Lufilian Arc, African Platei
| Regional Level Types | |
|---|---|
| Lufilian Arc | Volcanic Arc |
| African Plate | Tectonic Plate |
This page is currently not sponsored. Click here to sponsor this page.
Type:
The Lufilian Orogenic Arc extends approximately 500 km along the eastern Zambia-DRC border before curving westward to the Zambia-Angola border, forming a polymetallic (Cu-Co-Ni-Pb-Zn) metallogenic belt. At ∼ 880–550 Ma the subsequent convergence-compression between the Congo and Kalahari cratons subjected the Meso- to Neoproterozoic sedimentary strata of the Katanga Basin to intense compressional folding and faulting, ultimately forming the arcuate structural belt with an overall NW-SE trend. From north to south, this belt comprises five tectonic units: the Katanga aulacogen, external fold-and-thrust belt, dome zone, syncline zone, and Katanga highlands. The first three units constitute the principal components of the Central African Cu-Co metallogenic belt. Cu-Co mineralization predominantly occurs within the external fold-and-thrust belt, which hosts multiple world-class stratiform Cu-Co deposits such as Musonoi and Kamoto. The Katanga Cu-Co Belt constitutes the DRC segment of the Central African Cu-Co metallogenic system. It extends westward from the Kamoto deposit (west of Kolwezi City, Lualaba Province, DRC) through the Tenke-Fungurume and Likasi areas, to the Kinsenda deposit in the east. The belt measures over 300 km in length and 100–150 km in width.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities188 valid minerals. 6 (TL) - type locality of valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 Localities: Kansanshi Mine, Solwezi District, North-Western Province, Zambia Kamakanga Mine, Kafubu emerald mining district, Lufwanyama District, Copperbelt Province, Zambia Kagem Emerald Mine, Kafubu emerald mining district, Lufwanyama District, Copperbelt Province, Zambia Kafubu emerald mining district, Lufwanyama District, Copperbelt Province, Zambia |
| ⓘ Adamite Formula: Zn2(AsO4)(OH) Colour: Yellow. Description: Extremely rare at Kipushi. Only a few specimen known. References: |
| ⓘ Aikinite Formula: CuPbBiS3 |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reported from at least 11 localities in this region. |
| ⓘ Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ Allophane Formula: (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ Amesite Formula: Mg2Al(AlSiO5)(OH)4 |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5(T8O22)W2 |
| ⓘ Andalusite Formula: Al2(SiO4)O |
| ⓘ Anglesite Formula: PbSO4 References: |
| ⓘ Anhydrite Formula: CaSO4 Localities: Reported from at least 6 localities in this region. |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A Localities: Reported from at least 8 localities in this region. |
| ⓘ Aragonite Formula: CaCO3 |
| ✪ Arfvedsonite Formula: NaNa2(Fe2+4Fe3+)Si8O22(OH)2 Habit: flattened tabular crystal Colour: Dark brown to black Description: When dissolving calcite out of Almandine pockets, sometimes the mineral occurs. References: |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Atacamite Formula: Cu2(OH)3Cl Colour: Dark emerald-green to blackish green. Fluorescence: Not fluorescent. References: |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 References: |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Baryte Formula: BaSO4 Localities: Kipushi Mine, Kipushi, Kipushi Territory, Haut-Katanga, DR Congo Nkana Mine, Kitwe, Kitwe District, Copperbelt Province, Zambia Kafubu emerald mining district, Lufwanyama District, Copperbelt Province, Zambia Musoshi Mine, Musoshi, Kipushi Territory, Haut-Katanga, DR Congo Lonshi Mine, Sakania Territory, Haut-Katanga, DR Congo |
| ⓘ 'Bastnäsite' Formula: (Ce/Nd/Y/REE)(CO3)F |
| ⓘ Beaverite-(Cu) Formula: Pb(Fe3+2Cu)(SO4)2(OH)6 References: |
| ⓘ Bertrandite Formula: Be4(Si2O7)(OH)2 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Localities: Reported from at least 25 localities in this region. Habit: well terminated deep green and clear hexagonal crystals in black Mica Colour: deep green |
| ⓘ Beryl var. Emerald Formula: Be3Al2(Si6O18) Localities: Reported from at least 25 localities in this region. Description: The results of LA-ICP-MS showed that Kamakanga emeralds from Zambia had stable and high contents of alkali metals (Li, Na, K, Rb, Cs) in the range of 15,120 to 20,407 ppmw (avg. 17,592 ppmw). The alkali metal concentrations, from highest to lowest, were Na, Cs, Li, K, and Rb. The Na contents ranged from 12,343 to 23,517 ppmw (avg. 15,981 ppmw); the Cs contents ranged from 626 to 2724 ppmw (avg. 1331 ppmw); the Li contents ranged from 301 to 843 ppmw (avg. 485 ppmw); the K contents ranged from 119 to 573 ppmw (avg. 369 ppmw); and the Rb contents ranged from 21 to 248 ppmw (avg. 68 ppmw). Chromophore Cr, V, and Fe contents, respectively, ranged from 76 to 2934 ppmw (avg. 1435 ppmw), 78 to 183 ppmw (avg. 128 ppmw), and 5136 to 11,320 ppmw (avg. 8556 ppmw). The concentration of Cr was much higher than that of V and the Cr/V ratio was highly variable, ranging from 0.70 to 34.35. In addition, Zambian Kamakanga emeralds had high contents of Cs (avg. 1331 ppmw), Fe (avg. 8556 ppmw), and Li (avg. 485 ppmw).[[1]] |
| ⓘ Betekhtinite Formula: Pb2(Cu,Fe)22-24S15 References: |
| ⓘ Beudantite Formula: PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Reported from at least 14 localities in this region. |
| ⓘ Bismuthinite Formula: Bi2S3 References: |
| ⓘ Bornite Formula: Cu5FeS4 Localities: Reported from at least 19 localities in this region. |
| ⓘ Brannerite Formula: UTi2O6 |
| ✪ Briartite (TL) Formula: Cu2FeGeS4 Type Locality: |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 Localities: Habit: Lath-like crystals. Colour: Green. Fluorescence: Not fluorescent. |
| ⓘ Brookite Formula: TiO2 References: (Hanco) Zwaan, J. C., Seifert, Antonín V., Vrána, Stanislav, Laurs, Brendan M., Anckar, Björn, (Skip) Simmons, William B., Falster, Alexander U., Lustenhouwer, Wim J., Muhlmeister, Sam, Koivula, John I., Garcia-Guillerminet, Héja (2005) Emeralds from the Kafubu Area, Zambia. Gems & Gemology, 41 (2) 116-148 doi:10.5741/gems.41.2.116 |
| ⓘ 'Calamine' |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 17 localities in this region. |
| ⓘ Calcite var. Iron-bearing Calcite Formula: (Ca,Fe)CO3 |
| ⓘ Calcite var. Zinc-bearing Calcite Formula: (Ca,Zn)CO3 References: |
| ⓘ Carrollite Formula: CuCo2S4 Localities: Reported from at least 12 localities in this region. |
| ⓘ Cattierite Formula: CoS2 |
| ⓘ Cerussite Formula: PbCO3 |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O |
| ⓘ Chalcocite Formula: Cu2S Localities: Reported from at least 16 localities in this region. |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 23 localities in this region. |
| ⓘ 'Chlorite Group' Localities: Reported from at least 16 localities in this region. |
| ⓘ Chrysoberyl Formula: BeAl2O4 References: (Hanco) Zwaan, J. C., Seifert, Antonín V., Vrána, Stanislav, Laurs, Brendan M., Anckar, Björn, (Skip) Simmons, William B., Falster, Alexander U., Lustenhouwer, Wim J., Muhlmeister, Sam, Koivula, John I., Garcia-Guillerminet, Héja (2005) Emeralds from the Kafubu Area, Zambia. Gems & Gemology, 41 (2) 116-148 doi:10.5741/gems.41.2.116 |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 Localities: Reported from at least 7 localities in this region. |
