This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Providence | 179,207 (2017) |
| Warwick | 81,699 (2017) |
| Cranston | 81,073 (2017) |
| Pawtucket | 71,591 (2017) |
| East Providence | 47,408 (2017) |
| Woonsocket | 41,475 (2017) |
Other Languages:
French:
Rhode Island, États-Unis
German:
Rhode Island, Vereinigte Staaten
Italian:
Rhode Island, Stati Uniti d'America
Russian:
Род-Айленд, Соединённые Штаты Америки
Simplified Chinese:
羅德島州, 美国
Spanish:
Rhode Island, Estados Unidos
Afrikaans:
Rhode Island, Verenigde State van Amerika
Albanian:
Rhode Island, Shtetet e Bashkuara të Amerikës
Amharic:
ሮድ አይላንድ, አሜሪካ
Anglo-Saxon:
Rhode Īeg, Geānedu Rīcu American
Arabic:
رود آيلاند, الولايات المتحدة
Aragonese:
Rhode Island
Armenian:
Ռոդ Այլենդ, Ամերիկայի Միացյալ Նահանգներ
Asturian:
Rhode Island, Estaos Xuníos d'América
Aymara:
Rhode Island suyu, Istadus Unidus
Azeri:
Rod-Aylend, Amerika Birləşmiş Ştatları
Bashkir:
Род-Айленд, Америка Ҡушма Штаттары
Basque:
Rhode Island
Bavarian:
Rhode Island, Vaoanigte Stootn
Belarusian:
Род-Айленд, Злучаныя Штаты Амерыкі
Belarusian (Tarashkevitsa):
Род-Айлэнд, Злучаныя Штаты Амэрыкі
Bengali:
রোড আইল্যান্ড, মার্কিন যুক্তরাষ্ট্র
Bishnupriya Manipuri:
রোড আইল্যান্ড, তিলপারাষ্ট্র
Bislama:
Rhode Island, Yunaeted Stet blong Amerika
Bosnian:
Rhode Island, Sjedinjene Američke Države
Breton:
Rhode Island, Stadoù-Unanet Amerika
Bulgarian:
Роуд Айланд, Съединени американски щати
Burmese:
ရုဒ်အိုင်းလန်းပြည်နယ်, အမေရိကန်ပြည်ထောင်စု
Catalan:
Rhode Island, Estats Units d’Amèrica
Cebuano:
Rhode Island
Central Bikol:
Rhode Island, Estados Unidos
Chechen:
Род-Айленд, Америкин Цхьаьнатоьхна Штаташ
Chuvash:
Род Айленд, Пĕрлешнĕ Штатсем
Cornish:
Ynys Rhode, Statys Unys
Corsican:
Rhode Island, Stati Uniti d'America
Croatian:
Rhode Island, Sjedinjene Američke Države
Czech:
Rhode Island, Spojené státy americké
Danish:
Rhode Island, USA
Dutch:
Rhode Island, Verenigde Staten
Dutch Low Saxon:
Rhode Island, Verienigde Staoten van Amerika
Egyptian Arabic:
رود ايلاند, امريكا
Emilian-Romagnol:
Rhode Island, Stat Unî
Esperanto:
Rod-Insulo
Estonian:
Rhode Island, Ameerika Ühendriigid
Faroese:
Rhode Island
Farsi/Persian:
رود آیلند, ایالات متحده آمریکا
Fiji Hindi:
Rhode Island, United States
Finnish:
Rhode Island, Yhdysvallat
Gagauz:
Rhode Island, Amerika Birleşik Devletläri
Galician:
Rhode Island, Estados Unidos de América
Georgian:
როდ-აილენდი, ამერიკის შეერთებული შტატები
Greek:
Ρόουντ Άιλαντ, Ηνωμένες Πολιτείες Αμερικής
Guarani:
Rhode Island, Tetãvore Joapykuéra
Haitian:
Rod Aylann, Etazini
Hakka:
Rhode Island
Hausa:
Rhode Island, Tarayyar Amurka
Hawaiian:
Loke ‘Ailana, ‘Amelika Hui Pū ‘ia
Hebrew:
רוד איילנד, ארצות הברית
Hill Mari:
Род-Айленд, Америкын Ушымы Штатвлӓжӹ
Hindi:
रोड आइलैण्ड, संयुक्त राज्य
Hungarian:
Rhode Island, Amerikai Egyesült Államok
Icelandic:
Rhode Island, Bandaríkin
Ido:
Rhode Island, Usa
Igbo:
Àlá mmírí Rhode, Njikọ̀taọ̀hà
Iloko:
Rhode Island, Estados Unidos iti Amerika
Indonesian:
Rhode Island, Amerika Serikat
Interlingua:
Rhode Island, Statos Unite de America
Irish Gaelic:
Oileán Rhode, Stáit Aontaithe Mheiriceá
Japanese:
ロードアイランド州, アメリカ合衆国
Javanese:
Rhode Island, Amérika Sarékat
Judaeo-Spanish:
Rhode Island, Estados Unidos de Amerika
Kabiye:
Rood Ayilandi, Etaazuunii
Kabyle:
Rhode Island, Iwunak Yeddukklen n Temrikt
Kalmyk:
Род-Айленд, Америкин Ниицәтә Орн Нутугуд
Kannada:
ರೋಡ್ ಐಲೆಂಡ್, ಅಮೇರಿಕ ಸಂಯುಕ್ತ ಸಂಸ್ಥಾನ
Kapampangan:
Pulu ning Rhode, Estados Unidos
Kazakh (Cyrillic Script):
Род-Айленд, Америка Құрама Штаттары
Korean:
로드아일랜드주, 미국
Kurdish (Latin Script):
Rhode Island, Dewletên Yekbûyî yên Amerîkayê
Latin:
Rhodensis Insula, Civitates Foederatae Americae
Latvian:
Rodailenda, Amerikas Savienotās Valstis
Ligurian:
Isoa de Rhode, Stati Unïi d'America
Limburgian:
Rhode Island, Vereinegde Staote vaan Amerika
Lithuanian:
Rod Ailandas, Jungtinės Amerikos Valstijos
Lombard:
Rhode Island, Stat Ünì d'America
Low Saxon/Low German:
Rhode Island, USA
Luri:
رودآیلأند, ڤولاتچٱیا یٱکاگرتٱ آمریکا
Luxembourgish:
Rhode Island, Vereenegt Staate vun Amerika
Macedonian:
Род Ајленд, Соединети Американски Држави
Maithili:
रोड आइल्यान्ड, संयुक्त राज्य अमेरिका
Malagasy:
Rhode Island, Etazonia
Malay:
Rhode Island, Amerika Syarikat
Malayalam:
റോഡ് ഐലൻഡ്
Manx:
Ellan Rhode, Steatyn Unnaneysit America
Maori:
Rhode Island, Hononga-o-Amerika
Marathi:
र्होड आयलंड, अमेरिकेची संयुक्त संस्थाने
Mazanderani:
رودآیلند
Meadow Mari:
Род-Айленд, Ушымо Американ Штат-влак
Min Dong Chinese:
Rhode Island
Mingrelian:
როდ-აილენდი, ამერიკაშ აკოართაფილი შტატეფი
Mongolian:
Рөүд-Айленд, Америкийн Нэгдсэн Улс
Nauruan:
Rhode Island, Eben Merika
Nepali:
रोड आइल्यान्ड, संयुक्त राज्य अमेरिका
Northern Frisian:
Rhode Island, Feriind Stoote foon Ameerika
Northern Sami:
Rhode Island, Amerihká ovttastuvvan stáhtat
Norwegian:
Rhode Island, USA
Norwegian (Nynorsk):
Rhode Island, USA
Occitan:
Rhode Island, Estats Units d'America
Ossetian:
Род-Айленд, Америкæйы Иугонд Штаттæ
Pali:
रोड टापू, संयुक्त राज्य अमेरिका
Piedmontese:
Rhode Island, Stat Unì d'América
Polish:
Rhode Island, Stany Zjednoczone
Portuguese:
Rhode Island, Estados Unidos
Punjabi:
ਰੋਡ ਟਾਪੂ, ਸੰਯੁਕਤ ਰਾਜ ਅਮਰੀਕਾ
Quechua:
Rhode Island suyu, Hukllachasqa Amirika Suyukuna
Romanian:
Rhode Island, Statele Unite ale Americii
Romansh:
Rhode Island, Stadis Unids
Russia Buriat:
Род-Айленд
Samogitian:
Rod Ailands, JAV
Sanskrit:
रोड ऐलैंड, अमेरिकासंयुक्तराज्यम्
Sardinian:
Rhode Island, Istados Unidos de Amèrica
Saterland Frisian:
Rhode Island, Fereende Stoaten fon Amerikoa
Scots:
Rhode Island
Scottish Gaelic:
Rhode Island, Na Stàitean Aonaichte
Serbian:
Роуд Ајланд, Сједињене Америчке Државе
Serbo-Croatian:
Rhode Island, Sjedinjene Američke Države
Sicilian:
Rhode Island, Stati Uniti
Slovak:
Rhode Island, Spojené štáty
Slovenian:
Rhode Island, Združene države Amerike
South Azerbaijani:
رود آیلند ایالتی, آمریکا بیرلشمیش ایالتلری
Swahili:
Rhode Island, Marekani
Swedish:
Rhode Island, USA
Tagalog:
Rhode Island, Estados Unidos
Tamil:
றோட் தீவு, அமெரிக்க ஐக்கிய நாடு
Tatar:
Род-Айленд, Америка Кушма Штатлары
Thai:
รัฐโรดไอแลนด์, ประเทศสหรัฐอเมริกา
Traditional Chinese:
羅德島州, 美國
Turkish:
Rhode Island, Amerika Birleşik Devletleri
Ukrainian:
Род-Айленд, Сполучені Штати Америки
Urdu:
روڈ آئلینڈ, ریاستہائے متحدہ امریکا
Uyghur:
Rodé Arili Shitati, ئامېرىكا قوشما شىتاتلىرى
Uzbek (Latin Script):
Rod-Aylend, Amerika Qoʻshma Shtatlari
Venetian:
Rhode Island, Stati Unii de ła Mèrica
Vietnamese:
Rhode Island, Chủng Quốc Hoa Kỳ
Volapük:
Rhode Island, Lamerikän
Waray:
Rhode Island, Estados Unidos
Welsh:
Rhode Island, Unol Daleithiau America
West Frisian:
Rhode Island, Feriene Steaten
Western Punjabi:
رہوڈز آئلینڈ, امریکہ
Yakut:
Род Айлэнд, Америка Холбоһуктаах Штааттара
Yiddish:
ראוד איילענד, פאראייניקטע שטאטן פון אמעריקע
Yoruba:
Erékùṣù Rhode
Zazaki:
Rhode Island, Dewletê Amerikayê Yewbiyayey
The state with the longest name! The formal name of this state is: "The State of Rhode Island and Providence Plantations". Part of the Appalachians (Boston platform). Western part of state is granitic and metamorphic rocks. Eastern portion contains Narragansett basin. State has been glaciated.
There are 5 counties in the state. The counties are further divided into 31 towns, 8 cities, and 1 undefined area (consisting of water). [Source: US Census Bureau]
There were changes to the boundary between Rhode Island and Massachusetts in 1862, and the boundary was adjusted again in 1897.
There are 5 counties in the state. The counties are further divided into 31 towns, 8 cities, and 1 undefined area (consisting of water). [Source: US Census Bureau]
There were changes to the boundary between Rhode Island and Massachusetts in 1862, and the boundary was adjusted again in 1897.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities153 valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S |
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 Localities: Reported from at least 28 localities in this region. Habit: fibrous Colour: green Description: Parallel fibers embedded in quartz. |
