Thann-Guebwiller, Haut-Rhin, Grand Est, Francei
| Regional Level Types | |
|---|---|
| Thann-Guebwiller | Arrondissement |
| Haut-Rhin | Department |
| Grand Est | Region |
| France | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Guebwiller | 12,548 (2016) |
| Cernay | 11,127 (2018) |
| Thann | 8,429 (2017) |
| Soultz-Haut-Rhin | 6,963 (2018) |
| Ensisheim | 6,940 (2018) |
| Rouffach | 4,656 (2016) |
Other/historical names associated with this locality:
Alsace
Other Languages:
French:
arrondissement de Thann-Guebwiller, Haut-Rhin, Grand Est, France
German:
Arrondissement Thann-Guebwiller, Oberelsass, Großer Osten, Frankreich
Russian:
Тан-Гебвиллер, Верхний Рейн, Гранд-Эст, Франция
Simplified Chinese:
坦恩-盖布维莱尔区, 上莱茵省, 大東部大區, 法国
Spanish:
Distrito de Thann-Guebwiller, Alto Rin, Gran Este, Francia
Albanian:
Qarku Thann-Guebwiller, Alto Rin, Lindja e madhe, Franca
Alemannic:
Arrondissement Thann-Guebwiller, Département Haut-Rhin, Grand Est, Frankreich
Azeri:
Tan-Qebviller, Yuxarı Reyn, Qrand Est, Fransa
Breton:
arondisamant Thann-Gebweiler, Roen-Uhel, Grand Est, Bro-C'hall
Czech:
Arrondissement Thann-Guebwiller, Haut-Rhin, Grand Est, Francie
Dutch:
Arrondissement Thann-Guebwiller, Haut-Rhin, Grand Est, Frankrijk
Esperanto:
Arondismento Thann-Guebwiller, Haut-Rhin, Grand Est, Francio
Farsi/Persian:
بخش تن-گوبویله, او-رن, گرانت است, فرانسه
Luxembourgish:
Arrondissement Thann-Guebwiller, Departement Haut-Rhin, Grand Est, Frankräich
Minnan / Hokkien-Taiwanese:
Thann-Guebwiller Kūn, Haut-Rhin, Hoat-kok
Romanian:
Arondismentul Thann-Guebwiller, Haut-Rhin, Franța
The arrondissement of Thann-Guebwiller was created in January 2015 from 42 communes of the former arrondissement of Guebwiller and 49 communes of the former arrondissement of Thann. In January 2017 seven communes from the arrondissement of Thann-Guebwiller joined the arrondissement of Colmar-Ribeauvillé.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities154 valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S |
| ⓘ Aikinite Formula: CuPbBiS3 |
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Allargentum Formula: (Ag1-xSbx) |
| ⓘ Anatase Formula: TiO2 References: |
| ⓘ Anglesite Formula: PbSO4 Localities: Reported from at least 12 localities in this region. |
| ⓘ Anhydrite Formula: CaSO4 Localities: Reported from at least 7 localities in this region. |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 Localities: Reported from at least 16 localities in this region. |
| ⓘ Annabergite Formula: Ni3(AsO4)2 · 8H2O |
| ⓘ Antigorite Formula: Mg3(Si2O5)(OH)4 |
| ⓘ Aragonite Formula: CaCO3 Localities: Reported from at least 10 localities in this region. |
| ⓘ Arseniosiderite Formula: Ca2Fe3+3(AsO4)3O2 · 3H2O |
| ⓘ 'Arsenobismite' |
| ⓘ Arsenolite Formula: As2O3 |
| ⓘ Arsenopyrite Formula: FeAsS Localities: Reported from at least 6 localities in this region. |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ 'Axinite Group' |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 Localities: Reported from at least 12 localities in this region. |
| ⓘ Bariopharmacosiderite Formula: Ba0.5Fe3+4(AsO4)3(OH)4 · 5H2O |
| ⓘ Baryte Formula: BaSO4 Localities: Reported from at least 55 localities in this region. |
| ⓘ Beudantite ? Formula: PbFe3+3(AsO4)(SO4)(OH)6 Habit: crystallized rice grains Description: Only one sample found. Analysis will be done after new crystals discovery. References: |
| ✪ Billietite Formula: Ba(UO2)6O4(OH)6 · 4-8H2O |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Birnessite Formula: (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ Bornite Formula: Cu5FeS4 Localities: St Joseph Mine, Urbès, Thann-Guebwiller, Haut-Rhin, Grand Est, France Houppach, Masevaux-Niederbruck, Thann-Guebwiller, Haut-Rhin, Grand Est, France Ferdinand Mine, Vordergesick, Sewen, Thann-Guebwiller, Haut-Rhin, Grand Est, France Fanny mine (Kruth 1), Kruth, Thann-Guebwiller, Haut-Rhin, Grand Est, France Leimkritter veins, Sewen, Thann-Guebwiller, Haut-Rhin, Grand Est, France |
| ⓘ Bournonite Formula: PbCuSbS3 |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 Localities: Reported from at least 6 localities in this region. |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 33 localities in this region. |