| ⓘ Chrysotile Formula: Mg3(Si2O5)(OH)4 References: (Hanco) Zwaan, J. C., Seifert, Antonín V., Vrána, Stanislav, Laurs, Brendan M., Anckar, Björn, (Skip) Simmons, William B., Falster, Alexander U., Lustenhouwer, Wim J., Muhlmeister, Sam, Koivula, John I., Garcia-Guillerminet, Héja (2005) Emeralds from the Kafubu Area, Zambia. Gems & Gemology, 41 (2) 116-148 doi:10.5741/gems.41.2.116 |
| ⓘ 'Clay minerals' References: |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinochlore var. Pennine Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinochlore var. Talc-chlorite Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ Cobaltpentlandite Formula: Co9S8 |
| ⓘ Coffinite Formula: U(SiO4) · nH2O |
| ⓘ Columbite-(Mn) Formula: Mn2+Nb2O6 |
| ⓘ Cordierite Formula: Mg2Al4Si5O18 |
| ⓘ Cornetite Formula: Cu3(PO4)(OH)3 |
| ⓘ Corundum Formula: Al2O3 References: |
| ⓘ Cosalite Formula: Pb2Bi2S5 References: |
| ⓘ Covellite Formula: CuS Localities: Reported from at least 7 localities in this region. |
| ⓘ Cronstedtite Formula: Fe2+2Fe3+((Si,Fe3+)2O5)(OH)4 |
| ⓘ Cummingtonite Formula: ◻Mg2Mg5(Si8O22)(OH)2 |
| ⓘ Cuprite Formula: Cu2O Localities: Reported from at least 8 localities in this region. Habit: Massive. Colour: Dark red to almost black. Fluorescence: Not fluorescent. |
| ⓘ Cuprite var. Chalcotrichite Formula: Cu2O |
| ✪ 'Davidite' Habit: Blocky Colour: Black |
| ⓘ Descloizite Formula: PbZn(VO4)(OH) |
| ⓘ Descloizite var. Copper-bearing Descloizite Formula: Pb(Zn,Cu)VO4OH References: |
| ⓘ Devilline Formula: CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ Diaspore Formula: AlO(OH) References: |
| ⓘ Digenite Formula: Cu9S5 Localities: Reported from at least 6 localities in this region. |
| ⓘ Diopside Formula: CaMgSi2O6 |
| ⓘ Dioptase Formula: CuSiO3 · H2O |
| ⓘ Djurleite Formula: Cu31S16 |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: Reported from at least 19 localities in this region. |
| ⓘ Dolomite var. Iron-bearing Dolomite Formula: Ca(Mg,Fe)(CO3)2 |
| ⓘ Dolomite var. Zinc-bearing Dolomite Formula: Ca(Mg,Zn)(CO3)2 |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Drysdallite (TL) Formula: MoSe2 Type Locality: |
| ⓘ 'Ellestadite' |
| ⓘ Emplectite Formula: CuBiS2 |
| ⓘ Enargite Formula: Cu3AsS4 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Feldspar Group' Localities: Chambishi Mine, Chambishi, Kalulushi District, Copperbelt Province, Zambia Kagem Emerald Mine, Kafubu emerald mining district, Lufwanyama District, Copperbelt Province, Zambia Nkana south limb, Nkana Mine, Kitwe, Kitwe District, Copperbelt Province, Zambia Sentinel mine, Kalumbila District, North-Western Province, Zambia Lonshi Mine, Sakania Territory, Haut-Katanga, DR Congo |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorellestadite Formula: Ca5(SiO4)1.5(SO4)1.5F |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ 'Fluor-uvite-Uvite Series' Description: Green "trapiche" habit. Vanadium-bearing. |
| ⓘ Gahnite Formula: ZnAl2O4 |
| ⓘ Galena Formula: PbS Localities: Reported from at least 9 localities in this region. |
| ⓘ Gallite (TL) Formula: CuGaS2 Type Locality: References: Kamona, A. F., Lévêque, J., Friedrich, G., Haack, U. (1999) Lead isotopes of the carbonate-hosted Kabwe, Tsumeb, and Kipushi Pb-Zn-Cu sulphide deposits in relation to Pan African orogenesis in the Damaran-Lufilian Fold Belt of Central Africa. Mineralium Deposita, 34 (3). 273-283 doi:10.1007/s001260050203 |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Geerite Formula: Cu8S5 |
| ⓘ Germanite Formula: Cu13Fe2Ge2S16 References: Kamona, A. F., Lévêque, J., Friedrich, G., Haack, U. (1999) Lead isotopes of the carbonate-hosted Kabwe, Tsumeb, and Kipushi Pb-Zn-Cu sulphide deposits in relation to Pan African orogenesis in the Damaran-Lufilian Fold Belt of Central Africa. Mineralium Deposita, 34 (3). 273-283 doi:10.1007/s001260050203 |
| ⓘ Germanocolusite Formula: Cu26V2(Ge,As)6S32 |
| ⓘ 'Glauconite' Formula: K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 References: (Hanco) Zwaan, J. C., Seifert, Antonín V., Vrána, Stanislav, Laurs, Brendan M., Anckar, Björn, (Skip) Simmons, William B., Falster, Alexander U., Lustenhouwer, Wim J., Muhlmeister, Sam, Koivula, John I., Garcia-Guillerminet, Héja (2005) Emeralds from the Kafubu Area, Zambia. Gems & Gemology, 41 (2) 116-148 doi:10.5741/gems.41.2.116 |
| ⓘ Goethite Formula: Fe3+O(OH) Localities: Habit: Reniform agregates Colour: Brown |
| ⓘ Goslarite Formula: ZnSO4 · 7H2O |
| ⓘ Graphite Formula: C Localities: Kipushi Mine, Kipushi, Kipushi Territory, Haut-Katanga, DR Congo Kansanshi Mine, Solwezi District, North-Western Province, Zambia Kagem Emerald Mine, Kafubu emerald mining district, Lufwanyama District, Copperbelt Province, Zambia Kavungu Mine, Jivunda, Mwinilunga District, North-Western Province, Zambia Sentinel mine, Kalumbila District, North-Western Province, Zambia |
| ⓘ Greenockite Formula: CdS |
| ⓘ Grunerite Formula: ◻Fe2+2Fe2+5(Si8O22)(OH)2 |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Halite Formula: NaCl |
| ⓘ Hastingsite Formula: NaCa2(Fe2+4Fe3+)(Si6Al2)O22(OH)2 |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 14 localities in this region. |
| ⓘ Hematite var. Martite Formula: Fe2O3 |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O |
| ⓘ Heterogenite Formula: Co3+O(OH) |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 References: |
| ⓘ Idaite Formula: Cu5FeS6 |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Kaersutite Formula: NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ 'K Feldspar' Localities: Reported from at least 7 localities in this region. |
| ✪ Kipushite (TL) Formula: (Cu,Zn)5Zn(PO4)2(OH)6 · H2O Type Locality: Colour: Green. Fluorescence: Not fluorescent. Description: The first specimens were recovered in the 1970's but due to too less specimens, the specie was not reported. The same collector ( Joseph Lhoest ) from the early kipushites, briefed J. M. Pendeville about the locality where he found them. Then in 1988, he was succesfull and found the locality and cleaned the pocket out. The specimens were found just underneath shaft 1, along with reichenbachite and pseudomalachite. |
| ⓘ Kyanite Formula: Al2(SiO4)O |
| ⓘ 'Leucoxene' |
| ⓘ Libethenite Formula: Cu2(PO4)(OH) Localities: Habit: pseudo-octahedron, short, stubby, elongated along the a axis. Colour: Dark green to black. Description: The best crystals were found in Area E open pit. |
| ⓘ 'Limonite' |
| ⓘ Linnaeite Formula: Co2+Co3+2S4 |
| ⓘ Löllingite Formula: FeAs2 |
| ⓘ Mackinawite Formula: FeS |
| ⓘ Magnesite Formula: MgCO3 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 7 localities in this region. |
| ⓘ Magnetite var. Mushketovite Formula: Fe2+Fe3+2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 17 localities in this region. |
| ⓘ Marcasite Formula: FeS2 References: |
| ⓘ Margarite Formula: CaAl2(Al2Si2O10)(OH)2 References: (Hanco) Zwaan, J. C., Seifert, Antonín V., Vrána, Stanislav, Laurs, Brendan M., Anckar, Björn, (Skip) Simmons, William B., Falster, Alexander U., Lustenhouwer, Wim J., Muhlmeister, Sam, Koivula, John I., Garcia-Guillerminet, Héja (2005) Emeralds from the Kafubu Area, Zambia. Gems & Gemology, 41 (2) 116-148 doi:10.5741/gems.41.2.116 |
| ⓘ Massicot Formula: PbO |