| ⓘ Aegirine Formula: NaFe3+Si2O6 |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reported from at least 30 localities in this region. |
| ⓘ Albite var. Andesine Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ Albite var. Cleavelandite ? Formula: Na(AlSi3O8) |
| ⓘ Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] Localities: Reported from at least 19 localities in this region. |
| ⓘ Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 Localities: Reported from at least 9 localities in this region. |
| ⓘ 'Amber' |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5(T8O22)W2 |
| ⓘ 'Amphibole Supergroup var. Uralite' Formula: AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ Analcime Formula: Na(AlSi2O6) · H2O |
| ⓘ Anatase Formula: TiO2 Localities: Reported from at least 14 localities in this region. |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 |
| ⓘ Anglesite Formula: PbSO4 |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 Localities: Ochee Spring Quarry (Johnston Soapstone Quarry), Johnston, Providence County, Rhode Island, USA Conklin Quarry, Lime Rock, Lincoln, Providence County, Rhode Island, USA Manton Avenue Quarry, Manton, Providence, Providence County, Rhode Island, USA Dexter Quarry (Dexter Lime Quarry), Lime Rock, Lincoln, Providence County, Rhode Island, USA Grants Mills, Cumberland, Providence County, Rhode Island, USA |
| ⓘ Anorthite Formula: Ca(Al2Si2O8) |
| ⓘ Anorthite var. Labradorite Formula: (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ Anthophyllite Formula: ◻Mg2Mg5(Si8O22)(OH)2 Locality: Ochee Spring Quarry (Johnston Soapstone Quarry), Johnston, Providence County, Rhode Island, USA References: |
| ⓘ Antigorite Formula: Mg3(Si2O5)(OH)4 Localities: Reported from at least 14 localities in this region. |
| ⓘ Antigorite var. Bowenite Formula: Mg3(Si2O5)(OH)4 Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A |
| ⓘ Aragonite Formula: CaCO3 Localities: Reported from at least 7 localities in this region. |
| ⓘ Arfvedsonite Formula: NaNa2(Fe2+4Fe3+)Si8O22(OH)2 |
| ⓘ Arsenopyrite Formula: FeAsS Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Asbestos' |
| ⓘ 'Asbestos var. Mountain Leather' |
| ⓘ Astrophyllite Formula: K2NaFe2+7Ti2[Si4O12]2O2(OH)4F |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 Localities: Reported from at least 6 localities in this region. |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ Axinite-(Fe) Formula: Ca2Fe2+Al2BSi4O15OH Localities: Manville Quarry, Cumberland, Providence County, Rhode Island, USA Conklin Quarry, Lime Rock, Lincoln, Providence County, Rhode Island, USA Keating Quarry, Cranston, Providence County, Rhode Island, USA Hi-Lo Construction Co. Quarry, Johnston, Providence County, Rhode Island, USA Old River Road quarry, Lincoln, Providence County, Rhode Island, USA |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Babingtonite Formula: Ca2Fe2+Fe3+Si5O14(OH) Locality: Warwick, Kent County, Rhode Island, USA References: |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Bastnäsite-(Ce) Formula: Ce(CO3)F Locality: Redstone Granite Quarry (Cherenzia Quarry), Westerly, Washington County, Rhode Island, USA References: |
| ⓘ Bertrandite Formula: Be4(Si2O7)(OH)2 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Localities: Reported from at least 18 localities in this region. |
| ⓘ Beryl var. Aquamarine |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Reported from at least 33 localities in this region. |
| ⓘ Birnessite ? Formula: (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| ⓘ 'Bloodstone' Formula: SiO2 References: |
| ⓘ Bornite Formula: Cu5FeS4 Localities: Reported from at least 6 localities in this region. |
| ⓘ Braunite Formula: Mn2+Mn3+6(SiO4)O8 |
| ⓘ Brookite Formula: TiO2 Localities: Grants Mills, Cumberland, Providence County, Rhode Island, USA Construction Materials Corp. quarry (Fish Road quarry), Tiverton, Newport County, Rhode Island, USA Interstate 95 road cuts, Richmond, Washington County, Rhode Island, USA Poker Hill, Ashton, Cumberland, Providence County, Rhode Island, USA |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 48 localities in this region. |
| ⓘ Calcite var. Iron-bearing Calcite Formula: (Ca,Fe)CO3 |
| ⓘ 'Calcium Amphibole Subgroup' Formula: AnCa2(C2+5-mC3+m)(Si8-(n+m)Al(n+m))W2 |
| ⓘ 'Calcium Amphibole Subgroup var. Hornblende' Formula: AnCa2(Z2+5-mZ3+m)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| ⓘ Cerussite Formula: PbCO3 |
| ⓘ 'Chabazite' Localities: Reported from at least 6 localities in this region. |
| ⓘ Chabazite-Ca Formula: (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 27 localities in this region. |
| ⓘ Chalcopyrite var. Gold-bearing Chalcopyrite Formula: CuFeS2 with Au References: |
| ⓘ Chamosite Formula: Fe2+5Al(AlSi3O10)(OH)8 References: |
| ⓘ Chevkinite-(Ce) Formula: Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| ⓘ 'Chlorite Group' Localities: Reported from at least 16 localities in this region. |
| ✪ Chloritoid Formula: Fe2+Al2O(SiO4)(OH)2 Description: Crystals to tens of centimeters across. |
| ⓘ Chloritoid var. Masonite Formula: (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 Localities: Interstate highway 295 road cut, Cranston, Providence County, Rhode Island, USA Conklin Quarry, Lime Rock, Lincoln, Providence County, Rhode Island, USA Grants Mills, Cumberland, Providence County, Rhode Island, USA State Route 102 road cut, Glendale, Burrillville, Providence County, Rhode Island, USA Old Maids Quarry, Woonsocket, Providence County, Rhode Island, USA |
| ⓘ 'Chrysoprase' References: |
| ⓘ Chrysotile Formula: Mg3(Si2O5)(OH)4 Localities: Habit: parallel fibers Colour: olive green Description: Veins of fibers reached 18 inches across. |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 Localities: Reported from at least 38 localities in this region. |
| ⓘ Clinochlore var. Pennine Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinochlore var. Ripidolite Formula: (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| ⓘ 'Clinochrysotile' Formula: Mg3(Si2O5)(OH)4 |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Columbite-(Fe) Formula: Fe2+Nb2O6 |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' |
| ⓘ Copiapite ? Formula: Fe2+Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ Cordierite Formula: Mg2Al4Si5O18 |
| ⓘ Covellite Formula: CuS |
| ⓘ Cryptomelane Formula: K(Mn4+7Mn3+)O16 |
| ⓘ Danalite Formula: Be3Fe2+4(SiO4)3S Description: The majority of specimens of labeled danalite are in fact genthelvite. |
| ⓘ 'Danalite-Genthelvite Series' References: |
| ⓘ Datolite Formula: CaB(SiO4)(OH) Description: In calcite vein. |
| ⓘ Diopside Formula: CaMgSi2O6 |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: Description: Found in a calcite vein with graphite and muscovite. |
| ⓘ 'Elaterite' Formula: (C,H,O,S) References: |
| ⓘ Elbaite ? Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Enstatite Formula: Mg2Si2O6 References: |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: Reported from at least 39 localities in this region. |
| ⓘ 'Fayalite-Forsterite Series' Localities: Cumberland, Providence County, Rhode Island, USA Coventry, Kent County, Rhode Island, USA State Route 78, Westerly, Washington County, Rhode Island, USA Diamond Hill Iron prospects, Diamond Hill, Cumberland, Providence County, Rhode Island, USA Iron Mine Hill quarry, Cumberland, Providence County, Rhode Island, USA |
| ⓘ 'Fayalite-Tephroite Series' References: |
| ⓘ 'Fayalite-Tephroite Series var. Knebelite' Formula: from (Fe1.5Mn0.5)2SiO4 to (Mn1.5Fe0.5)2SiO4 References: |
| ⓘ 'Feldspar Group' Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Feldspar Group var. Perthite' Localities: Smithfield beryl prospect, Smithfield, Providence County, Rhode Island, USA West Kingston, South Kingstown, Washington County, Rhode Island, USA Bristol Ferry, Portsmouth, Newport County, Rhode Island, USA Grants Mills, Cumberland, Providence County, Rhode Island, USA Bear Ledge quarry, Graniteville, Johnston, Providence County, Rhode Island, USA |