| ⓘ Caledonite Formula: Pb5Cu2(SO4)3(CO3)(OH)6 Localities: St Philippe Mine (Kleinsilberthal vein), Silberthal, Steinbach, Thann-Guebwiller, Haut-Rhin, Grand Est, France St Nicolas Mine (Großsilberthal vein), Silberthal, Steinbach, Thann-Guebwiller, Haut-Rhin, Grand Est, France Silberthalrücken vein, Silberthal, Steinbach, Thann-Guebwiller, Haut-Rhin, Grand Est, France |
| ⓘ Cannizzarite Formula: Pb48Bi56S132 |
| ⓘ Carbonatecyanotrichite Formula: Cu4Al2(CO3,SO4)(OH)12 · 2H2O Description: Nicolas MEISSER 2008 analysis, Lausanne Geologic museum |
| ⓘ Cerussite Formula: PbCO3 Localities: Reported from at least 13 localities in this region. Description: Exceptionnal big cluster found in 2005-2005 |
| ⓘ Chalcocite Formula: Cu2S Localities: Houppach, Masevaux-Niederbruck, Thann-Guebwiller, Haut-Rhin, Grand Est, France Katzenbach Valley, Rimbach-près-Masevaux, Thann-Guebwiller, Haut-Rhin, Grand Est, France Joseph Mine, Rimbach-près-Masevaux, Thann-Guebwiller, Haut-Rhin, Grand Est, France Fanny mine (Kruth 1), Kruth, Thann-Guebwiller, Haut-Rhin, Grand Est, France |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 37 localities in this region. |
| ⓘ 'Chlorite Group' |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 Localities: Reported from at least 14 localities in this region. |
| ⓘ Clausthalite Formula: PbSe |
| ⓘ Clinoclase Formula: Cu3(AsO4)(OH)3 |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ Coffinite Formula: U(SiO4) · nH2O |
| ⓘ Conichalcite Formula: CaCu(AsO4)(OH) |
| ⓘ Cornwallite Formula: Cu5(AsO4)2(OH)4 |
| ⓘ Cosalite Formula: Pb2Bi2S5 |
| ⓘ Covellite Formula: CuS Localities: Reported from at least 14 localities in this region. |
| ⓘ Cryptomelane Formula: K(Mn4+7Mn3+)O16 |
| ⓘ Cubanite Formula: CuFe2S3 |
| ⓘ Cuprite Formula: Cu2O Localities: Reported from at least 7 localities in this region. |
| ⓘ Cuprite var. Chalcotrichite Formula: Cu2O References: |
| ⓘ Curite Formula: Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| ⓘ Devilline Formula: CaCu4(SO4)2(OH)6 · 3H2O Description: in association with Linarite. References: |
| ⓘ Digenite Formula: Cu9S5 Localities: Reported from at least 6 localities in this region. |
| ⓘ Diopside Formula: CaMgSi2O6 |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: Reported from at least 11 localities in this region. |
| ⓘ Dyscrasite Formula: Ag3Sb |
| ⓘ Emplectite Formula: CuBiS2 Colour: green Description: Elongated green oxydated crystals into fluorite or quartz.
When crystals get out of quartz or fluorite, they are covered by goethite or yellow tabular petitjeanite crystals. Petitjeanite need to be confirmed with analysis.
References: |
| ⓘ Enargite Formula: Cu3AsS4 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O |
| ⓘ 'Fayalite-Forsterite Series' Description: Olivine (Fa28.0±0.7)[Rubin,1990]. |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorite Formula: CaF2 Localities: Reported from at least 23 localities in this region. |
| ⓘ 'Freibergite Subgroup' Formula: (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ Fukuchilite Formula: Cu3FeS8 |
| ⓘ Galena Formula: PbS Localities: Reported from at least 36 localities in this region. |
| ⓘ Galena var. Silver-bearing Galena Formula: PbS with Ag Localities: Silberthalrücken vein, Silberthal, Steinbach, Thann-Guebwiller, Haut-Rhin, Grand Est, France Amselkopf Mt. (Amselkopf veins), Silberthal, Steinbach, Thann-Guebwiller, Haut-Rhin, Grand Est, France St Nicolas Mine (Großsilberthal vein), Silberthal, Steinbach, Thann-Guebwiller, Haut-Rhin, Grand Est, France Erzgrubenthal Mine, Wattwiller, Thann-Guebwiller, Haut-Rhin, Grand Est, France Description: SOme specimens are well crystalized but the galena is essentially found into massive quartz. |
| ⓘ Gartrellite Formula: PbCuFe3+(AsO4)2(OH) · H2O Description: Nicolas MEISSER 2008 analysis, Lausanne Geologic museum |
| ⓘ Gersdorffite Formula: NiAsS |
| ⓘ Goethite Formula: Fe3+O(OH) Localities: Reported from at least 41 localities in this region. |
| ⓘ Gorceixite Formula: BaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ Guérinite Formula: Ca6(HAsO4)3(AsO4)2 · 10.5H2O |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: Reported from at least 6 localities in this region. |
| ⓘ Gypsum var. Selenite Formula: CaSO4 · 2H2O |
| ⓘ Halite Formula: NaCl |
