This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Saskatoon | 198,958 (2016) |
| Regina | 176,183 (2010) |
| Prince Albert | 34,609 (2008) |
| Moose Jaw | 32,166 (2013) |
| North Battleford | 19,440 (2013) |
| Yorkton | 15,669 (2013) |
Other Languages:
French:
Saskatchewan, Canada
German:
Saskatchewan, Kanada
Italian:
Saskatchewan, Canada
Russian:
Саскачеван, Канада
Simplified Chinese:
薩斯喀徹溫省, 加拿大
Spanish:
Saskatchewan, Canadá
Afrikaans:
Saskatchewan, Kanada
Albanian:
Saskatchewan, Kanadaja
Amharic:
ሰስካቸወን, ካናዳ
Anglo-Saxon:
Sascatcewan, Cænada
Arabic:
ساسكاتشوان, كندا
Armenian:
Սասկաչևան, Կանադա
Asturian:
Saskatchewan, Canadá
Azeri:
Saskaçevan, Kanada
Basque:
Saskatchewan, Kanada
Belarusian:
Саскачэван, Канада
Belarusian (Tarashkevitsa):
Саскачэван, Канада
Bengali:
সাসক্যাচুয়ান, কানাডা
Bosnian:
Saskatchewan, Kanada
Breton:
Saskatchewan, Kanada
Bulgarian:
Саскачеван, Канада
Burmese:
ဆက်စကက်ချီဝမ်နယ်, ကနေဒါနိုင်ငံ
Catalan:
Saskatchewan, Canadà
Cebuano:
Saskatchewan, Canada
Cornish:
Saskatchewan, Kanada
Corsican:
Saskatchewan, Canadà
Croatian:
Saskatchewan, Kanada
Czech:
Saskatchewan, Kanada
Danish:
Saskatchewan, Canada
Dutch:
Saskatchewan, Canada
Egyptian Arabic:
ساسكاتشوان, كندا
Esperanto:
Saskaĉevano, Kanado
Estonian:
Saskatchewani provints, Kanada
Faroese:
Saskatchewan, Kanada
Farsi/Persian:
ساسکاچوان, کانادا
Finnish:
Saskatchewan, Kanada
Galician:
Saskatchewan, Canadá
Georgian:
სასკაჩევანი, კანადა
Greek:
Σασκάτσουαν, Καναδάς
Greenlandic:
Saskatchewan, Canada
Hakka:
Saskatchewan-sén, Kâ-nâ-thai
Hebrew:
ססקצ'ואן, קנדה
Hindi:
सस्कैचवन, कनाडा
Hungarian:
Saskatchewan, Kanada
Icelandic:
Saskatchewan, Kanada
Ido:
Saskatchewan, Kanada
Indonesian:
Saskatchewan, Kanada
Irish Gaelic:
Saskatchewan, Ceanada
Japanese:
サスカチュワン州, カナダ
Judaeo-Spanish:
Saskatchewan, Kanada
Kabyle:
Saskatchewan, Kanada
Kapampangan:
Saskatchewan, Canada
Korean:
서스캐처원주, 캐나다
Latin:
Saskatchewan, Canada
Latvian:
Saskačevana, Kanāda
Ligurian:
Saskatchewan, Canada
Lithuanian:
Saskačevanas, Kanada
Luxembourgish:
Saskatchewan, Kanada
Macedonian:
Саскачеван, Канада
Malay:
Saskatchewan, Kanada
Manx:
Saskatchewan, Yn Chanadey
Marathi:
सास्काचेवान, कॅनडा
Min Dong Chinese:
Saskatchewan, Gă-nā-dâi
Mingrelian:
სასკაჩევანი, კანადა
Mongolian:
Саскачеван, Канад
Northern Frisian:
Saskatchewan, Kanada
Norwegian:
Saskatchewan, Canada
Norwegian (Nynorsk):
Saskatchewan, Canada
Occitan:
Saskatchewan, Canadà
Ossetian:
Саскачеван, Канадæ
Papiamento:
Saskatchewan, Canada
Piedmontese:
Saskatchewan, Canadà
Polish:
Saskatchewan, Kanada
Portuguese:
Saskatchewan, Canadá
Punjabi:
ਸਸਕਾਚਵਾਨ, ਕੈਨੇਡਾ
Quechua:
Saskatchewan pruwinsya, Kanada
Romanian:
Saskatchewan, Canada
Russia Buriat:
Саскачеван, Канада
Samogitian:
Saskačevans, Kanada
Sardinian:
Saskatchewan, Canada
Scots:
Saskatchewan, Canadae
Scottish Gaelic:
Saskatchewan, Canada
Serbian:
Саскачеван, Канада
Serbo-Croatian:
Saskatchewan, Kanada
Slovak:
Saskatchewan, Kanada
Slovenian:
Saskatchewan, Kanada
Swahili:
Saskatchewan, Kanada
Swedish:
Saskatchewan, Kanada
Tagalog:
Saskatchewan, Canada
Tamil:
சஸ்காச்சுவான், கனடா
Thai:
รัฐซัสแคตเชวัน, แคนาดา
Traditional Chinese:
沙斯卡寸旺, 加拿大
Turkish:
Saskatchewan, Kanada
Ukrainian:
Саскачеван, Канада
Urdu:
ساسکچیوان, کینیڈا
Uyghur:
Saskachéwan, كانادا
Uzbek (Latin Script):
Saskachevan, Kanada
Venetian:
Saskatchewan, Canada
Vietnamese:
Saskatchewan, Canada
Volapük:
Saskatchewan, Kanadän
Walloon:
Sascatchewane, Canada
Waray:
Saskatchewan, Kanada
Welsh:
Saskatchewan, Canada
West Frisian:
Saskatchewan, Kanada
Western Punjabi:
ساسکاچیوان, کینیڈا
Wu Chinese:
萨斯喀彻温省, 加拿大
Yakut:
Саскачеван, Канаада
Yiddish:
סאסקאטשעווען, קאנאדע
Zazaki:
Saskatchewan, Kanada
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities287 valid minerals. 5 (TL) - type locality of valid minerals. 2 erroneous literature entries.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S |
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reported from at least 25 localities in this region. |
| ⓘ Albite var. Andesine Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ Albite var. Anorthoclase Formula: (Na,K)AlSi3O8 Description: Ribbons with quartz in felsic gneisses. References: |
| ⓘ 'Alkali Feldspar' References: Beaudin, D., Partin, C.A., Ansdell, K., Yang, P. (2024) Comparative lithology and alteration mineral chemistry of host rocks at the Seabee Gold Operation, northern Saskatchewan, Canada: Implications for a connected orogenic gold-mineralizing system. Ore Geology Reviews, 166. 105950 doi:10.1016/j.oregeorev.2024.105950 |
| ⓘ Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 Localities: Description: In felsic gneisses. |
| ⓘ Altaite Formula: PbTe |
| ⓘ 'Alum Group' Formula: XAl(SO4)2 · 12H2O Locality: Waldsea Lake, Saskatchewan, Canada |
| ⓘ 'Alunite Supergroup' Formula: AD3(XO4)2(OH)6 |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5(T8O22)W2 Localities: Reported from at least 12 localities in this region. |
| ⓘ Analcime Formula: Na(AlSi2O6) · H2O Locality: Nisikkatch Lake, Saskatchewan, Canada |
| ⓘ Anatase Formula: TiO2 |
| ⓘ Andalusite Formula: Al2(SiO4)O |
| ⓘ 'Andesine-oligoclase' |
| ⓘ Anhydrite Formula: CaSO4 |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| ⓘ Annabergite Formula: Ni3(AsO4)2 · 8H2O |
| ⓘ Anorthite Formula: Ca(Al2Si2O8) |
| ⓘ Anorthite var. Labradorite Formula: (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ Anthophyllite Formula: ◻Mg2Mg5(Si8O22)(OH)2 |
| ⓘ Antlerite Formula: Cu3(SO4)(OH)4 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A Localities: Reported from at least 13 localities in this region. |
| ⓘ 'Apatite var. Carbonate-rich Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Locality: Muskiki Lake, Saskatchewan, Canada |
| ⓘ 'Apatite Group' |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Arcanite Formula: K2SO4 |
| ⓘ Arfvedsonite Formula: NaNa2(Fe2+4Fe3+)Si8O22(OH)2 Locality: Nisikkatch Lake, Saskatchewan, Canada |
| ⓘ Arsenoflorencite-(Ce) Formula: CeAl3(AsO4)2(OH)6 |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Artinite Formula: Mg2(CO3)(OH)2 · 3H2O |
| ⓘ Atacamite Formula: Cu2(OH)3Cl |
| ⓘ Athabascaite (TL) Formula: Cu5Se4 Localities: Description: Occurs as inclusions and replacements of umangite and as stringers in carbonate vein material. The mineral is found as lath-shaped grains up to 100μm by 40μm. |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ Augite var. Fassaite Formula: (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] Description: In clinopyroxenites. References: |
| ⓘ Augite var. Soda-Augite Description: Associated with labradorite (retrograde after Na-cpx), in clinopyroxenites. References: |
| ⓘ Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 |
| ⓘ Baddeleyite Formula: ZrO2 References: Boulogne, Q.; Milesi, G.; Brouand, M.; Obin, T.; Martz, P.; Gerbaud, O.; Fischer, E.; Villeneuve, J.; Anderson, M.; Peiffert, C.; et al. (2026) Deciphering Fluid and Uranium Mobilities in Unconformity-Related Uranium Deposits Using Uranium Oxides: The Waterfound Case Study. Economic Geology, 121 (1). 45-73 doi:10.5382/econgeo.5211 |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ 'Bastnäsite' Formula: (Ce/Nd/Y/REE)(CO3)F |
| ⓘ Bayleyite Formula: Mg2(UO2)(CO3)3 · 18H2O |
| ⓘ Becquerelite Formula: Ca(UO2)6O4(OH)6 · 8H2O |
| ⓘ Benstonite Formula: Ba6Ca6Mg(CO3)13 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Description: Occurs as opaque hexagonal prismatic crystals, typically 0.5–1 inch long and 0.25–0.5 inch wide, occasionally up to ~1 inch in diameter. It is green to yellow-green, often zoned, and is confined to small pockets within the pegmatites. |
| ⓘ Berzelianite Formula: Cu2-xSe (x ≈ 0.12) Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Reported from at least 21 localities in this region. |
| ⓘ Bischofite Formula: MgCl2 · 6H2O |
| ⓘ Bismuthinite Formula: Bi2S3 References: |
| ⓘ Bismutohauchecornite Formula: Ni9Bi2S8 Description: Originally reported by Watkinson et al. as Hauchecornitem 5 years before Bismutohauchecornite was defined. Watkinson et al's analysis is given under Bismutohauchecornite in the Handbook of Mineralogy, Vol 1, p 57. |
| ⓘ Blödite Formula: Na2Mg(SO4)2 · 4H2O |
| ⓘ Boltwoodite Formula: (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| ⓘ Bornhardtite Formula: Co2+Co3+2Se4 |
| ⓘ Bornite Formula: Cu5FeS4 Localities: Reported from at least 16 localities in this region. |
| ⓘ Boulangerite Formula: Pb5Sb4S11 |
| ⓘ Bournonite Formula: PbCuSbS3 |
| ⓘ Boussingaultite Formula: (NH4)2Mg(SO4)2 · 6H2O Locality: Waldsea Lake, Saskatchewan, Canada |
| ⓘ Bradleyite Formula: Na3Mg(CO3)(PO4) |
| ⓘ Brannerite Formula: UTi2O6 References: |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 |
| ⓘ Burkeite Formula: Na6(CO3)(SO4)2 |
| ⓘ Calaverite Formula: AuTe2 |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 49 localities in this region. |
| ⓘ 'Calcium Amphibole Subgroup' Formula: AnCa2(C2+5-mC3+m)(Si8-(n+m)Al(n+m))W2 Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Calcium Amphibole Subgroup var. Hornblende' Formula: AnCa2(Z2+5-mZ3+m)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Carbonate' Locality: Foster River, Saskatchewan, Canada |
| ⓘ Carbonatecyanotrichite Formula: Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| ⓘ Carnallite Formula: KMgCl3 · 6H2O |
| ⓘ Carnotite Formula: K2(UO2)2(VO4)2 · 3H2O |
| ⓘ Chalcocite Formula: Cu2S Localities: Reported from at least 6 localities in this region. |
| ⓘ Chalcomenite Formula: CuSeO3 · 2H2O Localities: Ato Bay, Beaverlodge Lake, Goldfields District, Beaverlodge Lake area, Saskatchewan, Canada Goldfields District, Beaverlodge Lake area, Saskatchewan, Canada Hal Lake Selenium Occurrence No. 1, Beaverlodge Lake area, Saskatchewan, Canada Eagle Claims U-Cu-Se occurrence, Beaverlodge Lake area, Saskatchewan, Canada |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 56 localities in this region. |
| ⓘ Chamosite Formula: Fe2+5Al(AlSi3O10)(OH)8 |
| ⓘ 'Chevkinite Group' |
| ⓘ Chlorapatite Formula: Ca5(PO4)3Cl Description: In felsic gneisses, with exsolution needles of monazite. References: |
| ⓘ 'Chlorite Group' Localities: Reported from at least 54 localities in this region. |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 |
| ⓘ Clausthalite Formula: PbSe Localities: Reported from at least 12 localities in this region. |
| ⓘ 'Clay minerals' |