| ⓘ Ferrimolybdite Formula: Fe2(MoO4)3 · nH2O Localities: Durfee Hill Gold mine, Glocester, Providence County, Rhode Island, USA Sneech Pond copper mines (Copper Mine Hill), Cumberland, Providence County, Rhode Island, USA Conklin Quarry, Lime Rock, Lincoln, Providence County, Rhode Island, USA Route 146 road cuts, Lincoln, Providence County, Rhode Island, USA |
| ⓘ Ferro-actinolite Formula: ◻Ca2Fe2+5(Si8O22)(OH)2 Localities: Description: Note: There is an analysis of ferro-actinolite from Cumberland, Rhode Island in The Handbook of Mineralogy. Specific locality not provided, but it may be Sneech Pond. ( http://www.handbookofmineralogy.org/pdfs/ferroactinolite.pdf ) |
| ⓘ Ferro-hornblende Formula: ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Localities: Reported from at least 20 localities in this region. |
| ⓘ Fluorapophyllite-(K) Formula: KCa4(Si8O20)(F,OH) · 8H2O |
| ⓘ Fluorite Formula: CaF2 Localities: Reported from at least 26 localities in this region. |
| ⓘ Fluorite var. Chlorophane Formula: CaF2 References: |
| ⓘ Forsterite Formula: Mg2(SiO4) |
| ⓘ Galena Formula: PbS Localities: Reported from at least 15 localities in this region. |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Genthelvite Formula: Be3Zn4(SiO4)3S Localities: Description: The majority of specimens of labeled danalite are in fact genthelvite. |
| ⓘ 'Gmelinite Subgroup' |
| ⓘ Goethite Formula: Fe3+O(OH) Localities: Reported from at least 13 localities in this region. |
| ⓘ Graphite Formula: C Localities: Reported from at least 28 localities in this region. |
| ⓘ Greenockite Formula: CdS |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 |
| ⓘ Grossular var. Hessonite Formula: Ca3Al2(SiO4)3 |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: Reported from at least 6 localities in this region. |
| ⓘ Halite Formula: NaCl Description: Formed from seawater seeping into mines. |
| ⓘ Harmotome Formula: Ba2(Si12Al4)O32 · 12H2O |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 45 localities in this region. |
| ⓘ Hematite var. Specularite Formula: Fe2O3 References: Robinson, Samuel (1825) A Catalogue of American Minerals, With Their Localities - Including All Which Are Known to Exist in the United States and British Provinces, And Having the Towns, Counties, and Districts in Each State and Province Arranged Alphabetically. With an Appendix, Containing Additional Localities and a Tabular View. Cummings, Hilliard, & Co. |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O |
| ⓘ Heulandite-Ca Formula: (Ca,Na)5(Si27Al9)O72 · 26H2O |
| ⓘ 'Heulandite Subgroup' Formula: (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O Locality: Coventry, Kent County, Rhode Island, USA References: |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(C2+4C3+)(AlSi7O22)W2 Localities: Reported from at least 12 localities in this region. |
| ⓘ Hydrocerussite Formula: Pb3(CO3)2(OH)2 |
| ⓘ Hydromagnesite Formula: Mg5(CO3)4(OH)2 · 4H2O |
| ⓘ Ilmenite Formula: Fe2+TiO3 Localities: Reported from at least 22 localities in this region. |
| ⓘ Ilmenite var. Washingtonite Formula: Fe2+(Ti,Fe3+)O3 |
| ⓘ Ilvaite Formula: CaFe3+Fe2+2(Si2O7)O(OH) |
| ⓘ Jamesonite Formula: Pb4FeSb6S14 References: |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 References: |
| ⓘ Kaersutite Formula: NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 Localities: Reported from at least 7 localities in this region. |
| ⓘ 'K Feldspar' Localities: Reported from at least 12 localities in this region. |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 Localities: Reported from at least 11 localities in this region. |
| ⓘ Kyanite Formula: Al2(SiO4)O |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O |
| ⓘ Lepidocrocite Formula: Fe3+O(OH) |
| ⓘ 'Lepidolite' |
| ⓘ 'Leucoxene' Localities: Interstate 295 / US Route 6 road cuts, Johnston, Providence County, Rhode Island, USA Construction Materials Corp. quarry (Fish Road quarry), Tiverton, Newport County, Rhode Island, USA Bristol Ferry, Portsmouth, Newport County, Rhode Island, USA Route 146 road cuts, Lincoln, Providence County, Rhode Island, USA |
| ⓘ 'Limonite' Localities: Reported from at least 12 localities in this region. |
| ⓘ Magnesio-hornblende Formula: ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 Localities: Reported from at least 13 localities in this region. Description: Euhedral crystals in mariolitic cavities. |
| ⓘ Magnesite Formula: MgCO3 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 45 localities in this region. |
| ⓘ Magnetite var. Titanium-bearing Magnetite Formula: Fe2+(Fe3+,Ti)2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 14 localities in this region. |
| ⓘ 'Manganese Oxides' |
| ⓘ 'Manganese Oxides var. Manganese Dendrites' |
| ⓘ Manganite Formula: Mn3+O(OH) |
| ⓘ Marcasite Formula: FeS2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Meionite Formula: Ca4Al6Si6O24CO3 |
| ⓘ Melanterite Formula: Fe2+(H2O)6(SO4) · H2O |
| ⓘ Microcline Formula: K(AlSi3O8) Localities: Reported from at least 43 localities in this region. |
| ⓘ Microcline var. Amazonite Formula: K(AlSi3O8) |
| ⓘ Molybdenite Formula: MoS2 Localities: Reported from at least 19 localities in this region. |
| ⓘ Molybdite Formula: MoO3 References: |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) Localities: Reported from at least 8 localities in this region. |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O Localities: Interstate highway 295 road cut, Cranston, Providence County, Rhode Island, USA Conklin Quarry, Lime Rock, Lincoln, Providence County, Rhode Island, USA Diamond Hill (Ashaway Village), Ashaway, Hopkinton, Washington County, Rhode Island, USA State Route 102 road cut, Glendale, Burrillville, Providence County, Rhode Island, USA State Route 102 road cut, Oakland, Burrillville, Providence County, Rhode Island, USA |
| ⓘ 'Moonstone' |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 39 localities in this region. |
| ⓘ Muscovite var. Damourite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 Localities: |
| ⓘ Nacrite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Native Copper Formula: Cu |
| ⓘ Native Gold Formula: Au Description: In sulphides. |
| ⓘ Native Silver Formula: Ag |
| ⓘ Native Sulphur Formula: S8 |
| ⓘ Natrolite Formula: Na2Al2Si3O10 · 2H2O |
| ⓘ Nontronite Formula: Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O Colour: Blue-gray Description: Alteration of diabase dike. |
| ⓘ 'Olivine Group' Formula: M2SiO4 |
| ⓘ Opal Formula: SiO2 · nH2O Localities: Reported from at least 10 localities in this region. Description: Hyalite |
| ⓘ Opal var. Hyalite Formula: SiO2 · nH2O |
| ⓘ Opal var. Opal-AN Formula: SiO2 · nH2O Localities: Interstate 295 / US Route 6 road cuts, Johnston, Providence County, Rhode Island, USA Sneech Pond copper mines (Copper Mine Hill), Cumberland, Providence County, Rhode Island, USA Grants Mills, Cumberland, Providence County, Rhode Island, USA State Route 102 road cut, Oakland, Burrillville, Providence County, Rhode Island, USA |
| ⓘ Orthoclase Formula: K(AlSi3O8) Localities: Reported from at least 20 localities in this region. |
| ⓘ Ottrélite ? Formula: Mn2+Al2O(SiO4)(OH)2 Localities: Reported from at least 9 localities in this region. |
| ⓘ Paragonite Formula: NaAl2(AlSi3O10)(OH)2 |
| ⓘ Pargasite Formula: NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| ⓘ Parisite-(Ce) Formula: CaCe2(CO3)3F2 References: |
| ⓘ 'Petroleum var. Bitumen' References: |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 |
| ⓘ Phosgenite Formula: Pb2CO3Cl2 |
| ⓘ Piemontite Formula: (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 Localities: |
