This page is currently not sponsored. Click here to sponsor this page.
Type:
Other Languages:
French:
Comté d'Örebro, Suède
German:
Örebro län, Schweden
Italian:
Contea di Örebro, Svezia
Russian:
Эребру, Швеция
Simplified Chinese:
厄勒布鲁省, 瑞典
Spanish:
Provincia de Örebro, Suecia
Swedish:
Örebro län, Sverige
Arabic:
محافظة اوربرو, السويد
Asturian:
Provincia d'Örebro, Suecia
Basque:
Örebroko konderria, Suedia
Belarusian:
Эрэбру, Швецыя
Belarusian (Tarashkevitsa):
Эрэбру, Швэцыя
Bosnian:
Kotar Örebro, Švedska
Bulgarian:
Йоребру, Швеция
Catalan:
Comtat d'Örebro, Suècia
Cebuano:
Örebro län, Suwesya
Cornish:
Konteth Örebro, Swedherwyk
Croatian:
Županija Örebro, Švedska
Czech:
Örebro, Švédsko
Danish:
Örebro län, Sverige
Dutch:
Örebro län, Zweden
Esperanto:
Örebro län, Svedio
Estonian:
Örebro lään, Rootsi
Faroese:
Örebro län, Svøríki
Farsi/Persian:
شهرستان اوربرو, سوئد
Finnish:
Örebron lääni, Ruotsi
Galician:
Condado de Örebro, Suecia
Hebrew:
ארברו, שוודיה
Hindi:
ओरेब्रो लैन, स्वीडन
Hungarian:
Örebro megye, Svédország
Indonesian:
Daerah Örebro, Swedia
Japanese:
エレブルー県, スウェーデン
Korean:
외레브로주, 스웨덴
Latvian:
Erebrū lēne, Zviedrija
Limburgian:
Örebro län, Zwede
Lithuanian:
Erebru lėnas, Švedija
Low Saxon/Low German:
Lehn Örebro, Sweden
Macedonian:
Еребру, Шведска
Malay:
Daerah Örebro, Sweden
Northern Sami:
Örebro leatna, Ruoŧŧa
Norwegian:
Örebro län, Sverige
Norwegian (Nynorsk):
Örebro län, Sverige
Polish:
Örebro, Szwecja
Portuguese:
Örebro, Suécia
Romanian:
Örebro län, Suedia
Scots:
Örebro Coonty, Swaden
Scottish Gaelic:
Örebro län, An t-Suain
Serbian:
Еребро, Шведска
Serbo-Croatian:
Örebro, Švedska
Slovak:
Örebro, Švédsko
Swahili:
Örebro län, Uswidi
Turkish:
Örebro ili, İsveç
Ukrainian:
Еребру, Швеція
Urdu:
اوریبرو کاؤنٹی, سویڈن
Vietnamese:
Örebro, Thụy Điển
Volapük:
Lörebroiän, Svedän
Waray:
Condado han Örebro, Suwesya
West Frisian:
Örebro län, Sweden
Örebro County (Swedish: Örebro län) is a county or län in central Sweden. It borders the counties of Västra Götaland, Värmland, Dalarna, Västmanland, Södermanland and Östergötland. It is frequently culturally divided into the hilly northern region of Bergslagen, where mining and metallurgic industry have been important since the Middle Ages, and the southern Mälardalen of lakes and farms.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities266 valid minerals. 9 (TL) - type locality of valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S |
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 Localities: Reported from at least 34 localities in this region. |
| ⓘ 'Actinolite-Tremolite Series' |
| ⓘ Aegirine Formula: NaFe3+Si2O6 |
| ⓘ Aegirine-augite Formula: (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 Localities: |
| ⓘ Aegirine-augite var. Urbanite Formula: (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 Localities: |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reported from at least 11 localities in this region. |
| ⓘ Albite var. Andesine Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ Allactite Formula: Mn2+7(AsO4)2(OH)8 Description: Originally described as "elfstorpite" by Igelström (1883). The holotype material and other specimens of ‘elfstorpite’ was investigated by powder X-ray diffraction and chemical analysis, and found that it was indistinguishable from allactite (Fontan et al 2004). Elfstorpite is now descredited. |
| ⓘ Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) Localities: Reported from at least 12 localities in this region. |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) Localities: Reported from at least 12 localities in this region. |
| ⓘ Allargentum Formula: (Ag1-xSbx) Localities: Björskogsnäs, Grythyttan, Hällefors, Örebro County, Sweden Gamla Mines (Old mines), Hällefors silver mines, Hällefors, Örebro County, Sweden Västra ore field (Western field), Hällefors silver mines, Hällefors, Örebro County, Sweden Mellan ore field (Middle field), Hällefors silver mines, Hällefors, Örebro County, Sweden Hällefors silver mines, Hällefors, Örebro County, Sweden |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 Localities: Reported from at least 13 localities in this region. |
| ⓘ Amesite Formula: Mg2Al(AlSiO5)(OH)4 Habit: short hexagonal prisms Description: Found in zinc ore. |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5(T8O22)W2 Localities: Reported from at least 12 localities in this region. |
| ⓘ 'Amphibole Supergroup var. Clinoamphibole' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ Anatase Formula: TiO2 |
| ⓘ Andalusite Formula: Al2(SiO4)O Localities: Reported from at least 9 localities in this region. |
| ⓘ Andersonite Formula: Na2Ca(UO2)(CO3)3 · 5.33H2O |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 Localities: Reported from at least 6 localities in this region. |
| ⓘ Anthophyllite Formula: ◻Mg2Mg5(Si8O22)(OH)2 Localities: Reported from at least 10 localities in this region. |
| ⓘ Antigorite Formula: Mg3(Si2O5)(OH)4 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A Localities: Reported from at least 25 localities in this region. |
| ⓘ 'Apophyllite Group' Formula: AB4[Si8O20]X · 8H2O |
| ⓘ Argentopentlandite Formula: Ag(Fe,Ni)8S8 |
| ⓘ Argentotetrahedrite-(Fe) Formula: Ag6(Cu4Fe2)Sb4S12S |
| ⓘ Arseniopleite (TL) Formula: NaCaMnMn2(AsO4)3 Type Locality: |
| ⓘ Arsenopyrite Formula: FeAsS Localities: Reported from at least 21 localities in this region. |
| ⓘ 'Asbestos' |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 Localities: |
| ⓘ Augite var. Jeffersonite Formula: Ca(Mn,Zn,Fe)Si2O6 |
| ⓘ Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O References: The Swedish Museum of Natural History, Stockholm (Naturhistoriska riksmuseet) CollectionsIdentification: Dealer/Collection Label |
| ⓘ Axinite-(Fe) Formula: Ca2Fe2+Al2BSi4O15OH |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 Localities: Björskogsnäs, Grythyttan, Hällefors, Örebro County, Sweden Yxsjö ore field, Ljusnarsberg, Örebro County, Sweden Hasselhöjden, Grythyttan, Hällefors, Örebro County, Sweden Gamla Mines (Old mines), Hällefors silver mines, Hällefors, Örebro County, Sweden Hällefors silver mines, Hällefors, Örebro County, Sweden |
| ⓘ Banalsite Formula: Na2BaAl4Si4O16 References: |
| ⓘ Bannisterite Formula: (Ca,K,Na)(Mn2+,Fe2+)10(Si,Al)16O38(OH)8 · nH2O |
| ⓘ Barylite Formula: Be2Ba(Si2O7) |
| ⓘ Barysilite Formula: Pb8Mn2+[Si2O7]3 |
| ⓘ Baryte Formula: BaSO4 Localities: Reported from at least 10 localities in this region. |
| ⓘ Barytocalcite Formula: BaCa(CO3)2 |
| ⓘ 'Basiliite' |
| ⓘ Bastnäsite-(Ce) Formula: Ce(CO3)F |
| ⓘ Bementite Formula: Mn7Si6O15(OH)8 |
| ⓘ Benavidesite Formula: Pb4MnSb6S14 |
| ⓘ Berthierite Formula: FeSb2S4 |
| ⓘ Bertrandite Formula: Be4(Si2O7)(OH)2 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Localities: Reported from at least 7 localities in this region. |
| ⓘ Berzeliite Formula: (NaCa2)Mg2(AsO4)3 Description: Is sometimes misIDed for Sarkinite References: |
| ⓘ Bindheimite Formula: Pb2Sb2O6O |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Reported from at least 26 localities in this region. |
| ⓘ 'Biotite var. Manganophyllite' Formula: K(Fe,Mg,Mn)3AlSi3O10(OH)2 |
| ⓘ Bismite Formula: Bi2O3 |
| ⓘ Bismuthinite Formula: Bi2S3 Localities: Reported from at least 17 localities in this region. |
| ⓘ Bismuthinite var. Antimony-bearing Bismuthinite Formula: (Bi,Sb)2S3 |
| ⓘ Bornite Formula: Cu5FeS4 Localities: Reported from at least 10 localities in this region. |
| ⓘ Boulangerite Formula: Pb5Sb4S11 Localities: Reported from at least 7 localities in this region. |
| ⓘ Bournonite Formula: PbCuSbS3 Localities: Reported from at least 7 localities in this region. |
| ⓘ Brannerite Formula: UTi2O6 |
| ⓘ Braunite Formula: Mn2+Mn3+6(SiO4)O8 Localities: Gladtjärns Mine, Nyberget ore field, Nyberget, Lindesberg, Örebro County, Sweden Mangruvan, Nyberget ore field, Nyberget, Lindesberg, Örebro County, Sweden Sjögruvan, Grythyttan, Hällefors, Örebro County, Sweden Nyberget ore field, Nyberget, Lindesberg, Örebro County, Sweden Slöjdartorp, Nyberget ore field, Nyberget, Lindesberg, Örebro County, Sweden |
| ⓘ Breithauptite Formula: NiSb Localities: Zinkgruvan mine, Zinkgruvan, Askersund, Örebro County, Sweden Håkansboda, Stråssa, Lindesberg, Örebro County, Sweden Björskogsnäs, Grythyttan, Hällefors, Örebro County, Sweden Burkland Cu deposit, Knalla Mine, Zinkgruvan mine, Zinkgruvan, Askersund, Örebro County, Sweden Kaveltorp Mines, Kopparberg, Ljusnarsberg, Örebro County, Sweden |
| ⓘ Brookite Formula: TiO2 |
| ⓘ Brucite Formula: Mg(OH)2 Localities: Habit: Flaky, rosetts Colour: Colorless to greenish Description: Up to a meter sized zone in the contact with a metagabbro. Crystals up to 5 cm. |
| ⓘ Bustamite Formula: CaMn2+(Si2O6) |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 41 localities in this region. Colour: White, Grey Fluorescence: Weak fluorescence yellow or red Description: White or grey scalenohedrons up to 150 mm, also as smaller crystals in other crystal habits. Grey coloured by microscopic pyrite/marcasite inclusions. |
| ⓘ Calcite var. Manganese-bearing Calcite Formula: (Ca,Mn)CO3 |
| ⓘ 'Calcium Amphibole Subgroup' Formula: AnCa2(C2+5-mC3+m)(Si8-(n+m)Al(n+m))W2 |
| ⓘ 'Calcium Amphibole Subgroup var. Hornblende' Formula: AnCa2(Z2+5-mZ3+m)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| ⓘ Carnotite Formula: K2(UO2)2(VO4)2 · 3H2O References: The Swedish Museum of Natural History, Stockholm (Naturhistoriska riksmuseet) CollectionsIdentification: Dealer/Collection Label |
| ⓘ Caryinite Formula: (Na,Pb)(Ca,Na)CaMn2+2(AsO4)3 |
| ⓘ Cassiterite Formula: SnO2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Celsian Formula: Ba(Al2Si2O8) |
| ⓘ Cerchiaraite-(Al) Formula: Ba4Al4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl References: Cámara, Fernando, Holtstam, Dan, Jansson, Nils, Jonsson, Erik, Karlsson, Andreas, Langhof, Jörgen, Majka, Jaroslaw, Zetterqvist, Anders (2021) Zinkgruvanite, Ba4Mn2+4Fe3+2(Si2O7)2(SO4)2O2(OH)2, a new ericssonite-group mineral from the Zinkgruvan Zn-Pb-Ag-Cu deposit, Askersund, Örebro County, Sweden. European Journal of Mineralogy, 33 (6) 659-673 doi:10.5194/ejm-33-659-2021 |
| ⓘ Cerchiaraite-(Fe) Formula: Ba4Fe3+4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl References: Cámara, Fernando, Holtstam, Dan, Jansson, Nils, Jonsson, Erik, Karlsson, Andreas, Langhof, Jörgen, Majka, Jaroslaw, Zetterqvist, Anders (2021) Zinkgruvanite, Ba4Mn2+4Fe3+2(Si2O7)2(SO4)2O2(OH)2, a new ericssonite-group mineral from the Zinkgruvan Zn-Pb-Ag-Cu deposit, Askersund, Örebro County, Sweden. European Journal of Mineralogy, 33 (6) 659-673 doi:10.5194/ejm-33-659-2021 |
| ⓘ Cerite-(CeCa) Formula: (Ce7Ca2)◻Mg(SiO4)3(SiO3OH)4(OH)3 |
| ⓘ Cerussite Formula: PbCO3 Habit: Different shapes. Twins are common Colour: light brown nearly colorless to reddish brown Description: Crystals up to 20 mm, normally only few millimeters. References: |
| ⓘ Chalcocite Formula: Cu2S Localities: Reported from at least 8 localities in this region. |
| ⓘ 'Chalcocite-Digenite Group' |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 63 localities in this region. |
| ⓘ 'Chlorite Group' Localities: Reported from at least 23 localities in this region. |
| ⓘ Chloritoid Formula: Fe2+Al2O(SiO4)(OH)2 |
| ⓘ 'Chloroarsenian' |
| ⓘ Chondrodite Formula: Mg5(SiO4)2F2 Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Chondrostibian' |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 |
| ⓘ Chrysoberyl Formula: BeAl2O4 |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ Chrysotile Formula: Mg3(Si2O5)(OH)4 |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinochlore var. Diabantite Formula: (Mg,Fe,Al)6((Si,Al)4O10)(OH)8 |
| ⓘ Clino-ferro-suenoite Formula: ◻Mn2+2(Fe2+5)(Si8O22)(OH)2 Localities: Reported from at least 10 localities in this region. |
| ⓘ Clinohumite Formula: Mg9(SiO4)4F2 |
| ⓘ 'Clinopyroxene Subgroup' |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Cobaltite Formula: CoAsS Localities: Reported from at least 11 localities in this region. Description: but of course today not an easy pick!
