This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Mende | 14,837 (2018) |
| Marvejols | 6,086 (2016) |
| Langogne | 3,490 (2016) |
| La Canourgue | 2,126 (2016) |
| Florac | 1,921 (2018) |
| Saint-Alban-sur-Limagnole | 1,535 (2016) |
Other/historical names associated with this locality:
Languedoc-Roussillon
Other Languages:
French:
Département de la Lozère, Occitanie, France
German:
Département Lozère, Okzitanien, Frankreich
Italian:
Lozère, Occitania, Francia
Russian:
Лозер, Окситания, Франция
Simplified Chinese:
洛泽尔省, 奥克西塔尼大区, 法国
Spanish:
Lozère, Occitania, Francia
Afrikaans:
Lozère, Oksitanië, Frankryk
Albanian:
Lozère, Oksitania, Franca
Arabic:
لوزار, أوسيتاني, فرنسا
Aragonese:
Losera, Occitania, Francia
Armenian:
Լոզեր, Օկսիտանիա, Ֆրանսիա
Azeri:
Lozer, Oksitaniya , Fransa
Basque:
Lozère, Okzitania, Frantzia
Belarusian:
Лазер , рэгіён Аксітанія, Францыя
Belarusian (Tarashkevitsa):
Лязэр, Аксытанія, Францыя
Bengali:
লোজের, ফ্রান্স
Breton:
Lozère, Okitania, Bro-C'hall
Bulgarian:
Лозер, Окситания, Франция
Catalan:
Losera, Occitània, França
Cebuano:
Lozère, Occitanie, Pransiya
Chechen:
Лозер, Франци
Chuvash:
Лозер, Франци
Czech:
Lozère, Okcitánie, Francie
Danish:
Lozère, Occitanie, Frankrig
Dutch:
Lozère, Occitanie, Frankrijk
Esperanto:
Lozère, Okcitanio, Francio
Estonian:
Lozère'i departemang, Prantsusmaa
Farsi/Persian:
لوزر, اکسیتنی, فرانسه
Finnish:
Lozère, Oksitania , Ranska
Franco-Provençal:
Lozère, France
Galician:
Lozère, Occitania, Francia
Georgian:
ლოზერი, საფრანგეთი
Greek:
Λοζέρ, Οξιτανία, Γαλλία
Gujarati:
લોઝેરે, ફ્રાન્સ
Hakka:
Lozère-sén, Fap-koet
Hebrew:
לוזר, אוקסיטניה, צרפת
Hindi:
लोज़ेरे, ओसीटानिया, फ़्रान्स
Hungarian:
Lozère, Franciaország
Indonesian:
Lozère, Ositania, Perancis
Interlingua:
Departimento Lozere, Francia
Japanese:
ロゼール県, オクシタニー地域圏, フランス
Judaeo-Spanish:
Lozère, Fransia
Kannada:
ಲೊಝೆರೆ, ಫ್ರಾನ್ಸ್
Kapampangan:
Lozère, Pransiya
Kazakh (Cyrillic Script):
Лозер, Франция
Kongo:
Lozère, Fwalansa
Korean:
로제르주, 옥시타니, 프랑스
Latin:
Losara, Occitania, Francia
Latvian:
Lozēra, Francija
Limburgian:
Lozère, Occitanië, Frankriek
Lithuanian:
Lozeras, Oksitanija, Prancūzija
Lombard:
Lozère, Frància
Low Saxon/Low German:
Lozère, Frankriek
Luxembourgish:
Departement Lozère, Occitanie, Frankräich
Macedonian:
Лозер, Франција
Malagasy:
Lozère, Frantsa
Malay:
Lozère, Perancis
Marathi:
लोझेर, फ्रान्स
Minnan / Hokkien-Taiwanese:
Lozère, Hoat-kok
Mongolian:
Лозер, Франц
Northern Sami:
Lozère, Frankriika
Norwegian:
Lozère, Occitanie, Frankrike
Norwegian (Nynorsk):
Lozère, Frankrike
Occitan:
Losera, Occitània, França
Piedmontese:
Lozère, Fransa
Polish:
Lozère, Oksytania, Francja
Portuguese:
Lozère, Occitânia, França
Romanian:
Lozère, Occitania, Franța
Scots:
Lozère, Occitanie, Fraunce
Scottish Gaelic:
Lozère, An Fhraing
Serbian:
Лозер, Окситанија, Француска
Serbo-Croatian:
Lozère, Francuska
Sinhalese:
ලොසෙරේ, ප්රංශය
Slovak:
Lozère, Occitánia, Francúzsko
Slovenian:
Lozère, Francija
Swahili:
Lozère, Ufaransa
Swedish:
Lozère, Occitanien, Frankrike
Tajik (Cyrillic Script):
Департаменти Лозер, Фаронса
Tamil:
லோஸிர், பிரான்சு
Telugu:
లోజియర్, ఫ్రాన్సు
Thai:
จังหวัดลอแซร์, แคว้นอ็อกซีตานี, ประเทศฝรั่งเศส
Traditional Chinese:
洛澤爾, 奧斯坦尼, 法國
Turkish:
Lozère, Occitanie, Fransa
Ukrainian:
Лозер, Окситанія, Франція
Urdu:
لوزیر, اوکیتانی, فرانس
Vietnamese:
Lozère, Occitanie, Pháp
Volapük:
Lozère, Loxitän, Fransän
Waray:
Lozère, Occitanie, Fransya
Welsh:
Lozère, Ocsitania, Ffrainc
Western Punjabi:
ضلع لوزر, فرانس
French department (formerly called "Gévaudan") located in the southern "Massif Central". It can be divided into 4 main areas:
- Cevennes (to the east) are mountains composed of mica schists with many granitic intrusions (like the Mont Lozère granite)
- Margeride (to the north) is a large plateau situated on a huge laccolite of a porphyroïd granite
- Causses (to the south-west) are large plateaux too but situated on Liassic and Jurassic limestones
- Aubrac (to the west) is a large basaltic flow above hills around Marvejols that are composed of a metamorphic series (miscellaneous gneisses and amphibolites).
