This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Museums in region:
Other Languages:
Dutch:
Luxemburg, Wallonië, België
French:
Province de Luxembourg, Région wallonne, Belgique
German:
Provinz Luxemburg, Wallonische Region, Belgien
Italian:
Provincia del Lussemburgo, Vallonia, Belgio
Russian:
Люксембург, Валлония, Бельгия
Simplified Chinese:
盧森堡省, 瓦隆大区, 比利时
Spanish:
Provincia de Luxemburgo, Región Valona, Bélgica
Walloon:
Province do Lussimbork, Walonreye, Beldjike
Afrikaans:
Luxemburg, Waalse Gewes, België
Alemannic:
Provinz Luxemburg, Belgien
Arabic:
لوكسمبورغ, والونيا, بلجيكا
Aragonese:
Provincia de Luxemburgo, Valonia, Belchica
Armenian:
Լյուքսեմբուրգ, Վալոնիա, Բելգիա
Basque:
Luxenburgo, Valonia, Belgika
Belarusian:
Люксембург, Валонія, Бельгія
Belarusian (Tarashkevitsa):
Люксэмбург, Валёнія, Бэльгія
Breton:
Luksembourg, Wallonia, Belgia
Bulgarian:
Люксембург, Валония, Белгия
Catalan:
Província de Luxemburg, Valònia, Bèlgica
Cebuano:
Province du Luxembourg, Wallonia, Belhika
Chuvash:
Люксембург, Валлони, Бельги
Croatian:
Luxembourg, Valonija, Belgija
Czech:
Lucemburk, Valonsko, Belgie
Danish:
Luxembourg, Vallonien, Belgien
Dutch Low Saxon:
Luxembörg, Waalnlaand, België
Esperanto:
Luksemburgo, Valonio, Belgio
Estonian:
Luxembourgi provints, Valloonia, Belgia
Farsi/Persian:
لوکزامبورگ, والونی, بلژیک
Finnish:
Luxembourgin provinssi, Vallonia, Belgia
Galician:
Provincia de Luxemburgo, Valonia, Bélxica
Georgian:
ლუქსემბურგის პროვინცია, ვალონია, ბელგია
Greek:
Λουξεμβούργο, Βαλλωνική Περιοχή, Βέλγιο
Hebrew:
לוקסמבורג, ולוניה, בלגיה
Hungarian:
Luxembourg, Vallónia, Belgium
Icelandic:
Lúxemborg, Vallónía, Belgía
Indonesian:
Luksemburg, Walonia, Belgia
Japanese:
リュクサンブール州, ワロン地域, ベルギー
Korean:
뤽상부르주, 왈롱, 벨기에
Latin:
Luxemburgum, Wallonia, Belgica
Latvian:
Luksemburgas province, Valonija, Beļģija
Limburgian:
Luxemburg, Wallonië, Belsj
Lithuanian:
Liuksemburgo provincija, Valonija, Belgija
Luxembourgish:
Provënz Lëtzebuerg, Wallounesch Regioun, Belsch
Marathi:
लक्झेंबर्ग, वालोनी, बेल्जियम
Norwegian:
Luxembourg, Vallonia, Belgia
Occitan:
Província de Luxemborg, Valonia, Belgica
Polish:
Luksemburg, Region Waloński, Belgia
Portuguese:
Luxemburgo, Valônia, Bélgica
Ripuarian:
Luxemburg, Belgien
Romanian:
Luxemburg, Valonia, Belgia
Scots:
Luxembourg, Wallonie, Belgium
Serbian:
Луксембург, Валонија, Белгија
Slovak:
Luxembourg, Valónsky región, Belgicko
Swedish:
Luxemburg, Vallonien, Belgien
Tamil:
லக்சம்பர்க், வல்லோனியா, பெல்ஜியம்
Thai:
มณฑลลักเซมเบิร์ก, เขตวัลลูน, ประเทศเบลเยียม
Turkish:
Lüksemburg, Valon Bölgesi, Belçika
Ukrainian:
Люксембург, Валлонія, Бельгія
Urdu:
لکسمبرگ, والونیا, بلجئیم
Vietnamese:
Luxembourg, Wallonie, Bỉ
Volapük:
Luxembourg, Belgän
Waray:
Luxembourg, Wallonie, Belhika
Welsh:
Luxembourg, Walonia, Gwlad Belg
West Flemish:
Luxemburg, Wallonië, België
West Frisian:
Lúksemboarch, Walloanje, Belgje
Western Punjabi:
صوبہ لکسمبورگ, ویلونیا, بیلجیم
NOTE: Not to be confused with the country Luxembourg.
Luxembourg (French: Luxembourg [lyksɑ̃buʁ]; Dutch: Luxemburg [ˈlyksəmˌbʏr(ə)x]; German: Luxemburg [ˈlʊksm̩bʊʁk]; Luxembourgish: Lëtzebuerg [ˈlətsəbuəɕ]; Walloon: Lussimbork), also called Belgian Luxembourg, is the southernmost province of Wallonia and of Belgium. It borders on the country of Luxembourg to the east, the French departments of Ardennes, Meuse and Meurthe-et-Moselle to the south and southwest, and the Walloon provinces of Namur and Liège to the north. Its capital and largest city is Arlon, in the south-east of the province.
Luxembourg (French: Luxembourg [lyksɑ̃buʁ]; Dutch: Luxemburg [ˈlyksəmˌbʏr(ə)x]; German: Luxemburg [ˈlʊksm̩bʊʁk]; Luxembourgish: Lëtzebuerg [ˈlətsəbuəɕ]; Walloon: Lussimbork), also called Belgian Luxembourg, is the southernmost province of Wallonia and of Belgium. It borders on the country of Luxembourg to the east, the French departments of Ardennes, Meuse and Meurthe-et-Moselle to the south and southwest, and the Walloon provinces of Namur and Liège to the north. Its capital and largest city is Arlon, in the south-east of the province.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities208 valid minerals. 7 (TL) - type locality of valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S Localities: Description: Acanthite occurs as fibrous radiating tufts of black crystals less than 100 µm in size, deposited on dendrites of native silver. The X-ray powder pattern is similar to that of synthetic acanthite (JCPDS 14-72). Qualitative chemical analysis confirms the presence of major Ag and S, together with minor Cu, Zn, and Cl. |
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reported from at least 16 localities in this region. |
| ⓘ Albite var. Andesine Formula: (Na,Ca)[Al(Si,Al)Si2O8] Localities: |
| ⓘ Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ 'Allanite Group' ? Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) Description: "Allanite was listed dubitatively by de Béthune (1977) as small inclusions in epidote or clinozoisite from Libramont." (Hatert et al., 2002) References: |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 References: |
| ⓘ Altaite Formula: PbTe Localities: Habit: rounded grains Colour: creamy white Description: Rounded grains up to 50µ disseminated in bornite from certain quartz veins at Vielsalm. Highly reflective, isotropic and creamy white. The mineral was identified by chemical analysis with the electronic microprobe which gives (Pb0.97Cu0.03)(Te0.99Se0.01) with Bi (0.18%) and S (0.03%) in lower proportions. |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5(T8O22)W2 |
| ⓘ Anatase Formula: TiO2 Localities: Reported from at least 14 localities in this region. Colour: red, orange, yellow, brown, green, black |
| ⓘ Andalusite Formula: Al2(SiO4)O Localities: Reported from at least 11 localities in this region. Habit: prismatic Colour: pale green Description: alters to muscovite (Corin, 1929) or kaolinite, sericite and/or pyrophyllite (Theunissen, 1970) |
| ⓘ Andalusite var. Chiastolite Formula: Al2(SiO4)O References: |
| ⓘ Andalusite var. Viridine Formula: (Al,Mn3+)2SiO4O |
| ⓘ 'Andalusite-Kanonaite Series' |
| ⓘ Anglesite Formula: PbSO4 Localities: Reported from at least 7 localities in this region. |
| ⓘ Anilite Formula: Cu7S4 |
| ⓘ Anorthite Formula: Ca(Al2Si2O8) |
| ⓘ Anorthite var. Bytownite Formula: (Ca,Na)[Al(Al,Si)Si2O8] References: |
| ⓘ Anorthite var. Labradorite Formula: (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A Localities: Reported from at least 16 localities in this region. |
| ⓘ Aragonite Formula: CaCO3 Localities: Reported from at least 12 localities in this region. |
| ⓘ 'Ardennite' Localities: Description: "Ardennite was discovered at Salmchâteau, associated with apatite and albite, in a quartz vein more or less parallel to the stratification of the weakly metamorphic manganiferous phyllites of the Ottré Formation." (Hatert et al., 2002) |
| ⓘ Ardennite-(As) (TL) Formula: Mn2+4Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 Localities: Reported from at least 11 localities in this region. Description: The specimens are typically massive cream colored quartz that have in it non freestanding prismatic, tan radiating bundles up to 4cm of non terminated crystals. |
| ⓘ Ardennite-(V) Formula: Mn2+4Al4(AlMg)(VO4)(SiO4)2(Si3O10)(OH)6 |
| ⓘ Arseniosiderite Formula: Ca2Fe3+3(AsO4)3O2 · 3H2O |
| ⓘ Arsenoflorencite-(Ce) Formula: CeAl3(AsO4)2(OH)6 |
| ⓘ Arsenogoyazite Formula: SrAl3(AsO4)(AsO3OH)(OH)6 |
| ⓘ Arsenopyrite Formula: FeAsS Localities: Thier des Carrières, Cahay, Vielsalm, Luxembourg, Wallonia, Belgium Grand-Halleux borehole, Grand-Halleux, Vielsalm, Luxembourg, Wallonia, Belgium Vielsalm, Luxembourg, Wallonia, Belgium Hourt quarry, Grand-Halleux, Vielsalm, Luxembourg, Wallonia, Belgium Grand-Halleux, Vielsalm, Luxembourg, Wallonia, Belgium |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O Habit: isolated or grouped square platelets References: |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Balkanite ? Formula: Cu9Ag5HgS8 |
| ⓘ Balyakinite Formula: Cu(TeO3) Localities: Habit: millimetre-sized specks and prismatic crystals up to 30µm Colour: bluish-green Description: Associated with teineite. |
| ⓘ Bariopharmacosiderite Formula: Ba0.5Fe3+4(AsO4)3(OH)4 · 5H2O Description: Lefevre & Hatert (2003): "Other crystals [of pharmacosiderite] have been identified on the graulichite-(Ce) aggregates. Qualitative chemical analysis of these crystals has shown an enrichment in Ba compared to K, indicating that they would probably consist of bariopharmacosiderite."
