Dumfries and Galloway, Scotland, UKi
| Regional Level Types | |
|---|---|
| Dumfries and Galloway | Council Area |
| Scotland | Country |
| UK | Country |
This page is currently not sponsored. Click here to sponsor this page.
Area:
6,426 km2
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Dumfries | 33,280 (2017) |
| Stranraer | 10,510 (2017) |
| Annan | 8,920 (2017) |
| Locharbriggs | 5,960 (2017) |
| Lockerbie | 4,290 (2017) |
| Dalbeattie | 4,260 (2017) |
Other/historical names associated with this locality:
Kirkcudbrightshire
Other Languages:
French:
Dumfries and Galloway, Écosse, Royaume-Uni
German:
Dumfries and Galloway, Schottland, Vereinigtes Königreich
Italian:
Dumfries e Galloway, Scozia, Regno Unito
Russian:
Дамфрис-энд-Галловей, Шотландия, Великобритания
Scots:
Dumfries an Gallowa, Scotland, Unitit Kinrick
Scottish Gaelic:
Comhairle Dhùn Phris is Ghall-Ghàidhealaibh, Alba, An Rìoghachd Aonaichte
Simplified Chinese:
鄧弗里斯-加洛韋, 蘇格蘭, 英国
Spanish:
Dumfries and Galloway, Escocia, Reino Unido
Arabic:
دومفريز وغالاوي, اسكتلندا, المملكة المتحدة
Asturian:
Dumfries and Galloway, Escocia, Reinu Xuníu
Basque:
Dumfries eta Galloway, Eskozia, Erresuma Batua
Bavarian:
Dumfries and Galloway, Schottland, Vaoanigts Kinireich
Belarusian:
Дамфрыс-энд-Галаўэй, Шатландыя, Вялікабрытанія
Belarusian (Tarashkevitsa):
Дамфрыз-энд-Галаўэй, Шатляндыя, Вялікабрытанія
Bengali:
ডাম্ফ্রাই ও গালোভেই, স্কটল্যান্ড, যুক্তরাজ্য
Breton:
Dùn Phrìs is Gall-Ghaidhealaibh, Bro-Skos, Rouantelezh-Unanet
Bulgarian:
Дъмфрис и Галоуей, Шотландия, Обединено кралство Великобритания и Северна Ирландия
Catalan:
Dumfries i Galloway, Escòcia, Regne Unit
Cebuano:
Dumfries and Galloway, Scotland (apil sa nasod), Hiniusang Gingharian
Czech:
Dumfries a Galloway, Skotsko, Spojené království
Dutch:
Dumfries and Galloway, Schotland, Verenigd Koninkrijk
Esperanto:
Dumfries kaj Galloway, Skotlando, Unuiĝinta Reĝlando
Estonian:
Dumfries and Galloway, Šotimaa, Suurbritannia
Farsi/Persian:
دامفریس و گالووی, اسکاتلند, بریتانیا
Fiji Hindi:
Dumfries and Galloway, Scotland, United Kingdom
Finnish:
Dumfries ja Galloway, Skotlanti, Yhdistynyt kuningaskunta
Gujarati:
ડમફ્રીઝ અને ગેલોવે, સ્કોટલેન્ડ, યુનાઇટેડ કિંગડમ
Indonesian:
Dumfries and Galloway, Skotlandia, Britania Raya
Irish Gaelic:
Comhairle Dhún Phrís is Gall-Ghaidhealaibh, Albain, An Ríocht Aontaithe
Japanese:
ダンフリーズ・アンド・ガロウェイ, スコットランド, イギリス
Kannada:
ಡಮ್ಫ್ರೀಸ್ ಮತ್ತು ಗ್ಯಾಲೋವೆ, ಸ್ಕಾಟ್ಲೆಂಡ್, ಯುನೈಟೆಡ್ ಕಿಂಗ್ಡಂ
Korean:
덤프리스 갤러웨이, 스코틀랜드, 영국
Lithuanian:
Damfrisas ir Galovėjus, Škotija, Jungtinė Karalystė
Manx:
Dùn Phris as y Ghallioo, Nalbin, Reeriaght Unnaneysit
Norwegian:
Dumfries and Galloway, Skottland, Storbritannia
Norwegian (Nynorsk):
Dumfries and Galloway, Skottland, Storbritannia
Polish:
Dumfries and Galloway, Szkocja, Wielka Brytania
Portuguese:
Dumfries and Galloway, Escócia, Reino Unido
Romanian:
Dumfries and Galloway, Scoția, Regatul Unit al Marii Britanii și al Irlandei de Nord
Serbo-Croatian:
Dumfries i Galloway, Škotska, Ujedinjeno Kraljevstvo
Swedish:
Dumfries and Galloway, Skottland, Storbritannien
Tamil:
டுமிபிரிஸ் & கல்லோவாய், இசுக்கொட்லாந்து, ஐக்கிய இராச்சியம்
Telugu:
డంఫ్రీస్ మరియు గాల్లోవే, స్కాట్లాండ్, యునైటెడ్ కింగ్డమ్
Ukrainian:
Дамфріс і Галловей, Шотландія, Велика Британія
Urdu:
دومفرییس اینڈ جالووے, اسکاٹ لینڈ, مملکت متحدہ
Welsh:
Dumfries a Galloway, Yr Alban, Y Deyrnas Unedig
Western Punjabi:
ڈمفریز اینڈ گالوے, سکاٹلینڈ, برطانیہ
One of the 32 unitary council areas of Scotland.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities169 valid minerals. 1 (TL) - type locality of valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S Habit: very thin metallic inconspicuous sooty coatings on tiny wires of Silver/argentiferous lead, appearing within minutes of being exposed to the atmosphere Colour: black |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5(T8O22)W2 |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 |
| ⓘ Anglesite Formula: PbSO4 Localities: Reported from at least 12 localities in this region. |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 Localities: Meadowfoot Mine, Wanlockhead, Dumfries and Galloway, Scotland, UK Straitstep Vein (Margaret's Vein), Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Lees Vein, Stake Moss, Wanlockhead, Dumfries and Galloway, Scotland, UK Sandyhills Bay (Southwick Cliffs), Dalbeattie, Dumfries and Galloway, Scotland, UK New Glencrieff Mine (Wanlockhead Mine; East and West branch of New Glencrieff Vein), Wanlockhead, Dumfries and Galloway, Scotland, UK |
| ⓘ Annabergite Formula: Ni3(AsO4)2 · 8H2O |
| ⓘ Annabergite var. Calcium-bearing Annabergite Formula: (Ni,Ca)3(AsO4)2 · 8H2O |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A Localities: Description: May refer to plumbian apatite or mattheddleite. |
| ⓘ Aragonite Formula: CaCO3 Localities: Reported from at least 7 localities in this region. Colour: light blue |
| ⓘ Aragonite var. Lead-bearing Aragonite Formula: (Ca,Pb)CO3 References: |
| ⓘ Argentopentlandite Formula: Ag(Fe,Ni)8S8 |
| ⓘ Atacamite Formula: Cu2(OH)3Cl Localities: Caulkerbush, Dalbeattie, Dumfries and Galloway, Scotland, UK Dalbeattie, Dumfries and Galloway, Scotland, UK Marbruie Cove, Dalbeattie, Dumfries and Galloway, Scotland, UK Needle's Eye Mine, Needle's Eye, Dumfries and Galloway, Scotland, UK Criffel granodiorite, Dalbeattie, Dumfries and Galloway, Scotland, UK |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 Localities: New Glencrieff Mine (Wanlockhead Mine; East and West branch of New Glencrieff Vein), Wanlockhead, Dumfries and Galloway, Scotland, UK Waygate Shaft (Straitstep Vein), Wanlockhead, Dumfries and Galloway, Scotland, UK Blackcraig Mine (East Blackcraig Mine; West Blackcraig Mine), Blackcraig, Dumfries and Galloway, Scotland, UK Toors Hill, Dalbeattie, Dumfries and Galloway, Scotland, UK |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 |
| ⓘ Baryte Formula: BaSO4 Localities: Reported from at least 13 localities in this region. |
| ⓘ Beudantite Formula: PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 References: |
| ⓘ Birnessite Formula: (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| ⓘ 'Bisbeeite' Formula: (Cu,Mg)SiO3 · nH2O References: Eberhard Zeh collectionIdentification: Raman Spectroscopy |
| ⓘ Bismoclite Formula: BiOCl |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ Bismutite Formula: (BiO)2CO3 |
| ⓘ Blixite Formula: Pb8O5(OH)2Cl4 |
| ⓘ Boleite Formula: KPb26Ag9Cu24(OH)48Cl62 |
| ⓘ Boltwoodite Formula: (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| ⓘ Bornite Formula: Cu5FeS4 Localities: Reported from at least 6 localities in this region. |
| ⓘ Botallackite Formula: Cu2(OH)3Cl |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 Localities: Reported from at least 12 localities in this region. |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 28 localities in this region. Habit: spheres Colour: light blue (copper-bearing) |
| ⓘ Calcite var. Iron-bearing Calcite Formula: (Ca,Fe)CO3 References: |
| ⓘ Calcite var. Lead-bearing Calcite Formula: (Ca,Pb)CO3 Description: Recorded as "Plumbocalcite"
"Some Wanlockhead specimens have been recorded as containing up to 9.47% of lead carbonate." |