| ⓘ Powellite Formula: Ca(MoO4) |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 47 localities in this region. |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Reported from at least 12 localities in this region. |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 130 localities in this region. |
| ⓘ Quartz var. Agate Formula: SiO2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Quartz var. Agate-Jasper Formula: SiO2 Localities: Colour: red, yellow, white, brown, green, etc. |
| ⓘ Quartz var. Amethyst Formula: SiO2 Localities: Reported from at least 27 localities in this region. Habit: Scepters on milky quartz to 45cm. Description: 500 scepters collected, 25 matrix specimens. |
| ⓘ Quartz var. Carnelian Formula: SiO2 |
| ⓘ Quartz var. Chalcedony Formula: SiO2 Localities: Reported from at least 11 localities in this region. |
| ⓘ Quartz var. Citrine Formula: SiO2 |
| ⓘ Quartz var. Milky Quartz Formula: SiO2 Localities: Reported from at least 10 localities in this region. |
| ⓘ Quartz var. Onyx Formula: SiO2 References: |
| ⓘ Quartz var. Prase Formula: SiO2 |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 |
| ⓘ Quartz var. Rutilated Quartz Formula: SiO2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Quartz var. Sardonyx Formula: SiO2 References: |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 Localities: Reported from at least 33 localities in this region. Description: Occurs in pegmatite. |
| ⓘ Rhodochrosite Formula: MnCO3 |
| ⓘ Rhodonite Formula: CaMn3Mn[Si5O15] Localities: Reported from at least 6 localities in this region. |
| ⓘ Riebeckite Formula: ◻Na2(Fe2+3Fe3+2)Si8O22(OH)2 Localities: Smithfield, Providence County, Rhode Island, USA Grants Mills, Cumberland, Providence County, Rhode Island, USA Kent County, Rhode Island, USA Beacon Pole Hill quarry, Cumberland, Providence County, Rhode Island, USA Diamond Hill Granite Company quarry, Diamond Hill, Cumberland, Providence County, Rhode Island, USA |
| ⓘ 'Riebeckite Root Name Group' Formula: ◻Na2(C2+3Fe3+2)(Si8O22)W2 |
| ⓘ 'Riebeckite Root Name Group var. Crocidolite' Formula: ◻[Na2][Z2+3Fe3+2]Si8O22(OH,F,Cl)2 |
| ⓘ Rutile Formula: TiO2 Localities: Reported from at least 20 localities in this region. |
| ⓘ 'Scapolite' Locality: Coventry, Kent County, Rhode Island, USA |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: Reported from at least 14 localities in this region. |
| ⓘ Scolecite Formula: CaAl2Si3O10 · 3H2O |
| ⓘ Sepiolite Formula: Mg4(Si6O15)(OH)2 · 6H2O References: |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 Localities: Redstone Granite Quarry (Cherenzia Quarry), Westerly, Washington County, Rhode Island, USA Iron Mine Hill quarry, Cumberland, Providence County, Rhode Island, USA Manton Avenue Quarry, Manton, Providence, Providence County, Rhode Island, USA Coventry, Kent County, Rhode Island, USA Newport, Newport County, Rhode Island, USA |
| ⓘ Siderite Formula: FeCO3 Localities: Reported from at least 12 localities in this region. |
| ⓘ Siderite var. Sphärosiderite Formula: FeCO3 References: |
| ⓘ Sillimanite Formula: Al2(SiO4)O |
| ⓘ Smithsonite Formula: ZnCO3 |
| ⓘ 'Soapstone' |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 10 localities in this region. |
| ⓘ Spinel Formula: MgAl2O4 |
| ⓘ Staurolite Formula: Fe2+2Al9Si4O23(OH) Localities: Reported from at least 6 localities in this region. |
| ⓘ Stilbite-Ca Formula: NaCa4(Si27Al9)O72 · 28H2O |
| ⓘ 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O Localities: Reported from at least 6 localities in this region. Description: Often bright orange. |
| ⓘ Stolzite Formula: Pb(WO4) |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 Localities: Reported from at least 21 localities in this region. Description: George English described the foliated talc from this quarry as perhaps the best in the US. |
| ⓘ Talc var. Steatite Formula: Mg3(Si4O10)(OH)2 |
| ⓘ Tephroite ? Formula: Mn2+2(SiO4) References: |
| ⓘ Thorianite Formula: ThO2 Locality: Redstone Granite Quarry (Cherenzia Quarry), Westerly, Washington County, Rhode Island, USA References: |
| ⓘ Thorianite var. Uranothorianite Formula: (Th,U)O2 |
| ⓘ Titanite Formula: CaTiO(SiO4) Localities: Reported from at least 26 localities in this region. |
| ⓘ Titanite var. Keilhauite Formula: (Ca,Y3+)(Ti,Al,Fe3+)[SiO4]O |
| ⓘ Todorokite ? Formula: (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O References: |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 Localities: Reported from at least 18 localities in this region. |
| ⓘ Uraninite Formula: UO2 |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ 'Wad' |
| ⓘ Wavellite Formula: Al3(PO4)2(OH)3 · 5H2O |
| ⓘ 'Wolframite Group' References: |
| ⓘ Wulfenite Formula: Pb(MoO4) |
| ⓘ Xenotime-(Y) Formula: Y(PO4) |
| ⓘ 'Zinnwaldite' References: |
| ⓘ Zircon Formula: Zr(SiO4) Localities: Reported from at least 18 localities in this region. |
| ⓘ Zircon var. Cyrtolite Formula: Zr[(SiO4),(OH)4] |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) Localities: Reported from at least 9 localities in this region. |
| ⓘ Zoisite var. Thulite Formula: {Ca2}{Al,Mn3+3}(Si2O7)(SiO4)O(OH) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | var. Gold-bearing Chalcopyrite | 2.CB.10a | CuFeS2 with Au |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| Group 3 - Halides | |||
| ⓘ | Halite | 3.AA.20 | NaCl |
| ⓘ | Fluorite var. Chlorophane | 3.AB.25 | CaF2 |
| ⓘ | 3.AB.25 | CaF2 | |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Magnetite var. Titanium-bearing Magnetite | 4.BB.05 | Fe2+(Fe3+,Ti)2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Hematite var. Specularite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite var. Washingtonite | 4.CB.05 | Fe2+(Ti,Fe3+)O3 |
| ⓘ | Quartz var. Agate | 4.DA.05 | SiO2 |
| ⓘ | var. Agate-Jasper | 4.DA.05 | SiO2 |
| ⓘ | var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | var. Citrine | 4.DA.05 | SiO2 |
| ⓘ | var. Onyx | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Rutilated Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | var. Milky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Prase | 4.DA.05 | SiO2 |
| ⓘ | var. Sardonyx | 4.DA.05 | SiO2 |
| ⓘ | var. Carnelian | 4.DA.05 | SiO2 |
| ⓘ | Opal var. Opal-AN | 4.DA.10 | SiO2 · nH2O |
| ⓘ | 4.DA.10 | SiO2 · nH2O | |
| ⓘ | var. Hyalite | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brookite | 4.DD.10 | TiO2 |
| ⓘ | Cryptomelane | 4.DK.05a | K(Mn4+7Mn3+)O16 |
| ⓘ | Todorokite ? | 4.DK.10 | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| ⓘ | Thorianite | 4.DL.05 | ThO2 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | Thorianite var. Uranothorianite | 4.DL.05 | (Th,U)O2 |
| ⓘ | Molybdite | 4.E0.10 | MoO3 |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Lepidocrocite | 4.FE.15 | Fe3+O(OH) |
| ⓘ | Birnessite ? | 4.FL.45 | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Siderite var. Sphärosiderite | 5.AB.05 | FeCO3 |
| ⓘ | Calcite var. Iron-bearing Calcite | 5.AB.05 | (Ca,Fe)CO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Bastnäsite-(Ce) | 5.BD.20a | Ce(CO3)F |
| ⓘ | Parisite-(Ce) | 5.BD.20b | CaCe2(CO3)3F2 |
| ⓘ | Hydrocerussite | 5.BE.10 | Pb3(CO3)2(OH)2 |
| ⓘ | Phosgenite | 5.BE.20 | Pb2CO3Cl2 |
| ⓘ | Hydromagnesite | 5.DA.05 | Mg5(CO3)4(OH)2 · 4H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6(SO4) · H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Copiapite ? | 7.DB.35 | Fe2+Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ | Powellite | 7.GA.05 | Ca(MoO4) |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Stolzite | 7.GA.05 | Pb(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| ⓘ | Ferrimolybdite | 7.GB.30 | Fe2(MoO4)3 · nH2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Wavellite | 8.DC.50 | Al3(PO4)2(OH)3 · 5H2O |
| ⓘ | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 · 10-12H2O |
| Group 9 - Silicates | |||
| ⓘ | Chrysotile | 9.00. | Mg3(Si2O5)(OH)4 |
| ⓘ | Forsterite | 9.AC.05 | Mg2(SiO4) |
| ⓘ | Tephroite ? | 9.AC.05 | Mn2+2(SiO4) |