| ⓘ Heinrichite Formula: Ba(UO2)2(AsO4)2 · 10H2O |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 41 localities in this region. |
| ⓘ Hematite var. Martite Formula: Fe2O3 |
| ⓘ Hematite var. Specularite Formula: Fe2O3 References: |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O Localities: St Philippe Mine (Kleinsilberthal vein), Silberthal, Steinbach, Thann-Guebwiller, Haut-Rhin, Grand Est, France St Nicolas Mine (Großsilberthal vein), Silberthal, Steinbach, Thann-Guebwiller, Haut-Rhin, Grand Est, France Katzenbach Valley, Rimbach-près-Masevaux, Thann-Guebwiller, Haut-Rhin, Grand Est, France Moritz adit, Klosterwald, Sewen, Thann-Guebwiller, Haut-Rhin, Grand Est, France |
| ⓘ Hörnesite Formula: Mg3(AsO4)2 · 8H2O |
| ⓘ Hydroniumjarosite Formula: (H3O)Fe3+3(SO4)2(OH)6 |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Isocubanite Formula: CuFe2S3 |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ 'K Feldspar' |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 |
| ⓘ Klockmannite Formula: CuSe |
| ⓘ Köttigite Formula: Zn3(AsO4)2 · 8H2O References: Georges FAVREAU collection & EDX analysisIdentified by Georges Favreau: SEM-EDS |
| ⓘ Koutekite Formula: Cu5As2 |
| ⓘ Kutinaite Formula: Ag6Cu14As7 |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O |
| ⓘ Lepidocrocite Formula: Fe3+O(OH) |
| ⓘ 'Limonite' Localities: Reported from at least 29 localities in this region. |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 Localities: Silberthalrücken vein, Silberthal, Steinbach, Thann-Guebwiller, Haut-Rhin, Grand Est, France St Philippe Mine (Kleinsilberthal vein), Silberthal, Steinbach, Thann-Guebwiller, Haut-Rhin, Grand Est, France Schletzenburg (Schletzelberg; incl. Donnerloch Mine), Silberthal, Steinbach, Thann-Guebwiller, Haut-Rhin, Grand Est, France St Nicolas Mine (Großsilberthal vein), Silberthal, Steinbach, Thann-Guebwiller, Haut-Rhin, Grand Est, France |
| ⓘ Löllingite Formula: FeAs2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 28 localities in this region. |
| ⓘ 'Manganese Oxides' Localities: Reported from at least 8 localities in this region. |
| ⓘ 'Manganese Oxides var. Manganese Dendrites' |
| ⓘ Manganite Formula: Mn3+O(OH) |
| ⓘ Marcasite Formula: FeS2 Localities: Reported from at least 9 localities in this region. |
| ⓘ Matildite Formula: AgBiS2 |
| ⓘ Melanterite Formula: Fe2+(H2O)6(SO4) · H2O |
| ⓘ Merrillite Formula: Ca9NaMg(PO4)7 Description: Reading "Merrillite" (preferred) for "Whitlockite" (the terrestrial analogue). |
| ⓘ Metazeunerite Formula: Cu(UO2)2(AsO4)2 · 8H2O |
| ⓘ Millerite Formula: NiS |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Copper Formula: Cu Localities: Wasserfall, Sewen, Thann-Guebwiller, Haut-Rhin, Grand Est, France St Barnabé (Demberg & Fundelkoepfel veins), Murbach, Thann-Guebwiller, Haut-Rhin, Grand Est, France St Nicolas Mine (Großsilberthal vein), Silberthal, Steinbach, Thann-Guebwiller, Haut-Rhin, Grand Est, France Copper deposits, Mollau, Thann-Guebwiller, Haut-Rhin, Grand Est, France Copper deposit, Osenbach, Thann-Guebwiller, Haut-Rhin, Grand Est, France |
| ⓘ Native Gold Formula: Au |
| ⓘ Native Gold var. Electrum Formula: (Au,Ag) |
| ⓘ Native Iron Formula: Fe References: |
| ⓘ Native Iron var. Kamacite Formula: (Fe,Ni) References: |
| ⓘ Native Silver Formula: Ag Localities: St Nicolas Mine (Großsilberthal vein), Silberthal, Steinbach, Thann-Guebwiller, Haut-Rhin, Grand Est, France Wasserfall, Sewen, Thann-Guebwiller, Haut-Rhin, Grand Est, France Moritz adit, Klosterwald, Sewen, Thann-Guebwiller, Haut-Rhin, Grand Est, France Silberthalrücken vein, Silberthal, Steinbach, Thann-Guebwiller, Haut-Rhin, Grand Est, France |
| ⓘ Nickelskutterudite Formula: NiAs3 |
| ⓘ Olivenite Formula: Cu2(AsO4)(OH) |
| ⓘ 'Orthopyroxene Subgroup' |
| ⓘ Parasymplesite Formula: Fe2+3(AsO4)2 · 8H2O |
| ⓘ Pearceite Formula: [Ag6As2S7][Ag9CuS4] |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 |
| ✪ Petitjeanite ? Formula: Bi3(PO4)2O(OH) Habit: Thin tabular. Colour: translucent yellow Description: Second occurence in the Vosges mountains (after first discovery at Dambach-la-ville). An axis of mining work containing bismuth (mixite, zalesiite, emplectite, eulytin, atelestite, petitjeanite) following the Val d'Ajol district to Bussang, Munster valley, Brézouard massif and Dambach la Ville.