Great specimen in Natural History Museum, Stockholm 8 x 8 cm single xx [see Bancroft, Peter (1973) The World's Finest Minerals and Crystals]. |
| ⓘ Cobaltpentlandite Formula: Co9S8 References: |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' |
| ⓘ Cordierite Formula: Mg2Al4Si5O18 Localities: Reported from at least 16 localities in this region. |
| ⓘ Corundum Formula: Al2O3 |
| ⓘ Costibite Formula: CoSbS |
| ⓘ Covellite Formula: CuS Localities: |
| ⓘ Cubanite Formula: CuFe2S3 Localities: Reported from at least 8 localities in this region. |
| ⓘ Cummingtonite Formula: ◻Mg2Mg5(Si8O22)(OH)2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Cuprite Formula: Cu2O Habit: Grains Colour: Red Description: As thin film on copper |
| ⓘ Danalite Formula: Be3Fe2+4(SiO4)3S |
| ⓘ Datolite Formula: CaB(SiO4)(OH) |
| ⓘ Digenite Formula: Cu9S5 |
| ⓘ Diopside Formula: CaMgSi2O6 Localities: Reported from at least 34 localities in this region. |
| ⓘ Diopside var. Schefferite Formula: (Ca,Mn)(Mg,Fe,Mn)Si2O6 |
| ⓘ Djurleite Formula: Cu31S16 |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: Reported from at least 15 localities in this region. |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: Reported from at least 10 localities in this region. |
| ⓘ Dyscrasite Formula: Ag3Sb |
| ⓘ Eckermannite ? Formula: NaNa2(Mg4Al}Si8O22(OH)2 Description: Need to be checked if it can be assigned to eckermannite according to the redefinition by IMA (IMA2013-136). References: |
| ⓘ Emplectite Formula: CuBiS2 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: Reported from at least 34 localities in this region. |
| ⓘ Fayalite Formula: Fe2+2(SiO4) |
| ⓘ 'Fayalite-Forsterite Series' |
| ⓘ 'Fayalite-Tephroite Series' Localities: Reported from at least 13 localities in this region. |
| ⓘ 'Fayalite-Tephroite Series var. Knebelite' Formula: from (Fe1.5Mn0.5)2SiO4 to (Mn1.5Fe0.5)2SiO4 Localities: Reported from at least 13 localities in this region. |
| ⓘ Feitknechtite Formula: Mn3+O(OH) |
| ⓘ 'Feldspar Group' Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Feldspar Group var. Perthite' |
| ⓘ Ferberite Formula: FeWO4 |
| ⓘ Ferriallanite-(Ce) Formula: (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) Localities: Description: According to Kjell Gatedal, jan. 2006, it may be the unnamed Mg-analogue of ferriallanite-(Ce). However Holtstam & Andersson (2007) describes ferriallanite-(Ce) as occuring at this locality. |
| ⓘ Ferriperbøeite-(Ce) Formula: CaCe3(Fe3+Al2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| ⓘ Ferri-winchite Formula: ◻(NaCa)(Mg4Fe3+)Si8O22(OH)2 |
| ⓘ Ferro-hornblende ? Formula: ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 |
| ⓘ Ferro-richterite Formula: Na(CaNa)Fe2+5(Si8O22)(OH)2 |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorapatite var. Manganapatite Formula: Ca5(PO4)3F References: |
| ⓘ Fluorite Formula: CaF2 Localities: Reported from at least 32 localities in this region. |
| ⓘ 'Fluor-uvite-Uvite Series' Colour: Reddish brown Description: In clacite filled vugs or as crystals in massive mica. Up to 10 mm. |
| ⓘ Forsterite Formula: Mg2(SiO4) |
| ⓘ Franklinite Formula: Zn2+Fe3+2O4 Habit: Cubic singel crystals Colour: Black, small crystals brown in thin section. Description: This is the first recorded V variety of franklinite.
Some crystals can hold up to 20%atom V (K. Gatedal commentary). The samples analyzed by Holtstam shows tht theiy are low in MnO, and high in Ca and in particular V (corresponding to 3.5–7.6 wt.% V2O5). |
| ⓘ 'Freibergite Subgroup' Formula: (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 Localities: Reported from at least 8 localities in this region. |
| ⓘ Friedelite Formula: Mn2+8Si6O15(OH,Cl)10 Colour: Redbrown References: |
| ⓘ 'Gadolinite Group' Formula: A2MQ2Si2O8φ2 Locality: Högfors, Örebro, Örebro County, Sweden |
| ⓘ Gadolinite-(Y) Formula: Y2Fe2+Be2Si2O10 |
| ⓘ Gahnite Formula: ZnAl2O4 |
| ⓘ Galena Formula: PbS Localities: Reported from at least 33 localities in this region. |
| ⓘ Galena var. Silver-bearing Galena Formula: PbS with Ag |
| ⓘ Ganophyllite Formula: (K,Na)xMn2+6(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 Localities: Reported from at least 44 localities in this region. |
| ⓘ Gedrite Formula: ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| ⓘ Geocronite Formula: Pb14Sb6S23 |
| ⓘ Gersdorffite Formula: NiAsS References: |
| ⓘ Giessenite Formula: Pb27Cu2(Bi,Sb)19S57 |
| ⓘ 'Gigantolite' References: |
| ⓘ Glaucodot Formula: (Co0.50Fe0.50)AsS |
| ⓘ Glaucophane Formula: ◻Na2(Mg3Al2)Si8O22(OH)2 Locality: Kvarntorp, Kumla, Örebro County, Sweden |
| ⓘ Goethite Formula: Fe3+O(OH) Localities: Reported from at least 12 localities in this region. |
| ⓘ Graphite Formula: C |
| ⓘ Greenalite Formula: (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| ⓘ Greenockite Formula: CdS Colour: greenish yellow Description: Normally as thin fracture fillings in zinkblende ore. Rarely as coatings on other crystals in vugs. Easily confused with a more common yellowish green chlorite mineral. References: |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 Localities: Reported from at least 7 localities in this region. |
| ⓘ Grunerite Formula: ◻Fe2+2Fe2+5(Si8O22)(OH)2 |
| ⓘ Gudmundite Formula: FeSbS Localities: Reported from at least 14 localities in this region. |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Hausmannite Formula: Mn2+Mn3+2O4 |
| ⓘ Hedenbergite Formula: CaFe2+Si2O6 Localities: Reported from at least 9 localities in this region. |
| ⓘ Hedyphane Formula: Ca2Pb3(AsO4)3Cl |
| ⓘ Helvine Formula: Be3Mn2+4(SiO4)3S |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 42 localities in this region. |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O |
| ⓘ Herzenbergite Formula: SnS |
| ⓘ Hingganite-(Y) Formula: (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| ⓘ Hisingerite Formula: Fe3+2(Si2O5)(OH)4 · 2H2O |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(C2+4C3+)(AlSi7O22)W2 Localities: Reported from at least 42 localities in this region. |
| ⓘ Humite Formula: Mg7(SiO4)3F2 |
| ⓘ Hübnerite Formula: MnWO4 |
| ⓘ Hydromagnesite Formula: Mg5(CO3)4(OH)2 · 4H2O Habit: Spherulitic Colour: White Description: Snow white crystals on brucite. References: |
| ⓘ Hydrotalcite Formula: Mg6Al2(CO3)(OH)16 · 4H2O |
| ⓘ Hydroxylbastnäsite-(Ce) Formula: Ce(CO3)(OH) |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 References: |
| ⓘ 'Hypersthene' Formula: (Mg,Fe)SiO3 |
| ⓘ Ilmenite Formula: Fe2+TiO3 Localities: Reported from at least 20 localities in this region. |
| ⓘ Inesite Formula: Ca2(Mn,Fe)7Si10O28(OH)2 · 5H2O |
| ⓘ Ingersonite Formula: Ca3Mn2+Sb5+4O14 |
| ⓘ Izoklakeite (TL) Formula: Pb27(Cu,Fe,Ag)2(Sb,Bi)19S57 Type Locality: Habit: aggregates up to a few mm in diameter Description: Aggregates intergrown with Jaskólskiite, native bismuth, galena, pyrrhotite and, rarely, native antimony. References: Harris, Donald C., Roberts, Andrew C., Criddle, Alan J. (1986) Izoklakeite, a new mineral species from Izok Lake, Northwest Territories. The Canadian Mineralogist, 24 (1) 1-5 |
| ⓘ Jacobsite Formula: Mn2+Fe3+2O4 Localities: Gladtjärns Mine, Nyberget ore field, Nyberget, Lindesberg, Örebro County, Sweden Mangruvan, Nyberget ore field, Nyberget, Lindesberg, Örebro County, Sweden Sjögruvan, Grythyttan, Hällefors, Örebro County, Sweden Nyberget ore field, Nyberget, Lindesberg, Örebro County, Sweden Slöjdartorp, Nyberget ore field, Nyberget, Lindesberg, Örebro County, Sweden |
| ⓘ 'Jacobsite-Q' Formula: Mn2+(Fe3+,Mn3+)2O4 |
| ⓘ Jaskólskiite (TL) Formula: CuxPb2+x(Sb,Bi)2-xS5 (x ~ 0.15) Type Locality: References: |
| ⓘ Johnbaumite Formula: Ca5(AsO4)3(OH) |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Katoptrite Formula: (Mn2+,Mg)13(Al,Fe3+)4Sb5+2(SiO4)2O20 References: Igelström, Lars Johan (1885) Haematostibiite, nouveau minéral de la mine de Sjœgrufvan, paroisse Grythyttan, gouvernement d'Œrebro (Suède). Bulletin de la Société française de Minéralogie, 8 (6). 143-145 doi:10.3406/bulmi.1885.1932(as hematostibite) |
| ⓘ Kentrolite Formula: Pb2Mn3+2(Si2O7)O2 |
| ⓘ 'K Feldspar' |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 References: |
| ⓘ Kieftite Formula: CoSb3 |
| ⓘ Kobellite (TL) Formula: Pb22Cu4(Bi,Sb)30S69 Localities: Type Locality: Vena Mines, Hammar, Askersund, Örebro County, Sweden |
| ⓘ Kobellite var. Antimony-bearing Kobellite Formula: Pb22Cu4(Bi,Sb)30S69 |
| ⓘ 'Kolm' References: photo-1768364. Francisco Rabano specimen & labelIdentification: Dealer/Collection Label |
| ⓘ Kutnohorite Formula: CaMn2+(CO3)2 |
| ⓘ 'Lamprostibian' |
| ⓘ Långbanite Formula: Mn2+4Mn3+9Sb5+O16(SiO4)2 Localities: Habit: Somtimes in shortprismatic hexagonal crystals up to 5 mm Colour: Black Description: Usually this långbanite is the Fe richest of all. |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O |
| ⓘ Liebigite Formula: Ca2(UO2)(CO3)3 · 11H2O |
| ⓘ Lillianite ? Formula: Pb3-2xAgxBi2+xS6 |
| ⓘ Löllingite Formula: FeAs2 Locality: Nora, Örebro County, Sweden References: |
| ⓘ Mackinawite Formula: FeS |
| ⓘ Magnesite Formula: MgCO3 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 69 localities in this region. |
| ⓘ Magnetite var. Titanium-bearing Magnetite Formula: Fe2+(Fe3+,Ti)2O4 |
| ⓘ Magnetoplumbite Formula: PbFe3+12O19 Localities: Habit: microscopic grains (generally ≤0.1 mm) Description: In locally remobilized braunite‐silicate ore |
| ⓘ Magnetoplumbite var. Barium-bearing magnetoplumbite Formula: (Pb,Ba)(Fe,Mn)12O19 Habit: microscopic grains (generally ≤0.1 mm) Description: In locally remobilized braunite‐silicate ore |
| ⓘ 'Magnetostibian' Habit: Grains Colour: Black Fluorescence: None |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 9 localities in this region. |
| ⓘ Manganberzeliite (TL) Formula: (NaCa2)Mn2+2(AsO4)3 Type Locality: |
| ⓘ Manganite Formula: Mn3+O(OH) |
| ⓘ Marcasite Formula: FeS2 Localities: Reported from at least 14 localities in this region. |
| ⓘ Marialite Formula: Na4Al3Si9O24Cl |
| ⓘ Maucherite Formula: Ni11As8 |
| ⓘ Mckinstryite Formula: Ag5-xCu3+xS4 |
| ⓘ Meionite Formula: Ca4Al6Si6O24CO3 |
| ⓘ Melanostibite (TL) Formula: Mn2+2Fe3+Sb5+O6 Type Locality: Habit: Tiny, prismatic Colour: Black Description: Occurs in veinlets in dolomite. |
| ⓘ Meneghinite Formula: Pb13CuSb7S24 |
| ⓘ 'Meteoritic Iron' |
| ⓘ Miargyrite Formula: AgSbS2 |
| ⓘ Microcline Formula: K(AlSi3O8) Localities: Reported from at least 15 localities in this region. |
| ⓘ Microcline var. Hyalophane Formula: (K,Ba)[Al(Si,Al)Si2O8] |
| ⓘ Minnesotaite Formula: Fe2+3Si4O10(OH)2 |
| ⓘ Molybdenite Formula: MoS2 Localities: Reported from at least 41 localities in this region. |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) |
| ⓘ 'Monazite Group' Formula: REE(PO4) Localities: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 16 localities in this region. |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Native Antimony Formula: Sb Localities: Reported from at least 6 localities in this region. |
| ⓘ Native Bismuth Formula: Bi Localities: Reported from at least 16 localities in this region. |
| ⓘ Native Copper Formula: Cu Localities: Reported from at least 8 localities in this region. |
| ⓘ Native Gold Formula: Au Localities: Reported from at least 6 localities in this region. |
| ⓘ Native Gold var. Electrum Formula: (Au,Ag) |
| ⓘ Native Lead Formula: Pb |
| ⓘ Native Silver Formula: Ag Localities: Reported from at least 12 localities in this region. |
| ⓘ Native Sulphur Formula: S8 |
| ⓘ Neotocite Formula: (Mn,Fe)SiO3 · H2O (?) |
| ⓘ Nepheline Formula: Na3K(Al4Si4O16) |
| ⓘ Nickeline Formula: NiAs |
| ⓘ Nickelskutterudite Formula: NiAs3 |
| ⓘ Nisbite Formula: NiSb2 |
| ⓘ Nontronite Formula: Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ Opal Formula: SiO2 · nH2O References: |
| ⓘ 'Orthochamosite' Formula: (Fe2+,Mg,Fe3+)5Al(AlSi3O10)(OH,O)8 |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ 'Orthopyroxene Subgroup' |
| ⓘ Örebroite (TL) Formula: Mn2+3(Sb5+,Fe3+)(SiO4)(O,OH)3 Type Locality: |
| ⓘ Paracostibite Formula: CoSbS |
| ⓘ Parauranophane Formula: Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ Parisite-(Ce) Formula: CaCe2(CO3)3F2 |
| ⓘ Parkerite Formula: Ni3(Bi,Pb)2S2 |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 |
| ⓘ Perbøeite-(Ce) Formula: CaCe3(AlAl2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| ⓘ 'Petroleum' Colour: black, brown Description: Very common in vugs as black to brown small drops. A coal like type can be found in larger specimens of more than 100 mm size, but notice - these specimens are highly radioactive. |