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | var. Hessonite | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | var. Cyrtolite | 9.AD.30 | Zr[(SiO4),(OH)4] |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Chloritoid | 9.AF.85 | Fe2+Al2O(SiO4)(OH)2 |
| ⓘ | Ottrélite ? | 9.AF.85 | Mn2+Al2O(SiO4)(OH)2 |
| ⓘ | Chloritoid var. Masonite | 9.AF.85 | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| ⓘ | Braunite | 9.AG.05 | Mn2+Mn3+6(SiO4)O8 |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | var. Keilhauite | 9.AG.15 | (Ca,Y3+)(Ti,Al,Fe3+)[SiO4]O |
| ⓘ | Datolite | 9.AJ.20 | CaB(SiO4)(OH) |
| ⓘ | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Axinite-(Fe) | 9.BD.20 | Ca2Fe2+Al2BSi4O15OH |
| ⓘ | Ilvaite | 9.BE.07 | CaFe3+Fe2+2(Si2O7)O(OH) |
| ⓘ | Chevkinite-(Ce) | 9.BE.70 | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Piemontite | 9.BG.05a | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite var. Thulite | 9.BG.10 | {Ca2}{Al,Mn3+3}(Si2O7)(SiO4)O(OH) |
| ⓘ | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) | |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Beryl var. Aquamarine | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | 9.CJ.05 | Be3Al2(Si6O18) | |
| ⓘ | Cordierite | 9.CJ.10 | Mg2Al4Si5O18 |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Elbaite ? | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Enstatite | 9.DA.05 | Mg2Si2O6 |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Aegirine | 9.DA.25 | NaFe3+Si2O6 |
| ⓘ | Astrophyllite | 9.DC.05 | K2NaFe2+7Ti2[Si4O12]2O2(OH)4F |
| ⓘ | Anthophyllite | 9.DD.05 | ◻Mg2Mg5(Si8O22)(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Ferro-actinolite | 9.DE.10 | ◻Ca2Fe2+5(Si8O22)(OH)2 |
| ⓘ | Ferro-hornblende | 9.DE.10 | ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 |
| ⓘ | Magnesio-hornblende | 9.DE.10 | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Kaersutite | 9.DE.15 | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| ⓘ | Pargasite | 9.DE.15 | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| ⓘ | Arfvedsonite | 9.DE.25 | NaNa2(Fe2+4Fe3+)Si8O22(OH)2 |
| ⓘ | Riebeckite | 9.DE.25 | ◻Na2(Fe2+3Fe3+2)Si8O22(OH)2 |
| ⓘ | Babingtonite | 9.DK.05 | Ca2Fe2+Fe3+Si5O14(OH) |
| ⓘ | Rhodonite | 9.DK.05 | CaMn3Mn[Si5O15] |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Fluorapophyllite-(K) | 9.EA.15 | KCa4(Si8O20)(F,OH) · 8H2O |
| ⓘ | Talc var. Steatite | 9.EC.05 | Mg3(Si4O10)(OH)2 |
| ⓘ | 9.EC.05 | Mg3Si4O10(OH)2 | |
| ⓘ | Muscovite var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Paragonite | 9.EC.15 | NaAl2(AlSi3O10)(OH)2 |
| ⓘ | Muscovite var. Damourite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Nontronite | 9.EC.40 | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ | Chamosite | 9.EC.55 | Fe2+5Al(AlSi3O10)(OH)8 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | var. Ripidolite | 9.EC.55 | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| ⓘ | var. Pennine | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | 'Clinochrysotile' | 9.ED. | Mg3(Si2O5)(OH)4 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Nacrite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | var. Bowenite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Sepiolite | 9.EE.25 | Mg4(Si6O15)(OH)2 · 6H2O |
| ⓘ | Microcline var. Amazonite | 9.FA.30 | K(AlSi3O8) |
| ⓘ | 9.FA.30 | K(AlSi3O8) | |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Andesine | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | var. Labradorite | 9.FA.35 | (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ | Albite var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | var. Cleavelandite ? | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Danalite | 9.FB.10 | Be3Fe2+4(SiO4)3S |
| ⓘ | Genthelvite | 9.FB.10 | Be3Zn4(SiO4)3S |
| ⓘ | Meionite | 9.FB.15 | Ca4Al6Si6O24CO3 |
| ⓘ | Natrolite | 9.GA.05 | Na2Al2Si3O10 · 2H2O |
| ⓘ | Scolecite | 9.GA.05 | CaAl2Si3O10 · 3H2O |
| ⓘ | Analcime | 9.GB.05 | Na(AlSi2O6) · H2O |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| ⓘ | Harmotome | 9.GC.10 | Ba2(Si12Al4)O32 · 12H2O |
| ⓘ | Chabazite-Ca | 9.GD.10 | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| ⓘ | Heulandite-Ca | 9.GE.05 | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| ⓘ | Stilbite-Ca | 9.GE.10 | NaCa4(Si27Al9)O72 · 28H2O |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Amber' | - | |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Asbestos' | - | |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chrysoprase' | - | |
| ⓘ | 'Chabazite' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Gmelinite Subgroup' | - | |
| ⓘ | 'Heulandite Subgroup' | - | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| ⓘ | 'Calcium Amphibole Subgroup var. Hornblende' | - | AnCa2(Z2+5-mZ3+m)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| ⓘ | 'Lepidolite' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Moonstone' | - | |
| ⓘ | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Amphibole Supergroup var. Uralite' | - | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Wad' | - | |
| ⓘ | 'Zinnwaldite' | - | |
| ⓘ | 'Leucoxene' | - | |
| ⓘ | 'Feldspar Group var. Perthite' | - | |
| ⓘ | 'Bloodstone' | - | SiO2 |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Fayalite-Tephroite Series' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Riebeckite Root Name Group' | - | ◻Na2(C2+3Fe3+2)(Si8O22)W2 |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'Danalite-Genthelvite Series' | - | |
| ⓘ | 'Riebeckite Root Name Group var. Crocidolite' | - | ◻[Na2][Z2+3Fe3+2]Si8O22(OH,F,Cl)2 |
| ⓘ | 'Asbestos var. Mountain Leather' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Fayalite-Tephroite Series var. Knebelite' | - | from (Fe1.5Mn0.5)2SiO4 to (Mn1.5Fe0.5)2SiO4 |
| ⓘ | 'Soapstone' | - | |
| ⓘ | 'Petroleum var. Bitumen' | - | |
| ⓘ | 'Elaterite' | - | (C,H,O,S) |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Manganese Oxides var. Manganese Dendrites' | - | |
| ⓘ | '' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Olivine Group' | - | M2SiO4 |
| ⓘ | 'Calcium Amphibole Subgroup' | - | AnCa2(C2+5-mC3+m)(Si8-(n+m)Al(n+m))W2 |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Analcime | Na(AlSi2O6) · H2O |
| H | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| H | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| H | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| H | ⓘ Antigorite var. Bowenite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| H | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinochrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Datolite | CaB(SiO4)(OH) |
| H | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| H | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| H | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| H | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| H | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| H | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| H | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| H | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| H | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Lepidocrocite | Fe3+O(OH) |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| H | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| H | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Ottrélite | Mn2+Al2O(SiO4)(OH)2 |
| H | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| H | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| H | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| H | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Talc var. Steatite | Mg3(Si4O10)(OH)2 |
