Leadhills-Wanlockhead Mining District, Scotland, UKi
| Regional Level Types | |
|---|---|
| Leadhills-Wanlockhead Mining District | Mining District |
| Scotland | Country |
| UK | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
A mining district in Southern Scotland that was first active in the late bronze age and finally closed in the 1930s. It is based around the villages of Leadhills in South Lanarkshire and Wanlockhead in Dumfries and Galloway.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities127 valid minerals. 10 (TL) - type locality of valid minerals. 2 erroneous literature entries.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S Habit: very thin metallic inconspicuous sooty coatings on tiny wires of Silver/argentiferous lead, appearing within minutes of being exposed to the atmosphere Colour: black |
| ⓘ Anglesite Formula: PbSO4 Localities: Reported from at least 32 localities in this region. |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 Localities: Reported from at least 17 localities in this region. |
| ⓘ Annabergite Formula: Ni3(AsO4)2 · 8H2O |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Localities: Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Lady Anne Hopetoun shaft (Brow and Hopeful Veins), Wanlock Dod, Leadhills, South Lanarkshire, Scotland, UK High Pirn Mine (Belton Grain Vein and New Vein), Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK ? (more information) Description: May refer to plumbian apatite or mattheddleite. |
| ⓘ Aragonite Formula: CaCO3 Localities: Reported from at least 9 localities in this region. |
| ⓘ Aragonite var. Lead-bearing Aragonite Formula: (Ca,Pb)CO3 References: |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 |
| ⓘ Baryte Formula: BaSO4 Localities: Reported from at least 19 localities in this region. |
| ⓘ Beaverite-(Cu) Formula: Pb(Fe3+2Cu)(SO4)2(OH)6 References: Steve Rust collectionIdentification: XRD |
| ✪ Bechererite Formula: Zn7Cu(OH)13[(SiO(OH)3(SO4)] Habit: Thin crust of minute crystals Colour: Light blue-green |
| ⓘ Beudantite Formula: PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 References: |
| ⓘ Blixite Formula: Pb8O5(OH)2Cl4 |
| ⓘ Boleite Formula: KPb26Ag9Cu24(OH)48Cl62 |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 Localities: Reported from at least 11 localities in this region. |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 33 localities in this region. |
| ⓘ Calcite var. Lead-bearing Calcite Formula: (Ca,Pb)CO3 Description: Recorded as "Plumbocalcite"
"Some Wanlockhead specimens have been recorded as containing up to 9.47% of lead carbonate." |
| ⓘ Caledonite (TL) Formula: Pb5Cu2(SO4)3(CO3)(OH)6 Localities: Reported from at least 14 localities in this region. Type Locality: Leadhills, South Lanarkshire, Scotland, UK |
| ⓘ Cassedanneite Formula: Pb5(CrO4)2(VO4)2 · H2O Localities: Habit: Micro crystals Colour: Yellow |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Cerussite Formula: PbCO3 Localities: Reported from at least 49 localities in this region. |
| ⓘ Chalcocite Formula: Cu2S References: |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 30 localities in this region. |
| ⓘ Chenite (TL) Formula: Pb4Cu(SO4)2(OH)6 Localities: Reported from at least 8 localities in this region. Habit: Bladed Colour: Light blue to green |
| ⓘ 'Chlorite Group' |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 Localities: Reported from at least 24 localities in this region. |
| ⓘ 'Clay minerals' |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ Copiapite Formula: Fe2+Fe3+4(SO4)6(OH)2 · 20H2O Description: As a powdery yellow efflorescence on altered pyrite 'from 160 level, Wanlockhead, Dumfriesshire'. IGS specimen collected by J. Brown in 1916. ID confirmed by X-ray diffraction in 1979. |
| ⓘ Corkite Formula: PbFe3+3(PO4)(SO4)(OH)6 Localities: Belton Grain vein, Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Hopeful Vein, Wanlock Dod, Leadhills, South Lanarkshire, Scotland, UK High Pirn Mine (Belton Grain Vein and New Vein), Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Cove Vein, Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Habit: Micro crystals Colour: Yellow to dark brown |
| ⓘ Cornwallite Formula: Cu5(AsO4)2(OH)4 |
| ⓘ Cotunnite Formula: PbCl2 |
| ⓘ Covellite Formula: CuS Localities: |
| ⓘ Creaseyite Formula: Pb2Cu2Fe3+2(Si4.67Al0.33)O15.33(OH)3 · H2O |
| ⓘ Crocoite Formula: PbCr6+O4 |
| ⓘ Cuprite Formula: Cu2O Colour: red References: |
| ⓘ Cuprite var. Chalcotrichite Formula: Cu2O |
| ⓘ Cuprostibite Formula: Cu2(Sb,Tl) |
| ⓘ Cyanotrichite Formula: Cu4Al2(SO4)(OH)12 · 2H2O |
| ⓘ Descloizite Formula: PbZn(VO4)(OH) Localities: Reported from at least 12 localities in this region. |
| ⓘ 'Descloizite-Mottramite Series' |
| ⓘ Devilline Formula: CaCu4(SO4)2(OH)6 · 3H2O Localities: Habit: Lath-like Colour: Pale Blue to light blue |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Duftite Formula: PbCu(AsO4)(OH) Habit: Thin crusts Colour: Black Description: Recordede on a specimen from Taits Level, Whytes Cleugh. |
| ⓘ Dundasite Formula: PbAl2(CO3)2(OH)4 · H2O |
