This page is currently not sponsored. Click here to sponsor this page.
Type:
Other/historical names associated with this locality:
Midi-Pyrénées
Other Languages:
French:
Tarn, Occitanie, France
German:
Département Tarn, Okzitanien, Frankreich
Italian:
Tarn, Occitania, Francia
Russian:
Тарн, Окситания, Франция
Simplified Chinese:
塔恩省, 奥克西塔尼大区, 法国
Spanish:
Tarn, Occitania, Francia
Afrikaans:
Tarn, Oksitanië, Frankryk
Albanian:
Tarn, Oksitania, Franca
Arabic:
تارن, أوسيتاني, فرنسا
Aragonese:
Tarn, Occitania, Francia
Armenian:
Թարն, Օկսիտանիա, Ֆրանսիա
Azeri:
Tarn , Oksitaniya , Fransa
Basque:
Tarn, Okzitania, Frantzia
Bavarian:
Département Tarn, Frankreich
Belarusian:
Тарн , рэгіён Аксітанія, Францыя
Belarusian (Tarashkevitsa):
Тарн, Аксытанія, Францыя
Bengali:
টারন, ফ্রান্স
Breton:
Tarn, Okitania, Bro-C'hall
Bulgarian:
Тарн, Окситания, Франция
Catalan:
Tarn, Occitània, França
Cebuano:
Tarn, Occitanie, Pransiya
Chuvash:
Тарн, Франци
Croatian:
Tarn, Francuska
Czech:
Tarn, Okcitánie, Francie
Danish:
Tarn, Occitanie, Frankrig
Dutch:
Tarn, Occitanie, Frankrijk
Esperanto:
Tarn, Okcitanio, Francio
Estonian:
Tarni departemang, Prantsusmaa
Farsi/Persian:
تارن, اکسیتنی, فرانسه
Finnish:
Tarn, Oksitania , Ranska
Franco-Provençal:
Tarn, France
Galician:
Tarn, Occitania, Francia
Georgian:
ტარნი, საფრანგეთი
Greek:
Ταρν, Οξιτανία, Γαλλία
Gujarati:
ટાર્ન, ફ્રાન્સ
Hakka:
Tarn-sén, Fap-koet
Hebrew:
טארן, אוקסיטניה, צרפת
Hindi:
टार्न, ओसीटानिया, फ़्रान्स
Hungarian:
Tarn, Franciaország
Indonesian:
Tarn, Ositania, Perancis
Interlingua:
Departimento Tarn, Francia
Japanese:
タルヌ県, オクシタニー地域圏, フランス
Judaeo-Spanish:
Tarn, Fransia
Kannada:
ಟಾರ್ನ್, ಫ್ರಾನ್ಸ್
Kapampangan:
Tarn, Pransiya
Kazakh (Cyrillic Script):
Тарн, Франция
Kongo:
Tarn, Fwalansa
Korean:
타른주, 옥시타니, 프랑스
Latin:
Tarnis, Occitania, Francia
Latvian:
Tarna, Francija
Limburgian:
Tarn, Occitanië, Frankriek
Lithuanian:
Tarnas, Oksitanija, Prancūzija
Lombard:
Tarn, Frància
Low Saxon/Low German:
Tarn, Frankriek
Luxembourgish:
Departement Tarn, Occitanie, Frankräich
Macedonian:
Тарн, Франција
Malagasy:
Tarn, Frantsa
Malay:
Tarn, Perancis
Marathi:
तार्न, फ्रान्स
Minnan / Hokkien-Taiwanese:
Tarn, Hoat-kok
Northern Sami:
Tarn, Frankriika
Norwegian:
Tarn, Occitanie, Frankrike
Norwegian (Nynorsk):
Tarn, Frankrike
Occitan:
Tarn, Occitània, França
Piedmontese:
Dipartiment dël Tarn, Fransa
Polish:
Tarn, Oksytania, Francja
Portuguese:
Tarn, Occitânia, França
Romanian:
Tarn, Occitania, Franța
Scots:
Tarn, Occitanie, Fraunce
Scottish Gaelic:
Tarn, An Fhraing
Serbian:
Тарн, Окситанија, Француска
Serbo-Croatian:
Tarn, Francuska
Sinhalese:
ටාර්න්, ප්රංශය
Slovak:
Tarn, Occitánia, Francúzsko
Slovenian:
Tarn, Francija
Swahili:
Tarn, Ufaransa
Swedish:
Tarn, Occitanien, Frankrike
Tajik (Cyrillic Script):
Департаменти Тарн, Фаронса
Tamil:
டர்ன், பிரான்சு
Telugu:
టార్న్, ఫ్రాన్సు
Thai:
จังหวัดตาร์น, แคว้นอ็อกซีตานี, ประเทศฝรั่งเศส
Traditional Chinese:
塔恩, 奧斯坦尼, 法國
Turkish:
Tarn, Occitanie, Fransa
Ukrainian:
Тарн, Окситанія, Франція
Urdu:
تارن, اوکیتانی, فرانس
Vietnamese:
Tarn, Occitanie, Pháp
Volapük:
Tarn, Loxitän, Fransän
Waray:
Tarn, Occitanie, Fransya
Welsh:
Tarn, Ocsitania, Ffrainc
Western Punjabi:
ضلع ٹارن, فرانس
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities218 valid minerals. 3 (TL) - type locality of valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S Localities: Habit: small cubes, lanceolate crystals Colour: black Description: On galena. |
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ✪ Afmite (TL) Formula: Al3(OH)4(H2O)3(PO4)(PO3OH) · H2O Type Locality: Habit: platy, diamond-shaped crystals Colour: white References: Williams, P. A., Hatert, F., Pasero, M., Mills, S. J. (2010) IMA Commission on New Minerals, Nomenclature and Classification (CNMNC) CNMNC Newsletter No 4. Mineralogical Magazine, 74 (4) 797-800 doi:10.1180/s0026461x00038925 Kampf, Anthony R., Mills, Stuart J., Rossman, George R., Steele, Ian M., Pluth, Joseph J., Favreau, Georges (2011) Afmite, Al3(OH)4(H2O)3(PO4)(PO3OH)·H2O, a new mineral from Fumade, Tarn, France: description and crystal structure. European Journal of Mineralogy, 23 (2) 269-277 doi:10.1127/0935-1221/2011/0023-2093 |
| ⓘ Agardite-(Ce) Formula: CeCu6(AsO4)3(OH)6 · 3H2O Locality: Courris, Albi, Tarn, Occitanie, France Description: rich in Y References: Marcel Valladares collection; EDX analysis Georges FavreauIdentified by Georges Favreau: SEM-EDS |
| ⓘ Agardite-(La) ? Formula: LaCu6(AsO4)3(OH)6 · 3H2O References: |
| ⓘ Aguilarite Formula: Ag4SeS |
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Albite var. Andesine Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ 'Alunite Group' Formula: A0.5-1 B3[SO4]2(OH)6 |
| ⓘ Anatase Formula: TiO2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Anglesite Formula: PbSO4 |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A Localities: Le Soulié, Fontrieu, Castres, Tarn, Occitanie, France La Croix Saint Julien (Le Clap), La Croix Saint Julien, Fontrieu, Castres, Tarn, Occitanie, France Lacaune-les-Bains, Lacaune, Castres, Tarn, Occitanie, France Las Costes Mine, Le Fraysse, Albi, Tarn, Occitanie, France Phosphate occurrence, Fumade, Fontrieu, Castres, Tarn, Occitanie, France |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Argentopyrite Formula: AgFe2S3 References: Georges FAVREAU EDX analysisIdentified by Georges Favreau: SEM-EDS |
| ⓘ Argentotetrahedrite-(Fe) Formula: Ag6(Cu4Fe2)Sb4S12S References: Georges FAVREAU collection + EDX analysisIdentified by Georges Favreau: SEM-EDS |
| ⓘ Arseniosiderite ? Formula: Ca2Fe3+3(AsO4)3O2 · 3H2O Locality: Courris, Albi, Tarn, Occitanie, France References: |
| ⓘ Arsenopyrite Formula: FeAsS Localities: Reported from at least 12 localities in this region. |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 |
| ⓘ Baileychlore Formula: Zn5Al(AlSi3O10)(OH)8 |
| ⓘ Barrotite Formula: Cu9Al(HSiO4)2[(SO4)(HAsO4)0.5](OH)12 · 8H2O References: |
| ⓘ Baryte Formula: BaSO4 Localities: Reported from at least 16 localities in this region. |
| ⓘ Beraunite Formula: Fe3+6(PO4)4O(OH)4 · 6H2O |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ Beudantite Formula: PbFe3+3(AsO4)(SO4)(OH)6 Habit: acute rhombohedrons Colour: yellowish brown References: |
| ⓘ Bindheimite Formula: Pb2Sb2O6O References: |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bismite Formula: Bi2O3 Habit: tiny pearly scales Colour: white |
| ⓘ Bismuthinite Formula: Bi2S3 Localities: Reported from at least 10 localities in this region. |
| ⓘ Bismutite Formula: (BiO)2CO3 |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Boulangerite Formula: Pb5Sb4S11 |
| ⓘ Bournonite Formula: PbCuSbS3 |
| ⓘ Brianyoungite Formula: Zn3(CO3,SO4)(OH)4 References: |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 |
| ⓘ Brookite Formula: TiO2 |
| ⓘ Bushmakinite Formula: Pb2Al(PO4)(VO4)(OH) References: |
| ✪ Cacoxenite Formula: Fe3+24AlO6(PO4)17(OH)12 · 75H2O Habit: needles, resinous balls Colour: yellow, brownish yellow References: |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 7 localities in this region. |
| ⓘ Calcite var. Manganese-bearing Calcite Formula: (Ca,Mn)CO3 |
| ⓘ Carbonatecyanotrichite ? Formula: Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| ⓘ Carminite Formula: PbFe3+2(AsO4)2(OH)2 |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Cerussite Formula: PbCO3 Localities: Le Soulié, Fontrieu, Castres, Tarn, Occitanie, France Saint-Salvy Mine, Saint-Salvy-de-la-Balme, Castres, Tarn, Occitanie, France Le Rivet Quarry, Peyrebrune, Montredon-Labessonnié, Castres, Tarn, Occitanie, France La Caravantié quarry, Peyrebrune, Montredon-Labessonnié, Castres, Tarn, Occitanie, France Phosphate occurrence, Fumade, Fontrieu, Castres, Tarn, Occitanie, France |
| ⓘ Cesàrolite Formula: PbMn4+3O6(OH)2 References: Georges FAVREAU collection and EDX analysisIdentified by Georges Favreau: SEM-EDS |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O |
| ⓘ Chalcocite Formula: Cu2S Localities: Reported from at least 7 localities in this region. |
| ⓘ Chalcophanite Formula: ZnMn4+3O7 · 3H2O |
| ⓘ Chalcophyllite Formula: Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 16 localities in this region. |
| ⓘ Chamosite Formula: Fe2+5Al(AlSi3O10)(OH)8 References: André MELLE collection - Georges FAVREAU EDX analysisIdentified by Georges Favreau: SEM-EDS |
| ⓘ Chenevixite ? Formula: Cu2Fe3+2(AsO4)2(OH)4 Locality: Courris, Albi, Tarn, Occitanie, France References: |
| ⓘ 'Chlorite Group' |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 Description: Zincian chromite.