| H | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| H | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| H | ⓘ Zinnwaldite | |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Chloritoid var. Masonite | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| H | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| H | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| H | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| H | ⓘ Zircon var. Cyrtolite | Zr[(SiO4),(OH)4] |
| H | ⓘ Muscovite var. Damourite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Riebeckite Root Name Group var. Crocidolite | ◻[Na2][Z32+Fe23+]Si8O22(OH,F,Cl)2 |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Elaterite | (C,H,O,S) |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Opal var. Hyalite | SiO2 · nH2O |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Li | Lithium | |
| Li | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | ⓘ Zinnwaldite | |
| Be | Beryllium | |
| Be | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| Be | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| Be | ⓘ Danalite-Genthelvite Series | |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Datolite | CaB(SiO4)(OH) |
| B | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| C | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| C | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| C | ⓘ Phosgenite | Pb2CO3Cl2 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Siderite var. Sphärosiderite | FeCO3 |
| C | ⓘ Elaterite | (C,H,O,S) |
| C | ⓘ Calcite var. Iron-bearing Calcite | (Ca,Fe)CO3 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Aegirine | NaFe3+Si2O6 |
| O | ⓘ Quartz var. Agate | SiO2 |
| O | ⓘ Quartz var. Agate-Jasper | SiO2 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Analcime | Na(AlSi2O6) · H2O |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| O | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| O | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| O | ⓘ Antigorite var. Bowenite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| O | ⓘ Brookite | TiO2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| O | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Quartz var. Citrine | SiO2 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinochrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| O | ⓘ Cordierite | Mg2Al4Si5O18 |
| O | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Datolite | CaB(SiO4)(OH) |
| O | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| O | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Enstatite | Mg2Si2O6 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| O | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| O | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| O | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| O | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| O | ⓘ Forsterite | Mg2(SiO4) |
| O | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Grossular var. Hessonite | Ca3Al2(SiO4)3 |
| O | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| O | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| O | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| O | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| O | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Lepidocrocite | Fe3+O(OH) |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| O | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Molybdite | MoO3 |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| O | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| O | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Quartz var. Onyx | SiO2 |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Ottrélite | Mn2+Al2O(SiO4)(OH)2 |
| O | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| O | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| O | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Phosgenite | Pb2CO3Cl2 |
| O | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Powellite | Ca(MoO4) |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| O | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| O | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| O | ⓘ Quartz var. Rutilated Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| O | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Talc var. Steatite | Mg3(Si4O10)(OH)2 |
| O | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | ⓘ Stolzite | Pb(WO4) |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Tephroite | Mn22+(SiO4) |
| O | ⓘ Thorianite | ThO2 |
| O | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| O | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Thorianite var. Uranothorianite | (Th,U)O2 |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zinnwaldite | |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Chloritoid var. Masonite | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| O | ⓘ Hematite var. Specularite | Fe2O3 |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Quartz var. Milky Quartz | SiO2 |
| O | ⓘ Quartz var. Prase | SiO2 |
| O | ⓘ Siderite var. Sphärosiderite | FeCO3 |
| O | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| O | ⓘ Chevkinite-(Ce) | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| O | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| O | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| O | ⓘ Zircon var. Cyrtolite | Zr[(SiO4),(OH)4] |
| O | ⓘ Quartz var. Sardonyx | SiO2 |
| O | ⓘ Bloodstone | SiO2 |
| O | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| O | ⓘ Titanite var. Keilhauite | (Ca,Y3+)(Ti,Al,Fe3+)[SiO4]O |
| O | ⓘ Muscovite var. Damourite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Fayalite-Forsterite Series | |
| O | ⓘ Fayalite-Tephroite Series | |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| O | ⓘ Riebeckite Root Name Group | ◻Na2(C32+Fe23+)(Si8O22)W2 |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Danalite-Genthelvite Series | |
| O | ⓘ Riebeckite Root Name Group var. Crocidolite | ◻[Na2][Z32+Fe23+]Si8O22(OH,F,Cl)2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Fayalite-Tephroite Series var. Knebelite | from (Fe1.5Mn0.5)2SiO4 to (Mn1.5Fe0.5)2SiO4 |
| O | ⓘ Quartz var. Carnelian | SiO2 |
| O | ⓘ Elaterite | (C,H,O,S) |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Calcite var. Iron-bearing Calcite | (Ca,Fe)CO3 |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Ilmenite var. Washingtonite | Fe2+(Ti,Fe3+)O3 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Olivine Group | M2SiO4 |
| O | ⓘ Opal var. Hyalite | SiO2 · nH2O |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| F | Fluorine | |
| F | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| F | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorite var. Chlorophane | CaF2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| F | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| F | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Zinnwaldite | |
| F | ⓘ Riebeckite Root Name Group var. Crocidolite | ◻[Na2][Z32+Fe23+]Si8O22(OH,F,Cl)2 |
| Na | Sodium | |
| Na | ⓘ Aegirine | NaFe3+Si2O6 |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Na | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| Na | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Na | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Halite | NaCl |
| Na | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Na | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Na | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Na | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Na | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Na | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Na | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Na | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Na | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Na | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Na | ⓘ Riebeckite Root Name Group | ◻Na2(C32+Fe23+)(Si8O22)W2 |