Steingraben mine could be now attached at this axis. References: |
| ⓘ Pharmacolite Formula: Ca(HAsO4) · 2H2O |
| ⓘ Picropharmacolite Formula: Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ Polybasite Formula: [Ag6Sb2S7][Ag9CuS4] |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 |
| ⓘ Proustite Formula: Ag3AsS3 |
| ⓘ Pseudomalachite Formula: Cu5(PO4)2(OH)4 References: |
| ⓘ 'Psilomelane' |
| ⓘ Pyrargyrite Formula: Ag3SbS3 |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 33 localities in this region. |
| ⓘ Pyrite var. Bravoite Formula: (Fe,Ni)S2 |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl Localities: Reported from at least 8 localities in this region. Description: Very nice cabinet size specimens |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 66 localities in this region. |
| ⓘ Quartz var. Agate Formula: SiO2 |
| ⓘ Quartz var. Amethyst Formula: SiO2 Localities: Reported from at least 10 localities in this region. |
| ⓘ Quartz var. Carnelian Formula: SiO2 |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Quartz var. Eisenkiesel Formula: SiO2 |
| ⓘ Quartz var. Milky Quartz Formula: SiO2 |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 Localities: |
| ⓘ Ranciéite Formula: (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O Localities: Storckensohn, Thann-Guebwiller, Haut-Rhin, Grand Est, France St Nicolas Mine (Großsilberthal vein), Silberthal, Steinbach, Thann-Guebwiller, Haut-Rhin, Grand Est, France Steingraben Mine, Urbès, Thann-Guebwiller, Haut-Rhin, Grand Est, France Copper deposits, Mollau, Thann-Guebwiller, Haut-Rhin, Grand Est, France Allenbourn (Allenburn), Bitschwiller-lès-Thann, Thann-Guebwiller, Haut-Rhin, Grand Est, France |
| ⓘ Romanèchite Formula: (Ba,H2O)2(Mn4+,Mn3+)5O10 Localities: Storckensohn, Thann-Guebwiller, Haut-Rhin, Grand Est, France Stahlberg Mountain, Rimbach-près-Masevaux, Thann-Guebwiller, Haut-Rhin, Grand Est, France Enzengesick, Sewen, Thann-Guebwiller, Haut-Rhin, Grand Est, France Baerenbach, Sewen, Thann-Guebwiller, Haut-Rhin, Grand Est, France Allenbourn (Allenburn), Bitschwiller-lès-Thann, Thann-Guebwiller, Haut-Rhin, Grand Est, France |
| ⓘ Rosasite Formula: (Cu,Zn)2(CO3)(OH)2 Description: Nicolas Meisser 2008 Analysis, Lausanne Geologic Museum |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Schröckingerite Formula: NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O |
| ⓘ Segnitite Formula: PbFe3+3AsO4(AsO3OH)(OH)6 |
| ⓘ Sharpite Formula: Ca(UO2)3(CO3)4 · 3H2O Description: May not be same as type material. |
| ⓘ Siderite Formula: FeCO3 Localities: Reported from at least 32 localities in this region. |
| ⓘ Skutterudite Formula: CoAs3 |
| ⓘ Smithsonite Formula: ZnCO3 |
| ⓘ Smythite Formula: (Fe,Ni)3+xS4 (x=0-0.3) |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 27 localities in this region. Habit: Massiv and crystallized Description: Crystallized specimens are not common. |
| ⓘ Stibnite Formula: Sb2S3 |
| ⓘ Stromeyerite Formula: AgCuS |
| ⓘ Sylvite Formula: KCl |
| ⓘ Symplesite Formula: Fe2+3(AsO4)2 · 8H2O |
| ⓘ Taenite Formula: (Ni,Fe) |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Tennantite Subgroup var. Silver-bearing Tennantite' Formula: (Cu,Ag)6[Cu4(Fe,Zn)2]As4S13 |
| ⓘ Tenorite Formula: CuO |
| ⓘ 'Tetrahedrite Group' Formula: M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S Localities: Reported from at least 7 localities in this region. |
| ⓘ Tetrataenite Formula: FeNi |
| ⓘ Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
| ⓘ Trigodomeykite Formula: Cu3-xAs |
| ⓘ Troilite Formula: FeS |
| ⓘ Tyrolite Formula: Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| ⓘ Umangite Formula: Cu3Se2 |
| ⓘ Uraninite Formula: UO2 |
| ⓘ Uraninite var. Pitchblende Formula: UO2 |
| ⓘ Uranophane Formula: Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ 'Vosgite' |
| ⓘ Wölsendorfite Formula: Pb7(UO2)14O19(OH)4 · 12H2O |
| ✪ Wroewolfeite Formula: Cu4(SO4)(OH)6 · 2H2O Habit: tabular crystals Colour: blue Description: Nicolas MEISSER 2008 analysis, Lausanne Geologic museum |
| ✪ Wulfenite Formula: Pb(MoO4) Locality: Silberthalrücken vein, Silberthal, Steinbach, Thann-Guebwiller, Haut-Rhin, Grand Est, France Habit: dipyramidal Colour: Orange |
| ⓘ Zálesíite Formula: CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O |
| ⓘ Zeunerite Formula: Cu(UO2)2(AsO4)2 · 12H2O |
| ⓘ Zincrosasite Formula: (Zn,Cu)2(CO3)(OH)2 Description: Nicolas MEISSER 2008 analysis, Lausanne Geologic museum |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold var. Electrum | 1.AA.05 | (Au,Ag) |
| ⓘ | 1.AA.05 | Au | |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Iron | 1.AE.05 | Fe |
| ⓘ | var. Kamacite | 1.AE.05 | (Fe,Ni) |
| ⓘ | Taenite | 1.AE.10 | (Ni,Fe) |
| ⓘ | Tetrataenite | 1.AE.10 | FeNi |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Trigodomeykite | 2.AA. | Cu3-xAs |
| ⓘ | Koutekite | 2.AA.10d | Cu5As2 |
| ⓘ | Kutinaite | 2.AA.25 | Ag6Cu14As7 |
| ⓘ | Allargentum | 2.AA.30 | (Ag1-xSbx) |
| ⓘ | Dyscrasite | 2.AA.35 | Ag3Sb |
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Umangite | 2.BA.25 | Cu3Se2 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Stromeyerite | 2.BA.40 | AgCuS |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Klockmannite | 2.CA.05b | CuSe |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Isocubanite | 2.CB.55b | CuFe2S3 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Smythite | 2.CC.10 | (Fe,Ni)3+xS4 (x=0-0.3) |
| ⓘ | Troilite | 2.CC.10 | FeS |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Clausthalite | 2.CD.10 | PbSe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | var. Silver-bearing Galena | 2.CD.10 | PbS with Ag |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Pyrite var. Bravoite | 2.EB.05a | (Fe,Ni)S2 |