| ⓘ 'Petroleum var. Bitumen' Localities: Colour: black, brown Description: Very common in vugs as black to brown small drops. A coal like type can be found in larger specimens of more than 100 mm size, but notice - these specimens are highly radioactive. |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Piemontite Formula: (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| ⓘ Pilsenite Formula: Bi4Te3 |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ 'Pleurasite' Formula: Mn, Fe, AsO4 |
| ⓘ Plumboferrite ? Formula: Pb[Fe3+10.67Mn2+0.33Pb]O18.33 Description: Plumboferrite was reported from Sjögruvan by Igelström (1895). However a reexamination of Sjögrens material was found to be devoid of this mineral (Holtstam (2003, reprint from a papier in 1991))
The excistence of plumbofererite at Sjögruvan is thus doubtful. |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 |
| ⓘ Pyrargyrite Formula: Ag3SbS3 Localities: Reported from at least 8 localities in this region. |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 52 localities in this region. |
| ⓘ Pyrobelonite Formula: PbMn2+(VO4)(OH) |
| ⓘ 'Pyrobitumen' |
| ⓘ 'Pyrobitumen var. Thucholite' |
| ⓘ Pyrochroite Formula: Mn(OH)2 |
| ⓘ Pyrolusite ? Formula: Mn4+O2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl Habit: Elongated prisms Colour: reddish brown, very rare green References: |
| ⓘ Pyrophanite Formula: Mn2+TiO3 Localities: Mangruvan, Nyberget ore field, Nyberget, Lindesberg, Örebro County, Sweden Sjögruvan, Grythyttan, Hällefors, Örebro County, Sweden Lovisagruvan (Lovisa Mine), Stråssa, Lindesberg, Örebro County, Sweden Nyberget ore field, Nyberget, Lindesberg, Örebro County, Sweden Brunnsjögruvan, Grythyttan, Hällefors, Örebro County, Sweden |
| ⓘ Pyrosmalite-(Fe) Formula: Fe2+8Si6O15(OH,Cl)10 |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 Localities: Reported from at least 11 localities in this region. |
| ⓘ Pyroxmangite Formula: Mn2+SiO3 |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Reported from at least 34 localities in this region. |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 51 localities in this region. |
| ⓘ Quartz var. Amethyst Formula: SiO2 |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Quartz var. Milky Quartz Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Rhodochrosite Formula: MnCO3 |
| ⓘ Rhodonite Formula: CaMn3Mn[Si5O15] Localities: Gladtjärns Mine, Nyberget ore field, Nyberget, Lindesberg, Örebro County, Sweden Sjögruvan, Grythyttan, Hällefors, Örebro County, Sweden Slöjdartorp, Nyberget ore field, Nyberget, Lindesberg, Örebro County, Sweden Mangruvan, Nyberget ore field, Nyberget, Lindesberg, Örebro County, Sweden Nyberget ore field, Nyberget, Lindesberg, Örebro County, Sweden |
| ⓘ Richterite Formula: Na(CaNa)Mg5(Si8O22)(OH)2 |
| ⓘ 'Roméite Group' Formula: A2(Sb5+)2O6Z |
| ⓘ Rutile Formula: TiO2 Localities: Reported from at least 16 localities in this region. |
| ⓘ Safflorite Formula: (Co,Ni,Fe)As2 |
| ⓘ Sarkinite Formula: Mn2+2(AsO4)(OH) |
| ⓘ Sarkinite var. Xanthoarsenite Formula: Mn2(As,Sb)O4OH |
| ⓘ 'Scapolite' Localities: Reported from at least 13 localities in this region. |
| ⓘ 'Scapolite var. Wernerite' |
| ⓘ Scheelite Formula: Ca(WO4) Localities: Reported from at least 22 localities in this region. |
| ⓘ Scheelite var. Molybdoscheelite Formula: Ca(WO4) References: Vik Vanrusselt collectionIdentified by Vik Vanrusselt: Visual Identification |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: Reported from at least 7 localities in this region. |
| ⓘ Schröckingerite Formula: NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| ⓘ Senaite Formula: Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 Localities: Reported from at least 9 localities in this region. |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Sillimanite Formula: Al2(SiO4)O Localities: Reported from at least 8 localities in this region. |
| ⓘ 'Sjogruvite' |
| ⓘ Skutterudite Formula: CoAs3 |
| ⓘ Sonolite Formula: Mn2+9(SiO4)4(OH)2 |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 Localities: Reported from at least 7 localities in this region. |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 40 localities in this region. |
| ⓘ Spinel Formula: MgAl2O4 Localities: Reported from at least 9 localities in this region. |
| ⓘ Spinel var. Pleonaste Formula: (Mg,Fe)Al2O4 |
| ⓘ Stannite Formula: Cu2FeSnS4 |
| ⓘ Stephanite Formula: Ag5SbS4 |
| ⓘ Sternbergite Formula: AgFe2S3 |
| ⓘ 'Stibiatil' |
| ⓘ Stibnite Formula: Sb2S3 |
| ⓘ Stilpnomelane Formula: K4Fe2+48[Si64Al8]O164(OH)52 · nH2O |
| ⓘ Stilpnomelane var. Ekmanite Formula: K4(Fe2+,Mn)48[Si64Al8]O1664(OH)52 · nH2O |
| ⓘ Stromeyerite Formula: AgCuS Colour: Silver, blue anisotropic in reflected light x-nicols Description: Usually seen when Ag and Cu appears together |
| ⓘ Svabite Formula: Ca5(AsO4)3F Localities: Habit: Masses and veins Colour: Greyish-white Fluorescence: Yellow-orange (SW) |
| ⓘ Synchysite-(Ce) Formula: CaCe(CO3)2F |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 Localities: Reported from at least 10 localities in this region. |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S Localities: Reported from at least 6 localities in this region. |
| ⓘ Tephroite Formula: Mn2+2(SiO4) References: |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S Localities: Reported from at least 11 localities in this region. |
| ⓘ Thorite Formula: Th(SiO4) References: |
| ⓘ Tilasite Formula: CaMg(AsO4)F |
| ⓘ Titanite Formula: CaTiO(SiO4) Localities: Reported from at least 25 localities in this region. |
| ⓘ Törnebohmite-(Ce) Formula: Ce2Al(SiO4)2(OH) |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z Localities: Reported from at least 19 localities in this region. |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 Localities: Reported from at least 21 localities in this region. |
| ⓘ 'Trioctahedral mica' References: Dr. Günter Grundmann collectionIdentified by Dr. Günter Grundmann: Polarised-light microscopy |
| ⓘ Triplite Formula: Mn2+2(PO4)F References: The Swedish Museum of Natural History, Stockholm (Naturhistoriska riksmuseet) CollectionsIdentification: Dealer/Collection Label |
| ⓘ Troilite Formula: FeS |
| ⓘ Turneaureite Formula: Ca5(AsO4)3Cl |
| ⓘ Ullmannite Formula: NiSbS |
| ⓘ 'UM2007-35-SiO:AlCaFFeMgREE' Formula: Ca(Ce,La)3Al2Fe2+2(Si2O7)(SiO4)3(OH)2F |
| ⓘ 'Unnamed (Mg-analogue of Ferriallanite-(Ce))' Formula: (CaCe)(Fe3+AlMg)O[Si2O7][SiO4](OH) Description: see http://www.mindat.org/photo-215824.html for EDX spectra |
| ⓘ Uraninite Formula: UO2 |
| ⓘ Uraninite var. Pitchblende Formula: UO2 |
| ⓘ Uranophane Formula: Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ Valleriite (TL) Formula: (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 Localities: |
| ⓘ Västmanlandite-(Ce) Formula: CaCe3(MgAl2Mg)[Si2O7][SiO4]3F(OH)2 References: |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 Localities: Reported from at least 9 localities in this region. |
| ⓘ Wagnerite Formula: Mg2(PO4)F |
| ⓘ Welinite Formula: Mn2+6(W6+,Mg)2(SiO4)2(O,OH)6 Habit: Microscopic grains; polycrystalline aggregates; compositional zones and patches in örebroite. Description: Found in 3 different settings: a) Small polycrystalline aggregates (<0,5mm)in a vein assamblage composed by friedelite, calcite, rhodocrosite, tilasite etc. b) as compositional zones and patchy inclusions in örebroite (from materiale originally named "chondrostibian" (Sjøgren 1893) c) microscopic grains in a granular tephroite-calcite- jacobsite rock |
| ⓘ Willemite Formula: Zn2SiO4 Habit: Singel crystal masses Colour: Brown Fluorescence: Weak green in SW. Description: As finegrain masses in veins with sphalerite, copper stromeyerite, silver and so on. |
| ⓘ Willyamite Formula: CoSbS |
| ⓘ Witherite Formula: BaCO3 References: Cámara, Fernando, Holtstam, Dan, Jansson, Nils, Jonsson, Erik, Karlsson, Andreas, Langhof, Jörgen, Majka, Jaroslaw, Zetterqvist, Anders (2021) Zinkgruvanite, Ba4Mn2+4Fe3+2(Si2O7)2(SO4)2O2(OH)2, a new ericssonite-group mineral from the Zinkgruvan Zn-Pb-Ag-Cu deposit, Askersund, Örebro County, Sweden. European Journal of Mineralogy, 33 (6) 659-673 doi:10.5194/ejm-33-659-2021 |
| ⓘ 'Wolframite Group' |
| ⓘ Wollastonite Formula: Ca3(Si3O9) Localities: Reported from at least 11 localities in this region. |
| ⓘ Wulfenite Formula: Pb(MoO4) Colour: Yellow, grayish white (rare) Description: Yellow pyramidal crystals up to 3 mm, normally smaller. Bladed crystals are very rare. References: |
| ⓘ 'Xenotime' |
| ⓘ Xenotime-(Y) Formula: Y(PO4) |
| ⓘ Zhangpeishanite Formula: BaFCl References: Cámara, Fernando, Holtstam, Dan, Jansson, Nils, Jonsson, Erik, Karlsson, Andreas, Langhof, Jörgen, Majka, Jaroslaw, Zetterqvist, Anders (2021) Zinkgruvanite, Ba4Mn2+4Fe3+2(Si2O7)2(SO4)2O2(OH)2, a new ericssonite-group mineral from the Zinkgruvan Zn-Pb-Ag-Cu deposit, Askersund, Örebro County, Sweden. European Journal of Mineralogy, 33 (6) 659-673 doi:10.5194/ejm-33-659-2021 |
| ⓘ Zinkgruvanite (TL) Formula: Ba4Mn2+4Fe3+2(Si2O7)2(SO4)2O2(OH)2 Type Locality: References: Miyawaki, Ritsuro, Hatert, Frédéric, Pasero, Marco, Mills, Stuart J. (2020) IMA Commission on New Minerals, Nomenclature and Classification (CNMNC) – Newsletter 56. European Journal of Mineralogy, 32 (4) 443-448 doi:10.5194/ejm-32-443-2020 Cámara, Fernando, Holtstam, Dan, Jansson, Nils, Jonsson, Erik, Karlsson, Andreas, Langhof, Jörgen, Majka, Jaroslaw, Zetterqvist, Anders (2021) Zinkgruvanite, Ba4Mn2+4Fe3+2(Si2O7)2(SO4)2O2(OH)2, a new ericssonite-group mineral from the Zinkgruvan Zn-Pb-Ag-Cu deposit, Askersund, Örebro County, Sweden. European Journal of Mineralogy, 33 (6) 659-673 doi:10.5194/ejm-33-659-2021 |
| ⓘ Zippeite Formula: K3(UO2)4(SO4)2O3(OH) · 3H2O |
| ⓘ Zircon Formula: Zr(SiO4) Localities: Reported from at least 15 localities in this region. |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) Localities: Reported from at least 7 localities in this region. |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold var. Electrum | 1.AA.05 | (Au,Ag) |
| ⓘ | 1.AA.05 | Au | |
| ⓘ | Native Lead | 1.AA.05 | Pb |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Antimony | 1.CA.05 | Sb |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Allargentum | 2.AA.30 | (Ag1-xSbx) |
| ⓘ | Dyscrasite | 2.AA.35 | Ag3Sb |
| ⓘ | Maucherite | 2.AB.15 | Ni11As8 |
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Djurleite | 2.BA.05 | Cu31S16 |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Mckinstryite | 2.BA.40 | Ag5-xCu3+xS4 |
| ⓘ | Stromeyerite | 2.BA.40 | AgCuS |
| ⓘ | Argentopentlandite | 2.BB.15 | Ag(Fe,Ni)8S8 |
| ⓘ | Cobaltpentlandite | 2.BB.15 | Co9S8 |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Parkerite | 2.BE.20 | Ni3(Bi,Pb)2S2 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Sternbergite | 2.CB.65 | AgFe2S3 |
| ⓘ | Breithauptite | 2.CC.05 | NiSb |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Troilite | 2.CC.10 | FeS |
| ⓘ | Mackinawite | 2.CC.25 | FeS |
| ⓘ | Herzenbergite | 2.CD.05 | SnS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | var. Silver-bearing Galena | 2.CD.10 | PbS with Ag |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Bismuthinite var. Antimony-bearing Bismuthinite | 2.DB.05 | (Bi,Sb)2S3 |
| ⓘ | Pilsenite | 2.DC.05 | Bi4Te3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Glaucodot | 2.EB.10c | (Co0.50Fe0.50)AsS |
| ⓘ | Costibite | 2.EB.10d | CoSbS |
| ⓘ | Paracostibite | 2.EB.10e | CoSbS |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Nisbite | 2.EB.15a | NiSb2 |
| ⓘ | Safflorite | 2.EB.15a | (Co,Ni,Fe)As2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Gudmundite | 2.EB.20 | FeSbS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Ullmannite | 2.EB.25 | NiSbS |
| ⓘ | Willyamite | 2.EB.25 | CoSbS |
| ⓘ | Kieftite | 2.EC.05 | CoSb3 |
| ⓘ | Nickelskutterudite | 2.EC.05 | NiAs3 |
| ⓘ | Skutterudite | 2.EC.05 | CoAs3 |
| ⓘ | Valleriite (TL) | 2.FD.30 | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | 'Freibergite Subgroup' | 2.GB.05 | (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Argentotetrahedrite-(Fe) | 2.GB.05 | Ag6(Cu4Fe2)Sb4S12S |
| ⓘ | Stephanite | 2.GB.10 | Ag5SbS4 |
| ⓘ | Emplectite | 2.HA.05 | CuBiS2 |
| ⓘ | Miargyrite | 2.HA.10 | AgSbS2 |
| ⓘ | Berthierite | 2.HA.20 | FeSb2S4 |
| ⓘ | Meneghinite | 2.HB.05b | Pb13CuSb7S24 |
| ⓘ | Jaskólskiite (TL) | 2.HB.05c | CuxPb2+x(Sb,Bi)2-xS5 (x ~ 0.15) |
| ⓘ | Kobellite (TL) | 2.HB.10a | Pb22Cu4(Bi,Sb)30S69 |
| ⓘ | var. Antimony-bearing Kobellite | 2.HB.10a | Pb22Cu4(Bi,Sb)30S69 |
| ⓘ | Giessenite | 2.HB.10b | Pb27Cu2(Bi,Sb)19S57 |
| ⓘ | Izoklakeite (TL) | 2.HB.10b | Pb27(Cu,Fe,Ag)2(Sb,Bi)19S57 |
| ⓘ | Benavidesite | 2.HB.15 | Pb4MnSb6S14 |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Geocronite | 2.JB.30a | Pb14Sb6S23 |
| ⓘ | Lillianite ? | 2.JB.40a | Pb3-2xAgxBi2+xS6 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Zhangpeishanite | 3.DC.25 | BaFCl |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Chrysoberyl | 4.BA.05 | BeAl2O4 |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Franklinite | 4.BB.05 | Zn2+Fe3+2O4 |