| Na | ⓘ Riebeckite Root Name Group var. Crocidolite | ◻[Na2][Z32+Fe23+]Si8O22(OH,F,Cl)2 |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Antigorite var. Bowenite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Clinochrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Cordierite | Mg2Al4Si5O18 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Enstatite | Mg2Si2O6 |
| Mg | ⓘ Forsterite | Mg2(SiO4) |
| Mg | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| Mg | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Mg | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Talc var. Steatite | Mg3(Si4O10)(OH)2 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Mg | ⓘ Chloritoid var. Masonite | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Mg | ⓘ Fayalite-Forsterite Series | |
| Mg | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| Al | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Al | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Al | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Cordierite | Mg2Al4Si5O18 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Al | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Al | ⓘ Grossular var. Hessonite | Ca3Al2(SiO4)3 |
| Al | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Al | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Al | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Al | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Ottrélite | Mn2+Al2O(SiO4)(OH)2 |
| Al | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| Al | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Al | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| Al | ⓘ Zinnwaldite | |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Chloritoid var. Masonite | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Al | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Al | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Al | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Al | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Al | ⓘ Titanite var. Keilhauite | (Ca,Y3+)(Ti,Al,Fe3+)[SiO4]O |
| Al | ⓘ Muscovite var. Damourite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Calcium Amphibole Subgroup | AnCa2(C2+5-mCm3+)(Si8-(n+m)Al(n+m))W2 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Aegirine | NaFe3+Si2O6 |
| Si | ⓘ Quartz var. Agate | SiO2 |
| Si | ⓘ Quartz var. Agate-Jasper | SiO2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Si | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| Si | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| Si | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Antigorite var. Bowenite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Si | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Quartz var. Citrine | SiO2 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinochrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Cordierite | Mg2Al4Si5O18 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Datolite | CaB(SiO4)(OH) |
| Si | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| Si | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Enstatite | Mg2Si2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Si | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| Si | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Si | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| Si | ⓘ Forsterite | Mg2(SiO4) |
| Si | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Grossular var. Hessonite | Ca3Al2(SiO4)3 |
| Si | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Si | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Si | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Si | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Si | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Si | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Quartz var. Onyx | SiO2 |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Ottrélite | Mn2+Al2O(SiO4)(OH)2 |
| Si | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Si | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| Si | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Si | ⓘ Quartz var. Rutilated Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Si | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Talc var. Steatite | Mg3(Si4O10)(OH)2 |
| Si | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Tephroite | Mn22+(SiO4) |
| Si | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Zinnwaldite | |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Chloritoid var. Masonite | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Quartz var. Milky Quartz | SiO2 |
| Si | ⓘ Quartz var. Prase | SiO2 |
| Si | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Si | ⓘ Chevkinite-(Ce) | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| Si | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Si | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Si | ⓘ Zircon var. Cyrtolite | Zr[(SiO4),(OH)4] |
| Si | ⓘ Quartz var. Sardonyx | SiO2 |
| Si | ⓘ Bloodstone | SiO2 |
| Si | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | ⓘ Titanite var. Keilhauite | (Ca,Y3+)(Ti,Al,Fe3+)[SiO4]O |
| Si | ⓘ Muscovite var. Damourite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Fayalite-Forsterite Series | |
| Si | ⓘ Fayalite-Tephroite Series | |
| Si | ⓘ Riebeckite Root Name Group | ◻Na2(C32+Fe23+)(Si8O22)W2 |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Danalite-Genthelvite Series | |
| Si | ⓘ Riebeckite Root Name Group var. Crocidolite | ◻[Na2][Z32+Fe23+]Si8O22(OH,F,Cl)2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Fayalite-Tephroite Series var. Knebelite | from (Fe1.5Mn0.5)2SiO4 to (Mn1.5Fe0.5)2SiO4 |
| Si | ⓘ Quartz var. Carnelian | SiO2 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Olivine Group | M2SiO4 |
| Si | ⓘ Calcium Amphibole Subgroup | AnCa2(C2+5-mCm3+)(Si8-(n+m)Al(n+m))W2 |
| Si | ⓘ Opal var. Hyalite | SiO2 · nH2O |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| S | ⓘ Covellite | CuS |
| S | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| S | ⓘ Galena | PbS |
| S | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Danalite-Genthelvite Series | |
| S | ⓘ Elaterite | (C,H,O,S) |
| S | ⓘ Chalcopyrite var. Gold-bearing Chalcopyrite | CuFeS2 with Au |
| Cl | Chlorine | |
| Cl | ⓘ Halite | NaCl |
| Cl | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Cl | ⓘ Phosgenite | Pb2CO3Cl2 |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Riebeckite Root Name Group var. Crocidolite | ◻[Na2][Z32+Fe23+]Si8O22(OH,F,Cl)2 |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| K | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| K | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| K | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| K | ⓘ Zinnwaldite | |
| K | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| K | ⓘ Muscovite var. Damourite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| Ca | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Fluorite var. Chlorophane | CaF2 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Datolite | CaB(SiO4)(OH) |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Ca | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| Ca | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Grossular var. Hessonite | Ca3Al2(SiO4)3 |
| Ca | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Ca | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Ca | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Ca | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Ca | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Ca | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| Ca | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Powellite | Ca(MoO4) |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Ca | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Ca | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Ca | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Ca | ⓘ Titanite var. Keilhauite | (Ca,Y3+)(Ti,Al,Fe3+)[SiO4]O |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Calcite var. Iron-bearing Calcite | (Ca,Fe)CO3 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ca | ⓘ Calcium Amphibole Subgroup | AnCa2(C2+5-mCm3+)(Si8-(n+m)Al(n+m))W2 |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brookite | TiO2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Ti | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| Ti | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Chevkinite-(Ce) | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| Ti | ⓘ Titanite var. Keilhauite | (Ca,Y3+)(Ti,Al,Fe3+)[SiO4]O |
