454 doi:10.1080/11035892709444585
Flink, Gustaf (1927) Förteckning på Stockholms Högskolas samling av nya eller ofullständigt beskrivna mineral från Långban (fortsättning) Geologiska Föreningen i Stockholm Förhandlingar, 49 (1) 138-142 doi:10.1080/11035892709454060
Magnusson, Nils Harald (1930) Långbans malmtrakt - Geologisk beskrivning. Avhandlingar och uppsatser. Serie Ca 23. Sveriges Geologiska Undersökning
Hurlbut, Cornelius S. (1937) Aminoffite, a new mineral from Långban. Geologiska Föreningen i Stockholm Förhandlingar, 59 (3) 290-292 doi:10.1080/11035893709444957
Mason, Brian (1942) Bixbyite from Långban. Geologiska Föreningen i Stockholm Förhandlingar, 64 (2) 117-125 doi:10.1080/11035894209445090
Kautz, Karl (1967) Faseriger Hedyphan von Långban (Schweden): eine orientierte Verwachsung mit Antigorit. Contributions to Mineralogy and Petrology, 14 (3) 224-228 doi:10.1007/bf00376641
Burke, E.A.J, Kieft, C (1971) Second occurrence of makedonite, PbTiO3, Långban, Sweden. Lithos, 4 (2) 101-104 doi:10.1016/0024-4937(71)90102-2Note: macedonite is spelled as makedonite
Bostroem, K., Rydell, H., Joensuu, O. (1979) Langbån; an exhalative sedimentary deposit?. Economic Geology, 74 (5) 1002-1011 doi:10.2113/gsecongeo.74.5.1002
Hansen, Staffan, Fälth, Lars, Johnsen, Ole (1984) Bergslagite, a mineral with tetrahedral berylloarsenate sheet anions. Zeitschrift für Kristallographie - Crystalline Materials, 166 (14). 73-80 doi:10.1524/zkri.1984.166.14.73
Åberg, Göran, Charalampides, Georgios (1986) New lead isotope data from the Långban mineralization, central Sweden. Geologiska Föreningen i Stockholm Förhandlingar, 108 (3) 243-250 doi:10.1080/11035898609454690
Metropolis, W.C. (1988) Two Flink unknowns from Långban identified, in Contributed Papers in Specimen Mineralogy: 15th Rochester Mineralogical Symposium. Rocks & Minerals, 63 (6). 456 doi:10.1080/00357529.1988.11761882
Åberg, Göran, Charalampides, Georgios (1988) Evolution of the mineral deposits from Långban, Sweden, as recorded from strontium isotope data. Geologiska Föreningen i Stockholm Förhandlingar, 110 (4). 329-334 doi:10.1080/11035898809452667
Nysten, Per (1988) Cassiterite from Långban, Sweden. Geologiska Föreningen i Stockholm Förhandlingar, 110 (3) 292 doi:10.1080/11035898809455454
Holtstam, Dan (2000) Malmförekomster av Långban-typ: aspekter på malmgenes och mineraldiversitet [Långban-type ore deposits: aspects of ore genera and mineral diversity], in Kongsberg Mineralsymposium 2000. Norsk Bergverksmuseum Skrift, 17. 5-11
Jonsson, E., Broman, C. (2002) Fluid inclusions in late stage Pb Mn As Sb mineral assemblages in the Långban deposit, Bergslagen, Sweden. The Canadian Mineralogist, 40 (1). 47-65 doi:10.2113/gscanmin.40.1.47
Christy, A. G., Gatedal, K. (2005) Extremely Pb-rich rock-forming silicates including a beryllian scapolite and associated minerals in a skarn from Långban, Värmland, Sweden. Mineralogical Magazine, 69 (6) 995-1018 doi:10.1180/0026461056960304
Chukanov, N. V., Yakubovich, O. V., Pekov, I. V., Belakovsky, D. I., Massa, W. (2008) Britvinite, Pb15Mg9(Si10O28)(BO3)4(CO3)2(OH)12O2, a new mineral species from Långban, Sweden. Geology of Ore Deposits, 50 (8) 713-719 doi:10.1134/s1075701508080072
Jonsson, Erik, Hålenius, Ulf (2010) Mn3+-bearing pargasite from the Långban Fe-Mn oxide mineralisation, Bergslagen, Sweden. GFF, 132 (3) 167-172 doi:10.1080/11035897.2010.518763
Zhitova, E. S., Ivanyuk, G. Yu., Krivovichev, S. V., Yakovenchuk, V. N., Pakhomovsky, Ya. A., Mikhailova, Yu. A. (2017) Crystal Chemistry of Pyroaurite from the Kovdor Pluton, Kola Peninsula, Russia, and the Långban Fe–Mn deposit, Värmland, Sweden. Geology of Ore Deposits, 59 (7) 652-661 doi:10.1134/s1075701517070121
Zhitova, Elena S., Chukanov, Nikita V., Jonsson, Erik, Pekov, Igor V., Belakovskiy, Dmitry I., Vigasina, Marina F., Zubkova, Natalia V., Van, Konstantin V., Britvin, Sergey N. (2021) Erssonite, CaMg7Fe3+2(OH)18(SO4)2⋅12H2O, a new hydrotalcite-supergroup mineral from Långban, Sweden. Mineralogical Magazine, 85 (5) 817-826 doi:10.1180/mgm.2021.70
Holtstam, Dan; Langhof, Jörgen; Friis, Henrik; Karlsson, Andreas; Erambert, Muriel (2024) Igelströmite, Fe3+(Sb3+Pb2+)O4, and manganoschafarzikite, Mn2+Sb3+2O4, two new members of the newly established minium group, from the Långban Mn–Fe deposit, Värmland, Sweden. European Journal of Mineralogy, 36 (2). 311-322 doi:10.5194/ejm-36-311-2024
Quick NavTopCommoditiesMineral ListRock TypesGeochronologyOther DatabasesLocalities in RegionOther RegionsReferences
Långban Mine, Långban Ore District, Filipstad, Värmland County, Sweden