| ⓘ | Fukuchilite | 2.EB.05a | Cu3FeS8 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Nickelskutterudite | 2.EC.05 | NiAs3 |
| ⓘ | Skutterudite | 2.EC.05 | CoAs3 |
| ⓘ | Proustite | 2.GA.05 | Ag3AsS3 |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | 'Freibergite Subgroup' | 2.GB.05 | (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | 'Tennantite Subgroup var. Silver-bearing Tennantite' | 2.GB.05 | (Cu,Ag)6[Cu4(Fe,Zn)2]As4S13 |
| ⓘ | Pearceite | 2.GB.15 | [Ag6As2S7][Ag9CuS4] |
| ⓘ | Polybasite | 2.GB.15 | [Ag6Sb2S7][Ag9CuS4] |
| ⓘ | Emplectite | 2.HA.05 | CuBiS2 |
| ⓘ | Aikinite | 2.HB.05a | CuPbBiS3 |
| ⓘ | Matildite | 2.JA.20 | AgBiS2 |
| ⓘ | Cosalite | 2.JB.10 | Pb2Bi2S5 |
| ⓘ | Cannizzarite | 2.JB.20 | Pb48Bi56S132 |
| ⓘ | Enargite | 2.KA.05 | Cu3AsS4 |
| Group 3 - Halides | |||
| ⓘ | Halite | 3.AA.20 | NaCl |
| ⓘ | Sylvite | 3.AA.20 | KCl |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Cuprite var. Chalcotrichite | 4.AA.10 | Cu2O |
| ⓘ | 4.AA.10 | Cu2O | |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Hematite var. Martite | 4.CB.05 | Fe2O3 |
| ⓘ | var. Specularite | 4.CB.05 | Fe2O3 |
| ⓘ | Arsenolite | 4.CB.50 | As2O3 |
| ⓘ | Quartz var. Agate | 4.DA.05 | SiO2 |
| ⓘ | var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | var. Milky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Eisenkiesel | 4.DA.05 | SiO2 |
| ⓘ | var. Carnelian | 4.DA.05 | SiO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Cryptomelane | 4.DK.05a | K(Mn4+7Mn3+)O16 |
| ⓘ | Romanèchite | 4.DK.10 | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| ⓘ | Uraninite var. Pitchblende | 4.DL.05 | UO2 |
| ⓘ | 4.DL.05 | UO2 | |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Lepidocrocite | 4.FE.15 | Fe3+O(OH) |
| ⓘ | Ranciéite | 4.FL.40 | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| ⓘ | Birnessite | 4.FL.45 | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| ⓘ | Billietite | 4.GB.10 | Ba(UO2)6O4(OH)6 · 4-8H2O |
| ⓘ | Wölsendorfite | 4.GB.30 | Pb7(UO2)14O19(OH)4 · 12H2O |
| ⓘ | Curite | 4.GB.55 | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Rosasite | 5.BA.10 | (Cu,Zn)2(CO3)(OH)2 |
| ⓘ | Zincrosasite | 5.BA.10 | (Zn,Cu)2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Sharpite | 5.EA.35 | Ca(UO2)3(CO3)4 · 3H2O |
| ⓘ | Schröckingerite | 5.EG.05 | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Hydroniumjarosite | 7.BC.10 | (H3O)Fe3+3(SO4)2(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Caledonite | 7.BC.50 | Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6(SO4) · H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | var. Selenite | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Wroewolfeite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Devilline | 7.DD.30 | CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Carbonatecyanotrichite | 7.DE.10 | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Merrillite | 8.AC.45 | Ca9NaMg(PO4)7 |
| ⓘ | Olivenite | 8.BB.30 | Cu2(AsO4)(OH) |
| ⓘ | Cornwallite | 8.BD.05 | Cu5(AsO4)2(OH)4 |
| ⓘ | Pseudomalachite | 8.BD.05 | Cu5(PO4)2(OH)4 |
| ⓘ | Clinoclase | 8.BE.20 | Cu3(AsO4)(OH)3 |
| ⓘ | Conichalcite | 8.BH.35 | CaCu(AsO4)(OH) |
| ⓘ | Beudantite ? | 8.BL.05 | PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ | Gorceixite | 8.BL.10 | BaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Segnitite | 8.BL.10 | PbFe3+3AsO4(AsO3OH)(OH)6 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Petitjeanite ? | 8.BO.10 | Bi3(PO4)2O(OH) |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Annabergite | 8.CE.40 | Ni3(AsO4)2 · 8H2O |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Hörnesite | 8.CE.40 | Mg3(AsO4)2 · 8H2O |
| ⓘ | Köttigite | 8.CE.40 | Zn3(AsO4)2 · 8H2O |
| ⓘ | Parasymplesite | 8.CE.40 | Fe2+3(AsO4)2 · 8H2O |
| ⓘ | Symplesite | 8.CE.45 | Fe2+3(AsO4)2 · 8H2O |
| ⓘ | Gartrellite | 8.CG.20 | PbCuFe3+(AsO4)2(OH) · H2O |
| ⓘ | Picropharmacolite | 8.CH.15 | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| ⓘ | Pharmacolite | 8.CJ.50 | Ca(HAsO4) · 2H2O |
| ⓘ | Guérinite | 8.CJ.75 | Ca6(HAsO4)3(AsO4)2 · 10.5H2O |
| ⓘ | Arseniosiderite | 8.DH.30 | Ca2Fe3+3(AsO4)3O2 · 3H2O |
| ⓘ | Bariopharmacosiderite | 8.DK.10 | Ba0.5Fe3+4(AsO4)3(OH)4 · 5H2O |
| ⓘ | Zálesíite | 8.DL.15 | CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O |
| ⓘ | Tyrolite | 8.DM.10 | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| ⓘ | Heinrichite | 8.EB.05 | Ba(UO2)2(AsO4)2 · 10H2O |
| ⓘ | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ | Zeunerite | 8.EB.05 | Cu(UO2)2(AsO4)2 · 12H2O |
| ⓘ | Metazeunerite | 8.EB.10 | Cu(UO2)2(AsO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Coffinite | 9.AD.30 | U(SiO4) · nH2O |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Uranophane | 9.AK.15 | Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Arsenobismite' | - | |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Vosgite' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Orthopyroxene Subgroup' | - | |
| ⓘ | 'Manganese Oxides var. Manganese Dendrites' | - | |
| ⓘ | '' | - | |
| ⓘ | 'Axinite Group' | - | |
| ⓘ | 'Tetrahedrite Group' | - | M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| H | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| H | ⓘ Billietite | Ba(UO2)6O4(OH)6 · 4-8H2O |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| H | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| H | ⓘ Coffinite | U(SiO4) · nH2O |