- Cevennes (to the east) are mountains composed of mica schists with many granitic intrusions (like the Mont Lozère granite)
- Margeride (to the north) is a large plateau situated on a huge laccolite of a porphyroïd granite
- Causses (to the south-west) are large plateaux too but situated on Liassic and Jurassic limestones
- Aubrac (to the west) is a large basaltic flow above hills around Marvejols that are composed of a metamorphic series (miscellaneous gneisses and amphibolites).
Geological Map
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities171 valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S |
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Cévennes I placers, Saint-Privat-de-Vallongue, Florac, Lozère, Occitanie, France L'Aldeyre quarry, Grandrieu, Mende, Lozère, Occitanie, France Les Bombes, Bouges, Le Bleymard, Mont Lozère et Goulet, Mende, Lozère, Occitanie, France Froidviala Est, Estables, Monts-de-Randon, Mende, Lozère, Occitanie, France Saint-Juéry, Mende, Lozère, Occitanie, France |
| ⓘ Albite var. Andesine Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ Analcime Formula: Na(AlSi2O6) · H2O References: |
| ⓘ Anatase Formula: TiO2 |
| ⓘ Andalusite Formula: Al2(SiO4)O |
| ⓘ Anglesite Formula: PbSO4 Localities: Reported from at least 10 localities in this region. |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Arseniosiderite ? Formula: Ca2Fe3+3(AsO4)3O2 · 3H2O References: Patrice Queneau Collection. Visual identificationIdentified by Patrice Queneau: Visual Identification |
| ⓘ Arsenopyrite Formula: FeAsS Localities: Reported from at least 10 localities in this region. |
| ⓘ Atelestite Formula: Bi2(AsO4)O(OH) References: |
| ⓘ Aurichalcite ? Formula: (Zn,Cu)5(CO3)2(OH)6 References: |
| ⓘ Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O Localities: Le Cellier, Saint-Jean-la-Fouillouse, Mende, Lozère, Occitanie, France Puech-Mijiot (Puech-Mijot), Albaret-le-Comtal, Mende, Lozère, Occitanie, France Couffours, Le Malzieu-Ville, Mende, Lozère, Occitanie, France Le Villaret, La Chaze-de-Peyre, Aumont-Aubrac, Peyre-en-Aubrac, Mende, Lozère, Occitanie, France Puech d'Arzenc, Albaret-le-Comtal, Mende, Lozère, Occitanie, France |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 |
| ⓘ Baryte Formula: BaSO4 Localities: Reported from at least 27 localities in this region. |
| ⓘ Berthierite Formula: FeSb2S4 |
| ⓘ Beudantite Formula: PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bismite ? Formula: Bi2O3 References: Patrice Queneau Collection. Visual identificationIdentified by Patrice Queneau: Visual Identification |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ Bismutite ? Formula: (BiO)2CO3 References: Patrice Queneau Collection. Visual identificationIdentified by Patrice Queneau: Visual Identification |
| ⓘ Boleite Formula: KPb26Ag9Cu24(OH)48Cl62 References: |
| ⓘ Bornite Formula: Cu5FeS4 References: |
| ⓘ Boulangerite Formula: Pb5Sb4S11 References: |
| ⓘ Böhmite Formula: AlO(OH) |
| ⓘ Bournonite Formula: PbCuSbS3 |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 Localities: Sainte-Lucie Mine, Saint-Léger-de-Peyre, Mende, Lozère, Occitanie, France Lozère, Occitanie, France Le Buisson Mine, Montmirat, Saint-Étienne-du-Valdonnez, Mende, Lozère, Occitanie, France Vialas smelter slag locality, Vialas, Florac, Lozère, Occitanie, France Le Passadou, Altier, Mende, Lozère, Occitanie, France |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 15 localities in this region. |
| ⓘ Caledonite Formula: Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ Cannonite ? Formula: Bi2(SO4)O(OH)2 References: Patrice Queneau Collection. Visual identificationIdentified by Patrice Queneau: Visual Identification |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Cerussite Formula: PbCO3 Localities: Reported from at least 11 localities in this region. |
| ⓘ 'Chabazite' References: |
| ⓘ Chalcocite Formula: Cu2S References: |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 19 localities in this region. |
| ⓘ Chenite Formula: Pb4Cu(SO4)2(OH)6 References: |
| ⓘ 'Chlorite Group' |
| ⓘ Claraite ? Formula: (Cu,Zn)15(CO3)4(AsO4)2(SO4)(OH)14 · 7H2O References: Patrice Queneau Collection visual identification.