| ⓘ Elyite Formula: Pb4Cu(SO4)O2(OH)4 · H2O Localities: Susanna Mine (Glennery Scar vein; Susanna vein [Scar vein]; Portobello vein; Humby vein; Lead vein), Leadhills, South Lanarkshire, Scotland, UK Meadowfoot Smelter slag locality, Wanlockhead, Dumfries and Galloway, Scotland, UK Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Cove Vein, Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Pates Knowes Smelter slag locality, Wanlockhead, Dumfries and Galloway, Scotland, UK Description: Livingstone, A. and Macpherson, H.G. (1983): Sprays of lilac needles (up to 0.4 mm) in cavities in small 2 cm sample of litharge, massicot, and cerussite. Sample found in stream bed, Leadhills, Lanarkshire. Presented to RSM in 1981 by Mrs F. Christison. [Identified by X-ray diffraction and electron-probe microanalysis which gave PbO 78.7%, CuO 6.9%, and SO3 6.0%. Elyite probably formed naturally in what may be a dumped flue product.] |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O |
| ⓘ Fassinaite Formula: Pb2(S2O3)(CO3) Description: Colourless; looks a little like sword-shaped anglesite with distorted terminations. |
| ⓘ 'Fayalite-Forsterite Series' |
| ⓘ Ferrisurite Formula: (Pb,Ca)2.4Fe3+2(Si4O10)(CO3)1.7(OH)3 · nH2O |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Formula: CaF2 Locality: Leadhills, South Lanarkshire, Scotland, UK - erroneously reported Description: Fluorite has not been recorded from the Leadhills/Wanlockhead Orefield specimens have been found on old dumps which look remarkably like Fluorite from the north of England, and may have been left there by collectors. Also it is reputed that old miners sold specimens from the north of England but this is unsubstantiated. |
| ⓘ Galena Formula: PbS Localities: Reported from at least 52 localities in this region. |
| ⓘ Goethite Formula: Fe3+O(OH) Localities: Reported from at least 29 localities in this region. |
| ⓘ Goslarite Formula: ZnSO4 · 7H2O |
| ⓘ Greenockite Formula: CdS Localities: |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Colour: colourless References: |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 16 localities in this region. |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O Localities: Reported from at least 19 localities in this region. |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ Hydrocerussite Formula: Pb3(CO3)2(OH)2 Localities: Reported from at least 10 localities in this region. |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 Localities: Raiks Vein (incl. Broadlaw Low Level), Mine Hill-Broad Law, Leadhills, South Lanarkshire, Scotland, UK Gordon's Vein, Snar Water, Leadhills, South Lanarkshire, Scotland, UK Katystaklin Vein, Leadhills, South Lanarkshire, Scotland, UK Straitstep Vein (Margaret's Vein), Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Meadowfoot Mine, Wanlockhead, Dumfries and Galloway, Scotland, UK |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Kegelite Formula: Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| ⓘ Lanarkite (TL) Formula: Pb2(SO4)O Localities: Reported from at least 19 localities in this region. Habit: Bladed Colour: Colourless to pale yellow |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O Localities: Reported from at least 7 localities in this region. |
| ⓘ Lautenthalite Formula: PbCu4(SO4)2(OH)6 · 3H2O References: |
| ⓘ Leadhillite (TL) Formula: Pb4(CO3)2(SO4)(OH)2 Localities: Reported from at least 23 localities in this region. Habit: Tabular Colour: Colourless-white, pale yellow, pale brown |
| ⓘ 'Limonite' Description: Mostly as crusts commonly coats other species and intermixed with clay minerals. |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 Localities: Reported from at least 21 localities in this region. Habit: Prismatic to tabular crystals Colour: Blue Description: Associated with malachite and cerussite. |
| ⓘ Litharge Formula: PbO Localities: Description: Red plates (up to 1.0 mm) in sample from stream bed. Identified by X-ray diffraction. |
| ⓘ Macphersonite (TL) Formula: Pb4(CO3)2(SO4)(OH)2 Localities: Habit: Tabular Colour: Light Brown |
| ⓘ Magnesite Formula: MgCO3 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 28 localities in this region. |
| ⓘ Marcasite Formula: FeS2 Localities: Belton Grain vein, Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Brow Vein, Wanlock Dod, Leadhills, South Lanarkshire, Scotland, UK Wilsons shaft (Brown's vein), Mine Hill, Leadhills, South Lanarkshire, Scotland, UK Straitstep Vein (Margaret's Vein), Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Glencrief Burn, Wanlockhead, Dumfries and Galloway, Scotland, UK |
| ⓘ Massicot Formula: PbO Localities: Description: Soft, cream-yellow earthy mineral in sample from stream bed. Identified by X-ray diffraction. |
| ⓘ Mattheddleite (TL) Formula: Pb5(SiO4)1.5(SO4)1.5(Cl,OH) Localities: Reported from at least 10 localities in this region. Type Locality: Leadhills, South Lanarkshire, Scotland, UK |
| ⓘ Melanterite Formula: Fe2+(H2O)6SO4 · H2O |
| ⓘ 'Melilite Group' Formula: Ca2M(XSiO7) |
| ⓘ Mimetite ? Formula: Pb5(AsO4)3Cl Localities: Belton Grain vein, Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK ? (more information) Wilsons shaft (Brown's vein), Mine Hill, Leadhills, South Lanarkshire, Scotland, UK ? (more information) Browns Vein, Mine Hill, Leadhills, South Lanarkshire, Scotland, UK ? (more information) |
| ⓘ Minium Formula: Pb3O4 |
| ⓘ Monohydrocalcite Formula: CaCO3 · H2O Description: Natural History Museum London x-ray file number 4068F References: |
| ⓘ Mottramite Formula: PbCu(VO4)(OH) Localities: Reported from at least 14 localities in this region. |
| ⓘ Namuwite ? Formula: Zn4(SO4)(OH)6 · 4H2O Description: A XRD in 19/05/2025 analysis of namuwite from this location, has given an odd result and remains a maybe.