| ⓘ Masuyite Formula: Pb(UO2)3O3(OH)2 · 3H2O |
| ⓘ Mawsonite Formula: Cu6Fe2SnS8 |
| ⓘ Meionite Formula: Ca4Al6Si6O24CO3 |
| ⓘ Melonite Formula: NiTe2 |
| ⓘ Metatorbernite Formula: Cu(UO2)2(PO4)2 · 8H2O |
| ⓘ 'Mica Group' |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ 'Microlite Group' Formula: A2-mTa2X6-wZ1-n |
| ⓘ Millerite Formula: NiS |
| ⓘ Molybdenite Formula: MoS2 Localities: Reported from at least 8 localities in this region. |
| ⓘ 'Monazite Group' Formula: REE(PO4) |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 17 localities in this region. |
| ⓘ Muscovite var. Fuchsite Formula: K(Al,Cr)3Si3O10(OH)2 |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ Muscovite var. Oellacherite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Copper Formula: Cu Localities: Reported from at least 10 localities in this region. |
| ⓘ Native Gold Formula: Au |
| ⓘ Native Silver Formula: Ag |
| ⓘ Nontronite Formula: Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Palygorskite Formula: ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 |
| ⓘ Phenakite Formula: Be2SiO4 |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 Localities: Reported from at least 6 localities in this region. |
| ⓘ Plancheite Formula: Cu8(Si8O22)(OH)4 · H2O |
| ⓘ 'Plumbomicrolite (of Hogarth 1977)' |
| ⓘ Potassic-chloro-hastingsite Formula: KCa2(Fe2+4Fe3+)(Si6Al2)O22Cl2 |
| ⓘ Pseudomalachite Formula: Cu5(PO4)2(OH)4 Localities: Kipushi Mine, Kipushi, Kipushi Territory, Haut-Katanga, DR Congo Bwana M'Kubwa Mine (Bwana M'Kubina Mine; Bwana Mkubwa Mine), Ndola District, Copperbelt Province, Zambia Nkana Mine, Kitwe, Kitwe District, Copperbelt Province, Zambia Chambishi Mine, Chambishi, Kalulushi District, Copperbelt Province, Zambia |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 23 localities in this region. |
| ⓘ Pyrite var. Bravoite Formula: (Fe,Ni)S2 |
| ⓘ Pyrite var. Cobalt-bearing Pyrite Formula: (Fe,Co)S2 |
| ⓘ 'Pyrobitumen' |
| ⓘ 'Pyrobitumen var. Shungite (1)' |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Reported from at least 7 localities in this region. |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 33 localities in this region. |
| ⓘ Quartz var. Amethyst Formula: SiO2 |
| ⓘ Quartz var. Ametrine Formula: SiO2 References: Ella Masciulli specimensIdentification: Visual Identification |
| ⓘ Quartz var. Microcrystalline quartz |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ✪ Reichenbachite Formula: Cu5(PO4)2(OH)4 Description: The specie was discovered when the kipushite pocked was worked out in 1988/89 by J. M. Pendeville.
The specimens were found just underneath shaft 1, along with kipushite. References: Frost, Ray L., Reddy, B. Jagannadha, Palmer, Sara J., Keeffe, Eloise C. (2011) Structure of selected basic zinc/copper (II) phosphate minerals based upon near-infrared spectroscopy – Implications for hydrogen bonding. Spectrochimica Acta Part A: Molecular and Biomolecular Spectroscopy, 78 (3) 996-1003 doi:10.1016/j.saa.2010.12.014 |
| ✪ Renierite (TL) Formula: (Cu1+,Zn)11Fe4(Ge4+,As5+)2S16 Type Locality: Description: Renierite was found in two germanium-rich zones at Kipushi. The first at a depth between -275 and -400 meters and a second one between the levels -725 and -775. Deeper or between these levels, the mineral was very rare and absent under -975 meters. References: Kamona, A. F., Lévêque, J., Friedrich, G., Haack, U. (1999) Lead isotopes of the carbonate-hosted Kabwe, Tsumeb, and Kipushi Pb-Zn-Cu sulphide deposits in relation to Pan African orogenesis in the Damaran-Lufilian Fold Belt of Central Africa. Mineralium Deposita, 34 (3). 273-283 doi:10.1007/s001260050203 |
| ⓘ Rhodonite Formula: CaMn3Mn[Si5O15] |
| ⓘ 'Rhombohedral Carbonate' Formula: (Ca/Mg/Fe/Mn etc)CO3 |
| ⓘ Riebeckite Formula: ◻Na2(Fe2+3Fe3+2)Si8O22(OH)2 |
| ⓘ Rosasite Formula: (Cu,Zn)2(CO3)(OH)2 |
| ⓘ Roscoelite Formula: KV3+2(AlSi3O10)(OH)2 |
| ⓘ Rutile Formula: TiO2 Localities: Reported from at least 11 localities in this region. |
| ⓘ Samarskite-(Y) Formula: YFe3+Nb2O8 |
| ⓘ 'Saussurite' |
| ⓘ 'Scapolite' |
| ⓘ Scheelite Formula: Ca(WO4) References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: Kamakanga Mine, Kafubu emerald mining district, Lufwanyama District, Copperbelt Province, Zambia Kafubu emerald mining district, Lufwanyama District, Copperbelt Province, Zambia Pirala Mine, Kafubu emerald mining district, Lufwanyama District, Copperbelt Province, Zambia Fwaya-Fwaya mine, Kagem Emerald Mine, Kafubu emerald mining district, Lufwanyama District, Copperbelt Province, Zambia |
| ⓘ Schreyerite Formula: V3+2Ti4+3O9 |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Siegenite Formula: CoNi2S4 |
| ⓘ 'Smectite Group' Formula: A0.3D2-3[T4O10]Z2 · nH2O References: |
| ⓘ Smithsonite Formula: ZnCO3 |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 7 localities in this region. |
| ⓘ Spherocobaltite Formula: CoCO3 References: Torremans, K., Gauquie, J., Boyce, A.J., Barrie, C.D., Dewaele, S., Sikazwe, O., Muchez, Ph. (2013) Remobilisation features and structural control on ore grade distribution at the Konkola stratiform Cu–Co ore deposit, Zambia. Journal of African Earth Sciences, 79. 10-23 doi:10.1016/j.jafrearsci.2012.10.005 |
| ⓘ Stannite Formula: Cu2FeSnS4 |
| ⓘ Stannoidite Formula: Cu+6Cu2+2(Fe2+,Zn)3Sn2S12 |
| ⓘ Staurolite Formula: Fe2+2Al9Si4O23(OH) |
| ⓘ Stromeyerite Formula: AgCuS References: |
| ⓘ Strontianite Formula: SrCO3 |
| ⓘ Sulvanite Formula: Cu3VS4 |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 Localities: Reported from at least 11 localities in this region. |
| ⓘ Tantalite-(Mn) Formula: Mn2+Ta2O6 |
| ⓘ Taramite ? Formula: Na(CaNa)(Mg3Al2)(Al2Si6O22)(OH)2 Description: MacIntyre (2019) lists taramite as an amphibole from the Kansanshi Mine without any supporting analytical data. An association with magnesio-hastingsite and hastinsite would indicate that any taramite root name mineral present would probably ferro/ferri dominant. |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S |
| ⓘ Tennantite-(Zn) Formula: Cu6(Cu4Zn2)As4S12S References: |
| ⓘ Tenorite Formula: CuO |
| ⓘ Tetradymite Formula: Bi2Te2S |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| ⓘ Thorianite Formula: ThO2 |
| ⓘ Thorite Formula: Th(SiO4) |
| ⓘ Titanite Formula: CaTi(SiO4)O |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 |
| ⓘ Topaz var. Imperial Topaz Formula: Al2(SiO4)(F,OH)2 |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z Localities: Reported from at least 8 localities in this region. |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Tsumebite Formula: Pb2Cu(PO4)(SO4)(OH) |
| ⓘ Tungstenite Formula: WS2 References: |
| ⓘ Turquoise Formula: CuAl6(PO4)4(OH)8 · 4H2O |
| ⓘ Uraninite Formula: UO2 Localities: Kapijimpanga (Kampijimpanga), Solwezi District, North-Western Province, Zambia Nkana Mine, Kitwe, Kitwe District, Copperbelt Province, Zambia Mindola pit, Nkana Mine, Kitwe, Kitwe District, Copperbelt Province, Zambia Kansanshi Mine, Solwezi District, North-Western Province, Zambia Musoshi Mine, Musoshi, Kipushi Territory, Haut-Katanga, DR Congo |
| ⓘ Uraninite var. Pitchblende Formula: UO2 |
| ⓘ Vaesite Formula: NiS2 References: |
| ⓘ Valleriite Formula: (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| ⓘ Vanadinite Formula: Pb5(VO4)3Cl |
| ⓘ Vauquelinite Formula: Pb2Cu(CrO4)(PO4)(OH) |
