Meadowfoot Smelter slag locality, Wanlockhead, Dumfries and Galloway, Scotland, UKi
| Regional Level Types | |
|---|---|
| Meadowfoot Smelter slag locality | Slag Locality (Abandoned) |
| Wanlockhead | Village |
| Dumfries and Galloway | Council Area |
| Scotland | Country |
| UK | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
55° 24' 35'' North , 3° 48' 35'' West
Latitude & Longitude (decimal):
UK National Grid Reference:
NS854143
Type:
Slag Locality (Abandoned) - last checked 2024
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Sanquhar | 1,980 (2017) | 8.6km |
| Kirkconnel | 2,070 (2017) | 12.2km |
| Douglas | 1,560 (2017) | 15.8km |
| Thornhill | 1,610 (2017) | 19.8km |
| Muirkirk | 1,540 (2017) | 20.4km |
Other/historical names associated with this locality:
Queensberry Smelter
2.5 km northwest of Wanlockhead village.
The Meadowfoot Smelter was constructed in 1843 and worked until the 1930s, when the depression forced the closure of the surrounding mines. Dates as early as 1928 have been cited for the smelter closure.
Note on the mineral list: Rust (2022) also lists "Zn-Copper", "Zn-Covelline", and a number of unnamed species (e.g., an unnamed Cu,Sb alloy) and/or unidentified species (e.g., an iron-rich mineral gel).
The Meadowfoot Smelter was constructed in 1843 and worked until the 1930s, when the depression forced the closure of the surrounding mines. Dates as early as 1928 have been cited for the smelter closure.
Note on the mineral list: Rust (2022) also lists "Zn-Copper", "Zn-Covelline", and a number of unnamed species (e.g., an unnamed Cu,Sb alloy) and/or unidentified species (e.g., an iron-rich mineral gel).
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
57 valid minerals.
Rock Types Recorded
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S Habit: very thin metallic inconspicuous sooty coatings on tiny wires of Silver/argentiferous lead, appearing within minutes of being exposed to the atmosphere Colour: black |
| ⓘ Anglesite Formula: PbSO4 Habit: tabular, prismatic, blocky, bladed, platy, spiky, acicular... Colour: colourless, white, yellow, very rarely tinted blue by internal reflection from underlying blue minerals such as caledonite/langite References: |
| ⓘ Aragonite Formula: CaCO3 Colour: light blue References: |
| ⓘ 'Bisbeeite' Formula: (Cu,Mg)SiO3 · nH2O References: Eberhard Zeh collectionIdentification: Raman Spectroscopy |
| ⓘ Blixite Formula: Pb8O5(OH)2Cl4 |
| ⓘ Boleite Formula: KPb26Ag9Cu24(OH)48Cl62 |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 Colour: light to dark emerald green References: |
| ⓘ Calcite Formula: CaCO3 Habit: spheres Colour: light blue (copper-bearing) |
| ⓘ Caledonite Formula: Pb5Cu2(SO4)3(CO3)(OH)6 Habit: acicular, prismatic Colour: blue(-green) References: |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Cerussite Formula: PbCO3 Habit: tabular, platy Colour: blue(-grey) References: |
| ⓘ Chenite Formula: Pb4Cu(SO4)2(OH)6 References: |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ 'Clay minerals' |
| ⓘ Covellite Formula: CuS Description: Occurs as a Zinc-bearing variety. |
| ⓘ Cuprite Formula: Cu2O Colour: red References: |
| ⓘ Cuprite var. Chalcotrichite Formula: Cu2O |
| ⓘ Cuprostibite Formula: Cu2(Sb,Tl) |
| ⓘ Devilline ? Formula: CaCu4(SO4)2(OH)6 · 3H2O Description: 15 specimens of supposed Devilline were investigated by RAMAN all were found to be Serpierite. References: |
| ⓘ Elyite Formula: Pb4Cu(SO4)O2(OH)4 · H2O References: |
| ⓘ 'Fayalite-Forsterite Series' |
| ⓘ Galena Formula: PbS Colour: grey References: |
| ⓘ Goethite Formula: Fe3+O(OH) Colour: yellow, brown |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Colour: colourless References: |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O |
| ⓘ Hydrocerussite Formula: Pb3(CO3)2(OH)2 Colour: white |
| ⓘ Lanarkite Formula: Pb2(SO4)O Habit: bladed Colour: white, yellowish References: |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O Colour: blue References: |
| ⓘ Lautenthalite Formula: PbCu4(SO4)2(OH)6 · 3H2O References: |
| ⓘ Leadhillite Formula: Pb4(CO3)2(SO4)(OH)2 Habit: botryoidal Colour: (creamy) white References: |
| ⓘ 'Limonite' Description: Mostly as crusts commonly coats other species and intermixed with clay minerals. |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 References: |