Confirmed. Analyzed by Nicolas Meisser, Museum of Natural Sciences (Naturéum), University of Lausanne, Switzerland.Identified by Patrice Queneau: Visual Identification |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 References: |
| ⓘ Cordierite Formula: Mg2Al4Si5O18 |
| ⓘ Corundum Formula: Al2O3 |
| ⓘ Corundum var. Ruby Formula: Al2O3 |
| ⓘ Corundum var. Sapphire Formula: Al2O3 |
| ⓘ Cotunnite Formula: PbCl2 |
| ⓘ Covellite Formula: CuS Localities: Pierrefiche Sud, Les Salces, Mende, Lozère, Occitanie, France Les Cayres mine, Barjac, Mende, Lozère, Occitanie, France Sainte-Lucie Mine, Saint-Léger-de-Peyre, Mende, Lozère, Occitanie, France Raveyrines valley, Gabrias, Mende, Lozère, Occitanie, France Vialas smelter slag locality, Vialas, Florac, Lozère, Occitanie, France |
| ⓘ Cuprite Formula: Cu2O |
| ⓘ Cuprostibite Formula: Cu2(Sb,Tl) |
| ⓘ Cyanotrichite ? Formula: Cu4Al2(SO4)(OH)12 · 2H2O References: |
| ⓘ Daubréeite ? Formula: BiO(OH) References: Patrice Queneau Collection. Visual identificationIdentified by Patrice Queneau: Visual Identification |
| ⓘ Diaspore Formula: AlO(OH) |
| ⓘ Digenite Formula: Cu9S5 References: |
| ⓘ Dolomite ? Formula: CaMg(CO3)2 References: |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Dundasite ? Formula: PbAl2(CO3)2(OH)4 · H2O |
| ⓘ Elyite Formula: Pb4Cu(SO4)O2(OH)4 · H2O |
| ⓘ Eulytine Formula: Bi4(SiO4)3 References: Queneau, Patrice (n.d.) Personal Communication.Identified by Patrice Queneau: Visual Identification |
| ⓘ Fayalite Formula: Fe2+2(SiO4) |
| ⓘ 'Feldspar Group' |
| ⓘ Ferberite Formula: FeWO4 |
| ⓘ Ferrihydrite Formula: Fe3+10O14(OH)2 |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorite Formula: CaF2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Freieslebenite Formula: AgPbSbS3 |
| ⓘ Fülöppite Formula: Pb3Sb8S15 |
| ⓘ Gahnite Formula: ZnAl2O4 |
| ⓘ Galena Formula: PbS Localities: Reported from at least 25 localities in this region. |
| ⓘ Galena var. Silver-bearing Galena Formula: PbS with Ag |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Goethite Formula: Fe3+O(OH) Localities: Reported from at least 7 localities in this region. |
| ⓘ Greenockite Formula: CdS |
| ⓘ Gustavite Formula: AgPbBi3S6 |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: Le Mazel-Neyrac mine, Le Bleymard, Mont Lozère et Goulet, Mende, Lozère, Occitanie, France Sainte-Lucie Mine, Saint-Léger-de-Peyre, Mende, Lozère, Occitanie, France Le Buisson Mine, Montmirat, Saint-Étienne-du-Valdonnez, Mende, Lozère, Occitanie, France Vialas smelter slag locality, Vialas, Florac, Lozère, Occitanie, France |
| ⓘ Harmotome ? Formula: Ba2(Si12Al4)O32 · 12H2O |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 6 localities in this region. |
| ⓘ Hematite var. Specularite Formula: Fe2O3 |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O |
| ⓘ Hübnerite Formula: MnWO4 |
| ⓘ Hydrocerussite Formula: Pb3(CO3)2(OH)2 |
| ⓘ Hydrokenoelsmoreite Formula: ◻2W2O6(H2O) References: Patrice Queneau Collection. Visual identificationIdentified by Patrice Queneau: Visual Identification |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 Localities: Reported from at least 8 localities in this region. |
| ⓘ Idaite Formula: Cu5FeS6 References: |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 References: Queneau, Patrice (n.d.) Personal Communication.Identified by Patrice Queneau: Visual Identification Patrice Queneau Collection. Visual identificationIdentified by Patrice Queneau: Visual Identification |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Kobellite Formula: Pb22Cu4(Bi,Sb)30S69 |
| ⓘ Kyanite Formula: Al2(SiO4)O |
| ⓘ Lanarkite Formula: Pb2(SO4)O |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O |
| ⓘ Lautenthalite Formula: PbCu4(SO4)2(OH)6 · 3H2O |
| ⓘ Leadhillite ? Formula: Pb4(CO3)2(SO4)(OH)2 References: |
| ⓘ Leiteite ? Formula: Zn(As2O4) Description: Probably valentinite (compare photos of analysed valentinite from other slag localities). See also http://www.mindat.org/locentry-23669.html |
| ⓘ Lepidocrocite Formula: Fe3+O(OH) |
| ⓘ 'Lepidolite' |
| ⓘ Liebigite Formula: Ca2(UO2)(CO3)3 · 11H2O |
| ⓘ 'Limonite' |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 Localities: Sainte-Lucie Mine, Saint-Léger-de-Peyre, Mende, Lozère, Occitanie, France Lozère, Occitanie, France Le Buisson Mine, Montmirat, Saint-Étienne-du-Valdonnez, Mende, Lozère, Occitanie, France Vialas smelter slag locality, Vialas, Florac, Lozère, Occitanie, France Le Passadou, Altier, Mende, Lozère, Occitanie, France |
| ⓘ Litharge Formula: PbO |
| ⓘ Löllingite Formula: FeAs2 |
| ⓘ Magnesioferrite Formula: MgFe3+2O4 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 9 localities in this region. |
| ⓘ 'Manganese Oxides' |
| ⓘ Marcasite Formula: FeS2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Massicot Formula: PbO |
| ⓘ Matlockite Formula: PbFCl References: |
| ⓘ Mattheddleite ? Formula: Pb5(SiO4)1.5(SO4)1.5(Cl,OH) References: Patrice Queneau Collection visual identification.