| ✪ Veszelyite Formula: (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O Description: Originally thought to be a new mineral and named "kipushite". After analysis, this turned out to be veszelyite. In 1986, a new phosphate was discovered on another old specimen, which was subsequently named kipushite. (Deliens, 1996) |
| ⓘ Violarite Formula: Fe2+Ni3+2S4 |
| ⓘ Vivianite Formula: Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ 'Wad' |
| ⓘ Willemite Formula: Zn2SiO4 References: |
| ⓘ Witherite Formula: BaCO3 |
| ⓘ Wittichenite Formula: Cu3BiS3 |
| ⓘ Woodwardite Formula: Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| ⓘ Wulfenite Formula: Pb(MoO4) |
| ⓘ Wurtzite Formula: (Zn,Fe)S |
| ⓘ 'Xenotime' |
| ⓘ Yakhontovite Formula: (Ca,Na)0.5(Cu,Fe,Mg)2(Si4O10)(OH)2 · 3H2O |
| ⓘ Zincite Formula: ZnO References: |
| ⓘ Zincobriartite (TL) Formula: Cu2(Zn,Fe)(Ge,Ga)S4 Type Locality: |
| ⓘ 'Zinnwaldite' References: |
| ⓘ Zircon Formula: Zr(SiO4) Localities: Reported from at least 7 localities in this region. |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Djurleite | 2.BA.05 | Cu31S16 |
| ⓘ | Geerite | 2.BA.05 | Cu8S5 |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Stromeyerite | 2.BA.40 | AgCuS |
| ⓘ | Cobaltpentlandite | 2.BB.15 | Co9S8 |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Betekhtinite | 2.BE.05 | Pb2(Cu,Fe)22-24S15 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Gallite (TL) | 2.CB.10a | CuGaS2 |
| ⓘ | Idaite | 2.CB.15a | Cu5FeS6 |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Stannoidite | 2.CB.15c | Cu+6Cu2+2(Fe2+,Zn)3Sn2S12 |
| ⓘ | Mawsonite | 2.CB.20 | Cu6Fe2SnS8 |
| ⓘ | Germanite | 2.CB.30 | Cu13Fe2Ge2S16 |
| ⓘ | Germanocolusite | 2.CB.30 | Cu26V2(Ge,As)6S32 |
| ⓘ | Renierite (TL) | 2.CB.35a | (Cu1+,Zn)11Fe4(Ge4+,As5+)2S16 |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Wurtzite | 2.CB.45 | (Zn,Fe)S |
| ⓘ | Sulvanite | 2.CB.70 | Cu3VS4 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Mackinawite | 2.CC.25 | FeS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Carrollite | 2.DA.05 | CuCo2S4 |
| ⓘ | Linnaeite | 2.DA.05 | Co2+Co3+2S4 |
| ⓘ | Siegenite | 2.DA.05 | CoNi2S4 |
| ⓘ | Violarite | 2.DA.05 | Fe2+Ni3+2S4 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Tetradymite | 2.DC.05 | Bi2Te2S |
| ⓘ | Melonite | 2.EA.20 | NiTe2 |
| ⓘ | Drysdallite (TL) | 2.EA.30 | MoSe2 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Tungstenite | 2.EA.30 | WS2 |
| ⓘ | Pyrite var. Bravoite | 2.EB.05a | (Fe,Ni)S2 |
| ⓘ | Cattierite | 2.EB.05a | CoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Vaesite | 2.EB.05a | NiS2 |
| ⓘ | Pyrite var. Cobalt-bearing Pyrite | 2.EB.05a | (Fe,Co)S2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Valleriite | 2.FD.30 | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| ⓘ | Wittichenite | 2.GA.20 | Cu3BiS3 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Tennantite-(Zn) | 2.GB.05 | Cu6(Cu4Zn2)As4S12S |
| ⓘ | Emplectite | 2.HA.05 | CuBiS2 |
| ⓘ | Aikinite | 2.HB.05a | CuPbBiS3 |
| ⓘ | Cosalite | 2.JB.10 | Pb2Bi2S5 |
| ⓘ | Enargite | 2.KA.05 | Cu3AsS4 |
| ⓘ | Briartite (TL) | 2.KA.10 | Cu2FeGeS4 |
| ⓘ | Zincobriartite (TL) | 2.KA.10 | Cu2(Zn,Fe)(Ge,Ga)S4 |
| Group 3 - Halides | |||
| ⓘ | Halite | 3.AA.20 | NaCl |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Atacamite | 3.DA.10a | Cu2(OH)3Cl |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | 'Microlite Group' | 4.00. | A2-mTa2X6-wZ1-n |
| ⓘ | Cuprite var. Chalcotrichite | 4.AA.10 | Cu2O |
| ⓘ | 4.AA.10 | Cu2O | |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Zincite | 4.AB.20 | ZnO |
| ⓘ | Massicot | 4.AC.25 | PbO |
| ⓘ | Chrysoberyl | 4.BA.05 | BeAl2O4 |
| ⓘ | Gahnite | 4.BB.05 | ZnAl2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | var. Mushketovite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Hematite var. Martite | 4.CB.05 | Fe2O3 |
| ⓘ | Schreyerite | 4.CB.35 | V3+2Ti4+3O9 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Ametrine | 4.DA.05 | SiO2 |
| ⓘ | var. Microcrystalline quartz | 4.DA.05 | SiO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Samarskite-(Y) | 4.DB.25 | YFe3+Nb2O8 |
| ⓘ | Columbite-(Mn) | 4.DB.35 | Mn2+Nb2O6 |
| ⓘ | Tantalite-(Mn) | 4.DB.35 | Mn2+Ta2O6 |
| ⓘ | Brookite | 4.DD.10 | TiO2 |
| ⓘ | Brannerite | 4.DH.05 | UTi2O6 |
| ⓘ | 'Plumbomicrolite (of Hogarth 1977)' | 4.DH.15 | |
| ⓘ | Uraninite var. Pitchblende | 4.DL.05 | UO2 |
| ⓘ | Thorianite | 4.DL.05 | ThO2 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | Diaspore | 4.FD.10 | AlO(OH) |
| ⓘ | Heterogenite | 4.FE.20 | Co3+O(OH) |
| ⓘ | Masuyite | 4.GB.35 | Pb(UO2)3O3(OH)2 · 3H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Spherocobaltite | 5.AB.05 | CoCO3 |
| ⓘ | Calcite var. Iron-bearing Calcite | 5.AB.05 | (Ca,Fe)CO3 |
| ⓘ | var. Zinc-bearing Calcite | 5.AB.05 | (Ca,Zn)CO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | var. Zinc-bearing Dolomite | 5.AB.10 | Ca(Mg,Zn)(CO3)2 |
| ⓘ | var. Iron-bearing Dolomite | 5.AB.10 | Ca(Mg,Fe)(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Strontianite | 5.AB.15 | SrCO3 |
| ⓘ | Witherite | 5.AB.15 | BaCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Rosasite | 5.BA.10 | (Cu,Zn)2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Beaverite-(Cu) | 7.BC.10 | Pb(Fe3+2Cu)(SO4)2(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Goslarite | 7.CB.40 | ZnSO4 · 7H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Devilline | 7.DD.30 | CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Woodwardite | 7.DD.35 | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| ⓘ | Vauquelinite | 7.FC.05 | Pb2Cu(CrO4)(PO4)(OH) |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Adamite | 8.BB.30 | Zn2(AsO4)(OH) |
| ⓘ | Libethenite | 8.BB.30 | Cu2(PO4)(OH) |
| ⓘ | Pseudomalachite | 8.BD.05 | Cu5(PO4)2(OH)4 |
| ⓘ | Reichenbachite | 8.BD.05 | Cu5(PO4)2(OH)4 |
| ⓘ | Cornetite | 8.BE.15 | Cu3(PO4)(OH)3 |
| ⓘ | Tsumebite | 8.BG.05 | Pb2Cu(PO4)(SO4)(OH) |
| ⓘ | Descloizite var. Copper-bearing Descloizite | 8.BH.40 | Pb(Zn,Cu)VO4OH |
| ⓘ | 8.BH.40 | PbZn(VO4)(OH) | |
| ⓘ | Beudantite | 8.BL.05 | PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Vanadinite | 8.BN.05 | Pb5(VO4)3Cl |
| ⓘ | Vivianite | 8.CE.40 | Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ | Turquoise | 8.DD.15 | CuAl6(PO4)4(OH)8 · 4H2O |
| ⓘ | Kipushite (TL) | 8.DE. | (Cu,Zn)5Zn(PO4)2(OH)6 · H2O |
| ⓘ | Veszelyite | 8.DE.30 | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| ⓘ | Metatorbernite | 8.EB.10 | Cu(UO2)2(PO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Chrysotile | 9.00. | Mg3(Si2O5)(OH)4 |
| ⓘ | Phenakite | 9.AA.05 | Be2SiO4 |
| ⓘ | Willemite | 9.AA.05 | Zn2SiO4 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Coffinite | 9.AD.30 | U(SiO4) · nH2O |
| ⓘ | Thorite | 9.AD.30 | Th(SiO4) |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | var. Imperial Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Fluorellestadite | 9.AH.25 | Ca5(SiO4)1.5(SO4)1.5F |
| ⓘ | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | var. Emerald | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Cordierite | 9.CJ.10 | Mg2Al4Si5O18 |
| ⓘ | Dioptase | 9.CJ.30 | CuSiO3 · H2O |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Cummingtonite | 9.DE.05 | ◻Mg2Mg5(Si8O22)(OH)2 |