| ⓘ Clinochalcomenite Formula: CuSeO3(H2O)2 References: |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 Localities: Reported from at least 9 localities in this region. |
| ⓘ Clinochlore var. Pennine Formula: Mg5Al(AlSi3O10)(OH)8 References: |
| ⓘ Clinochlore var. Penninite Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ 'Clinopyroxene Subgroup' |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Cobaltite Formula: CoAsS Localities: Reported from at least 6 localities in this region. |
| ⓘ Coffinite Formula: U(SiO4) · nH2O Localities: Reported from at least 18 localities in this region. |
| ⓘ Coloradoite Formula: HgTe |
| ⓘ 'Columbite-Tantalite' Description: Occurs as very rare accessory grains in isolated dykes. |
| ⓘ 'Copper Stain' |
| ⓘ Cordierite Formula: Mg2Al4Si5O18 Localities: Reported from at least 10 localities in this region. |
| ⓘ Corundum Formula: Al2O3 |
| ⓘ Cosalite Formula: Pb2Bi2S5 |
| ⓘ Covellite Formula: CuS Localities: Reported from at least 11 localities in this region. |
| ⓘ Crandallite Formula: CaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ Cristobalite Formula: SiO2 |
| ⓘ Crookesite Formula: Cu7(Tl, Ag)Se4 |
| ⓘ Cubanite Formula: CuFe2S3 |
| ⓘ Cummingtonite Formula: ◻Mg2Mg5(Si8O22)(OH)2 |
| ⓘ Cuprosklodowskite Formula: Cu(UO2)2(SiO3OH)2 · 6H2O |
| ⓘ Curite Formula: Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| ⓘ D'Ansite Formula: Na21Mg(SO4)10Cl3 Locality: Waldsea Lake, Saskatchewan, Canada |
| ⓘ Dawsonite Formula: NaAlCO3(OH)2 Locality: Muskiki Lake, Saskatchewan, Canada |
| ⓘ Despujolsite Formula: Ca3Mn4+(SO4)2(OH)6 · 3H2O |
| ⓘ Devilline Formula: CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ Diamond Formula: C Locality: Fort à la Corne, Saskatchewan, Canada |
| ⓘ Diaspore Formula: AlO(OH) Locality: Muskiki Lake, Saskatchewan, Canada |
| ⓘ Dickite Formula: Al2(Si2O5)(OH)4 Localities: Reported from at least 7 localities in this region. |
| ⓘ Digenite Formula: Cu9S5 |
| ⓘ Diopside Formula: CaMgSi2O6 Localities: Reported from at least 8 localities in this region. |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: Reported from at least 28 localities in this region. |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: Reported from at least 10 localities in this region. |
| ⓘ Dypingite Formula: Mg5(CO3)4(OH)2 · 5H2O Locality: Waldsea Lake, Saskatchewan, Canada |
| ⓘ Dyscrasite Formula: Ag3Sb |
| ⓘ Edenite Formula: NaCa2Mg5(Si7Al)O22(OH)2 |
| ⓘ Enstatite Formula: Mg2Si2O6 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: Reported from at least 13 localities in this region. |
| ⓘ Epsomite Formula: MgSO4 · 7H2O |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O |
| ⓘ Eskebornite Formula: CuFeSe2 Localities: Description: Eskebornite occurs as island remnants in, and replaced by, umangite. The remnants range up to 200 microns in diameter and frequently contain small inclusions of eucairite. |
| ⓘ Eucairite Formula: AgCuSe |
| ⓘ Eugsterite Formula: Na4Ca(SO4)3 · 2H2O |
| ⓘ Fairchildite Formula: K2Ca(CO3)2 |
| ⓘ Farringtonite (TL) Formula: Mg3(PO4)2 Type Locality: References: DuFresne, E.R., Roy, S.K. (1961) A new phosphate mineral from the Springwater pallasite. Geochimica et Cosmochimica Acta, 24 (3) 198-205 doi:10.1016/0016-7037(61)90017-5 |
| ⓘ 'Fayalite-Forsterite Series' |
| ⓘ 'Feldspar Group' Localities: Reported from at least 11 localities in this region. |
| ⓘ 'Feldspar Group var. Perthite' Description: Orthoclase network in oligoclase host, in felsic gneisses. References: |
| ⓘ 'Fergusonite' |
| ⓘ Ferro-edenite Formula: NaCa2Fe2+5(Si7Al)O22(OH)2 |
| ⓘ Ferro-pargasite Formula: NaCa2(Fe2+4Al)(Si6Al2)O22(OH)2 |
| ⓘ Ferrosilite Formula: Fe2+2Si2O6 Locality: Foster River, Saskatchewan, Canada References: |
| ⓘ Florencite-(Ce) Formula: CeAl3(PO4)2(OH)6 |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Foggite Formula: CaAl(PO4)(OH)2 · H2O Locality: Waldsea Lake, Saskatchewan, Canada |
| ⓘ Forsterite Formula: Mg2(SiO4) |
| ⓘ Fourmarierite Formula: Pb(UO2)4O3(OH)4 · 4H2O |
| ⓘ Freboldite Formula: CoSe References: |
| ⓘ Frohbergite Formula: FeTe2 |
| ⓘ Froodite Formula: α-PdBi2 |
| ⓘ Gahnite Formula: ZnAl2O4 |
| ⓘ Galena Formula: PbS Localities: Reported from at least 37 localities in this region. |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 Localities: Reported from at least 16 localities in this region. |
| ⓘ Gaylussite Formula: Na2Ca(CO3)2 · 5H2O |
| ⓘ 'Geikielite-Ilmenite Series' Description: Inclusions in coronitic garnets in opx/cpx/plagioclase mafic rocks included in felsic gneisses. References: |
| ⓘ Gersdorffite Formula: NiAsS Localities: Reported from at least 9 localities in this region. |
| ⓘ 'Glass' |
| ⓘ Glauberite Formula: Na2Ca(SO4)2 |
| ⓘ Glaucodot Formula: (Co0.50Fe0.50)AsS |
| ⓘ 'Glimmerite' Locality: Alces Lake, Saskatchewan, Canada |
| ⓘ Goethite Formula: Fe3+O(OH) Localities: Reported from at least 9 localities in this region. |
| ⓘ Görgeyite Formula: K2Ca5(SO4)6 · H2O |
| ⓘ Goyazite Formula: SrAl3(PO4)(PO3OH)(OH)6 |
| ⓘ Graphite Formula: C Localities: Reported from at least 25 localities in this region. |
| ⓘ Guanajuatite Formula: Bi2Se3 |
| ⓘ Gudmundite Formula: FeSbS |
| ⓘ 'Gummite' Localities: Eldorado Mine (Beaverlodge Mine; Beaverlodge Operation), Eldorado Mining & Refining Ltd. mines, Beaverlodge Lake area, Saskatchewan, Canada McArthur River Mine, Athabasca Basin, Saskatchewan, Canada Rix Mine, Rix-Athabasca Uranium mines, Beaverlodge Lake area, Saskatchewan, Canada National Explorations mine, Beaverlodge Lake area, Saskatchewan, Canada Smitty mine, Rix-Athabasca Uranium mines, Beaverlodge Lake area, Saskatchewan, Canada |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: Reported from at least 6 localities in this region. Habit: Clusters Description: Were burned to produce white edges, |
| ⓘ Haiweeite Formula: Ca(UO2)2[Si5O12(OH)2] · 6H2O |
| ⓘ Halite Formula: NaCl Localities: Reported from at least 9 localities in this region. |
| ⓘ Hanksite Formula: Na22K(SO4)9(CO3)2Cl |
| ⓘ Hannebachite Formula: CaSO3 · H2O Locality: Waldsea Lake, Saskatchewan, Canada |
| ⓘ Harmotome Formula: Ba2(Si12Al4)O32 · 12H2O Locality: Nisikkatch Lake, Saskatchewan, Canada |
| ⓘ Formula: Ni9BiSbS8 Locality: Zimmer Lake area, Athabasca Basin, Saskatchewan, Canada - erroneously reported Description: Watkinson et al published Hauchecornite in 1975, 5 years before Bismutohauchecornite was defined in 1980. Watkinson's 1975 analysis was reported in the Handbook of Mineralogy, vol 1, pg 57 under Bismutohauchecornite |
| ⓘ Hedenbergite Formula: CaFe2+Si2O6 Locality: Foster River, Saskatchewan, Canada References: |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 58 localities in this region. |
| ⓘ Hematite var. Specularite Formula: Fe2O3 |
| ⓘ Hercynite Formula: Fe2+Al2O4 |
| ⓘ Hexahydrite Formula: Mg(H2O)6(SO4) |
| ⓘ Hisingerite Formula: Fe3+2(Si2O5)(OH)4 · 2H2O |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ Huntite Formula: CaMg3(CO3)4 Locality: Muskiki Lake, Saskatchewan, Canada |
| ⓘ Hydroglauberite Formula: Na10Ca3(SO4)8 · 6H2O Locality: Ceylon Lake, Saskatchewan, Canada |
| ⓘ Hydrohalite Formula: NaCl · 2H2O Locality: Waldsea Lake, Saskatchewan, Canada |
| ⓘ Hydromagnesite Formula: Mg5(CO3)4(OH)2 · 4H2O |
| ⓘ Ikaite Formula: CaCO3 · 6H2O Locality: Manito Lake, Saskatchewan, Canada |
| ⓘ Ilmenite Formula: Fe2+TiO3 Localities: Reported from at least 13 localities in this region. |
| ⓘ Inderborite Formula: CaMg(H3B3O7)2 · 8H2O |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Jolliffeite (TL) Formula: NiAsSe Type Locality: |
| ⓘ Jordisite Formula: MoS2 |
| ⓘ Kainite Formula: KMg(SO4)Cl · 3H2O |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 Localities: Reported from at least 12 localities in this region. |
| ⓘ Kasolite Formula: Pb(UO2)(SiO4) · H2O Localities: Eldorado Mine (Beaverlodge Mine; Beaverlodge Operation), Eldorado Mining & Refining Ltd. mines, Beaverlodge Lake area, Saskatchewan, Canada Nicholson No. 1 ("No. 1 zone extension" vein), Consolidated Nicholson Mines, Goldfields District, Beaverlodge Lake area, Saskatchewan, Canada Lee (Jahala) Lake occurrence, Lac la Ronge, Saskatchewan, Canada |
| ⓘ 'K Feldspar' Localities: Reported from at least 12 localities in this region. |
| ⓘ Kieserite Formula: MgSO4 · H2O Locality: Ceylon Lake, Saskatchewan, Canada |
| ⓘ Klockmannite Formula: CuSe Localities: Pinky Fault Uranium Deposit, Saskatchewan, Canada Ato Bay, Beaverlodge Lake, Goldfields District, Beaverlodge Lake area, Saskatchewan, Canada Goldfields District, Beaverlodge Lake area, Saskatchewan, Canada Martin Lake mine, Beaverlodge Lake area, Saskatchewan, Canada Eagle Claims U-Cu-Se occurrence, Beaverlodge Lake area, Saskatchewan, Canada |
| ⓘ Formula: Na4Mg9Al4Cl12(OH)22 Locality: Esterhazy Potash Mines, Esterhazy, Saskatchewan, Canada - erroneously reported |
| ⓘ Korshunovskite Formula: Mg2Cl(OH)3 · 4H2O |
| ⓘ Kotulskite Formula: Pd(Te,Bi)2-x (x ≈ 0.4) Locality: Rottenstone Mine, Saskatchewan, Canada |
| ⓘ Krausite Formula: KFe(SO4)2 · H2O |
| ⓘ Kutnohorite Formula: CaMn2+(CO3)2 |
| ⓘ Kyanite Formula: Al2(SiO4)O Description: In clinopyroxenites.
In felsic needles : Deep blue to green crystals, with Cr2O3 up to 2.21 wt%. References: |
| ⓘ Lechatelierite Formula: SiO2 Locality: Lake Athabasca, Saskatchewan, Canada References: |
| ⓘ Leightonite Formula: K2Ca2Cu(SO4)4 · 2H2O |
| ⓘ 'Lepidolite' |
| ⓘ 'Leucoxene' |
| ⓘ Liebigite Formula: Ca2(UO2)(CO3)3 · 11H2O |
| ⓘ 'Limonite' Localities: Reported from at least 6 localities in this region. |
| ⓘ Linnaeite Formula: Co2+Co3+2S4 |
| ⓘ Löllingite Formula: FeAs2 |
| ⓘ Magnesio-foitite Formula: ◻(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Magnesite Formula: MgCO3 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 26 localities in this region. |
| ⓘ Majorite Formula: Mg3(MgSi)(SiO4)3 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Marcasite Formula: FeS2 Localities: Reported from at least 11 localities in this region. |
| ⓘ Marialite Formula: Na4Al3Si9O24Cl Locality: Nisikkatch Lake, Saskatchewan, Canada |
| ⓘ Masuyite Formula: Pb(UO2)3O3(OH)2 · 3H2O |
| ⓘ Maucherite Formula: Ni11As8 |
| ⓘ Melonite Formula: NiTe2 |
| ⓘ 'Melonite-Merenskyite Series' Habit: always euhedral, and is rather small (<20μm). Description: Its chemical composition corresponds to the Ni-Pd substitution of the melonite-merenskyite solid solution, combined with the Bi replacement of Te to a fairly significant, but not exceptional, extent.