Confirmed. Analyzed by Nicolas Meisser, Museum of Natural Sciences (Naturéum), University of Lausanne, Switzerland.Identified by Patrice Queneau: Visual Identification |
| ⓘ 'Melnikovite' |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl |
| ⓘ 'Mimetite-Pyromorphite Series' References: Enguerrand Cales CollectionIdentified by Jean-Marc Johannet: Visual Identification |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ 'Monazite Group' Formula: REE(PO4) |
| ⓘ Munakataite Formula: Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ Native Antimony Formula: Sb |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Copper Formula: Cu |
| ⓘ Native Gold Formula: Au |
| ⓘ Native Lead Formula: Pb |
| ⓘ Native Silver Formula: Ag |
| ⓘ Native Sulphur Formula: S8 References: |
| ⓘ Nickeline Formula: NiAs |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Parsonsite Formula: Pb2(UO2)(PO4)2 |
| ⓘ 'Petrified Wood' Locality: Mende, Lozère, Occitanie, France |
| ⓘ 'Petroleum var. Bitumen' |
| ⓘ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ 'Phillipsite Subgroup' Formula: (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O References: |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 |
| ⓘ Phosgenite ? Formula: Pb2CO3Cl2 References: |
| ⓘ Pigeonite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ 'Pinite' |
| ⓘ Plattnerite Formula: PbO2 |
| ⓘ Plumbojarosite Formula: Pb0.5Fe3+3(SO4)2(OH)6 |
| ⓘ Plumbonacrite Formula: Pb5O(OH)2(CO3)3 |
| ⓘ Posnjakite Formula: Cu4(SO4)(OH)6 · H2O |
| ⓘ Preisingerite ? Formula: Bi3(AsO4)2O(OH) References: Patrice Queneau Collection. Visual identificationIdentified by Patrice Queneau: Visual Identification |
| ⓘ 'Psilomelane' Description: Tungomelane (tungsten-rich psilomelane). |
| ⓘ Pyrargyrite Formula: Ag3SbS3 |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 25 localities in this region. |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl Localities: Reported from at least 8 localities in this region. |
| ⓘ Pyrope Formula: Mg3Al2(SiO4)3 |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 35 localities in this region. |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 References: |
| ⓘ Ramsbeckite ? Formula: (Cu,Zn)15(SO4)4(OH)22 · 6H2O References: |
| ⓘ Ranciéite Formula: (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O Locality: Mt Mirat, Lozère, Occitanie, France References: |
| ⓘ Rooseveltite ? Formula: Bi(AsO4) References: Patrice Queneau Collection. Visual identificationIdentified by Patrice Queneau: Visual Identification |
| ⓘ Rosasite Formula: (Cu,Zn)2(CO3)(OH)2 |
| ⓘ Rutherfordine Formula: (UO2)CO3 |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Scheelite Formula: Ca(WO4) Localities: Reported from at least 6 localities in this region. |
| ⓘ Schneiderhöhnite ? Formula: Fe2+Fe3+3As3+5O13 |
| ⓘ Schoenfliesite ? Formula: Mg[Sn(OH)6] |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Schröckingerite Formula: NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| ⓘ Schulenbergite Formula: (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O |
| ⓘ Scotlandite ? Formula: PbSO3 References: Patrice Queneau Collection visual identification.