| ⓘ | Grunerite | 9.DE.05 | ◻Fe2+2Fe2+5(Si8O22)(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Hastingsite | 9.DE.15 | NaCa2(Fe2+4Fe3+)(Si6Al2)O22(OH)2 |
| ⓘ | Kaersutite | 9.DE.15 | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| ⓘ | Potassic-chloro-hastingsite | 9.DE.15 | KCa2(Fe2+4Fe3+)(Si6Al2)O22Cl2 |
| ⓘ | Taramite ? | 9.DE.20 | Na(CaNa)(Mg3Al2)(Al2Si6O22)(OH)2 |
| ⓘ | Arfvedsonite | 9.DE.25 | NaNa2(Fe2+4Fe3+)Si8O22(OH)2 |
| ⓘ | Riebeckite | 9.DE.25 | ◻Na2(Fe2+3Fe3+2)Si8O22(OH)2 |
| ⓘ | Rhodonite | 9.DK.05 | CaMn3Mn[Si5O15] |
| ⓘ | Plancheite | 9.DP.55 | Cu8(Si8O22)(OH)4 · H2O |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite var. Fuchsite | 9.EC.15 | K(Al,Cr)3Si3O10(OH)2 |
| ⓘ | var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Roscoelite | 9.EC.15 | KV3+2(AlSi3O10)(OH)2 |
| ⓘ | Muscovite var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Oellacherite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Margarite | 9.EC.30 | CaAl2(Al2Si2O10)(OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Nontronite | 9.EC.40 | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ | Yakhontovite | 9.EC.40 | (Ca,Na)0.5(Cu,Fe,Mg)2(Si4O10)(OH)2 · 3H2O |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | var. Pennine | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | var. Talc-chlorite | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Amesite | 9.ED.15 | Mg2Al(AlSiO5)(OH)4 |
| ⓘ | Cronstedtite | 9.ED.15 | Fe2+2Fe3+((Si,Fe3+)2O5)(OH)4 |
| ⓘ | Allophane | 9.ED.20 | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Palygorskite | 9.EE.20 | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Meionite | 9.FB.15 | Ca4Al6Si6O24CO3 |
| Unclassified | |||
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Bastnäsite' | - | (Ce/Nd/Y/REE)(CO3)F |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Clay minerals' | - | |
| ⓘ | 'Davidite' | - | |
| ⓘ | 'Ellestadite' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Glauconite' | - | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Fluor-uvite-Uvite Series' | - | |
| ⓘ | 'Wad' | - | |
| ⓘ | 'Zinnwaldite' | - | |
| ⓘ | 'Leucoxene' | - | |
| ⓘ | 'Xenotime' | - | |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Calamine' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Pyrobitumen var. Shungite (1)' | - | |
| ⓘ | 'Smectite Group' | - | A0.3D2-3[T4O10]Z2 · nH2O |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Saussurite' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Pyrobitumen' | - | |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ | 'Rhombohedral Carbonate' | - | (Ca/Mg/Fe/Mn etc)CO3 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Adamite | Zn2(AsO4)(OH) |
| H | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| H | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| H | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| H | ⓘ Atacamite | Cu2(OH)3Cl |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| H | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| H | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Coffinite | U(SiO4) · nH2O |
| H | ⓘ Cornetite | Cu3(PO4)(OH)3 |
| H | ⓘ Cronstedtite | Fe22+Fe3+((Si,Fe3+)2O5)(OH)4 |
| H | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| H | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| H | ⓘ Descloizite | PbZn(VO4)(OH) |
| H | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Diaspore | AlO(OH) |
| H | ⓘ Dioptase | CuSiO3 · H2O |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Ellestadite | |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| H | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Goslarite | ZnSO4 · 7H2O |
| H | ⓘ Grunerite | ◻Fe22+Fe52+(Si8O22)(OH)2 |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Heterogenite | Co3+O(OH) |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Kipushite | (Cu,Zn)5Zn(PO4)2(OH)6 · H2O |
| H | ⓘ Libethenite | Cu2(PO4)(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| H | ⓘ Masuyite | Pb(UO2)3O3(OH)2 · 3H2O |
| H | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| H | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| H | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| H | ⓘ Reichenbachite | Cu5(PO4)2(OH)4 |
| H | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| H | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| H | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| H | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| H | ⓘ Fluor-uvite-Uvite Series | |
| H | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| H | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| H | ⓘ Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| H | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| H | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| H | ⓘ Yakhontovite | (Ca,Na)0.5(Cu,Fe,Mg)2(Si4O10)(OH)2 · 3H2O |
| H | ⓘ Zinnwaldite | |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Taramite | Na(CaNa)(Mg3Al2)(Al2Si6O22)(OH)2 |
| H | ⓘ Topaz var. Imperial Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Muscovite var. Oellacherite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| H | ⓘ Clinochlore var. Talc-chlorite | Mg5Al(AlSi3O10)(OH)8 |
| Li | Lithium | |
| Li | ⓘ Zinnwaldite | |
| Be | Beryllium | |
| Be | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Chrysoberyl | BeAl2O4 |
| Be | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Be | ⓘ Phenakite | Be2SiO4 |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| B | ⓘ Fluor-uvite-Uvite Series | |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| C | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Spherocobaltite | CoCO3 |
| C | ⓘ Strontianite | SrCO3 |
| C | ⓘ Witherite | BaCO3 |
| C | ⓘ Dolomite var. Zinc-bearing Dolomite | Ca(Mg,Zn)(CO3)2 |
| C | ⓘ Calcite var. Iron-bearing Calcite | (Ca,Fe)CO3 |
| C | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| C | ⓘ Calcite var. Zinc-bearing Calcite | (Ca,Zn)CO3 |
| C | ⓘ Rhombohedral Carbonate | (Ca/Mg/Fe/Mn etc)CO3 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Adamite | Zn2(AsO4)(OH) |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| O | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| O | ⓘ Atacamite | Cu2(OH)3Cl |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| O | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| O | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| O | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Brannerite | UTi2O6 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Brookite | TiO2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| O | ⓘ Chrysoberyl | BeAl2O4 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Coffinite | U(SiO4) · nH2O |
| O | ⓘ Cordierite | Mg2Al4Si5O18 |
| O | ⓘ Cornetite | Cu3(PO4)(OH)3 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Cronstedtite | Fe22+Fe3+((Si,Fe3+)2O5)(OH)4 |
| O | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| O | ⓘ Descloizite | PbZn(VO4)(OH) |
| O | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Diaspore | AlO(OH) |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dioptase | CuSiO3 · H2O |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Ellestadite | |
| O | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Fluorellestadite | Ca5(SiO4)1.5(SO4)1.5F |
| O | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| O | ⓘ Gahnite | ZnAl2O4 |