Hatert et al. (2003): "It is noteworthy that Lefèvre (2001) described barium-pharmacosiderite, BaFe3+8(AsO4)6(OH)8.14H2O, in very close association with the new mineral species [graulichite-(Ce)]." |
| ⓘ Baryte Formula: BaSO4 Localities: Reported from at least 10 localities in this region. |
| ⓘ Bassetite Formula: Fe2+(UO2)2(PO4)2 · 10H2O |
| ⓘ Bastnäsite-(Ce) Formula: Ce(CO3)F Habit: spherical aggregates consisting of rosettes of extremely thin polygonal crystals on adularia Colour: white to beige to yellow Description: intermixed with synchisite-(Ce) |
| ⓘ 'Bastonite' Formula: near K3(Mg,Fe,Fe,Al)5.5(Si,Al)8O22(OH)4 · 1.5H2O |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Localities: Habit: prismatic Colour: colourless to light green Description: intimately associated with malachite and vein quartz |
| ⓘ Beudantite Formula: PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Reported from at least 21 localities in this region. |
| ⓘ Bismite ? Formula: Bi2O3 Description: Jedwab & Dejonghe (1982): "The origin of the elevated Bi concentrations [in the iron hydroxides] is probably due to a Bi oxide phase (bismite or sillénite), of which crystals were encountered in iron-bearing alteration products of tiemannite." |
| ⓘ 'Blaubleibender Covellite' Locality: Vielsalm, Luxembourg, Wallonia, Belgium Description: Necessary entry for non-analysed specimens of spionkopite/yarrowite. Microprobe analysis indicates an important enrichment in copper (Cu/S ratio = 1,20). References: |
| ⓘ Bogdanovite ? Formula: (Au,Te,Pb)3(Cu,Fe) |
| ⓘ Bohdanowiczite ? Formula: AgBiSe2 Description: Listed as "unconfirmed" by Jedwab & Dejonghe (1982) |
| ⓘ Bornite Formula: Cu5FeS4 Localities: Reported from at least 6 localities in this region. Description: Irregularly shaped inclusions of up to 4 cm in quartz veins. In thin sections, it is run through by veinlets of covellite/digenite and can also show a myrmekitic (rounded contours) association with covellite and chalcocite. Under oxidising conditions, bornite transforms into idaite, with the appearance of chalcopyrite lamellae. |
| ⓘ Brannerite Formula: UTi2O6 Habit: elongated prisms up to 50µm with a rectangular, rhombic or cruciform cross-section, sometimes grouped in bundles of parallel or fibrous radiating acicular crystals. Colour: brown Description: Associated with tiemannite and rutile (Jedwab & Dejonghe, 1982). References: |
| ⓘ Braunite Formula: Mn2+Mn3+6(SiO4)O8 Localities: Habit: fine-grained Colour: Creamy grey with a hint of brown in polished sections |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 Localities: Reported from at least 7 localities in this region. |
| ⓘ Brookite Formula: TiO2 |
| ⓘ Cacoxenite Formula: Fe3+24AlO6(PO4)17(OH)12 · 75H2O Localities: Reported from at least 7 localities in this region. Habit: spherules with fibroradiating structure and matte or spikey surface Colour: brown |
| ⓘ Calcioancylite-(Ce) Formula: (Ce,Ca,Sr)CO3(OH,H2O) Habit: tiny acute dipyramidal crystals |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 36 localities in this region. |
| ⓘ Calcite var. Lublinite Formula: CaCO3 |
| ⓘ Caledonite Formula: Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ Carminite Formula: PbFe3+2(AsO4)2(OH)2 Habit: acicular Colour: carmine-red Description: carmine-red acicular crystals, usually grouped in bundles |
| ⓘ Carpholite Formula: Mn2+Al2(Si2O6)(OH)4 |
| ⓘ Celestine Formula: SrSO4 |
| ⓘ Cerussite Formula: PbCO3 Localities: Reported from at least 15 localities in this region. |
| ⓘ Chabazite-Ca Formula: (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| ⓘ Chalcoalumite Formula: CuAl4(SO4)(OH)12 · 3H2O |
| ⓘ Chalcocite Formula: Cu2S Localities: Reported from at least 6 localities in this region. |
| ⓘ Chalcophyllite Formula: Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O Localities: Habit: pseudohexagonal tablets up to 1mm, flattened parallel to the perfect cleavage plane (0001) Colour: turquoise blue with pearly lustre Description: Apart from the major elements, qualitative chemical analysis has shown low V, P, Cl, Ca and U contents (Hatert et al., 1998). The arsenic would originate from the alteration of arsenopyrite which also occurs in the deposit. |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 30 localities in this region. |
| ⓘ Chamosite Formula: Fe2+5Al(AlSi3O10)(OH)8 |
| ⓘ Chernikovite Formula: (H3O)2(UO2)2(PO4)2 · 6H2O Description: listed as "hydrogène-autunite". |
| ⓘ 'Chlorite Group' Localities: Reported from at least 27 localities in this region. |
| ⓘ Chloritoid Formula: Fe2+Al2O(SiO4)(OH)2 Localities: Reported from at least 20 localities in this region. |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 Habit: (mostly rounded) grains from 25 to 150µm; badly crystallised aggregates (altered) Colour: reddish-yellow to brownish red (altered) Description: Significant Fe is replaced by Mg, whereas Al is replaced by Cr only in part. Up to 7% MnO has been detected. References: |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ Clausthalite Formula: PbSe Description: Inclusions in quartz. References: |
| ⓘ 'Clay minerals' |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 Localities: Reported from at least 12 localities in this region. |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Cobaltite Formula: CoAsS Localities: Description: "Inclusions of cobaltite up to 1mm have been identified by x-ray diffraction in the bornite of certain quartz veins in the region of Vielsalm." (Hatert et al., 2002) |
| ⓘ Connellite Formula: Cu19(SO4)(OH)32Cl4 · 3H2O Localities: Habit: fibroradiating spherules or aggregates up to 200µm. Colour: deep blue Description: Associated with brochantite and langite. |
| ⓘ Cookeite Formula: (LiAl4◻)[AlSi3O10](OH)8 |
| ⓘ Covellite Formula: CuS Localities: Reported from at least 13 localities in this region. |
| ⓘ Crandallite Formula: CaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ Cryptomelane Formula: K(Mn4+7Mn3+)O16 Localities: Reported from at least 11 localities in this region. Description: Mixtures with lithiophorite. |
| ⓘ Cuprite Formula: Cu2O Localities: Reported from at least 12 localities in this region. |
| ⓘ Danielsite ? Formula: (Cu,Ag)14HgS8 |
| ⓘ Davreuxite (TL) Formula: MnAl6Si4O17(OH)2 Localities: Reported from at least 7 localities in this region. Type Locality: Ottré, Bihain, Vielsalm, Luxembourg, Wallonia, Belgium Habit: fibrous Colour: creamy white to light pink |
| ⓘ Dawsonite Formula: NaAlCO3(OH)2 Localities: Habit: fibroradiated spherulites and globules up to 1-2mm (Van Tassel, 1962) Colour: white |
| ⓘ Delafossite Formula: Cu+Fe3+O2 Localities: Thier des Carrières, Cahay, Vielsalm, Luxembourg, Wallonia, Belgium Salmchâteau, Vielsalm, Luxembourg, Wallonia, Belgium Vielsalm, Luxembourg, Wallonia, Belgium Coticule mines (west), Salmchâteau, Vielsalm, Luxembourg, Wallonia, Belgium Copper-tellurium mineralization, Salmchâteau, Vielsalm, Luxembourg, Wallonia, Belgium Habit: small spherules or fibroradiated aggregates consisting of black acicular crystals Colour: black |
| ⓘ Denningite ? Formula: CaMn2+Te4+4O10 |
| ⓘ Diaspore Formula: AlO(OH) |
| ⓘ Dickite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Digenite Formula: Cu9S5 Localities: |
| ⓘ Diopside Formula: CaMgSi2O6 References: |
| ⓘ Djurleite Formula: Cu31S16 Localities: Salmchâteau, Vielsalm, Luxembourg, Wallonia, Belgium Coticule mines (west), Salmchâteau, Vielsalm, Luxembourg, Wallonia, Belgium Vielsalm, Luxembourg, Wallonia, Belgium Thier des Carrières, Cahay, Vielsalm, Luxembourg, Wallonia, Belgium Copper-tellurium mineralization, Salmchâteau, Vielsalm, Luxembourg, Wallonia, Belgium Colour: black |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: Reported from at least 11 localities in this region. |
| ⓘ Dumontite ? Formula: Pb2(UO2)3O2(PO4)2 · 5H2O Description: Listed as "unconfirmed" in Dejonghe et al. (1982) |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: Reported from at least 10 localities in this region. |
| ⓘ Epsomite Formula: MgSO4 · 7H2O References: |
| ⓘ Euclase Formula: BeAl(SiO4)(OH) Colour: whitish Description: inclusions of up to 2cm in massive quartz associated with pyrophyllite, ottrelite, and davreuxite. Visually it is only distinguishable from the quartz by its perfect (010) cleavage. |
| ⓘ Faustite Formula: ZnAl6(PO4)4(OH)8 · 4H2O Habit: spheres Colour: grey to white Description: Beside Zn and Al only minor Cu, Fe and Ni could be determined (semiquantitatively). |
| ⓘ 'Feldspar Group' |
| ⓘ Ferrimolybdite Formula: Fe2(MoO4)3 · nH2O |
| ⓘ 'Florencite' |
| ⓘ Florencite-(Ce) Formula: CeAl3(PO4)2(OH)6 Localities: Reported from at least 6 localities in this region. |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Localities: Reported from at least 11 localities in this region. |
| ⓘ Fluorite Formula: CaF2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Gahnite Formula: ZnAl2O4 Localities: Habit: octahedra up to 10 microns Colour: red (UV) Description: Only visible in polished sections. |
| ⓘ Galena Formula: PbS Localities: Reported from at least 35 localities in this region. |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 Localities: Reported from at least 18 localities in this region. |
| ⓘ 'Glauconite' Formula: K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| ⓘ Goethite Formula: Fe3+O(OH) Localities: Reported from at least 54 localities in this region. |
| ⓘ Gonnardite Formula: (Na,Ca)2(Si,Al)5O10 · 3H2O |
| ⓘ Graemite Formula: Cu[TeO3] · H2O |
| ⓘ Graphite Formula: C |
| ⓘ Graulichite-(Ce) (TL) Formula: CeFe3+3(AsO4)2(OH)6 Type Locality: Habit: 80 to 150 µm spherical aggregates of rhombohedral crystals 50 to 80μm in length Colour: light-green to brownish, resinous lustre References: Hatert, Frédéric, Lefèvre, Pierre, Pasero, Marco, Fransolet, André -Mathieu (2003) Graulichite-(Ce), a new arsenate mineral from the Stavelot Massif, Belgium. European Journal of Mineralogy, 15 (4) 733-739 doi:10.1127/0935-1221/2003/0015-0733 Dillen, R., Dehove, J., Detaille, J. (2004) Graulichiet-Ce), een nieuw mineraal ontdekt in België [Graulichiet-Ce), a new mineral discovered in Belgium]. Geonieuws, 29 (06) 134-148 |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: Reported from at least 18 localities in this region. |