. References: |
| ⓘ Native Copper Formula: Cu Colour: copper-red Description: Also found as a Zinc-bearing variety. References: |
| ⓘ Native Gold Formula: Au |
| ⓘ Native Lead Formula: Pb Description: argentiferous in some cases |
| ⓘ Native Silver Formula: Ag |
| ⓘ Native Sulphur Formula: S8 Localities: Belton Grain vein, Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK New Glencrieff Mine (Wanlockhead Mine; East and West branch of New Glencrieff Vein), Wanlockhead, Dumfries and Galloway, Scotland, UK Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Hopeful Vein, Wanlock Dod, Leadhills, South Lanarkshire, Scotland, UK |
| ⓘ Nickeline Formula: NiAs References: |
| ⓘ Olivenite Formula: Cu2(AsO4)(OH) Localities: Glengonnar shaft (Brow and Browns Veins), Mine Hill, Leadhills, South Lanarkshire, Scotland, UK Wilsons shaft (Brown's vein), Mine Hill, Leadhills, South Lanarkshire, Scotland, UK Dobbies Vein, Mine Hill, Leadhills, South Lanarkshire, Scotland, UK Browns Vein, Mine Hill, Leadhills, South Lanarkshire, Scotland, UK |
| ⓘ Oxyplumboroméite Formula: Pb2Sb2O6O References: |
| ⓘ Palygorskite Formula: ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| ⓘ Paralaurionite Formula: PbCl(OH) |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 |
| ⓘ Phoenicochroite Formula: Pb2(CrO4)O Colour: Red to orange-red Description: Associated with pyromorphite, leadhillite, and cerussite. Temple's 'phoenicochroite' probably = impure phoenicochroite, while his 'new mineral' almost certainly = pure phoenicochroite. See S. A. Williams (1974) Bull. Brit. Mus. (Nat. Hist.), Mineral. 2, 394. |
| ⓘ Phosphohedyphane Formula: Ca2Pb3(PO4)3Cl Localities: Belton Grain vein, Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK New Glencrieff Mine (Wanlockhead Mine; East and West branch of New Glencrieff Vein), Wanlockhead, Dumfries and Galloway, Scotland, UK Cove Vein, Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Wilsons Vein, Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Lady Anne Hopetoun shaft (Brow and Hopeful Veins), Wanlock Dod, Leadhills, South Lanarkshire, Scotland, UK |
| ⓘ Plattnerite (TL) Formula: PbO2 Localities: Reported from at least 7 localities in this region. Type Locality: Leadhills, South Lanarkshire, Scotland, UK Description: There is some dispute about the confirmation of plattnerite from the Leadhills-Wanlockhead Orefield. Although it has been now confirmed on specimens collected from the Susanna Mine in 2010. It would appear that many old specimens have been found wanting, mostly turning out to be Mn-Oxides or mottramite. Work is continuing to try and locate an authentic 'old' specimen in the Natural History Museum London and the Hunterian Museum, Glasgow. |
| ⓘ Plumbogummite Formula: PbAl3(PO4)(PO3OH)(OH)6 Localities: Belton Grain vein, Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Raiks Vein (incl. Broadlaw Low Level), Mine Hill-Broad Law, Leadhills, South Lanarkshire, Scotland, UK Hopeful Vein, Wanlock Dod, Leadhills, South Lanarkshire, Scotland, UK High Pirn Mine (Belton Grain Vein and New Vein), Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK |
| ⓘ Plumbonacrite (TL) Formula: Pb5O(OH)2(CO3)3 Type Locality: Description: Work is continuing to confirm the occurance of plumbonacrite in the Leadhills-Wanlockhead Orefield. |
| ⓘ Posnjakite Formula: Cu4(SO4)(OH)6 · H2O References: |
| ⓘ Pseudoboleite Formula: Pb31Cu24Cl62(OH)48 |
| ⓘ 'Psilomelane' |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 23 localities in this region. |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl Localities: Reported from at least 48 localities in this region. |
| ⓘ Pyromorphite var. Calcium-bearing Pyromorphite Formula: (Pb,Ca)5(PO4)3Cl Localities: New Glencrieff Mine (Wanlockhead Mine; East and West branch of New Glencrieff Vein), Wanlockhead, Dumfries and Galloway, Scotland, UK Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK High Pirn Mine (Belton Grain Vein and New Vein), Wanlock Dod-Whytes Cleuch, Wanlockhead, Dumfries and Galloway, Scotland, UK Old Glencrieff Vein, Wanlockhead, Dumfries and Galloway, Scotland, UK |
| ⓘ Pyromorphite var. Collieite Formula: Pb5(PO4)3Cl Colour: Black Description: A black, botryoidal, vanadian and calcian variety of Pyromorphite. |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 References: S. Rust collection.Identified by Steve Rust: Visual Identification |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 39 localities in this region. |
| ⓘ Queitite Formula: Pb4Zn2(SO4)(SiO4)(Si2O7) Habit: Micro balls and botryoidal crusts Colour: White |
| ⓘ Rammelsbergite Formula: NiAs2 References: |
| ⓘ Redgillite Formula: Cu6(SO4)(OH)10 · H2O Localities: Colour: Ligth Green Description: Redgillite was tentatively identified on one specimen collected from the Broadlaw Low Level. The Redgillite is associated with confirmed Bechererite, Leadhillite and possible namuwite. |
| ⓘ 'Roméite Group' Formula: A2(Sb5+)2O6Z |
| ⓘ Rosiaite Formula: PbSb5+2O6 |
| ⓘ Sauconite Formula: Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O References: Steve Rust collectionIdentification: XRD |
| ⓘ Schmiederite Formula: Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 Description: NAM London X-Ray File 4377F (near Schmiederite) References: |
| ⓘ Schulenbergite Formula: (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| ⓘ Scotlandite (TL) Formula: PbSO3 Localities: Reported from at least 7 localities in this region. Habit: Bladed Colour: Colourless, white, brown and yellow |