| ⓘ Caledonite Formula: Pb5Cu2(SO4)3(CO3)(OH)6 Localities: Reported from at least 7 localities in this region. |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Cerussite Formula: PbCO3 Localities: Reported from at least 18 localities in this region. |
| ⓘ Cervantite Formula: Sb3+Sb5+O4 |
| ⓘ 'Chabazite' |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O References: |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 25 localities in this region. |
| ⓘ Chenite Formula: Pb4Cu(SO4)2(OH)6 Localities: Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Cove Vein, Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Meadowfoot Smelter slag locality, Wanlockhead, Dumfries and Galloway, Scotland, UK Pates Knowes Smelter slag locality, Wanlockhead, Dumfries and Galloway, Scotland, UK |
| ⓘ 'Chlorite Group' References: |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 Localities: Reported from at least 13 localities in this region. |
| ⓘ 'Clay minerals' |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ Connellite Formula: Cu19(SO4)(OH)32Cl4 · 3H2O Localities: Reported from at least 9 localities in this region. |
| ⓘ Copiapite Formula: Fe2+Fe3+4(SO4)6(OH)2 · 20H2O Description: As a powdery yellow efflorescence on altered pyrite 'from 160 level, Wanlockhead, Dumfriesshire'. IGS specimen collected by J. Brown in 1916. ID confirmed by X-ray diffraction in 1979. |
| ⓘ Corkite Formula: PbFe3+3(PO4)(SO4)(OH)6 Localities: Habit: Blocky Colour: Dark brown |
| ⓘ Cornubite Formula: Cu5(AsO4)2(OH)4 |
| ⓘ Cotunnite Formula: PbCl2 |
| ⓘ Covellite Formula: CuS |
| ⓘ Creaseyite Formula: Pb2Cu2Fe3+2(Si4.67Al0.33)O15.33(OH)3 · H2O Localities: Colour: Pale Green to mint green |
| ⓘ Crocoite Formula: PbCr6+O4 Habit: Primatic Colour: Dull orange |
| ⓘ Cuprite Formula: Cu2O Colour: red References: |
| ⓘ Cuprite var. Chalcotrichite Formula: Cu2O |
| ⓘ Cuprostibite Formula: Cu2(Sb,Tl) |
| ⓘ Descloizite Formula: PbZn(VO4)(OH) Localities: Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Cove Vein, Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK New Vein, Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK New Glencrieff Mine (Wanlockhead Mine; East and West branch of New Glencrieff Vein), Wanlockhead, Dumfries and Galloway, Scotland, UK Belton Grain vein, Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK |
| ⓘ 'Descloizite-Mottramite Series' |
| ⓘ Devilline Formula: CaCu4(SO4)2(OH)6 · 3H2O Localities: Habit: Lath-like Colour: Pale Blue to light blue |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: Reported from at least 10 localities in this region. |
| ⓘ Duftite Formula: PbCu(AsO4)(OH) Habit: Thin crusts Colour: Black Description: Recordede on a specimen from Taits Level, Whytes Cleugh. |
| ⓘ Elyite Formula: Pb4Cu(SO4)O2(OH)4 · H2O Localities: Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Meadowfoot Smelter slag locality, Wanlockhead, Dumfries and Galloway, Scotland, UK Cove Vein, Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Pates Knowes Smelter slag locality, Wanlockhead, Dumfries and Galloway, Scotland, UK |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O Localities: Dalbeattie, Dumfries and Galloway, Scotland, UK Needle's Eye Mine, Needle's Eye, Dumfries and Galloway, Scotland, UK Blackcraig Mine (East Blackcraig Mine; West Blackcraig Mine), Blackcraig, Dumfries and Galloway, Scotland, UK New Glencrieff Mine (Wanlockhead Mine; East and West branch of New Glencrieff Vein), Wanlockhead, Dumfries and Galloway, Scotland, UK |
| ⓘ Eulytine Formula: Bi4(SiO4)3 |
| ⓘ 'Fayalite-Forsterite Series' |
| ⓘ Ferrimolybdite Formula: Fe2(MoO4)3 · nH2O Description: Yellow earthy coating, associated with molybdenite, in a quartz vein cutting granite References: |
| ⓘ Ferrisurite Formula: (Pb,Ca)2.4Fe3+2(Si4O10)(CO3)1.7(OH)3 · nH2O |
| ⓘ Froodite Formula: α-PdBi2 |
| ⓘ Galena Formula: PbS Localities: Reported from at least 20 localities in this region. |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Gersdorffite Formula: NiAsS |
| ⓘ 'Gmelinite Subgroup' |
| ⓘ Goethite Formula: Fe3+O(OH) Localities: Reported from at least 16 localities in this region. |
| ⓘ Greenockite Formula: CdS |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: Reported from at least 6 localities in this region. |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 24 localities in this region. |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O Localities: Reported from at least 12 localities in this region. |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ Hydrocerussite Formula: Pb3(CO3)2(OH)2 Localities: Cove Vein, Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK New Cove Vein, Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Belton Grain vein, Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Meadowfoot Smelter slag locality, Wanlockhead, Dumfries and Galloway, Scotland, UK |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 |
| ⓘ Irarsite Formula: (Ir,Ru,Rh,Pt)AsS |
| ⓘ Jamesonite Formula: Pb4FeSb6S14 |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Kahlerite Formula: Fe2+(UO2)2(AsO4)2 · 12H2O |
| ⓘ Kegelite Formula: Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| ⓘ Lanarkite Formula: Pb2(SO4)O Localities: Reported from at least 10 localities in this region. |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O Localities: Reported from at least 9 localities in this region. |
| ⓘ Lautenthalite Formula: PbCu4(SO4)2(OH)6 · 3H2O References: |
| ⓘ Lavendulan Formula: NaCaCu5(AsO4)4Cl · 5H2O |
| ⓘ Leadhillite Formula: Pb4(CO3)2(SO4)(OH)2 Localities: Reported from at least 12 localities in this region. |
| ⓘ 'Limonite' Description: Mostly as crusts commonly coats other species and intermixed with clay minerals. |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 Localities: Reported from at least 11 localities in this region. |
| ⓘ Litharge Formula: PbO |
| ⓘ Lithiophorite Formula: (Al,Li)MnO2(OH)2 |
| ⓘ Löllingite Formula: FeAs2 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 27 localities in this region. |
| ⓘ Manganite Formula: Mn3+O(OH) |
| ⓘ Marcasite Formula: FeS2 Localities: Belton Grain vein, Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Blackcraig Mine (East Blackcraig Mine; West Blackcraig Mine), Blackcraig, Dumfries and Galloway, Scotland, UK Glencrief Burn, Wanlockhead, Dumfries and Galloway, Scotland, UK Straitstep Vein (Margaret's Vein), Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK |
| ⓘ Massicot Formula: PbO References: |
| ⓘ Matildite Formula: AgBiS2 |
| ⓘ Mattheddleite Formula: Pb5(SiO4)1.5(SO4)1.5(Cl,OH) Localities: Wilsons Vein, Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Cove Vein, Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Belton Grain vein, Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK |
| ⓘ Melanterite Formula: Fe2+(H2O)6(SO4) · H2O |
| ⓘ 'Melilite Group' Formula: Ca2M(XSiO7) |
| ⓘ Merenskyite Formula: PdTe2 |
| ⓘ Meta-autunite Formula: Ca(UO2)2(PO4)2 · 6H2O |
| ⓘ Metakahlerite Formula: Fe2+(UO2)2(AsO4)2 · 8H2O |
| ⓘ Metazeunerite Formula: Cu(UO2)2(AsO4)2 · 8H2O |
| ⓘ Michenerite Formula: PdBiTe |
| ⓘ Millerite Formula: NiS Description: capillary crystal bundles in cavities. |
| ⓘ Mimetite ? Formula: Pb5(AsO4)3Cl |