| ⓘ Halite Formula: NaCl Description: Microinclusions in quartz. |
| ⓘ Hausmannite Formula: Mn2+Mn3+2O4 Colour: black (dark brown when powdered) References: |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 32 localities in this region. |
| ⓘ Hematite var. Martite Formula: Fe2O3 Localities: Habit: octahedra |
| ⓘ Hessite Formula: Ag2Te References: |
| ⓘ Hollandite Formula: Ba(Mn4+6Mn3+2)O16 |
| ⓘ Hydroniumjarosite Formula: (H3O)Fe3+3(SO4)2(OH)6 |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 |
| ⓘ Ice Formula: H2O |
| ⓘ Idaite Formula: Cu5FeS6 Localities: Habit: metallic patches up to 5µm associated with altered bornite and tiny chalcopyrite lamellae Colour: bronze; weak bluish to brownish pleochroism in thin section; vivid yellow to green anisotropy Description: Microprobe analysis shows a composition that is significantly enriched in copper. |
| ⓘ Ilmenite Formula: Fe2+TiO3 Localities: Reported from at least 10 localities in this region. Habit: grains; lamellae up to 1cm in quartz veins; acicular crystals up to 2mm in schist and phyllite. |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Kanonaite Formula: Mn3+Al(SiO4)O Localities: Reported from at least 6 localities in this region. |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 Localities: Reported from at least 17 localities in this region. |
| ⓘ 'K Feldspar' |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 Localities: Habit: crystals up to 300µm |
| ⓘ Kintoreite Formula: PbFe3(PO4)(PO3OH)(OH)6 Habit: tiny steep rhombohedra Fluorescence: beige to light pale green |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O Localities: Reported from at least 6 localities in this region. Habit: lamellae (flattened according to {001} and elongated according to [100]) Colour: blue Description: Associated with copper sulfides in quartz veins |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O Localities: Reported from at least 7 localities in this region. |
| ⓘ Leadhillite Formula: Pb4(CO3)2(SO4)(OH)2 References: |
| ⓘ Lepidocrocite Formula: Fe3+O(OH) |
| ⓘ 'Leucoxene' |
| ⓘ Libethenite Formula: Cu2(PO4)(OH) Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Limonite' Localities: Reported from at least 19 localities in this region. |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 |
| ⓘ Lithiophorite Formula: (Al,Li)MnO2(OH)2 Localities: Reported from at least 8 localities in this region. Habit: Small masses associated with wavellite or quartz Colour: dark grey to black Description: Microprobe analysis has shown, apart from Al and Mn, low contents of Co, Cu, Zn and Ni. According to Mélon et al. (1976), Laspeyre may have analysed a mixture of cryptomelane and lithiophorite (due to the relatively high K2O content). |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 19 localities in this region. |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 25 localities in this region. |
| ⓘ Malhmoodite Formula: FeZr(PO4)2 · 4H2O |
| ⓘ 'Manganese Oxides' Localities: Reported from at least 7 localities in this region. |
| ⓘ Manganite Formula: Mn3+O(OH) |
| ⓘ Marcasite Formula: FeS2 Localities: Reported from at least 24 localities in this region. |
| ⓘ Margarite Formula: CaAl2(Al2Si2O10)(OH)2 Localities: Habit: small lamellae, sometimes as polysynthetic twins Description: de Béthune (1977) provides evidence of variations in the chemical composition of the lamellae, in particular, weak variations in the Ca content. |
| ⓘ Melanterite Formula: Fe2+(H2O)6(SO4) · H2O References: |
| ⓘ Melonite Formula: NiTe2 Localities: Description: Inclusions of up to 5µm in bornite in certain quartz veins (Hatert, 1996). Microprobe analysis lead to (Ni0.78Cu0.13Co0.06Fe0.04)(Te1.89Bi0.10Se0.01) with low Mo contents (0.05%). |
| ⓘ Melonite var. Palladium-bearing Melonite ? Formula: (Ni,Pd)Te2 |
| ⓘ Metatorbernite Formula: Cu(UO2)2(PO4)2 · 8H2O Localities: Colour: light green |
| ⓘ 'Mica Group' |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl Localities: Habit: acicular crystals up to 300µm, often in fibroradiating groups Colour: colourless to whitish Description: Associated with arsenopyrite. Contains trace amounts of Fe and Ca. |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Molybdite Formula: MoO3 |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) |
| ⓘ 'Monazite Group' Formula: REE(PO4) |
| ⓘ Montanite Formula: Bi2(TeO6) · nH2O |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ Montroydite ? Formula: HgO |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 26 localities in this region. |
| ⓘ Muscovite var. Alurgite Formula: K(Al,Mn3+)2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Fuchsite Formula: K(Al,Cr)3Si3O10(OH)2 Localities: Habit: lamellae Colour: greenish (dichroic) Description: erroneously identified as cupriferous pyrophyllite by e.g. Dewalque (1894) |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Nahcolite Formula: NaHCO3 Description: Microinclusions in quartz. |
| ⓘ Native Bismuth Formula: Bi Locality: Bastogne, Luxembourg, Wallonia, Belgium Colour: light yellowish (polarised light) Description: "Godfroid (1999) has identified native bismuth as micrometre-sized inclusions in the galena of Bastogne. Under the polarized reflection microscope, these planes appear light yellowish. Qualitative chemical analysis confirms the presence of Bi only." (Hatert et al., 2002) References: |
| ⓘ Native Copper Formula: Cu Localities: Reported from at least 7 localities in this region. |
| ⓘ Native Gold Formula: Au Localities: Reported from at least 20 localities in this region. Habit: lamellae |
| ⓘ Native Gold var. Palladium-bearing Gold Formula: (Au,Pd) References: |
| ⓘ Native Gold var. Porpezite ? Formula: (Au,Pd) Description: Listed as "unconfirmed" by Jedwab & Dejonghe (1982) |
| ⓘ Native Silver Formula: Ag |
| ⓘ Native Sulphur Formula: S8 Localities: Reported from at least 6 localities in this region. Colour: yellowish |
| ⓘ Native Tellurium Formula: Te Localities: Description: Inclusions up to 10 microns in digenite and chalcocite. |
| ⓘ Natrolite Formula: Na2Al2Si3O10 · 2H2O |
| ⓘ Naumannite ? Formula: Ag2Se Description: Listed as "unconfirmed/probable" by Jedwab & Dejonghe (1982) |
| ⓘ Nsutite Formula: (Mn4+,Mn2+)(O,OH)2 |
| ⓘ Olivenite Formula: Cu2(AsO4)(OH) Habit: prismatic, elongated according to the c axis showing {110} and {101} Colour: pale olive green |
| ⓘ Orthoclase Formula: K(AlSi3O8) Localities: Reported from at least 6 localities in this region. |
| ⓘ Ottrélite (TL) Formula: Mn2+Al2O(SiO4)(OH)2 Localities: Reported from at least 8 localities in this region. Type Locality: Ottré, Bihain, Vielsalm, Luxembourg, Wallonia, Belgium Colour: pistachio green scales or aggregates at the contact with the quartz vein |
| ⓘ Paragonite Formula: NaAl2(AlSi3O10)(OH)2 Localities: Description: intimately associated with muscovite |
| ⓘ Paratellurite Formula: TeO2 |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 Habit: rectangular platelets in pyrite pseudomorphs References: |
| ⓘ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O Localities: Habit: coatings consisting of cubic or tetrahedral microcrystals up to 100µm showing {100} and {111} Colour: yellowish, pale green, brownish Description: Associated with arsenopyrite. Chemical analysis shows the presence of low quantities of Al replacing Fe3+. |
| ⓘ Philipsbornite Formula: PbAl3(AsO4)(AsO3OH)(OH)6 |
| ⓘ Piemontite Formula: (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) Description: associated with kanonaite and braunite. Contains up to 5% rare earths (Hatert et al., 2002). |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ Plumbogummite Formula: PbAl3(PO4)(PO3OH)(OH)6 |
| ⓘ Plumbojarosite Formula: Pb0.5Fe3+3(SO4)2(OH)6 |
| ⓘ Posnjakite Formula: Cu4(SO4)(OH)6 · H2O Localities: Habit: transversely striated, simulating a stack of segments (Van Der Meersche, 1992) Colour: greenish blue |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 Localities: Habit: aggregates of tabular crystals up to 5mm Colour: colourless, light pink |
| ⓘ Pseudomalachite Formula: Cu5(PO4)2(OH)4 Localities: Reported from at least 7 localities in this region. |
| ⓘ ' Locality: Malempré, Manhay, Luxembourg, Wallonia, Belgium - erroneously reported Description: Mélon et al. (1976): "It appears that the latter species [psilomelane] should well be removed from the list of Belgian minerals (Fransolet & Mélon 1975)." References: |
| ⓘ Pumpellyite-(Al) (TL) Formula: Ca2AlAl2[Si2O6OH][SiO4](OH)2O Type Locality: |
| ⓘ Pumpellyite-(Fe2+) Formula: Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| ⓘ 'Pumpellyite Subgroup' Formula: Ca2XAl2[Si2O6(OH)][SiO4](OH)2A Habit: grains References: |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 43 localities in this region. |
| ⓘ Pyrite var. Bravoite ? Formula: (Fe,Ni)S2 Description: Listed as "unconfirmed" by Jedwab & Dejonghe (1982) |
| ⓘ 'Pyrobitumen' |
| ⓘ Pyrolusite Formula: Mn4+O2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl Localities: Reported from at least 9 localities in this region. |
| ⓘ Pyrophyllite Formula: Al2Si4O10(OH)2 Localities: Reported from at least 9 localities in this region. |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Reported from at least 12 localities in this region. |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 57 localities in this region. |
| ⓘ Quartz var. Amethyst Formula: SiO2 |
| ⓘ Quartz var. Milky Quartz Formula: SiO2 |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 Localities: Reported from at least 6 localities in this region. Habit: Very nice Dauphiné law twins are common.