| ⓘ | Gahnite | 4.BB.05 | ZnAl2O4 |
| ⓘ | Jacobsite | 4.BB.05 | Mn2+Fe3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Magnetite var. Titanium-bearing Magnetite | 4.BB.05 | Fe2+(Fe3+,Ti)2O4 |
| ⓘ | Spinel var. Pleonaste | 4.BB.05 | (Mg,Fe)Al2O4 |
| ⓘ | Hausmannite | 4.BB.10 | Mn2+Mn3+2O4 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Melanostibite (TL) | 4.CB.05 | Mn2+2Fe3+Sb5+O6 |
| ⓘ | Pyrophanite | 4.CB.05 | Mn2+TiO3 |
| ⓘ | Bismite | 4.CB.60 | Bi2O3 |
| ⓘ | Senaite | 4.CC.40 | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
| ⓘ | Magnetoplumbite | 4.CC.45 | PbFe3+12O19 |
| ⓘ | Plumboferrite ? | 4.CC.45 | Pb[Fe3+10.67Mn2+0.33Pb]O18.33 |
| ⓘ | Magnetoplumbite var. Barium-bearing magnetoplumbite | 4.CC.45 | (Pb,Ba)(Fe,Mn)12O19 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Milky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Pyrolusite ? | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Ferberite | 4.DB.30 | FeWO4 |
| ⓘ | Hübnerite | 4.DB.30 | MnWO4 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brookite | 4.DD.10 | TiO2 |
| ⓘ | 'Roméite Group' | 4.DH. | A2(Sb5+)2O6Z |
| ⓘ | Brannerite | 4.DH.05 | UTi2O6 |
| ⓘ | Bindheimite | 4.DH.20 | Pb2Sb2O6O |
| ⓘ | Ingersonite | 4.DH.40 | Ca3Mn2+Sb5+4O14 |
| ⓘ | Uraninite var. Pitchblende | 4.DL.05 | UO2 |
| ⓘ | 4.DL.05 | UO2 | |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Brucite | 4.FE.05 | Mg(OH)2 |
| ⓘ | Pyrochroite | 4.FE.05 | Mn(OH)2 |
| ⓘ | Feitknechtite | 4.FE.25 | Mn3+O(OH) |
| ⓘ | Carnotite | 4.HB.05 | K2(UO2)2(VO4)2 · 3H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Calcite var. Manganese-bearing Calcite | 5.AB.05 | (Ca,Mn)CO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Kutnohorite | 5.AB.10 | CaMn2+(CO3)2 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Witherite | 5.AB.15 | BaCO3 |
| ⓘ | Barytocalcite | 5.AB.45 | BaCa(CO3)2 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Bastnäsite-(Ce) | 5.BD.20a | Ce(CO3)F |
| ⓘ | Hydroxylbastnäsite-(Ce) | 5.BD.20a | Ce(CO3)(OH) |
| ⓘ | Parisite-(Ce) | 5.BD.20b | CaCe2(CO3)3F2 |
| ⓘ | Synchysite-(Ce) | 5.BD.20c | CaCe(CO3)2F |
| ⓘ | Hydromagnesite | 5.DA.05 | Mg5(CO3)4(OH)2 · 4H2O |
| ⓘ | Hydrotalcite | 5.DA.50 | Mg6Al2(CO3)(OH)16 · 4H2O |
| ⓘ | Liebigite | 5.ED.20 | Ca2(UO2)(CO3)3 · 11H2O |
| ⓘ | Andersonite | 5.ED.30 | Na2Ca(UO2)(CO3)3 · 5.33H2O |
| ⓘ | Schröckingerite | 5.EG.05 | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Zippeite | 7.EC.05 | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| ⓘ | Scheelite var. Molybdoscheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Arseniopleite (TL) | 8.AC.10 | NaCaMnMn2(AsO4)3 |
| ⓘ | Caryinite | 8.AC.10 | (Na,Pb)(Ca,Na)CaMn2+2(AsO4)3 |
| ⓘ | Berzeliite | 8.AC.25 | (NaCa2)Mg2(AsO4)3 |
| ⓘ | Manganberzeliite (TL) | 8.AC.25 | (NaCa2)Mn2+2(AsO4)3 |
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Tilasite | 8.BB. | CaMg(AsO4)F |
| ⓘ | Triplite | 8.BB.10 | Mn2+2(PO4)F |
| ⓘ | Sarkinite | 8.BB.15 | Mn2+2(AsO4)(OH) |
| ⓘ | Wagnerite | 8.BB.15 | Mg2(PO4)F |
| ⓘ | Sarkinite var. Xanthoarsenite | 8.BB.15 | Mn2(As,Sb)O4OH |
| ⓘ | Allactite | 8.BE.30 | Mn2+7(AsO4)2(OH)8 |
| ⓘ | Pyrobelonite | 8.BH.40 | PbMn2+(VO4)(OH) |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Hedyphane | 8.BN.05 | Ca2Pb3(AsO4)3Cl |
| ⓘ | Johnbaumite | 8.BN.05 | Ca5(AsO4)3(OH) |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Svabite | 8.BN.05 | Ca5(AsO4)3F |
| ⓘ | Turneaureite | 8.BN.05 | Ca5(AsO4)3Cl |
| ⓘ | Fluorapatite var. Manganapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 · 10-12H2O |
| Group 9 - Silicates | |||
| ⓘ | Chrysotile | 9.00. | Mg3(Si2O5)(OH)4 |
| ⓘ | Willemite | 9.AA.05 | Zn2SiO4 |
| ⓘ | Fayalite | 9.AC.05 | Fe2+2(SiO4) |
| ⓘ | Forsterite | 9.AC.05 | Mg2(SiO4) |
| ⓘ | Tephroite | 9.AC.05 | Mn2+2(SiO4) |
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Thorite | 9.AD.30 | Th(SiO4) |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Katoptrite | 9.AE.40 | (Mn2+,Mg)13(Al,Fe3+)4Sb5+2(SiO4)2O20 |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Chondrodite | 9.AF.45 | Mg5(SiO4)2F2 |
| ⓘ | Humite | 9.AF.50 | Mg7(SiO4)3F2 |
| ⓘ | Clinohumite | 9.AF.55 | Mg9(SiO4)4F2 |
| ⓘ | Sonolite | 9.AF.55 | Mn2+9(SiO4)4(OH)2 |
| ⓘ | Örebroite (TL) | 9.AF.75 | Mn2+3(Sb5+,Fe3+)(SiO4)(O,OH)3 |
| ⓘ | Welinite | 9.AF.75 | Mn2+6(W6+,Mg)2(SiO4)2(O,OH)6 |
| ⓘ | Chloritoid | 9.AF.85 | Fe2+Al2O(SiO4)(OH)2 |
| ⓘ | Braunite | 9.AG.05 | Mn2+Mn3+6(SiO4)O8 |
| ⓘ | Långbanite | 9.AG.10 | Mn2+4Mn3+9Sb5+O16(SiO4)2 |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Cerite-(CeCa) | 9.AG.20 | (Ce7Ca2)◻Mg(SiO4)3(SiO3OH)4(OH)3 |
| ⓘ | Törnebohmite-(Ce) | 9.AG.45 | Ce2Al(SiO4)2(OH) |
| ⓘ | Datolite | 9.AJ.20 | CaB(SiO4)(OH) |
| ⓘ | Gadolinite-(Y) | 9.AJ.20 | Y2Fe2+Be2Si2O10 |
| ⓘ | Hingganite-(Y) | 9.AJ.20 | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| ⓘ | Parauranophane | 9.AK.15 | Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ | Uranophane | 9.AK.15 | Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ | Barylite | 9.BB.15 | Be2Ba(Si2O7) |
| ⓘ | Barysilite | 9.BC.20 | Pb8Mn2+[Si2O7]3 |
| ⓘ | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Axinite-(Fe) | 9.BD.20 | Ca2Fe2+Al2BSi4O15OH |
| ⓘ | Zinkgruvanite (TL) | 9.BE. | Ba4Mn2+4Fe3+2(Si2O7)2(SO4)2O2(OH)2 |
| ⓘ | Kentrolite | 9.BE.80 | Pb2Mn3+2(Si2O7)O2 |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Piemontite | 9.BG.05a | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Ferriallanite-(Ce) | 9.BG.05b | (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | 'Unnamed (Mg-analogue of Ferriallanite-(Ce))' | 9.BG.05b | (CaCe)(Fe3+AlMg)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Perbøeite-(Ce) | 9.BG.50 | CaCe3(AlAl2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| ⓘ | Ferriperbøeite-(Ce) | 9.BG.50 | CaCe3(Fe3+Al2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| ⓘ | Västmanlandite-(Ce) | 9.BG.55 | CaCe3(MgAl2Mg)[Si2O7][SiO4]3F(OH)2 |
| ⓘ | Cerchiaraite-(Al) | 9.CF.25 | Ba4Al4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| ⓘ | Cerchiaraite-(Fe) | 9.CF.25 | Ba4Fe3+4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Cordierite | 9.CJ.10 | Mg2Al4Si5O18 |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Hedenbergite | 9.DA.15 | CaFe2+Si2O6 |
| ⓘ | Diopside var. Schefferite | 9.DA.15 | (Ca,Mn)(Mg,Fe,Mn)Si2O6 |
| ⓘ | Augite var. Jeffersonite | 9.DA.15 va | Ca(Mn,Zn,Fe)Si2O6 |
| ⓘ | Aegirine-augite | 9.DA.20 | (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 |
| ⓘ | var. Urbanite | 9.DA.20 | (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 |
| ⓘ | Aegirine | 9.DA.25 | NaFe3+Si2O6 |
| ⓘ | Anthophyllite | 9.DD.05 | ◻Mg2Mg5(Si8O22)(OH)2 |
| ⓘ | Gedrite | 9.DD.05 | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| ⓘ | Cummingtonite | 9.DE.05 | ◻Mg2Mg5(Si8O22)(OH)2 |
| ⓘ | Grunerite | 9.DE.05 | ◻Fe2+2Fe2+5(Si8O22)(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Ferro-hornblende ? | 9.DE.10 | ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Clino-ferro-suenoite | 9.DE.10 | ◻Mn2+2(Fe2+5)(Si8O22)(OH)2 |
| ⓘ | Ferro-richterite | 9.DE.20 | Na(CaNa)Fe2+5(Si8O22)(OH)2 |
| ⓘ | Richterite | 9.DE.20 | Na(CaNa)Mg5(Si8O22)(OH)2 |
| ⓘ | Ferri-winchite | 9.DE.20 | ◻(NaCa)(Mg4Fe3+)Si8O22(OH)2 |
| ⓘ | Eckermannite ? | 9.DE.25 | NaNa2(Mg4Al}Si8O22(OH)2 |
| ⓘ | Glaucophane | 9.DE.25 | ◻Na2(Mg3Al2)Si8O22(OH)2 |
| ⓘ | Bustamite | 9.DG.05 | CaMn2+(Si2O6) |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Rhodonite | 9.DK.05 | CaMn3Mn[Si5O15] |
| ⓘ | Inesite | 9.DL.05 | Ca2(Mn,Fe)7Si10O28(OH)2 · 5H2O |
| ⓘ | Pyroxmangite | 9.DO.05 | Mn2+SiO3 |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Minnesotaite | 9.EC.05 | Fe2+3Si4O10(OH)2 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Nontronite | 9.EC.40 | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | var. Diabantite | 9.EC.55 | (Mg,Fe,Al)6((Si,Al)4O10)(OH)8 |
| ⓘ | 'Orthochamosite' | 9.EC.55 | (Fe2+,Mg,Fe3+)5Al(AlSi3O10)(OH,O)8 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Hisingerite | 9.ED.10 | Fe3+2(Si2O5)(OH)4 · 2H2O |
| ⓘ | Amesite | 9.ED.15 | Mg2Al(AlSiO5)(OH)4 |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Greenalite | 9.ED.15 | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Neotocite | 9.ED.20 | (Mn,Fe)SiO3 · H2O (?) |
| ⓘ | Bementite | 9.EE.05 | Mn7Si6O15(OH)8 |
| ⓘ | Pyrosmalite-(Fe) | 9.EE.10 | Fe2+8Si6O15(OH,Cl)10 |
| ⓘ | Friedelite | 9.EE.10 | Mn2+8Si6O15(OH,Cl)10 |
| ⓘ | Ganophyllite | 9.EG.30 | (K,Na)xMn2+6(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| ⓘ | Stilpnomelane | 9.EG.40 | K4Fe2+48[Si64Al8]O164(OH)52 · nH2O |
| ⓘ | var. Ekmanite | 9.EG.40 | K4(Fe2+,Mn)48[Si64Al8]O1664(OH)52 · nH2O |
| ⓘ | Bannisterite | 9.EG.75 | (Ca,K,Na)(Mn2+,Fe2+)10(Si,Al)16O38(OH)8 · nH2O |
| ⓘ | Nepheline | 9.FA.05 | Na3K(Al4Si4O16) |
| ⓘ | Celsian | 9.FA.30 | Ba(Al2Si2O8) |
| ⓘ | Microcline var. Hyalophane | 9.FA.30 | (K,Ba)[Al(Si,Al)Si2O8] |
| ⓘ | 9.FA.30 | K(AlSi3O8) | |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Andesine | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Banalsite | 9.FA.60 | Na2BaAl4Si4O16 |
| ⓘ | Danalite | 9.FB.10 | Be3Fe2+4(SiO4)3S |
| ⓘ | Helvine | 9.FB.10 | Be3Mn2+4(SiO4)3S |
| ⓘ | Marialite | 9.FB.15 | Na4Al3Si9O24Cl |
| ⓘ | Meionite | 9.FB.15 | Ca4Al6Si6O24CO3 |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Apophyllite Group' | - | AB4[Si8O20]X · 8H2O |
| ⓘ | 'Asbestos' | - | |
| ⓘ | 'Basiliite' | - | |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Calcium Amphibole Subgroup var. Hornblende' | - | AnCa2(Z2+5-mZ3+m)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| ⓘ | 'Hypersthene' | - | (Mg,Fe)SiO3 |
| ⓘ | 'Jacobsite-Q' | - | Mn2+(Fe3+,Mn3+)2O4 |
| ⓘ | 'Biotite var. Manganophyllite' | - | K(Fe,Mg,Mn)3AlSi3O10(OH)2 |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Pyrobitumen var. Thucholite' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Fluor-uvite-Uvite Series' | - | |
| ⓘ | 'Scapolite var. Wernerite' | - | |
| ⓘ | 'Xenotime' | - | |
| ⓘ | 'Feldspar Group var. Perthite' | - | |
| ⓘ | 'Gigantolite' | - | |
| ⓘ | 'Clinopyroxene Subgroup' | - | |
| ⓘ | 'Actinolite-Tremolite Series' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Fayalite-Tephroite Series' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Fayalite-Tephroite Series var. Knebelite' | - | from (Fe1.5Mn0.5)2SiO4 to (Mn1.5Fe0.5)2SiO4 |
| ⓘ | 'Petroleum var. Bitumen' | - | |
| ⓘ | '' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Meteoritic Iron' | - | |
| ⓘ | 'Orthopyroxene Subgroup' | - | |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Calcium Amphibole Subgroup' | - | AnCa2(C2+5-mC3+m)(Si8-(n+m)Al(n+m))W2 |
| ⓘ | 'UM2007-35-SiO:AlCaFFeMgREE' | - | Ca(Ce,La)3Al2Fe2+2(Si2O7)(SiO4)3(OH)2F |
| ⓘ | 'Kolm' | - | |
| ⓘ | 'Chloroarsenian' | - | |
| ⓘ | 'Gadolinite Group' | - | A2MQ2Si2O8φ2 |
| ⓘ | 'Pleurasite' | - | Mn, Fe, AsO4 |
| ⓘ | 'Sjogruvite' | - | |
| ⓘ | 'Magnetostibian' | - | |
| ⓘ | 'Lamprostibian' | - | |
| ⓘ | 'Chondrostibian' | - | |
| ⓘ | 'Stibiatil' | - | |
| ⓘ | 'Chalcocite-Digenite Group' | - | |
| ⓘ | 'Pyrobitumen' | - | |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ | 'Trioctahedral mica' | - | |
| ⓘ | 'Amphibole Supergroup var. Clinoamphibole' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Allactite | Mn72+(AsO4)2(OH)8 |
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| H | ⓘ Andersonite | Na2Ca(UO2)(CO3)3 · 5.33H2O |
| H | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Apophyllite Group | AB4[Si8O20]X · 8H2O |
| H | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Bannisterite | (Ca,K,Na)(Mn2+,Fe2+)10(Si,Al)16O38(OH)8 · nH2O |
| H | ⓘ Bementite | Mn7Si6O15(OH)8 |
| H | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brucite | Mg(OH)2 |
| H | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| H | ⓘ Cerite-(CeCa) | (Ce7Ca2)◻Mg(SiO4)3(SiO3OH)4(OH)3 |
| H | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| H | ⓘ Clinochlore var. Diabantite | (Mg,Fe,Al)6((Si,Al)4O10)(OH)8 |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Datolite | CaB(SiO4)(OH) |
| H | ⓘ Eckermannite | NaNa2(Mg4Al}Si8O22(OH)2 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| H | ⓘ Feitknechtite | Mn3+O(OH) |
| H | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| H | ⓘ Pyrosmalite-(Fe) | Fe82+Si6O15(OH,Cl)10 |
| H | ⓘ Ferro-richterite | Na(CaNa)Fe52+(Si8O22)(OH)2 |
| H | ⓘ Friedelite | Mn82+Si6O15(OH,Cl)10 |
| H | ⓘ Ganophyllite | (K,Na)xMn62+(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| H | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| H | ⓘ Glaucophane | ◻Na2(Mg3Al2)Si8O22(OH)2 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Greenalite | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| H | ⓘ Grunerite | ◻Fe22+Fe52+(Si8O22)(OH)2 |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| H | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| H | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| H | ⓘ Hydroxylbastnäsite-(Ce) | Ce(CO3)(OH) |