| ⓘ Mixite Formula: BiCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ Molybdenite Formula: MoS2 Localities: Almorness coast, Dalbeattie, Dumfries and Galloway, Scotland, UK Almorness Point, Almorness coast, Dalbeattie, Dumfries and Galloway, Scotland, UK Lotus Hill, New Abbey, Dumfries and Galloway, Scotland, UK Lower Porterbelly Quarry, Kirkgunzeon, Dumfries and Galloway, Scotland, UK Screel Hill, Dumfries and Galloway, Scotland, UK |
| ⓘ Monohydrocalcite Formula: CaCO3 · H2O Description: Natural History Museum London x-ray file number 4068F References: |
| ⓘ Mottramite Formula: PbCu(VO4)(OH) Localities: Reported from at least 7 localities in this region. |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Copper Formula: Cu Colour: copper-red Description: Also found as a Zinc-bearing variety. References: |
| ⓘ Native Gold Formula: Au |
| ⓘ Native Gold var. Electrum Formula: (Au,Ag) |
| ⓘ Native Lead Formula: Pb Description: argentiferous in some cases |
| ⓘ Native Silver Formula: Ag Habit: tiny sprigs or wires coated by black sooty acanthite |
| ⓘ Native Sulphur Formula: S8 Localities: |
| ⓘ Nickeline Formula: NiAs Localities: Reported from at least 6 localities in this region. |
| ⓘ Nováčekite Formula: Mg(UO2)2(AsO4)2 · 10H2O |
| ⓘ Orthoserpierite Formula: Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O References: Eberhard Zeh collectionIdentification: Raman Spectroscopy |
| ⓘ Oxyplumboroméite Formula: Pb2Sb2O6O References: |
| ⓘ Paralaurionite Formula: PbCl(OH) |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 |
| ⓘ 'Petroleum var. Bitumen' |
| ⓘ Phosphohedyphane Formula: Ca2Pb3(PO4)3Cl Localities: Cove Vein, Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Belton Grain vein, Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK New Glencrieff Mine (Wanlockhead Mine; East and West branch of New Glencrieff Vein), Wanlockhead, Dumfries and Galloway, Scotland, UK Wilsons Vein, Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK |
| ⓘ Plattnerite Formula: PbO2 Localities: High Pirn Mine (Belton Grain Vein and New Vein), Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK New Vein, Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Belton Grain vein, Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Meadowfoot Smelter slag locality, Wanlockhead, Dumfries and Galloway, Scotland, UK ? (more information) |
| ⓘ Plumbogummite Formula: PbAl3(PO4)(PO3OH)(OH)6 |
| ⓘ Plumbonacrite (TL) Formula: Pb5O(OH)2(CO3)3 Type Locality: Description: Work is continuing to confirm the occurance of plumbonacrite in the Leadhills-Wanlockhead Orefield. |
| ⓘ Posnjakite Formula: Cu4(SO4)(OH)6 · H2O |
| ⓘ Pseudoboleite Formula: Pb31Cu24Cl62(OH)48 |
| ✪ Pseudomalachite Formula: Cu5(PO4)2(OH)4 |
| ⓘ 'Psilomelane' |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 21 localities in this region. |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl Localities: Reported from at least 16 localities in this region. |
| ⓘ Pyromorphite var. Calcium-bearing Pyromorphite Formula: (Pb,Ca)5(PO4)3Cl Localities: Old Glencrieff Vein, Wanlockhead, Dumfries and Galloway, Scotland, UK Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK High Pirn Mine (Belton Grain Vein and New Vein), Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK New Glencrieff Mine (Wanlockhead Mine; East and West branch of New Glencrieff Vein), Wanlockhead, Dumfries and Galloway, Scotland, UK |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 References: S. Rust collection.Identified by Steve Rust: Visual Identification |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 46 localities in this region. |
| ⓘ Quartz var. Amethyst Formula: SiO2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Quartz var. Chalcedony Formula: SiO2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 Localities: Boreland Burn, New Abbey, Dumfries and Galloway, Scotland, UK Rascarrel Bay, Auchencairn, Dumfries and Galloway, Scotland, UK Abbey Head, Abbey Burn Foot beach, Dundrennan, Dumfries and Galloway, Scotland, UK Toors Hill, Dalbeattie, Dumfries and Galloway, Scotland, UK Screel Hill, Dumfries and Galloway, Scotland, UK |
| ⓘ Quenselite Formula: PbMnO2(OH) |
| ⓘ Rammelsbergite Formula: NiAs2 |
| ⓘ Redgillite Formula: Cu6(SO4)(OH)10 · H2O |
| ⓘ Retgersite Formula: NiSO4 · 6H2O Description: Pale blue to blue-green crusts and minute curved or twisted crystals associated with annabergite and niccolite (= nickeline), RSM X-ray diffraction identification 1977 from specimens in Heddle collection. References: |
| ⓘ Romanèchite Formula: (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| ⓘ 'Roméite Group' Formula: A2(Sb5+)2O6Z |
| ⓘ Rosiaite Formula: PbSb5+2O6 |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Sauconite Formula: Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O References: Steve Rust collectionIdentification: XRD |
| ⓘ Scheelite Formula: Ca(WO4) Colour: pale blue-green |
| ⓘ Schmiederite Formula: Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 Description: NAM London X-Ray File 4377F (near Schmiederite) References: |
| ⓘ Schoepite Formula: (UO2)8O2(OH)12 · 12H2O |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ Schulenbergite Formula: (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| ⓘ Scotlandite Formula: PbSO3 References: |
| ⓘ Semseyite Formula: Pb9Sb8S21 |
| ⓘ Serpierite Formula: Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O Localities: Habit: pearly, fibrous to lath-like aggregates Colour: sky blue |
| ⓘ Shattuckite Formula: Cu5(Si2O6)2(OH)2 |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Siegenite Formula: CoNi2S4 Description: Fine-grained bronze-like patches in mine dump material. Two electron-probe microanalyses of an X-rayed grain gave: Co = 30.0-31.0%, Ni = 24.3-25.0%, Fe = 1.6%, Cu = 0.3-0.5%. References: Livingstone, A., Macpherson, H.G., Jackson, B. (1976) Wroewolfeite and other langite-group minerals from Blackcraig, Kirkcudbrightshire. Mineralogical Magazine, 40 (316) 893-894 doi:10.1180/minmag.1976.040.316.12 |
| ⓘ Skutterudite Formula: CoAs3 |
| ⓘ Smithsonite Formula: ZnCO3 |
| ⓘ Sperrylite Formula: PtAs2 |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 13 localities in this region. |
| ⓘ Sphalerite var. Honigblende Formula: ZnS |
| ⓘ Sphalerite var. Marmatite Formula: (Zn,Fe)S |
| ⓘ Steverustite Formula: Pb2+5(OH)5[Cu+(S6+O3S2-)3](H2O)2 Description: Steverustite was visually identified by comparison with confirmed specimens from several Welsh and Scottish locations. References: |
| ⓘ Stibnite Formula: Sb2S3 |
| ⓘ Stolzite Formula: Pb(WO4) |
| ✪ Sundiusite Formula: Pb10(SO4)O8Cl2 Description: Natural History Museum London X-ray File number 6939F shows the mineral to be near Sundiusite but not100%. |
| ⓘ Susannite Formula: Pb4(CO3)2(SO4)(OH)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Tellurobismuthite Formula: Bi2Te3 |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S |
| ⓘ Tenorite Formula: CuO Description: Well-formed typically black lustrous micro-crystals, with coverings on slag to several centimeters. References: S. Rust collection.Identification: SEM-EDS, Raman Spectroscopy |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S Description: Five specimens were analysed by Stephen Moreton in 2026 using SEM-EDS. Two gave Sb > As, so were tetrahedrite. Two gave As > Sb, so were tennantite. One gave Sb = As, placing it in the middle of the series. All look the same visually, as disseminations in quartz. References: |