| ⓘ Serpierite Formula: Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O Colour: blue-green References: |
| ⓘ Shattuckite Formula: Cu5(Si2O6)2(OH)2 |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Smithsonite Formula: ZnCO3 Localities: Description: Listed as "calamine (zinc carbonate)". |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 20 localities in this region. |
| ⓘ Steverustite Formula: Pb2+5(OH)5[Cu+(S6+O3S2-)3](H2O)2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Stolzite Formula: Pb(WO4) |
| ⓘ Strontianite Formula: SrCO3 |
| ✪ Sundiusite Formula: Pb10(SO4)O8Cl2 Description: Natural History Museum London X-ray File number 6939F shows the mineral to be near Sundiusite but not100%. |
| ⓘ Susannite (TL) Formula: Pb4(CO3)2(SO4)(OH)2 Localities: Reported from at least 13 localities in this region. Habit: Tabular to prismatic Colour: Colorless-white, pale blue, pale green, pale brown |
| ⓘ Tenorite Formula: CuO |
| ⓘ Titanite Formula: CaTi(SiO4)O |
| ⓘ 'Unnamed (Cu-Pb Silicate ?)' Formula: Pb, Cu, Si, O ? Localities: Colour: Blue to white Description: Collected on two specimens associated with caledonite. |
| ⓘ 'Unnamed (Pb-Cu-Al-Si-O)' Formula: Pb-Cu-Al-Si-O References: Steve Rust collectionIdentified by Steve Rust: SEM-EDS |
| ⓘ Valentinite Formula: Sb2O3 |
| ⓘ Vanadinite Formula: Pb5(VO4)3Cl Localities: Reported from at least 16 localities in this region. Colour: Pale brown to Orange-red |
| ⓘ Formula: Pb2Cu(CrO4)(PO4)(OH) Localities: Description: Davies' Vauquelinite = Mottramite. See Bannister, F.A. (1933) The identity of mottramite and psittacinite with cupriferous descloizite. Mineralogical Magazine, vol. 23, n° 141, 376-386. |
| ⓘ Veszelyite Formula: (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| ⓘ 'Wad' |
| ⓘ Willemite Formula: Zn2SiO4 |
| ⓘ Witherite Formula: BaCO3 |
| ⓘ Wroewolfeite Formula: Cu4(SO4)(OH)6 · 2H2O Localities: Colour: blue |
| ⓘ Wulfenite Formula: Pb(MoO4) Localities: Reported from at least 12 localities in this region. |
| ⓘ Wulfenite var. Vanadium-bearing Wulfenite Formula: Pb[(Mo,V)O4] Habit: Minute, imperfectly developed. Colour: Deep Aurora-red. References: |
| ⓘ Wüstite Formula: FeO |
| ⓘ Zincite Formula: ZnO |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Lead | 1.AA.05 | Pb |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Cuprostibite | 2.AA.20 | Cu2(Sb,Tl) |
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Rammelsbergite | 2.EB.15a | NiAs2 |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| Group 3 - Halides | |||
| ⓘ | Fluorite ? | 3.AB.25 | CaF2 |
| ⓘ | Cotunnite | 3.AB.85 | PbCl2 |
| ⓘ | Pseudoboleite | 3.DB.10 | Pb31Cu24Cl62(OH)48 |
| ⓘ | Boleite | 3.DB.15 | KPb26Ag9Cu24(OH)48Cl62 |
| ⓘ | Paralaurionite | 3.DC.05 | PbCl(OH) |
| ⓘ | Blixite | 3.DC.50 | Pb8O5(OH)2Cl4 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Cuprite var. Chalcotrichite | 4.AA.10 | Cu2O |
| ⓘ | 4.AA.10 | Cu2O | |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Zincite | 4.AB.20 | ZnO |
| ⓘ | Wüstite | 4.AB.25 | FeO |
| ⓘ | Litharge | 4.AC.20 | PbO |
| ⓘ | Massicot | 4.AC.25 | PbO |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Minium | 4.BD.05 | Pb3O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Valentinite | 4.CB.55 | Sb2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Plattnerite (TL) | 4.DB.05 | PbO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | 'Roméite Group' | 4.DH. | A2(Sb5+)2O6Z |
| ⓘ | Oxyplumboroméite | 4.DH. | Pb2Sb2O6O |
| ⓘ | Rosiaite | 4.DH.25 | PbSb5+2O6 |
| ⓘ | Scotlandite (TL) | 4.JE.20 | PbSO3 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Calcite var. Lead-bearing Calcite | 5.AB.05 | (Ca,Pb)CO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Strontianite | 5.AB.15 | SrCO3 |
| ⓘ | Aragonite var. Lead-bearing Aragonite | 5.AB.15 | (Ca,Pb)CO3 |
| ⓘ | Witherite | 5.AB.15 | BaCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Hydrocerussite | 5.BE.10 | Pb3(CO3)2(OH)2 |
| ⓘ | Plumbonacrite (TL) | 5.BE.15 | Pb5O(OH)2(CO3)3 |
| ⓘ | Leadhillite (TL) | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Macphersonite (TL) | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Susannite (TL) | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Monohydrocalcite | 5.CB.20 | CaCO3 · H2O |
| ⓘ | Dundasite | 5.DB.10 | PbAl2(CO3)2(OH)4 · H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Beaverite-(Cu) | 7.BC.10 | Pb(Fe3+2Cu)(SO4)2(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Caledonite (TL) | 7.BC.50 | Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Schmiederite | 7.BC.65 | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| ⓘ | Chenite (TL) | 7.BC.70 | Pb4Cu(SO4)2(OH)6 |
| ⓘ | Lanarkite (TL) | 7.BD.40 | Pb2(SO4)O |
| ⓘ | Sundiusite | 7.BD.70 | Pb10(SO4)O8Cl2 |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6SO4 · H2O |
| ⓘ | Goslarite | 7.CB.40 | ZnSO4 · 7H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Copiapite | 7.DB.35 | Fe2+Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Posnjakite | 7.DD.10 | Cu4(SO4)(OH)6 · H2O |
| ⓘ | Wroewolfeite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Devilline | 7.DD.30 | CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Serpierite | 7.DD.30 | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| ⓘ | Namuwite ? | 7.DD.50 | Zn4(SO4)(OH)6 · 4H2O |
| ⓘ | Bechererite | 7.DD.55 | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| ⓘ | Redgillite | 7.DD.70 | Cu6(SO4)(OH)10 · H2O |