| ⓘ Litharge Formula: PbO References: |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Habit: botryoidal Colour: (yellowish) green, light brown (altered) References: |
| ⓘ Melanterite Formula: Fe2+(H2O)6(SO4) · H2O |
| ⓘ 'Melilite Group' Formula: Ca2M(XSiO7) |
| ⓘ Monohydrocalcite Formula: CaCO3 · H2O Description: Natural History Museum London x-ray file number 4068F References: |
| ⓘ Native Copper Formula: Cu Colour: copper-red Description: Also found as a Zinc-bearing variety. References: |
| ⓘ Native Lead Formula: Pb Description: argentiferous in some cases |
| ⓘ Native Silver Formula: Ag Habit: tiny sprigs or wires coated by black sooty acanthite |
| ⓘ Orthoserpierite Formula: Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O References: Eberhard Zeh collectionIdentification: Raman Spectroscopy |
| ⓘ Oxyplumboroméite Formula: Pb2Sb2O6O References: |
| ⓘ Paralaurionite Formula: PbCl(OH) References: |
| ⓘ Plattnerite ? Formula: PbO2 Description: Appears to be a misidentification for metallic acicular crystals which are a metalloid formed as part of the slag melt.
|
| ⓘ Posnjakite Formula: Cu4(SO4)(OH)6 · H2O References: |
| ⓘ Pseudoboleite Formula: Pb31Cu24Cl62(OH)48 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 References: S. Rust collection.Identified by Steve Rust: Visual Identification |
| ⓘ Redgillite Formula: Cu6(SO4)(OH)10 · H2O |
| ⓘ 'Roméite Group' Formula: A2(Sb5+)2O6Z |
| ⓘ Rosiaite Formula: PbSb5+2O6 |
| ⓘ Schmiederite Formula: Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 Description: NAM London X-Ray File 4377F (near Schmiederite) References: |
| ⓘ Schulenbergite Formula: (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| ⓘ Serpierite Formula: Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O Colour: blue-green References: |
| ⓘ Shattuckite Formula: Cu5(Si2O6)2(OH)2 |
| ⓘ Sphalerite Formula: ZnS |
| ✪ Sundiusite Formula: Pb10(SO4)O8Cl2 Description: Natural History Museum London X-ray File number 6939F shows the mineral to be near Sundiusite but not100%. |
| ⓘ Susannite Formula: Pb4(CO3)2(SO4)(OH)2 |
| ⓘ Tenorite Formula: CuO Description: Well-formed typically black lustrous micro-crystals, with coverings on slag to several centimeters. References: S. Rust collection.Identification: SEM-EDS, Raman Spectroscopy |
| ⓘ 'Unnamed (Pb-Cu-Al-Si-O)' Formula: Pb-Cu-Al-Si-O Description: The Unnamed mineral is a sublimation product, rather than a secondary mineral. References: Steve Rust collectionIdentified by Steve Rust: SEM-EDS |
| ⓘ Valentinite Formula: Sb2O3 |
| ⓘ Willemite Formula: Zn2SiO4 |
| ⓘ Wroewolfeite Formula: Cu4(SO4)(OH)6 · 2H2O Colour: blue References: |
| ⓘ Wüstite Formula: FeO |
| ⓘ Zincite Formula: ZnO |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Lead | 1.AA.05 | Pb |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Cuprostibite | 2.AA.20 | Cu2(Sb,Tl) |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Galena | 2.CD.10 | PbS |
| Group 3 - Halides | |||
| ⓘ | Pseudoboleite | 3.DB.10 | Pb31Cu24Cl62(OH)48 |
| ⓘ | Boleite | 3.DB.15 | KPb26Ag9Cu24(OH)48Cl62 |
| ⓘ | Paralaurionite | 3.DC.05 | PbCl(OH) |
| ⓘ | Blixite | 3.DC.50 | Pb8O5(OH)2Cl4 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Cuprite var. Chalcotrichite | 4.AA.10 | Cu2O |
| ⓘ | 4.AA.10 | Cu2O | |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Zincite | 4.AB.20 | ZnO |
| ⓘ | Wüstite | 4.AB.25 | FeO |
| ⓘ | Litharge | 4.AC.20 | PbO |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Valentinite | 4.CB.55 | Sb2O3 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Plattnerite ? | 4.DB.05 | PbO2 |
| ⓘ | 'Roméite Group' | 4.DH. | A2(Sb5+)2O6Z |
| ⓘ | Oxyplumboroméite | 4.DH. | Pb2Sb2O6O |
| ⓘ | Rosiaite | 4.DH.25 | PbSb5+2O6 |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Hydrocerussite | 5.BE.10 | Pb3(CO3)2(OH)2 |
| ⓘ | Leadhillite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Susannite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Monohydrocalcite | 5.CB.20 | CaCO3 · H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Caledonite | 7.BC.50 | Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Schmiederite | 7.BC.65 | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| ⓘ | Chenite | 7.BC.70 | Pb4Cu(SO4)2(OH)6 |
| ⓘ | Lanarkite | 7.BD.40 | Pb2(SO4)O |
| ⓘ | Sundiusite | 7.BD.70 | Pb10(SO4)O8Cl2 |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6(SO4) · H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Posnjakite | 7.DD.10 | Cu4(SO4)(OH)6 · H2O |