| H | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| H | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| H | ⓘ Curite | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| H | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Gartrellite | PbCuFe3+(AsO4)2(OH) · H2O |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Guérinite | Ca6(HAsO4)3(AsO4)2 · 10.5H2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Heinrichite | Ba(UO2)2(AsO4)2 · 10H2O |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| H | ⓘ Hydroniumjarosite | (H3O)Fe33+(SO4)2(OH)6 |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Köttigite | Zn3(AsO4)2 · 8H2O |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Lepidocrocite | Fe3+O(OH) |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| H | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Olivenite | Cu2(AsO4)(OH) |
| H | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| H | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| H | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| H | ⓘ Petitjeanite | Bi3(PO4)2O(OH) |
| H | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| H | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| H | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| H | ⓘ Sharpite | Ca(UO2)3(CO3)4 · 3H2O |
| H | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| H | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| H | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| H | ⓘ Wölsendorfite | Pb7(UO2)14O19(OH)4 · 12H2O |
| H | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| H | ⓘ Zincrosasite | (Zn,Cu)2(CO3)(OH)2 |
| H | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| H | ⓘ Zálesíite | CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| C | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| C | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| C | ⓘ Sharpite | Ca(UO2)3(CO3)4 · 3H2O |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| C | ⓘ Zincrosasite | (Zn,Cu)2(CO3)(OH)2 |
| O | Oxygen | |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Quartz var. Agate | SiO2 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Arsenolite | As2O3 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| O | ⓘ Billietite | Ba(UO2)6O4(OH)6 · 4-8H2O |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| O | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| O | ⓘ Coffinite | U(SiO4) · nH2O |
| O | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| O | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| O | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Curite | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| O | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Gartrellite | PbCuFe3+(AsO4)2(OH) · H2O |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Guérinite | Ca6(HAsO4)3(AsO4)2 · 10.5H2O |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Heinrichite | Ba(UO2)2(AsO4)2 · 10H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| O | ⓘ Hydroniumjarosite | (H3O)Fe33+(SO4)2(OH)6 |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Köttigite | Zn3(AsO4)2 · 8H2O |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Lepidocrocite | Fe3+O(OH) |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Hematite var. Martite | Fe2O3 |
| O | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| O | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Olivenite | Cu2(AsO4)(OH) |
| O | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| O | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| O | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| O | ⓘ Uraninite var. Pitchblende | UO2 |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Petitjeanite | Bi3(PO4)2O(OH) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| O | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| O | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| O | ⓘ Sharpite | Ca(UO2)3(CO3)4 · 3H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| O | ⓘ Wölsendorfite | Pb7(UO2)14O19(OH)4 · 12H2O |
| O | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| O | ⓘ Zincrosasite | (Zn,Cu)2(CO3)(OH)2 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| O | ⓘ Hematite var. Specularite | Fe2O3 |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Quartz var. Milky Quartz | SiO2 |
| O | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| O | ⓘ Zálesíite | CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O |
| O | ⓘ Fayalite-Forsterite Series | |
| O | ⓘ Quartz var. Eisenkiesel | SiO2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Quartz var. Carnelian | SiO2 |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Na | ⓘ Halite | NaCl |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| Na | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| Mg | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| Mg | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| Mg | ⓘ Fayalite-Forsterite Series | |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Quartz var. Agate | SiO2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Coffinite | U(SiO4) · nH2O |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Quartz var. Milky Quartz | SiO2 |
| Si | ⓘ Fayalite-Forsterite Series | |
| Si | ⓘ Quartz var. Eisenkiesel | SiO2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Quartz var. Carnelian | SiO2 |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Petitjeanite | Bi3(PO4)2O(OH) |
| P | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Aikinite | CuPbBiS3 |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| S | ⓘ Cannizzarite | Pb48Bi56S132 |
| S | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Cosalite | Pb2Bi2S5 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Emplectite | CuBiS2 |
| S | ⓘ Enargite | Cu3AsS4 |