| ⓘ | Schulenbergite | 7.DD.80 | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| ⓘ | Cyanotrichite | 7.DE.10 | Cu4Al2(SO4)(OH)12 · 2H2O |
| ⓘ | Elyite | 7.DF.65 | Pb4Cu(SO4)O2(OH)4 · H2O |
| ⓘ | Lautenthalite | 7.DF.70 | PbCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Crocoite | 7.FA.20 | PbCr6+O4 |
| ⓘ | Phoenicochroite | 7.FB.05 | Pb2(CrO4)O |
| ⓘ | Vauquelinite ? | 7.FC.05 | Pb2Cu(CrO4)(PO4)(OH) |
| ⓘ | Cassedanneite | 7.FC.20 | Pb5(CrO4)2(VO4)2 · H2O |
| ⓘ | Stolzite | 7.GA.05 | Pb(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| ⓘ | var. Vanadium-bearing Wulfenite | 7.GA.05 | Pb[(Mo,V)O4] |
| ⓘ | Steverustite | 7.JA.10 | Pb2+5(OH)5[Cu+(S6+O3S2-)3](H2O)2 |
| ⓘ | Fassinaite | 7.JA.15 | Pb2(S2O3)(CO3) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Olivenite | 8.BB.30 | Cu2(AsO4)(OH) |
| ⓘ | Cornwallite | 8.BD.05 | Cu5(AsO4)2(OH)4 |
| ⓘ | Duftite | 8.BH.35 | PbCu(AsO4)(OH) |
| ⓘ | Descloizite | 8.BH.40 | PbZn(VO4)(OH) |
| ⓘ | Mottramite | 8.BH.40 | PbCu(VO4)(OH) |
| ⓘ | Beudantite | 8.BL.05 | PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ | Corkite | 8.BL.05 | PbFe3+3(PO4)(SO4)(OH)6 |
| ⓘ | Plumbogummite | 8.BL.10 | PbAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Mimetite ? | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Vanadinite | 8.BN.05 | Pb5(VO4)3Cl |
| ⓘ | Pyromorphite var. Calcium-bearing Pyromorphite | 8.BN.05 | (Pb,Ca)5(PO4)3Cl |
| ⓘ | Phosphohedyphane | 8.BN.05 | Ca2Pb3(PO4)3Cl |
| ⓘ | Pyromorphite var. Collieite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Annabergite | 8.CE.40 | Ni3(AsO4)2 · 8H2O |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Veszelyite | 8.DE.30 | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| Group 9 - Silicates | |||
| ⓘ | Willemite | 9.AA.05 | Zn2SiO4 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Mattheddleite (TL) | 9.AH.25 | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Queitite | 9.BF.20 | Pb4Zn2(SO4)(SiO4)(Si2O7) |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Shattuckite | 9.DB.40 | Cu5(Si2O6)2(OH)2 |
| ⓘ | Sauconite | 9.EC.45 | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| ⓘ | Ferrisurite | 9.EC.75 | (Pb,Ca)2.4Fe3+2(Si4O10)(CO3)1.7(OH)3 · nH2O |
| ⓘ | Kegelite | 9.EC.80 | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Palygorskite | 9.EE.20 | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| ⓘ | Creaseyite | 9.HH.15 | Pb2Cu2Fe3+2(Si4.67Al0.33)O15.33(OH)3 · H2O |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Clay minerals' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Wad' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Descloizite-Mottramite Series' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Unnamed (Cu-Pb Silicate ?)' | - | Pb, Cu, Si, O ? |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Melilite Group' | - | Ca2M(XSiO7) |
| ⓘ | 'Unnamed (Pb-Cu-Al-Si-O)' | - | Pb-Cu-Al-Si-O |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| H | ⓘ Bechererite | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| H | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Blixite | Pb8O5(OH)2Cl4 |
| H | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| H | ⓘ Cassedanneite | Pb5(CrO4)2(VO4)2 · H2O |
| H | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| H | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| H | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| H | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| H | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| H | ⓘ Descloizite | PbZn(VO4)(OH) |
| H | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Duftite | PbCu(AsO4)(OH) |
| H | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| H | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Ferrisurite | (Pb,Ca)2.4Fe23+(Si4O10)(CO3)1.7(OH)3 · nH2O |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Goslarite | ZnSO4 · 7H2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Lautenthalite | PbCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Macphersonite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| H | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| H | ⓘ Monohydrocalcite | CaCO3 · H2O |
| H | ⓘ Mottramite | PbCu(VO4)(OH) |
| H | ⓘ Namuwite | Zn4(SO4)(OH)6 · 4H2O |
| H | ⓘ Olivenite | Cu2(AsO4)(OH) |
| H | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| H | ⓘ Paralaurionite | PbCl(OH) |
| H | ⓘ Plumbonacrite | Pb5O(OH)2(CO3)3 |
| H | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| H | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| H | ⓘ Sauconite | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| H | ⓘ Schmiederite | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| H | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| H | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| H | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| H | ⓘ Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| H | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Descloizite-Mottramite Series | |
| H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | ⓘ Redgillite | Cu6(SO4)(OH)10 · H2O |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Steverustite | Pb52+(OH)5[Cu+(S6+O3S2-)3](H2O)2 |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| C | ⓘ Ferrisurite | (Pb,Ca)2.4Fe23+(Si4O10)(CO3)1.7(OH)3 · nH2O |
| C | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| C | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Macphersonite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Monohydrocalcite | CaCO3 · H2O |