| O | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Goslarite | ZnSO4 · 7H2O |
| O | ⓘ Grunerite | ◻Fe22+Fe52+(Si8O22)(OH)2 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Heterogenite | Co3+O(OH) |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kipushite | (Cu,Zn)5Zn(PO4)2(OH)6 · H2O |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Libethenite | Cu2(PO4)(OH) |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| O | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| O | ⓘ Hematite var. Martite | Fe2O3 |
| O | ⓘ Massicot | PbO |
| O | ⓘ Masuyite | Pb(UO2)3O3(OH)2 · 3H2O |
| O | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| O | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| O | ⓘ Phenakite | Be2SiO4 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Uraninite var. Pitchblende | UO2 |
| O | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| O | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Reichenbachite | Cu5(PO4)2(OH)4 |
| O | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| O | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| O | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| O | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Schreyerite | V23+Ti34+O9 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Spherocobaltite | CoCO3 |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Strontianite | SrCO3 |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Thorianite | ThO2 |
| O | ⓘ Thorite | Th(SiO4) |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| O | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Fluor-uvite-Uvite Series | |
| O | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| O | ⓘ Vanadinite | Pb5(VO4)3Cl |
| O | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| O | ⓘ Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| O | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| O | ⓘ Willemite | Zn2SiO4 |
| O | ⓘ Witherite | BaCO3 |
| O | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Yakhontovite | (Ca,Na)0.5(Cu,Fe,Mg)2(Si4O10)(OH)2 · 3H2O |
| O | ⓘ Zincite | ZnO |
| O | ⓘ Zinnwaldite | |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Taramite | Na(CaNa)(Mg3Al2)(Al2Si6O22)(OH)2 |
| O | ⓘ Dolomite var. Zinc-bearing Dolomite | Ca(Mg,Zn)(CO3)2 |
| O | ⓘ Quartz var. Ametrine | SiO2 |
| O | ⓘ Topaz var. Imperial Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Magnetite var. Mushketovite | Fe2+Fe23+O4 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Calcite var. Iron-bearing Calcite | (Ca,Fe)CO3 |
| O | ⓘ Muscovite var. Oellacherite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| O | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Potassic-chloro-hastingsite | KCa2(Fe42+Fe3+)(Si6Al2)O22Cl2 |
| O | ⓘ Calcite var. Zinc-bearing Calcite | (Ca,Zn)CO3 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| O | ⓘ Rhombohedral Carbonate | (Ca/Mg/Fe/Mn etc)CO3 |
| O | ⓘ Clinochlore var. Talc-chlorite | Mg5Al(AlSi3O10)(OH)8 |
| F | Fluorine | |
| F | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Ellestadite | |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorellestadite | Ca5(SiO4)1.5(SO4)1.5F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Fluor-uvite-Uvite Series | |
| F | ⓘ Zinnwaldite | |
| F | ⓘ Topaz var. Imperial Topaz | Al2(SiO4)(F,OH)2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Halite | NaCl |
| Na | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Na | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Yakhontovite | (Ca,Na)0.5(Cu,Fe,Mg)2(Si4O10)(OH)2 · 3H2O |
| Na | ⓘ Taramite | Na(CaNa)(Mg3Al2)(Al2Si6O22)(OH)2 |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Cordierite | Mg2Al4Si5O18 |
| Mg | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Mg | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Fluor-uvite-Uvite Series | |
| Mg | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Mg | ⓘ Yakhontovite | (Ca,Na)0.5(Cu,Fe,Mg)2(Si4O10)(OH)2 · 3H2O |
| Mg | ⓘ Taramite | Na(CaNa)(Mg3Al2)(Al2Si6O22)(OH)2 |
| Mg | ⓘ Dolomite var. Zinc-bearing Dolomite | Ca(Mg,Zn)(CO3)2 |
| Mg | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Mg | ⓘ Rhombohedral Carbonate | (Ca/Mg/Fe/Mn etc)CO3 |
| Mg | ⓘ Clinochlore var. Talc-chlorite | Mg5Al(AlSi3O10)(OH)8 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Al | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Chrysoberyl | BeAl2O4 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Cordierite | Mg2Al4Si5O18 |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Diaspore | AlO(OH) |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Al | ⓘ Gahnite | ZnAl2O4 |
| Al | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Al | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Al | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| Al | ⓘ Fluor-uvite-Uvite Series | |
| Al | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Al | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| Al | ⓘ Zinnwaldite | |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Taramite | Na(CaNa)(Mg3Al2)(Al2Si6O22)(OH)2 |
| Al | ⓘ Topaz var. Imperial Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Muscovite var. Oellacherite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Potassic-chloro-hastingsite | KCa2(Fe42+Fe3+)(Si6Al2)O22Cl2 |
| Al | ⓘ Clinochlore var. Talc-chlorite | Mg5Al(AlSi3O10)(OH)8 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Si | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Coffinite | U(SiO4) · nH2O |
| Si | ⓘ Cordierite | Mg2Al4Si5O18 |
| Si | ⓘ Cronstedtite | Fe22+Fe3+((Si,Fe3+)2O5)(OH)4 |
| Si | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dioptase | CuSiO3 · H2O |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Ellestadite | |
| Si | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Fluorellestadite | Ca5(SiO4)1.5(SO4)1.5F |
| Si | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Si | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Si | ⓘ Grunerite | ◻Fe22+Fe52+(Si8O22)(OH)2 |
| Si | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Si | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Si | ⓘ Phenakite | Be2SiO4 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Si | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| Si | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Thorite | Th(SiO4) |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Fluor-uvite-Uvite Series | |
| Si | ⓘ Willemite | Zn2SiO4 |
| Si | ⓘ Yakhontovite | (Ca,Na)0.5(Cu,Fe,Mg)2(Si4O10)(OH)2 · 3H2O |
| Si | ⓘ Zinnwaldite | |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Taramite | Na(CaNa)(Mg3Al2)(Al2Si6O22)(OH)2 |
| Si | ⓘ Quartz var. Ametrine | SiO2 |
| Si | ⓘ Topaz var. Imperial Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Muscovite var. Oellacherite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Potassic-chloro-hastingsite | KCa2(Fe42+Fe3+)(Si6Al2)O22Cl2 |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Clinochlore var. Talc-chlorite | Mg5Al(AlSi3O10)(OH)8 |
| P | Phosphorus | |
| P | ⓘ Cornetite | Cu3(PO4)(OH)3 |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Kipushite | (Cu,Zn)5Zn(PO4)2(OH)6 · H2O |
| P | ⓘ Libethenite | Cu2(PO4)(OH) |
| P | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Reichenbachite | Cu5(PO4)2(OH)4 |