Inclusions in phlogopite and amphibole phenocrysts. |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ Cinnabar Formula: HgS |
| ⓘ Clinobisvanite Formula: Bi(VO4) |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Cobaltite Formula: CoAsS Description: Inclusions in phlogopite and amphibole phenocrysts. |
| ⓘ Connellite Formula: Cu19(SO4)(OH)32Cl4 · 3H2O |
| ⓘ Corkite Formula: PbFe3+3(PO4)(SO4)(OH)6 |
| ⓘ Cornubite Formula: Cu5(AsO4)2(OH)4 Locality: Courris, Albi, Tarn, Occitanie, France |
| ⓘ Coronadite Formula: Pb(Mn4+6Mn3+2)O16 |
| ⓘ Cosalite Formula: Pb2Bi2S5 |
| ⓘ Covellite Formula: CuS Localities: Las Costes Mine, Le Fraysse, Albi, Tarn, Occitanie, France Les Combes mine, Trébas, Albi, Tarn, Occitanie, France Le Rivet Quarry, Peyrebrune, Montredon-Labessonnié, Castres, Tarn, Occitanie, France Phosphate occurrence, Fumade, Fontrieu, Castres, Tarn, Occitanie, France Le Franciman Mine, Saint-Jean-de-Jeannes, Paulinet, Albi, Tarn, Occitanie, France |
| ⓘ Crandallite Formula: CaAl3(PO4)(PO3OH)(OH)6 Habit: crusts Colour: yellowish |
| ⓘ Cryptomelane Formula: K(Mn4+7Mn3+)O16 |
| ⓘ Cuprite Formula: Cu2O Localities: Reported from at least 6 localities in this region. |
| ⓘ Cuprite var. Chalcotrichite Formula: Cu2O References: |
| ⓘ Cupropearceite Formula: [Cu6As2S7][Ag9CuS4] References: Georges FAVREAU collection + EDX analysisIdentified by Georges Favreau: SEM-EDS |
| ⓘ Cupropolybasite Formula: [Cu6Sb2S7][Ag9CuS4] References: Robet Pecorini collection & Georges Favreau EDX analysisIdentified by Georges Favreau: SEM-EDS |
| ⓘ Delafossite Formula: Cu+Fe3+O2 |
| ⓘ Descloizite Formula: PbZn(VO4)(OH) |
| ⓘ Devilline Formula: CaCu4(SO4)2(OH)6 · 3H2O References: Georges FAVREAU EDX analysisIdentified by Georges Favreau: SEM-EDS |
| ⓘ Diaphorite Formula: Ag3Pb2Sb3S8 References: |
| ⓘ Digenite Formula: Cu9S5 |
| ⓘ Diopside Formula: CaMgSi2O6 |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: |
| ⓘ Dumortierite Formula: Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| ⓘ Edenite Formula: NaCa2Mg5(Si7Al)O22(OH)2 References: |
| ⓘ Elbaite Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) Locality: La Croix Saint Julien (Le Clap), La Croix Saint Julien, Fontrieu, Castres, Tarn, Occitanie, France References: |
| ⓘ Emplectite Formula: CuBiS2 |
| ⓘ 'Feldspar Group' |
| ⓘ Ferberite Formula: FeWO4 |
| ⓘ Ferristrunzite Formula: Fe3+Fe3+2(PO4)2(OH)3 · 5H2O |
| ⓘ Ferrisurite Formula: (Pb,Ca)2.4Fe3+2(Si4O10)(CO3)1.7(OH)3 · nH2O References: |
| ⓘ Ferro-actinolite Formula: ◻Ca2Fe2+5(Si8O22)(OH)2 References: Laurent GayraudIdentified by Georges Favreau: SEM-EDS François Garric collection - Georges Favreau EDX analysisIdentified by Georges Favreau: SEM-EDS |
| ⓘ Ferroberaunite Formula: Fe2+Fe3+5(PO4)4(OH)5 · 6H2O |
| ⓘ Ferro-tschermakite Formula: ◻Ca2(Fe2+3Al2)(Al2Si6O22)(OH)2 References: |
| ⓘ Fizélyite Formula: Ag5Pb14Sb21S48 |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F References: |
| ⓘ Fluorite Formula: CaF2 Localities: Reported from at least 23 localities in this region. Habit: cubes Colour: sky blue |
| ⓘ Fraipontite Formula: (Zn,Al)3((Si,Al)2O5)(OH)4 References: André Melle collection; EDX analysis V. Bourgoin (AJW, Paris)Identified by Georges Favreau: SEM-EDS |
| ⓘ Freieslebenite Formula: AgPbSbS3 |
| ⓘ 'Frondelite-Rockbridgeite Series' |
| ⓘ Galena Formula: PbS Localities: Reported from at least 13 localities in this region. |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Gersdorffite Formula: NiAsS Description: Inclusions in phlogopite and amphibole phenocrysts. |
| ⓘ Gibbsite Formula: Al(OH)3 References: |
| ⓘ Goethite Formula: Fe3+O(OH) Localities: Reported from at least 21 localities in this region. |
| ⓘ Graphite Formula: C References: |
| ⓘ Greenockite Formula: CdS |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 10 localities in this region. |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O |
| ⓘ Hetaerolite Formula: ZnMn2O4 References: Georges FAVREAU collection and EDX analysisIdentified by Georges Favreau: SEM-EDS |
| ⓘ 'Heterosite-Purpurite Series' Locality: La Croix Saint Julien (Le Clap), La Croix Saint Julien, Fontrieu, Castres, Tarn, Occitanie, France References: |
| ⓘ Hidalgoite Formula: PbAl3(AsO4)(SO4)(OH)6 Description: Ferrous hidalgoite Pb1.0(Al1.8Fe1.2)3.0[(As0.8P0.2)1.0O4](SO4)(OH) |
| ⓘ Hinsdalite Formula: PbAl3(PO4)(SO4)(OH)6 Habit: small sharp trigonal xx Colour: yellowish brown |
| ⓘ Hollandite Formula: Ba(Mn4+6Mn3+2)O16 |
| ⓘ Hydrocerussite Formula: Pb3(CO3)2(OH)2 References: Robert Pecorini collection; EDX analysis Georges FavreauIdentified by Georges Favreau: SEM-EDS |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 |
| ✪ Iodargyrite Formula: AgI Locality: Courris, Albi, Tarn, Occitanie, France |
| ⓘ Irinarassite ? Formula: Ca3Sn2(SiO4)(AlO4)2 Locality: La Croix Saint Julien (Le Clap), La Croix Saint Julien, Fontrieu, Castres, Tarn, Occitanie, France Description: An EDS by Jean wyart association gave identification of this unknown mineral as irinarassite.
An XRD analysis will be manage asap to confirm. References: |
| ⓘ Jamesonite Formula: Pb4FeSb6S14 |
| ⓘ Kentrolite Formula: Pb2Mn3+2(Si2O7)O2 |
| ⓘ Kermesite Formula: Sb2S2O |
| ⓘ 'K Feldspar' |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 |
| ⓘ Kidwellite ? Formula: NaFe3+9+x(PO4)6(OH)11 · 3H2O, x = 0.33 References: |
| ⓘ Kintoreite Formula: PbFe3(PO4)(PO3OH)(OH)6 |
| ⓘ 'Kobellite-Tintinaite Series' |
| ⓘ Kobokoboite Formula: Al6(PO4)4(OH)6 · 11H2O |
| ⓘ Kutnohorite ? Formula: CaMn2+(CO3)2 Description: The analysed specimen was calcite (SEM-EDX G. Favreau) References: |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O |
| ⓘ Lenaite Formula: AgFeS2 |
| ⓘ Lepidocrocite Formula: Fe3+O(OH) Localities: Phosphate occurrence, Fumade, Fontrieu, Castres, Tarn, Occitanie, France Le Franciman Mine, Saint-Jean-de-Jeannes, Paulinet, Albi, Tarn, Occitanie, France Le Soulié, Fontrieu, Castres, Tarn, Occitanie, France Courris, Albi, Tarn, Occitanie, France ? (more information) Habit: good, thick platy xx, balls Colour: dark orange brown, brown |
| ⓘ 'Lepidolite' |
| ⓘ 'Limonite' Localities: Reported from at least 9 localities in this region. |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 |
| ⓘ Löllingite Formula: FeAs2 Locality: La Croix Saint Julien (Le Clap), La Croix Saint Julien, Fontrieu, Castres, Tarn, Occitanie, France References: |
| ⓘ Mackinawite Formula: FeS References: |
| ⓘ Magnesio-hastingsite Formula: NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 10 localities in this region. |
| ⓘ Manganite Formula: Mn3+O(OH) |
| ⓘ Mansfieldite Formula: AlAsO4 · 2H2O |
| ⓘ Marcasite Formula: FeS2 Localities: Reported from at least 9 localities in this region. |
| ✪ Matulaite Formula: (Fe3+,Al)Al7(PO4)4(PO3OH)2(OH)8(H2O)8 · 8H2O Habit: platy xx, balls, coatings Colour: white References: |
| ⓘ Meurigite-K Formula: KFe3+8(PO4)6(OH)7 · 6.5H2O |
| ⓘ Millerite Formula: NiS |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl |
| ⓘ Mottramite Formula: PbCu(VO4)(OH) Habit: small black xx Colour: black References: |
| ⓘ Munakataite Formula: Pb2Cu2(Se4+O3)(SO4)(OH)4 References: Guy Bernadi collection; EDX analysis Georges FavreauIdentified by Georges Favreau: SEM-EDS |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Habit: White flaky agregates in dolomite/siderite vug. Description: Illite (K-deficient) variety. |
| ⓘ Native Antimony Formula: Sb |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Copper Formula: Cu Localities: Reported from at least 7 localities in this region. |
| ⓘ Native Silver Formula: Ag |
| ⓘ Native Sulphur Formula: S8 |
| ⓘ Nesquehonite Formula: MgCO3 · 3H2O |
| ⓘ Olivenite Formula: Cu2(AsO4)(OH) |
| ⓘ Opal Formula: SiO2 · nH2O |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Pargasite Formula: NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| ⓘ Parnauite Formula: Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| ⓘ Pearceite Formula: [Ag6As2S7][Ag9CuS4] |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 |
| ⓘ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ Philipsbornite Formula: PbAl3(AsO4)(AsO3OH)(OH)6 References: Didier Baissières specimen - EDX analysis Georges FavreauIdentified by Georges Favreau: SEM-EDS |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 Description: Ti-rich phenocrysts. |
| ⓘ Phosgenite ? Formula: Pb2CO3Cl2 References: Patrice Queneau Collection.Identified by Patrice Queneau: Visual Identification |
| ⓘ Plagionite Formula: Pb5Sb8S17 References: |
| ⓘ Plumbogummite Formula: PbAl3(PO4)(PO3OH)(OH)6 Habit: heagonal platy xx, balls Colour: greenish References: |
| ⓘ Polybasite Formula: [Ag6Sb2S7][Ag9CuS4] |