| C | ⓘ Plumbonacrite | Pb5O(OH)2(CO3)3 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Strontianite | SrCO3 |
| C | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Aragonite var. Lead-bearing Aragonite | (Ca,Pb)CO3 |
| C | ⓘ Witherite | BaCO3 |
| C | ⓘ Calcite var. Lead-bearing Calcite | (Ca,Pb)CO3 |
| C | ⓘ Fassinaite | Pb2(S2O3)(CO3) |
| O | Oxygen | |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| O | ⓘ Bechererite | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| O | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Blixite | Pb8O5(OH)2Cl4 |
| O | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| O | ⓘ Cassedanneite | Pb5(CrO4)2(VO4)2 · H2O |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| O | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| O | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| O | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| O | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| O | ⓘ Crocoite | PbCr6+O4 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| O | ⓘ Descloizite | PbZn(VO4)(OH) |
| O | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Duftite | PbCu(AsO4)(OH) |
| O | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| O | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Ferrisurite | (Pb,Ca)2.4Fe23+(Si4O10)(CO3)1.7(OH)3 · nH2O |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Goslarite | ZnSO4 · 7H2O |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| O | ⓘ Lanarkite | Pb2(SO4)O |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Lautenthalite | PbCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Litharge | PbO |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Macphersonite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Massicot | PbO |
| O | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| O | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Minium | Pb3O4 |
| O | ⓘ Monohydrocalcite | CaCO3 · H2O |
| O | ⓘ Mottramite | PbCu(VO4)(OH) |
| O | ⓘ Namuwite | Zn4(SO4)(OH)6 · 4H2O |
| O | ⓘ Olivenite | Cu2(AsO4)(OH) |
| O | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| O | ⓘ Paralaurionite | PbCl(OH) |
| O | ⓘ Phoenicochroite | Pb2(CrO4)O |
| O | ⓘ Plumbonacrite | Pb5O(OH)2(CO3)3 |
| O | ⓘ Plattnerite | PbO2 |
| O | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| O | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Queitite | Pb4Zn2(SO4)(SiO4)(Si2O7) |
| O | ⓘ Roméite Group | A2(Sb5+)2O6Z |
| O | ⓘ Sauconite | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| O | ⓘ Schmiederite | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| O | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| O | ⓘ Scotlandite | PbSO3 |
| O | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Stolzite | Pb(WO4) |
| O | ⓘ Strontianite | SrCO3 |
| O | ⓘ Sundiusite | Pb10(SO4)O8Cl2 |
| O | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Aragonite var. Lead-bearing Aragonite | (Ca,Pb)CO3 |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Valentinite | Sb2O3 |
| O | ⓘ Vanadinite | Pb5(VO4)3Cl |
| O | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| O | ⓘ Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| O | ⓘ Willemite | Zn2SiO4 |
| O | ⓘ Witherite | BaCO3 |
| O | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Wüstite | FeO |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Zincite | ZnO |
| O | ⓘ Rosiaite | PbSb25+O6 |
| O | ⓘ Fayalite-Forsterite Series | |
| O | ⓘ Descloizite-Mottramite Series | |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Redgillite | Cu6(SO4)(OH)10 · H2O |
| O | ⓘ Unnamed (Cu-Pb Silicate ?) | Pb, Cu, Si, O ? |
| O | ⓘ Pyromorphite var. Calcium-bearing Pyromorphite | (Pb,Ca)5(PO4)3Cl |
| O | ⓘ Calcite var. Lead-bearing Calcite | (Ca,Pb)CO3 |
| O | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Melilite Group | Ca2M(XSiO7) |
| O | ⓘ Pyromorphite var. Collieite | Pb5(PO4)3Cl |
| O | ⓘ Wulfenite var. Vanadium-bearing Wulfenite | Pb[(Mo,V)O4] |
| O | ⓘ Steverustite | Pb52+(OH)5[Cu+(S6+O3S2-)3](H2O)2 |
| O | ⓘ Fassinaite | Pb2(S2O3)(CO3) |
| O | ⓘ Oxyplumboroméite | Pb2Sb2O6O |
| O | ⓘ Unnamed (Pb-Cu-Al-Si-O) | Pb-Cu-Al-Si-O |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Sauconite | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| Mg | Magnesium | |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Mg | ⓘ Fayalite-Forsterite Series | |
| Al | Aluminium | |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| Al | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| Al | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| Al | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| Al | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Al | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Sauconite | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Al | ⓘ Unnamed (Pb-Cu-Al-Si-O) | Pb-Cu-Al-Si-O |
| Si | Silicon | |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Bechererite | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| Si | ⓘ Ferrisurite | (Pb,Ca)2.4Fe23+(Si4O10)(CO3)1.7(OH)3 · nH2O |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| Si | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| Si | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Queitite | Pb4Zn2(SO4)(SiO4)(Si2O7) |
| Si | ⓘ Sauconite | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| Si | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Willemite | Zn2SiO4 |
| Si | ⓘ Fayalite-Forsterite Series | |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Unnamed (Cu-Pb Silicate ?) | Pb, Cu, Si, O ? |