|
| ⓘ Mercallite Formula: KHSO4 |
| ⓘ Merrillite Formula: Ca9NaMg(PO4)7 References: |
| ⓘ Mertieite ? Formula: Pd8Sb2.5As0.5 References: |
| ⓘ Meta-aluminite Formula: Al2(SO4)(OH)4 · 5H2O Locality: Waldsea Lake, Saskatchewan, Canada |
| ⓘ Metanováčekite Formula: Mg(UO2)2(AsO4)2 · 8H2O |
| ⓘ Metazeunerite Formula: Cu(UO2)2(AsO4)2 · 8H2O |
| ⓘ 'Meteoritic Iron' |
| ⓘ Michenerite Formula: PdBiTe Locality: Rottenstone Mine, Saskatchewan, Canada |
| ⓘ Microcline Formula: K(AlSi3O8) Localities: Reported from at least 7 localities in this region. |
| ⓘ Microcline var. Amazonite Formula: K(AlSi3O8) |
| ⓘ Microcline var. Hyalophane Formula: (K,Ba)[Al(Si,Al)Si2O8] |
| ⓘ Millerite Formula: NiS |
| ⓘ Mirabilite Formula: Na2SO4 · 10H2O Localities: Description: Occurs in alkaline lakes in the western portions of the Province. |
| ⓘ Mohrite Formula: (NH4)2Fe(SO4)2 · 6H2O Locality: Waldsea Lake, Saskatchewan, Canada |
| ⓘ Molybdenite Formula: MoS2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Molybdomenite Formula: PbSeO3 |
| ⓘ 'Monazite Group' Formula: REE(PO4) Localities: Reported from at least 16 localities in this region. |
| ⓘ Monohydrocalcite Formula: CaCO3 · H2O |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ Munakataite Formula: Pb2Cu2(Se4+O3)(SO4)(OH)4 References: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 34 localities in this region. |
| ⓘ Muscovite var. Fuchsite Formula: K(Al,Cr)3Si3O10(OH)2 |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 Localities: Reported from at least 13 localities in this region. |
| ⓘ Muscovite var. Phengite Formula: KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 17 localities in this region. |
| ⓘ Nahcolite Formula: NaHCO3 Locality: Ceylon Lake, Saskatchewan, Canada |
| ⓘ Native Bismuth Formula: Bi References: |
| ⓘ Native Copper Formula: Cu Localities: Laird Island Uranium Occurrences 1 2 & 3, Laird Island, Tazin Lake, Saskatchewan, Canada Martin Lake mine, Beaverlodge Lake area, Saskatchewan, Canada Nemeiben Lake deposit, Lac la Ronge, Saskatchewan, Canada Birch Lake Mine, Amisk Lake District, Saskatchewan, Canada Anglo-Rouyn Mine, Lac la Ronge, Saskatchewan, Canada |
| ⓘ Native Gold Formula: Au Localities: Reported from at least 23 localities in this region. |
| ⓘ Native Gold var. Electrum Formula: (Au,Ag) |
| ⓘ Native Iron Formula: Fe |
| ⓘ Native Iron var. Kamacite Formula: (Fe,Ni) |
| ⓘ Native Selenium Formula: Se |
| ⓘ Native Silver Formula: Ag Localities: Consolidated Nicholson Mines, Goldfields District, Beaverlodge Lake area, Saskatchewan, Canada Fish Hook Bay Mine, Lake Athabasca, Saskatchewan, Canada Nicholson No. 2, Consolidated Nicholson Mines, Goldfields District, Beaverlodge Lake area, Saskatchewan, Canada Martin Lake mine, Beaverlodge Lake area, Saskatchewan, Canada Nemeiben Lake deposit, Lac la Ronge, Saskatchewan, Canada |
| ⓘ Native Tellurium Formula: Te |
| ⓘ Native Tin Formula: Sn References: |
| ⓘ Natron Formula: Na2CO3 · 10H2O Locality: Ceylon Lake, Saskatchewan, Canada |
| ⓘ Nickeline Formula: NiAs Localities: Reported from at least 8 localities in this region. |
| ⓘ Niter Formula: KNO3 |
| ⓘ Nitratine Formula: NaNO3 |
| ⓘ Nitrobarite Formula: Ba(NO3)2 |
| ⓘ Nolanite (TL) Formula: V3+8Fe3+2O14(OH)2 Localities: Nicholson No. 2, Consolidated Nicholson Mines, Goldfields District, Beaverlodge Lake area, Saskatchewan, Canada Eldorado Mining & Refining Ltd. mines, Beaverlodge Lake area, Saskatchewan, Canada Ace deposit, Eldorado Mining & Refining Ltd. mines, Beaverlodge Lake area, Saskatchewan, Canada Pitche Group, Beaverlodge Lake area, Saskatchewan, Canada Fish Hook Bay Mine, Lake Athabasca, Saskatchewan, Canada |
| ⓘ Nordstrandite Formula: Al(OH)3 Locality: Muskiki Lake, Saskatchewan, Canada |
| ⓘ Northupite Formula: Na3Mg(CO3)2Cl Locality: Waldsea Lake, Saskatchewan, Canada |
| ⓘ Olsacherite Formula: Pb2(Se6+O4)(SO4) References: |
| ⓘ Oosterboschite Formula: (Pd,Cu)7Se5 |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ 'Orthopyroxene Subgroup' Locality: Foster River, Saskatchewan, Canada |
| ⓘ Oxy-dravite Formula: Na(Al2Mg)(Al5Mg)(Si6O18)(BO3)3(OH)3O |
| ⓘ Oxy-schorl Formula: Na(Fe2+2Al)Al6(Si6O18)(BO3)3(OH)3O |
| ⓘ Paragonite Formula: NaAl2(AlSi3O10)(OH)2 |
| ⓘ Paraguanajuatite Formula: Bi2Se3 |
| ⓘ Pararammelsbergite Formula: NiAs2 |
| ⓘ Pargasite Formula: NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| ⓘ Pentahydrite Formula: MgSO4 · 5H2O Locality: Ceylon Lake, Saskatchewan, Canada |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 Localities: Reported from at least 6 localities in this region. |
| ⓘ Perrierite-(Ce) Formula: Ce4MgFe3+2Ti2(Si2O7)2O8 |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 |
| ⓘ 'Pinite' |
| ⓘ Pirssonite Formula: Na2Ca(CO3)2 · 2H2O Locality: Ceylon Lake, Saskatchewan, Canada |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 Localities: Reported from at least 14 localities in this region. |
| ⓘ 'Plessite' |
| ⓘ Polyhalite Formula: K2Ca2Mg(SO4)4 · 2H2O |
| ⓘ Posnjakite Formula: Cu4(SO4)(OH)6 · H2O |
| ⓘ 'Protodolomite' Formula: (Ca,Mg)CO3 |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 71 localities in this region. |
| ⓘ Pyrite var. Bravoite Formula: (Fe,Ni)S2 Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Pyrobitumen' |
| ⓘ 'Pyrobitumen var. Thucholite' |
| ⓘ 'Pyrochlore Supergroup' Formula: A2-mD2X6-wZ1-n Description: Originally identified as a betafite, but no mention was made of the homegeneity of the sample. |
| ⓘ Pyrope Formula: Mg3Al2(SiO4)3 Description: Replaced by spinel+plagioclase+opx kelyphites, in clinopyroxenites. References: |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Reported from at least 28 localities in this region. |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 72 localities in this region. |
| ⓘ Quartz var. Amethyst Formula: SiO2 |
| ⓘ Quartz var. Blue Quartz Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Rammelsbergite Formula: NiAs2 Localities: Key Lake Mine, Athabasca Basin, Saskatchewan, Canada Unnamed pegmatite, Moore Lake, Athabasca Basin, Saskatchewan, Canada Cigar Lake Mine, Athabasca Basin, Saskatchewan, Canada Nicholson No. 2, Consolidated Nicholson Mines, Goldfields District, Beaverlodge Lake area, Saskatchewan, Canada Waterfound prospect, Athabasca Basin, Saskatchewan, Canada |
| ⓘ Rapidcreekite Formula: Ca2(SO4)(CO3) · 4H2O |
| ⓘ Retgersite Formula: NiSO4 · 6H2O |
| ⓘ Rhomboclase Formula: (H5O2)Fe3+(SO4)2 · 2H2O Locality: Waldsea Lake, Saskatchewan, Canada |
| ⓘ Ringwoodite Formula: (Mg,Fe2+)2SiO4 |
| ⓘ Rutherfordine Formula: (UO2)CO3 |
| ⓘ Rutile Formula: TiO2 Localities: Reported from at least 9 localities in this region. |
| ⓘ Rutile var. Niobium-bearing Rutile Formula: (Ti,Nb)O2 Description: In felsic gneisses. References: |
| ⓘ Sapphirine Formula: Mg4(Mg3Al9)O4[Si3Al9O36] Description: At the clinopyroxenites/gneisses contacts. References: |
| ⓘ 'Scapolite' |
| ⓘ Scarbroite Formula: Al5(CO3)(OH)13 · 5H2O Locality: Muskiki Lake, Saskatchewan, Canada |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ Schreibersite Formula: (Fe,Ni)3P |
| ⓘ Sepiolite Formula: Mg4(Si6O15)(OH)2 · 6H2O |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 |
| ⓘ Siderite Formula: FeCO3 Localities: Reported from at least 10 localities in this region. |
| ⓘ Siegenite Formula: CoNi2S4 References: |
| ⓘ Sillimanite Formula: Al2(SiO4)O Localities: Reported from at least 8 localities in this region. |
| ⓘ Sillimanite var. Fibrolite Formula: Al2(SiO4)O Locality: Foster River, Saskatchewan, Canada |
| ⓘ Sklodowskite Formula: Mg(UO2)2(SiO3OH)2 · 6H2O |
| ⓘ Skutterudite Formula: CoAs3 |
| ⓘ 'Smectite Group' Formula: A0.3D2-3[T4O10]Z2 · nH2O |
| ⓘ Smythite Formula: (Fe,Ni)3+xS4 (x=0-0.3) |
| ⓘ Sperrylite Formula: PtAs2 Locality: Rottenstone Mine, Saskatchewan, Canada |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 33 localities in this region. |
| ⓘ Spinel Formula: MgAl2O4 Localities: Description: In clinopyroxenites.
In felsic gneisses : green to grey-brown, rich in Zn, Cr, V. |
| ⓘ Stanfieldite Formula: Ca4Mg5(PO4)6 |
| ⓘ Starkeyite Formula: MgSO4 · 4H2O |
| ⓘ Staurolite Formula: Fe2+2Al9Si4O23(OH) |
| ⓘ Stibiopalladinite Formula: Pd5Sb2 |
| ⓘ Sudoite Formula: Mg2Al3(AlSi3O10)(OH)8 Localities: Reported from at least 10 localities in this region. |
| ⓘ Svanbergite Formula: SrAl3(PO4)(SO4)(OH)6 |
| ⓘ Sylvite Formula: KCl |
| ⓘ Syngenite Formula: K2Ca(SO4)2 · H2O Locality: Waldsea Lake, Saskatchewan, Canada |
| ⓘ Taenite Formula: (Ni,Fe) |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ Tellurobismuthite Formula: Bi2Te3 |
| ⓘ Tetradymite Formula: Bi2Te2S |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| ⓘ Thénardite Formula: Na2SO4 |
| ⓘ Thorite Formula: Th(SiO4) |
| ⓘ Thorite var. Uranothorite Formula: (Th,U)SiO4 |
| ⓘ Tiemannite Formula: HgSe |
| ⓘ Titanite Formula: CaTiO(SiO4) Localities: Reported from at least 14 localities in this region. |
| ⓘ Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z Localities: Reported from at least 11 localities in this region. |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Troilite Formula: FeS References: |
| ⓘ Trona Formula: Na3H(CO3)2 · 2H2O Locality: Ceylon Lake, Saskatchewan, Canada |
| ⓘ Tychite Formula: Na6Mg2(CO3)4(SO4) |
| ⓘ Tyrrellite (TL) Formula: Cu(Co,Ni)2Se4 Localities: Ato Bay, Beaverlodge Lake, Goldfields District, Beaverlodge Lake area, Saskatchewan, Canada Eagle Claims U-Cu-Se occurrence, Beaverlodge Lake area, Saskatchewan, Canada Hal Lake Selenium Occurrence No. 1, Beaverlodge Lake area, Saskatchewan, Canada Martin Lake mine, Beaverlodge Lake area, Saskatchewan, Canada |
| ⓘ Tyuyamunite Formula: Ca(UO2)2(VO4)2 · 5-8H2O |
| ⓘ Ullmannite Formula: NiSbS |
| ⓘ Ulvöspinel Formula: TiFe2+2O4 Locality: Fort à la Corne, Saskatchewan, Canada |
| ⓘ 'UM1978-10-O:U' Formula: U3O7 References: |
| ⓘ 'UM1991-19-Se:AsCo' Formula: (Co,Ni)AsSe |
| ⓘ Umangite Formula: Cu3Se2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Uraninite Formula: UO2 Localities: Reported from at least 56 localities in this region. |
| ⓘ Uraninite var. Pitchblende Formula: UO2 Localities: Reported from at least 35 localities in this region. |
| ⓘ Uranophane Formula: Ca(UO2)2(SiO3OH)2 · 5H2O Localities: Reported from at least 14 localities in this region. |
| ⓘ Uranopilite Formula: (UO2)6(SO4)O2(OH)6 · 14H2O |
| ⓘ Vaesite Formula: NiS2 |
| ⓘ Vandendriesscheite Formula: PbU7O22 · 12H2O |
| ⓘ Vermiculite Formula: Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| ⓘ Violarite Formula: Fe2+Ni3+2S4 |
| ⓘ Wattevilleite Formula: Na2Ca(SO4)2 · 4H2O (?) |
| ⓘ 'White mica' |
| ⓘ Whitlockite Formula: Ca9Mg(PO4)6(PO3OH) |
| ⓘ Woodhouseite Formula: CaAl3(PO4)(SO4)(OH)6 |
| ⓘ Wulfenite Formula: Pb(MoO4) |
| ⓘ 'Xenotime' |
| ⓘ Zemkorite Formula: Na2Ca(CO3)2 |
| ⓘ Zippeite Formula: K3(UO2)4(SO4)2O3(OH) · 3H2O |
| ⓘ Zircon Formula: Zr(SiO4) Localities: Reported from at least 12 localities in this region. |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold var. Electrum | 1.AA.05 | (Au,Ag) |
| ⓘ | 1.AA.05 | Au | |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Tin | 1.AC.10 | Sn |
| ⓘ | Native Iron | 1.AE.05 | Fe |
| ⓘ | var. Kamacite | 1.AE.05 | (Fe,Ni) |
| ⓘ | Taenite | 1.AE.10 | (Ni,Fe) |
| ⓘ | Schreibersite | 1.BD.05 | (Fe,Ni)3P |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Diamond | 1.CB.10a | C |
| ⓘ | Native Selenium | 1.CC.10 | Se |
| ⓘ | Native Tellurium | 1.CC.10 | Te |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Dyscrasite | 2.AA.35 | Ag3Sb |
| ⓘ | Maucherite | 2.AB.15 | Ni11As8 |
| ⓘ | Mertieite ? | 2.AC.10b | Pd8Sb2.5As0.5 |
| ⓘ | Stibiopalladinite | 2.AC.20a | Pd5Sb2 |
| ⓘ | Froodite | 2.AC.45a | α-PdBi2 |
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Berzelianite | 2.BA.20 | Cu2-xSe (x ≈ 0.12) |
| ⓘ | Athabascaite (TL) | 2.BA.25 | Cu5Se4 |
| ⓘ | Umangite | 2.BA.25 | Cu3Se2 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Eucairite | 2.BA.50 | AgCuSe |
| ⓘ | Bismutohauchecornite | 2.BB.10 | Ni9Bi2S8 |
| ⓘ | Hauchecornite ? | 2.BB.10 | Ni9BiSbS8 |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Oosterboschite | 2.BC.10 | (Pd,Cu)7Se5 |
| ⓘ | Crookesite | 2.BD.50 | Cu7(Tl, Ag)Se4 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Klockmannite | 2.CA.05b | CuSe |
| ⓘ | Coloradoite | 2.CB.05a | HgTe |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Tiemannite | 2.CB.05a | HgSe |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Eskebornite | 2.CB.10a | CuFeSe2 |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Freboldite | 2.CC.05 | CoSe |
| ⓘ | Kotulskite | 2.CC.05 | Pd(Te,Bi)2-x (x ≈ 0.4) |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Smythite | 2.CC.10 | (Fe,Ni)3+xS4 (x=0-0.3) |