|
| ⓘ Quartz var. Rutilated Quartz Formula: SiO2 References: |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Rhabdophane-(Ce) Formula: Ce(PO4) · 0.6H2O |
| ⓘ Rhodochrosite Formula: MnCO3 Localities: Thier des Carrières, Cahay, Vielsalm, Luxembourg, Wallonia, Belgium Salmchâteau, Vielsalm, Luxembourg, Wallonia, Belgium Coticule mines (west), Salmchâteau, Vielsalm, Luxembourg, Wallonia, Belgium Ardennite-quartz veins, Salmchâteau, Vielsalm, Luxembourg, Wallonia, Belgium Vielsalm, Luxembourg, Wallonia, Belgium Habit: barrel-shaped aggregates composed of elongated scalenohedra Colour: reddish-brown to yellowish-brown |
| ⓘ Rosasite Formula: (Cu,Zn)2(CO3)(OH)2 Localities: Habit: fibrous radiating lamellar aggregates up to 0.5mm Colour: sky blue |
| ⓘ Rutile Formula: TiO2 Localities: Reported from at least 25 localities in this region. Habit: prismatic Colour: colourless, yellow, brown |
| ⓘ Rutile var. Sagenite (of Saussure) Formula: TiO2 References: |
| ⓘ Sabugalite Formula: HAl(UO2)4(PO4)4 · 16H2O |
| ⓘ 'Saussurite' |
| ⓘ 'Scapolite' Description: Saussurite. |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O Localities: Habit: spherical aggregates sometimes surpassing 150 µm, consisting of crystals of up to 20 microns, on quartz Colour: whitish to pale green Description: Associated with arsenopyrite |
| ⓘ Siderite Formula: FeCO3 Localities: Reported from at least 17 localities in this region. |
| ⓘ Sillénite ? Formula: Bi12SiO20 Description: Jedwab & Dejonghe (1982): "The origin of the elevated Bi concentrations [in the iron hydroxides] is probably due to a Bi oxide phase (bismite or sillénite), of which crystals were encountered in iron-bearing alteration products of tiemannite." |
| ⓘ Smithsonite Formula: ZnCO3 |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 Localities: Reported from at least 14 localities in this region. |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 24 localities in this region. |
| ⓘ Spinel ? Formula: MgAl2O4 References: |
| ⓘ Spionkopite Formula: Cu39S28 Locality: Vielsalm, Luxembourg, Wallonia, Belgium |
| ⓘ Stavelotite-(La) (TL) Formula: (La,Nd,Ca)3Mn2+3Cu(Mn3+,Fe3+,Mn4+)26(Si2O7)6O30 Type Locality: |
| ⓘ Stibnite Formula: Sb2S3 |
| ⓘ Stilbite-Ca Formula: NaCa4(Si27Al9)O72 · 28H2O |
| ⓘ Strengite Formula: FePO4 · 2H2O References: |
| ⓘ Strontiomelane Formula: Sr(Mn4+6Mn3+2)O16 Habit: thin acicular crystals up to 2mm Description: Associated with braunite and/or kanonaite. Microprobe analysis shows the replacement of Ba by Sr of up to 60%, resulting in the mineral strontiomelane. References: Schreyer, Werner, Fransolet, André-Mathieu, Bernhardt, Heinz-Jürgen (2001) Hollandite–strontiomelane solid solutions coexisting with kanonaite and braunite in late quartz veins of the Stavelot Massif, Ardennes, Belgium. Contributions to Mineralogy and Petrology, 141 (5) 560-571 doi:10.1007/s004100100260 |
| ⓘ Sudoite Formula: Mg2Al3(AlSi3O10)(OH)8 |
| ⓘ Susannite Formula: Pb4(CO3)2(SO4)(OH)2 |
| ⓘ Synchysite-(Ce) Formula: CaCe(CO3)2F Description: intermixed with bastnäsite-(Ce) References: |
| ⓘ Teineite Formula: Cu2+(Te4+O3) · 2H2O Localities: Habit: millimeter-sized isolated crystals; polycrystalline aggregates up to 2.5mm; lamellae and "veneer"; glassy lustre; SEM analysis shows complex crystal faces Colour: azure blue Description: Intimately associated with covellite, hematite, and malachite |
| ⓘ Tellurobismuthite Formula: Bi2Te3 |
| ⓘ Tenorite Formula: CuO |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| ⓘ Tiemannite Formula: HgSe Colour: black Description: Dejonghe et al. (1982): "Nonetheless, this mineral was observed in a concentrate and one must not exclude a priori the hypothesis of a contamination during grinding or during magnetic separation. Its presence has not been confirmed in rough samples." References: |
| ⓘ Titanite Formula: CaTiO(SiO4) Localities: Reported from at least 8 localities in this region. |
| ⓘ Todorokite Formula: (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| ⓘ Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O Localities: Reported from at least 9 localities in this region. |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z Localities: Reported from at least 16 localities in this region. |
| ⓘ Turquoise Formula: CuAl6(PO4)4(OH)8 · 4H2O Localities: Reported from at least 6 localities in this region. |
| ⓘ Uraninite Formula: UO2 Habit: isolated or grouped cubes or cuboctahedra (2 to 20µm), interpenetrating or twinned. Zoning and skeletal internal structures have also been observed. Colour: black References: |
| ⓘ Uranosphaerite Formula: Bi(UO2)O2(OH) References: |
| ⓘ Vantasselite (TL) Formula: Al4(PO4)3(OH)3 · 9H2O Localities: Habit: rosettes of thin tabular crystals; comb-shaped aggregates consisting of stacked fan-shaped lamellae (flattened according to {001}, elongated according to [100] and ending in {120} faces) Colour: white |
| ⓘ Variscite Formula: AlPO4 · 2H2O Localities: Habit: rosettes, lozenge-shaped, platy Colour: white Description: Associated with wavellite, vantasselite, turquoise and/or cacoxenite |
| ⓘ Volborthite Formula: Cu3(V2O7)(OH)2 · 2H2O |
| ⓘ 'Wad' |
| ⓘ Wakefieldite-(Nd) Formula: Nd(VO4) Locality: Vielsalm, Luxembourg, Wallonia, Belgium References: Specimen auctioned by Carsten Slotta, photo uploaded by Hamza. SIdentified by Hamza Ilhan Sito: XRD, SEM-EDS |
| ⓘ Wardite Formula: NaAl3(PO4)2(OH)4 · 2H2O |
| ⓘ Wavellite Formula: Al3(PO4)2(OH)3 · 5H2O Localities: Reported from at least 8 localities in this region. |
| ⓘ Wittichenite Formula: Cu3BiS3 |
| ⓘ Wroewolfeite Formula: Cu4(SO4)(OH)6 · 2H2O |
| ⓘ Wulfenite Formula: Pb(MoO4) Localities: Reported from at least 6 localities in this region. Habit: usually as combinations of {101} and {112}, sometimes with less developed {104} facets; sometimes more elongated crystals, composed of very steep quadroctahedra with curved faces Colour: white, caramel brown, greasy lustre Description: Qualitative chemical analyses show (apart from Pb and Mo as major elements) non-negligible amounts of Fe and Cu. |
| ⓘ Xenotime-(Y) Formula: Y(PO4) Localities: Reported from at least 7 localities in this region. |
| ⓘ Yarrowite Formula: Cu9S8 Locality: Vielsalm, Luxembourg, Wallonia, Belgium |
| ⓘ Zemannite ? Formula: Mg0.5ZnFe3+(Te4+O3)3 · 4.5H2O |
| ⓘ Zeunerite Formula: Cu(UO2)2(AsO4)2 · 12H2O |
| ⓘ Zircon Formula: Zr(SiO4) Localities: Reported from at least 7 localities in this region. Colour: colourless to greyish |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) Localities: Description: Saussurite. |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Gold var. Porpezite ? | 1.AA.05 | (Au,Pd) |
| ⓘ | var. Palladium-bearing Gold | 1.AA.05 | (Au,Pd) |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| ⓘ | Native Tellurium | 1.CC.10 | Te |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Djurleite | 2.BA.05 | Cu31S16 |
| ⓘ | Anilite | 2.BA.10 | Cu7S4 |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Naumannite ? | 2.BA.55 | Ag2Se |
| ⓘ | Hessite | 2.BA.60 | Ag2Te |
| ⓘ | Bogdanovite ? | 2.BA.80 | (Au,Te,Pb)3(Cu,Fe) |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Balkanite ? | 2.BD.15 | Cu9Ag5HgS8 |
| ⓘ | Danielsite ? | 2.BD.15 | (Cu,Ag)14HgS8 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Spionkopite | 2.CA.05c | Cu39S28 |
| ⓘ | Yarrowite | 2.CA.05d | Cu9S8 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Tiemannite | 2.CB.05a | HgSe |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Idaite | 2.CB.15a | Cu5FeS6 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Altaite | 2.CD.10 | PbTe |
| ⓘ | Clausthalite | 2.CD.10 | PbSe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Tellurobismuthite | 2.DC.05 | Bi2Te3 |
| ⓘ | Melonite | 2.EA.20 | NiTe2 |
| ⓘ | var. Palladium-bearing Melonite ? | 2.EA.20 | (Ni,Pd)Te2 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite var. Bravoite ? | 2.EB.05a | (Fe,Ni)S2 |
| ⓘ | 2.EB.05a | FeS2 | |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Wittichenite | 2.GA.20 | Cu3BiS3 |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Bohdanowiczite ? | 2.JA.20 | AgBiSe2 |
| Group 3 - Halides | |||
| ⓘ | Halite | 3.AA.20 | NaCl |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Connellite | 3.DA.25 | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Ice | 4.AA.05 | H2O |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Delafossite | 4.AB.15 | Cu+Fe3+O2 |
| ⓘ | Montroydite ? | 4.AC.15 | HgO |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Gahnite | 4.BB.05 | ZnAl2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel ? | 4.BB.05 | MgAl2O4 |
| ⓘ | Hausmannite | 4.BB.10 | Mn2+Mn3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Hematite var. Martite | 4.CB.05 | Fe2O3 |
| ⓘ | Bismite ? | 4.CB.60 | Bi2O3 |
| ⓘ | Sillénite ? | 4.CB.70 | Bi12SiO20 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Rutilated Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | var. Milky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | var. Sagenite (of Saussure) | 4.DB.05 | TiO2 |
| ⓘ | Nsutite | 4.DB.15c | (Mn4+,Mn2+)(O,OH)2 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brookite | 4.DD.10 | TiO2 |
| ⓘ | Paratellurite | 4.DE.25 | TeO2 |
| ⓘ | Brannerite | 4.DH.05 | UTi2O6 |
| ⓘ | Cryptomelane | 4.DK.05a | K(Mn4+7Mn3+)O16 |
| ⓘ | Hollandite | 4.DK.05a | Ba(Mn4+6Mn3+2)O16 |
| ⓘ | Strontiomelane | 4.DK.05a | Sr(Mn4+6Mn3+2)O16 |
| ⓘ | Todorokite | 4.DK.10 | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | Molybdite | 4.E0.10 | MoO3 |
| ⓘ | Diaspore | 4.FD.10 | AlO(OH) |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Lepidocrocite | 4.FE.15 | Fe3+O(OH) |