| ⓘ Titanite Formula: CaTiO(SiO4) |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z References: |
| ⓘ Tyrolite Formula: Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| ⓘ 'Unnamed (Pb-Cu-Al-Si-O)' Formula: Pb-Cu-Al-Si-O Description: The Unnamed mineral is a sublimation product, rather than a secondary mineral. References: Steve Rust collectionIdentified by Steve Rust: SEM-EDS |
| ⓘ Uraninite Formula: UO2 Localities: Dalbeattie, Dumfries and Galloway, Scotland, UK Sandyhills Bay (Southwick Cliffs), Dalbeattie, Dumfries and Galloway, Scotland, UK Needle's Eye Mine, Needle's Eye, Dumfries and Galloway, Scotland, UK Criffel granodiorite, Dalbeattie, Dumfries and Galloway, Scotland, UK Marbruie Cove, Dalbeattie, Dumfries and Galloway, Scotland, UK |
| ⓘ Uraninite var. Pitchblende Formula: UO2 |
| ⓘ Uranophane Formula: Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ Uranospinite Formula: Ca(UO2)2(AsO4)2 · 10H2O |
| ⓘ Valentinite Formula: Sb2O3 |
| ⓘ Vanadinite Formula: Pb5(VO4)3Cl Localities: Reported from at least 8 localities in this region. Colour: Pale brown to Orange-red |
| ⓘ Vandendriesscheite Formula: PbU7O22 · 12H2O |
| ⓘ Formula: Pb2Cu(CrO4)(PO4)(OH) Locality: Wanlockhead, Dumfries and Galloway, Scotland, UK - erroneously reported Description: Davies' Vauquelinite = Mottramite. See Bannister, F.A. (1933) The identity of mottramite and psittacinite with cupriferous descloizite. Mineralogical Magazine, vol. 23, n° 141, 376-386. References: Davies, Thos. (1877) VI.—Notes on Vauquelinite from Scotland, and Cantonite from Cornwall. Mineralogical Magazine and Journal of the Mineralogical Society, 1 (4) 112-114 doi:10.1180/minmag.1877.001.4.07 |
| ⓘ Veszelyite Formula: (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| ⓘ 'Wad' |
| ⓘ Walpurgite Formula: (BiO)4(UO2)(AsO4)2 · 2H2O |
| ⓘ Widenmannite Formula: Pb2(OH)2[(UO2)(CO3)2] |
| ⓘ Willemite Formula: Zn2SiO4 |
| ⓘ Witherite Formula: BaCO3 |
| ⓘ 'Wolframite Group' |
| ⓘ Wroewolfeite Formula: Cu4(SO4)(OH)6 · 2H2O Localities: Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Cove Vein, Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Blackcraig Mine (East Blackcraig Mine; West Blackcraig Mine), Blackcraig, Dumfries and Galloway, Scotland, UK Meadowfoot Smelter slag locality, Wanlockhead, Dumfries and Galloway, Scotland, UK |
| ⓘ Wulfenite Formula: Pb(MoO4) Localities: Reported from at least 11 localities in this region. |
| ⓘ Wüstite Formula: FeO |
| ⓘ Zeunerite Formula: Cu(UO2)2(AsO4)2 · 12H2O |
| ⓘ Zincite Formula: ZnO |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold var. Electrum | 1.AA.05 | (Au,Ag) |
| ⓘ | 1.AA.05 | Au | |
| ⓘ | Native Lead | 1.AA.05 | Pb |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Cuprostibite | 2.AA.20 | Cu2(Sb,Tl) |
| ⓘ | Froodite | 2.AC.45a | α-PdBi2 |
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Argentopentlandite | 2.BB.15 | Ag(Fe,Ni)8S8 |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | var. Marmatite | 2.CB.05a | (Zn,Fe)S |
| ⓘ | var. Honigblende | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Siegenite | 2.DA.05 | CoNi2S4 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Tellurobismuthite | 2.DC.05 | Bi2Te3 |
| ⓘ | Merenskyite | 2.EA.20 | PdTe2 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Sperrylite | 2.EB.05a | PtAs2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Rammelsbergite | 2.EB.15a | NiAs2 |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Irarsite | 2.EB.25 | (Ir,Ru,Rh,Pt)AsS |
| ⓘ | Michenerite | 2.EB.25 | PdBiTe |
| ⓘ | Skutterudite | 2.EC.05 | CoAs3 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | Semseyite | 2.HC.10d | Pb9Sb8S21 |
| ⓘ | Matildite | 2.JA.20 | AgBiS2 |
| Group 3 - Halides | |||
| ⓘ | Cotunnite | 3.AB.85 | PbCl2 |
| ⓘ | Atacamite | 3.DA.10a | Cu2(OH)3Cl |
| ⓘ | Botallackite | 3.DA.10b | Cu2(OH)3Cl |
| ⓘ | Connellite | 3.DA.25 | Cu19(SO4)(OH)32Cl4 · 3H2O |
| ⓘ | Pseudoboleite | 3.DB.10 | Pb31Cu24Cl62(OH)48 |
| ⓘ | Boleite | 3.DB.15 | KPb26Ag9Cu24(OH)48Cl62 |
| ⓘ | Paralaurionite | 3.DC.05 | PbCl(OH) |
| ⓘ | Bismoclite | 3.DC.25 | BiOCl |
| ⓘ | Blixite | 3.DC.50 | Pb8O5(OH)2Cl4 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Cuprite var. Chalcotrichite | 4.AA.10 | Cu2O |
| ⓘ | 4.AA.10 | Cu2O | |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Zincite | 4.AB.20 | ZnO |
| ⓘ | Wüstite | 4.AB.25 | FeO |
| ⓘ | Litharge | 4.AC.20 | PbO |
| ⓘ | Massicot | 4.AC.25 | PbO |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Valentinite | 4.CB.55 | Sb2O3 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Plattnerite | 4.DB.05 | PbO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Cervantite | 4.DE.30 | Sb3+Sb5+O4 |
| ⓘ | 'Roméite Group' | 4.DH. | A2(Sb5+)2O6Z |
| ⓘ | Oxyplumboroméite | 4.DH. | Pb2Sb2O6O |
| ⓘ | Rosiaite | 4.DH.25 | PbSb5+2O6 |
| ⓘ | Romanèchite | 4.DK.10 | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| ⓘ | Uraninite var. Pitchblende | 4.DL.05 | UO2 |
| ⓘ | 4.DL.05 | UO2 | |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Lithiophorite | 4.FE.25 | (Al,Li)MnO2(OH)2 |
| ⓘ | Quenselite | 4.FE.30 | PbMnO2(OH) |
| ⓘ | Birnessite | 4.FL.45 | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| ⓘ | Schoepite | 4.GA.05 | (UO2)8O2(OH)12 · 12H2O |
| ⓘ | Vandendriesscheite | 4.GB.40 | PbU7O22 · 12H2O |
| ⓘ | Scotlandite | 4.JE.20 | PbSO3 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Calcite var. Iron-bearing Calcite | 5.AB.05 | (Ca,Fe)CO3 |
| ⓘ | var. Lead-bearing Calcite | 5.AB.05 | (Ca,Pb)CO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Aragonite var. Lead-bearing Aragonite | 5.AB.15 | (Ca,Pb)CO3 |
| ⓘ | Witherite | 5.AB.15 | BaCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Hydrocerussite | 5.BE.10 | Pb3(CO3)2(OH)2 |
| ⓘ | Plumbonacrite (TL) | 5.BE.15 | Pb5O(OH)2(CO3)3 |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| ⓘ | Leadhillite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Susannite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Monohydrocalcite | 5.CB.20 | CaCO3 · H2O |
| ⓘ | Widenmannite | 5.ED.40 | Pb2(OH)2[(UO2)(CO3)2] |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Caledonite | 7.BC.50 | Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Schmiederite | 7.BC.65 | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| ⓘ | Chenite | 7.BC.70 | Pb4Cu(SO4)2(OH)6 |
| ⓘ | Lanarkite | 7.BD.40 | Pb2(SO4)O |
| ⓘ | Sundiusite | 7.BD.70 | Pb10(SO4)O8Cl2 |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Retgersite | 7.CB.30 | NiSO4 · 6H2O |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6(SO4) · H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Copiapite | 7.DB.35 | Fe2+Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Posnjakite | 7.DD.10 | Cu4(SO4)(OH)6 · H2O |
| ⓘ | Wroewolfeite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Devilline | 7.DD.30 | CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Orthoserpierite | 7.DD.30 | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| ⓘ | Serpierite | 7.DD.30 | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| ⓘ | Redgillite | 7.DD.70 | Cu6(SO4)(OH)10 · H2O |