| ⓘ | Troilite | 2.CC.10 | FeS |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Altaite | 2.CD.10 | PbTe |
| ⓘ | Clausthalite | 2.CD.10 | PbSe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Bornhardtite | 2.DA.05 | Co2+Co3+2Se4 |
| ⓘ | Linnaeite | 2.DA.05 | Co2+Co3+2S4 |
| ⓘ | Siegenite | 2.DA.05 | CoNi2S4 |
| ⓘ | Tyrrellite (TL) | 2.DA.05 | Cu(Co,Ni)2Se4 |
| ⓘ | Violarite | 2.DA.05 | Fe2+Ni3+2S4 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Guanajuatite | 2.DB.05 | Bi2Se3 |
| ⓘ | Paraguanajuatite | 2.DC.05 | Bi2Se3 |
| ⓘ | Tellurobismuthite | 2.DC.05 | Bi2Te3 |
| ⓘ | Tetradymite | 2.DC.05 | Bi2Te2S |
| ⓘ | Calaverite | 2.EA.10 | AuTe2 |
| ⓘ | Melonite | 2.EA.20 | NiTe2 |
| ⓘ | Jordisite | 2.EA.30 | MoS2 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite var. Bravoite | 2.EB.05a | (Fe,Ni)S2 |
| ⓘ | 2.EB.05a | FeS2 | |
| ⓘ | Sperrylite | 2.EB.05a | PtAs2 |
| ⓘ | Vaesite | 2.EB.05a | NiS2 |
| ⓘ | Frohbergite | 2.EB.10a | FeTe2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Glaucodot | 2.EB.10c | (Co0.50Fe0.50)AsS |
| ⓘ | Pararammelsbergite | 2.EB.10e | NiAs2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Rammelsbergite | 2.EB.15a | NiAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Gudmundite | 2.EB.20 | FeSbS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Jolliffeite (TL) | 2.EB.25 | NiAsSe |
| ⓘ | Michenerite | 2.EB.25 | PdBiTe |
| ⓘ | Ullmannite | 2.EB.25 | NiSbS |
| ⓘ | Skutterudite | 2.EC.05 | CoAs3 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Cosalite | 2.JB.10 | Pb2Bi2S5 |
| Group 3 - Halides | |||
| ⓘ | Halite | 3.AA.20 | NaCl |
| ⓘ | Sylvite | 3.AA.20 | KCl |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Hydrohalite | 3.BA.05 | NaCl · 2H2O |
| ⓘ | Carnallite | 3.BA.10 | KMgCl3 · 6H2O |
| ⓘ | Bischofite | 3.BB.15 | MgCl2 · 6H2O |
| ⓘ | Korshunovskite | 3.BD.15 | Mg2Cl(OH)3 · 4H2O |
| ⓘ | Koenenite ? | 3.BD.25 | Na4Mg9Al4Cl12(OH)22 |
| ⓘ | Atacamite | 3.DA.10a | Cu2(OH)3Cl |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Gahnite | 4.BB.05 | ZnAl2O4 |
| ⓘ | Hercynite | 4.BB.05 | Fe2+Al2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Ulvöspinel | 4.BB.05 | TiFe2+2O4 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Hematite var. Specularite | 4.CB.05 | Fe2O3 |
| ⓘ | Nolanite (TL) | 4.CB.40 | V3+8Fe3+2O14(OH)2 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Blue Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cristobalite | 4.DA.15 | SiO2 |
| ⓘ | Lechatelierite | 4.DA.30 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | var. Niobium-bearing Rutile | 4.DB.05 | (Ti,Nb)O2 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Baddeleyite | 4.DE.35 | ZrO2 |
| ⓘ | Brannerite | 4.DH.05 | UTi2O6 |
| ⓘ | Uraninite var. Pitchblende | 4.DL.05 | UO2 |
| ⓘ | 4.DL.05 | UO2 | |
| ⓘ | Diaspore | 4.FD.10 | AlO(OH) |
| ⓘ | Nordstrandite | 4.FE.10 | Al(OH)3 |
| ⓘ | Becquerelite | 4.GB.10 | Ca(UO2)6O4(OH)6 · 8H2O |
| ⓘ | Fourmarierite | 4.GB.25 | Pb(UO2)4O3(OH)4 · 4H2O |
| ⓘ | Masuyite | 4.GB.35 | Pb(UO2)3O3(OH)2 · 3H2O |
| ⓘ | Vandendriesscheite | 4.GB.40 | PbU7O22 · 12H2O |
| ⓘ | Curite | 4.GB.55 | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| ⓘ | Carnotite | 4.HB.05 | K2(UO2)2(VO4)2 · 3H2O |
| ⓘ | Tyuyamunite | 4.HB.25 | Ca(UO2)2(VO4)2 · 5-8H2O |
| ⓘ | Hannebachite | 4.JE.10 | CaSO3 · H2O |
| ⓘ | Molybdomenite | 4.JF.05 | PbSeO3 |
| ⓘ | Chalcomenite | 4.JH.05 | CuSeO3 · 2H2O |
| ⓘ | Clinochalcomenite | 4.JH.10 | CuSeO3(H2O)2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Nahcolite | 5.AA.15 | NaHCO3 |
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Kutnohorite | 5.AB.10 | CaMn2+(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Huntite | 5.AB.25 | CaMg3(CO3)4 |
| ⓘ | Benstonite | 5.AB.55 | Ba6Ca6Mg(CO3)13 |
| ⓘ | Zemkorite | 5.AC.10 | Na2Ca(CO3)2 |
| ⓘ | Fairchildite | 5.AC.20 | K2Ca(CO3)2 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Dawsonite | 5.BB.10 | NaAlCO3(OH)2 |
| ⓘ | Northupite | 5.BF.05 | Na3Mg(CO3)2Cl |
| ⓘ | Tychite | 5.BF.05 | Na6Mg2(CO3)4(SO4) |
| ⓘ | Bradleyite | 5.BF.10 | Na3Mg(CO3)(PO4) |
| ⓘ | Natron | 5.CB.10 | Na2CO3 · 10H2O |
| ⓘ | Trona | 5.CB.15 | Na3H(CO3)2 · 2H2O |
| ⓘ | Monohydrocalcite | 5.CB.20 | CaCO3 · H2O |
| ⓘ | Ikaite | 5.CB.25 | CaCO3 · 6H2O |
| ⓘ | Pirssonite | 5.CB.30 | Na2Ca(CO3)2 · 2H2O |
| ⓘ | Gaylussite | 5.CB.35 | Na2Ca(CO3)2 · 5H2O |
| ⓘ | Dypingite | 5.DA.05 | Mg5(CO3)4(OH)2 · 5H2O |
| ⓘ | Hydromagnesite | 5.DA.05 | Mg5(CO3)4(OH)2 · 4H2O |
| ⓘ | Artinite | 5.DA.10 | Mg2(CO3)(OH)2 · 3H2O |
| ⓘ | Scarbroite | 5.DA.35 | Al5(CO3)(OH)13 · 5H2O |
| ⓘ | Rutherfordine | 5.EB.05 | (UO2)CO3 |
| ⓘ | Bayleyite | 5.ED.05 | Mg2(UO2)(CO3)3 · 18H2O |
| ⓘ | Liebigite | 5.ED.20 | Ca2(UO2)(CO3)3 · 11H2O |
| ⓘ | Nitratine | 5.NA.05 | NaNO3 |
| ⓘ | Niter | 5.NA.10 | KNO3 |
| ⓘ | Nitrobarite | 5.NA.20 | Ba(NO3)2 |
| Group 6 - Borates | |||
| ⓘ | Inderborite | 6.CA.25 | CaMg(H3B3O7)2 · 8H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Arcanite | 7.AD.05 | K2SO4 |
| ⓘ | Mercallite | 7.AD.10 | KHSO4 |
| ⓘ | Glauberite | 7.AD.25 | Na2Ca(SO4)2 |
| ⓘ | Thénardite | 7.AD.25 | Na2SO4 |
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Olsacherite | 7.AD.35 | Pb2(Se6+O4)(SO4) |
| ⓘ | Antlerite | 7.BB.15 | Cu3(SO4)(OH)4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | D'Ansite | 7.BC.05 | Na21Mg(SO4)10Cl3 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Munakataite | 7.BC.65 | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| ⓘ | Burkeite | 7.BD.25 | Na6(CO3)(SO4)2 |
| ⓘ | Hanksite | 7.BD.30 | Na22K(SO4)9(CO3)2Cl |
| ⓘ | Kieserite | 7.CB.05 | MgSO4 · H2O |
| ⓘ | Starkeyite | 7.CB.15 | MgSO4 · 4H2O |
| ⓘ | Pentahydrite | 7.CB.20 | MgSO4 · 5H2O |
| ⓘ | Hexahydrite | 7.CB.25 | Mg(H2O)6(SO4) |
| ⓘ | Retgersite | 7.CB.30 | NiSO4 · 6H2O |
| ⓘ | Epsomite | 7.CB.40 | MgSO4 · 7H2O |
| ⓘ | Rhomboclase | 7.CB.55 | (H5O2)Fe3+(SO4)2 · 2H2O |
| ⓘ | Krausite | 7.CC.05 | KFe(SO4)2 · H2O |
| ⓘ | Blödite | 7.CC.50 | Na2Mg(SO4)2 · 4H2O |
| ⓘ | Boussingaultite | 7.CC.60 | (NH4)2Mg(SO4)2 · 6H2O |
| ⓘ | Mohrite | 7.CC.60 | (NH4)2Fe(SO4)2 · 6H2O |
| ⓘ | Polyhalite | 7.CC.65 | K2Ca2Mg(SO4)4 · 2H2O |
| ⓘ | Leightonite | 7.CC.70 | K2Ca2Cu(SO4)4 · 2H2O |
| ⓘ | Wattevilleite | 7.CC.85 | Na2Ca(SO4)2 · 4H2O (?) |
| ⓘ | Mirabilite | 7.CD.10 | Na2SO4 · 10H2O |
| ⓘ | Hydroglauberite | 7.CD.20 | Na10Ca3(SO4)8 · 6H2O |
| ⓘ | Eugsterite | 7.CD.25 | Na4Ca(SO4)3 · 2H2O |
| ⓘ | Görgeyite | 7.CD.30 | K2Ca5(SO4)6 · H2O |
| ⓘ | Syngenite | 7.CD.35 | K2Ca(SO4)2 · H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Meta-aluminite | 7.DC.05 | Al2(SO4)(OH)4 · 5H2O |
| ⓘ | Posnjakite | 7.DD.10 | Cu4(SO4)(OH)6 · H2O |
| ⓘ | Devilline | 7.DD.30 | CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Carbonatecyanotrichite | 7.DE.10 | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| ⓘ | Kainite | 7.DF.10 | KMg(SO4)Cl · 3H2O |
| ⓘ | Despujolsite | 7.DF.25 | Ca3Mn4+(SO4)2(OH)6 · 3H2O |
| ⓘ | Rapidcreekite | 7.DG.20 | Ca2(SO4)(CO3) · 4H2O |
| ⓘ | Uranopilite | 7.EA.05 | (UO2)6(SO4)O2(OH)6 · 14H2O |
| ⓘ | Zippeite | 7.EC.05 | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Farringtonite (TL) | 8.AB.05 | Mg3(PO4)2 |
| ⓘ | Whitlockite | 8.AC.45 | Ca9Mg(PO4)6(PO3OH) |
| ⓘ | Merrillite | 8.AC.45 | Ca9NaMg(PO4)7 |
| ⓘ | Stanfieldite | 8.AC.70 | Ca4Mg5(PO4)6 |
| ⓘ | Svanbergite | 8.BL.05 | SrAl3(PO4)(SO4)(OH)6 |
| ⓘ | Woodhouseite | 8.BL.05 | CaAl3(PO4)(SO4)(OH)6 |
| ⓘ | Crandallite | 8.BL.10 | CaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Goyazite | 8.BL.10 | SrAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Arsenoflorencite-(Ce) | 8.BL.13 | CeAl3(AsO4)2(OH)6 |
| ⓘ | Florencite-(Ce) | 8.BL.13 | CeAl3(PO4)2(OH)6 |
| ⓘ | Chlorapatite | 8.BN.05 | Ca5(PO4)3Cl |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Annabergite | 8.CE.40 | Ni3(AsO4)2 · 8H2O |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Foggite | 8.DL.05 | CaAl(PO4)(OH)2 · H2O |
| ⓘ | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ | Metanováčekite | 8.EB.10 | Mg(UO2)2(AsO4)2 · 8H2O |
| ⓘ | Metazeunerite | 8.EB.10 | Cu(UO2)2(AsO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Forsterite | 9.AC.05 | Mg2(SiO4) |
| ⓘ | Ringwoodite | 9.AC.15 | (Mg,Fe2+)2SiO4 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Majorite | 9.AD.25 | Mg3(MgSi)(SiO4)3 |
| ⓘ | Pyrope | 9.AD.25 | Mg3Al2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Coffinite | 9.AD.30 | U(SiO4) · nH2O |
| ⓘ | Thorite | 9.AD.30 | Th(SiO4) |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Thorite var. Uranothorite | 9.AD.30 | (Th,U)SiO4 |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | var. Fibrolite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Cuprosklodowskite | 9.AK.10 | Cu(UO2)2(SiO3OH)2 · 6H2O |
| ⓘ | Sklodowskite | 9.AK.10 | Mg(UO2)2(SiO3OH)2 · 6H2O |
| ⓘ | Boltwoodite | 9.AK.15 | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| ⓘ | Kasolite | 9.AK.15 | Pb(UO2)(SiO4) · H2O |
| ⓘ | Uranophane | 9.AK.15 | Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ | Haiweeite | 9.AK.25 | Ca(UO2)2[Si5O12(OH)2] · 6H2O |
| ⓘ | Perrierite-(Ce) | 9.BE.70 | Ce4MgFe3+2Ti2(Si2O7)2O8 |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Cordierite | 9.CJ.10 | Mg2Al4Si5O18 |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Magnesio-foitite | 9.CK.05 | ◻(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Oxy-dravite | 9.CK.05 | Na(Al2Mg)(Al5Mg)(Si6O18)(BO3)3(OH)3O |
| ⓘ | Oxy-schorl | 9.CK.05 | Na(Fe2+2Al)Al6(Si6O18)(BO3)3(OH)3O |
| ⓘ | Enstatite | 9.DA.05 | Mg2Si2O6 |
| ⓘ | Ferrosilite | 9.DA.05 | Fe2+2Si2O6 |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Hedenbergite | 9.DA.15 | CaFe2+Si2O6 |
| ⓘ | Augite var. Soda-Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | var. Fassaite | 9.DA.15 | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| ⓘ | Anthophyllite | 9.DD.05 | ◻Mg2Mg5(Si8O22)(OH)2 |
| ⓘ | Cummingtonite | 9.DE.05 | ◻Mg2Mg5(Si8O22)(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Edenite | 9.DE.15 | NaCa2Mg5(Si7Al)O22(OH)2 |
| ⓘ | Ferro-edenite | 9.DE.15 | NaCa2Fe2+5(Si7Al)O22(OH)2 |
| ⓘ | Ferro-pargasite | 9.DE.15 | NaCa2(Fe2+4Al)(Si6Al2)O22(OH)2 |
| ⓘ | Pargasite | 9.DE.15 | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| ⓘ | Arfvedsonite | 9.DE.25 | NaNa2(Fe2+4Fe3+)Si8O22(OH)2 |
| ⓘ | Sapphirine | 9.DH.45 | Mg4(Mg3Al9)O4[Si3Al9O36] |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite var. Fuchsite | 9.EC.15 | K(Al,Cr)3Si3O10(OH)2 |
| ⓘ | var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Paragonite | 9.EC.15 | NaAl2(AlSi3O10)(OH)2 |
| ⓘ | Muscovite var. Phengite | 9.EC.15 | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Vermiculite | 9.EC.50 | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| ⓘ | Chamosite | 9.EC.55 | Fe2+5Al(AlSi3O10)(OH)8 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Sudoite | 9.EC.55 | Mg2Al3(AlSi3O10)(OH)8 |
| ⓘ | Clinochlore var. Pennine | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | var. Penninite | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Dickite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Hisingerite | 9.ED.10 | Fe3+2(Si2O5)(OH)4 · 2H2O |
| ⓘ | Sepiolite | 9.EE.25 | Mg4(Si6O15)(OH)2 · 6H2O |
| ⓘ | Microcline var. Amazonite | 9.FA.30 | K(AlSi3O8) |
| ⓘ | var. Hyalophane | 9.FA.30 | (K,Ba)[Al(Si,Al)Si2O8] |
| ⓘ | 9.FA.30 | K(AlSi3O8) | |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Andesine | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | Albite var. Anorthoclase | 9.FA.35 | (Na,K)AlSi3O8 |
| ⓘ | Anorthite var. Labradorite | 9.FA.35 | (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ | Marialite | 9.FB.15 | Na4Al3Si9O24Cl |
| ⓘ | Analcime | 9.GB.05 | Na(AlSi2O6) · H2O |
| ⓘ | Harmotome | 9.GC.10 | Ba2(Si12Al4)O32 · 12H2O |
| Unclassified | |||
| ⓘ | 'Alkali Feldspar' | - | |
| ⓘ | 'Alum Group' | - | XAl(SO4)2 · 12H2O |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Andesine-oligoclase' | - | |
| ⓘ | 'Bastnäsite' | - | (Ce/Nd/Y/REE)(CO3)F |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Clay minerals' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Gummite' | - | |
| ⓘ | 'Calcium Amphibole Subgroup var. Hornblende' | - | AnCa2(Z2+5-mZ3+m)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| ⓘ | 'Lepidolite' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Pyrobitumen var. Thucholite' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Leucoxene' | - | |
| ⓘ | 'Xenotime' | - | |
| ⓘ | 'Feldspar Group var. Perthite' | - | |
| ⓘ | 'Clinopyroxene Subgroup' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Geikielite-Ilmenite Series' | - | |
| ⓘ | 'Melonite-Merenskyite Series' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Pinite' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Columbite-Tantalite' | - | |