| ⓘ Proustite Formula: Ag3AsS3 References: Robert Pecorini collection; EDX analysis Georges FavreauIdentified by Georges Favreau: SEM-EDS |
| ⓘ Pseudomalachite Formula: Cu5(PO4)2(OH)4 |
| ⓘ 'Psilomelane' ? |
| ⓘ 'Pyralspite' Locality: La Croix Saint Julien (Le Clap), La Croix Saint Julien, Fontrieu, Castres, Tarn, Occitanie, France References: |
| ⓘ Pyrargyrite Formula: Ag3SbS3 |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 18 localities in this region. |
| ⓘ Pyrolusite Formula: Mn4+O2 Localities: Reported from at least 11 localities in this region. |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl Localities: Saint-Salvy Mine, Saint-Salvy-de-la-Balme, Castres, Tarn, Occitanie, France Le Rivet Quarry, Peyrebrune, Montredon-Labessonnié, Castres, Tarn, Occitanie, France La Caravantié quarry, Peyrebrune, Montredon-Labessonnié, Castres, Tarn, Occitanie, France Phosphate occurrence, Fumade, Fontrieu, Castres, Tarn, Occitanie, France |
| ⓘ Pyrostilpnite Formula: Ag3SbS3 |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Reported from at least 7 localities in this region. |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 29 localities in this region. |
| ⓘ Quartz var. Agate Formula: SiO2 References: |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Ramdohrite Formula: Pb5.9Fe0.1Mn0.1In0.1Cd0.2Ag2.8Sb10.8S24 References: Georges FAVREAU collection + EDX analysisIdentified by Georges Favreau: SEM-EDS |
| ⓘ Ramsdellite Formula: Mn4+O2 |
| ⓘ Ranciéite Formula: (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| ⓘ Rhabdophane-(La) Formula: La(PO4) · H2O References: Georges FAVREAU collection + EDX analysisIdentified by Georges Favreau: SEM-EDS |
| ⓘ Rhodochrosite Formula: MnCO3 |
| ⓘ Rockbridgeite Formula: (Fe2+0.5Fe3+0.5)2Fe3+3(PO4)3(OH)5 References: |
| ⓘ Rosasite Formula: (Cu,Zn)2(CO3)(OH)2 Description: Collection D&P Journet, EDX analysis G. Favreau |
| ⓘ Rosièresite (TL) Formula: (Pb, Cu, Al, P, O, H) Type Locality: |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Rutile var. Niobium-bearing Rutile Formula: (Ti,Nb)O2 |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: |
| ⓘ Schulenbergite Formula: (Cu,Zn)7(SO4)2(OH)10 · 3H2O References: |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O |
| ⓘ Semseyite Formula: Pb9Sb8S21 |
| ⓘ Senarmontite Formula: Sb2O3 |
| ⓘ Sepiolite Formula: Mg4(Si6O15)(OH)2 · 6H2O References: Guy Bernadi collection & Georges Favreau EDX analysisIdentified by Georges Favreau: SEM-EDS |
| ⓘ Serpierite Formula: Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O References: |
| ⓘ Siderite Formula: FeCO3 Localities: Reported from at least 19 localities in this region. |
| ⓘ Sigloite Formula: Fe3+Al2(PO4)2(OH)3 · 7H2O |
| ⓘ Smithsonite Formula: ZnCO3 |
| ⓘ Spangolite Formula: Cu6Al(SO4)(OH)12Cl · 3H2O |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 14 localities in this region. |
| ⓘ Stannite Formula: Cu2FeSnS4 |
| ⓘ Stephanite Formula: Ag5SbS4 |
| ⓘ Sternbergite Formula: AgFe2S3 References: Guy Bernadi collection & Georges Favreau EDX analysisIdentified by Georges Favreau: SEM-EDS |
| ⓘ Stibarsen Formula: AsSb References: Guy Bernadi collection & Georges Favreau EDX analysisIdentified by Georges Favreau: SEM-EDS |
| ⓘ Stibnite Formula: Sb2S3 |
| ⓘ Stolzite Formula: Pb(WO4) Habit: platy xx Colour: orange References: |
| ⓘ 'Stolzite-Wulfenite Series' References: |
| ⓘ Strengite Formula: FePO4 · 2H2O Habit: balls Colour: pale pink, greenish pink, gray References: |
| ⓘ 'Strengite-Variscite Series' |
| ⓘ Stromeyerite Formula: AgCuS |
| ⓘ Sudoite Formula: Mg2Al3(AlSi3O10)(OH)8 |
| ⓘ Susannite Formula: Pb4(CO3)2(SO4)(OH)2 References: |
| ⓘ 'Synchysite' Formula: Ca(Ce/Nd/Y/REE)(CO3)2F References: François Garric collectionIdentification: Dealer/Collection Label |
| ⓘ Synchysite-(Ce) Formula: CaCe(CO3)2F |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 Description: In phlogopite ocelli. References: |
| ⓘ Tennantite-(Fe) Formula: Cu6(Cu4Fe2+2)As4S12S References: Georges FAVREAU collection + EDX analysisIdentified by Georges Favreau: SEM-EDS |
| ⓘ Tenorite Formula: CuO |
| ⓘ Tetrahedrite-(Fe) Formula: Cu6(Cu4Fe2+2)Sb4S12S |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S References: |
| ⓘ Tetrahedrite-(Zn) Formula: Cu6(Cu4Zn2)Sb4S12S References: Robert Pecorini collection; EDX analysis Georges FavreauIdentified by Georges Favreau: SEM-EDS |
| ⓘ Titanite Formula: CaTiO(SiO4) |
| ⓘ Todorokite Formula: (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
| ⓘ 'Tourmaline var. Rubellite' |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ✪ Tubulite (TL) Formula: Ag2Pb22Sb20S53 Type Locality: References: Williams, P. A., Hatert, F., Pasero, M., Mills, S. J. (2012) New minerals and nomenclature modifications approved in 2012. CNMNC Newsletter No 13. Mineralogical Magazine, 76 (3) 807-817 doi:10.1180/minmag.2012.076.3.26 Moëlo, Yves, Pecorini, Robert, Ciriotti, Marco E., Meisser, Nicolas, Caldes, Maria Teresa, Orlandi, Paolo, Petit, Pierre-Emmanuel, Martini, Bruno, Salvetti, Adrio (2014) Tubulite, ~Ag2Pb22Sb20S53, a new Pb-Ag-Sb sulfosalt from Le Rivet quarry, Peyrebrune ore field (Tarn, France) and Biò, Borgofranco mines, Borgofranco d'Ivrea (Piedmont, Italy). European Journal of Mineralogy, 25 (6). 1017-1030 doi:10.1127/0935-1221/2013/0025-2334 |
| ⓘ Turquoise Formula: CuAl6(PO4)4(OH)8 · 4H2O Habit: small xx Colour: pale green, pale blue |
| ⓘ Vaesite Formula: NiS2 References: |
| ⓘ Valentinite Formula: Sb2O3 References: Robert Pecorini collection; EDX analysis Georges FavreauIdentified by Georges Favreau: SEM-EDS |
| ⓘ Vanadinite Formula: Pb5(VO4)3Cl |
| ⓘ Variscite Formula: AlPO4 · 2H2O Habit: balls Colour: white |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ 'Wad' |
| ⓘ Wavellite Formula: Al3(PO4)2(OH)3 · 5H2O Habit: sprays, balls of thick xx, thin needles Colour: colorless, white, yellowish, greenish References: |
| ⓘ Willemite Formula: Zn2SiO4 |
| ⓘ 'Wolframite Group' |
| ⓘ Wulfenite Formula: Pb(MoO4) |
| ⓘ Xanthoconite Formula: Ag3AsS3 Description: Collection & EDX analysis Georges Favreau |
| ⓘ Zálesíite Formula: CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O Locality: Courris, Albi, Tarn, Occitanie, France |
| ⓘ Formula: Zn1-xAlx(OH)2[SO4]x/2 · nH2O Locality: Le Rivet Quarry, Peyrebrune, Montredon-Labessonnié, Castres, Tarn, Occitanie, France - erroneously reported |
| ⓘ Zinkenite Formula: Pb9Sb22S42 References: Robert Pecorini collection; EDX analysis Georges FavreauIdentified by Georges Favreau: SEM-EDS |
| ⓘ Zircon Formula: Zr(SiO4) |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Antimony | 1.CA.05 | Sb |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Stibarsen | 1.CA.05 | AsSb |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Stromeyerite | 2.BA.40 | AgCuS |
| ⓘ | Aguilarite | 2.BA.55 | Ag4SeS |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Lenaite | 2.CB.10a | AgFeS2 |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Argentopyrite | 2.CB.65 | AgFe2S3 |
| ⓘ | Sternbergite | 2.CB.65 | AgFe2S3 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Mackinawite | 2.CC.25 | FeS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Cinnabar | 2.CD.15a | HgS |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Vaesite | 2.EB.05a | NiS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Kermesite | 2.FD.05 | Sb2S2O |
| ⓘ | Proustite | 2.GA.05 | Ag3AsS3 |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | Pyrostilpnite | 2.GA.10 | Ag3SbS3 |
| ⓘ | Xanthoconite | 2.GA.10 | Ag3AsS3 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Argentotetrahedrite-(Fe) | 2.GB.05 | Ag6(Cu4Fe2)Sb4S12S |
| ⓘ | Tetrahedrite-(Zn) | 2.GB.05 | Cu6(Cu4Zn2)Sb4S12S |
| ⓘ | Tennantite-(Fe) | 2.GB.05 | Cu6(Cu4Fe2+2)As4S12S |
| ⓘ | Tetrahedrite-(Fe) | 2.GB.05 | Cu6(Cu4Fe2+2)Sb4S12S |
| ⓘ | Stephanite | 2.GB.10 | Ag5SbS4 |
| ⓘ | Pearceite | 2.GB.15 | [Ag6As2S7][Ag9CuS4] |
| ⓘ | Polybasite | 2.GB.15 | [Ag6Sb2S7][Ag9CuS4] |
| ⓘ | Cupropearceite | 2.GB.15 | [Cu6As2S7][Ag9CuS4] |
| ⓘ | Cupropolybasite | 2.GB.15 | [Cu6Sb2S7][Ag9CuS4] |
| ⓘ | Emplectite | 2.HA.05 | CuBiS2 |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | Plagionite | 2.HC.10b | Pb5Sb8S17 |
| ⓘ | Semseyite | 2.HC.10d | Pb9Sb8S21 |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Diaphorite | 2.JB.05 | Ag3Pb2Sb3S8 |
| ⓘ | Cosalite | 2.JB.10 | Pb2Bi2S5 |
| ⓘ | Freieslebenite | 2.JB.15 | AgPbSbS3 |
| ⓘ | Zinkenite | 2.JB.35a | Pb9Sb22S42 |
| ⓘ | Tubulite (TL) | 2.JB.35f | Ag2Pb22Sb20S53 |
| ⓘ | Fizélyite | 2.JB.40a | Ag5Pb14Sb21S48 |
| ⓘ | Ramdohrite | 2.JB.40a | Pb5.9Fe0.1Mn0.1In0.1Cd0.2Ag2.8Sb10.8S24 |
| Group 3 - Halides | |||
| ⓘ | Iodargyrite | 3.AA.10 | AgI |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Connellite | 3.DA.25 | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Quartz var. Agate | 4.00.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.00.05 | SiO2 |