| ⓘ | Schulenbergite | 7.DD.80 | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| ⓘ | Elyite | 7.DF.65 | Pb4Cu(SO4)O2(OH)4 · H2O |
| ⓘ | Lautenthalite | 7.DF.70 | PbCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Crocoite | 7.FA.20 | PbCr6+O4 |
| ⓘ | Vauquelinite ? | 7.FC.05 | Pb2Cu(CrO4)(PO4)(OH) |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Stolzite | 7.GA.05 | Pb(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| ⓘ | Ferrimolybdite | 7.GB.30 | Fe2(MoO4)3 · nH2O |
| ⓘ | Steverustite | 7.JA.10 | Pb2+5(OH)5[Cu+(S6+O3S2-)3](H2O)2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Pseudomalachite | 8.BD.05 | Cu5(PO4)2(OH)4 |
| ⓘ | Cornubite | 8.BD.30 | Cu5(AsO4)2(OH)4 |
| ⓘ | Duftite | 8.BH.35 | PbCu(AsO4)(OH) |
| ⓘ | Descloizite | 8.BH.40 | PbZn(VO4)(OH) |
| ⓘ | Mottramite | 8.BH.40 | PbCu(VO4)(OH) |
| ⓘ | Beudantite | 8.BL.05 | PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ | Corkite | 8.BL.05 | PbFe3+3(PO4)(SO4)(OH)6 |
| ⓘ | Plumbogummite | 8.BL.10 | PbAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Mimetite ? | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Vanadinite | 8.BN.05 | Pb5(VO4)3Cl |
| ⓘ | Pyromorphite var. Calcium-bearing Pyromorphite | 8.BN.05 | (Pb,Ca)5(PO4)3Cl |
| ⓘ | Phosphohedyphane | 8.BN.05 | Ca2Pb3(PO4)3Cl |
| ⓘ | Annabergite | 8.CE.40 | Ni3(AsO4)2 · 8H2O |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Annabergite var. Calcium-bearing Annabergite | 8.CE.40 | (Ni,Ca)3(AsO4)2 · 8H2O |
| ⓘ | Veszelyite | 8.DE.30 | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| ⓘ | Lavendulan | 8.DG.05 | NaCaCu5(AsO4)4Cl · 5H2O |
| ⓘ | Mixite | 8.DL.15 | BiCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ | Tyrolite | 8.DM.10 | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| ⓘ | Walpurgite | 8.EA.05 | (BiO)4(UO2)(AsO4)2 · 2H2O |
| ⓘ | Kahlerite | 8.EB.05 | Fe2+(UO2)2(AsO4)2 · 12H2O |
| ⓘ | Uranospinite | 8.EB.05 | Ca(UO2)2(AsO4)2 · 10H2O |
| ⓘ | Zeunerite | 8.EB.05 | Cu(UO2)2(AsO4)2 · 12H2O |
| ⓘ | Nováčekite | 8.EB.05 | Mg(UO2)2(AsO4)2 · 10H2O |
| ⓘ | Meta-autunite | 8.EB.10 | Ca(UO2)2(PO4)2 · 6H2O |
| ⓘ | Metakahlerite | 8.EB.10 | Fe2+(UO2)2(AsO4)2 · 8H2O |
| ⓘ | Metazeunerite | 8.EB.10 | Cu(UO2)2(AsO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Willemite | 9.AA.05 | Zn2SiO4 |
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Eulytine | 9.AD.40 | Bi4(SiO4)3 |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Mattheddleite | 9.AH.25 | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| ⓘ | Boltwoodite | 9.AK.15 | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| ⓘ | Uranophane | 9.AK.15 | Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Shattuckite | 9.DB.40 | Cu5(Si2O6)2(OH)2 |
| ⓘ | Sauconite | 9.EC.45 | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| ⓘ | Ferrisurite | 9.EC.75 | (Pb,Ca)2.4Fe3+2(Si4O10)(CO3)1.7(OH)3 · nH2O |
| ⓘ | Kegelite | 9.EC.80 | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Creaseyite | 9.HH.15 | Pb2Cu2Fe3+2(Si4.67Al0.33)O15.33(OH)3 · H2O |
| Unclassified | |||
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chabazite' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Clay minerals' | - | |
| ⓘ | 'Gmelinite Subgroup' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Wad' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Descloizite-Mottramite Series' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'Petroleum var. Bitumen' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Bisbeeite' | - | (Cu,Mg)SiO3 · nH2O |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Melilite Group' | - | Ca2M(XSiO7) |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ | 'Unnamed (Pb-Cu-Al-Si-O)' | - | Pb-Cu-Al-Si-O |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| H | ⓘ Atacamite | Cu2(OH)3Cl |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| H | ⓘ Blixite | Pb8O5(OH)2Cl4 |
| H | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| H | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| H | ⓘ Botallackite | Cu2(OH)3Cl |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| H | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| H | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| H | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| H | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| H | ⓘ Descloizite | PbZn(VO4)(OH) |
| H | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Duftite | PbCu(AsO4)(OH) |
| H | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| H | ⓘ Ferrisurite | (Pb,Ca)2.4Fe23+(Si4O10)(CO3)1.7(OH)3 · nH2O |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kahlerite | Fe2+(UO2)2(AsO4)2 · 12H2O |
| H | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Lautenthalite | PbCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| H | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Lithiophorite | (Al,Li)MnO2(OH)2 |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| H | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| H | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| H | ⓘ Metakahlerite | Fe2+(UO2)2(AsO4)2 · 8H2O |
| H | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| H | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| H | ⓘ Monohydrocalcite | CaCO3 · H2O |
| H | ⓘ Mottramite | PbCu(VO4)(OH) |
| H | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Paralaurionite | PbCl(OH) |
| H | ⓘ Plumbonacrite | Pb5O(OH)2(CO3)3 |
| H | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| H | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| H | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| H | ⓘ Quenselite | PbMnO2(OH) |
| H | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| H | ⓘ Retgersite | NiSO4 · 6H2O |
| H | ⓘ Sauconite | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| H | ⓘ Schmiederite | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| H | ⓘ Schoepite | (UO2)8O2(OH)12 · 12H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| H | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| H | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| H | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| H | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| H | ⓘ Uranospinite | Ca(UO2)2(AsO4)2 · 10H2O |
| H | ⓘ Vandendriesscheite | PbU7O22 · 12H2O |
| H | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| H | ⓘ Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| H | ⓘ Walpurgite | (BiO)4(UO2)(AsO4)2 · 2H2O |
| H | ⓘ Widenmannite | Pb2(OH)2[(UO2)(CO3)2] |
| H | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| H | ⓘ Descloizite-Mottramite Series | |
| H | ⓘ Redgillite | Cu6(SO4)(OH)10 · H2O |
| H | ⓘ Bisbeeite | (Cu,Mg)SiO3 · nH2O |
| H | ⓘ Annabergite var. Calcium-bearing Annabergite | (Ni,Ca)3(AsO4)2 · 8H2O |
| H | ⓘ Steverustite | Pb52+(OH)5[Cu+(S6+O3S2-)3](H2O)2 |
| H | ⓘ Nováčekite | Mg(UO2)2(AsO4)2 · 10H2O |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Li | Lithium | |
| Li | ⓘ Lithiophorite | (Al,Li)MnO2(OH)2 |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Ferrisurite | (Pb,Ca)2.4Fe23+(Si4O10)(CO3)1.7(OH)3 · nH2O |