Confirmed. Analyzed by Nicolas Meisser, Museum of Natural Sciences (Naturéum), University of Lausanne, Switzerland.Identified by Patrice Queneau: Visual Identification |
| ⓘ Serpierite Formula: Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| ⓘ Sewardite Formula: CaFe3+2(AsO4)2(OH)2 |
| ⓘ Siderite Formula: FeCO3 Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Smectite Group' Formula: A0.3D2-3[T4O10]Z2 · nH2O |
| ⓘ Smithsonite Formula: ZnCO3 Localities: Le Mazel-Neyrac mine, Le Bleymard, Mont Lozère et Goulet, Mende, Lozère, Occitanie, France Pomaret mine, Cubières, Mende, Lozère, Occitanie, France Le Buisson Mine, Montmirat, Saint-Étienne-du-Valdonnez, Mende, Lozère, Occitanie, France Sainte-Lucie Mine, Saint-Léger-de-Peyre, Mende, Lozère, Occitanie, France ? (more information) |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 26 localities in this region. |
| ⓘ Stannite Formula: Cu2FeSnS4 |
| ⓘ Steverustite ? Formula: Pb2+5(OH)5[Cu+(S6+O3S2-)3](H2O)2 |
| ⓘ Stibnite Formula: Sb2S3 Localities: Richaldon Mine, Le Collet-de-Dèze, Florac, Lozère, Occitanie, France La Felgerette Mine, Le Collet-de-Dèze, Florac, Lozère, Occitanie, France La Coupette, St Etienne-Vallée-Française, Saint-Germain-de-Calberte, Florac, Lozère, Occitanie, France Les Longagnes, St Etienne-Vallée-Française, Saint-Germain-de-Calberte, Florac, Lozère, Occitanie, France |
| ⓘ Stolzite Formula: Pb(WO4) Localities: Habit: tabular (2-7cm), rarely pyramidal or flattened pseudo-octahedrons Colour: yellow, grey, orange |
| ⓘ Susannite Formula: Pb4(CO3)2(SO4)(OH)2 |
| ⓘ Tellurite ? Formula: TeO2 References: |
| ⓘ Tellurobismuthite Formula: Bi2Te3 |
| ⓘ Tenorite Formula: CuO |
| ⓘ Tetradymite Formula: Bi2Te2S |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| ⓘ Thorite Formula: Th(SiO4) Description: Uranophosphothorite. |
| ⓘ Thorite var. Uranothorite Formula: (Th,U)SiO4 Description: Uranophosphothorite. |
| ⓘ Titanite Formula: CaTiO(SiO4) |
| ⓘ Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Tungstite Formula: WO3 · H2O References: Patrice Queneau Collection. Visual identificationIdentified by Patrice Queneau: Visual Identification |
| ⓘ Uraninite Formula: UO2 |
| ⓘ Uraninite var. Pitchblende Formula: UO2 |
| ⓘ Valentinite Formula: Sb2O3 |
| ⓘ Vikingite Formula: Ag5Pb8Bi13S30 |
| ⓘ Welinite Formula: Mn2+6(W6+,Mg)2(SiO4)2(O,OH)6 References: |
| ⓘ Wherryite Formula: Pb7Cu2(SO4)4(SiO4)2(OH)2 |
| ⓘ 'Wolframite Group' |
| ⓘ Wulfenite Formula: Pb(MoO4) |
| ⓘ Wüstite Formula: FeO |
| ⓘ Xenotime-(Y) Formula: Y(PO4) |
| ⓘ Zincite Formula: ZnO |
| ⓘ Zinkenite Formula: Pb9Sb22S42 |
| ⓘ Zircon Formula: Zr(SiO4) Localities: Cévennes I placers, Saint-Privat-de-Vallongue, Florac, Lozère, Occitanie, France Les Bombes, Bouges, Le Bleymard, Mont Lozère et Goulet, Mende, Lozère, Occitanie, France Chambon-le-Château, Grandrieu, Mende, Lozère, Occitanie, France L'Aldeyre quarry, Grandrieu, Mende, Lozère, Occitanie, France Cévennes II placers, Saint-Privat-de-Vallongue, Florac, Lozère, Occitanie, France |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Lead | 1.AA.05 | Pb |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Antimony | 1.CA.05 | Sb |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Cuprostibite | 2.AA.20 | Cu2(Sb,Tl) |
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Idaite | 2.CB.15a | Cu5FeS6 |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | var. Silver-bearing Galena | 2.CD.10 | PbS with Ag |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Tellurobismuthite | 2.DC.05 | Bi2Te3 |
| ⓘ | Tetradymite | 2.DC.05 | Bi2Te2S |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Berthierite | 2.HA.20 | FeSb2S4 |
| ⓘ | Kobellite | 2.HB.10a | Pb22Cu4(Bi,Sb)30S69 |
| ⓘ | Fülöppite | 2.HC.10a | Pb3Sb8S15 |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Freieslebenite | 2.JB.15 | AgPbSbS3 |
| ⓘ | Zinkenite | 2.JB.35a | Pb9Sb22S42 |
| ⓘ | Gustavite | 2.JB.40a | AgPbBi3S6 |
| ⓘ | Vikingite | 2.JB.40a | Ag5Pb8Bi13S30 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Cotunnite | 3.AB.85 | PbCl2 |
| ⓘ | Boleite | 3.DB.15 | KPb26Ag9Cu24(OH)48Cl62 |
| ⓘ | Matlockite | 3.DC.25 | PbFCl |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Zincite | 4.AB.20 | ZnO |
| ⓘ | Wüstite | 4.AB.25 | FeO |
| ⓘ | Litharge | 4.AC.20 | PbO |
| ⓘ | Massicot | 4.AC.25 | PbO |
| ⓘ | Gahnite | 4.BB.05 | ZnAl2O4 |
| ⓘ | Magnesioferrite | 4.BB.05 | MgFe3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Corundum var. Ruby | 4.CB.05 | Al2O3 |
| ⓘ | var. Sapphire | 4.CB.05 | Al2O3 |
| ⓘ | Hematite var. Specularite | 4.CB.05 | Fe2O3 |
| ⓘ | Valentinite | 4.CB.55 | Sb2O3 |
| ⓘ | Bismite ? | 4.CB.60 | Bi2O3 |
| ⓘ | Quartz var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Plattnerite | 4.DB.05 | PbO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Ferberite | 4.DB.30 | FeWO4 |
| ⓘ | Hübnerite | 4.DB.30 | MnWO4 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Tellurite ? | 4.DE.20 | TeO2 |
| ⓘ | Hydrokenoelsmoreite | 4.DH.15 | ◻2W2O6(H2O) |
| ⓘ | Uraninite var. Pitchblende | 4.DL.05 | UO2 |
| ⓘ | 4.DL.05 | UO2 | |
| ⓘ | Daubréeite ? | 4.F0.25 | BiO(OH) |
| ⓘ | Schoenfliesite ? | 4.FC.10 | Mg[Sn(OH)6] |