| ⓘ | 4.00.05 | SiO2 | |
| ⓘ | var. Smoky Quartz | 4.00.05 | SiO2 |
| ⓘ | Cuprite var. Chalcotrichite | 4.AA.10 | Cu2O |
| ⓘ | 4.AA.10 | Cu2O | |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Delafossite | 4.AB.15 | Cu+Fe3+O2 |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Hetaerolite | 4.BB.10 | ZnMn2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Senarmontite | 4.CB.50 | Sb2O3 |
| ⓘ | Valentinite | 4.CB.55 | Sb2O3 |
| ⓘ | Bismite | 4.CB.60 | Bi2O3 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | var. Niobium-bearing Rutile | 4.DB.05 | (Ti,Nb)O2 |
| ⓘ | Ramsdellite | 4.DB.15a | Mn4+O2 |
| ⓘ | Ferberite | 4.DB.30 | FeWO4 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brookite | 4.DD.10 | TiO2 |
| ⓘ | Bindheimite | 4.DH.20 | Pb2Sb2O6O |
| ⓘ | Coronadite | 4.DK.05a | Pb(Mn4+6Mn3+2)O16 |
| ⓘ | Cryptomelane | 4.DK.05a | K(Mn4+7Mn3+)O16 |
| ⓘ | Hollandite | 4.DK.05a | Ba(Mn4+6Mn3+2)O16 |
| ⓘ | Todorokite | 4.DK.10 | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Gibbsite | 4.FE.10 | Al(OH)3 |
| ⓘ | Lepidocrocite | 4.FE.15 | Fe3+O(OH) |
| ⓘ | Cesàrolite | 4.FG.10 | PbMn4+3O6(OH)2 |
| ⓘ | Chalcophanite | 4.FL.20 | ZnMn4+3O7 · 3H2O |
| ⓘ | Ranciéite | 4.FL.40 | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | var. Manganese-bearing Calcite | 5.AB.05 | (Ca,Mn)CO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Kutnohorite ? | 5.AB.10 | CaMn2+(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Rosasite | 5.BA.10 | (Cu,Zn)2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Synchysite-(Ce) | 5.BD.20c | CaCe(CO3)2F |
| ⓘ | Hydrocerussite | 5.BE.10 | Pb3(CO3)2(OH)2 |
| ⓘ | Phosgenite ? | 5.BE.20 | Pb2CO3Cl2 |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| ⓘ | Brianyoungite | 5.BF.30 | Zn3(CO3,SO4)(OH)4 |
| ⓘ | Susannite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Nesquehonite | 5.CA.05 | MgCO3 · 3H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Munakataite | 7.BC.65 | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Spangolite | 7.DD.15 | Cu6Al(SO4)(OH)12Cl · 3H2O |
| ⓘ | Devilline | 7.DD.30 | CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Serpierite | 7.DD.30 | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| ⓘ | Zincowoodwardite ? | 7.DD.35 | Zn1-xAlx(OH)2[SO4]x/2 · nH2O |
| ⓘ | Schulenbergite | 7.DD.80 | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| ⓘ | Carbonatecyanotrichite ? | 7.DE.10 | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| ⓘ | Barrotite | 7.DE.45 | Cu9Al(HSiO4)2[(SO4)(HAsO4)0.5](OH)12 · 8H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Stolzite | 7.GA.05 | Pb(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Clinobisvanite | 8.AD.65 | Bi(VO4) |
| ⓘ | Olivenite | 8.BB.30 | Cu2(AsO4)(OH) |
| ⓘ | Rockbridgeite | 8.BC.10 | (Fe2+0.5Fe3+0.5)2Fe3+3(PO4)3(OH)5 |
| ⓘ | Pseudomalachite | 8.BD.05 | Cu5(PO4)2(OH)4 |
| ⓘ | Cornubite | 8.BD.30 | Cu5(AsO4)2(OH)4 |
| ⓘ | Bushmakinite | 8.BG.05 | Pb2Al(PO4)(VO4)(OH) |
| ⓘ | Carminite | 8.BH.30 | PbFe3+2(AsO4)2(OH)2 |
| ⓘ | Descloizite | 8.BH.40 | PbZn(VO4)(OH) |
| ⓘ | Mottramite | 8.BH.40 | PbCu(VO4)(OH) |
| ⓘ | Beudantite | 8.BL.05 | PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ | Corkite | 8.BL.05 | PbFe3+3(PO4)(SO4)(OH)6 |
| ⓘ | Hidalgoite | 8.BL.05 | PbAl3(AsO4)(SO4)(OH)6 |
| ⓘ | Hinsdalite | 8.BL.05 | PbAl3(PO4)(SO4)(OH)6 |
| ⓘ | Crandallite | 8.BL.10 | CaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Kintoreite | 8.BL.10 | PbFe3(PO4)(PO3OH)(OH)6 |
| ⓘ | Philipsbornite | 8.BL.10 | PbAl3(AsO4)(AsO3OH)(OH)6 |
| ⓘ | Plumbogummite | 8.BL.10 | PbAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Vanadinite | 8.BN.05 | Pb5(VO4)3Cl |
| ⓘ | Mansfieldite | 8.CD.10 | AlAsO4 · 2H2O |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Strengite | 8.CD.10 | FePO4 · 2H2O |
| ⓘ | Variscite | 8.CD.10 | AlPO4 · 2H2O |
| ⓘ | Rhabdophane-(La) | 8.CJ.45 | La(PO4) · H2O |
| ⓘ | Ferroberaunite | 8.DC. | Fe2+Fe3+5(PO4)4(OH)5 · 6H2O |
| ⓘ | Ferristrunzite | 8.DC.25 | Fe3+Fe3+2(PO4)2(OH)3 · 5H2O |
| ⓘ | Beraunite | 8.DC.27 | Fe3+6(PO4)4O(OH)4 · 6H2O |
| ⓘ | Sigloite | 8.DC.30 | Fe3+Al2(PO4)2(OH)3 · 7H2O |
| ⓘ | Cacoxenite | 8.DC.40 | Fe3+24AlO6(PO4)17(OH)12 · 75H2O |
| ⓘ | Wavellite | 8.DC.50 | Al3(PO4)2(OH)3 · 5H2O |
| ⓘ | Chenevixite ? | 8.DD.05 | Cu2Fe3+2(AsO4)2(OH)4 |
| ⓘ | Turquoise | 8.DD.15 | CuAl6(PO4)4(OH)8 · 4H2O |
| ⓘ | Afmite (TL) | 8.DD.15 | Al3(OH)4(H2O)3(PO4)(PO3OH) · H2O |
| ⓘ | Kobokoboite | 8.DD.25 | Al6(PO4)4(OH)6 · 11H2O |
| ⓘ | Rosièresite (TL) | 8.DF.10 | (Pb, Cu, Al, P, O, H) |
| ⓘ | Chalcophyllite | 8.DF.30 | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| ⓘ | Parnauite | 8.DF.35 | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| ⓘ | Arseniosiderite ? | 8.DH.30 | Ca2Fe3+3(AsO4)3O2 · 3H2O |
| ⓘ | Meurigite-K | 8.DJ.20 | KFe3+8(PO4)6(OH)7 · 6.5H2O |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ | Kidwellite ? | 8.DK.20 | NaFe3+9+x(PO4)6(OH)11 · 3H2O, x = 0.33 |
| ⓘ | Matulaite | 8.DK.30 | (Fe3+,Al)Al7(PO4)4(PO3OH)2(OH)8(H2O)8 · 8H2O |
| ⓘ | Agardite-(Ce) | 8.DL.15 | CeCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ | Agardite-(La) ? | 8.DL.15 | LaCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ | Zálesíite | 8.DL.15 | CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O |
| ⓘ | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 · 10-12H2O |
| Group 9 - Silicates | |||
| ⓘ | Willemite | 9.AA.05 | Zn2SiO4 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Irinarassite ? | 9.AD.25 | Ca3Sn2(SiO4)(AlO4)2 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Dumortierite | 9.AJ.10 | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Kentrolite | 9.BE.80 | Pb2Mn3+2(Si2O7)O2 |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Ferro-actinolite | 9.DE.10 | ◻Ca2Fe2+5(Si8O22)(OH)2 |
| ⓘ | Ferro-tschermakite | 9.DE.10 | ◻Ca2(Fe2+3Al2)(Al2Si6O22)(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Edenite | 9.DE.15 | NaCa2Mg5(Si7Al)O22(OH)2 |
| ⓘ | Magnesio-hastingsite | 9.DE.15 | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| ⓘ | Pargasite | 9.DE.15 | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Baileychlore | 9.EC.55 | Zn5Al(AlSi3O10)(OH)8 |
| ⓘ | Chamosite | 9.EC.55 | Fe2+5Al(AlSi3O10)(OH)8 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Sudoite | 9.EC.55 | Mg2Al3(AlSi3O10)(OH)8 |
| ⓘ | Ferrisurite | 9.EC.75 | (Pb,Ca)2.4Fe3+2(Si4O10)(CO3)1.7(OH)3 · nH2O |
| ⓘ | Fraipontite | 9.ED.15 | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Sepiolite | 9.EE.25 | Mg4(Si6O15)(OH)2 · 6H2O |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Andesine | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Lepidolite' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Psilomelane' ? | - | |
| ⓘ | 'Tourmaline var. Rubellite' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | '' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Wad' | - | |
| ⓘ | 'Synchysite' | - | Ca(Ce/Nd/Y/REE)(CO3)2F |
| ⓘ | 'Strengite-Variscite Series' | - | |
| ⓘ | 'Kobellite-Tintinaite Series' | - | |
| ⓘ | 'Frondelite-Rockbridgeite Series' | - | |
| ⓘ | 'Heterosite-Purpurite Series' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Pyralspite' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Stolzite-Wulfenite Series' | - | |
| ⓘ | 'Alunite Group' | - | A0.5-1 B3[SO4]2(OH)6 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Agardite-(Ce) | CeCu6(AsO4)3(OH)6 · 3H2O |
| H | ⓘ Agardite-(La) | LaCu6(AsO4)3(OH)6 · 3H2O |
| H | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Baileychlore | Zn5Al(AlSi3O10)(OH)8 |
| H | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| H | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| H | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| H | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| H | ⓘ Cesàrolite | PbMn34+O6(OH)2 |
| H | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| H | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| H | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| H | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| H | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| H | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Descloizite | PbZn(VO4)(OH) |
| H | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| H | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Ferristrunzite | Fe3+Fe23+(PO4)2(OH)3 · 5H2O |
| H | ⓘ Ferrisurite | (Pb,Ca)2.4Fe23+(Si4O10)(CO3)1.7(OH)3 · nH2O |
| H | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| H | ⓘ Ferro-tschermakite | ◻Ca2(Fe32+Al2)(Al2Si6O22)(OH)2 |