| ⓘ | 'Meteoritic Iron' | - | |
| ⓘ | 'Fergusonite' | - | |
| ⓘ | 'Plessite' | - | |
| ⓘ | 'Orthopyroxene Subgroup' | - | |
| ⓘ | 'Smectite Group' | - | A0.3D2-3[T4O10]Z2 · nH2O |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Copper Stain' | - | |
| ⓘ | 'Glass' | - | |
| ⓘ | 'Protodolomite' | - | (Ca,Mg)CO3 |
| ⓘ | 'Pyrochlore Supergroup' | - | A2-mD2X6-wZ1-n |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Alunite Supergroup' | - | AD3(XO4)2(OH)6 |
| ⓘ | 'Calcium Amphibole Subgroup' | - | AnCa2(C2+5-mC3+m)(Si8-(n+m)Al(n+m))W2 |
| ⓘ | 'Apatite var. Carbonate-rich Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Apatite Group' | - | |
| ⓘ | 'Pyrobitumen' | - | |
| ⓘ | 'Chevkinite Group' | - | |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ | 'White mica' | - | |
| ⓘ | 'UM1978-10-O:U' | - | U3O7 |
| ⓘ | 'Carbonate' | - | |
| ⓘ | 'Glimmerite' | - | |
| ⓘ | 'UM1991-19-Se:AsCo' | - | (Co,Ni)AsSe |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Alum Group | XAl(SO4)2 · 12H2O |
| H | ⓘ Analcime | Na(AlSi2O6) · H2O |
| H | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| H | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| H | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| H | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| H | ⓘ Arsenoflorencite-(Ce) | CeAl3(AsO4)2(OH)6 |
| H | ⓘ Artinite | Mg2(CO3)(OH)2 · 3H2O |
| H | ⓘ Atacamite | Cu2(OH)3Cl |
| H | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Bayleyite | Mg2(UO2)(CO3)3 · 18H2O |
| H | ⓘ Becquerelite | Ca(UO2)6O4(OH)6 · 8H2O |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Bischofite | MgCl2 · 6H2O |
| H | ⓘ Blödite | Na2Mg(SO4)2 · 4H2O |
| H | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| H | ⓘ Boussingaultite | (NH4)2Mg(SO4)2 · 6H2O |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| H | ⓘ Carnallite | KMgCl3 · 6H2O |
| H | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| H | ⓘ Chalcomenite | CuSeO3 · 2H2O |
| H | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinochalcomenite | CuSeO3(H2O)2 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Coffinite | U(SiO4) · nH2O |
| H | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| H | ⓘ Cuprosklodowskite | Cu(UO2)2(SiO3OH)2 · 6H2O |
| H | ⓘ Curite | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| H | ⓘ Dawsonite | NaAlCO3(OH)2 |
| H | ⓘ Despujolsite | Ca3Mn4+(SO4)2(OH)6 · 3H2O |
| H | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Diaspore | AlO(OH) |
| H | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Dypingite | Mg5(CO3)4(OH)2 · 5H2O |
| H | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Epsomite | MgSO4 · 7H2O |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Eugsterite | Na4Ca(SO4)3 · 2H2O |
| H | ⓘ Ferro-edenite | NaCa2Fe52+(Si7Al)O22(OH)2 |
| H | ⓘ Ferro-pargasite | NaCa2(Fe42+Al)(Si6Al2)O22(OH)2 |
| H | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| H | ⓘ Foggite | CaAl(PO4)(OH)2 · H2O |
| H | ⓘ Fourmarierite | Pb(UO2)4O3(OH)4 · 4H2O |
| H | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| H | ⓘ Gaylussite | Na2Ca(CO3)2 · 5H2O |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Görgeyite | K2Ca5(SO4)6 · H2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Haiweeite | Ca(UO2)2[Si5O12(OH)2] · 6H2O |
| H | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| H | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| H | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| H | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| H | ⓘ Hydroglauberite | Na10Ca3(SO4)8 · 6H2O |
| H | ⓘ Hydrohalite | NaCl · 2H2O |
| H | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| H | ⓘ Hannebachite | CaSO3 · H2O |
| H | ⓘ Ikaite | CaCO3 · 6H2O |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Inderborite | CaMg(H3B3O7)2 · 8H2O |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kainite | KMg(SO4)Cl · 3H2O |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| H | ⓘ Kieserite | MgSO4 · H2O |
| H | ⓘ Korshunovskite | Mg2Cl(OH)3 · 4H2O |
| H | ⓘ Krausite | KFe(SO4)2 · H2O |
| H | ⓘ Koenenite | Na4Mg9Al4Cl12(OH)22 |
| H | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| H | ⓘ Liebigite | Ca2(UO2)(CO3)3 · 11H2O |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Masuyite | Pb(UO2)3O3(OH)2 · 3H2O |
| H | ⓘ Mercallite | KHSO4 |
| H | ⓘ Meta-aluminite | Al2(SO4)(OH)4 · 5H2O |
| H | ⓘ Metanováčekite | Mg(UO2)2(AsO4)2 · 8H2O |
| H | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| H | ⓘ Mirabilite | Na2SO4 · 10H2O |
| H | ⓘ Mohrite | (NH4)2Fe(SO4)2 · 6H2O |
| H | ⓘ Monohydrocalcite | CaCO3 · H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Nahcolite | NaHCO3 |
| H | ⓘ Natron | Na2CO3 · 10H2O |
| H | ⓘ Nolanite | V83+Fe23+O14(OH)2 |
| H | ⓘ Nordstrandite | Al(OH)3 |
| H | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| H | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| H | ⓘ Pentahydrite | MgSO4 · 5H2O |
| H | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Pirssonite | Na2Ca(CO3)2 · 2H2O |
| H | ⓘ Polyhalite | K2Ca2Mg(SO4)4 · 2H2O |
| H | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| H | ⓘ Rapidcreekite | Ca2(SO4)(CO3) · 4H2O |
| H | ⓘ Rhomboclase | (H5O2)Fe3+(SO4)2 · 2H2O |
| H | ⓘ Retgersite | NiSO4 · 6H2O |
| H | ⓘ Scarbroite | Al5(CO3)(OH)13 · 5H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| H | ⓘ Sklodowskite | Mg(UO2)2(SiO3OH)2 · 6H2O |
| H | ⓘ Starkeyite | MgSO4 · 4H2O |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Sudoite | Mg2Al3(AlSi3O10)(OH)8 |
| H | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| H | ⓘ Syngenite | K2Ca(SO4)2 · H2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Trona | Na3H(CO3)2 · 2H2O |
| H | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| H | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| H | ⓘ Uranopilite | (UO2)6(SO4)O2(OH)6 · 14H2O |
| H | ⓘ Vandendriesscheite | PbU7O22 · 12H2O |
| H | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| H | ⓘ Wattevilleite | Na2Ca(SO4)2 · 4H2O (?) |
| H | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| H | ⓘ Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| H | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Magnesio-foitite | ◻(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Oxy-dravite | Na(Al2Mg)(Al5Mg)(Si6O18)(BO3)3(OH)3O |
| H | ⓘ Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Clinochlore var. Penninite | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Alunite Supergroup | AD3(XO4)2(OH)6 |
| H | ⓘ Apatite var. Carbonate-rich Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| H | ⓘ Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Inderborite | CaMg(H3B3O7)2 · 8H2O |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| B | ⓘ Magnesio-foitite | ◻(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Oxy-dravite | Na(Al2Mg)(Al5Mg)(Si6O18)(BO3)3(OH)3O |
| B | ⓘ Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Artinite | Mg2(CO3)(OH)2 · 3H2O |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| C | ⓘ Bayleyite | Mg2(UO2)(CO3)3 · 18H2O |
| C | ⓘ Benstonite | Ba6Ca6Mg(CO3)13 |
| C | ⓘ Bradleyite | Na3Mg(CO3)(PO4) |
| C | ⓘ Burkeite | Na6(CO3)(SO4)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| C | ⓘ Dawsonite | NaAlCO3(OH)2 |
| C | ⓘ Diamond | C |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Dypingite | Mg5(CO3)4(OH)2 · 5H2O |
| C | ⓘ Fairchildite | K2Ca(CO3)2 |
| C | ⓘ Gaylussite | Na2Ca(CO3)2 · 5H2O |
| C | ⓘ Graphite | C |
| C | ⓘ Hanksite | Na22K(SO4)9(CO3)2Cl |
| C | ⓘ Huntite | CaMg3(CO3)4 |
| C | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| C | ⓘ Ikaite | CaCO3 · 6H2O |
| C | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| C | ⓘ Liebigite | Ca2(UO2)(CO3)3 · 11H2O |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Monohydrocalcite | CaCO3 · H2O |
| C | ⓘ Nahcolite | NaHCO3 |
| C | ⓘ Natron | Na2CO3 · 10H2O |
| C | ⓘ Northupite | Na3Mg(CO3)2Cl |
| C | ⓘ Pirssonite | Na2Ca(CO3)2 · 2H2O |
| C | ⓘ Rapidcreekite | Ca2(SO4)(CO3) · 4H2O |
| C | ⓘ Rutherfordine | (UO2)CO3 |
| C | ⓘ Scarbroite | Al5(CO3)(OH)13 · 5H2O |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Trona | Na3H(CO3)2 · 2H2O |
| C | ⓘ Tychite | Na6Mg2(CO3)4(SO4) |
| C | ⓘ Zemkorite | Na2Ca(CO3)2 |
| C | ⓘ Protodolomite | (Ca,Mg)CO3 |
| N | Nitrogen | |
| N | ⓘ Boussingaultite | (NH4)2Mg(SO4)2 · 6H2O |
| N | ⓘ Mohrite | (NH4)2Fe(SO4)2 · 6H2O |
| N | ⓘ Nitratine | NaNO3 |
| N | ⓘ Niter | KNO3 |
| N | ⓘ Nitrobarite | Ba(NO3)2 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Alum Group | XAl(SO4)2 · 12H2O |
| O | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Analcime | Na(AlSi2O6) · H2O |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| O | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| O | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Arcanite | K2SO4 |
| O | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| O | ⓘ Arsenoflorencite-(Ce) | CeAl3(AsO4)2(OH)6 |
| O | ⓘ Artinite | Mg2(CO3)(OH)2 · 3H2O |
| O | ⓘ Atacamite | Cu2(OH)3Cl |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Baddeleyite | ZrO2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| O | ⓘ Bayleyite | Mg2(UO2)(CO3)3 · 18H2O |
| O | ⓘ Becquerelite | Ca(UO2)6O4(OH)6 · 8H2O |
| O | ⓘ Benstonite | Ba6Ca6Mg(CO3)13 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bischofite | MgCl2 · 6H2O |
| O | ⓘ Blödite | Na2Mg(SO4)2 · 4H2O |
| O | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| O | ⓘ Boussingaultite | (NH4)2Mg(SO4)2 · 6H2O |
| O | ⓘ Bradleyite | Na3Mg(CO3)(PO4) |
| O | ⓘ Brannerite | UTi2O6 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Burkeite | Na6(CO3)(SO4)2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| O | ⓘ Carnallite | KMgCl3 · 6H2O |
| O | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| O | ⓘ Chalcomenite | CuSeO3 · 2H2O |
| O | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| O | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Clinochalcomenite | CuSeO3(H2O)2 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Coffinite | U(SiO4) · nH2O |
| O | ⓘ Cordierite | Mg2Al4Si5O18 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Cristobalite | SiO2 |
| O | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| O | ⓘ Cuprosklodowskite | Cu(UO2)2(SiO3OH)2 · 6H2O |
| O | ⓘ Curite | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| O | ⓘ D'Ansite | Na21Mg(SO4)10Cl3 |
| O | ⓘ Dawsonite | NaAlCO3(OH)2 |
| O | ⓘ Despujolsite | Ca3Mn4+(SO4)2(OH)6 · 3H2O |
| O | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Diaspore | AlO(OH) |
| O | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Dypingite | Mg5(CO3)4(OH)2 · 5H2O |
| O | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| O | ⓘ Enstatite | Mg2Si2O6 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Epsomite | MgSO4 · 7H2O |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Eugsterite | Na4Ca(SO4)3 · 2H2O |
| O | ⓘ Fairchildite | K2Ca(CO3)2 |
| O | ⓘ Farringtonite | Mg3(PO4)2 |
| O | ⓘ Ferro-edenite | NaCa2Fe52+(Si7Al)O22(OH)2 |
| O | ⓘ Ferro-pargasite | NaCa2(Fe42+Al)(Si6Al2)O22(OH)2 |
| O | ⓘ Ferrosilite | Fe22+Si2O6 |
| O | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Foggite | CaAl(PO4)(OH)2 · H2O |
| O | ⓘ Forsterite | Mg2(SiO4) |
| O | ⓘ Fourmarierite | Pb(UO2)4O3(OH)4 · 4H2O |
| O | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| O | ⓘ Gahnite | ZnAl2O4 |
| O | ⓘ Gaylussite | Na2Ca(CO3)2 · 5H2O |
| O | ⓘ Glauberite | Na2Ca(SO4)2 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Görgeyite | K2Ca5(SO4)6 · H2O |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Haiweeite | Ca(UO2)2[Si5O12(OH)2] · 6H2O |
| O | ⓘ Hanksite | Na22K(SO4)9(CO3)2Cl |
| O | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| O | ⓘ Hedenbergite | CaFe2+Si2O6 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hercynite | Fe2+Al2O4 |
| O | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| O | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| O | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| O | ⓘ Huntite | CaMg3(CO3)4 |
| O | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| O | ⓘ Hydroglauberite | Na10Ca3(SO4)8 · 6H2O |
| O | ⓘ Hydrohalite | NaCl · 2H2O |
| O | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| O | ⓘ Hannebachite | CaSO3 · H2O |
| O | ⓘ Ikaite | CaCO3 · 6H2O |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Inderborite | CaMg(H3B3O7)2 · 8H2O |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kainite | KMg(SO4)Cl · 3H2O |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| O | ⓘ Kieserite | MgSO4 · H2O |
| O | ⓘ Korshunovskite | Mg2Cl(OH)3 · 4H2O |
| O | ⓘ Krausite | KFe(SO4)2 · H2O |