| Si | ⓘ Melilite Group | Ca2M(XSiO7) |
| Si | ⓘ Unnamed (Pb-Cu-Al-Si-O) | Pb-Cu-Al-Si-O |
| P | Phosphorus | |
| P | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| P | ⓘ Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| P | ⓘ Pyromorphite var. Calcium-bearing Pyromorphite | (Pb,Ca)5(PO4)3Cl |
| P | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| P | ⓘ Pyromorphite var. Collieite | Pb5(PO4)3Cl |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| S | ⓘ Bechererite | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| S | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| S | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| S | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| S | ⓘ Galena | PbS |
| S | ⓘ Goslarite | ZnSO4 · 7H2O |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| S | ⓘ Lanarkite | Pb2(SO4)O |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Lautenthalite | PbCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Macphersonite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| S | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| S | ⓘ Namuwite | Zn4(SO4)(OH)6 · 4H2O |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Queitite | Pb4Zn2(SO4)(SiO4)(Si2O7) |
| S | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| S | ⓘ Scotlandite | PbSO3 |
| S | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Sundiusite | Pb10(SO4)O8Cl2 |
| S | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Redgillite | Cu6(SO4)(OH)10 · H2O |
| S | ⓘ Steverustite | Pb52+(OH)5[Cu+(S6+O3S2-)3](H2O)2 |
| S | ⓘ Fassinaite | Pb2(S2O3)(CO3) |
| Cl | Chlorine | |
| Cl | ⓘ Blixite | Pb8O5(OH)2Cl4 |
| Cl | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Cl | ⓘ Cotunnite | PbCl2 |
| Cl | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Paralaurionite | PbCl(OH) |
| Cl | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Sundiusite | Pb10(SO4)O8Cl2 |
| Cl | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | ⓘ Pyromorphite var. Calcium-bearing Pyromorphite | (Pb,Ca)5(PO4)3Cl |
| Cl | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Cl | ⓘ Pyromorphite var. Collieite | Pb5(PO4)3Cl |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Ca | Calcium | |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Ferrisurite | (Pb,Ca)2.4Fe23+(Si4O10)(CO3)1.7(OH)3 · nH2O |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Monohydrocalcite | CaCO3 · H2O |
| Ca | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Aragonite var. Lead-bearing Aragonite | (Ca,Pb)CO3 |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | ⓘ Pyromorphite var. Calcium-bearing Pyromorphite | (Pb,Ca)5(PO4)3Cl |
| Ca | ⓘ Calcite var. Lead-bearing Calcite | (Ca,Pb)CO3 |
| Ca | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | ⓘ Melilite Group | Ca2M(XSiO7) |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| V | Vanadium | |
| V | ⓘ Cassedanneite | Pb5(CrO4)2(VO4)2 · H2O |
| V | ⓘ Descloizite | PbZn(VO4)(OH) |
| V | ⓘ Mottramite | PbCu(VO4)(OH) |
| V | ⓘ Vanadinite | Pb5(VO4)3Cl |
| V | ⓘ Descloizite-Mottramite Series | |
| V | ⓘ Wulfenite var. Vanadium-bearing Wulfenite | Pb[(Mo,V)O4] |
| Cr | Chromium | |
| Cr | ⓘ Cassedanneite | Pb5(CrO4)2(VO4)2 · H2O |
| Cr | ⓘ Crocoite | PbCr6+O4 |
| Cr | ⓘ Phoenicochroite | Pb2(CrO4)O |
| Cr | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| Mn | Manganese | |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Fe | Iron | |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Fe | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| Fe | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| Fe | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| Fe | ⓘ Ferrisurite | (Pb,Ca)2.4Fe23+(Si4O10)(CO3)1.7(OH)3 · nH2O |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Wüstite | FeO |
| Fe | ⓘ Fayalite-Forsterite Series | |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Ni | Nickel | |
| Ni | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| Ni | ⓘ Nickeline | NiAs |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Rammelsbergite | NiAs2 |
| Cu | Copper | |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Cu | ⓘ Bechererite | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| Cu | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| Cu | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Cuprostibite | Cu2(Sb,Tl) |
| Cu | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Duftite | PbCu(AsO4)(OH) |
| Cu | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Lautenthalite | PbCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Mottramite | PbCu(VO4)(OH) |
| Cu | ⓘ Olivenite | Cu2(AsO4)(OH) |
| Cu | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| Cu | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| Cu | ⓘ Schmiederite | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| Cu | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| Cu | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| Cu | ⓘ Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| Cu | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Descloizite-Mottramite Series | |
| Cu | ⓘ Redgillite | Cu6(SO4)(OH)10 · H2O |
| Cu | ⓘ Unnamed (Cu-Pb Silicate ?) | Pb, Cu, Si, O ? |
| Cu | ⓘ Steverustite | Pb52+(OH)5[Cu+(S6+O3S2-)3](H2O)2 |
| Cu | ⓘ Unnamed (Pb-Cu-Al-Si-O) | Pb-Cu-Al-Si-O |
| Zn | Zinc | |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Bechererite | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| Zn | ⓘ Descloizite | PbZn(VO4)(OH) |