| H | ⓘ Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| H | ⓘ Gibbsite | Al(OH)3 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| H | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| H | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Kidwellite | NaFe3+9+x(PO4)6(OH)11 · 3H2O, x = 0.33 |
| H | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Lepidocrocite | Fe3+O(OH) |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Magnesio-hastingsite | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Mansfieldite | AlAsO4 · 2H2O |
| H | ⓘ Matulaite | (Fe3+,Al)Al7(PO4)4(PO3OH)2(OH)8(H2O)8 · 8H2O |
| H | ⓘ Mottramite | PbCu(VO4)(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Nesquehonite | MgCO3 · 3H2O |
| H | ⓘ Olivenite | Cu2(AsO4)(OH) |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| H | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| H | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| H | ⓘ Rhabdophane-(La) | La(PO4) · H2O |
| H | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| H | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| H | ⓘ Rosièresite | (Pb, Cu, Al, P, O, H) |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| H | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| H | ⓘ Sigloite | Fe3+Al2(PO4)2(OH)3 · 7H2O |
| H | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| H | ⓘ Strengite | FePO4 · 2H2O |
| H | ⓘ Sudoite | Mg2Al3(AlSi3O10)(OH)8 |
| H | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| H | ⓘ Variscite | AlPO4 · 2H2O |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Zálesíite | CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O |
| H | ⓘ Meurigite-K | KFe83+(PO4)6(OH)7 · 6.5H2O |
| H | ⓘ Strengite-Variscite Series | |
| H | ⓘ Frondelite-Rockbridgeite Series | |
| H | ⓘ Zincowoodwardite | Zn1-xAlx(OH)2[SO4]x/2 · nH2O |
| H | ⓘ Bushmakinite | Pb2Al(PO4)(VO4)(OH) |
| H | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| H | ⓘ Kobokoboite | Al6(PO4)4(OH)6 · 11H2O |
| H | ⓘ Alunite Group | A0.5-1 B3[SO4]2(OH)6 |
| H | ⓘ Afmite | Al3(OH)4(H2O)3(PO4)(PO3OH) · H2O |
| H | ⓘ Barrotite | Cu9Al(HSiO4)2[(SO4)(HAsO4)0.5](OH)12 · 8H2O |
| H | ⓘ Ferroberaunite | Fe2+Fe53+(PO4)4(OH)5 · 6H2O |
| Li | Lithium | |
| Li | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| B | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline var. Rubellite | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Ferrisurite | (Pb,Ca)2.4Fe23+(Si4O10)(CO3)1.7(OH)3 · nH2O |
| C | ⓘ Graphite | C |
| C | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| C | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Nesquehonite | MgCO3 · 3H2O |
| C | ⓘ Phosgenite | Pb2CO3Cl2 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Agardite-(Ce) | CeCu6(AsO4)3(OH)6 · 3H2O |
| O | ⓘ Agardite-(La) | LaCu6(AsO4)3(OH)6 · 3H2O |
| O | ⓘ Quartz var. Agate | SiO2 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Baileychlore | Zn5Al(AlSi3O10)(OH)8 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| O | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| O | ⓘ Bindheimite | Pb2Sb2O6O |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bismite | Bi2O3 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Brookite | TiO2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| O | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Cesàrolite | PbMn34+O6(OH)2 |
| O | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| O | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| O | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| O | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinobisvanite | Bi(VO4) |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| O | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| O | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| O | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| O | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Delafossite | Cu+Fe3+O2 |
| O | ⓘ Descloizite | PbZn(VO4)(OH) |
| O | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| O | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| O | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Ferberite | FeWO4 |
| O | ⓘ Ferristrunzite | Fe3+Fe23+(PO4)2(OH)3 · 5H2O |
| O | ⓘ Ferrisurite | (Pb,Ca)2.4Fe23+(Si4O10)(CO3)1.7(OH)3 · nH2O |
| O | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| O | ⓘ Ferro-tschermakite | ◻Ca2(Fe32+Al2)(Al2Si6O22)(OH)2 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| O | ⓘ Gibbsite | Al(OH)3 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Hetaerolite | ZnMn2O4 |
| O | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| O | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| O | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| O | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Kentrolite | Pb2Mn23+(Si2O7)O2 |
| O | ⓘ Kermesite | Sb2S2O |
| O | ⓘ Kidwellite | NaFe3+9+x(PO4)6(OH)11 · 3H2O, x = 0.33 |
| O | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Lepidocrocite | Fe3+O(OH) |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Magnesio-hastingsite | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Mansfieldite | AlAsO4 · 2H2O |
| O | ⓘ Matulaite | (Fe3+,Al)Al7(PO4)4(PO3OH)2(OH)8(H2O)8 · 8H2O |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Mottramite | PbCu(VO4)(OH) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Nesquehonite | MgCO3 · 3H2O |
| O | ⓘ Olivenite | Cu2(AsO4)(OH) |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| O | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Phosgenite | Pb2CO3Cl2 |
| O | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Ramsdellite | Mn4+O2 |
| O | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| O | ⓘ Rhabdophane-(La) | La(PO4) · H2O |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| O | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| O | ⓘ Rosièresite | (Pb, Cu, Al, P, O, H) |
| O | ⓘ Tourmaline var. Rubellite | |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Senarmontite | Sb2O3 |
| O | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| O | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Sigloite | Fe3+Al2(PO4)2(OH)3 · 7H2O |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| O | ⓘ Stolzite | Pb(WO4) |
| O | ⓘ Strengite | FePO4 · 2H2O |
| O | ⓘ Sudoite | Mg2Al3(AlSi3O10)(OH)8 |
| O | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| O | ⓘ Valentinite | Sb2O3 |
| O | ⓘ Vanadinite | Pb5(VO4)3Cl |
| O | ⓘ Variscite | AlPO4 · 2H2O |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| O | ⓘ Willemite | Zn2SiO4 |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Zálesíite | CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O |
| O | ⓘ Meurigite-K | KFe83+(PO4)6(OH)7 · 6.5H2O |
| O | ⓘ Strengite-Variscite Series | |
| O | ⓘ Frondelite-Rockbridgeite Series | |
| O | ⓘ Heterosite-Purpurite Series | |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Rutile var. Niobium-bearing Rutile | (Ti,Nb)O2 |
| O | ⓘ Zincowoodwardite | Zn1-xAlx(OH)2[SO4]x/2 · nH2O |
| O | ⓘ Bushmakinite | Pb2Al(PO4)(VO4)(OH) |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| O | ⓘ Stolzite-Wulfenite Series | |
| O | ⓘ Kobokoboite | Al6(PO4)4(OH)6 · 11H2O |
| O | ⓘ Alunite Group | A0.5-1 B3[SO4]2(OH)6 |
| O | ⓘ Afmite | Al3(OH)4(H2O)3(PO4)(PO3OH) · H2O |
| O | ⓘ Irinarassite | Ca3Sn2(SiO4)(AlO4)2 |
| O | ⓘ Barrotite | Cu9Al(HSiO4)2[(SO4)(HAsO4)0.5](OH)12 · 8H2O |
| O | ⓘ Ferroberaunite | Fe2+Fe53+(PO4)4(OH)5 · 6H2O |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Na | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Kidwellite | NaFe3+9+x(PO4)6(OH)11 · 3H2O, x = 0.33 |
| Na | ⓘ Magnesio-hastingsite | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| Na | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Mg | ⓘ Magnesio-hastingsite | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| Mg | ⓘ Nesquehonite | MgCO3 · 3H2O |
| Mg | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Mg | ⓘ Sudoite | Mg2Al3(AlSi3O10)(OH)8 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Baileychlore | Zn5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Al | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| Al | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Al | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Al | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Al | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Ferro-tschermakite | ◻Ca2(Fe32+Al2)(Al2Si6O22)(OH)2 |
| Al | ⓘ Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| Al | ⓘ Gibbsite | Al(OH)3 |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| Al | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| Al | ⓘ Magnesio-hastingsite | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| Al | ⓘ Mansfieldite | AlAsO4 · 2H2O |