| ⓘ | Lithiophorite | 4.FE.25 | (Al,Li)MnO2(OH)2 |
| ⓘ | Uranosphaerite | 4.GB.65 | Bi(UO2)O2(OH) |
| ⓘ | Balyakinite | 4.JK.15 | Cu(TeO3) |
| ⓘ | Denningite ? | 4.JK.30 | CaMn2+Te4+4O10 |
| ⓘ | Zemannite ? | 4.JM.05 | Mg0.5ZnFe3+(Te4+O3)3 · 4.5H2O |
| ⓘ | Graemite | 4.JM.15 | Cu[TeO3] · H2O |
| ⓘ | Teineite | 4.JM.20 | Cu2+(Te4+O3) · 2H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Nahcolite | 5.AA.15 | NaHCO3 |
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Calcite var. Lublinite | 5.AB.05 | CaCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Rosasite | 5.BA.10 | (Cu,Zn)2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Dawsonite | 5.BB.10 | NaAlCO3(OH)2 |
| ⓘ | Bastnäsite-(Ce) | 5.BD.20a | Ce(CO3)F |
| ⓘ | Synchysite-(Ce) | 5.BD.20c | CaCe(CO3)2F |
| ⓘ | Leadhillite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Susannite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Calcioancylite-(Ce) | 5.DC.05 | (Ce,Ca,Sr)CO3(OH,H2O) |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Celestine | 7.AD.35 | SrSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Hydroniumjarosite | 7.BC.10 | (H3O)Fe3+3(SO4)2(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Plumbojarosite | 7.BC.10 | Pb0.5Fe3+3(SO4)2(OH)6 |
| ⓘ | Caledonite | 7.BC.50 | Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6(SO4) · H2O |
| ⓘ | Epsomite | 7.CB.40 | MgSO4 · 7H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Montanite | 7.CD.60 | Bi2(TeO6) · nH2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Posnjakite | 7.DD.10 | Cu4(SO4)(OH)6 · H2O |
| ⓘ | Wroewolfeite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Chalcoalumite | 7.DD.75 | CuAl4(SO4)(OH)12 · 3H2O |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| ⓘ | Ferrimolybdite | 7.GB.30 | Fe2(MoO4)3 · nH2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Wakefieldite-(Nd) | 8.AD.35 | Nd(VO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Libethenite | 8.BB.30 | Cu2(PO4)(OH) |
| ⓘ | Olivenite | 8.BB.30 | Cu2(AsO4)(OH) |
| ⓘ | Pseudomalachite | 8.BD.05 | Cu5(PO4)2(OH)4 |
| ⓘ | Carminite | 8.BH.30 | PbFe3+2(AsO4)2(OH)2 |
| ⓘ | Beudantite | 8.BL.05 | PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ | Arsenogoyazite | 8.BL.10 | SrAl3(AsO4)(AsO3OH)(OH)6 |
| ⓘ | Crandallite | 8.BL.10 | CaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Kintoreite | 8.BL.10 | PbFe3(PO4)(PO3OH)(OH)6 |
| ⓘ | Philipsbornite | 8.BL.10 | PbAl3(AsO4)(AsO3OH)(OH)6 |
| ⓘ | Plumbogummite | 8.BL.10 | PbAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Arsenoflorencite-(Ce) | 8.BL.13 | CeAl3(AsO4)2(OH)6 |
| ⓘ | Florencite-(Ce) | 8.BL.13 | CeAl3(PO4)2(OH)6 |
| ⓘ | Graulichite-(Ce) (TL) | 8.BL.13 | CeFe3+3(AsO4)2(OH)6 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Strengite | 8.CD.10 | FePO4 · 2H2O |
| ⓘ | Variscite | 8.CD.10 | AlPO4 · 2H2O |
| ⓘ | Malhmoodite | 8.CE.75 | FeZr(PO4)2 · 4H2O |
| ⓘ | Rhabdophane-(Ce) | 8.CJ.45 | Ce(PO4) · 0.6H2O |
| ⓘ | Vantasselite (TL) | 8.DC.37 | Al4(PO4)3(OH)3 · 9H2O |
| ⓘ | Cacoxenite | 8.DC.40 | Fe3+24AlO6(PO4)17(OH)12 · 75H2O |
| ⓘ | Wavellite | 8.DC.50 | Al3(PO4)2(OH)3 · 5H2O |
| ⓘ | Faustite | 8.DD.15 | ZnAl6(PO4)4(OH)8 · 4H2O |
| ⓘ | Turquoise | 8.DD.15 | CuAl6(PO4)4(OH)8 · 4H2O |
| ⓘ | Chalcophyllite | 8.DF.30 | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| ⓘ | Arseniosiderite | 8.DH.30 | Ca2Fe3+3(AsO4)3O2 · 3H2O |
| ⓘ | Bariopharmacosiderite | 8.DK.10 | Ba0.5Fe3+4(AsO4)3(OH)4 · 5H2O |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ | Wardite | 8.DL.10 | NaAl3(PO4)2(OH)4 · 2H2O |
| ⓘ | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ | Zeunerite | 8.EB.05 | Cu(UO2)2(AsO4)2 · 12H2O |
| ⓘ | Bassetite | 8.EB.10 | Fe2+(UO2)2(PO4)2 · 10H2O |
| ⓘ | Metatorbernite | 8.EB.10 | Cu(UO2)2(PO4)2 · 8H2O |
| ⓘ | Chernikovite | 8.EB.15 | (H3O)2(UO2)2(PO4)2 · 6H2O |
| ⓘ | Sabugalite | 8.EB.55 | HAl(UO2)4(PO4)4 · 16H2O |
| ⓘ | Dumontite ? | 8.EC.15 | Pb2(UO2)3O2(PO4)2 · 5H2O |
| ⓘ | Volborthite | 8.FD.05 | Cu3(V2O7)(OH)2 · 2H2O |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Euclase | 9.AE.10 | BeAl(SiO4)(OH) |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | var. Chiastolite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Kanonaite | 9.AF.10 | Mn3+Al(SiO4)O |
| ⓘ | Andalusite var. Viridine | 9.AF.10 | (Al,Mn3+)2SiO4O |
| ⓘ | Chloritoid | 9.AF.85 | Fe2+Al2O(SiO4)(OH)2 |
| ⓘ | Ottrélite (TL) | 9.AF.85 | Mn2+Al2O(SiO4)(OH)2 |
| ⓘ | Braunite | 9.AG.05 | Mn2+Mn3+6(SiO4)O8 |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Stavelotite-(La) (TL) | 9.BE.87 | (La,Nd,Ca)3Mn2+3Cu(Mn3+,Fe3+,Mn4+)26(Si2O7)6O30 |
| ⓘ | Davreuxite (TL) | 9.BF.15 | MnAl6Si4O17(OH)2 |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Piemontite | 9.BG.05a | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Pumpellyite-(Fe2+) | 9.BG.20 | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| ⓘ | Pumpellyite-(Al) (TL) | 9.BG.20 | Ca2AlAl2[Si2O6OH][SiO4](OH)2O |
| ⓘ | Ardennite-(As) (TL) | 9.BJ.40 | Mn2+4Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 |
| ⓘ | Ardennite-(V) | 9.BJ.40 | Mn2+4Al4(AlMg)(VO4)(SiO4)2(Si3O10)(OH)6 |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Carpholite | 9.DB.05 | Mn2+Al2(Si2O6)(OH)4 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Pyrophyllite | 9.EC.10 | Al2Si4O10(OH)2 |
| ⓘ | Muscovite var. Alurgite | 9.EC.15 | K(Al,Mn3+)2(AlSi3O10)(OH)2 |
| ⓘ | var. Fuchsite | 9.EC.15 | K(Al,Cr)3Si3O10(OH)2 |
| ⓘ | var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Paragonite | 9.EC.15 | NaAl2(AlSi3O10)(OH)2 |
| ⓘ | Muscovite var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Margarite | 9.EC.30 | CaAl2(Al2Si2O10)(OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Chamosite | 9.EC.55 | Fe2+5Al(AlSi3O10)(OH)8 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Cookeite | 9.EC.55 | (LiAl4◻)[AlSi3O10](OH)8 |
| ⓘ | Sudoite | 9.EC.55 | Mg2Al3(AlSi3O10)(OH)8 |
| ⓘ | Dickite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Andesine | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | var. Bytownite | 9.FA.35 | (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ | var. Labradorite | 9.FA.35 | (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ | Albite var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Gonnardite | 9.GA.05 | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| ⓘ | Natrolite | 9.GA.05 | Na2Al2Si3O10 · 2H2O |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| ⓘ | Chabazite-Ca | 9.GD.10 | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| ⓘ | Stilbite-Ca | 9.GE.10 | NaCa4(Si27Al9)O72 · 28H2O |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Bastonite' | - | near K3(Mg,Fe,Fe,Al)5.5(Si,Al)8O22(OH)4 · 1.5H2O |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Clay minerals' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Glauconite' | - | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Psilomelane' ? | - | |
| ⓘ | 'Pumpellyite Subgroup' | - | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Wad' | - | |
| ⓘ | 'Leucoxene' | - | |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Andalusite-Kanonaite Series' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Blaubleibender Covellite' | - | |
| ⓘ | 'Florencite' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Manganese Oxides' | - | |
| ⓘ | 'Saussurite' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Ardennite' | - | |
| ⓘ | 'Pyrobitumen' | - | |
| ⓘ | 'Allanite Group' ? | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Muscovite var. Alurgite | K(Al,Mn3+)2(AlSi3O10)(OH)2 |
| H | ⓘ Arsenogoyazite | SrAl3(AsO4)(AsO3OH)(OH)6 |
| H | ⓘ Ardennite-(As) | Mn42+Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 |
| H | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| H | ⓘ Arsenoflorencite-(Ce) | CeAl3(AsO4)2(OH)6 |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| H | ⓘ Bassetite | Fe2+(UO2)2(PO4)2 · 10H2O |
| H | ⓘ Bastonite | near K3(Mg,Fe,Fe,Al)5.5(Si,Al)8O22(OH)4 · 1.5H2O |
| H | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| H | ⓘ Calcioancylite-(Ce) | (Ce,Ca,Sr)CO3(OH,H2O) |
| H | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| H | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| H | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| H | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| H | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| H | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| H | ⓘ Chernikovite | (H3O)2(UO2)2(PO4)2 · 6H2O |
| H | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| H | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| H | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Davreuxite | MnAl6Si4O17(OH)2 |
| H | ⓘ Dawsonite | NaAlCO3(OH)2 |
| H | ⓘ Diaspore | AlO(OH) |
| H | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| H | ⓘ Dumontite | Pb2(UO2)3O2(PO4)2 · 5H2O |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Epsomite | MgSO4 · 7H2O |
| H | ⓘ Euclase | BeAl(SiO4)(OH) |
| H | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| H | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| H | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| H | ⓘ Faustite | ZnAl6(PO4)4(OH)8 · 4H2O |
| H | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gonnardite | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| H | ⓘ Graemite | Cu[TeO3] · H2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hydroniumjarosite | (H3O)Fe33+(SO4)2(OH)6 |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Ice | H2O |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Lepidocrocite | Fe3+O(OH) |