| S | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| S | ⓘ Fukuchilite | Cu3FeS8 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Hydroniumjarosite | (H3O)Fe33+(SO4)2(OH)6 |
| S | ⓘ Isocubanite | CuFe2S3 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Matildite | AgBiS2 |
| S | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| S | ⓘ Millerite | NiS |
| S | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| S | ⓘ Proustite | Ag3AsS3 |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| S | ⓘ Smythite | (Fe,Ni)3+xS4 (x=0-0.3) |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Stromeyerite | AgCuS |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Troilite | FeS |
| S | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| S | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| S | ⓘ Tennantite Subgroup var. Silver-bearing Tennantite | (Cu,Ag)6[Cu4(Fe,Zn)2]As4S13 |
| S | ⓘ Tetrahedrite Group | M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
| Cl | Chlorine | |
| Cl | ⓘ Halite | NaCl |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Sylvite | KCl |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Sylvite | KCl |
| Ca | Calcium | |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Ca | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Ca | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Guérinite | Ca6(HAsO4)3(AsO4)2 · 10.5H2O |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| Ca | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| Ca | ⓘ Sharpite | Ca(UO2)3(CO3)4 · 3H2O |
| Ca | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Ca | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Ca | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| Ca | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| Ca | ⓘ Zálesíite | CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Mn | Manganese | |
| Mn | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Mn | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| Mn | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Fe | Iron | |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Fe | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| Fe | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Fukuchilite | Cu3FeS8 |
| Fe | ⓘ Gartrellite | PbCuFe3+(AsO4)2(OH) · H2O |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hydroniumjarosite | (H3O)Fe33+(SO4)2(OH)6 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Native Iron | Fe |
| Fe | ⓘ Isocubanite | CuFe2S3 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Native Iron var. Kamacite | (Fe,Ni) |
| Fe | ⓘ Lepidocrocite | Fe3+O(OH) |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Hematite var. Martite | Fe2O3 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| Fe | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Smythite | (Fe,Ni)3+xS4 (x=0-0.3) |
| Fe | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| Fe | ⓘ Taenite | (Ni,Fe) |
| Fe | ⓘ Tetrataenite | FeNi |
| Fe | ⓘ Troilite | FeS |
| Fe | ⓘ Hematite var. Specularite | Fe2O3 |
| Fe | ⓘ Fayalite-Forsterite Series | |
| Fe | ⓘ Tennantite Subgroup var. Silver-bearing Tennantite | (Cu,Ag)6[Cu4(Fe,Zn)2]As4S13 |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Co | ⓘ Skutterudite | CoAs3 |
| Ni | Nickel | |
| Ni | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| Ni | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Native Iron var. Kamacite | (Fe,Ni) |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Nickelskutterudite | NiAs3 |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Smythite | (Fe,Ni)3+xS4 (x=0-0.3) |
| Ni | ⓘ Taenite | (Ni,Fe) |
| Ni | ⓘ Tetrataenite | FeNi |
| Cu | Copper | |
| Cu | ⓘ Aikinite | CuPbBiS3 |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Cu | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| Cu | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Cu | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Emplectite | CuBiS2 |
| Cu | ⓘ Enargite | Cu3AsS4 |
| Cu | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Cu | ⓘ Fukuchilite | Cu3FeS8 |
| Cu | ⓘ Gartrellite | PbCuFe3+(AsO4)2(OH) · H2O |
| Cu | ⓘ Isocubanite | CuFe2S3 |
| Cu | ⓘ Klockmannite | CuSe |
| Cu | ⓘ Koutekite | Cu5As2 |
| Cu | ⓘ Kutinaite | Ag6Cu14As7 |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| Cu | ⓘ Olivenite | Cu2(AsO4)(OH) |
| Cu | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| Cu | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Cu | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| Cu | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Cu | ⓘ Stromeyerite | AgCuS |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Cu | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Cu | ⓘ Umangite | Cu3Se2 |
| Cu | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| Cu | ⓘ Zincrosasite | (Zn,Cu)2(CO3)(OH)2 |
| Cu | ⓘ Zálesíite | CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O |
| Cu | ⓘ Tennantite Subgroup var. Silver-bearing Tennantite | (Cu,Ag)6[Cu4(Fe,Zn)2]As4S13 |
| Cu | ⓘ Trigodomeykite | Cu3-xAs |
| Zn | Zinc | |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Köttigite | Zn3(AsO4)2 · 8H2O |
| Zn | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Zincrosasite | (Zn,Cu)2(CO3)(OH)2 |
| Zn | ⓘ Tennantite Subgroup var. Silver-bearing Tennantite | (Cu,Ag)6[Cu4(Fe,Zn)2]As4S13 |
| As | Arsenic | |
| As | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| As | ⓘ Arsenolite | As2O3 |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| As | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| As | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| As | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| As | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| As | ⓘ Enargite | Cu3AsS4 |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Gartrellite | PbCuFe3+(AsO4)2(OH) · H2O |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Guérinite | Ca6(HAsO4)3(AsO4)2 · 10.5H2O |