| H | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| H | ⓘ Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Inesite | Ca2(Mn,Fe)7Si10O28(OH)2 · 5H2O |
| H | ⓘ Johnbaumite | Ca5(AsO4)3(OH) |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Liebigite | Ca2(UO2)(CO3)3 · 11H2O |
| H | ⓘ Biotite var. Manganophyllite | K(Fe,Mg,Mn)3AlSi3O10(OH)2 |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Minnesotaite | Fe32+Si4O10(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Neotocite | (Mn,Fe)SiO3 · H2O (?) |
| H | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Orthochamosite | (Fe2+,Mg,Fe3+)5Al(AlSi3O10)(OH,O)8 |
| H | ⓘ Örebroite | Mn32+(Sb5+,Fe3+)(SiO4)(O,OH)3 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Pyrobelonite | PbMn2+(VO4)(OH) |
| H | ⓘ Pyrochroite | Mn(OH)2 |
| H | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| H | ⓘ Sarkinite | Mn22+(AsO4)(OH) |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| H | ⓘ Senaite | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
| H | ⓘ Sonolite | Mn92+(SiO4)4(OH)2 |
| H | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Törnebohmite-(Ce) | Ce2Al(SiO4)2(OH) |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Parauranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| H | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| H | ⓘ Fluor-uvite-Uvite Series | |
| H | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Welinite | Mn62+(W6+,Mg)2(SiO4)2(O,OH)6 |
| H | ⓘ Sarkinite var. Xanthoarsenite | Mn2(As,Sb)O4OH |
| H | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Stilpnomelane var. Ekmanite | K4(Fe2+,Mn)48[Si64Al8]O1664(OH)52 · nH2O |
| H | ⓘ Actinolite-Tremolite Series | |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Ferriallanite-(Ce) | (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Västmanlandite-(Ce) | CaCe3(MgAl2Mg)[Si2O7][SiO4]3F(OH)2 |
| H | ⓘ Ferri-winchite | ◻(NaCa)(Mg4Fe3+)Si8O22(OH)2 |
| H | ⓘ UM2007-35-SiO:AlCaFFeMgREE | Ca(Ce,La)3Al2Fe22+(Si2O7)(SiO4)3(OH)2F |
| H | ⓘ Unnamed (Mg-analogue of Ferriallanite-(Ce)) | (CaCe)(Fe3+AlMg)O[Si2O7][SiO4](OH) |
| H | ⓘ Perbøeite-(Ce) | CaCe3(AlAl2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| H | ⓘ Cerchiaraite-(Al) | Ba4Al4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| H | ⓘ Cerchiaraite-(Fe) | Ba4Fe43+O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| H | ⓘ Ferriperbøeite-(Ce) | CaCe3(Fe3+Al2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| H | ⓘ Clino-ferro-suenoite | ◻Mn22+(Fe52+)(Si8O22)(OH)2 |
| H | ⓘ Zinkgruvanite | Ba4Mn42+Fe23+(Si2O7)2(SO4)2O2(OH)2 |
| H | ⓘ Amphibole Supergroup var. Clinoamphibole | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Be | Beryllium | |
| Be | ⓘ Barylite | Be2Ba(Si2O7) |
| Be | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Chrysoberyl | BeAl2O4 |
| Be | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| Be | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| Be | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Be | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Datolite | CaB(SiO4)(OH) |
| B | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| B | ⓘ Fluor-uvite-Uvite Series | |
| C | Carbon | |
| C | ⓘ Andersonite | Na2Ca(UO2)(CO3)3 · 5.33H2O |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Barytocalcite | BaCa(CO3)2 |
| C | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Hydroxylbastnäsite-(Ce) | Ce(CO3)(OH) |
| C | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| C | ⓘ Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| C | ⓘ Liebigite | Ca2(UO2)(CO3)3 · 11H2O |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| C | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| C | ⓘ Scapolite var. Wernerite | |
| C | ⓘ Witherite | BaCO3 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Aegirine | NaFe3+Si2O6 |
| O | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allactite | Mn72+(AsO4)2(OH)8 |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Andersonite | Na2Ca(UO2)(CO3)3 · 5.33H2O |
| O | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Apophyllite Group | AB4[Si8O20]X · 8H2O |
| O | ⓘ Arseniopleite | NaCaMnMn2(AsO4)3 |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Barytocalcite | BaCa(CO3)2 |
| O | ⓘ Banalsite | Na2BaAl4Si4O16 |
| O | ⓘ Bannisterite | (Ca,K,Na)(Mn2+,Fe2+)10(Si,Al)16O38(OH)8 · nH2O |
| O | ⓘ Barylite | Be2Ba(Si2O7) |
| O | ⓘ Barysilite | Pb8Mn2+[Si2O7]3 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| O | ⓘ Bementite | Mn7Si6O15(OH)8 |
| O | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| O | ⓘ Berzeliite | (NaCa2)Mg2(AsO4)3 |
| O | ⓘ Bindheimite | Pb2Sb2O6O |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bismite | Bi2O3 |
| O | ⓘ Brannerite | UTi2O6 |
| O | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| O | ⓘ Brookite | TiO2 |
| O | ⓘ Bustamite | CaMn2+(Si2O6) |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Brucite | Mg(OH)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| O | ⓘ Caryinite | (Na,Pb)(Ca,Na)CaMn22+(AsO4)3 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Celsian | Ba(Al2Si2O8) |
| O | ⓘ Cerite-(CeCa) | (Ce7Ca2)◻Mg(SiO4)3(SiO3OH)4(OH)3 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| O | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Chrysoberyl | BeAl2O4 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Cordierite | Mg2Al4Si5O18 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Clinochlore var. Diabantite | (Mg,Fe,Al)6((Si,Al)4O10)(OH)8 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Datolite | CaB(SiO4)(OH) |
| O | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| O | ⓘ Eckermannite | NaNa2(Mg4Al}Si8O22(OH)2 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Fayalite | Fe22+(SiO4) |
| O | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| O | ⓘ Feitknechtite | Mn3+O(OH) |
| O | ⓘ Ferberite | FeWO4 |
| O | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| O | ⓘ Pyrosmalite-(Fe) | Fe82+Si6O15(OH,Cl)10 |
| O | ⓘ Ferro-richterite | Na(CaNa)Fe52+(Si8O22)(OH)2 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Forsterite | Mg2(SiO4) |
| O | ⓘ Franklinite | Zn2+Fe23+O4 |
| O | ⓘ Friedelite | Mn82+Si6O15(OH,Cl)10 |
| O | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| O | ⓘ Gahnite | ZnAl2O4 |
| O | ⓘ Ganophyllite | (K,Na)xMn62+(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| O | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| O | ⓘ Glaucophane | ◻Na2(Mg3Al2)Si8O22(OH)2 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Greenalite | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Grunerite | ◻Fe22+Fe52+(Si8O22)(OH)2 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hausmannite | Mn2+Mn23+O4 |
| O | ⓘ Hedenbergite | CaFe2+Si2O6 |
| O | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| O | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| O | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| O | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| O | ⓘ Hübnerite | MnWO4 |
| O | ⓘ Humite | Mg7(SiO4)3F2 |
| O | ⓘ Hydroxylbastnäsite-(Ce) | Ce(CO3)(OH) |
| O | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| O | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| O | ⓘ Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Inesite | Ca2(Mn,Fe)7Si10O28(OH)2 · 5H2O |
| O | ⓘ Ingersonite | Ca3Mn2+Sb45+O14 |
| O | ⓘ Jacobsite-Q | Mn2+(Fe3+,Mn3+)2O4 |
| O | ⓘ Jacobsite | Mn2+Fe23+O4 |
| O | ⓘ Augite var. Jeffersonite | Ca(Mn,Zn,Fe)Si2O6 |
| O | ⓘ Johnbaumite | Ca5(AsO4)3(OH) |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Katoptrite | (Mn2+,Mg)13(Al,Fe3+)4Sb25+(SiO4)2O20 |
| O | ⓘ Kentrolite | Pb2Mn23+(Si2O7)O2 |
| O | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| O | ⓘ Långbanite | Mn42+Mn93+Sb5+O16(SiO4)2 |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Liebigite | Ca2(UO2)(CO3)3 · 11H2O |
| O | ⓘ Biotite var. Manganophyllite | K(Fe,Mg,Mn)3AlSi3O10(OH)2 |
| O | ⓘ Manganberzeliite | (NaCa2)Mn22+(AsO4)3 |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Magnetoplumbite | PbFe123+O19 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Marialite | Na4Al3Si9O24Cl |
| O | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| O | ⓘ Melanostibite | Mn22+Fe3+Sb5+O6 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Minnesotaite | Fe32+Si4O10(OH)2 |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Neotocite | (Mn,Fe)SiO3 · H2O (?) |
| O | ⓘ Nepheline | Na3K(Al4Si4O16) |
| O | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthochamosite | (Fe2+,Mg,Fe3+)5Al(AlSi3O10)(OH,O)8 |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Örebroite | Mn32+(Sb5+,Fe3+)(SiO4)(O,OH)3 |
| O | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Uraninite var. Pitchblende | UO2 |
| O | ⓘ Plumboferrite | Pb[Fe3+10.67Mn2+0.33Pb]O18.33 |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pyrobelonite | PbMn2+(VO4)(OH) |
| O | ⓘ Pyrochroite | Mn(OH)2 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Pyrophanite | Mn2+TiO3 |
| O | ⓘ Pyroxmangite | Mn2+SiO3 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| O | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| O | ⓘ Roméite Group | A2(Sb5+)2O6Z |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Sarkinite | Mn22+(AsO4)(OH) |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Diopside var. Schefferite | (Ca,Mn)(Mg,Fe,Mn)Si2O6 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| O | ⓘ Senaite | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Sonolite | Mn92+(SiO4)4(OH)2 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| O | ⓘ Svabite | Ca5(AsO4)3F |
| O | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Tephroite | Mn22+(SiO4) |
| O | ⓘ Thorite | Th(SiO4) |
| O | ⓘ Tilasite | CaMg(AsO4)F |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| O | ⓘ Törnebohmite-(Ce) | Ce2Al(SiO4)2(OH) |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Triplite | Mn22+(PO4)F |
| O | ⓘ Turneaureite | Ca5(AsO4)3Cl |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Parauranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| O | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| O | ⓘ Fluor-uvite-Uvite Series | |
| O | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Wagnerite | Mg2(PO4)F |
| O | ⓘ Welinite | Mn62+(W6+,Mg)2(SiO4)2(O,OH)6 |
| O | ⓘ Scapolite var. Wernerite | |
| O | ⓘ Willemite | Zn2SiO4 |
| O | ⓘ Witherite | BaCO3 |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Sarkinite var. Xanthoarsenite | Mn2(As,Sb)O4OH |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Quartz var. Milky Quartz | SiO2 |
| O | ⓘ Spinel var. Pleonaste | (Mg,Fe)Al2O4 |
| O | ⓘ Stilpnomelane var. Ekmanite | K4(Fe2+,Mn)48[Si64Al8]O1664(OH)52 · nH2O |
| O | ⓘ Actinolite-Tremolite Series | |
| O | ⓘ Fayalite-Forsterite Series | |
| O | ⓘ Fayalite-Tephroite Series | |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Fayalite-Tephroite Series var. Knebelite | from (Fe1.5Mn0.5)2SiO4 to (Mn1.5Fe0.5)2SiO4 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Aegirine-augite var. Urbanite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Ferriallanite-(Ce) | (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Västmanlandite-(Ce) | CaCe3(MgAl2Mg)[Si2O7][SiO4]3F(OH)2 |
| O | ⓘ Scheelite var. Molybdoscheelite | Ca(WO4) |
| O | ⓘ Ferri-winchite | ◻(NaCa)(Mg4Fe3+)Si8O22(OH)2 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Fluorapatite var. Manganapatite | Ca5(PO4)3F |
| O | ⓘ UM2007-35-SiO:AlCaFFeMgREE | Ca(Ce,La)3Al2Fe22+(Si2O7)(SiO4)3(OH)2F |
| O | ⓘ Gadolinite Group | A2MQ2Si2O8φ2 |
| O | ⓘ Pleurasite | Mn, Fe, AsO4 |
| O | ⓘ Unnamed (Mg-analogue of Ferriallanite-(Ce)) | (CaCe)(Fe3+AlMg)O[Si2O7][SiO4](OH) |
| O | ⓘ Perbøeite-(Ce) | CaCe3(AlAl2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| O | ⓘ Cerchiaraite-(Al) | Ba4Al4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| O | ⓘ Cerchiaraite-(Fe) | Ba4Fe43+O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| O | ⓘ Magnetoplumbite var. Barium-bearing magnetoplumbite | (Pb,Ba)(Fe,Mn)12O19 |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| O | ⓘ Ferriperbøeite-(Ce) | CaCe3(Fe3+Al2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| O | ⓘ Clino-ferro-suenoite | ◻Mn22+(Fe52+)(Si8O22)(OH)2 |
| O | ⓘ Zinkgruvanite | Ba4Mn42+Fe23+(Si2O7)2(SO4)2O2(OH)2 |
| O | ⓘ Amphibole Supergroup var. Clinoamphibole | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | Fluorine | |
| F | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| F | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| F | ⓘ Humite | Mg7(SiO4)3F2 |