| ⓘ | Diaspore | 4.FD.10 | AlO(OH) |
| ⓘ | Böhmite | 4.FE.15 | AlO(OH) |
| ⓘ | Lepidocrocite | 4.FE.15 | Fe3+O(OH) |
| ⓘ | Ferrihydrite | 4.FE.35 | Fe3+10O14(OH)2 |
| ⓘ | Tungstite | 4.FJ.10 | WO3 · H2O |
| ⓘ | Ranciéite | 4.FL.40 | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| ⓘ | Leiteite ? | 4.JA.05 | Zn(As2O4) |
| ⓘ | Schneiderhöhnite ? | 4.JA.35 | Fe2+Fe3+3As3+5O13 |
| ⓘ | Scotlandite ? | 4.JE.20 | PbSO3 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Dolomite ? | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Rosasite | 5.BA.10 | (Cu,Zn)2(CO3)(OH)2 |
| ⓘ | Aurichalcite ? | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Hydrocerussite | 5.BE.10 | Pb3(CO3)2(OH)2 |
| ⓘ | Plumbonacrite | 5.BE.15 | Pb5O(OH)2(CO3)3 |
| ⓘ | Phosgenite ? | 5.BE.20 | Pb2CO3Cl2 |
| ⓘ | Bismutite ? | 5.BE.25 | (BiO)2CO3 |
| ⓘ | Leadhillite ? | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Susannite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Claraite ? | 5.DA.30 | (Cu,Zn)15(CO3)4(AsO4)2(SO4)(OH)14 · 7H2O |
| ⓘ | Dundasite ? | 5.DB.10 | PbAl2(CO3)2(OH)4 · H2O |
| ⓘ | Rutherfordine | 5.EB.05 | (UO2)CO3 |
| ⓘ | Liebigite | 5.ED.20 | Ca2(UO2)(CO3)3 · 11H2O |
| ⓘ | Schröckingerite | 5.EG.05 | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Plumbojarosite | 7.BC.10 | Pb0.5Fe3+3(SO4)2(OH)6 |
| ⓘ | Caledonite | 7.BC.50 | Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ | Wherryite | 7.BC.55 | Pb7Cu2(SO4)4(SiO4)2(OH)2 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Munakataite | 7.BC.65 | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| ⓘ | Chenite | 7.BC.70 | Pb4Cu(SO4)2(OH)6 |
| ⓘ | Cannonite ? | 7.BD.35 | Bi2(SO4)O(OH)2 |
| ⓘ | Lanarkite | 7.BD.40 | Pb2(SO4)O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Posnjakite | 7.DD.10 | Cu4(SO4)(OH)6 · H2O |
| ⓘ | Serpierite | 7.DD.30 | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| ⓘ | Ramsbeckite ? | 7.DD.60 | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| ⓘ | Schulenbergite | 7.DD.80 | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| ⓘ | Cyanotrichite ? | 7.DE.10 | Cu4Al2(SO4)(OH)12 · 2H2O |
| ⓘ | Elyite | 7.DF.65 | Pb4Cu(SO4)O2(OH)4 · H2O |
| ⓘ | Lautenthalite | 7.DF.70 | PbCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Stolzite | 7.GA.05 | Pb(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| ⓘ | Steverustite ? | 7.JA.10 | Pb2+5(OH)5[Cu+(S6+O3S2-)3](H2O)2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Rooseveltite ? | 8.AD.50 | Bi(AsO4) |
| ⓘ | Sewardite | 8.BH.30 | CaFe3+2(AsO4)2(OH)2 |
| ⓘ | Beudantite | 8.BL.05 | PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Preisingerite ? | 8.BO.10 | Bi3(AsO4)2O(OH) |
| ⓘ | Atelestite | 8.BO.15 | Bi2(AsO4)O(OH) |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Arseniosiderite ? | 8.DH.30 | Ca2Fe3+3(AsO4)3O2 · 3H2O |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ | Parsonsite | 8.EA.10 | Pb2(UO2)(PO4)2 |
| ⓘ | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 · 12H2O |
| Group 9 - Silicates | |||
| ⓘ | Fayalite | 9.AC.05 | Fe2+2(SiO4) |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Pyrope | 9.AD.25 | Mg3Al2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Thorite | 9.AD.30 | Th(SiO4) |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Thorite var. Uranothorite | 9.AD.30 | (Th,U)SiO4 |
| ⓘ | Eulytine | 9.AD.40 | Bi4(SiO4)3 |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Welinite | 9.AF.75 | Mn2+6(W6+,Mg)2(SiO4)2(O,OH)6 |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Mattheddleite ? | 9.AH.25 | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Cordierite | 9.CJ.10 | Mg2Al4Si5O18 |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Pigeonite | 9.DA.10 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Muscovite var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Andesine | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Analcime | 9.GB.05 | Na(AlSi2O6) · H2O |
| ⓘ | Harmotome ? | 9.GC.10 | Ba2(Si12Al4)O32 · 12H2O |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chabazite' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Lepidolite' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Phillipsite Subgroup' | - | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Melnikovite' | - | |
| ⓘ | 'Petrified Wood' | - | |
| ⓘ | 'Pinite' | - | |
| ⓘ | 'Petroleum var. Bitumen' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Smectite Group' | - | A0.3D2-3[T4O10]Z2 · nH2O |
| ⓘ | 'Manganese Oxides' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Mimetite-Pyromorphite Series' | - | |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Analcime | Na(AlSi2O6) · H2O |
| H | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| H | ⓘ Atelestite | Bi2(AsO4)O(OH) |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Böhmite | AlO(OH) |
| H | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| H | ⓘ Cannonite | Bi2(SO4)O(OH)2 |
| H | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| H | ⓘ Claraite | (Cu,Zn)15(CO3)4(AsO4)2(SO4)(OH)14 · 7H2O |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| H | ⓘ Daubréeite | BiO(OH) |