| H | ⓘ Libethenite | Cu2(PO4)(OH) |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Lithiophorite | (Al,Li)MnO2(OH)2 |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Malhmoodite | FeZr(PO4)2 · 4H2O |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| H | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| H | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| H | ⓘ Montanite | Bi2(TeO6) · nH2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Nahcolite | NaHCO3 |
| H | ⓘ Nsutite | (Mn4+,Mn2+)(O,OH)2 |
| H | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| H | ⓘ Olivenite | Cu2(AsO4)(OH) |
| H | ⓘ Ottrélite | Mn2+Al2O(SiO4)(OH)2 |
| H | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| H | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| H | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| H | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| H | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| H | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| H | ⓘ Rhabdophane-(Ce) | Ce(PO4) · 0.6H2O |
| H | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| H | ⓘ Sabugalite | HAl(UO2)4(PO4)4 · 16H2O |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Strengite | FePO4 · 2H2O |
| H | ⓘ Sudoite | Mg2Al3(AlSi3O10)(OH)8 |
| H | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Teineite | Cu2+(Te4+O3) · 2H2O |
| H | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| H | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| H | ⓘ Uranosphaerite | Bi(UO2)O2(OH) |
| H | ⓘ Vantasselite | Al4(PO4)3(OH)3 · 9H2O |
| H | ⓘ Variscite | AlPO4 · 2H2O |
| H | ⓘ Volborthite | Cu3(V2O7)(OH)2 · 2H2O |
| H | ⓘ Wardite | NaAl3(PO4)2(OH)4 · 2H2O |
| H | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| H | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Zemannite | Mg0.5ZnFe3+(Te4+O3)3 · 4.5H2O |
| H | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| H | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Graulichite-(Ce) | CeFe33+(AsO4)2(OH)6 |
| H | ⓘ Pumpellyite-(Al) | Ca2AlAl2[Si2O6OH][SiO4](OH)2O |
| H | ⓘ Ardennite-(V) | Mn42+Al4(AlMg)(VO4)(SiO4)2(Si3O10)(OH)6 |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Li | Lithium | |
| Li | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Li | ⓘ Lithiophorite | (Al,Li)MnO2(OH)2 |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Euclase | BeAl(SiO4)(OH) |
| B | Boron | |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| C | ⓘ Calcioancylite-(Ce) | (Ce,Ca,Sr)CO3(OH,H2O) |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dawsonite | NaAlCO3(OH)2 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Nahcolite | NaHCO3 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| C | ⓘ Calcite var. Lublinite | CaCO3 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Muscovite var. Alurgite | K(Al,Mn3+)2(AlSi3O10)(OH)2 |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Arsenogoyazite | SrAl3(AsO4)(AsO3OH)(OH)6 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Ardennite-(As) | Mn42+Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 |
| O | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| O | ⓘ Arsenoflorencite-(Ce) | CeAl3(AsO4)2(OH)6 |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| O | ⓘ Balyakinite | Cu(TeO3) |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bassetite | Fe2+(UO2)2(PO4)2 · 10H2O |
| O | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| O | ⓘ Bastonite | near K3(Mg,Fe,Fe,Al)5.5(Si,Al)8O22(OH)4 · 1.5H2O |
| O | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bismite | Bi2O3 |
| O | ⓘ Brannerite | UTi2O6 |
| O | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Brookite | TiO2 |
| O | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| O | ⓘ Calcioancylite-(Ce) | (Ce,Ca,Sr)CO3(OH,H2O) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| O | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| O | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| O | ⓘ Celestine | SrSO4 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| O | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| O | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| O | ⓘ Chernikovite | (H3O)2(UO2)2(PO4)2 · 6H2O |
| O | ⓘ Andalusite var. Chiastolite | Al2(SiO4)O |
| O | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| O | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| O | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Davreuxite | MnAl6Si4O17(OH)2 |
| O | ⓘ Dawsonite | NaAlCO3(OH)2 |
| O | ⓘ Delafossite | Cu+Fe3+O2 |
| O | ⓘ Denningite | CaMn2+Te44+O10 |
| O | ⓘ Diaspore | AlO(OH) |
| O | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dumontite | Pb2(UO2)3O2(PO4)2 · 5H2O |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Epsomite | MgSO4 · 7H2O |
| O | ⓘ Euclase | BeAl(SiO4)(OH) |
| O | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| O | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| O | ⓘ Faustite | ZnAl6(PO4)4(OH)8 · 4H2O |
| O | ⓘ Gahnite | ZnAl2O4 |
| O | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gonnardite | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| O | ⓘ Graemite | Cu[TeO3] · H2O |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hausmannite | Mn2+Mn23+O4 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| O | ⓘ Hydroniumjarosite | (H3O)Fe33+(SO4)2(OH)6 |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Ice | H2O |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kanonaite | Mn3+Al(SiO4)O |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Lepidocrocite | Fe3+O(OH) |
| O | ⓘ Libethenite | Cu2(PO4)(OH) |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Lithiophorite | (Al,Li)MnO2(OH)2 |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malhmoodite | FeZr(PO4)2 · 4H2O |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| O | ⓘ Hematite var. Martite | Fe2O3 |
| O | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| O | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Molybdite | MoO3 |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Montanite | Bi2(TeO6) · nH2O |
| O | ⓘ Montroydite | HgO |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Nahcolite | NaHCO3 |
| O | ⓘ Nsutite | (Mn4+,Mn2+)(O,OH)2 |
| O | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Olivenite | Cu2(AsO4)(OH) |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Ottrélite | Mn2+Al2O(SiO4)(OH)2 |
| O | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| O | ⓘ Paratellurite | TeO2 |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| O | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| O | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| O | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| O | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rhabdophane-(Ce) | Ce(PO4) · 0.6H2O |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| O | ⓘ Quartz var. Rutilated Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Sabugalite | HAl(UO2)4(PO4)4 · 16H2O |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Sillénite | Bi12SiO20 |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Strengite | FePO4 · 2H2O |
| O | ⓘ Sudoite | Mg2Al3(AlSi3O10)(OH)8 |
| O | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| O | ⓘ Teineite | Cu2+(Te4+O3) · 2H2O |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| O | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Uranosphaerite | Bi(UO2)O2(OH) |
| O | ⓘ Vantasselite | Al4(PO4)3(OH)3 · 9H2O |
| O | ⓘ Variscite | AlPO4 · 2H2O |
| O | ⓘ Volborthite | Cu3(V2O7)(OH)2 · 2H2O |
| O | ⓘ Wardite | NaAl3(PO4)2(OH)4 · 2H2O |
| O | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| O | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zemannite | Mg0.5ZnFe3+(Te4+O3)3 · 4.5H2O |
| O | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Quartz var. Milky Quartz | SiO2 |
| O | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| O | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| O | ⓘ Strontiomelane | Sr(Mn64+Mn23+)O16 |
| O | ⓘ Andalusite var. Viridine | (Al,Mn3+)2SiO4O |
| O | ⓘ Andalusite-Kanonaite Series | |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Calcite var. Lublinite | CaCO3 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Graulichite-(Ce) | CeFe33+(AsO4)2(OH)6 |
| O | ⓘ Pumpellyite-(Al) | Ca2AlAl2[Si2O6OH][SiO4](OH)2O |
| O | ⓘ Stavelotite-(La) | (La,Nd,Ca)3Mn32+Cu(Mn3+,Fe3+,Mn4+)26(Si2O7)6O30 |
| O | ⓘ Ardennite-(V) | Mn42+Al4(AlMg)(VO4)(SiO4)2(Si3O10)(OH)6 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Rutile var. Sagenite (of Saussure) | TiO2 |
| O | ⓘ Wakefieldite-(Nd) | Nd(VO4) |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| F | Fluorine | |
| F | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Na | ⓘ Dawsonite | NaAlCO3(OH)2 |
| Na | ⓘ Gonnardite | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| Na | ⓘ Halite | NaCl |
| Na | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Nahcolite | NaHCO3 |
| Na | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Na | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Na | ⓘ Wardite | NaAl3(PO4)2(OH)4 · 2H2O |
| Na | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Na | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Ardennite-(As) | Mn42+Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 |
| Mg | ⓘ Bastonite | near K3(Mg,Fe,Fe,Al)5.5(Si,Al)8O22(OH)4 · 1.5H2O |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Epsomite | MgSO4 · 7H2O |
| Mg | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Sudoite | Mg2Al3(AlSi3O10)(OH)8 |
| Mg | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mg | ⓘ Zemannite | Mg0.5ZnFe3+(Te4+O3)3 · 4.5H2O |