| Ti | ⓘ Ilmenite var. Washingtonite | Fe2+(Ti,Fe3+)O3 |
| Mn | Manganese | |
| Mn | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Mn | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Mn | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Ottrélite | Mn2+Al2O(SiO4)(OH)2 |
| Mn | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Mn | ⓘ Tephroite | Mn22+(SiO4) |
| Mn | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| Mn | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mn | ⓘ Chloritoid var. Masonite | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Mn | ⓘ Fayalite-Tephroite Series | |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Mn | ⓘ Fayalite-Tephroite Series var. Knebelite | from (Fe1.5Mn0.5)2SiO4 to (Mn1.5Fe0.5)2SiO4 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Aegirine | NaFe3+Si2O6 |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| Fe | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Fe | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Fe | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| Fe | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Fe | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Fe | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| Fe | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Fe | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Lepidocrocite | Fe3+O(OH) |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| Fe | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| Fe | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Zinnwaldite | |
| Fe | ⓘ Chloritoid var. Masonite | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Fe | ⓘ Hematite var. Specularite | Fe2O3 |
| Fe | ⓘ Siderite var. Sphärosiderite | FeCO3 |
| Fe | ⓘ Chevkinite-(Ce) | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| Fe | ⓘ Titanite var. Keilhauite | (Ca,Y3+)(Ti,Al,Fe3+)[SiO4]O |
| Fe | ⓘ Fayalite-Forsterite Series | |
| Fe | ⓘ Fayalite-Tephroite Series | |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | ⓘ Riebeckite Root Name Group | ◻Na2(C32+Fe23+)(Si8O22)W2 |
| Fe | ⓘ Danalite-Genthelvite Series | |
| Fe | ⓘ Riebeckite Root Name Group var. Crocidolite | ◻[Na2][Z32+Fe23+]Si8O22(OH,F,Cl)2 |
| Fe | ⓘ Fayalite-Tephroite Series var. Knebelite | from (Fe1.5Mn0.5)2SiO4 to (Mn1.5Fe0.5)2SiO4 |
| Fe | ⓘ Calcite var. Iron-bearing Calcite | (Ca,Fe)CO3 |
| Fe | ⓘ Chalcopyrite var. Gold-bearing Chalcopyrite | CuFeS2 with Au |
| Fe | ⓘ Ilmenite var. Washingtonite | Fe2+(Ti,Fe3+)O3 |
| Cu | Copper | |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Chalcopyrite var. Gold-bearing Chalcopyrite | CuFeS2 with Au |
| Zn | Zinc | |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Danalite-Genthelvite Series | |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| Sr | Strontium | |
| Sr | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Y | Yttrium | |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Y | ⓘ Titanite var. Keilhauite | (Ca,Y3+)(Ti,Al,Fe3+)[SiO4]O |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Zr | ⓘ Zircon var. Cyrtolite | Zr[(SiO4),(OH)4] |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Mo | Molybdenum | |
| Mo | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Molybdite | MoO3 |
| Mo | ⓘ Powellite | Ca(MoO4) |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Native Silver | Ag |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| Sb | Antimony | |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Ba | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Ce | Cerium | |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ce | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Ce | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| Ce | ⓘ Chevkinite-(Ce) | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Stolzite | Pb(WO4) |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Au | ⓘ Chalcopyrite var. Gold-bearing Chalcopyrite | CuFeS2 with Au |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Phosgenite | Pb2CO3Cl2 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Stolzite | Pb(WO4) |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Th | Thorium | |
| Th | ⓘ Thorianite | ThO2 |
| Th | ⓘ Thorianite var. Uranothorianite | (Th,U)O2 |
| U | Uranium | |
| U | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Thorianite var. Uranothorianite | (Th,U)O2 |
Fossils
There are 20 fossil localities from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 20 | ||||||
|---|---|---|---|---|---|---|---|
| Youngest Fossil Listed | 307 Ma (Carboniferous) | ||||||
| Oldest Fossil Listed | 318 Ma (Carboniferous) | ||||||
| Stratigraphic Units |
| ||||||
| Fossils from Region | Click here to show the list. | ||||||
| Fossil Localities | Click to show 7 fossil localities |
Mindat Articles
Mineralogy of Rhode Island - A Literature Review by Michael KieronLocalities in this Region
- Rhode Island
- ⭔Bristol County
- ⭔Kent County
- ⭔Newport County
- ⭔Providence County
- Blackstone River
- ⭔Burrillville
- ⭔Central Falls
- ⭔Cranston
- ⭔Cumberland
- Ashton
- Beacon Pole Hill quarry
- Berkeley
- Cumberland Hill
- Diamond Hill
- Grants Mills
- Highland Commercial Drive
- Housing development in Staples Road
- Iron Mine Hill quarry
- Manville Quarry
- Maple Ridge Drive
- McLaughlin's Ledge
- Scott Road Manganese prospects
- Sneech Pond copper mines (Copper Mine Hill)
- Staples Road
- Staples Road Manganese bed
- Stephens Ledge
- ⭔Valley Falls
- Wrightman's Ledge
- Zoisite locality
- ⭔East Providence
- ⭔Foster
- Rhode Island
- Providence County
- Foster
- ⭔Glocester
- ⭔Johnston
- ⭔Lincoln
- ⭔North Providence
- ⭔North Smithfield
- ⭔Pawtucket
- ⭔Providence
- ⭔Scituate
- ⭔Smithfield
- Winsor Heights
- ⭔Woonsocket
- ⭔Washington County
- ⭔Charlestown
- ⭔Exeter
- ⭔Hopkinton
- ⭔Narragansett
- ⭔New Shoreham
- ⭔North Kingstown
- ⭔Richmond
- ⭔South Kingstown
- ⭔Westerly
- Bottinelli Granite quarry
- Bradford
- Calder & Carnie Granite Quarry
- Catto Granite Quarry
- Chapman Granite Quarry
- Dixon Granite Quarry
- Frazer Granite Quarry
- Gencarelli Granite Quarry
- New England Granite Quarry
- Redstone Granite Quarry (Cherenzia Quarry)
- Smalley quarry
- Smith Granite quarry
- Smith North Granite Quarry
- State Route 1 bypass
- State Route 78
- Weekapaug
- White Rock Quarry
- Providence County
Other Regions, Features and Areas that Intersect
Atlantic OceanOcean
North AmericaContinent
North America PlateTectonic Plate
- Avalonia TerraneVolcanic Arc
- Carolinia DomainDomain
- Narragansett BasinBasin
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Fisher, Lloyd W.; Gedney, Edwin K. (1926) Notes on the mineral localities of Rhode Island. I. Providence County. American Mineralogist, 11 (12). p.334-340.
Fisher, Lloyd W., Doll, Charles G. (1927) Notes on the mineral localities of Rhode Island. Part II. Remaining counties. American Mineralogist, 12 (12) 427-436
Metropolis, William C., Rakovan, John, Avella, Sal (1986) Amethyst Sceptered Quartz from Ashaway Village, Hopkinton, Rhode Island. Rocks & Minerals, 61 (5) 247-250 doi:10.1080/00357529.1986.11762722
Cain, J. Allan (1986) The Geology of Rhode Island. Rocks & Minerals, 61 (5) 257-263 doi:10.1080/00357529.1986.11762724
Quick NavTopCommoditiesMineral ListRock TypesFossilsArticlesLocalities in RegionOther RegionsReferences
Newport, Newport County, Rhode Island, USA