| P | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| P | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| P | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| P | ⓘ Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| P | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Aikinite | CuPbBiS3 |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| S | ⓘ Betekhtinite | Pb2(Cu,Fe)22-24S15 |
| S | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| S | ⓘ Briartite | Cu2FeGeS4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Carrollite | CuCo2S4 |
| S | ⓘ Cattierite | CoS2 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Cobaltpentlandite | Co9S8 |
| S | ⓘ Cosalite | Pb2Bi2S5 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Djurleite | Cu31S16 |
| S | ⓘ Ellestadite | |
| S | ⓘ Emplectite | CuBiS2 |
| S | ⓘ Enargite | Cu3AsS4 |
| S | ⓘ Fluorellestadite | Ca5(SiO4)1.5(SO4)1.5F |
| S | ⓘ Galena | PbS |
| S | ⓘ Gallite | CuGaS2 |
| S | ⓘ Geerite | Cu8S5 |
| S | ⓘ Germanite | Cu13Fe2Ge2S16 |
| S | ⓘ Germanocolusite | Cu26V2(Ge,As)6S32 |
| S | ⓘ Goslarite | ZnSO4 · 7H2O |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Idaite | Cu5FeS6 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Linnaeite | Co2+Co23+S4 |
| S | ⓘ Mackinawite | FeS |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Mawsonite | Cu6Fe2SnS8 |
| S | ⓘ Millerite | NiS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Renierite | (Cu1+,Zn)11Fe4(Ge4+,As5+)2S16 |
| S | ⓘ Siegenite | CoNi2S4 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stannite | Cu2FeSnS4 |
| S | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| S | ⓘ Stromeyerite | AgCuS |
| S | ⓘ Sulvanite | Cu3VS4 |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetradymite | Bi2Te2S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| S | ⓘ Tungstenite | WS2 |
| S | ⓘ Vaesite | NiS2 |
| S | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| S | ⓘ Violarite | Fe2+Ni23+S4 |
| S | ⓘ Wittichenite | Cu3BiS3 |
| S | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| S | ⓘ Wurtzite | (Zn,Fe)S |
| S | ⓘ Pyrite var. Cobalt-bearing Pyrite | (Fe,Co)S2 |
| S | ⓘ Zincobriartite | Cu2(Zn,Fe)(Ge,Ga)S4 |
| S | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| Cl | Chlorine | |
| Cl | ⓘ Atacamite | Cu2(OH)3Cl |
| Cl | ⓘ Halite | NaCl |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cl | ⓘ Potassic-chloro-hastingsite | KCa2(Fe42+Fe3+)(Si6Al2)O22Cl2 |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| K | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| K | ⓘ Zinnwaldite | |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite var. Oellacherite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Potassic-chloro-hastingsite | KCa2(Fe42+Fe3+)(Si6Al2)O22Cl2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Ellestadite | |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorellestadite | Ca5(SiO4)1.5(SO4)1.5F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Ca | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Ca | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Fluor-uvite-Uvite Series | |
| Ca | ⓘ Yakhontovite | (Ca,Na)0.5(Cu,Fe,Mg)2(Si4O10)(OH)2 · 3H2O |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Taramite | Na(CaNa)(Mg3Al2)(Al2Si6O22)(OH)2 |
| Ca | ⓘ Dolomite var. Zinc-bearing Dolomite | Ca(Mg,Zn)(CO3)2 |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Calcite var. Iron-bearing Calcite | (Ca,Fe)CO3 |
| Ca | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Ca | ⓘ Potassic-chloro-hastingsite | KCa2(Fe42+Fe3+)(Si6Al2)O22Cl2 |
| Ca | ⓘ Calcite var. Zinc-bearing Calcite | (Ca,Zn)CO3 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ca | ⓘ Rhombohedral Carbonate | (Ca/Mg/Fe/Mn etc)CO3 |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brannerite | UTi2O6 |
| Ti | ⓘ Brookite | TiO2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Schreyerite | V23+Ti34+O9 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| V | Vanadium | |
| V | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| V | ⓘ Descloizite | PbZn(VO4)(OH) |
| V | ⓘ Germanocolusite | Cu26V2(Ge,As)6S32 |
| V | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| V | ⓘ Schreyerite | V23+Ti34+O9 |
| V | ⓘ Sulvanite | Cu3VS4 |
| V | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cr | Chromium | |
| Cr | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Cr | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| Mn | Manganese | |
| Mn | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Mn | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Rhombohedral Carbonate | (Ca/Mg/Fe/Mn etc)CO3 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Fe | ⓘ Betekhtinite | Pb2(Cu,Fe)22-24S15 |
| Fe | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| Fe | ⓘ Briartite | Cu2FeGeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Cronstedtite | Fe22+Fe3+((Si,Fe3+)2O5)(OH)4 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Germanite | Cu13Fe2Ge2S16 |
| Fe | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Grunerite | ◻Fe22+Fe52+(Si8O22)(OH)2 |
| Fe | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Idaite | Cu5FeS6 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Mackinawite | FeS |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Hematite var. Martite | Fe2O3 |
| Fe | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Fe | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Renierite | (Cu1+,Zn)11Fe4(Ge4+,As5+)2S16 |
| Fe | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| Fe | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Fe | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Fe | ⓘ Violarite | Fe2+Ni23+S4 |
| Fe | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| Fe | ⓘ Wurtzite | (Zn,Fe)S |
| Fe | ⓘ Yakhontovite | (Ca,Na)0.5(Cu,Fe,Mg)2(Si4O10)(OH)2 · 3H2O |
| Fe | ⓘ Zinnwaldite | |
| Fe | ⓘ Magnetite var. Mushketovite | Fe2+Fe23+O4 |
| Fe | ⓘ Calcite var. Iron-bearing Calcite | (Ca,Fe)CO3 |
| Fe | ⓘ Pyrite var. Cobalt-bearing Pyrite | (Fe,Co)S2 |
| Fe | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Fe | ⓘ Potassic-chloro-hastingsite | KCa2(Fe42+Fe3+)(Si6Al2)O22Cl2 |
| Fe | ⓘ Zincobriartite | Cu2(Zn,Fe)(Ge,Ga)S4 |
| Fe | ⓘ Rhombohedral Carbonate | (Ca/Mg/Fe/Mn etc)CO3 |
| Co | Cobalt | |
| Co | ⓘ Carrollite | CuCo2S4 |
| Co | ⓘ Cattierite | CoS2 |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Cobaltpentlandite | Co9S8 |
| Co | ⓘ Heterogenite | Co3+O(OH) |
| Co | ⓘ Linnaeite | Co2+Co23+S4 |
| Co | ⓘ Siegenite | CoNi2S4 |
| Co | ⓘ Spherocobaltite | CoCO3 |
| Co | ⓘ Pyrite var. Cobalt-bearing Pyrite | (Fe,Co)S2 |
| Ni | Nickel | |
| Ni | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| Ni | ⓘ Melonite | NiTe2 |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Siegenite | CoNi2S4 |
| Ni | ⓘ Vaesite | NiS2 |
| Ni | ⓘ Violarite | Fe2+Ni23+S4 |
| Cu | Copper | |
| Cu | ⓘ Aikinite | CuPbBiS3 |
| Cu | ⓘ Atacamite | Cu2(OH)3Cl |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Cu | ⓘ Betekhtinite | Pb2(Cu,Fe)22-24S15 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Briartite | Cu2FeGeS4 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Carrollite | CuCo2S4 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Cornetite | Cu3(PO4)(OH)3 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Dioptase | CuSiO3 · H2O |