| C | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| C | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Monohydrocalcite | CaCO3 · H2O |
| C | ⓘ Plumbonacrite | Pb5O(OH)2(CO3)3 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Aragonite var. Lead-bearing Aragonite | (Ca,Pb)CO3 |
| C | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| C | ⓘ Widenmannite | Pb2(OH)2[(UO2)(CO3)2] |
| C | ⓘ Witherite | BaCO3 |
| C | ⓘ Calcite var. Iron-bearing Calcite | (Ca,Fe)CO3 |
| C | ⓘ Calcite var. Lead-bearing Calcite | (Ca,Pb)CO3 |
| O | Oxygen | |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Atacamite | Cu2(OH)3Cl |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| O | ⓘ Bismoclite | BiOCl |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Blixite | Pb8O5(OH)2Cl4 |
| O | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| O | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| O | ⓘ Botallackite | Cu2(OH)3Cl |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Cervantite | Sb3+Sb5+O4 |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| O | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| O | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| O | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| O | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| O | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| O | ⓘ Crocoite | PbCr6+O4 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Descloizite | PbZn(VO4)(OH) |
| O | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Duftite | PbCu(AsO4)(OH) |
| O | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Eulytine | Bi4(SiO4)3 |
| O | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| O | ⓘ Ferrisurite | (Pb,Ca)2.4Fe23+(Si4O10)(CO3)1.7(OH)3 · nH2O |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kahlerite | Fe2+(UO2)2(AsO4)2 · 12H2O |
| O | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| O | ⓘ Lanarkite | Pb2(SO4)O |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Lautenthalite | PbCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| O | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Lithiophorite | (Al,Li)MnO2(OH)2 |
| O | ⓘ Litharge | PbO |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Massicot | PbO |
| O | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| O | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| O | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| O | ⓘ Metakahlerite | Fe2+(UO2)2(AsO4)2 · 8H2O |
| O | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| O | ⓘ Monohydrocalcite | CaCO3 · H2O |
| O | ⓘ Mottramite | PbCu(VO4)(OH) |
| O | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Paralaurionite | PbCl(OH) |
| O | ⓘ Uraninite var. Pitchblende | UO2 |
| O | ⓘ Plumbonacrite | Pb5O(OH)2(CO3)3 |
| O | ⓘ Plattnerite | PbO2 |
| O | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| O | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| O | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Quenselite | PbMnO2(OH) |
| O | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| O | ⓘ Roméite Group | A2(Sb5+)2O6Z |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Retgersite | NiSO4 · 6H2O |
| O | ⓘ Sauconite | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schmiederite | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| O | ⓘ Schoepite | (UO2)8O2(OH)12 · 12H2O |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| O | ⓘ Scotlandite | PbSO3 |
| O | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| O | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Stolzite | Pb(WO4) |
| O | ⓘ Sundiusite | Pb10(SO4)O8Cl2 |
| O | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Aragonite var. Lead-bearing Aragonite | (Ca,Pb)CO3 |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| O | ⓘ Uranospinite | Ca(UO2)2(AsO4)2 · 10H2O |
| O | ⓘ Valentinite | Sb2O3 |
| O | ⓘ Vanadinite | Pb5(VO4)3Cl |
| O | ⓘ Vandendriesscheite | PbU7O22 · 12H2O |
| O | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| O | ⓘ Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| O | ⓘ Walpurgite | (BiO)4(UO2)(AsO4)2 · 2H2O |
| O | ⓘ Widenmannite | Pb2(OH)2[(UO2)(CO3)2] |
| O | ⓘ Willemite | Zn2SiO4 |
| O | ⓘ Witherite | BaCO3 |
| O | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Wüstite | FeO |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| O | ⓘ Zincite | ZnO |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Rosiaite | PbSb25+O6 |
| O | ⓘ Fayalite-Forsterite Series | |
| O | ⓘ Descloizite-Mottramite Series | |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Calcite var. Iron-bearing Calcite | (Ca,Fe)CO3 |
| O | ⓘ Redgillite | Cu6(SO4)(OH)10 · H2O |
| O | ⓘ Pyromorphite var. Calcium-bearing Pyromorphite | (Pb,Ca)5(PO4)3Cl |
| O | ⓘ Bisbeeite | (Cu,Mg)SiO3 · nH2O |
| O | ⓘ Calcite var. Lead-bearing Calcite | (Ca,Pb)CO3 |
| O | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Melilite Group | Ca2M(XSiO7) |
| O | ⓘ Annabergite var. Calcium-bearing Annabergite | (Ni,Ca)3(AsO4)2 · 8H2O |
| O | ⓘ Steverustite | Pb52+(OH)5[Cu+(S6+O3S2-)3](H2O)2 |
| O | ⓘ Nováčekite | Mg(UO2)2(AsO4)2 · 10H2O |
| O | ⓘ Oxyplumboroméite | Pb2Sb2O6O |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| O | ⓘ Unnamed (Pb-Cu-Al-Si-O) | Pb-Cu-Al-Si-O |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Na | Sodium | |
| Na | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Na | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| Na | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Na | ⓘ Sauconite | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Fayalite-Forsterite Series | |
| Mg | ⓘ Bisbeeite | (Cu,Mg)SiO3 · nH2O |
| Mg | ⓘ Nováčekite | Mg(UO2)2(AsO4)2 · 10H2O |
| Al | Aluminium | |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| Al | ⓘ Lithiophorite | (Al,Li)MnO2(OH)2 |
| Al | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Sauconite | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Al | ⓘ Unnamed (Pb-Cu-Al-Si-O) | Pb-Cu-Al-Si-O |
| Si | Silicon | |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Eulytine | Bi4(SiO4)3 |
| Si | ⓘ Ferrisurite | (Pb,Ca)2.4Fe23+(Si4O10)(CO3)1.7(OH)3 · nH2O |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| Si | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Sauconite | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Si | ⓘ Willemite | Zn2SiO4 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Fayalite-Forsterite Series | |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Bisbeeite | (Cu,Mg)SiO3 · nH2O |
| Si | ⓘ Melilite Group | Ca2M(XSiO7) |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Unnamed (Pb-Cu-Al-Si-O) | Pb-Cu-Al-Si-O |
| P | Phosphorus | |
| P | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| P | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| P | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| P | ⓘ Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| P | ⓘ Pyromorphite var. Calcium-bearing Pyromorphite | (Pb,Ca)5(PO4)3Cl |