| O | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Koenenite | Na4Mg9Al4Cl12(OH)22 |
| O | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| O | ⓘ Lechatelierite | SiO2 |
| O | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| O | ⓘ Liebigite | Ca2(UO2)(CO3)3 · 11H2O |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Majorite | Mg3(MgSi)(SiO4)3 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Marialite | Na4Al3Si9O24Cl |
| O | ⓘ Masuyite | Pb(UO2)3O3(OH)2 · 3H2O |
| O | ⓘ Mercallite | KHSO4 |
| O | ⓘ Meta-aluminite | Al2(SO4)(OH)4 · 5H2O |
| O | ⓘ Metanováčekite | Mg(UO2)2(AsO4)2 · 8H2O |
| O | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Mirabilite | Na2SO4 · 10H2O |
| O | ⓘ Molybdomenite | PbSeO3 |
| O | ⓘ Mohrite | (NH4)2Fe(SO4)2 · 6H2O |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Monohydrocalcite | CaCO3 · H2O |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Nahcolite | NaHCO3 |
| O | ⓘ Natron | Na2CO3 · 10H2O |
| O | ⓘ Nitratine | NaNO3 |
| O | ⓘ Niter | KNO3 |
| O | ⓘ Nitrobarite | Ba(NO3)2 |
| O | ⓘ Nolanite | V83+Fe23+O14(OH)2 |
| O | ⓘ Nordstrandite | Al(OH)3 |
| O | ⓘ Northupite | Na3Mg(CO3)2Cl |
| O | ⓘ Olsacherite | Pb2(Se6+O4)(SO4) |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| O | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| O | ⓘ Pentahydrite | MgSO4 · 5H2O |
| O | ⓘ Perrierite-(Ce) | Ce4MgFe23+Ti2(Si2O7)2O8 |
| O | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Pirssonite | Na2Ca(CO3)2 · 2H2O |
| O | ⓘ Uraninite var. Pitchblende | UO2 |
| O | ⓘ Polyhalite | K2Ca2Mg(SO4)4 · 2H2O |
| O | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| O | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rapidcreekite | Ca2(SO4)(CO3) · 4H2O |
| O | ⓘ Rhomboclase | (H5O2)Fe3+(SO4)2 · 2H2O |
| O | ⓘ Ringwoodite | (Mg,Fe2+)2SiO4 |
| O | ⓘ Rutherfordine | (UO2)CO3 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Retgersite | NiSO4 · 6H2O |
| O | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| O | ⓘ Scarbroite | Al5(CO3)(OH)13 · 5H2O |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Sklodowskite | Mg(UO2)2(SiO3OH)2 · 6H2O |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Stanfieldite | Ca4Mg5(PO4)6 |
| O | ⓘ Starkeyite | MgSO4 · 4H2O |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Sudoite | Mg2Al3(AlSi3O10)(OH)8 |
| O | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| O | ⓘ Syngenite | K2Ca(SO4)2 · H2O |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Thénardite | Na2SO4 |
| O | ⓘ Thorite | Th(SiO4) |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Trona | Na3H(CO3)2 · 2H2O |
| O | ⓘ Tychite | Na6Mg2(CO3)4(SO4) |
| O | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| O | ⓘ Ulvöspinel | TiFe22+O4 |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| O | ⓘ Uranopilite | (UO2)6(SO4)O2(OH)6 · 14H2O |
| O | ⓘ Vandendriesscheite | PbU7O22 · 12H2O |
| O | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| O | ⓘ Wattevilleite | Na2Ca(SO4)2 · 4H2O (?) |
| O | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| O | ⓘ Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Zemkorite | Na2Ca(CO3)2 |
| O | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Hematite var. Specularite | Fe2O3 |
| O | ⓘ Sillimanite var. Fibrolite | Al2(SiO4)O |
| O | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| O | ⓘ Magnesio-foitite | ◻(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Thorite var. Uranothorite | (Th,U)SiO4 |
| O | ⓘ Fayalite-Forsterite Series | |
| O | ⓘ Geikielite-Ilmenite Series | |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Rutile var. Niobium-bearing Rutile | (Ti,Nb)O2 |
| O | ⓘ Oxy-dravite | Na(Al2Mg)(Al5Mg)(Si6O18)(BO3)3(OH)3O |
| O | ⓘ Augite var. Fassaite | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| O | ⓘ Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Quartz var. Blue Quartz | SiO2 |
| O | ⓘ Protodolomite | (Ca,Mg)CO3 |
| O | ⓘ Clinochlore var. Penninite | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Alunite Supergroup | AD3(XO4)2(OH)6 |
| O | ⓘ Apatite var. Carbonate-rich Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| O | ⓘ Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| O | ⓘ UM1978-10-O:U | U3O7 |
| F | Fluorine | |
| F | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| F | ⓘ Apatite var. Carbonate-rich Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Na | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| Na | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| Na | ⓘ Blödite | Na2Mg(SO4)2 · 4H2O |
| Na | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| Na | ⓘ Bradleyite | Na3Mg(CO3)(PO4) |
| Na | ⓘ Burkeite | Na6(CO3)(SO4)2 |
| Na | ⓘ D'Ansite | Na21Mg(SO4)10Cl3 |
| Na | ⓘ Dawsonite | NaAlCO3(OH)2 |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Na | ⓘ Eugsterite | Na4Ca(SO4)3 · 2H2O |
| Na | ⓘ Ferro-edenite | NaCa2Fe52+(Si7Al)O22(OH)2 |
| Na | ⓘ Ferro-pargasite | NaCa2(Fe42+Al)(Si6Al2)O22(OH)2 |
| Na | ⓘ Gaylussite | Na2Ca(CO3)2 · 5H2O |
| Na | ⓘ Glauberite | Na2Ca(SO4)2 |
| Na | ⓘ Halite | NaCl |
| Na | ⓘ Hanksite | Na22K(SO4)9(CO3)2Cl |
| Na | ⓘ Hydroglauberite | Na10Ca3(SO4)8 · 6H2O |
| Na | ⓘ Hydrohalite | NaCl · 2H2O |
| Na | ⓘ Koenenite | Na4Mg9Al4Cl12(OH)22 |
| Na | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Na | ⓘ Marialite | Na4Al3Si9O24Cl |
| Na | ⓘ Mirabilite | Na2SO4 · 10H2O |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Nahcolite | NaHCO3 |
| Na | ⓘ Natron | Na2CO3 · 10H2O |
| Na | ⓘ Nitratine | NaNO3 |
| Na | ⓘ Northupite | Na3Mg(CO3)2Cl |
| Na | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Na | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Na | ⓘ Pirssonite | Na2Ca(CO3)2 · 2H2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Thénardite | Na2SO4 |
| Na | ⓘ Trona | Na3H(CO3)2 · 2H2O |
| Na | ⓘ Tychite | Na6Mg2(CO3)4(SO4) |
| Na | ⓘ Wattevilleite | Na2Ca(SO4)2 · 4H2O (?) |
| Na | ⓘ Zemkorite | Na2Ca(CO3)2 |
| Na | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | ⓘ Oxy-dravite | Na(Al2Mg)(Al5Mg)(Si6O18)(BO3)3(OH)3O |
| Na | ⓘ Augite var. Fassaite | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| Na | ⓘ Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Artinite | Mg2(CO3)(OH)2 · 3H2O |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Bayleyite | Mg2(UO2)(CO3)3 · 18H2O |
| Mg | ⓘ Benstonite | Ba6Ca6Mg(CO3)13 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Bischofite | MgCl2 · 6H2O |
| Mg | ⓘ Blödite | Na2Mg(SO4)2 · 4H2O |
| Mg | ⓘ Boussingaultite | (NH4)2Mg(SO4)2 · 6H2O |
| Mg | ⓘ Bradleyite | Na3Mg(CO3)(PO4) |
| Mg | ⓘ Carnallite | KMgCl3 · 6H2O |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Cordierite | Mg2Al4Si5O18 |
| Mg | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ D'Ansite | Na21Mg(SO4)10Cl3 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Dypingite | Mg5(CO3)4(OH)2 · 5H2O |
| Mg | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Mg | ⓘ Enstatite | Mg2Si2O6 |
| Mg | ⓘ Epsomite | MgSO4 · 7H2O |
| Mg | ⓘ Farringtonite | Mg3(PO4)2 |
| Mg | ⓘ Forsterite | Mg2(SiO4) |
| Mg | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| Mg | ⓘ Huntite | CaMg3(CO3)4 |
| Mg | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| Mg | ⓘ Inderborite | CaMg(H3B3O7)2 · 8H2O |
| Mg | ⓘ Kainite | KMg(SO4)Cl · 3H2O |
| Mg | ⓘ Kieserite | MgSO4 · H2O |
| Mg | ⓘ Korshunovskite | Mg2Cl(OH)3 · 4H2O |
| Mg | ⓘ Koenenite | Na4Mg9Al4Cl12(OH)22 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Majorite | Mg3(MgSi)(SiO4)3 |
| Mg | ⓘ Metanováčekite | Mg(UO2)2(AsO4)2 · 8H2O |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Northupite | Na3Mg(CO3)2Cl |
| Mg | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Mg | ⓘ Pentahydrite | MgSO4 · 5H2O |
| Mg | ⓘ Perrierite-(Ce) | Ce4MgFe23+Ti2(Si2O7)2O8 |
| Mg | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Polyhalite | K2Ca2Mg(SO4)4 · 2H2O |
| Mg | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Mg | ⓘ Ringwoodite | (Mg,Fe2+)2SiO4 |
| Mg | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| Mg | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Mg | ⓘ Sklodowskite | Mg(UO2)2(SiO3OH)2 · 6H2O |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Stanfieldite | Ca4Mg5(PO4)6 |
| Mg | ⓘ Starkeyite | MgSO4 · 4H2O |
| Mg | ⓘ Sudoite | Mg2Al3(AlSi3O10)(OH)8 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Tychite | Na6Mg2(CO3)4(SO4) |
| Mg | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Mg | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| Mg | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| Mg | ⓘ Magnesio-foitite | ◻(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Fayalite-Forsterite Series | |
| Mg | ⓘ Geikielite-Ilmenite Series | |
| Mg | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Oxy-dravite | Na(Al2Mg)(Al5Mg)(Si6O18)(BO3)3(OH)3O |
| Mg | ⓘ Augite var. Fassaite | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| Mg | ⓘ Protodolomite | (Ca,Mg)CO3 |
| Mg | ⓘ Clinochlore var. Penninite | Mg5Al(AlSi3O10)(OH)8 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Alum Group | XAl(SO4)2 · 12H2O |
| Al | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| Al | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| Al | ⓘ Arsenoflorencite-(Ce) | CeAl3(AsO4)2(OH)6 |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| Al | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Cordierite | Mg2Al4Si5O18 |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Dawsonite | NaAlCO3(OH)2 |
| Al | ⓘ Diaspore | AlO(OH) |
| Al | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Ferro-edenite | NaCa2Fe52+(Si7Al)O22(OH)2 |
| Al | ⓘ Ferro-pargasite | NaCa2(Fe42+Al)(Si6Al2)O22(OH)2 |
| Al | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| Al | ⓘ Foggite | CaAl(PO4)(OH)2 · H2O |
| Al | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Al | ⓘ Gahnite | ZnAl2O4 |
| Al | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Al | ⓘ Hercynite | Fe2+Al2O4 |
| Al | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Al | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Koenenite | Na4Mg9Al4Cl12(OH)22 |
| Al | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Al | ⓘ Marialite | Na4Al3Si9O24Cl |
| Al | ⓘ Meta-aluminite | Al2(SO4)(OH)4 · 5H2O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Nordstrandite | Al(OH)3 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Al | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Al | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| Al | ⓘ Scarbroite | Al5(CO3)(OH)13 · 5H2O |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Sudoite | Mg2Al3(AlSi3O10)(OH)8 |
| Al | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| Al | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Al | ⓘ Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Sillimanite var. Fibrolite | Al2(SiO4)O |
| Al | ⓘ Magnesio-foitite | ◻(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Oxy-dravite | Na(Al2Mg)(Al5Mg)(Si6O18)(BO3)3(OH)3O |
| Al | ⓘ Augite var. Fassaite | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| Al | ⓘ Clinochlore var. Penninite | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Calcium Amphibole Subgroup | AnCa2(C2+5-mCm3+)(Si8-(n+m)Al(n+m))W2 |
| Al | ⓘ Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| Si | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Coffinite | U(SiO4) · nH2O |
| Si | ⓘ Cordierite | Mg2Al4Si5O18 |
| Si | ⓘ Cristobalite | SiO2 |
| Si | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Cuprosklodowskite | Cu(UO2)2(SiO3OH)2 · 6H2O |
| Si | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Si | ⓘ Enstatite | Mg2Si2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Ferro-edenite | NaCa2Fe52+(Si7Al)O22(OH)2 |
| Si | ⓘ Ferro-pargasite | NaCa2(Fe42+Al)(Si6Al2)O22(OH)2 |
| Si | ⓘ Ferrosilite | Fe22+Si2O6 |
| Si | ⓘ Forsterite | Mg2(SiO4) |
| Si | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Si | ⓘ Haiweeite | Ca(UO2)2[Si5O12(OH)2] · 6H2O |
| Si | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Si | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Si | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Si | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Si | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Si | ⓘ Lechatelierite | SiO2 |
| Si | ⓘ Majorite | Mg3(MgSi)(SiO4)3 |
| Si | ⓘ Marialite | Na4Al3Si9O24Cl |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Si | ⓘ Perrierite-(Ce) | Ce4MgFe23+Ti2(Si2O7)2O8 |
| Si | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Ringwoodite | (Mg,Fe2+)2SiO4 |