| Al | ⓘ Matulaite | (Fe3+,Al)Al7(PO4)4(PO3OH)2(OH)8(H2O)8 · 8H2O |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Al | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Rosièresite | (Pb, Cu, Al, P, O, H) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sigloite | Fe3+Al2(PO4)2(OH)3 · 7H2O |
| Al | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| Al | ⓘ Sudoite | Mg2Al3(AlSi3O10)(OH)8 |
| Al | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Al | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| Al | ⓘ Variscite | AlPO4 · 2H2O |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Strengite-Variscite Series | |
| Al | ⓘ Zincowoodwardite | Zn1-xAlx(OH)2[SO4]x/2 · nH2O |
| Al | ⓘ Bushmakinite | Pb2Al(PO4)(VO4)(OH) |
| Al | ⓘ Kobokoboite | Al6(PO4)4(OH)6 · 11H2O |
| Al | ⓘ Afmite | Al3(OH)4(H2O)3(PO4)(PO3OH) · H2O |
| Al | ⓘ Irinarassite | Ca3Sn2(SiO4)(AlO4)2 |
| Al | ⓘ Barrotite | Cu9Al(HSiO4)2[(SO4)(HAsO4)0.5](OH)12 · 8H2O |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Quartz var. Agate | SiO2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Baileychlore | Zn5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Si | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Si | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Ferrisurite | (Pb,Ca)2.4Fe23+(Si4O10)(CO3)1.7(OH)3 · nH2O |
| Si | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| Si | ⓘ Ferro-tschermakite | ◻Ca2(Fe32+Al2)(Al2Si6O22)(OH)2 |
| Si | ⓘ Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Kentrolite | Pb2Mn23+(Si2O7)O2 |
| Si | ⓘ Magnesio-hastingsite | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Sudoite | Mg2Al3(AlSi3O10)(OH)8 |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Willemite | Zn2SiO4 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Irinarassite | Ca3Sn2(SiO4)(AlO4)2 |
| Si | ⓘ Barrotite | Cu9Al(HSiO4)2[(SO4)(HAsO4)0.5](OH)12 · 8H2O |
| P | Phosphorus | |
| P | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| P | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| P | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| P | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Ferristrunzite | Fe3+Fe23+(PO4)2(OH)3 · 5H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| P | ⓘ Kidwellite | NaFe3+9+x(PO4)6(OH)11 · 3H2O, x = 0.33 |
| P | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Matulaite | (Fe3+,Al)Al7(PO4)4(PO3OH)2(OH)8(H2O)8 · 8H2O |
| P | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Rhabdophane-(La) | La(PO4) · H2O |
| P | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| P | ⓘ Rosièresite | (Pb, Cu, Al, P, O, H) |
| P | ⓘ Sigloite | Fe3+Al2(PO4)2(OH)3 · 7H2O |
| P | ⓘ Strengite | FePO4 · 2H2O |
| P | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| P | ⓘ Variscite | AlPO4 · 2H2O |
| P | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| P | ⓘ Meurigite-K | KFe83+(PO4)6(OH)7 · 6.5H2O |
| P | ⓘ Strengite-Variscite Series | |
| P | ⓘ Frondelite-Rockbridgeite Series | |
| P | ⓘ Heterosite-Purpurite Series | |
| P | ⓘ Bushmakinite | Pb2Al(PO4)(VO4)(OH) |
| P | ⓘ Apatite | Ca5(PO4)3A |
| P | ⓘ Kobokoboite | Al6(PO4)4(OH)6 · 11H2O |
| P | ⓘ Afmite | Al3(OH)4(H2O)3(PO4)(PO3OH) · H2O |
| P | ⓘ Ferroberaunite | Fe2+Fe53+(PO4)4(OH)5 · 6H2O |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Aguilarite | Ag4SeS |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Argentopyrite | AgFe2S3 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| S | ⓘ Cinnabar | HgS |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| S | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| S | ⓘ Cosalite | Pb2Bi2S5 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Emplectite | CuBiS2 |
| S | ⓘ Fizélyite | Ag5Pb14Sb21S48 |
| S | ⓘ Freieslebenite | AgPbSbS3 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| S | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Kermesite | Sb2S2O |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Lenaite | AgFeS2 |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Mackinawite | FeS |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Millerite | NiS |
| S | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| S | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Plagionite | Pb5Sb8S17 |
| S | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| S | ⓘ Proustite | Ag3AsS3 |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrostilpnite | Ag3SbS3 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Ramdohrite | Pb5.9Fe0.1Mn0.1In0.1Cd0.2Ag2.8Sb10.8S24 |
| S | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| S | ⓘ Semseyite | Pb9Sb8S21 |
| S | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| S | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stannite | Cu2FeSnS4 |
| S | ⓘ Stephanite | Ag5SbS4 |
| S | ⓘ Sternbergite | AgFe2S3 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Stromeyerite | AgCuS |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Vaesite | NiS2 |
| S | ⓘ Xanthoconite | Ag3AsS3 |
| S | ⓘ Zinkenite | Pb9Sb22S42 |
| S | ⓘ Kobellite-Tintinaite Series | |
| S | ⓘ Zincowoodwardite | Zn1-xAlx(OH)2[SO4]x/2 · nH2O |
| S | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| S | ⓘ Cupropearceite | [Cu6As2S7][Ag9CuS4] |
| S | ⓘ Cupropolybasite | [Cu6Sb2S7][Ag9CuS4] |
| S | ⓘ Alunite Group | A0.5-1 B3[SO4]2(OH)6 |
| S | ⓘ Tubulite | Ag2Pb22Sb20S53 |
| S | ⓘ Barrotite | Cu9Al(HSiO4)2[(SO4)(HAsO4)0.5](OH)12 · 8H2O |
| S | ⓘ Argentotetrahedrite-(Fe) | Ag6(Cu4Fe2)Sb4S12S |
| S | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| S | ⓘ Tennantite-(Fe) | Cu6(Cu4Fe22+)As4S12S |
| S | ⓘ Tetrahedrite-(Fe) | Cu6(Cu4Fe22+)Sb4S12S |
| Cl | Chlorine | |
| Cl | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Phosgenite | Pb2CO3Cl2 |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| Cl | ⓘ Vanadinite | Pb5(VO4)3Cl |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| K | ⓘ Meurigite-K | KFe83+(PO4)6(OH)7 · 6.5H2O |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Ca | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Ca | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Ca | ⓘ Ferrisurite | (Pb,Ca)2.4Fe23+(Si4O10)(CO3)1.7(OH)3 · nH2O |
| Ca | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| Ca | ⓘ Ferro-tschermakite | ◻Ca2(Fe32+Al2)(Al2Si6O22)(OH)2 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| Ca | ⓘ Magnesio-hastingsite | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Ca | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| Ca | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Zálesíite | CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ca | ⓘ Irinarassite | Ca3Sn2(SiO4)(AlO4)2 |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brookite | TiO2 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Ti | ⓘ Rutile var. Niobium-bearing Rutile | (Ti,Nb)O2 |
| V | Vanadium | |
| V | ⓘ Clinobisvanite | Bi(VO4) |
| V | ⓘ Descloizite | PbZn(VO4)(OH) |
| V | ⓘ Mottramite | PbCu(VO4)(OH) |
| V | ⓘ Vanadinite | Pb5(VO4)3Cl |
| V | ⓘ Bushmakinite | Pb2Al(PO4)(VO4)(OH) |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Mn | Manganese | |
| Mn | ⓘ Cesàrolite | PbMn34+O6(OH)2 |
| Mn | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| Mn | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Mn | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| Mn | ⓘ Hetaerolite | ZnMn2O4 |
| Mn | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| Mn | ⓘ Kentrolite | Pb2Mn23+(Si2O7)O2 |
| Mn | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Ramdohrite | Pb5.9Fe0.1Mn0.1In0.1Cd0.2Ag2.8Sb10.8S24 |
| Mn | ⓘ Ramsdellite | Mn4+O2 |
| Mn | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mn | ⓘ Frondelite-Rockbridgeite Series | |
| Mn | ⓘ Heterosite-Purpurite Series | |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Argentopyrite | AgFe2S3 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| Fe | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Fe | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Fe | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| Fe | ⓘ Delafossite | Cu+Fe3+O2 |
| Fe | ⓘ Ferberite | FeWO4 |
| Fe | ⓘ Ferristrunzite | Fe3+Fe23+(PO4)2(OH)3 · 5H2O |
| Fe | ⓘ Ferrisurite | (Pb,Ca)2.4Fe23+(Si4O10)(CO3)1.7(OH)3 · nH2O |
| Fe | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| Fe | ⓘ Ferro-tschermakite | ◻Ca2(Fe32+Al2)(Al2Si6O22)(OH)2 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Kidwellite | NaFe3+9+x(PO4)6(OH)11 · 3H2O, x = 0.33 |
| Fe | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| Fe | ⓘ Lenaite | AgFeS2 |
| Fe | ⓘ Lepidocrocite | Fe3+O(OH) |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Magnesio-hastingsite | NaCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| Fe | ⓘ Mackinawite | FeS |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Matulaite | (Fe3+,Al)Al7(PO4)4(PO3OH)2(OH)8(H2O)8 · 8H2O |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Ramdohrite | Pb5.9Fe0.1Mn0.1In0.1Cd0.2Ag2.8Sb10.8S24 |