| Cu | ⓘ Djurleite | Cu31S16 |
| Cu | ⓘ Emplectite | CuBiS2 |
| Cu | ⓘ Enargite | Cu3AsS4 |
| Cu | ⓘ Gallite | CuGaS2 |
| Cu | ⓘ Geerite | Cu8S5 |
| Cu | ⓘ Germanite | Cu13Fe2Ge2S16 |
| Cu | ⓘ Germanocolusite | Cu26V2(Ge,As)6S32 |
| Cu | ⓘ Idaite | Cu5FeS6 |
| Cu | ⓘ Kipushite | (Cu,Zn)5Zn(PO4)2(OH)6 · H2O |
| Cu | ⓘ Libethenite | Cu2(PO4)(OH) |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Cu | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| Cu | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| Cu | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| Cu | ⓘ Reichenbachite | Cu5(PO4)2(OH)4 |
| Cu | ⓘ Renierite | (Cu1+,Zn)11Fe4(Ge4+,As5+)2S16 |
| Cu | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Cu | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Cu | ⓘ Stromeyerite | AgCuS |
| Cu | ⓘ Sulvanite | Cu3VS4 |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| Cu | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| Cu | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Cu | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| Cu | ⓘ Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| Cu | ⓘ Wittichenite | Cu3BiS3 |
| Cu | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| Cu | ⓘ Yakhontovite | (Ca,Na)0.5(Cu,Fe,Mg)2(Si4O10)(OH)2 · 3H2O |
| Cu | ⓘ Zincobriartite | Cu2(Zn,Fe)(Ge,Ga)S4 |
| Cu | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| Zn | Zinc | |
| Zn | ⓘ Adamite | Zn2(AsO4)(OH) |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| Zn | ⓘ Descloizite | PbZn(VO4)(OH) |
| Zn | ⓘ Gahnite | ZnAl2O4 |
| Zn | ⓘ Goslarite | ZnSO4 · 7H2O |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Kipushite | (Cu,Zn)5Zn(PO4)2(OH)6 · H2O |
| Zn | ⓘ Renierite | (Cu1+,Zn)11Fe4(Ge4+,As5+)2S16 |
| Zn | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Zn | ⓘ Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| Zn | ⓘ Willemite | Zn2SiO4 |
| Zn | ⓘ Wurtzite | (Zn,Fe)S |
| Zn | ⓘ Zincite | ZnO |
| Zn | ⓘ Dolomite var. Zinc-bearing Dolomite | Ca(Mg,Zn)(CO3)2 |
| Zn | ⓘ Calcite var. Zinc-bearing Calcite | (Ca,Zn)CO3 |
| Zn | ⓘ Zincobriartite | Cu2(Zn,Fe)(Ge,Ga)S4 |
| Zn | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| Ga | Gallium | |
| Ga | ⓘ Gallite | CuGaS2 |
| Ga | ⓘ Zincobriartite | Cu2(Zn,Fe)(Ge,Ga)S4 |
| Ge | Germanium | |
| Ge | ⓘ Briartite | Cu2FeGeS4 |
| Ge | ⓘ Germanite | Cu13Fe2Ge2S16 |
| Ge | ⓘ Germanocolusite | Cu26V2(Ge,As)6S32 |
| Ge | ⓘ Renierite | (Cu1+,Zn)11Fe4(Ge4+,As5+)2S16 |
| Ge | ⓘ Zincobriartite | Cu2(Zn,Fe)(Ge,Ga)S4 |
| As | Arsenic | |
| As | ⓘ Adamite | Zn2(AsO4)(OH) |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Enargite | Cu3AsS4 |
| As | ⓘ Germanocolusite | Cu26V2(Ge,As)6S32 |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Renierite | (Cu1+,Zn)11Fe4(Ge4+,As5+)2S16 |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| Se | Selenium | |
| Se | ⓘ Drysdallite | MoSe2 |
| Sr | Strontium | |
| Sr | ⓘ Strontianite | SrCO3 |
| Y | Yttrium | |
| Y | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Y | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Nb | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Mo | Molybdenum | |
| Mo | ⓘ Drysdallite | MoSe2 |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Stromeyerite | AgCuS |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| Sn | Tin | |
| Sn | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sn | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Sb | Antimony | |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Te | Tellurium | |
| Te | ⓘ Melonite | NiTe2 |
| Te | ⓘ Tetradymite | Bi2Te2S |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Witherite | BaCO3 |
| Ce | Cerium | |
| Ce | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Nd | Neodymium | |
| Nd | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Ta | Tantalum | |
| Ta | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
| Ta | ⓘ Microlite Group | A2-mTa2X6-wZ1-n |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Tungstenite | WS2 |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Aikinite | CuPbBiS3 |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Pb | ⓘ Betekhtinite | Pb2(Cu,Fe)22-24S15 |
| Pb | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Cosalite | Pb2Bi2S5 |
| Pb | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| Pb | ⓘ Descloizite | PbZn(VO4)(OH) |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Massicot | PbO |
| Pb | ⓘ Masuyite | Pb(UO2)3O3(OH)2 · 3H2O |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| Pb | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Pb | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Bi | Bismuth | |
| Bi | ⓘ Aikinite | CuPbBiS3 |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Cosalite | Pb2Bi2S5 |
| Bi | ⓘ Emplectite | CuBiS2 |
| Bi | ⓘ Tetradymite | Bi2Te2S |
| Bi | ⓘ Wittichenite | Cu3BiS3 |
| Th | Thorium | |
| Th | ⓘ Thorianite | ThO2 |
| Th | ⓘ Thorite | Th(SiO4) |
| U | Uranium | |
| U | ⓘ Brannerite | UTi2O6 |
| U | ⓘ Coffinite | U(SiO4) · nH2O |
| U | ⓘ Masuyite | Pb(UO2)3O3(OH)2 · 3H2O |
| U | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| U | ⓘ Uraninite var. Pitchblende | UO2 |
| U | ⓘ Uraninite | UO2 |
Geochronology
Mineralization age: Neoproterozoic to Silurian : 741 ± 1 Ma to 424 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | ||||||
|---|---|---|---|---|---|---|---|
| Phanerozoic | |||||||
| Paleozoic | |||||||
| Silurian | |||||||
| Ludlow |
| ||||||
| Cambrian | |||||||
| Furongian |
| ||||||
| Miaolingian |
| ||||||
| Cambrian Series 2 |
| ||||||
| Precambrian | |||||||
| Proterozoic | |||||||
| Neoproterozoic | |||||||
| Ediacaran |
| ||||||
| Tonian |
| ||||||
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Localities in this Region
- Haut-Katanga
- Kambove Territory
- Kipushi Territory
- Sakania Territory
- Zambezi Region
- Central Province
- Kapiri Mposhi District
- Mumbwa District
- Ngabwe District
- Copperbelt Province
- Chibuluma Mines
- Chililabombwe District
- Chingola District
- Kalulushi District
- Kitwe District
- Luanshya District
- Copperbelt Province
- Luanshya District
- Lufwanyama District
- Mufulira District
- Ndola District
- North-Western Province
- Kabompo District
- Kalumbila District
- Enterprise deposit
- Hope Mine
- Karengerenge village
- Lubwe
- Lumwana Copper Project
- Sentinel mine
- Kasempa District
- Mufumbwe District
- Mushindamo District
- Mwinilunga District
- Solwezi District
Other Regions, Features and Areas that Intersect
AfricaContinent
African PlateTectonic Plate
DR Congo
- Haut-Katanga
- Katanga Copper CrescentMining Area
Zambia
- Copperbelt Province
- Chibuluma MinesMining Area
- Lufwanyama District
- Kafubu emerald mining districtMining District
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
[1]Fu, Tian-Yao; Li, Wen-Bo; Wang, Zheng-Hua; Bi, Heng-Zhe; Wang, Bao-Xin (2026) Stratigraphic control on Co mineralization heterogeneity in sediment-hosted stratiform Cu-Co deposits: evidence from the Kamoya Cu-Co deposit, Democratic Republic of Congo (DRC). Ore Geology Reviews, 194. p.107341. doi:10.1016/j.oregeorev.2026.107341
Quick NavTopCommoditiesMineral ListRock TypesGeochronologyFossilsLocalities in RegionOther RegionsReferences
Kipushi Mine, Kipushi, Kipushi Territory, Haut-Katanga, DR Congo