| As | ⓘ Heinrichite | Ba(UO2)2(AsO4)2 · 10H2O |
| As | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| As | ⓘ Köttigite | Zn3(AsO4)2 · 8H2O |
| As | ⓘ Koutekite | Cu5As2 |
| As | ⓘ Kutinaite | Ag6Cu14As7 |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Nickelskutterudite | NiAs3 |
| As | ⓘ Olivenite | Cu2(AsO4)(OH) |
| As | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| As | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| As | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| As | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| As | ⓘ Proustite | Ag3AsS3 |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| As | ⓘ Skutterudite | CoAs3 |
| As | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| As | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| As | ⓘ Zálesíite | CaCu6(AsO4)2(AsO3OH)(OH)6 · 3H2O |
| As | ⓘ Tennantite Subgroup var. Silver-bearing Tennantite | (Cu,Ag)6[Cu4(Fe,Zn)2]As4S13 |
| As | ⓘ Trigodomeykite | Cu3-xAs |
| Se | Selenium | |
| Se | ⓘ Clausthalite | PbSe |
| Se | ⓘ Klockmannite | CuSe |
| Se | ⓘ Umangite | Cu3Se2 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Allargentum | (Ag1-xSbx) |
| Ag | ⓘ Dyscrasite | Ag3Sb |
| Ag | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Ag | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Ag | ⓘ Kutinaite | Ag6Cu14As7 |
| Ag | ⓘ Matildite | AgBiS2 |
| Ag | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| Ag | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Ag | ⓘ Proustite | Ag3AsS3 |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Stromeyerite | AgCuS |
| Ag | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Ag | ⓘ Tennantite Subgroup var. Silver-bearing Tennantite | (Cu,Ag)6[Cu4(Fe,Zn)2]As4S13 |
| Sb | Antimony | |
| Sb | ⓘ Allargentum | (Ag1-xSbx) |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Dyscrasite | Ag3Sb |
| Sb | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Sb | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Ba | Barium | |
| Ba | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Billietite | Ba(UO2)6O4(OH)6 · 4-8H2O |
| Ba | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| Ba | ⓘ Heinrichite | Ba(UO2)2(AsO4)2 · 10H2O |
| Ba | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Aikinite | CuPbBiS3 |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Pb | ⓘ Cannizzarite | Pb48Bi56S132 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Clausthalite | PbSe |
| Pb | ⓘ Cosalite | Pb2Bi2S5 |
| Pb | ⓘ Curite | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Gartrellite | PbCuFe3+(AsO4)2(OH) · H2O |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| Pb | ⓘ Wölsendorfite | Pb7(UO2)14O19(OH)4 · 12H2O |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Bi | Bismuth | |
| Bi | ⓘ Aikinite | CuPbBiS3 |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Cannizzarite | Pb48Bi56S132 |
| Bi | ⓘ Cosalite | Pb2Bi2S5 |
| Bi | ⓘ Emplectite | CuBiS2 |
| Bi | ⓘ Matildite | AgBiS2 |
| Bi | ⓘ Petitjeanite | Bi3(PO4)2O(OH) |
| U | Uranium | |
| U | ⓘ Billietite | Ba(UO2)6O4(OH)6 · 4-8H2O |
| U | ⓘ Coffinite | U(SiO4) · nH2O |
| U | ⓘ Curite | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| U | ⓘ Heinrichite | Ba(UO2)2(AsO4)2 · 10H2O |
| U | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| U | ⓘ Uraninite var. Pitchblende | UO2 |
| U | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| U | ⓘ Sharpite | Ca(UO2)3(CO3)4 · 3H2O |
| U | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| U | ⓘ Wölsendorfite | Pb7(UO2)14O19(OH)4 · 12H2O |
| U | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
Fossils
There are 6 fossil localities from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 6 | ||||||
|---|---|---|---|---|---|---|---|
| Youngest Fossil Listed | 331 Ma (Carboniferous) | ||||||
| Oldest Fossil Listed | 359 Ma (Late/Upper Devonian) | ||||||
| Stratigraphic Units |
| ||||||
| Fossils from Region | Click here to show the list. | ||||||
| Fossil Localities | Click to show 1 fossil locality |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Arrondissement_of_Thann-Guebwiller |
|---|---|
| Wikidata ID: | Q19250053 |
Localities in this Region
- Grand Est
- Haut-Rhin
- Thann-Guebwiller
- ⭔Bitschwiller-lès-Thann
- ⭔Bourbach-le-Bas
- ⭔Bourbach-le-Haut
- ⭔Buhl
- ⭔Cernay
- ⭔Dolleren
- ⭔Ensisheim
- ⭔Fellering
- ⭔Guebwiller
- ⭔Hartmannswiller
- ⭔Husseren-Wesserling
- ⭔Jungholtz
- ⭔Kirchberg
- ⭔Kruth
- ⭔Lautenbach
- ⭔Leimbach
- ⭔Leimbach - Rammersmatt area
- ⭔Malmerspach
- ⭔Masevaux-Niederbruck
- ⭔Mitzach
- ⭔Mollau
- ⭔Moosch
- ⭔Murbach
- ⭔Niederbruck
- ⭔Oberbruck
- ⭔Oderen
- ⭔Osenbach
- ⭔Rammersmatt
- ⭔Ranspach
- ⭔Rimbach-près-Guebwiller
- ⭔Rimbach-près-Masevaux
- Thann-Guebwiller
- Haut-Rhin
- Grand Est
- Haut-Rhin
- Thann-Guebwiller
- Rimbach-près-Masevaux
- ⭔Roderen
- ⭔Rouffach
- ⭔Saint-Amarin
- ⭔Sewen
- ⭔Sickert
- ⭔Soultz-Haut-Rhin
- ⭔Soultzmatt
- ⭔Steinbach
- ⭔Storckensohn
- ⭔Thann
- ⭔Uffholtz
- ⭔Urbès
- ⭔Wattwiller
- ⭔Wegscheid
- ⭔Wildenstein
- ⭔Willer-sur-Thur
- ⭔Wuenheim
- Thann-Guebwiller
- Haut-Rhin
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
- Moldanubian BeltOrogenic Belt
EuropeContinent
France
- Grand Est
- Haut-Rhin
- Doller ValleyValley
- Lauch ValleyValley
- Mulhouse potash mining districtMining District
- Thur valley (Thann valley)Valley
- Vosges
- Vosges Volcanic FieldVolcanic Field
- Haut-Rhin
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions
St Nicolas Mine, Silberthal, Steinbach, Thann-Guebwiller, Haut-Rhin, Grand Est, France