| Mg | ⓘ Ardennite-(V) | Mn42+Al4(AlMg)(VO4)(SiO4)2(Si3O10)(OH)6 |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Muscovite var. Alurgite | K(Al,Mn3+)2(AlSi3O10)(OH)2 |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Arsenogoyazite | SrAl3(AsO4)(AsO3OH)(OH)6 |
| Al | ⓘ Ardennite-(As) | Mn42+Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 |
| Al | ⓘ Arsenoflorencite-(Ce) | CeAl3(AsO4)2(OH)6 |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Bastonite | near K3(Mg,Fe,Fe,Al)5.5(Si,Al)8O22(OH)4 · 1.5H2O |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Al | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| Al | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| Al | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Al | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Al | ⓘ Andalusite var. Chiastolite | Al2(SiO4)O |
| Al | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Al | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Davreuxite | MnAl6Si4O17(OH)2 |
| Al | ⓘ Dawsonite | NaAlCO3(OH)2 |
| Al | ⓘ Diaspore | AlO(OH) |
| Al | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Euclase | BeAl(SiO4)(OH) |
| Al | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| Al | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Al | ⓘ Faustite | ZnAl6(PO4)4(OH)8 · 4H2O |
| Al | ⓘ Gahnite | ZnAl2O4 |
| Al | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Al | ⓘ Gonnardite | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kanonaite | Mn3+Al(SiO4)O |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Lithiophorite | (Al,Li)MnO2(OH)2 |
| Al | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Ottrélite | Mn2+Al2O(SiO4)(OH)2 |
| Al | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| Al | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| Al | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| Al | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Al | ⓘ Sabugalite | HAl(UO2)4(PO4)4 · 16H2O |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Sudoite | Mg2Al3(AlSi3O10)(OH)8 |
| Al | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Al | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| Al | ⓘ Vantasselite | Al4(PO4)3(OH)3 · 9H2O |
| Al | ⓘ Variscite | AlPO4 · 2H2O |
| Al | ⓘ Wardite | NaAl3(PO4)2(OH)4 · 2H2O |
| Al | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Al | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Al | ⓘ Andalusite var. Viridine | (Al,Mn3+)2SiO4O |
| Al | ⓘ Andalusite-Kanonaite Series | |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Pumpellyite-(Al) | Ca2AlAl2[Si2O6OH][SiO4](OH)2O |
| Al | ⓘ Ardennite-(V) | Mn42+Al4(AlMg)(VO4)(SiO4)2(Si3O10)(OH)6 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Muscovite var. Alurgite | K(Al,Mn3+)2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Ardennite-(As) | Mn42+Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Bastonite | near K3(Mg,Fe,Fe,Al)5.5(Si,Al)8O22(OH)4 · 1.5H2O |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Si | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| Si | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Si | ⓘ Andalusite var. Chiastolite | Al2(SiO4)O |
| Si | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Si | ⓘ Davreuxite | MnAl6Si4O17(OH)2 |
| Si | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Euclase | BeAl(SiO4)(OH) |
| Si | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Si | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Si | ⓘ Gonnardite | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Kanonaite | Mn3+Al(SiO4)O |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Ottrélite | Mn2+Al2O(SiO4)(OH)2 |
| Si | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| Si | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| Si | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Quartz var. Rutilated Quartz | SiO2 |
| Si | ⓘ Sillénite | Bi12SiO20 |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Sudoite | Mg2Al3(AlSi3O10)(OH)8 |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Quartz var. Milky Quartz | SiO2 |
| Si | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Si | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Si | ⓘ Andalusite var. Viridine | (Al,Mn3+)2SiO4O |
| Si | ⓘ Andalusite-Kanonaite Series | |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Pumpellyite-(Al) | Ca2AlAl2[Si2O6OH][SiO4](OH)2O |
| Si | ⓘ Stavelotite-(La) | (La,Nd,Ca)3Mn32+Cu(Mn3+,Fe3+,Mn4+)26(Si2O7)6O30 |
| Si | ⓘ Ardennite-(V) | Mn42+Al4(AlMg)(VO4)(SiO4)2(Si3O10)(OH)6 |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | ⓘ Bassetite | Fe2+(UO2)2(PO4)2 · 10H2O |
| P | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| P | ⓘ Chernikovite | (H3O)2(UO2)2(PO4)2 · 6H2O |
| P | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Dumontite | Pb2(UO2)3O2(PO4)2 · 5H2O |
| P | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Faustite | ZnAl6(PO4)4(OH)8 · 4H2O |
| P | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Libethenite | Cu2(PO4)(OH) |
| P | ⓘ Malhmoodite | FeZr(PO4)2 · 4H2O |
| P | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Rhabdophane-(Ce) | Ce(PO4) · 0.6H2O |
| P | ⓘ Sabugalite | HAl(UO2)4(PO4)4 · 16H2O |
| P | ⓘ Strengite | FePO4 · 2H2O |
| P | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| P | ⓘ Vantasselite | Al4(PO4)3(OH)3 · 9H2O |
| P | ⓘ Variscite | AlPO4 · 2H2O |
| P | ⓘ Wardite | NaAl3(PO4)2(OH)4 · 2H2O |
| P | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Anilite | Cu7S4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Balkanite | Cu9Ag5HgS8 |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| S | ⓘ Celestine | SrSO4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| S | ⓘ Covellite | CuS |
| S | ⓘ Danielsite | (Cu,Ag)14HgS8 |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Djurleite | Cu31S16 |
| S | ⓘ Epsomite | MgSO4 · 7H2O |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Hydroniumjarosite | (H3O)Fe33+(SO4)2(OH)6 |
| S | ⓘ Idaite | Cu5FeS6 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| S | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Spionkopite | Cu39S28 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Wittichenite | Cu3BiS3 |
| S | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Yarrowite | Cu9S8 |
| Cl | Chlorine | |
| Cl | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cl | ⓘ Halite | NaCl |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Muscovite var. Alurgite | K(Al,Mn3+)2(AlSi3O10)(OH)2 |
| K | ⓘ Bastonite | near K3(Mg,Fe,Fe,Al)5.5(Si,Al)8O22(OH)4 · 1.5H2O |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| K | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| K | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| K | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| K | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Ca | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Ca | ⓘ Calcioancylite-(Ce) | (Ce,Ca,Sr)CO3(OH,H2O) |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Ca | ⓘ Denningite | CaMn2+Te44+O10 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gonnardite | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| Ca | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| Ca | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Ca | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Calcite var. Lublinite | CaCO3 |
| Ca | ⓘ Pumpellyite-(Al) | Ca2AlAl2[Si2O6OH][SiO4](OH)2O |
| Ca | ⓘ Stavelotite-(La) | (La,Nd,Ca)3Mn32+Cu(Mn3+,Fe3+,Mn4+)26(Si2O7)6O30 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brannerite | UTi2O6 |
| Ti | ⓘ Brookite | TiO2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Ti | ⓘ Rutile var. Sagenite (of Saussure) | TiO2 |
| V | Vanadium | |
| V | ⓘ Volborthite | Cu3(V2O7)(OH)2 · 2H2O |
| V | ⓘ Ardennite-(V) | Mn42+Al4(AlMg)(VO4)(SiO4)2(Si3O10)(OH)6 |
| V | ⓘ Wakefieldite-(Nd) | Nd(VO4) |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Mn | Manganese | |
| Mn | ⓘ Muscovite var. Alurgite | K(Al,Mn3+)2(AlSi3O10)(OH)2 |
| Mn | ⓘ Ardennite-(As) | Mn42+Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 |
| Mn | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Mn | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| Mn | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| Mn | ⓘ Davreuxite | MnAl6Si4O17(OH)2 |
| Mn | ⓘ Denningite | CaMn2+Te44+O10 |
| Mn | ⓘ Hausmannite | Mn2+Mn23+O4 |
| Mn | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| Mn | ⓘ Kanonaite | Mn3+Al(SiO4)O |
| Mn | ⓘ Lithiophorite | (Al,Li)MnO2(OH)2 |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Nsutite | (Mn4+,Mn2+)(O,OH)2 |
| Mn | ⓘ Ottrélite | Mn2+Al2O(SiO4)(OH)2 |
| Mn | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mn | ⓘ Strontiomelane | Sr(Mn64+Mn23+)O16 |
| Mn | ⓘ Andalusite var. Viridine | (Al,Mn3+)2SiO4O |
| Mn | ⓘ Andalusite-Kanonaite Series | |
| Mn | ⓘ Stavelotite-(La) | (La,Nd,Ca)3Mn32+Cu(Mn3+,Fe3+,Mn4+)26(Si2O7)6O30 |
| Mn | ⓘ Ardennite-(V) | Mn42+Al4(AlMg)(VO4)(SiO4)2(Si3O10)(OH)6 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| Fe | ⓘ Bassetite | Fe2+(UO2)2(PO4)2 · 10H2O |
| Fe | ⓘ Bastonite | near K3(Mg,Fe,Fe,Al)5.5(Si,Al)8O22(OH)4 · 1.5H2O |
| Fe | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bogdanovite | (Au,Te,Pb)3(Cu,Fe) |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| Fe | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Fe | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Fe | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Delafossite | Cu+Fe3+O2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Fe | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hydroniumjarosite | (H3O)Fe33+(SO4)2(OH)6 |