| Fe | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Sigloite | Fe3+Al2(PO4)2(OH)3 · 7H2O |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Fe | ⓘ Sternbergite | AgFe2S3 |
| Fe | ⓘ Strengite | FePO4 · 2H2O |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Meurigite-K | KFe83+(PO4)6(OH)7 · 6.5H2O |
| Fe | ⓘ Strengite-Variscite Series | |
| Fe | ⓘ Frondelite-Rockbridgeite Series | |
| Fe | ⓘ Heterosite-Purpurite Series | |
| Fe | ⓘ Argentotetrahedrite-(Fe) | Ag6(Cu4Fe2)Sb4S12S |
| Fe | ⓘ Tennantite-(Fe) | Cu6(Cu4Fe22+)As4S12S |
| Fe | ⓘ Tetrahedrite-(Fe) | Cu6(Cu4Fe22+)Sb4S12S |
| Fe | ⓘ Ferroberaunite | Fe2+Fe53+(PO4)4(OH)5 · 6H2O |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Ni | Nickel | |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Vaesite | NiS2 |
| Cu | Copper | |
| Cu | ⓘ Agardite-(Ce) | CeCu6(AsO4)3(OH)6 · 3H2O |
| Cu | ⓘ Agardite-(La) | LaCu6(AsO4)3(OH)6 · 3H2O |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| Cu | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Cu | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cu | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Delafossite | Cu+Fe3+O2 |
| Cu | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Emplectite | CuBiS2 |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Mottramite | PbCu(VO4)(OH) |
| Cu | ⓘ Olivenite | Cu2(AsO4)(OH) |
| Cu | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| Cu | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| Cu | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Cu | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| Cu | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Cu | ⓘ Rosièresite | (Pb, Cu, Al, P, O, H) |
| Cu | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| Cu | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| Cu | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Cu | ⓘ Stromeyerite | AgCuS |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| Cu | ⓘ Zálesíite | CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O |
| Cu | ⓘ Kobellite-Tintinaite Series | |
| Cu | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| Cu | ⓘ Cupropearceite | [Cu6As2S7][Ag9CuS4] |
| Cu | ⓘ Cupropolybasite | [Cu6Sb2S7][Ag9CuS4] |
| Cu | ⓘ Barrotite | Cu9Al(HSiO4)2[(SO4)(HAsO4)0.5](OH)12 · 8H2O |
| Cu | ⓘ Argentotetrahedrite-(Fe) | Ag6(Cu4Fe2)Sb4S12S |
| Cu | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| Cu | ⓘ Tennantite-(Fe) | Cu6(Cu4Fe22+)As4S12S |
| Cu | ⓘ Tetrahedrite-(Fe) | Cu6(Cu4Fe22+)Sb4S12S |
| Zn | Zinc | |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Baileychlore | Zn5Al(AlSi3O10)(OH)8 |
| Zn | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| Zn | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| Zn | ⓘ Descloizite | PbZn(VO4)(OH) |
| Zn | ⓘ Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hetaerolite | ZnMn2O4 |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Zn | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| Zn | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Willemite | Zn2SiO4 |
| Zn | ⓘ Zincowoodwardite | Zn1-xAlx(OH)2[SO4]x/2 · nH2O |
| Zn | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| As | Arsenic | |
| As | ⓘ Agardite-(Ce) | CeCu6(AsO4)3(OH)6 · 3H2O |
| As | ⓘ Agardite-(La) | LaCu6(AsO4)3(OH)6 · 3H2O |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| As | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| As | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| As | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| As | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Mansfieldite | AlAsO4 · 2H2O |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Olivenite | Cu2(AsO4)(OH) |
| As | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| As | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| As | ⓘ Proustite | Ag3AsS3 |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Stibarsen | AsSb |
| As | ⓘ Xanthoconite | Ag3AsS3 |
| As | ⓘ Zálesíite | CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O |
| As | ⓘ Cupropearceite | [Cu6As2S7][Ag9CuS4] |
| As | ⓘ Barrotite | Cu9Al(HSiO4)2[(SO4)(HAsO4)0.5](OH)12 · 8H2O |
| As | ⓘ Tennantite-(Fe) | Cu6(Cu4Fe22+)As4S12S |
| Se | Selenium | |
| Se | ⓘ Aguilarite | Ag4SeS |
| Se | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| Sr | Strontium | |
| Sr | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Rutile var. Niobium-bearing Rutile | (Ti,Nb)O2 |
| Mo | Molybdenum | |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Mo | ⓘ Stolzite-Wulfenite Series | |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Aguilarite | Ag4SeS |
| Ag | ⓘ Argentopyrite | AgFe2S3 |
| Ag | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| Ag | ⓘ Fizélyite | Ag5Pb14Sb21S48 |
| Ag | ⓘ Freieslebenite | AgPbSbS3 |
| Ag | ⓘ Iodargyrite | AgI |
| Ag | ⓘ Lenaite | AgFeS2 |
| Ag | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| Ag | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Ag | ⓘ Proustite | Ag3AsS3 |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Pyrostilpnite | Ag3SbS3 |
| Ag | ⓘ Ramdohrite | Pb5.9Fe0.1Mn0.1In0.1Cd0.2Ag2.8Sb10.8S24 |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Stephanite | Ag5SbS4 |
| Ag | ⓘ Sternbergite | AgFe2S3 |
| Ag | ⓘ Stromeyerite | AgCuS |
| Ag | ⓘ Xanthoconite | Ag3AsS3 |
| Ag | ⓘ Cupropearceite | [Cu6As2S7][Ag9CuS4] |
| Ag | ⓘ Cupropolybasite | [Cu6Sb2S7][Ag9CuS4] |
| Ag | ⓘ Tubulite | Ag2Pb22Sb20S53 |
| Ag | ⓘ Argentotetrahedrite-(Fe) | Ag6(Cu4Fe2)Sb4S12S |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| Cd | ⓘ Ramdohrite | Pb5.9Fe0.1Mn0.1In0.1Cd0.2Ag2.8Sb10.8S24 |
| In | Indium | |
| In | ⓘ Ramdohrite | Pb5.9Fe0.1Mn0.1In0.1Cd0.2Ag2.8Sb10.8S24 |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sn | ⓘ Irinarassite | Ca3Sn2(SiO4)(AlO4)2 |
| Sb | Antimony | |
| Sb | ⓘ Native Antimony | Sb |
| Sb | ⓘ Bindheimite | Pb2Sb2O6O |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| Sb | ⓘ Fizélyite | Ag5Pb14Sb21S48 |
| Sb | ⓘ Freieslebenite | AgPbSbS3 |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Kermesite | Sb2S2O |
| Sb | ⓘ Plagionite | Pb5Sb8S17 |
| Sb | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Pyrostilpnite | Ag3SbS3 |
| Sb | ⓘ Ramdohrite | Pb5.9Fe0.1Mn0.1In0.1Cd0.2Ag2.8Sb10.8S24 |
| Sb | ⓘ Semseyite | Pb9Sb8S21 |
| Sb | ⓘ Senarmontite | Sb2O3 |
| Sb | ⓘ Stephanite | Ag5SbS4 |
| Sb | ⓘ Stibarsen | AsSb |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Valentinite | Sb2O3 |
| Sb | ⓘ Zinkenite | Pb9Sb22S42 |
| Sb | ⓘ Kobellite-Tintinaite Series | |
| Sb | ⓘ Cupropolybasite | [Cu6Sb2S7][Ag9CuS4] |
| Sb | ⓘ Tubulite | Ag2Pb22Sb20S53 |
| Sb | ⓘ Argentotetrahedrite-(Fe) | Ag6(Cu4Fe2)Sb4S12S |
| Sb | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| Sb | ⓘ Tetrahedrite-(Fe) | Cu6(Cu4Fe22+)Sb4S12S |
| I | Iodine | |
| I | ⓘ Iodargyrite | AgI |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| Ba | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| La | Lanthanum | |
| La | ⓘ Agardite-(La) | LaCu6(AsO4)3(OH)6 · 3H2O |
| La | ⓘ Rhabdophane-(La) | La(PO4) · H2O |
| Ce | Cerium | |
| Ce | ⓘ Agardite-(Ce) | CeCu6(AsO4)3(OH)6 · 3H2O |
| Ce | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| W | Tungsten | |
| W | ⓘ Ferberite | FeWO4 |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Stolzite | Pb(WO4) |
| W | ⓘ Stolzite-Wulfenite Series | |
| Hg | Mercury | |
| Hg | ⓘ Cinnabar | HgS |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Bindheimite | Pb2Sb2O6O |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Cesàrolite | PbMn34+O6(OH)2 |
| Pb | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| Pb | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Pb | ⓘ Cosalite | Pb2Bi2S5 |
| Pb | ⓘ Descloizite | PbZn(VO4)(OH) |
| Pb | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| Pb | ⓘ Ferrisurite | (Pb,Ca)2.4Fe23+(Si4O10)(CO3)1.7(OH)3 · nH2O |
| Pb | ⓘ Fizélyite | Ag5Pb14Sb21S48 |
| Pb | ⓘ Freieslebenite | AgPbSbS3 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| Pb | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Kentrolite | Pb2Mn23+(Si2O7)O2 |
| Pb | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Mottramite | PbCu(VO4)(OH) |
| Pb | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| Pb | ⓘ Phosgenite | Pb2CO3Cl2 |
| Pb | ⓘ Plagionite | Pb5Sb8S17 |
| Pb | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Ramdohrite | Pb5.9Fe0.1Mn0.1In0.1Cd0.2Ag2.8Sb10.8S24 |
| Pb | ⓘ Rosièresite | (Pb, Cu, Al, P, O, H) |
| Pb | ⓘ Semseyite | Pb9Sb8S21 |
| Pb | ⓘ Stolzite | Pb(WO4) |