| Si | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Sklodowskite | Mg(UO2)2(SiO3OH)2 · 6H2O |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Sudoite | Mg2Al3(AlSi3O10)(OH)8 |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Thorite | Th(SiO4) |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Si | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Sillimanite var. Fibrolite | Al2(SiO4)O |
| Si | ⓘ Magnesio-foitite | ◻(Mg2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Thorite var. Uranothorite | (Th,U)SiO4 |
| Si | ⓘ Fayalite-Forsterite Series | |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Oxy-dravite | Na(Al2Mg)(Al5Mg)(Si6O18)(BO3)3(OH)3O |
| Si | ⓘ Augite var. Fassaite | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Quartz var. Blue Quartz | SiO2 |
| Si | ⓘ Clinochlore var. Penninite | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Calcium Amphibole Subgroup | AnCa2(C2+5-mCm3+)(Si8-(n+m)Al(n+m))W2 |
| Si | ⓘ Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | ⓘ Bradleyite | Na3Mg(CO3)(PO4) |
| P | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| P | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Farringtonite | Mg3(PO4)2 |
| P | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Foggite | CaAl(PO4)(OH)2 · H2O |
| P | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Schreibersite | (Fe,Ni)3P |
| P | ⓘ Stanfieldite | Ca4Mg5(PO4)6 |
| P | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| P | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| P | ⓘ Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| P | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| P | ⓘ Apatite | Ca5(PO4)3A |
| P | ⓘ Apatite var. Carbonate-rich Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Alum Group | XAl(SO4)2 · 12H2O |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Arcanite | K2SO4 |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bismutohauchecornite | Ni9Bi2S8 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Blödite | Na2Mg(SO4)2 · 4H2O |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Boussingaultite | (NH4)2Mg(SO4)2 · 6H2O |
| S | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Burkeite | Na6(CO3)(SO4)2 |
| S | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Cosalite | Pb2Bi2S5 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ D'Ansite | Na21Mg(SO4)10Cl3 |
| S | ⓘ Despujolsite | Ca3Mn4+(SO4)2(OH)6 · 3H2O |
| S | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Epsomite | MgSO4 · 7H2O |
| S | ⓘ Eugsterite | Na4Ca(SO4)3 · 2H2O |
| S | ⓘ Galena | PbS |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Glauberite | Na2Ca(SO4)2 |
| S | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| S | ⓘ Görgeyite | K2Ca5(SO4)6 · H2O |
| S | ⓘ Gudmundite | FeSbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Hanksite | Na22K(SO4)9(CO3)2Cl |
| S | ⓘ Hauchecornite | Ni9BiSbS8 |
| S | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| S | ⓘ Hydroglauberite | Na10Ca3(SO4)8 · 6H2O |
| S | ⓘ Hannebachite | CaSO3 · H2O |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Jordisite | MoS2 |
| S | ⓘ Kainite | KMg(SO4)Cl · 3H2O |
| S | ⓘ Kieserite | MgSO4 · H2O |
| S | ⓘ Krausite | KFe(SO4)2 · H2O |
| S | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| S | ⓘ Linnaeite | Co2+Co23+S4 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Mercallite | KHSO4 |
| S | ⓘ Meta-aluminite | Al2(SO4)(OH)4 · 5H2O |
| S | ⓘ Millerite | NiS |
| S | ⓘ Mirabilite | Na2SO4 · 10H2O |
| S | ⓘ Mohrite | (NH4)2Fe(SO4)2 · 6H2O |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Olsacherite | Pb2(Se6+O4)(SO4) |
| S | ⓘ Pentahydrite | MgSO4 · 5H2O |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Polyhalite | K2Ca2Mg(SO4)4 · 2H2O |
| S | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Rapidcreekite | Ca2(SO4)(CO3) · 4H2O |
| S | ⓘ Rhomboclase | (H5O2)Fe3+(SO4)2 · 2H2O |
| S | ⓘ Retgersite | NiSO4 · 6H2O |
| S | ⓘ Siegenite | CoNi2S4 |
| S | ⓘ Smythite | (Fe,Ni)3+xS4 (x=0-0.3) |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Starkeyite | MgSO4 · 4H2O |
| S | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| S | ⓘ Syngenite | K2Ca(SO4)2 · H2O |
| S | ⓘ Tetradymite | Bi2Te2S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Thénardite | Na2SO4 |
| S | ⓘ Troilite | FeS |
| S | ⓘ Tychite | Na6Mg2(CO3)4(SO4) |
| S | ⓘ Ullmannite | NiSbS |
| S | ⓘ Uranopilite | (UO2)6(SO4)O2(OH)6 · 14H2O |
| S | ⓘ Vaesite | NiS2 |
| S | ⓘ Violarite | Fe2+Ni23+S4 |
| S | ⓘ Wattevilleite | Na2Ca(SO4)2 · 4H2O (?) |
| S | ⓘ Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| S | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| S | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| Cl | Chlorine | |
| Cl | ⓘ Atacamite | Cu2(OH)3Cl |
| Cl | ⓘ Bischofite | MgCl2 · 6H2O |
| Cl | ⓘ Carnallite | KMgCl3 · 6H2O |
| Cl | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| Cl | ⓘ D'Ansite | Na21Mg(SO4)10Cl3 |
| Cl | ⓘ Halite | NaCl |
| Cl | ⓘ Hanksite | Na22K(SO4)9(CO3)2Cl |
| Cl | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Cl | ⓘ Hydrohalite | NaCl · 2H2O |
| Cl | ⓘ Kainite | KMg(SO4)Cl · 3H2O |
| Cl | ⓘ Korshunovskite | Mg2Cl(OH)3 · 4H2O |
| Cl | ⓘ Koenenite | Na4Mg9Al4Cl12(OH)22 |
| Cl | ⓘ Marialite | Na4Al3Si9O24Cl |
| Cl | ⓘ Northupite | Na3Mg(CO3)2Cl |
| Cl | ⓘ Sylvite | KCl |
| Cl | ⓘ Apatite var. Carbonate-rich Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| K | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| K | ⓘ Arcanite | K2SO4 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| K | ⓘ Carnallite | KMgCl3 · 6H2O |
| K | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| K | ⓘ Fairchildite | K2Ca(CO3)2 |
| K | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| K | ⓘ Görgeyite | K2Ca5(SO4)6 · H2O |
| K | ⓘ Hanksite | Na22K(SO4)9(CO3)2Cl |
| K | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Kainite | KMg(SO4)Cl · 3H2O |
| K | ⓘ Krausite | KFe(SO4)2 · H2O |
| K | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| K | ⓘ Mercallite | KHSO4 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Niter | KNO3 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Polyhalite | K2Ca2Mg(SO4)4 · 2H2O |
| K | ⓘ Sylvite | KCl |
| K | ⓘ Syngenite | K2Ca(SO4)2 · H2O |
| K | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | ⓘ Becquerelite | Ca(UO2)6O4(OH)6 · 8H2O |
| Ca | ⓘ Benstonite | Ba6Ca6Mg(CO3)13 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Ca | ⓘ Despujolsite | Ca3Mn4+(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Eugsterite | Na4Ca(SO4)3 · 2H2O |
| Ca | ⓘ Fairchildite | K2Ca(CO3)2 |
| Ca | ⓘ Ferro-edenite | NaCa2Fe52+(Si7Al)O22(OH)2 |
| Ca | ⓘ Ferro-pargasite | NaCa2(Fe42+Al)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Foggite | CaAl(PO4)(OH)2 · H2O |
| Ca | ⓘ Gaylussite | Na2Ca(CO3)2 · 5H2O |
| Ca | ⓘ Glauberite | Na2Ca(SO4)2 |
| Ca | ⓘ Görgeyite | K2Ca5(SO4)6 · H2O |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Haiweeite | Ca(UO2)2[Si5O12(OH)2] · 6H2O |
| Ca | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Ca | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Ca | ⓘ Huntite | CaMg3(CO3)4 |
| Ca | ⓘ Hydroglauberite | Na10Ca3(SO4)8 · 6H2O |
| Ca | ⓘ Hannebachite | CaSO3 · H2O |
| Ca | ⓘ Ikaite | CaCO3 · 6H2O |
| Ca | ⓘ Inderborite | CaMg(H3B3O7)2 · 8H2O |
| Ca | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| Ca | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Ca | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| Ca | ⓘ Liebigite | Ca2(UO2)(CO3)3 · 11H2O |
| Ca | ⓘ Monohydrocalcite | CaCO3 · H2O |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Pirssonite | Na2Ca(CO3)2 · 2H2O |
| Ca | ⓘ Polyhalite | K2Ca2Mg(SO4)4 · 2H2O |
| Ca | ⓘ Rapidcreekite | Ca2(SO4)(CO3) · 4H2O |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Stanfieldite | Ca4Mg5(PO4)6 |
| Ca | ⓘ Syngenite | K2Ca(SO4)2 · H2O |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| Ca | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Ca | ⓘ Wattevilleite | Na2Ca(SO4)2 · 4H2O (?) |
| Ca | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| Ca | ⓘ Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| Ca | ⓘ Zemkorite | Na2Ca(CO3)2 |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Augite var. Fassaite | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| Ca | ⓘ Protodolomite | (Ca,Mg)CO3 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ca | ⓘ Calcium Amphibole Subgroup | AnCa2(C2+5-mCm3+)(Si8-(n+m)Al(n+m))W2 |
| Ca | ⓘ Apatite var. Carbonate-rich Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brannerite | UTi2O6 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Perrierite-(Ce) | Ce4MgFe23+Ti2(Si2O7)2O8 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Ti | ⓘ Ulvöspinel | TiFe22+O4 |
| Ti | ⓘ Geikielite-Ilmenite Series | |
| Ti | ⓘ Rutile var. Niobium-bearing Rutile | (Ti,Nb)O2 |
| Ti | ⓘ Augite var. Fassaite | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| V | Vanadium | |
| V | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| V | ⓘ Nolanite | V83+Fe23+O14(OH)2 |
| V | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Mn | Manganese | |
| Mn | ⓘ Despujolsite | Ca3Mn4+(SO4)2(OH)6 · 3H2O |
| Mn | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Eskebornite | CuFeSe2 |
| Fe | ⓘ Ferro-edenite | NaCa2Fe52+(Si7Al)O22(OH)2 |
| Fe | ⓘ Ferro-pargasite | NaCa2(Fe42+Al)(Si6Al2)O22(OH)2 |
| Fe | ⓘ Ferrosilite | Fe22+Si2O6 |
| Fe | ⓘ Frohbergite | FeTe2 |
| Fe | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Gudmundite | FeSbS |
| Fe | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hercynite | Fe2+Al2O4 |
| Fe | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Native Iron | Fe |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Native Iron var. Kamacite | (Fe,Ni) |
| Fe | ⓘ Krausite | KFe(SO4)2 · H2O |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Mohrite | (NH4)2Fe(SO4)2 · 6H2O |
| Fe | ⓘ Nolanite | V83+Fe23+O14(OH)2 |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Perrierite-(Ce) | Ce4MgFe23+Ti2(Si2O7)2O8 |
| Fe | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Rhomboclase | (H5O2)Fe3+(SO4)2 · 2H2O |
| Fe | ⓘ Ringwoodite | (Mg,Fe2+)2SiO4 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Schreibersite | (Fe,Ni)3P |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Smythite | (Fe,Ni)3+xS4 (x=0-0.3) |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Taenite | (Ni,Fe) |
| Fe | ⓘ Troilite | FeS |
| Fe | ⓘ Ulvöspinel | TiFe22+O4 |
| Fe | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Fe | ⓘ Violarite | Fe2+Ni23+S4 |
| Fe | ⓘ Hematite var. Specularite | Fe2O3 |
| Fe | ⓘ Fayalite-Forsterite Series | |
| Fe | ⓘ Geikielite-Ilmenite Series | |
| Fe | ⓘ Augite var. Fassaite | (Ca,Na)(Mg,Fe2+,Al,Fe3+,Ti)[(Si,Al)2O6] |
| Fe | ⓘ Oxy-schorl | Na(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3O |
| Co | Cobalt | |
| Co | ⓘ Bornhardtite | Co2+Co23+Se4 |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Co | ⓘ Freboldite | CoSe |
| Co | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Co | ⓘ Linnaeite | Co2+Co23+S4 |
| Co | ⓘ Siegenite | CoNi2S4 |
| Co | ⓘ Skutterudite | CoAs3 |
| Co | ⓘ Tyrrellite | Cu(Co,Ni)2Se4 |
| Co | ⓘ UM1991-19-Se:AsCo | (Co,Ni)AsSe |
| Ni | Nickel | |
| Ni | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| Ni | ⓘ Bismutohauchecornite | Ni9Bi2S8 |
| Ni | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Hauchecornite | Ni9BiSbS8 |
| Ni | ⓘ Jolliffeite | NiAsSe |
| Ni | ⓘ Native Iron var. Kamacite | (Fe,Ni) |
| Ni | ⓘ Maucherite | Ni11As8 |
| Ni | ⓘ Melonite | NiTe2 |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Nickeline | NiAs |
| Ni | ⓘ Pararammelsbergite | NiAs2 |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Rammelsbergite | NiAs2 |
| Ni | ⓘ Retgersite | NiSO4 · 6H2O |
| Ni | ⓘ Schreibersite | (Fe,Ni)3P |
| Ni | ⓘ Siegenite | CoNi2S4 |
| Ni | ⓘ Smythite | (Fe,Ni)3+xS4 (x=0-0.3) |
| Ni | ⓘ Taenite | (Ni,Fe) |
| Ni | ⓘ Tyrrellite | Cu(Co,Ni)2Se4 |
| Ni | ⓘ Ullmannite | NiSbS |
| Ni | ⓘ Vaesite | NiS2 |
| Ni | ⓘ Violarite | Fe2+Ni23+S4 |
| Ni | ⓘ Melonite-Merenskyite Series | |
| Ni | ⓘ UM1991-19-Se:AsCo | (Co,Ni)AsSe |
| Cu | Copper | |
| Cu | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| Cu | ⓘ Atacamite | Cu2(OH)3Cl |
| Cu | ⓘ Athabascaite | Cu5Se4 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Berzelianite | Cu2-xSe (x ≈ 0.12) |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| Cu | ⓘ Chalcomenite | CuSeO3 · 2H2O |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Clinochalcomenite | CuSeO3(H2O)2 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Crookesite | Cu7(Tl, Ag)Se4 |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Cuprosklodowskite | Cu(UO2)2(SiO3OH)2 · 6H2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Eskebornite | CuFeSe2 |
| Cu | ⓘ Eucairite | AgCuSe |