| H | ⓘ Diaspore | AlO(OH) |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| H | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| H | ⓘ Ferrihydrite | Fe103+O14(OH)2 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Lautenthalite | PbCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Lepidocrocite | Fe3+O(OH) |
| H | ⓘ Liebigite | Ca2(UO2)(CO3)3 · 11H2O |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Phillipsite Subgroup | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Plumbonacrite | Pb5O(OH)2(CO3)3 |
| H | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| H | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| H | ⓘ Preisingerite | Bi3(AsO4)2O(OH) |
| H | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| H | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| H | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| H | ⓘ Schoenfliesite | Mg[Sn(OH)6] |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| H | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Tungstite | WO3 · H2O |
| H | ⓘ Welinite | Mn62+(W6+,Mg)2(SiO4)2(O,OH)6 |
| H | ⓘ Wherryite | Pb7Cu2(SO4)4(SiO4)2(OH)2 |
| H | ⓘ Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| H | ⓘ Sewardite | CaFe23+(AsO4)2(OH)2 |
| H | ⓘ Hydrokenoelsmoreite | ◻2W2O6(H2O) |
| H | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| H | ⓘ Steverustite | Pb52+(OH)5[Cu+(S6+O3S2-)3](H2O)2 |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Claraite | (Cu,Zn)15(CO3)4(AsO4)2(SO4)(OH)14 · 7H2O |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| C | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Liebigite | Ca2(UO2)(CO3)3 · 11H2O |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Phosgenite | Pb2CO3Cl2 |
| C | ⓘ Plumbonacrite | Pb5O(OH)2(CO3)3 |
| C | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| C | ⓘ Rutherfordine | (UO2)CO3 |
| C | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Analcime | Na(AlSi2O6) · H2O |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| O | ⓘ Atelestite | Bi2(AsO4)O(OH) |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bismite | Bi2O3 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Böhmite | AlO(OH) |
| O | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| O | ⓘ Cannonite | Bi2(SO4)O(OH)2 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| O | ⓘ Claraite | (Cu,Zn)15(CO3)4(AsO4)2(SO4)(OH)14 · 7H2O |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Cordierite | Mg2Al4Si5O18 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| O | ⓘ Daubréeite | BiO(OH) |
| O | ⓘ Diaspore | AlO(OH) |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| O | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| O | ⓘ Eulytine | Bi4(SiO4)3 |
| O | ⓘ Fayalite | Fe22+(SiO4) |
| O | ⓘ Ferberite | FeWO4 |
| O | ⓘ Ferrihydrite | Fe103+O14(OH)2 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Gahnite | ZnAl2O4 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Hübnerite | MnWO4 |
| O | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Lanarkite | Pb2(SO4)O |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Lautenthalite | PbCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Leiteite | Zn(As2O4) |
| O | ⓘ Lepidocrocite | Fe3+O(OH) |
| O | ⓘ Liebigite | Ca2(UO2)(CO3)3 · 11H2O |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Litharge | PbO |
| O | ⓘ Magnesioferrite | MgFe23+O4 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Massicot | PbO |
| O | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Parsonsite | Pb2(UO2)(PO4)2 |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Phillipsite Subgroup | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Phosgenite | Pb2CO3Cl2 |
| O | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Uraninite var. Pitchblende | UO2 |
| O | ⓘ Plumbonacrite | Pb5O(OH)2(CO3)3 |
| O | ⓘ Plattnerite | PbO2 |
| O | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| O | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| O | ⓘ Preisingerite | Bi3(AsO4)2O(OH) |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| O | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| O | ⓘ Rooseveltite | Bi(AsO4) |
| O | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| O | ⓘ Corundum var. Ruby | Al2O3 |
| O | ⓘ Rutherfordine | (UO2)CO3 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Corundum var. Sapphire | Al2O3 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schneiderhöhnite | Fe2+Fe33+As53+O13 |
| O | ⓘ Schoenfliesite | Mg[Sn(OH)6] |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| O | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Scotlandite | PbSO3 |
| O | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Stolzite | Pb(WO4) |
| O | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Tellurite | TeO2 |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Thorite | Th(SiO4) |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Tungstite | WO3 · H2O |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Valentinite | Sb2O3 |
| O | ⓘ Welinite | Mn62+(W6+,Mg)2(SiO4)2(O,OH)6 |
| O | ⓘ Wherryite | Pb7Cu2(SO4)4(SiO4)2(OH)2 |