| F | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| F | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| F | ⓘ Svabite | Ca5(AsO4)3F |
| F | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| F | ⓘ Tilasite | CaMg(AsO4)F |
| F | ⓘ Triplite | Mn22+(PO4)F |
| F | ⓘ Fluor-uvite-Uvite Series | |
| F | ⓘ Wagnerite | Mg2(PO4)F |
| F | ⓘ Västmanlandite-(Ce) | CaCe3(MgAl2Mg)[Si2O7][SiO4]3F(OH)2 |
| F | ⓘ Fluorapatite var. Manganapatite | Ca5(PO4)3F |
| F | ⓘ UM2007-35-SiO:AlCaFFeMgREE | Ca(Ce,La)3Al2Fe22+(Si2O7)(SiO4)3(OH)2F |
| F | ⓘ Zhangpeishanite | BaFCl |
| F | ⓘ Amphibole Supergroup var. Clinoamphibole | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Na | Sodium | |
| Na | ⓘ Aegirine | NaFe3+Si2O6 |
| Na | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Andersonite | Na2Ca(UO2)(CO3)3 · 5.33H2O |
| Na | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Arseniopleite | NaCaMnMn2(AsO4)3 |
| Na | ⓘ Banalsite | Na2BaAl4Si4O16 |
| Na | ⓘ Bannisterite | (Ca,K,Na)(Mn2+,Fe2+)10(Si,Al)16O38(OH)8 · nH2O |
| Na | ⓘ Berzeliite | (NaCa2)Mg2(AsO4)3 |
| Na | ⓘ Caryinite | (Na,Pb)(Ca,Na)CaMn22+(AsO4)3 |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Eckermannite | NaNa2(Mg4Al}Si8O22(OH)2 |
| Na | ⓘ Ferro-richterite | Na(CaNa)Fe52+(Si8O22)(OH)2 |
| Na | ⓘ Ganophyllite | (K,Na)xMn62+(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| Na | ⓘ Glaucophane | ◻Na2(Mg3Al2)Si8O22(OH)2 |
| Na | ⓘ Manganberzeliite | (NaCa2)Mn22+(AsO4)3 |
| Na | ⓘ Marialite | Na4Al3Si9O24Cl |
| Na | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Na | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Na | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| Na | ⓘ Scapolite var. Wernerite | |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | ⓘ Aegirine-augite var. Urbanite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Na | ⓘ Ferri-winchite | ◻(NaCa)(Mg4Fe3+)Si8O22(OH)2 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Mg | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| Mg | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Berzeliite | (NaCa2)Mg2(AsO4)3 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Brucite | Mg(OH)2 |
| Mg | ⓘ Cerite-(CeCa) | (Ce7Ca2)◻Mg(SiO4)3(SiO3OH)4(OH)3 |
| Mg | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| Mg | ⓘ Cordierite | Mg2Al4Si5O18 |
| Mg | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Clinochlore var. Diabantite | (Mg,Fe,Al)6((Si,Al)4O10)(OH)8 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Eckermannite | NaNa2(Mg4Al}Si8O22(OH)2 |
| Mg | ⓘ Forsterite | Mg2(SiO4) |
| Mg | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Mg | ⓘ Glaucophane | ◻Na2(Mg3Al2)Si8O22(OH)2 |
| Mg | ⓘ Humite | Mg7(SiO4)3F2 |
| Mg | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| Mg | ⓘ Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| Mg | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Mg | ⓘ Katoptrite | (Mn2+,Mg)13(Al,Fe3+)4Sb25+(SiO4)2O20 |
| Mg | ⓘ Biotite var. Manganophyllite | K(Fe,Mg,Mn)3AlSi3O10(OH)2 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Orthochamosite | (Fe2+,Mg,Fe3+)5Al(AlSi3O10)(OH,O)8 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Diopside var. Schefferite | (Ca,Mn)(Mg,Fe,Mn)Si2O6 |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tilasite | CaMg(AsO4)F |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Fluor-uvite-Uvite Series | |
| Mg | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Mg | ⓘ Wagnerite | Mg2(PO4)F |
| Mg | ⓘ Welinite | Mn62+(W6+,Mg)2(SiO4)2(O,OH)6 |
| Mg | ⓘ Spinel var. Pleonaste | (Mg,Fe)Al2O4 |
| Mg | ⓘ Actinolite-Tremolite Series | |
| Mg | ⓘ Fayalite-Forsterite Series | |
| Mg | ⓘ Aegirine-augite var. Urbanite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Mg | ⓘ Västmanlandite-(Ce) | CaCe3(MgAl2Mg)[Si2O7][SiO4]3F(OH)2 |
| Mg | ⓘ Ferri-winchite | ◻(NaCa)(Mg4Fe3+)Si8O22(OH)2 |
| Mg | ⓘ Unnamed (Mg-analogue of Ferriallanite-(Ce)) | (CaCe)(Fe3+AlMg)O[Si2O7][SiO4](OH) |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Banalsite | Na2BaAl4Si4O16 |
| Al | ⓘ Bannisterite | (Ca,K,Na)(Mn2+,Fe2+)10(Si,Al)16O38(OH)8 · nH2O |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Celsian | Ba(Al2Si2O8) |
| Al | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Al | ⓘ Chrysoberyl | BeAl2O4 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Cordierite | Mg2Al4Si5O18 |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Clinochlore var. Diabantite | (Mg,Fe,Al)6((Si,Al)4O10)(OH)8 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Eckermannite | NaNa2(Mg4Al}Si8O22(OH)2 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Al | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Al | ⓘ Gahnite | ZnAl2O4 |
| Al | ⓘ Ganophyllite | (K,Na)xMn62+(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| Al | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Al | ⓘ Glaucophane | ◻Na2(Mg3Al2)Si8O22(OH)2 |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Al | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Al | ⓘ Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Katoptrite | (Mn2+,Mg)13(Al,Fe3+)4Sb25+(SiO4)2O20 |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Biotite var. Manganophyllite | K(Fe,Mg,Mn)3AlSi3O10(OH)2 |
| Al | ⓘ Marialite | Na4Al3Si9O24Cl |
| Al | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Al | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Al | ⓘ Orthochamosite | (Fe2+,Mg,Fe3+)5Al(AlSi3O10)(OH,O)8 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| Al | ⓘ Törnebohmite-(Ce) | Ce2Al(SiO4)2(OH) |
| Al | ⓘ Fluor-uvite-Uvite Series | |
| Al | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Scapolite var. Wernerite | |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Spinel var. Pleonaste | (Mg,Fe)Al2O4 |
| Al | ⓘ Stilpnomelane var. Ekmanite | K4(Fe2+,Mn)48[Si64Al8]O1664(OH)52 · nH2O |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Aegirine-augite var. Urbanite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Al | ⓘ Ferriallanite-(Ce) | (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Västmanlandite-(Ce) | CaCe3(MgAl2Mg)[Si2O7][SiO4]3F(OH)2 |
| Al | ⓘ Calcium Amphibole Subgroup | AnCa2(C2+5-mCm3+)(Si8-(n+m)Al(n+m))W2 |
| Al | ⓘ UM2007-35-SiO:AlCaFFeMgREE | Ca(Ce,La)3Al2Fe22+(Si2O7)(SiO4)3(OH)2F |
| Al | ⓘ Unnamed (Mg-analogue of Ferriallanite-(Ce)) | (CaCe)(Fe3+AlMg)O[Si2O7][SiO4](OH) |
| Al | ⓘ Perbøeite-(Ce) | CaCe3(AlAl2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| Al | ⓘ Cerchiaraite-(Al) | Ba4Al4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| Al | ⓘ Ferriperbøeite-(Ce) | CaCe3(Fe3+Al2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| Al | ⓘ Amphibole Supergroup var. Clinoamphibole | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Aegirine | NaFe3+Si2O6 |
| Si | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Apophyllite Group | AB4[Si8O20]X · 8H2O |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Banalsite | Na2BaAl4Si4O16 |
| Si | ⓘ Bannisterite | (Ca,K,Na)(Mn2+,Fe2+)10(Si,Al)16O38(OH)8 · nH2O |
| Si | ⓘ Barylite | Be2Ba(Si2O7) |
| Si | ⓘ Barysilite | Pb8Mn2+[Si2O7]3 |
| Si | ⓘ Bementite | Mn7Si6O15(OH)8 |
| Si | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Si | ⓘ Bustamite | CaMn2+(Si2O6) |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Celsian | Ba(Al2Si2O8) |
| Si | ⓘ Cerite-(CeCa) | (Ce7Ca2)◻Mg(SiO4)3(SiO3OH)4(OH)3 |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Si | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Cordierite | Mg2Al4Si5O18 |
| Si | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Clinochlore var. Diabantite | (Mg,Fe,Al)6((Si,Al)4O10)(OH)8 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Datolite | CaB(SiO4)(OH) |
| Si | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| Si | ⓘ Eckermannite | NaNa2(Mg4Al}Si8O22(OH)2 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Fayalite | Fe22+(SiO4) |
| Si | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Si | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Si | ⓘ Pyrosmalite-(Fe) | Fe82+Si6O15(OH,Cl)10 |
| Si | ⓘ Ferro-richterite | Na(CaNa)Fe52+(Si8O22)(OH)2 |
| Si | ⓘ Forsterite | Mg2(SiO4) |
| Si | ⓘ Friedelite | Mn82+Si6O15(OH,Cl)10 |
| Si | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| Si | ⓘ Ganophyllite | (K,Na)xMn62+(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| Si | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Si | ⓘ Glaucophane | ◻Na2(Mg3Al2)Si8O22(OH)2 |
| Si | ⓘ Greenalite | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Grunerite | ◻Fe22+Fe52+(Si8O22)(OH)2 |
| Si | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Si | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| Si | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Si | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Si | ⓘ Humite | Mg7(SiO4)3F2 |
| Si | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Si | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Si | ⓘ Inesite | Ca2(Mn,Fe)7Si10O28(OH)2 · 5H2O |
| Si | ⓘ Augite var. Jeffersonite | Ca(Mn,Zn,Fe)Si2O6 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Katoptrite | (Mn2+,Mg)13(Al,Fe3+)4Sb25+(SiO4)2O20 |
| Si | ⓘ Kentrolite | Pb2Mn23+(Si2O7)O2 |
| Si | ⓘ Långbanite | Mn42+Mn93+Sb5+O16(SiO4)2 |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Biotite var. Manganophyllite | K(Fe,Mg,Mn)3AlSi3O10(OH)2 |
| Si | ⓘ Marialite | Na4Al3Si9O24Cl |
| Si | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Minnesotaite | Fe32+Si4O10(OH)2 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Neotocite | (Mn,Fe)SiO3 · H2O (?) |
| Si | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Si | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthochamosite | (Fe2+,Mg,Fe3+)5Al(AlSi3O10)(OH,O)8 |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Örebroite | Mn32+(Sb5+,Fe3+)(SiO4)(O,OH)3 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Pyroxmangite | Mn2+SiO3 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Si | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| Si | ⓘ Diopside var. Schefferite | (Ca,Mn)(Mg,Fe,Mn)Si2O6 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Sonolite | Mn92+(SiO4)4(OH)2 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Tephroite | Mn22+(SiO4) |
| Si | ⓘ Thorite | Th(SiO4) |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Törnebohmite-(Ce) | Ce2Al(SiO4)2(OH) |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Parauranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Si | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Si | ⓘ Fluor-uvite-Uvite Series | |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Welinite | Mn62+(W6+,Mg)2(SiO4)2(O,OH)6 |
| Si | ⓘ Scapolite var. Wernerite | |
| Si | ⓘ Willemite | Zn2SiO4 |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Quartz var. Milky Quartz | SiO2 |
| Si | ⓘ Stilpnomelane var. Ekmanite | K4(Fe2+,Mn)48[Si64Al8]O1664(OH)52 · nH2O |
| Si | ⓘ Actinolite-Tremolite Series | |
| Si | ⓘ Fayalite-Forsterite Series | |
| Si | ⓘ Fayalite-Tephroite Series | |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Fayalite-Tephroite Series var. Knebelite | from (Fe1.5Mn0.5)2SiO4 to (Mn1.5Fe0.5)2SiO4 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Aegirine-augite var. Urbanite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Ferriallanite-(Ce) | (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Västmanlandite-(Ce) | CaCe3(MgAl2Mg)[Si2O7][SiO4]3F(OH)2 |
| Si | ⓘ Ferri-winchite | ◻(NaCa)(Mg4Fe3+)Si8O22(OH)2 |
| Si | ⓘ Calcium Amphibole Subgroup | AnCa2(C2+5-mCm3+)(Si8-(n+m)Al(n+m))W2 |
| Si | ⓘ UM2007-35-SiO:AlCaFFeMgREE | Ca(Ce,La)3Al2Fe22+(Si2O7)(SiO4)3(OH)2F |
| Si | ⓘ Gadolinite Group | A2MQ2Si2O8φ2 |
| Si | ⓘ Unnamed (Mg-analogue of Ferriallanite-(Ce)) | (CaCe)(Fe3+AlMg)O[Si2O7][SiO4](OH) |
| Si | ⓘ Perbøeite-(Ce) | CaCe3(AlAl2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| Si | ⓘ Cerchiaraite-(Al) | Ba4Al4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| Si | ⓘ Cerchiaraite-(Fe) | Ba4Fe43+O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Ferriperbøeite-(Ce) | CaCe3(Fe3+Al2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| Si | ⓘ Clino-ferro-suenoite | ◻Mn22+(Fe52+)(Si8O22)(OH)2 |
| Si | ⓘ Zinkgruvanite | Ba4Mn42+Fe23+(Si2O7)2(SO4)2O2(OH)2 |
| Si | ⓘ Amphibole Supergroup var. Clinoamphibole | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| P | Phosphorus | |
| P | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Triplite | Mn22+(PO4)F |
| P | ⓘ Wagnerite | Mg2(PO4)F |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3A |
| P | ⓘ Fluorapatite var. Manganapatite | Ca5(PO4)3F |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Argentopentlandite | Ag(Fe,Ni)8S8 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Benavidesite | Pb4MnSb6S14 |