| P | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Argentopentlandite | Ag(Fe,Ni)8S8 |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| S | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| S | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| S | ⓘ Galena | PbS |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Irarsite | (Ir,Ru,Rh,Pt)AsS |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| S | ⓘ Lanarkite | Pb2(SO4)O |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Lautenthalite | PbCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Matildite | AgBiS2 |
| S | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| S | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| S | ⓘ Millerite | NiS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Retgersite | NiSO4 · 6H2O |
| S | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| S | ⓘ Scotlandite | PbSO3 |
| S | ⓘ Semseyite | Pb9Sb8S21 |
| S | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| S | ⓘ Siegenite | CoNi2S4 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Sundiusite | Pb10(SO4)O8Cl2 |
| S | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Sphalerite var. Marmatite | (Zn,Fe)S |
| S | ⓘ Redgillite | Cu6(SO4)(OH)10 · H2O |
| S | ⓘ Sphalerite var. Honigblende | ZnS |
| S | ⓘ Steverustite | Pb52+(OH)5[Cu+(S6+O3S2-)3](H2O)2 |
| Cl | Chlorine | |
| Cl | ⓘ Atacamite | Cu2(OH)3Cl |
| Cl | ⓘ Bismoclite | BiOCl |
| Cl | ⓘ Blixite | Pb8O5(OH)2Cl4 |
| Cl | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Cl | ⓘ Botallackite | Cu2(OH)3Cl |
| Cl | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cl | ⓘ Cotunnite | PbCl2 |
| Cl | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Cl | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Paralaurionite | PbCl(OH) |
| Cl | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Sundiusite | Pb10(SO4)O8Cl2 |
| Cl | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cl | ⓘ Pyromorphite var. Calcium-bearing Pyromorphite | (Pb,Ca)5(PO4)3Cl |
| Cl | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| K | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Ca | Calcium | |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Ferrisurite | (Pb,Ca)2.4Fe23+(Si4O10)(CO3)1.7(OH)3 · nH2O |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Ca | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| Ca | ⓘ Monohydrocalcite | CaCO3 · H2O |
| Ca | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| Ca | ⓘ Aragonite var. Lead-bearing Aragonite | (Ca,Pb)CO3 |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Ca | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Ca | ⓘ Uranospinite | Ca(UO2)2(AsO4)2 · 10H2O |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ca | ⓘ Calcite var. Iron-bearing Calcite | (Ca,Fe)CO3 |
| Ca | ⓘ Pyromorphite var. Calcium-bearing Pyromorphite | (Pb,Ca)5(PO4)3Cl |
| Ca | ⓘ Calcite var. Lead-bearing Calcite | (Ca,Pb)CO3 |
| Ca | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ca | ⓘ Melilite Group | Ca2M(XSiO7) |
| Ca | ⓘ Annabergite var. Calcium-bearing Annabergite | (Ni,Ca)3(AsO4)2 · 8H2O |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| V | Vanadium | |
| V | ⓘ Descloizite | PbZn(VO4)(OH) |
| V | ⓘ Mottramite | PbCu(VO4)(OH) |
| V | ⓘ Vanadinite | Pb5(VO4)3Cl |
| V | ⓘ Descloizite-Mottramite Series | |
| Cr | Chromium | |
| Cr | ⓘ Crocoite | PbCr6+O4 |
| Cr | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| Mn | Manganese | |
| Mn | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Mn | ⓘ Lithiophorite | (Al,Li)MnO2(OH)2 |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Quenselite | PbMnO2(OH) |
| Mn | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Fe | Iron | |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Argentopentlandite | Ag(Fe,Ni)8S8 |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| Fe | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| Fe | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Fe | ⓘ Ferrisurite | (Pb,Ca)2.4Fe23+(Si4O10)(CO3)1.7(OH)3 · nH2O |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Kahlerite | Fe2+(UO2)2(AsO4)2 · 12H2O |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| Fe | ⓘ Metakahlerite | Fe2+(UO2)2(AsO4)2 · 8H2O |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Wüstite | FeO |
| Fe | ⓘ Sphalerite var. Marmatite | (Zn,Fe)S |
| Fe | ⓘ Fayalite-Forsterite Series | |
| Fe | ⓘ Calcite var. Iron-bearing Calcite | (Ca,Fe)CO3 |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Co | ⓘ Siegenite | CoNi2S4 |
| Co | ⓘ Skutterudite | CoAs3 |
| Ni | Nickel | |
| Ni | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| Ni | ⓘ Argentopentlandite | Ag(Fe,Ni)8S8 |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Nickeline | NiAs |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Rammelsbergite | NiAs2 |
| Ni | ⓘ Retgersite | NiSO4 · 6H2O |
| Ni | ⓘ Siegenite | CoNi2S4 |
| Ni | ⓘ Annabergite var. Calcium-bearing Annabergite | (Ni,Ca)3(AsO4)2 · 8H2O |
| Cu | Copper | |
| Cu | ⓘ Atacamite | Cu2(OH)3Cl |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Botallackite | Cu2(OH)3Cl |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| Cu | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cu | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Cuprostibite | Cu2(Sb,Tl) |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Duftite | PbCu(AsO4)(OH) |
| Cu | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Lautenthalite | PbCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| Cu | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| Cu | ⓘ Mottramite | PbCu(VO4)(OH) |
| Cu | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| Cu | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| Cu | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| Cu | ⓘ Schmiederite | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| Cu | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| Cu | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| Cu | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Cu | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| Cu | ⓘ Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| Cu | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| Cu | ⓘ Descloizite-Mottramite Series | |
| Cu | ⓘ Redgillite | Cu6(SO4)(OH)10 · H2O |
| Cu | ⓘ Bisbeeite | (Cu,Mg)SiO3 · nH2O |
| Cu | ⓘ Steverustite | Pb52+(OH)5[Cu+(S6+O3S2-)3](H2O)2 |
| Cu | ⓘ Unnamed (Pb-Cu-Al-Si-O) | Pb-Cu-Al-Si-O |
| Zn | Zinc | |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Descloizite | PbZn(VO4)(OH) |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Zn | ⓘ Sauconite | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| Zn | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| Zn | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| Zn | ⓘ Willemite | Zn2SiO4 |
| Zn | ⓘ Zincite | ZnO |
| Zn | ⓘ Sphalerite var. Marmatite | (Zn,Fe)S |
| Zn | ⓘ Descloizite-Mottramite Series | |
| Zn | ⓘ Sphalerite var. Honigblende | ZnS |
| As | Arsenic | |
| As | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| As | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| As | ⓘ Duftite | PbCu(AsO4)(OH) |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Irarsite | (Ir,Ru,Rh,Pt)AsS |
| As | ⓘ Kahlerite | Fe2+(UO2)2(AsO4)2 · 12H2O |
| As | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Metakahlerite | Fe2+(UO2)2(AsO4)2 · 8H2O |