| Fe | ⓘ Idaite | Cu5FeS6 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| Fe | ⓘ Lepidocrocite | Fe3+O(OH) |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Malhmoodite | FeZr(PO4)2 · 4H2O |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Hematite var. Martite | Fe2O3 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| Fe | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Strengite | FePO4 · 2H2O |
| Fe | ⓘ Zemannite | Mg0.5ZnFe3+(Te4+O3)3 · 4.5H2O |
| Fe | ⓘ Graulichite-(Ce) | CeFe33+(AsO4)2(OH)6 |
| Fe | ⓘ Stavelotite-(La) | (La,Nd,Ca)3Mn32+Cu(Mn3+,Fe3+,Mn4+)26(Si2O7)6O30 |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Ni | Nickel | |
| Ni | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| Ni | ⓘ Melonite | NiTe2 |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Melonite var. Palladium-bearing Melonite | (Ni,Pd)Te2 |
| Cu | Copper | |
| Cu | ⓘ Anilite | Cu7S4 |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Balkanite | Cu9Ag5HgS8 |
| Cu | ⓘ Balyakinite | Cu(TeO3) |
| Cu | ⓘ Bogdanovite | (Au,Te,Pb)3(Cu,Fe) |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Danielsite | (Cu,Ag)14HgS8 |
| Cu | ⓘ Delafossite | Cu+Fe3+O2 |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Djurleite | Cu31S16 |
| Cu | ⓘ Graemite | Cu[TeO3] · H2O |
| Cu | ⓘ Idaite | Cu5FeS6 |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Libethenite | Cu2(PO4)(OH) |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| Cu | ⓘ Olivenite | Cu2(AsO4)(OH) |
| Cu | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| Cu | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| Cu | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Cu | ⓘ Spionkopite | Cu39S28 |
| Cu | ⓘ Teineite | Cu2+(Te4+O3) · 2H2O |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Cu | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| Cu | ⓘ Volborthite | Cu3(V2O7)(OH)2 · 2H2O |
| Cu | ⓘ Wittichenite | Cu3BiS3 |
| Cu | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Yarrowite | Cu9S8 |
| Cu | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| Cu | ⓘ Stavelotite-(La) | (La,Nd,Ca)3Mn32+Cu(Mn3+,Fe3+,Mn4+)26(Si2O7)6O30 |
| Zn | Zinc | |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Faustite | ZnAl6(PO4)4(OH)8 · 4H2O |
| Zn | ⓘ Gahnite | ZnAl2O4 |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Zemannite | Mg0.5ZnFe3+(Te4+O3)3 · 4.5H2O |
| As | Arsenic | |
| As | ⓘ Arsenogoyazite | SrAl3(AsO4)(AsO3OH)(OH)6 |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Ardennite-(As) | Mn42+Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 |
| As | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| As | ⓘ Arsenoflorencite-(Ce) | CeAl3(AsO4)2(OH)6 |
| As | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| As | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| As | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| As | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Olivenite | Cu2(AsO4)(OH) |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| As | ⓘ Graulichite-(Ce) | CeFe33+(AsO4)2(OH)6 |
| Se | Selenium | |
| Se | ⓘ Bohdanowiczite | AgBiSe2 |
| Se | ⓘ Clausthalite | PbSe |
| Se | ⓘ Naumannite | Ag2Se |
| Se | ⓘ Tiemannite | HgSe |
| Sr | Strontium | |
| Sr | ⓘ Arsenogoyazite | SrAl3(AsO4)(AsO3OH)(OH)6 |
| Sr | ⓘ Calcioancylite-(Ce) | (Ce,Ca,Sr)CO3(OH,H2O) |
| Sr | ⓘ Celestine | SrSO4 |
| Sr | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Sr | ⓘ Strontiomelane | Sr(Mn64+Mn23+)O16 |
| Y | Yttrium | |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Zr | Zirconium | |
| Zr | ⓘ Malhmoodite | FeZr(PO4)2 · 4H2O |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Molybdite | MoO3 |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Pd | Palladium | |
| Pd | ⓘ Melonite var. Palladium-bearing Melonite | (Ni,Pd)Te2 |
| Pd | ⓘ Native Gold var. Porpezite | (Au,Pd) |
| Pd | ⓘ Native Gold var. Palladium-bearing Gold | (Au,Pd) |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Balkanite | Cu9Ag5HgS8 |
| Ag | ⓘ Bohdanowiczite | AgBiSe2 |
| Ag | ⓘ Danielsite | (Cu,Ag)14HgS8 |
| Ag | ⓘ Hessite | Ag2Te |
| Ag | ⓘ Naumannite | Ag2Se |
| Ag | ⓘ Native Silver | Ag |
| Sb | Antimony | |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Te | Tellurium | |
| Te | ⓘ Altaite | PbTe |
| Te | ⓘ Balyakinite | Cu(TeO3) |
| Te | ⓘ Bogdanovite | (Au,Te,Pb)3(Cu,Fe) |
| Te | ⓘ Denningite | CaMn2+Te44+O10 |
| Te | ⓘ Graemite | Cu[TeO3] · H2O |
| Te | ⓘ Hessite | Ag2Te |
| Te | ⓘ Melonite | NiTe2 |
| Te | ⓘ Montanite | Bi2(TeO6) · nH2O |
| Te | ⓘ Paratellurite | TeO2 |
| Te | ⓘ Teineite | Cu2+(Te4+O3) · 2H2O |
| Te | ⓘ Native Tellurium | Te |
| Te | ⓘ Tellurobismuthite | Bi2Te3 |
| Te | ⓘ Zemannite | Mg0.5ZnFe3+(Te4+O3)3 · 4.5H2O |
| Te | ⓘ Melonite var. Palladium-bearing Melonite | (Ni,Pd)Te2 |
| Ba | Barium | |
| Ba | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| Ba | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| La | Lanthanum | |
| La | ⓘ Stavelotite-(La) | (La,Nd,Ca)3Mn32+Cu(Mn3+,Fe3+,Mn4+)26(Si2O7)6O30 |
| Ce | Cerium | |
| Ce | ⓘ Arsenoflorencite-(Ce) | CeAl3(AsO4)2(OH)6 |
| Ce | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| Ce | ⓘ Calcioancylite-(Ce) | (Ce,Ca,Sr)CO3(OH,H2O) |
| Ce | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Ce | ⓘ Rhabdophane-(Ce) | Ce(PO4) · 0.6H2O |
| Ce | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ce | ⓘ Graulichite-(Ce) | CeFe33+(AsO4)2(OH)6 |
| Nd | Neodymium | |
| Nd | ⓘ Stavelotite-(La) | (La,Nd,Ca)3Mn32+Cu(Mn3+,Fe3+,Mn4+)26(Si2O7)6O30 |
| Nd | ⓘ Wakefieldite-(Nd) | Nd(VO4) |
| Au | Gold | |
| Au | ⓘ Bogdanovite | (Au,Te,Pb)3(Cu,Fe) |
| Au | ⓘ Native Gold | Au |
| Au | ⓘ Native Gold var. Porpezite | (Au,Pd) |
| Au | ⓘ Native Gold var. Palladium-bearing Gold | (Au,Pd) |
| Hg | Mercury | |
| Hg | ⓘ Balkanite | Cu9Ag5HgS8 |
| Hg | ⓘ Danielsite | (Cu,Ag)14HgS8 |
| Hg | ⓘ Montroydite | HgO |
| Hg | ⓘ Tiemannite | HgSe |
| Pb | Lead | |
| Pb | ⓘ Altaite | PbTe |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Bogdanovite | (Au,Te,Pb)3(Cu,Fe) |
| Pb | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Pb | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Clausthalite | PbSe |
| Pb | ⓘ Dumontite | Pb2(UO2)3O2(PO4)2 · 5H2O |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| Pb | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| Pb | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Pb | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Bi | Bismuth | |
| Bi | ⓘ Bismite | Bi2O3 |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bohdanowiczite | AgBiSe2 |
| Bi | ⓘ Montanite | Bi2(TeO6) · nH2O |
| Bi | ⓘ Sillénite | Bi12SiO20 |
| Bi | ⓘ Tellurobismuthite | Bi2Te3 |
| Bi | ⓘ Uranosphaerite | Bi(UO2)O2(OH) |
| Bi | ⓘ Wittichenite | Cu3BiS3 |
| U | Uranium | |
| U | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | ⓘ Bassetite | Fe2+(UO2)2(PO4)2 · 10H2O |
| U | ⓘ Brannerite | UTi2O6 |
| U | ⓘ Chernikovite | (H3O)2(UO2)2(PO4)2 · 6H2O |
| U | ⓘ Dumontite | Pb2(UO2)3O2(PO4)2 · 5H2O |
| U | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| U | ⓘ Sabugalite | HAl(UO2)4(PO4)4 · 16H2O |
| U | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Uranosphaerite | Bi(UO2)O2(OH) |
| U | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
Fossils
There are 227 fossil localities from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 227 |
|---|---|
| Youngest Fossil Listed | 113 Ma (Early/Lower Cretaceous) |
| Oldest Fossil Listed | 419 Ma (Early/Lower Devonian) |
| Stratigraphic Units | Click here to view 16 stratigraphic units. |
| Fossils from Region | Click here to show the list. |
| Fossil Localities | Click to show 40 fossil localities |
- Wallonia
- Luxembourg
- Devonian🐚 Affleurment du Bois le Pretre
- Early/Lower Cretaceous🐚 AP4mm-Jura
- Early Jurassic🐚 Athus
- Mesozoic🐚 Attert
- Jurassic🐚 Aubange
- Early Jurassic🐚 Bonnert
- Early Jurassic🐚 Chou valley
- Early Jurassic🐚 Cote Rouge
- Early Jurassic🐚 Differt
- Late/Upper Devonian🐚 Durbuy 5337
- Late/Upper Devonian🐚 Durbuy 8158: 500 m NE de Ny
- Early Jurassic🐚 Fouches
- Mesozoic🐚 Habay-la-Vieille
- Jurassic🐚 Halanzy
- Jurassic🐚 Halanzy
- Mesozoic🐚 HLV-3
- Early Jurassic🐚 Huombois quarry
- Early Jurassic🐚 Montauban
- Early Jurassic🐚 Northwest of Ethe
- Early Jurassic🐚 Ophiuroidea
- Luxembourg
- Wallonia
- Luxembourg
- Late/Upper Devonian🐚 Quarry of Val-Dieu-Charneux
- Early Jurassic🐚 Quarry on east side of Rabay valley
- Early Jurassic🐚 Quarry on the south side Etalle-Vitron road
- Early Jurassic🐚 Railway trench near Bar farm
- Early Jurassic🐚 Railway trench north of Muno station
- Early Jurassic🐚 Robelmont
- Mesozoic🐚 S-1
- Early Jurassic🐚 Stockem
- Early Jurassic🐚 Stockem Temnodontosaurus
- Mesozoic🐚 UDK
- Bastogne
- Durbuy
- Marche-en-Famenne
- Namur
- Luxembourg
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Luxembourg_(Belgium) |
|---|---|
| Wikidata ID: | Q1126 |
| GeoNames ID: | 2791993 |
Localities in this Region
- Wallonia
- Luxembourg
- Wallonia
- Luxembourg
- Libramont-Chevigny
- ⭔Manhay
- ⭔Marche-en-Famenne
- ⭔Martelange
- ⭔Messancy
- ⭔Musson
- ⭔Nassogne
- ⭔Neufchâteau
- ⭔Paliseul
- ⭔Rendeux
- ⭔Rouvroy
- ⭔Saint-Hubert
- ⭔Sainte-Ode
- ⭔Tellin
- ⭔Tenneville
- ⭔Tintigny
- ⭔Vaux-sur-Sûre
- ⭔Vielsalm
- ⭔Virton
- ⭔Wellin
- Luxembourg
Other Regions, Features and Areas that Intersect
Belgium
- Wallonia
- Luxembourg
- Libramont-Chevigny
- Serpont massifMassif
- Libramont-Chevigny
- Luxembourg
Eurasian PlateTectonic Plate
- Rheno-Hercynian BeltOrogenic Belt
EuropeContinent
- Ardennes MountainsMountain Range
- Rhenish MassifMassif
- Stavelot MassifMassif
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions
Lead mine, Longvilly, Bastogne, Luxembourg, Wallonia, Belgium