| Pb | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Zinkenite | Pb9Sb22S42 |
| Pb | ⓘ Kobellite-Tintinaite Series | |
| Pb | ⓘ Bushmakinite | Pb2Al(PO4)(VO4)(OH) |
| Pb | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| Pb | ⓘ Stolzite-Wulfenite Series | |
| Pb | ⓘ Tubulite | Ag2Pb22Sb20S53 |
| Bi | Bismuth | |
| Bi | ⓘ Bismite | Bi2O3 |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Clinobisvanite | Bi(VO4) |
| Bi | ⓘ Cosalite | Pb2Bi2S5 |
| Bi | ⓘ Emplectite | CuBiS2 |
| Bi | ⓘ Kobellite-Tintinaite Series | |
| U | Uranium | |
| U | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
Fossils
There are 464 fossil localities from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 464 |
|---|---|
| Youngest Fossil Listed | 23.0 Ma (Oligocene) |
| Oldest Fossil Listed | 513 Ma (Cambrian) |
| Stratigraphic Units | Click here to view 18 stratigraphic units. |
| Fossils from Region | Click here to show the list. |
| Fossil Localities | Click to show 53 fossil localities |
- Occitanie
- Tarn
- Early/Lower Cretaceous🐚 Bed 165/041
- Early Jurassic🐚 Cabannes-de-Cordes deposit
- Eocene🐚 Castrais
- Eocene🐚 Castres
- Devonian🐚 Emsian assemblage from the middle Moniello Fm
- Devonian🐚 Emsian assemblage from the Raneces Group Capas de Aguion Fm
- Early/Lower Devonian🐚 Emsian assemblage from the Raneces Grp Caliza de Ferrones Fm
- Early/Lower Devonian🐚 Emsian athyrid from the Raneces Group Caliza de Ferrones Fm
- Devonian🐚 Emsian athyrid from the Raneces Group Capas de Aguion Fm
- Early/Lower Devonian🐚 Emsian fauna from the lower Moniello Fm
- Devonian🐚 Emsian-Eifelian assemblage from the upper Moniello Fm
- Late/Upper Devonian🐚 Frasnian athyrids from the Candas Fm
- Paleogene🐚 Gaillac
- Middle Devonian🐚 Givetian athyrids from the Candas Fm
- Devonian🐚 Givetian fauna from the lower Candas Fm
- Devonian🐚 Givetian-Frasnian athyrids from the Candas Fm
- Devonian🐚 Givetian-Frasnian fauna from the upper Candas Fm
- Late/Upper Cretaceous🐚 Jablonski & Raup Locality 57
- Cambrian🐚 La Gardie hill situated at the SE of Ferrals-les-Montagnes
- Cenozoic🐚 La Sauzière Saint-Jean
- Eocene🐚 Lieu-dit Braconnac
- Early/Lower Devonian🐚 Lochkovian assem #2 from Raneces Group Caliza de Nieva member Asturias
- Early/Lower Devonian🐚 Lochkovian assem #3 from Raneces Group Caliza de Nieva member Asturias
- Tarn
- Occitanie
- Tarn
- Early/Lower Devonian🐚 Lochkovian assembl from Raneces Group Caliza de Nieva member Asturias
- Devonian🐚 Lower Dev assembl from Raneces Group Capas de Aguion Fm
- Devonian🐚 Lower Dev athyrid from the Raneces Group Capas de Aguion Fm
- Early/Lower Devonian🐚 Lower Dev athyrid from the Raneces Grp Caliza de Ferrones Fm
- Early/Lower Devonian🐚 lower Devonian athyrid from Raneces Gp lower Caliza de Nieva Asturias
- Eocene🐚 Montespieu
- Eocene🐚 Payrin-Augmontel
- Eocene🐚 Peyregoux
- Early/Lower Devonian🐚 Pragian assemblage from Raneces Gp lower Caliza de Nieva Fm
- Early/Lower Devonian🐚 Pragian assemblage from Raneces Group Caliza de Nieva member Asturias
- Cenozoic🐚 Puycelci
- Oligocene🐚 Puylaurens
- Oligocene🐚 Rabastens
- Eocene🐚 Saïx
- Oligocene🐚 St-Martin-de-Briatexte
- Devonian🐚 Upper Emsian assem from basal upper member of Moniello Fm
- Devonian🐚 Upper Emsian assem from the Raneces Group Capas de Aguion mem Asturias
- Devonian🐚 Upper Emsian assem from the Raneces Grp Capas de Aguion mem Fenolleda
- Devonian🐚 Upper Emsian assemblage from the basal Moniello Fm
- Devonian🐚 Upper Emsian assemblage from the upper Moniello Fm
- Early Jurassic🐚 Vaour deposit
- Eocene🐚 Vielmur-sur-Agout
- Eocene🐚 Viviers les Montagne
- Albi
- Castres
- Tarn
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Tarn_(department) |
|---|---|
| Wikidata ID: | Q12772 |
| GeoNames ID: | 2973362 |
Localities in this Region
- Occitanie
- Tarn
- Alban - Curvalle
- ⭔Albi
- ⭔Alban
- ⭔Albi
- ⭔Almayrac
- ⭔Alos
- ⭔Amarens
- ⭔Ambialet
- ⭔Andillac
- ⭔Andouque
- ⭔Arthès
- ⭔Assac
- ⭔Aussac
- ⭔Beauvais-sur-Tescou
- ⭔Bellegarde-Marsal
- ⭔Bernac
- ⭔Blaye-les-Mines
- ⭔Bournazel
- ⭔Brens
- ⭔Broze
- ⭔Cadalen
- ⭔Cadix
- ⭔Cagnac-les-Mines
- ⭔Cahuzac-sur-Vère
- ⭔Cambon
- ⭔Campagnac
- ⭔Carlus
- ⭔Carmaux
- ⭔Castanet
- ⭔Castelnau-de-Lévis
- ⭔Castelnau-de-Montmiral
- ⭔Cestayrols
- ⭔Combefa
- ⭔Cordes-sur-Ciel
- ⭔Coufouleux
- ⭔Courris
- ⭔Crespin
- ⭔Crespinet
- ⭔Cunac
- ⭔Curvalle
- ⭔Dénat
- ⭔Donnazac
- ⭔Fauch
- ⭔Faussergues
- ⭔Fayssac
- ⭔Fénols
- ⭔Florentin
- ⭔Fraissines
- ⭔Frausseilles
- ⭔Fréjairolles
- ⭔Gaillac
- ⭔Grazac
- ⭔Itzac
- ⭔Jouqueviel
- ⭔La Sauzière-Saint-Jean
- ⭔Labarthe-Bleys
- ⭔Labastide-de-Lévis
- ⭔Labastide-Gabausse
- ⭔Labessière-Candeil
- ⭔Laboutarie
- ⭔Lacapelle-Pinet
- ⭔Lacapelle-Ségalar
- ⭔Lagrave
- ⭔Lamillarié
- ⭔Laparrouquial
- ⭔Larroque
- ⭔Lasgraisses
- ⭔Le Dourn
- ⭔Le Fraysse
- ⭔Le Garric
- ⭔Le Riols
- ⭔Le Ségur
- ⭔Le Sequestre
- ⭔Le Verdier
- ⭔Lédas-et-Penthiès
- ⭔Les Cabannes
- ⭔Lescure-d'Albigeois
- ⭔Lisle-sur-Tarn
- ⭔Livers-Cazelles
- ⭔Lombers
- ⭔Loubers
- ⭔Loupiac
- ⭔Mailhoc
- ⭔Marnaves
- ⭔Marssac-sur-Tarn
- ⭔Massals
- ⭔Mézens
- ⭔Milhars
- ⭔Milhavet
- ⭔Miolles
- ⭔Mirandol-Bourgnounac
- ⭔Monestiés
- ⭔Montans
- ⭔Montauriol
- ⭔Montdurausse
- ⭔Montels
- ⭔Montgaillard
- ⭔Montirat
- ⭔Montrosier
- ⭔Montvalen
- ⭔Moularès
- ⭔Mouzieys-Panens
- ⭔Mouzieys-Teulet
- ⭔Noailles
- ⭔Orban
- ⭔Padiès
- ⭔Pampelonne
- ⭔Parisot
- ⭔Paulinet
- ⭔Penne
- ⭔Peyrole
- ⭔Poulan-Pouzols
- ⭔Puycelsi
- ⭔Puygouzon
- ⭔Rabastens
- ⭔Réalmont
- ⭔Rivières
- ⭔Roquemaure
- ⭔Rosières
- ⭔Rouffiac
- ⭔Roussayrolles
- ⭔Saint-André
- ⭔Saint-Beauzile
- ⭔Saint-Benoît-de-Carmaux
- ⭔Saint-Christophe
- ⭔Saint-Cirgue
- ⭔Saint-Grégoire
- ⭔Saint-Jean-de-Marcel
- ⭔Saint-Juéry
- ⭔Saint-Julien-Gaulène
- ⭔Saint-Marcel-Campes
- ⭔Saint-Martin-Laguépie
- ⭔Saint-Michel-de-Vax
- ⭔Saint-Michel-Labadié
- ⭔Saint-Urcisse
- ⭔Sainte-Cécile-du-Cayrou
- ⭔Sainte-Croix
- ⭔Sainte-Gemme
- ⭔Saliès
- ⭔Salles
- ⭔Salvagnac
- ⭔Saussenac
- ⭔Senouillac
- ⭔Sérénac
- ⭔Sieurac
- ⭔Souel
- ⭔Taïx
- ⭔Tanus
- ⭔Tauriac
- ⭔Técou
- ⭔Teillet
- ⭔Terre-de-Bancalié
- ⭔Terssac
- ⭔Tonnac
- ⭔Tréban
- ⭔Trébas
- ⭔Trévien
- ⭔Valderiès
- ⭔Valence-d'Albigeois
- ⭔Vaour
- ⭔Vieux
- ⭔Villefranche d'Albigeois
- ⭔Villeneuve-sur-Vère
- ⭔Vindrac-Alayrac
- ⭔Virac
- Calel à Sozèze
- Tarn
- Occitanie
- Tarn
- ⭔Castres
- ⭔Aguts
- ⭔Aiguefonde
- ⭔Albine
- ⭔Algans
- ⭔Ambres
- ⭔Anglès
- ⭔Appelle
- ⭔Arfons
- ⭔Arifat
- ⭔Aussillon
- ⭔Bannières
- ⭔Barre
- ⭔Belcastel
- ⭔Belleserre
- ⭔Berlats
- ⭔Bertre
- ⭔Blan
- ⭔Boissezon
- ⭔Bout-du-Pont-de-Larn
- ⭔Brassac
- ⭔Briatexte
- ⭔Brousse
- ⭔Burlats
- ⭔Busque
- ⭔Cabanès
- ⭔Cahuzac
- ⭔Cambon-lès-Lavaur
- ⭔Cambounès
- ⭔Cambounet-sur-le-Sor
- ⭔Carbes
- ⭔Castres
- ⭔Caucalières
- ⭔Cuq-Toulza
- ⭔Cuq
- ⭔Damiatte
- ⭔Dourgne
- ⭔Durfort
- ⭔Escoussens
- ⭔Escroux
- ⭔Espérausses
- ⭔Fiac
- ⭔Fontrieu
- ⭔Fréjeville
- ⭔Garrevaques
- ⭔Garrigues
- ⭔Gijounet
- ⭔Giroussens
- ⭔Graulhet
- ⭔Guitalens-L'Albarède
- ⭔Jonquières
- ⭔Labastide-Rouairoux
- ⭔Labastide-Saint-Georges
- ⭔Laboulbène
- ⭔Labruguière
- ⭔Lacabarède
- ⭔Lacaune
- ⭔Lacaze
- ⭔Lacougotte-Cadoul
- ⭔Lacroisille
- ⭔Lacrouzette
- ⭔Lagardiolle
- ⭔Lagarrigue
- ⭔Lamontélarié
- ⭔Lasfaillades
- ⭔Lautrec
- ⭔Lavaur
- ⭔Le Bez
- ⭔Le Masnau-Massuguiès
- ⭔Le Rialet
- ⭔Le Vintrou
- ⭔Lempaut
- ⭔Les Cammazes
- ⭔Lescout
- ⭔Lugan
- ⭔Magrin
- ⭔Marzens
- ⭔Massac-Séran
- ⭔Massaguel
- ⭔Maurens-Scopont
- ⭔Mazamet
- ⭔Missècle
- ⭔Mont-Roc
- ⭔Montcabrier
- ⭔Montdragon
- ⭔Montfa
- ⭔Montgey
- ⭔Montpinier
- ⭔Montredon-Labessonnié
- ⭔Moulayrès
- ⭔Moulin-Mage
- ⭔Mouzens
- ⭔Murat-sur-Vèbre
- ⭔Nages
- ⭔Navès
- ⭔Noailhac
- ⭔Palleville
- ⭔Payrin-Augmontel
- ⭔Péchaudier
- ⭔Peyregoux
- ⭔Pont-de-Larn
- ⭔Poudis
- ⭔Prades
- ⭔Pratviel
- ⭔Puéchoursi
- ⭔Puybegon
- ⭔Puycalvel
- ⭔Puylaurens
- ⭔Rayssac
- ⭔Roquecourbe
- ⭔Roquevidal
- ⭔Rouairoux
- ⭔Saint-Affrique-les-Montagnes
- ⭔Saint-Agnan
- ⭔Saint-Amancet
- ⭔Saint-Amans-Soult
- ⭔Saint-Amans-Valtoret
- ⭔Saint-Avit
- ⭔Saint-Gauzens
- ⭔Saint-Genest-de-Contest
- ⭔Saint-Germain-des-Prés
- ⭔Saint-Germier
- ⭔Saint-Jean-de-Rives
- ⭔Saint-Jean-de-Vals
- ⭔Saint-Julien-du-Puy
- ⭔Saint-Lieux-lès-Lavaur
- ⭔Saint-Paul-Cap-de-Joux
- ⭔Saint-Pierre-de-Trivisy
- ⭔Saint-Salvi-de-Carcavès
- ⭔Saint-Salvy-de-la-Balme
- ⭔Saint-Sernin-lès-Lavaur
- ⭔Saint-Sulpice-la-Pointe
- ⭔Saïx
- ⭔Sauveterre
- ⭔Sémalens
- ⭔Senaux
- ⭔Serviès
- ⭔Sorèze
- ⭔Soual
- ⭔Teulat
- ⭔Teyssode
- ⭔Vabre
- ⭔Valdurenque
- ⭔Veilhes
- ⭔Vénès
- ⭔Verdalle
- ⭔Viane
- ⭔Vielmur-sur-Agout
- ⭔Villeneuve-lès-Lavaur
- ⭔Viterbe
- ⭔Viviers-lès-Lavaur
- ⭔Viviers-lès-Montagnes
- Coutery
- ⭔Castres
- Tarn
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
- Moldanubian BeltOrogenic Belt
EuropeContinent
France
- Massif CentralHighland Region
- Occitanie
- Tarn
- Alban - Le Fraysse mining areaMining Area
- Tarn
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Phosphate occurrence, Fumade, Fontrieu, Castres, Tarn, Occitanie, France