| Zn | ⓘ Goslarite | ZnSO4 · 7H2O |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Namuwite | Zn4(SO4)(OH)6 · 4H2O |
| Zn | ⓘ Queitite | Pb4Zn2(SO4)(SiO4)(Si2O7) |
| Zn | ⓘ Sauconite | Na0.3Zn3((Si,Al)4O10)(OH)2 · 4H2O |
| Zn | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| Zn | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| Zn | ⓘ Willemite | Zn2SiO4 |
| Zn | ⓘ Zincite | ZnO |
| Zn | ⓘ Descloizite-Mottramite Series | |
| As | Arsenic | |
| As | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| As | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| As | ⓘ Duftite | PbCu(AsO4)(OH) |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Nickeline | NiAs |
| As | ⓘ Olivenite | Cu2(AsO4)(OH) |
| As | ⓘ Rammelsbergite | NiAs2 |
| Se | Selenium | |
| Se | ⓘ Schmiederite | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| Sr | Strontium | |
| Sr | ⓘ Strontianite | SrCO3 |
| Mo | Molybdenum | |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Mo | ⓘ Wulfenite var. Vanadium-bearing Wulfenite | Pb[(Mo,V)O4] |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Ag | ⓘ Native Silver | Ag |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sb | Antimony | |
| Sb | ⓘ Cuprostibite | Cu2(Sb,Tl) |
| Sb | ⓘ Roméite Group | A2(Sb5+)2O6Z |
| Sb | ⓘ Valentinite | Sb2O3 |
| Sb | ⓘ Rosiaite | PbSb25+O6 |
| Sb | ⓘ Oxyplumboroméite | Pb2Sb2O6O |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Witherite | BaCO3 |
| W | Tungsten | |
| W | ⓘ Stolzite | Pb(WO4) |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Tl | Thallium | |
| Tl | ⓘ Cuprostibite | Cu2(Sb,Tl) |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Pb | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Blixite | Pb8O5(OH)2Cl4 |
| Pb | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Pb | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Pb | ⓘ Cassedanneite | Pb5(CrO4)2(VO4)2 · H2O |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| Pb | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| Pb | ⓘ Cotunnite | PbCl2 |
| Pb | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| Pb | ⓘ Crocoite | PbCr6+O4 |
| Pb | ⓘ Descloizite | PbZn(VO4)(OH) |
| Pb | ⓘ Duftite | PbCu(AsO4)(OH) |
| Pb | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| Pb | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| Pb | ⓘ Ferrisurite | (Pb,Ca)2.4Fe23+(Si4O10)(CO3)1.7(OH)3 · nH2O |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| Pb | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| Pb | ⓘ Lanarkite | Pb2(SO4)O |
| Pb | ⓘ Lautenthalite | PbCu4(SO4)2(OH)6 · 3H2O |
| Pb | ⓘ Native Lead | Pb |
| Pb | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Litharge | PbO |
| Pb | ⓘ Macphersonite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Massicot | PbO |
| Pb | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Minium | Pb3O4 |
| Pb | ⓘ Mottramite | PbCu(VO4)(OH) |
| Pb | ⓘ Paralaurionite | PbCl(OH) |
| Pb | ⓘ Phoenicochroite | Pb2(CrO4)O |
| Pb | ⓘ Plumbonacrite | Pb5O(OH)2(CO3)3 |
| Pb | ⓘ Plattnerite | PbO2 |
| Pb | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Pb | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Queitite | Pb4Zn2(SO4)(SiO4)(Si2O7) |
| Pb | ⓘ Schmiederite | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| Pb | ⓘ Scotlandite | PbSO3 |
| Pb | ⓘ Stolzite | Pb(WO4) |
| Pb | ⓘ Sundiusite | Pb10(SO4)O8Cl2 |
| Pb | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Aragonite var. Lead-bearing Aragonite | (Ca,Pb)CO3 |
| Pb | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Pb | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Rosiaite | PbSb25+O6 |
| Pb | ⓘ Descloizite-Mottramite Series | |
| Pb | ⓘ Unnamed (Cu-Pb Silicate ?) | Pb, Cu, Si, O ? |
| Pb | ⓘ Pyromorphite var. Calcium-bearing Pyromorphite | (Pb,Ca)5(PO4)3Cl |
| Pb | ⓘ Calcite var. Lead-bearing Calcite | (Ca,Pb)CO3 |
| Pb | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Pb | ⓘ Pyromorphite var. Collieite | Pb5(PO4)3Cl |
| Pb | ⓘ Wulfenite var. Vanadium-bearing Wulfenite | Pb[(Mo,V)O4] |
| Pb | ⓘ Steverustite | Pb52+(OH)5[Cu+(S6+O3S2-)3](H2O)2 |
| Pb | ⓘ Fassinaite | Pb2(S2O3)(CO3) |
| Pb | ⓘ Oxyplumboroméite | Pb2Sb2O6O |
| Pb | ⓘ Unnamed (Pb-Cu-Al-Si-O) | Pb-Cu-Al-Si-O |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Localities in this Region
- Scotland
- Dumfries and Galloway
- Sanquhar
- Wanlockhead
- South Lanarkshire
- Dumfries and Galloway
- Scotland
- South Lanarkshire
- Leadhills
- Horners Vein (Jeffrey's Vein; Carse's Vein)
- Katystaklin Vein
- Laverock Hall
- Long Cleugh
- Meadowhead Vein
- Mill Vein
- Mine Hill-Broad Law
- Mine Hill
- Risping Cleuch
- Roan Burn Vein
- Short Cleuch
- Snar Water
- Susanna Mine (Glennery Scar vein; Susanna vein [Scar vein]; Portobello vein; Humby vein; Lead vein)
- Wanlock Dod
- Wool Law
- Windgate Burn
- Leadhills
- South Lanarkshire
Other Regions, Features and Areas that Intersect
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Temple, A. K. (1954) The Paragenetical Mineralogy of the Leadhills and Wanlockhead Lead and Zinc Deposits. The University of Leeds.
Temple, A. K. (1956) V.—The Leadhills-Wanlockhead Lead and Zinc Deposits. Transactions of the Royal Society of Edinburgh, 63 (1). 85-113 doi:10.1017/s0080456800003021
Livingstone, A., Macpherson, H. G. (1983) Fifth supplementary list of British minerals (Scottish) Mineralogical Magazine, 47 (342) 99-105 doi:10.1180/minmag.1983.047.342.23
Lady Anne Hopetoun shaft, Wanlock Dod, Leadhills, South Lanarkshire, Scotland, UK