| ⓘ | Wroewolfeite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Devilline ? | 7.DD.30 | CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Orthoserpierite | 7.DD.30 | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| ⓘ | Serpierite | 7.DD.30 | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| ⓘ | Redgillite | 7.DD.70 | Cu6(SO4)(OH)10 · H2O |
| ⓘ | Schulenbergite | 7.DD.80 | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| ⓘ | Elyite | 7.DF.65 | Pb4Cu(SO4)O2(OH)4 · H2O |
| ⓘ | Lautenthalite | 7.DF.70 | PbCu4(SO4)2(OH)6 · 3H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| Group 9 - Silicates | |||
| ⓘ | Willemite | 9.AA.05 | Zn2SiO4 |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Shattuckite | 9.DB.40 | Cu5(Si2O6)2(OH)2 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Unclassified | |||
| ⓘ | 'Clay minerals' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Bisbeeite' | - | (Cu,Mg)SiO3 · nH2O |
| ⓘ | 'Melilite Group' | - | Ca2M(XSiO7) |
| ⓘ | 'Unnamed (Pb-Cu-Al-Si-O)' | - | Pb-Cu-Al-Si-O |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Blixite | Pb8O5(OH)2Cl4 |
| H | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| H | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Lautenthalite | PbCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| H | ⓘ Monohydrocalcite | CaCO3 · H2O |
| H | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Paralaurionite | PbCl(OH) |
| H | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| H | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| H | ⓘ Schmiederite | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| H | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| H | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| H | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| H | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Redgillite | Cu6(SO4)(OH)10 · H2O |
| H | ⓘ Bisbeeite | (Cu,Mg)SiO3 · nH2O |
| C | Carbon | |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| C | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Monohydrocalcite | CaCO3 · H2O |
| C | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| O | Oxygen | |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Blixite | Pb8O5(OH)2Cl4 |
| O | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| O | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| O | ⓘ Lanarkite | Pb2(SO4)O |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Lautenthalite | PbCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Litharge | PbO |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| O | ⓘ Monohydrocalcite | CaCO3 · H2O |
| O | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Paralaurionite | PbCl(OH) |
| O | ⓘ Plattnerite | PbO2 |
| O | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| O | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Roméite Group | A2(Sb5+)2O6Z |
| O | ⓘ Schmiederite | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| O | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| O | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| O | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| O | ⓘ Sundiusite | Pb10(SO4)O8Cl2 |
| O | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Valentinite | Sb2O3 |
| O | ⓘ Willemite | Zn2SiO4 |
| O | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Wüstite | FeO |
| O | ⓘ Zincite | ZnO |
| O | ⓘ Rosiaite | PbSb25+O6 |
| O | ⓘ Fayalite-Forsterite Series | |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Redgillite | Cu6(SO4)(OH)10 · H2O |
| O | ⓘ Bisbeeite | (Cu,Mg)SiO3 · nH2O |
| O | ⓘ Melilite Group | Ca2M(XSiO7) |
| O | ⓘ Oxyplumboroméite | Pb2Sb2O6O |
| O | ⓘ Unnamed (Pb-Cu-Al-Si-O) | Pb-Cu-Al-Si-O |
| Mg | Magnesium | |
| Mg | ⓘ Fayalite-Forsterite Series | |
| Mg | ⓘ Bisbeeite | (Cu,Mg)SiO3 · nH2O |
| Al | Aluminium | |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Unnamed (Pb-Cu-Al-Si-O) | Pb-Cu-Al-Si-O |
| Si | Silicon | |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| Si | ⓘ Willemite | Zn2SiO4 |
| Si | ⓘ Fayalite-Forsterite Series | |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Bisbeeite | (Cu,Mg)SiO3 · nH2O |
| Si | ⓘ Melilite Group | Ca2M(XSiO7) |
| Si | ⓘ Unnamed (Pb-Cu-Al-Si-O) | Pb-Cu-Al-Si-O |