| S | ⓘ Berthierite | FeSb2S4 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Cobaltpentlandite | Co9S8 |
| S | ⓘ Costibite | CoSbS |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Djurleite | Cu31S16 |
| S | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| S | ⓘ Emplectite | CuBiS2 |
| S | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| S | ⓘ Galena | PbS |
| S | ⓘ Geocronite | Pb14Sb6S23 |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Giessenite | Pb27Cu2(Bi,Sb)19S57 |
| S | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Gudmundite | FeSbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| S | ⓘ Herzenbergite | SnS |
| S | ⓘ Izoklakeite | Pb27(Cu,Fe,Ag)2(Sb,Bi)19S57 |
| S | ⓘ Jaskólskiite | CuxPb2+x(Sb,Bi)2-xS5 (x ~ 0.15) |
| S | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| S | ⓘ Lillianite | Pb3-2xAgxBi2+xS6 |
| S | ⓘ Mackinawite | FeS |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Mckinstryite | Ag5-xCu3+xS4 |
| S | ⓘ Meneghinite | Pb13CuSb7S24 |
| S | ⓘ Miargyrite | AgSbS2 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Paracostibite | CoSbS |
| S | ⓘ Parkerite | Ni3(Bi,Pb)2S2 |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stannite | Cu2FeSnS4 |
| S | ⓘ Stephanite | Ag5SbS4 |
| S | ⓘ Sternbergite | AgFe2S3 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Stromeyerite | AgCuS |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Troilite | FeS |
| S | ⓘ Ullmannite | NiSbS |
| S | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| S | ⓘ Willyamite | CoSbS |
| S | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| S | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| S | ⓘ Kobellite var. Antimony-bearing Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| S | ⓘ Bismuthinite var. Antimony-bearing Bismuthinite | (Bi,Sb)2S3 |
| S | ⓘ Argentotetrahedrite-(Fe) | Ag6(Cu4Fe2)Sb4S12S |
| S | ⓘ Zinkgruvanite | Ba4Mn42+Fe23+(Si2O7)2(SO4)2O2(OH)2 |
| Cl | Chlorine | |
| Cl | ⓘ Pyrosmalite-(Fe) | Fe82+Si6O15(OH,Cl)10 |
| Cl | ⓘ Friedelite | Mn82+Si6O15(OH,Cl)10 |
| Cl | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| Cl | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Cl | ⓘ Marialite | Na4Al3Si9O24Cl |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Turneaureite | Ca5(AsO4)3Cl |
| Cl | ⓘ Scapolite var. Wernerite | |
| Cl | ⓘ Zhangpeishanite | BaFCl |
| Cl | ⓘ Cerchiaraite-(Al) | Ba4Al4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| Cl | ⓘ Cerchiaraite-(Fe) | Ba4Fe43+O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| Cl | ⓘ Amphibole Supergroup var. Clinoamphibole | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Bannisterite | (Ca,K,Na)(Mn2+,Fe2+)10(Si,Al)16O38(OH)8 · nH2O |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| K | ⓘ Ganophyllite | (K,Na)xMn62+(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| K | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| K | ⓘ Biotite var. Manganophyllite | K(Fe,Mg,Mn)3AlSi3O10(OH)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Nepheline | Na3K(Al4Si4O16) |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| K | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| K | ⓘ Stilpnomelane var. Ekmanite | K4(Fe2+,Mn)48[Si64Al8]O1664(OH)52 · nH2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Andersonite | Na2Ca(UO2)(CO3)3 · 5.33H2O |
| Ca | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Arseniopleite | NaCaMnMn2(AsO4)3 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | ⓘ Barytocalcite | BaCa(CO3)2 |
| Ca | ⓘ Bannisterite | (Ca,K,Na)(Mn2+,Fe2+)10(Si,Al)16O38(OH)8 · nH2O |
| Ca | ⓘ Berzeliite | (NaCa2)Mg2(AsO4)3 |
| Ca | ⓘ Bustamite | CaMn2+(Si2O6) |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Caryinite | (Na,Pb)(Ca,Na)CaMn22+(AsO4)3 |
| Ca | ⓘ Cerite-(CeCa) | (Ce7Ca2)◻Mg(SiO4)3(SiO3OH)4(OH)3 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Datolite | CaB(SiO4)(OH) |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Ca | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Ca | ⓘ Ferro-richterite | Na(CaNa)Fe52+(Si8O22)(OH)2 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Ca | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| Ca | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| Ca | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Ca | ⓘ Inesite | Ca2(Mn,Fe)7Si10O28(OH)2 · 5H2O |
| Ca | ⓘ Ingersonite | Ca3Mn2+Sb45+O14 |
| Ca | ⓘ Augite var. Jeffersonite | Ca(Mn,Zn,Fe)Si2O6 |
| Ca | ⓘ Johnbaumite | Ca5(AsO4)3(OH) |
| Ca | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Liebigite | Ca2(UO2)(CO3)3 · 11H2O |
| Ca | ⓘ Manganberzeliite | (NaCa2)Mn22+(AsO4)3 |
| Ca | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Ca | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Ca | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| Ca | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Ca | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Diopside var. Schefferite | (Ca,Mn)(Mg,Fe,Mn)Si2O6 |
| Ca | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| Ca | ⓘ Svabite | Ca5(AsO4)3F |
| Ca | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ca | ⓘ Tilasite | CaMg(AsO4)F |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Turneaureite | Ca5(AsO4)3Cl |
| Ca | ⓘ Parauranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Ca | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Ca | ⓘ Fluor-uvite-Uvite Series | |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Scapolite var. Wernerite | |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Actinolite-Tremolite Series | |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Aegirine-augite var. Urbanite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Ca | ⓘ Ferriallanite-(Ce) | (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Västmanlandite-(Ce) | CaCe3(MgAl2Mg)[Si2O7][SiO4]3F(OH)2 |
| Ca | ⓘ Scheelite var. Molybdoscheelite | Ca(WO4) |
| Ca | ⓘ Ferri-winchite | ◻(NaCa)(Mg4Fe3+)Si8O22(OH)2 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ca | ⓘ Calcium Amphibole Subgroup | AnCa2(C2+5-mCm3+)(Si8-(n+m)Al(n+m))W2 |
| Ca | ⓘ Fluorapatite var. Manganapatite | Ca5(PO4)3F |
| Ca | ⓘ UM2007-35-SiO:AlCaFFeMgREE | Ca(Ce,La)3Al2Fe22+(Si2O7)(SiO4)3(OH)2F |
| Ca | ⓘ Unnamed (Mg-analogue of Ferriallanite-(Ce)) | (CaCe)(Fe3+AlMg)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Perbøeite-(Ce) | CaCe3(AlAl2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| Ca | ⓘ Ferriperbøeite-(Ce) | CaCe3(Fe3+Al2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brannerite | UTi2O6 |
| Ti | ⓘ Brookite | TiO2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Pyrophanite | Mn2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Senaite | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Ti | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| Ti | ⓘ Amphibole Supergroup var. Clinoamphibole | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| V | Vanadium | |
| V | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| V | ⓘ Pyrobelonite | PbMn2+(VO4)(OH) |
| V | ⓘ Senaite | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Senaite | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
| Mn | Manganese | |
| Mn | ⓘ Allactite | Mn72+(AsO4)2(OH)8 |
| Mn | ⓘ Arseniopleite | NaCaMnMn2(AsO4)3 |
| Mn | ⓘ Bannisterite | (Ca,K,Na)(Mn2+,Fe2+)10(Si,Al)16O38(OH)8 · nH2O |
| Mn | ⓘ Barysilite | Pb8Mn2+[Si2O7]3 |
| Mn | ⓘ Bementite | Mn7Si6O15(OH)8 |
| Mn | ⓘ Benavidesite | Pb4MnSb6S14 |
| Mn | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Mn | ⓘ Bustamite | CaMn2+(Si2O6) |
| Mn | ⓘ Caryinite | (Na,Pb)(Ca,Na)CaMn22+(AsO4)3 |
| Mn | ⓘ Feitknechtite | Mn3+O(OH) |
| Mn | ⓘ Friedelite | Mn82+Si6O15(OH,Cl)10 |
| Mn | ⓘ Ganophyllite | (K,Na)xMn62+(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| Mn | ⓘ Hausmannite | Mn2+Mn23+O4 |
| Mn | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Mn | ⓘ Hübnerite | MnWO4 |
| Mn | ⓘ Inesite | Ca2(Mn,Fe)7Si10O28(OH)2 · 5H2O |
| Mn | ⓘ Ingersonite | Ca3Mn2+Sb45+O14 |
| Mn | ⓘ Jacobsite-Q | Mn2+(Fe3+,Mn3+)2O4 |
| Mn | ⓘ Jacobsite | Mn2+Fe23+O4 |
| Mn | ⓘ Augite var. Jeffersonite | Ca(Mn,Zn,Fe)Si2O6 |
| Mn | ⓘ Katoptrite | (Mn2+,Mg)13(Al,Fe3+)4Sb25+(SiO4)2O20 |
| Mn | ⓘ Kentrolite | Pb2Mn23+(Si2O7)O2 |
| Mn | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| Mn | ⓘ Långbanite | Mn42+Mn93+Sb5+O16(SiO4)2 |
| Mn | ⓘ Biotite var. Manganophyllite | K(Fe,Mg,Mn)3AlSi3O10(OH)2 |
| Mn | ⓘ Manganberzeliite | (NaCa2)Mn22+(AsO4)3 |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Mn | ⓘ Melanostibite | Mn22+Fe3+Sb5+O6 |
| Mn | ⓘ Neotocite | (Mn,Fe)SiO3 · H2O (?) |
| Mn | ⓘ Örebroite | Mn32+(Sb5+,Fe3+)(SiO4)(O,OH)3 |
| Mn | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Mn | ⓘ Plumboferrite | Pb[Fe3+10.67Mn2+0.33Pb]O18.33 |
| Mn | ⓘ Pyrobelonite | PbMn2+(VO4)(OH) |
| Mn | ⓘ Pyrochroite | Mn(OH)2 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Pyrophanite | Mn2+TiO3 |
| Mn | ⓘ Pyroxmangite | Mn2+SiO3 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Mn | ⓘ Sarkinite | Mn22+(AsO4)(OH) |
| Mn | ⓘ Diopside var. Schefferite | (Ca,Mn)(Mg,Fe,Mn)Si2O6 |
| Mn | ⓘ Senaite | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
| Mn | ⓘ Sonolite | Mn92+(SiO4)4(OH)2 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Tephroite | Mn22+(SiO4) |
| Mn | ⓘ Triplite | Mn22+(PO4)F |
| Mn | ⓘ Welinite | Mn62+(W6+,Mg)2(SiO4)2(O,OH)6 |
| Mn | ⓘ Sarkinite var. Xanthoarsenite | Mn2(As,Sb)O4OH |
| Mn | ⓘ Stilpnomelane var. Ekmanite | K4(Fe2+,Mn)48[Si64Al8]O1664(OH)52 · nH2O |
| Mn | ⓘ Fayalite-Tephroite Series | |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Mn | ⓘ Fayalite-Tephroite Series var. Knebelite | from (Fe1.5Mn0.5)2SiO4 to (Mn1.5Fe0.5)2SiO4 |
| Mn | ⓘ Pleurasite | Mn, Fe, AsO4 |
| Mn | ⓘ Magnetoplumbite var. Barium-bearing magnetoplumbite | (Pb,Ba)(Fe,Mn)12O19 |
| Mn | ⓘ Clino-ferro-suenoite | ◻Mn22+(Fe52+)(Si8O22)(OH)2 |
| Mn | ⓘ Zinkgruvanite | Ba4Mn42+Fe23+(Si2O7)2(SO4)2O2(OH)2 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Aegirine | NaFe3+Si2O6 |
| Fe | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Argentopentlandite | Ag(Fe,Ni)8S8 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Bannisterite | (Ca,K,Na)(Mn2+,Fe2+)10(Si,Al)16O38(OH)8 · nH2O |
| Fe | ⓘ Berthierite | FeSb2S4 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Clinochlore var. Diabantite | (Mg,Fe,Al)6((Si,Al)4O10)(OH)8 |
| Fe | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Fayalite | Fe22+(SiO4) |
| Fe | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Fe | ⓘ Ferberite | FeWO4 |
| Fe | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Fe | ⓘ Pyrosmalite-(Fe) | Fe82+Si6O15(OH,Cl)10 |
| Fe | ⓘ Ferro-richterite | Na(CaNa)Fe52+(Si8O22)(OH)2 |
| Fe | ⓘ Franklinite | Zn2+Fe23+O4 |
| Fe | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| Fe | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Greenalite | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| Fe | ⓘ Grunerite | ◻Fe22+Fe52+(Si8O22)(OH)2 |
| Fe | ⓘ Gudmundite | FeSbS |
| Fe | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| Fe | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Fe | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Inesite | Ca2(Mn,Fe)7Si10O28(OH)2 · 5H2O |
| Fe | ⓘ Jacobsite-Q | Mn2+(Fe3+,Mn3+)2O4 |
| Fe | ⓘ Izoklakeite | Pb27(Cu,Fe,Ag)2(Sb,Bi)19S57 |
| Fe | ⓘ Jacobsite | Mn2+Fe23+O4 |
| Fe | ⓘ Augite var. Jeffersonite | Ca(Mn,Zn,Fe)Si2O6 |
| Fe | ⓘ Katoptrite | (Mn2+,Mg)13(Al,Fe3+)4Sb25+(SiO4)2O20 |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Biotite var. Manganophyllite | K(Fe,Mg,Mn)3AlSi3O10(OH)2 |
| Fe | ⓘ Mackinawite | FeS |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Magnetoplumbite | PbFe123+O19 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Melanostibite | Mn22+Fe3+Sb5+O6 |
| Fe | ⓘ Minnesotaite | Fe32+Si4O10(OH)2 |
| Fe | ⓘ Neotocite | (Mn,Fe)SiO3 · H2O (?) |
| Fe | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Fe | ⓘ Orthochamosite | (Fe2+,Mg,Fe3+)5Al(AlSi3O10)(OH,O)8 |
| Fe | ⓘ Örebroite | Mn32+(Sb5+,Fe3+)(SiO4)(O,OH)3 |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Plumboferrite | Pb[Fe3+10.67Mn2+0.33Pb]O18.33 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Fe | ⓘ Diopside var. Schefferite | (Ca,Mn)(Mg,Fe,Mn)Si2O6 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Senaite | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Fe | ⓘ Sternbergite | AgFe2S3 |
| Fe | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| Fe | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| Fe | ⓘ Troilite | FeS |
| Fe | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Spinel var. Pleonaste | (Mg,Fe)Al2O4 |
| Fe | ⓘ Stilpnomelane var. Ekmanite | K4(Fe2+,Mn)48[Si64Al8]O1664(OH)52 · nH2O |
| Fe | ⓘ Actinolite-Tremolite Series | |
| Fe | ⓘ Fayalite-Forsterite Series | |