| As | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| As | ⓘ Nickeline | NiAs |
| As | ⓘ Rammelsbergite | NiAs2 |
| As | ⓘ Skutterudite | CoAs3 |
| As | ⓘ Sperrylite | PtAs2 |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| As | ⓘ Uranospinite | Ca(UO2)2(AsO4)2 · 10H2O |
| As | ⓘ Walpurgite | (BiO)4(UO2)(AsO4)2 · 2H2O |
| As | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| As | ⓘ Annabergite var. Calcium-bearing Annabergite | (Ni,Ca)3(AsO4)2 · 8H2O |
| As | ⓘ Nováčekite | Mg(UO2)2(AsO4)2 · 10H2O |
| Se | Selenium | |
| Se | ⓘ Schmiederite | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ru | Ruthenium | |
| Ru | ⓘ Irarsite | (Ir,Ru,Rh,Pt)AsS |
| Rh | Rhodium | |
| Rh | ⓘ Irarsite | (Ir,Ru,Rh,Pt)AsS |
| Pd | Palladium | |
| Pd | ⓘ Froodite | α-PdBi2 |
| Pd | ⓘ Merenskyite | PdTe2 |
| Pd | ⓘ Michenerite | PdBiTe |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Argentopentlandite | Ag(Fe,Ni)8S8 |
| Ag | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Ag | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Ag | ⓘ Matildite | AgBiS2 |
| Ag | ⓘ Native Silver | Ag |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sb | Antimony | |
| Sb | ⓘ Cervantite | Sb3+Sb5+O4 |
| Sb | ⓘ Cuprostibite | Cu2(Sb,Tl) |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Roméite Group | A2(Sb5+)2O6Z |
| Sb | ⓘ Semseyite | Pb9Sb8S21 |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Valentinite | Sb2O3 |
| Sb | ⓘ Rosiaite | PbSb25+O6 |
| Sb | ⓘ Oxyplumboroméite | Pb2Sb2O6O |
| Te | Tellurium | |
| Te | ⓘ Merenskyite | PdTe2 |
| Te | ⓘ Michenerite | PdBiTe |
| Te | ⓘ Tellurobismuthite | Bi2Te3 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Ba | ⓘ Witherite | BaCO3 |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Stolzite | Pb(WO4) |
| Ir | Iridium | |
| Ir | ⓘ Irarsite | (Ir,Ru,Rh,Pt)AsS |
| Pt | Platinum | |
| Pt | ⓘ Irarsite | (Ir,Ru,Rh,Pt)AsS |
| Pt | ⓘ Sperrylite | PtAs2 |
| Au | Gold | |
| Au | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Au | ⓘ Native Gold | Au |
| Tl | Thallium | |
| Tl | ⓘ Cuprostibite | Cu2(Sb,Tl) |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Blixite | Pb8O5(OH)2Cl4 |
| Pb | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Pb | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| Pb | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| Pb | ⓘ Cotunnite | PbCl2 |
| Pb | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| Pb | ⓘ Crocoite | PbCr6+O4 |
| Pb | ⓘ Descloizite | PbZn(VO4)(OH) |
| Pb | ⓘ Duftite | PbCu(AsO4)(OH) |
| Pb | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| Pb | ⓘ Ferrisurite | (Pb,Ca)2.4Fe23+(Si4O10)(CO3)1.7(OH)3 · nH2O |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| Pb | ⓘ Lanarkite | Pb2(SO4)O |
| Pb | ⓘ Lautenthalite | PbCu4(SO4)2(OH)6 · 3H2O |
| Pb | ⓘ Native Lead | Pb |
| Pb | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Litharge | PbO |
| Pb | ⓘ Massicot | PbO |
| Pb | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Mottramite | PbCu(VO4)(OH) |
| Pb | ⓘ Paralaurionite | PbCl(OH) |
| Pb | ⓘ Plumbonacrite | Pb5O(OH)2(CO3)3 |
| Pb | ⓘ Plattnerite | PbO2 |
| Pb | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Pb | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Quenselite | PbMnO2(OH) |
| Pb | ⓘ Schmiederite | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| Pb | ⓘ Scotlandite | PbSO3 |
| Pb | ⓘ Semseyite | Pb9Sb8S21 |
| Pb | ⓘ Stolzite | Pb(WO4) |
| Pb | ⓘ Sundiusite | Pb10(SO4)O8Cl2 |
| Pb | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Aragonite var. Lead-bearing Aragonite | (Ca,Pb)CO3 |
| Pb | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Pb | ⓘ Vandendriesscheite | PbU7O22 · 12H2O |
| Pb | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| Pb | ⓘ Widenmannite | Pb2(OH)2[(UO2)(CO3)2] |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Rosiaite | PbSb25+O6 |
| Pb | ⓘ Descloizite-Mottramite Series | |
| Pb | ⓘ Pyromorphite var. Calcium-bearing Pyromorphite | (Pb,Ca)5(PO4)3Cl |
| Pb | ⓘ Calcite var. Lead-bearing Calcite | (Ca,Pb)CO3 |
| Pb | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Pb | ⓘ Steverustite | Pb52+(OH)5[Cu+(S6+O3S2-)3](H2O)2 |
| Pb | ⓘ Oxyplumboroméite | Pb2Sb2O6O |
| Pb | ⓘ Unnamed (Pb-Cu-Al-Si-O) | Pb-Cu-Al-Si-O |
| Bi | Bismuth | |
| Bi | ⓘ Bismoclite | BiOCl |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Eulytine | Bi4(SiO4)3 |
| Bi | ⓘ Froodite | α-PdBi2 |
| Bi | ⓘ Matildite | AgBiS2 |
| Bi | ⓘ Michenerite | PdBiTe |
| Bi | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| Bi | ⓘ Tellurobismuthite | Bi2Te3 |
| Bi | ⓘ Walpurgite | (BiO)4(UO2)(AsO4)2 · 2H2O |
| U | Uranium | |
| U | ⓘ Boltwoodite | (K,Na)(UO2)(SiO3OH) · 1.5H2O |
| U | ⓘ Kahlerite | Fe2+(UO2)2(AsO4)2 · 12H2O |
| U | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| U | ⓘ Metakahlerite | Fe2+(UO2)2(AsO4)2 · 8H2O |
| U | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| U | ⓘ Uraninite var. Pitchblende | UO2 |
| U | ⓘ Schoepite | (UO2)8O2(OH)12 · 12H2O |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| U | ⓘ Uranospinite | Ca(UO2)2(AsO4)2 · 10H2O |
| U | ⓘ Vandendriesscheite | PbU7O22 · 12H2O |
| U | ⓘ Walpurgite | (BiO)4(UO2)(AsO4)2 · 2H2O |
| U | ⓘ Widenmannite | Pb2(OH)2[(UO2)(CO3)2] |
| U | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| U | ⓘ Nováčekite | Mg(UO2)2(AsO4)2 · 10H2O |
Fossils
There are 126 fossil localities from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 126 |
|---|---|
| Youngest Fossil Listed | 201 Ma (Late/Upper Triassic) |
| Oldest Fossil Listed | 466 Ma (Middle Ordovician) |
| Stratigraphic Units | Click here to view 14 stratigraphic units. |
| Fossils from Region | Click here to show the list. |
| Fossil Localities | Click to show 17 fossil localities |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Dumfries_and_Galloway |
|---|---|
| Wikidata ID: | Q126514 |
| GeoNames ID: | 2650797 |
Localities in this Region
- Scotland
- Dumfries and Galloway
- Archerbeck a Colliery
- Archerbeck b Colliery
- ⭔Auchencairn
- Bankhead c Colliery
- Barlocco Mine
- Blackcraig
- Blinkbonny Colliery
- Byreburn a Colliery
- Byreburn b Colliery
- Cairnsmore
- Canonbie Colliery
- Carsphairn
- Cassencarie
- ⭔Castle Douglas
- Colvend Mine
- Creetown
- ⭔Dalbeattie
- Drumbuie Colliery
- Dundrennan
- Engine Pit
- Eskdale
- Fauldhead Colliery
- Gatehouse of Fleet
- Gateside & Tower Colliery
- Gateside a Colliery
- Gateside b Colliery
- Girthon
- Guildhall Level
- Kinharvie Burn
- Kirkbean
- ⭔Kirkgunzeon
- Dumfries and Galloway
- Scotland
- Dumfries and Galloway
- Kirkgunzeon
- Lady Ann Colliery
- Mabie Forest
- Moffat
- Needle's Eye
- New Abbey
- New Galloway
- Newton Stewart
- Rig Colliery
- Roger Nos 1 & 2 Colliery
- Roger Nos 3 & 4 Colliery
- Sanquhar
- Screel Hill
- ⭔Solway Firth
- Southerness
- Tower Colliery
- ⭔Tundergarth
- Wanlockhead
- Dumfries and Galloway
Other Regions, Features and Areas that Intersect
British and Irish IslesGroup of Islands
Eurasian PlateTectonic Plate
- CaledonidesOrogenic Belt
EuropeContinent
UK
- Scotland
- Leadhills-Wanlockhead Mining DistrictMining District
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther RegionsReferences
New Glencrieff Mine, Wanlockhead, Dumfries and Galloway, Scotland, UK