| Cu | ⓘ Klockmannite | CuSe |
| Cu | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| Cu | ⓘ Oosterboschite | (Pd,Cu)7Se5 |
| Cu | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Cu | ⓘ Tyrrellite | Cu(Co,Ni)2Se4 |
| Cu | ⓘ Umangite | Cu3Se2 |
| Cu | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| Zn | Zinc | |
| Zn | ⓘ Gahnite | ZnAl2O4 |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Arsenoflorencite-(Ce) | CeAl3(AsO4)2(OH)6 |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| As | ⓘ Jolliffeite | NiAsSe |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Maucherite | Ni11As8 |
| As | ⓘ Mertieite | Pd8Sb2.5As0.5 |
| As | ⓘ Metanováčekite | Mg(UO2)2(AsO4)2 · 8H2O |
| As | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| As | ⓘ Nickeline | NiAs |
| As | ⓘ Pararammelsbergite | NiAs2 |
| As | ⓘ Rammelsbergite | NiAs2 |
| As | ⓘ Skutterudite | CoAs3 |
| As | ⓘ Sperrylite | PtAs2 |
| As | ⓘ UM1991-19-Se:AsCo | (Co,Ni)AsSe |
| Se | Selenium | |
| Se | ⓘ Athabascaite | Cu5Se4 |
| Se | ⓘ Berzelianite | Cu2-xSe (x ≈ 0.12) |
| Se | ⓘ Bornhardtite | Co2+Co23+Se4 |
| Se | ⓘ Chalcomenite | CuSeO3 · 2H2O |
| Se | ⓘ Clausthalite | PbSe |
| Se | ⓘ Clinochalcomenite | CuSeO3(H2O)2 |
| Se | ⓘ Crookesite | Cu7(Tl, Ag)Se4 |
| Se | ⓘ Eskebornite | CuFeSe2 |
| Se | ⓘ Eucairite | AgCuSe |
| Se | ⓘ Freboldite | CoSe |
| Se | ⓘ Guanajuatite | Bi2Se3 |
| Se | ⓘ Jolliffeite | NiAsSe |
| Se | ⓘ Klockmannite | CuSe |
| Se | ⓘ Molybdomenite | PbSeO3 |
| Se | ⓘ Olsacherite | Pb2(Se6+O4)(SO4) |
| Se | ⓘ Oosterboschite | (Pd,Cu)7Se5 |
| Se | ⓘ Paraguanajuatite | Bi2Se3 |
| Se | ⓘ Native Selenium | Se |
| Se | ⓘ Tiemannite | HgSe |
| Se | ⓘ Tyrrellite | Cu(Co,Ni)2Se4 |
| Se | ⓘ Umangite | Cu3Se2 |
| Se | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| Se | ⓘ UM1991-19-Se:AsCo | (Co,Ni)AsSe |
| Sr | Strontium | |
| Sr | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| Sr | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| Y | Yttrium | |
| Y | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Zr | Zirconium | |
| Zr | ⓘ Baddeleyite | ZrO2 |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Rutile var. Niobium-bearing Rutile | (Ti,Nb)O2 |
| Mo | Molybdenum | |
| Mo | ⓘ Jordisite | MoS2 |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Pd | Palladium | |
| Pd | ⓘ Froodite | α-PdBi2 |
| Pd | ⓘ Kotulskite | Pd(Te,Bi)2-x (x ≈ 0.4) |
| Pd | ⓘ Mertieite | Pd8Sb2.5As0.5 |
| Pd | ⓘ Michenerite | PdBiTe |
| Pd | ⓘ Oosterboschite | (Pd,Cu)7Se5 |
| Pd | ⓘ Stibiopalladinite | Pd5Sb2 |
| Pd | ⓘ Melonite-Merenskyite Series | |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Crookesite | Cu7(Tl, Ag)Se4 |
| Ag | ⓘ Dyscrasite | Ag3Sb |
| Ag | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Ag | ⓘ Eucairite | AgCuSe |
| Ag | ⓘ Native Silver | Ag |
| Sn | Tin | |
| Sn | ⓘ Native Tin | Sn |
| Sb | Antimony | |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Dyscrasite | Ag3Sb |
| Sb | ⓘ Gudmundite | FeSbS |
| Sb | ⓘ Hauchecornite | Ni9BiSbS8 |
| Sb | ⓘ Mertieite | Pd8Sb2.5As0.5 |
| Sb | ⓘ Stibiopalladinite | Pd5Sb2 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Ullmannite | NiSbS |
| Te | Tellurium | |
| Te | ⓘ Altaite | PbTe |
| Te | ⓘ Calaverite | AuTe2 |
| Te | ⓘ Coloradoite | HgTe |
| Te | ⓘ Frohbergite | FeTe2 |
| Te | ⓘ Kotulskite | Pd(Te,Bi)2-x (x ≈ 0.4) |
| Te | ⓘ Melonite | NiTe2 |
| Te | ⓘ Michenerite | PdBiTe |
| Te | ⓘ Native Tellurium | Te |
| Te | ⓘ Tellurobismuthite | Bi2Te3 |
| Te | ⓘ Tetradymite | Bi2Te2S |
| Te | ⓘ Melonite-Merenskyite Series | |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Benstonite | Ba6Ca6Mg(CO3)13 |
| Ba | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Ba | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Ba | ⓘ Nitrobarite | Ba(NO3)2 |
| Ce | Cerium | |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ce | ⓘ Arsenoflorencite-(Ce) | CeAl3(AsO4)2(OH)6 |
| Ce | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Ce | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| Ce | ⓘ Perrierite-(Ce) | Ce4MgFe23+Ti2(Si2O7)2O8 |
| Nd | Neodymium | |
| Nd | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Pt | Platinum | |
| Pt | ⓘ Sperrylite | PtAs2 |
| Au | Gold | |
| Au | ⓘ Calaverite | AuTe2 |
| Au | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Au | ⓘ Native Gold | Au |
| Hg | Mercury | |
| Hg | ⓘ Coloradoite | HgTe |
| Hg | ⓘ Tiemannite | HgSe |
| Tl | Thallium | |
| Tl | ⓘ Crookesite | Cu7(Tl, Ag)Se4 |
| Pb | Lead | |
| Pb | ⓘ Altaite | PbTe |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Clausthalite | PbSe |
| Pb | ⓘ Cosalite | Pb2Bi2S5 |
| Pb | ⓘ Curite | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| Pb | ⓘ Fourmarierite | Pb(UO2)4O3(OH)4 · 4H2O |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| Pb | ⓘ Masuyite | Pb(UO2)3O3(OH)2 · 3H2O |
| Pb | ⓘ Molybdomenite | PbSeO3 |
| Pb | ⓘ Olsacherite | Pb2(Se6+O4)(SO4) |
| Pb | ⓘ Vandendriesscheite | PbU7O22 · 12H2O |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| Bi | Bismuth | |
| Bi | ⓘ Bismutohauchecornite | Ni9Bi2S8 |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Cosalite | Pb2Bi2S5 |
| Bi | ⓘ Froodite | α-PdBi2 |
| Bi | ⓘ Guanajuatite | Bi2Se3 |
| Bi | ⓘ Hauchecornite | Ni9BiSbS8 |
| Bi | ⓘ Kotulskite | Pd(Te,Bi)2-x (x ≈ 0.4) |
| Bi | ⓘ Michenerite | PdBiTe |
| Bi | ⓘ Paraguanajuatite | Bi2Se3 |
| Bi | ⓘ Tellurobismuthite | Bi2Te3 |
| Bi | ⓘ Tetradymite | Bi2Te2S |
| Th | Thorium | |
| Th | ⓘ Thorite | Th(SiO4) |
| Th | ⓘ Thorite var. Uranothorite | (Th,U)SiO4 |
| U | Uranium | |
| U | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | ⓘ Bayleyite | Mg2(UO2)(CO3)3 · 18H2O |
| U | ⓘ Becquerelite | Ca(UO2)6O4(OH)6 · 8H2O |
| U | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| U | ⓘ Brannerite | UTi2O6 |
| U | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| U | ⓘ Coffinite | U(SiO4) · nH2O |
| U | ⓘ Cuprosklodowskite | Cu(UO2)2(SiO3OH)2 · 6H2O |
| U | ⓘ Curite | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| U | ⓘ Fourmarierite | Pb(UO2)4O3(OH)4 · 4H2O |
| U | ⓘ Haiweeite | Ca(UO2)2[Si5O12(OH)2] · 6H2O |
| U | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| U | ⓘ Liebigite | Ca2(UO2)(CO3)3 · 11H2O |
| U | ⓘ Masuyite | Pb(UO2)3O3(OH)2 · 3H2O |
| U | ⓘ Metanováčekite | Mg(UO2)2(AsO4)2 · 8H2O |
| U | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| U | ⓘ Uraninite var. Pitchblende | UO2 |
| U | ⓘ Rutherfordine | (UO2)CO3 |
| U | ⓘ Sklodowskite | Mg(UO2)2(SiO3OH)2 · 6H2O |
| U | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| U | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| U | ⓘ Uranopilite | (UO2)6(SO4)O2(OH)6 · 14H2O |
| U | ⓘ Vandendriesscheite | PbU7O22 · 12H2O |
| U | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| U | ⓘ Thorite var. Uranothorite | (Th,U)SiO4 |
| U | ⓘ UM1978-10-O:U | U3O7 |
Fossils
There are 1797 fossil localities from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 1797 |
|---|---|
| Youngest Fossil Listed | 0.01 Ma (Pleistocene) |
| Oldest Fossil Listed | 501 Ma (Cambrian) |
| Stratigraphic Units | Click here to view 42 stratigraphic units. |
| Fossils from Region | Click here to show the list. |
| Fossil Localities | Click to show 91 fossil localities |
- Saskatchewan
- Paleogene🐚 "4 miles above east end of Post Office"
- Pleistocene🐚 63rd Street
- Cenozoic🐚 Anxiety Butte
- Late/Upper Cretaceous🐚 Bainbridge River Bonebed
- Late/Upper Cretaceous🐚 Bearpaw Fm
- Paleocene🐚 Big Muddy 2
- Paleogene🐚 Blumenort
- Paleogene🐚 Calf Creek
- Paleogene🐚 Calf Creek bird locality
- Paleogene🐚 Carnagh
- Late/Upper Cretaceous🐚 Carrot River
- Late/Upper Cretaceous🐚 Carrot River Bonebed
- Cambrian🐚 Ceepee Reward Well
- Late/Upper Cretaceous🐚 Eastend "Scotty" site
- Pleistocene🐚 Fort Qu'Appelle
- Miocene🐚 Four Courners
- Phanerozoic🐚 Fr-1
- Paleocene🐚 French Fry
- Late/Upper Cretaceous🐚 Glen McPherson
- Late/Upper Cretaceous🐚 Grasslands National Park
- Late/Upper Cretaceous🐚 Gryde locality
- Late/Upper Cretaceous🐚 GSC Loc. 10374
- Late/Upper Cretaceous🐚 GSC Loc. 10375
- Late/Upper Cretaceous🐚 GSC Loc. 10395
- Late/Upper Cretaceous🐚 GSC Loc. 10407
- Late/Upper Cretaceous🐚 GSC Loc. 10437
- Late/Upper Cretaceous🐚 GSC Loc. 16313
- Late/Upper Cretaceous🐚 GSC Loc. 16325
- Late/Upper Cretaceous🐚 GSC Loc. 16326
- Late/Upper Cretaceous🐚 GSC Loc. 17882
- Late/Upper Cretaceous🐚 GSC Loc. 97990
- Late/Upper Cretaceous🐚 GSC Loc. 97995
- Late/Upper Cretaceous🐚 GSC Loc. 98003
- Paleocene🐚 Harptree 8
- Late/Upper Cretaceous🐚 Herbert Ferry
- Paleogene🐚 Irish Spring
- Paleocene🐚 Joffre Bridge Road Cut Fish Layer
- Late/Upper Cretaceous🐚 kaolin quarry
- Cenozoic🐚 Kealey Springs West
- Late/Upper Cretaceous🐚 Killdeer Badlands
- Late/Upper Cretaceous🐚 KJ87112
- Miocene🐚 Kleinfelder Farm
- Paleocene🐚 Knollys
- Eocene🐚 Lac Pelletier Lower Fauna
- Saskatchewan
- Phanerozoic🐚 Long Fall Horizon
- Late/Upper Cretaceous🐚 Medalta pit
- Late/Upper Cretaceous🐚 Morgan Creek
- Late/Upper Cretaceous🐚 Morgan Creek
- Pleistocene🐚 Muskox Pit
- Late/Upper Cretaceous🐚 Near Herschel
- Late/Upper Cretaceous🐚 north of Stewart Valley
- Late/Upper Cretaceous🐚 north side
- Paleozoic🐚 Northeastern Manitoba
- Late/Upper Cretaceous🐚 Notukeu Creek
- Late/Upper Cretaceous🐚 Notukeu Creek [Bearpaw Fm]
- Late/Upper Cretaceous🐚 Old Man
- Late/Upper Cretaceous🐚 Outlook ["Belly River Fm"]
- Paleocene🐚 Pine Cree Park
- Pleistocene🐚 Riddell
- Paleocene🐚 Roche Percée
- Miocene🐚 Rockglen
- Phanerozoic🐚 Rocky Creek plants
- Devonian🐚 SE EPB EPF
- Paleozoic🐚 Shamattawa Limestone Cephalopods
- Paleogene🐚 Simmie
- Late/Upper Cretaceous🐚 SMNH Frenchman River
- Miocene🐚 South of Fir Mountain
- Late/Upper Cretaceous🐚 south of Shaunavon
- Late/Upper Cretaceous🐚 South Saskatchewan River
- Late/Upper Cretaceous🐚 south side
- Paleocene🐚 Southeast of Montague Lake
- Cretaceous🐚 Southern Saskatchewan
- Paleozoic🐚 Stony Mountain Formation
- Pleistocene🐚 Sutherland Pit
- Eocene🐚 Swift Current Creek
- Miocene🐚 Topham
- Late/Upper Cretaceous🐚 Unity
- Paleocene🐚 US4
- Paleocene🐚 Vicinity of Estevan and Roche Percee
- Miocene🐚 West of Conglomerate Creek
- Paleocene🐚 Willow Bunch
- Late/Upper Cretaceous🐚 Wood Mountain
- Late/Upper Cretaceous🐚 Woodpile Creek
- Census Division 8
- Unity
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Saskatchewan |
|---|---|
| Wikidata ID: | Q1989 |
| GeoNames ID: | 6141242 |
Localities in this Region
- Saskatchewan
- Alces Lake
- ⭔Amisk Lake District
- ⭔Athabasca Basin
- Alligator prospect
- Centennial deposit
- Cigar Lake Mine
- Cluff Lake mines
- Dawn Lake Uranium Deposit
- ⭔Honsvall Lake
- Hurricane deposit
- Key Lake Mine
- Laroque Lake deposit
- MacAskill occurrence
- McArthur River Mine
- McLean Lake deposit
- Millenium Deposit
- ⭔Moore Lake
- Patterson Lake corridor
- Rabbit Lake Mine
- Roughrider deposit
- Shea Creek Prospect
- Waterfound prospect
- Wheeler River Project
- ⭔Zimmer Lake area
- ⭔Beaverlodge Lake area
- Archie Lake
- Beta Gamma Mine
- Black Bay Uranium Mines
- Bolger mine
- Camdeck occurrence
- Cayzor mine (Azor)
- Cenex U deposit
- Eagle Claims U-Cu-Se occurrence
- Eagle Mine (Eagle-Ace)
- Eldorado Mining & Refining Ltd. mines
- ⭔Goldfields District
- Gunnar mine (Gunnar deposit)
- Hal Lake Selenium Occurrence No. 1
- Lake Cinch mine
- Martin Lake mine
- National Explorations mine
- Nesbitt LaBine Uranium mine
- Pitch Ore mine
- Pitche Group
- Rix-Athabasca Uranium mines
- St. Louis fault
- St. Michael mine
- Uranium City
- Saskatchewan
- Beaverlodge Lake area
- Buzzard Coulee meteorite
- Catherwood
- ⭔Census Division 8
- Ceylon Lake
- Dominique-Peter Mine
- ⭔Esterhazy
- Fort à la Corne
- Foster River
- Glen Uranium Adit
- Gochager Lake Ni-Cu deposit
- ⭔Guernsey
- ⭔Hanson Lake
- Jan Lake
- Jansen Potash Project
- ⭔Lac la Ronge
- ⭔Lake Athabasca
- Manito Lake
- Muskiki Lake
- Nisikkatch Lake
- Nistowiack Lake
- North lngebright Lake
- Pinky Fault Uranium Deposit
- Rio Mine
- ⭔Rocanville
- Rottenstone Mine
- ⭔Saskatoon
- Seabee Gold Operation
- ⭔Springwater
- Star-Orion South Diamond Project
- ?Swift Current
- ⭔Tazin Lake
- ⭔Unity
- Waldsea Lake
Other Regions, Features and Areas that Intersect
North AmericaContinent
North America PlateTectonic Plate
- Athabasca basinBasin
- Hearne Craton
- Hearne ProvinceShield
- Rae Craton
- Snowbird Tectonic ZoneOrogenic Belt
- Rae ProvinceShield
- Trans-Hudson OrogenOrogenic Belt
- West Canadian-Alberta basinBasin
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Ridge, J.D. (1987) The Carswell structure uranium deposits, Saskatchewan. Ore Geology Reviews, 2 (4). p.406-409. doi:10.1016/0169-1368(87)90014-x
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther RegionsReferences
McArthur River Mine, Athabasca Basin, Saskatchewan, Canada