| Fe | ⓘ Fayalite-Tephroite Series | |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | ⓘ Fayalite-Tephroite Series var. Knebelite | from (Fe1.5Mn0.5)2SiO4 to (Mn1.5Fe0.5)2SiO4 |
| Fe | ⓘ Aegirine-augite var. Urbanite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Fe | ⓘ Ferriallanite-(Ce) | (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ferri-winchite | ◻(NaCa)(Mg4Fe3+)Si8O22(OH)2 |
| Fe | ⓘ UM2007-35-SiO:AlCaFFeMgREE | Ca(Ce,La)3Al2Fe22+(Si2O7)(SiO4)3(OH)2F |
| Fe | ⓘ Pleurasite | Mn, Fe, AsO4 |
| Fe | ⓘ Unnamed (Mg-analogue of Ferriallanite-(Ce)) | (CaCe)(Fe3+AlMg)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Perbøeite-(Ce) | CaCe3(AlAl2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| Fe | ⓘ Cerchiaraite-(Fe) | Ba4Fe43+O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| Fe | ⓘ Magnetoplumbite var. Barium-bearing magnetoplumbite | (Pb,Ba)(Fe,Mn)12O19 |
| Fe | ⓘ Argentotetrahedrite-(Fe) | Ag6(Cu4Fe2)Sb4S12S |
| Fe | ⓘ Ferriperbøeite-(Ce) | CaCe3(Fe3+Al2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| Fe | ⓘ Clino-ferro-suenoite | ◻Mn22+(Fe52+)(Si8O22)(OH)2 |
| Fe | ⓘ Zinkgruvanite | Ba4Mn42+Fe23+(Si2O7)2(SO4)2O2(OH)2 |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Cobaltpentlandite | Co9S8 |
| Co | ⓘ Costibite | CoSbS |
| Co | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Co | ⓘ Kieftite | CoSb3 |
| Co | ⓘ Paracostibite | CoSbS |
| Co | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Co | ⓘ Skutterudite | CoAs3 |
| Co | ⓘ Willyamite | CoSbS |
| Ni | Nickel | |
| Ni | ⓘ Argentopentlandite | Ag(Fe,Ni)8S8 |
| Ni | ⓘ Breithauptite | NiSb |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Maucherite | Ni11As8 |
| Ni | ⓘ Nickelskutterudite | NiAs3 |
| Ni | ⓘ Nickeline | NiAs |
| Ni | ⓘ Nisbite | NiSb2 |
| Ni | ⓘ Parkerite | Ni3(Bi,Pb)2S2 |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Ni | ⓘ Ullmannite | NiSbS |
| Cu | Copper | |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Djurleite | Cu31S16 |
| Cu | ⓘ Emplectite | CuBiS2 |
| Cu | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Cu | ⓘ Giessenite | Pb27Cu2(Bi,Sb)19S57 |
| Cu | ⓘ Izoklakeite | Pb27(Cu,Fe,Ag)2(Sb,Bi)19S57 |
| Cu | ⓘ Jaskólskiite | CuxPb2+x(Sb,Bi)2-xS5 (x ~ 0.15) |
| Cu | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Mckinstryite | Ag5-xCu3+xS4 |
| Cu | ⓘ Meneghinite | Pb13CuSb7S24 |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Cu | ⓘ Stromeyerite | AgCuS |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Cu | ⓘ Kobellite var. Antimony-bearing Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Cu | ⓘ Argentotetrahedrite-(Fe) | Ag6(Cu4Fe2)Sb4S12S |
| Zn | Zinc | |
| Zn | ⓘ Franklinite | Zn2+Fe23+O4 |
| Zn | ⓘ Gahnite | ZnAl2O4 |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Augite var. Jeffersonite | Ca(Mn,Zn,Fe)Si2O6 |
| Zn | ⓘ Senaite | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Willemite | Zn2SiO4 |
| As | Arsenic | |
| As | ⓘ Allactite | Mn72+(AsO4)2(OH)8 |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Arseniopleite | NaCaMnMn2(AsO4)3 |
| As | ⓘ Berzeliite | (NaCa2)Mg2(AsO4)3 |
| As | ⓘ Caryinite | (Na,Pb)(Ca,Na)CaMn22+(AsO4)3 |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| As | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| As | ⓘ Johnbaumite | Ca5(AsO4)3(OH) |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Manganberzeliite | (NaCa2)Mn22+(AsO4)3 |
| As | ⓘ Maucherite | Ni11As8 |
| As | ⓘ Nickelskutterudite | NiAs3 |
| As | ⓘ Nickeline | NiAs |
| As | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| As | ⓘ Sarkinite | Mn22+(AsO4)(OH) |
| As | ⓘ Skutterudite | CoAs3 |
| As | ⓘ Svabite | Ca5(AsO4)3F |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Tilasite | CaMg(AsO4)F |
| As | ⓘ Turneaureite | Ca5(AsO4)3Cl |
| As | ⓘ Sarkinite var. Xanthoarsenite | Mn2(As,Sb)O4OH |
| As | ⓘ Pleurasite | Mn, Fe, AsO4 |
| Y | Yttrium | |
| Y | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| Y | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| Y | ⓘ Senaite | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Allargentum | (Ag1-xSbx) |
| Ag | ⓘ Argentopentlandite | Ag(Fe,Ni)8S8 |
| Ag | ⓘ Dyscrasite | Ag3Sb |
| Ag | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Ag | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Ag | ⓘ Izoklakeite | Pb27(Cu,Fe,Ag)2(Sb,Bi)19S57 |
| Ag | ⓘ Lillianite | Pb3-2xAgxBi2+xS6 |
| Ag | ⓘ Mckinstryite | Ag5-xCu3+xS4 |
| Ag | ⓘ Miargyrite | AgSbS2 |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Stephanite | Ag5SbS4 |
| Ag | ⓘ Sternbergite | AgFe2S3 |
| Ag | ⓘ Stromeyerite | AgCuS |
| Ag | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Ag | ⓘ Argentotetrahedrite-(Fe) | Ag6(Cu4Fe2)Sb4S12S |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Herzenbergite | SnS |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sb | Antimony | |
| Sb | ⓘ Allargentum | (Ag1-xSbx) |
| Sb | ⓘ Native Antimony | Sb |
| Sb | ⓘ Benavidesite | Pb4MnSb6S14 |
| Sb | ⓘ Berthierite | FeSb2S4 |
| Sb | ⓘ Bindheimite | Pb2Sb2O6O |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Breithauptite | NiSb |
| Sb | ⓘ Costibite | CoSbS |
| Sb | ⓘ Dyscrasite | Ag3Sb |
| Sb | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Sb | ⓘ Geocronite | Pb14Sb6S23 |
| Sb | ⓘ Giessenite | Pb27Cu2(Bi,Sb)19S57 |
| Sb | ⓘ Gudmundite | FeSbS |
| Sb | ⓘ Ingersonite | Ca3Mn2+Sb45+O14 |
| Sb | ⓘ Izoklakeite | Pb27(Cu,Fe,Ag)2(Sb,Bi)19S57 |
| Sb | ⓘ Jaskólskiite | CuxPb2+x(Sb,Bi)2-xS5 (x ~ 0.15) |
| Sb | ⓘ Katoptrite | (Mn2+,Mg)13(Al,Fe3+)4Sb25+(SiO4)2O20 |
| Sb | ⓘ Kieftite | CoSb3 |
| Sb | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Sb | ⓘ Långbanite | Mn42+Mn93+Sb5+O16(SiO4)2 |
| Sb | ⓘ Melanostibite | Mn22+Fe3+Sb5+O6 |
| Sb | ⓘ Meneghinite | Pb13CuSb7S24 |
| Sb | ⓘ Miargyrite | AgSbS2 |
| Sb | ⓘ Nisbite | NiSb2 |
| Sb | ⓘ Örebroite | Mn32+(Sb5+,Fe3+)(SiO4)(O,OH)3 |
| Sb | ⓘ Paracostibite | CoSbS |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Roméite Group | A2(Sb5+)2O6Z |
| Sb | ⓘ Stephanite | Ag5SbS4 |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Ullmannite | NiSbS |
| Sb | ⓘ Willyamite | CoSbS |
| Sb | ⓘ Sarkinite var. Xanthoarsenite | Mn2(As,Sb)O4OH |
| Sb | ⓘ Kobellite var. Antimony-bearing Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Sb | ⓘ Bismuthinite var. Antimony-bearing Bismuthinite | (Bi,Sb)2S3 |
| Sb | ⓘ Argentotetrahedrite-(Fe) | Ag6(Cu4Fe2)Sb4S12S |
| Te | Tellurium | |
| Te | ⓘ Pilsenite | Bi4Te3 |
| Ba | Barium | |
| Ba | ⓘ Barytocalcite | BaCa(CO3)2 |
| Ba | ⓘ Banalsite | Na2BaAl4Si4O16 |
| Ba | ⓘ Barylite | Be2Ba(Si2O7) |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Celsian | Ba(Al2Si2O8) |
| Ba | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Ba | ⓘ Witherite | BaCO3 |
| Ba | ⓘ Zhangpeishanite | BaFCl |
| Ba | ⓘ Cerchiaraite-(Al) | Ba4Al4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| Ba | ⓘ Cerchiaraite-(Fe) | Ba4Fe43+O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| Ba | ⓘ Magnetoplumbite var. Barium-bearing magnetoplumbite | (Pb,Ba)(Fe,Mn)12O19 |
| Ba | ⓘ Zinkgruvanite | Ba4Mn42+Fe23+(Si2O7)2(SO4)2O2(OH)2 |
| La | Lanthanum | |
| La | ⓘ UM2007-35-SiO:AlCaFFeMgREE | Ca(Ce,La)3Al2Fe22+(Si2O7)(SiO4)3(OH)2F |
| Ce | Cerium | |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ce | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| Ce | ⓘ Cerite-(CeCa) | (Ce7Ca2)◻Mg(SiO4)3(SiO3OH)4(OH)3 |
| Ce | ⓘ Hydroxylbastnäsite-(Ce) | Ce(CO3)(OH) |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Ce | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| Ce | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ce | ⓘ Törnebohmite-(Ce) | Ce2Al(SiO4)2(OH) |
| Ce | ⓘ Ferriallanite-(Ce) | (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) |
| Ce | ⓘ Västmanlandite-(Ce) | CaCe3(MgAl2Mg)[Si2O7][SiO4]3F(OH)2 |
| Ce | ⓘ UM2007-35-SiO:AlCaFFeMgREE | Ca(Ce,La)3Al2Fe22+(Si2O7)(SiO4)3(OH)2F |
| Ce | ⓘ Unnamed (Mg-analogue of Ferriallanite-(Ce)) | (CaCe)(Fe3+AlMg)O[Si2O7][SiO4](OH) |
| Ce | ⓘ Perbøeite-(Ce) | CaCe3(AlAl2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| Ce | ⓘ Ferriperbøeite-(Ce) | CaCe3(Fe3+Al2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| W | Tungsten | |
| W | ⓘ Ferberite | FeWO4 |
| W | ⓘ Hübnerite | MnWO4 |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Welinite | Mn62+(W6+,Mg)2(SiO4)2(O,OH)6 |
| W | ⓘ Scheelite var. Molybdoscheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Barysilite | Pb8Mn2+[Si2O7]3 |
| Pb | ⓘ Benavidesite | Pb4MnSb6S14 |
| Pb | ⓘ Bindheimite | Pb2Sb2O6O |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Caryinite | (Na,Pb)(Ca,Na)CaMn22+(AsO4)3 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Geocronite | Pb14Sb6S23 |
| Pb | ⓘ Giessenite | Pb27Cu2(Bi,Sb)19S57 |
| Pb | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| Pb | ⓘ Izoklakeite | Pb27(Cu,Fe,Ag)2(Sb,Bi)19S57 |
| Pb | ⓘ Jaskólskiite | CuxPb2+x(Sb,Bi)2-xS5 (x ~ 0.15) |
| Pb | ⓘ Kentrolite | Pb2Mn23+(Si2O7)O2 |
| Pb | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Pb | ⓘ Native Lead | Pb |
| Pb | ⓘ Lillianite | Pb3-2xAgxBi2+xS6 |
| Pb | ⓘ Magnetoplumbite | PbFe123+O19 |
| Pb | ⓘ Meneghinite | Pb13CuSb7S24 |
| Pb | ⓘ Parkerite | Ni3(Bi,Pb)2S2 |
| Pb | ⓘ Plumboferrite | Pb[Fe3+10.67Mn2+0.33Pb]O18.33 |
| Pb | ⓘ Pyrobelonite | PbMn2+(VO4)(OH) |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Senaite | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Pb | ⓘ Kobellite var. Antimony-bearing Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Pb | ⓘ Magnetoplumbite var. Barium-bearing magnetoplumbite | (Pb,Ba)(Fe,Mn)12O19 |
| Bi | Bismuth | |
| Bi | ⓘ Bismite | Bi2O3 |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Emplectite | CuBiS2 |
| Bi | ⓘ Giessenite | Pb27Cu2(Bi,Sb)19S57 |
| Bi | ⓘ Izoklakeite | Pb27(Cu,Fe,Ag)2(Sb,Bi)19S57 |
| Bi | ⓘ Jaskólskiite | CuxPb2+x(Sb,Bi)2-xS5 (x ~ 0.15) |
| Bi | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Bi | ⓘ Lillianite | Pb3-2xAgxBi2+xS6 |
| Bi | ⓘ Parkerite | Ni3(Bi,Pb)2S2 |
| Bi | ⓘ Pilsenite | Bi4Te3 |
| Bi | ⓘ Kobellite var. Antimony-bearing Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Bi | ⓘ Bismuthinite var. Antimony-bearing Bismuthinite | (Bi,Sb)2S3 |
| Th | Thorium | |
| Th | ⓘ Thorite | Th(SiO4) |
| U | Uranium | |
| U | ⓘ Andersonite | Na2Ca(UO2)(CO3)3 · 5.33H2O |
| U | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | ⓘ Brannerite | UTi2O6 |
| U | ⓘ Carnotite | K2(UO2)2(VO4)2 · 3H2O |
| U | ⓘ Liebigite | Ca2(UO2)(CO3)3 · 11H2O |
| U | ⓘ Uraninite var. Pitchblende | UO2 |
| U | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| U | ⓘ Senaite | Pb(Mn,Y,U)(Fe,Zn)2(Ti,Fe,Cr,V)18(O,OH)38 |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Parauranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| U | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| U | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
Geochronology
Mineralization age: Paleoproterozoic : 1924 Ma to 1658 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | |||||||||
|---|---|---|---|---|---|---|---|---|---|---|
| Precambrian | ||||||||||
| Proterozoic | ||||||||||
| Paleoproterozoic | ||||||||||
| Statherian | ||||||||||
| Orosirian |
| |||||||||
Fossils
There are 90 fossil localities from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 90 | |||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Youngest Fossil Listed | 450 Ma (Late/Upper Ordovician) | |||||||||||||||
| Oldest Fossil Listed | 513 Ma (Cambrian) | |||||||||||||||
| Stratigraphic Units |
| |||||||||||||||
| Fossils from Region | Click here to show the list. | |||||||||||||||
| Fossil Localities | Click to show 4 fossil localities |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/%C3%96rebro_County |
|---|---|
| Wikidata ID: | Q104257 |
| GeoNames ID: | 2686655 |
Localities in this Region
- Örebro County
- ⭔Askersund
- ⭔Degerfors
- Ekers Quarry
- ⭔Hällefors
- ⭔Hallsberg
- ⭔Karlskoga
- ⭔Kumla
- ⭔Laxå
- ⭔Lekeberg
- ⭔Lindesberg
- Örebro County
- Lindesberg
- ⭔Ljusnarsberg
- Basttjärn ore field
- ⭔Blyberg ore field
- Frukost mine
- Getön
- Hörken silver mine
- Hörkengruvorna
- ⭔Kopparberg
- ⭔Krigstjärn ore field
- ⭔Kvarnback ore field
- Linnhöjden
- Nya Kopparberget (Ljusnarsbergsfältet; Ljusnarsbergs kopparmalmsgruvor)
- ⭔Silkesberg ore field
- Silverhytte ore field
- Skött mine
- Ställdalen
- Udd mine
- Wigström mine
- Yxsjö ore field
- ⭔Nora
- ⭔Örebro
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
- Baltic Shield
- Sveconorwegian BeltShield
- Transscandinavian Igneous BeltMagmatic Province
EuropeContinent
Sweden
- Bergslagen mining districtMining District
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesGeochronologyFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Ammeberg zinc roaster, Zinkgruvan mine, Zinkgruvan, Askersund, Örebro County, Sweden