| P | Phosphorus | |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| S | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Lanarkite | Pb2(SO4)O |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Lautenthalite | PbCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| S | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| S | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| S | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Sundiusite | Pb10(SO4)O8Cl2 |
| S | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Redgillite | Cu6(SO4)(OH)10 · H2O |
| Cl | Chlorine | |
| Cl | ⓘ Blixite | Pb8O5(OH)2Cl4 |
| Cl | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Cl | ⓘ Paralaurionite | PbCl(OH) |
| Cl | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Sundiusite | Pb10(SO4)O8Cl2 |
| K | Potassium | |
| K | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Ca | Calcium | |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Monohydrocalcite | CaCO3 · H2O |
| Ca | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| Ca | ⓘ Melilite Group | Ca2M(XSiO7) |
| Fe | Iron | |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| Fe | ⓘ Wüstite | FeO |
| Fe | ⓘ Fayalite-Forsterite Series | |
| Cu | Copper | |
| Cu | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Cu | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| Cu | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Cuprostibite | Cu2(Sb,Tl) |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Lautenthalite | PbCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| Cu | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| Cu | ⓘ Schmiederite | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| Cu | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| Cu | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| Cu | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Redgillite | Cu6(SO4)(OH)10 · H2O |
| Cu | ⓘ Bisbeeite | (Cu,Mg)SiO3 · nH2O |
| Cu | ⓘ Unnamed (Pb-Cu-Al-Si-O) | Pb-Cu-Al-Si-O |
| Zn | Zinc | |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Zn | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| Zn | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Willemite | Zn2SiO4 |
| Zn | ⓘ Zincite | ZnO |
| Se | Selenium | |
| Se | ⓘ Schmiederite | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Ag | ⓘ Native Silver | Ag |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sb | Antimony | |
| Sb | ⓘ Cuprostibite | Cu2(Sb,Tl) |
| Sb | ⓘ Roméite Group | A2(Sb5+)2O6Z |
| Sb | ⓘ Valentinite | Sb2O3 |
| Sb | ⓘ Rosiaite | PbSb25+O6 |
| Sb | ⓘ Oxyplumboroméite | Pb2Sb2O6O |
| Tl | Thallium | |
| Tl | ⓘ Cuprostibite | Cu2(Sb,Tl) |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Blixite | Pb8O5(OH)2Cl4 |
| Pb | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Pb | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| Pb | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| Pb | ⓘ Lanarkite | Pb2(SO4)O |
| Pb | ⓘ Lautenthalite | PbCu4(SO4)2(OH)6 · 3H2O |
| Pb | ⓘ Native Lead | Pb |
| Pb | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Litharge | PbO |
| Pb | ⓘ Paralaurionite | PbCl(OH) |
| Pb | ⓘ Plattnerite | PbO2 |
| Pb | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Schmiederite | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| Pb | ⓘ Sundiusite | Pb10(SO4)O8Cl2 |
| Pb | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Rosiaite | PbSb25+O6 |
| Pb | ⓘ Oxyplumboroméite | Pb2Sb2O6O |
| Pb | ⓘ Unnamed (Pb-Cu-Al-Si-O) | Pb-Cu-Al-Si-O |
Other Regions, Features and Areas containing this locality
British and Irish IslesGroup of Islands
Eurasian PlateTectonic Plate
- CaledonidesOrogenic Belt
EuropeContinent
UK
- Scotland
- Leadhills-Wanlockhead Mining DistrictMining District
- ⭔StrathclydeRegion
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
www.aditnow.co.uk (n.d.) https://www.aditnow.co.uk/Photo/Queensberry-Meadowfoot-Smelter-1971_112889/
www.mineralienatlas.de (2015) https://www.mineralienatlas.de/lexikon/index.php/UK/Schottland/South%20Lanarkshire/Wanlockhead/Meadowfoot%20Smelter
www.futuremuseum.co.uk (2020) http://www.futuremuseum.co.uk/collections/life-work/key-industries/mining-quarrying/lead/the-meadowfoot-(queensberry)-smelter.aspx
www.futuremuseum.co.uk (n.d.) http://www.futuremuseum.co.uk/collections/life-work/key-industries/mining-quarrying/lead/the-meadowfoot-smelter-with-piles-of-lead-%E2%80%98pigs%E2%80%99.aspx






Meadowfoot Smelter slag locality, Wanlockhead, Dumfries and Galloway, Scotland, UK