| O | ⓘ Wüstite | FeO |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zincite | ZnO |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Hematite var. Specularite | Fe2O3 |
| O | ⓘ Thorite var. Uranothorite | (Th,U)SiO4 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| O | ⓘ Sewardite | CaFe23+(AsO4)2(OH)2 |
| O | ⓘ Hydrokenoelsmoreite | ◻2W2O6(H2O) |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| O | ⓘ Mimetite-Pyromorphite Series | |
| O | ⓘ Steverustite | Pb52+(OH)5[Cu+(S6+O3S2-)3](H2O)2 |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Matlockite | PbFCl |
| F | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Na | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Phillipsite Subgroup | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Cordierite | Mg2Al4Si5O18 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Magnesioferrite | MgFe23+O4 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Mg | ⓘ Schoenfliesite | Mg[Sn(OH)6] |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Welinite | Mn62+(W6+,Mg)2(SiO4)2(O,OH)6 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Böhmite | AlO(OH) |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Cordierite | Mg2Al4Si5O18 |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| Al | ⓘ Diaspore | AlO(OH) |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| Al | ⓘ Gahnite | ZnAl2O4 |
| Al | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Phillipsite Subgroup | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Al | ⓘ Corundum var. Ruby | Al2O3 |
| Al | ⓘ Corundum var. Sapphire | Al2O3 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Cordierite | Mg2Al4Si5O18 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Eulytine | Bi4(SiO4)3 |
| Si | ⓘ Fayalite | Fe22+(SiO4) |
| Si | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Phillipsite Subgroup | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Thorite | Th(SiO4) |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Welinite | Mn62+(W6+,Mg)2(SiO4)2(O,OH)6 |
| Si | ⓘ Wherryite | Pb7Cu2(SO4)4(SiO4)2(OH)2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Thorite var. Uranothorite | (Th,U)SiO4 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Parsonsite | Pb2(UO2)(PO4)2 |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3A |
| P | ⓘ Mimetite-Pyromorphite Series | |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Berthierite | FeSb2S4 |
| S | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| S | ⓘ Cannonite | Bi2(SO4)O(OH)2 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| S | ⓘ Claraite | (Cu,Zn)15(CO3)4(AsO4)2(SO4)(OH)14 · 7H2O |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| S | ⓘ Fülöppite | Pb3Sb8S15 |
| S | ⓘ Freieslebenite | AgPbSbS3 |
| S | ⓘ Galena | PbS |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Gustavite | AgPbBi3S6 |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Idaite | Cu5FeS6 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| S | ⓘ Lanarkite | Pb2(SO4)O |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Lautenthalite | PbCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| S | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| S | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| S | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| S | ⓘ Scotlandite | PbSO3 |
| S | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stannite | Cu2FeSnS4 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Tetradymite | Bi2Te2S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Vikingite | Ag5Pb8Bi13S30 |
| S | ⓘ Wherryite | Pb7Cu2(SO4)4(SiO4)2(OH)2 |
| S | ⓘ Zinkenite | Pb9Sb22S42 |
| S | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| S | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| S | ⓘ Steverustite | Pb52+(OH)5[Cu+(S6+O3S2-)3](H2O)2 |
| Cl | Chlorine | |
| Cl | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Cl | ⓘ Cotunnite | PbCl2 |
| Cl | ⓘ Matlockite | PbFCl |
| Cl | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Phosgenite | Pb2CO3Cl2 |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Mimetite-Pyromorphite Series | |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| K | ⓘ Phillipsite Subgroup | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Ca | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Liebigite | Ca2(UO2)(CO3)3 · 11H2O |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Phillipsite Subgroup | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| Ca | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| Ca | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Sewardite | CaFe23+(AsO4)2(OH)2 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Mn | Manganese | |
| Mn | ⓘ Hübnerite | MnWO4 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Welinite | Mn62+(W6+,Mg)2(SiO4)2(O,OH)6 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Berthierite | FeSb2S4 |
| Fe | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Fayalite | Fe22+(SiO4) |
| Fe | ⓘ Ferberite | FeWO4 |
| Fe | ⓘ Ferrihydrite | Fe103+O14(OH)2 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Idaite | Cu5FeS6 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Lepidocrocite | Fe3+O(OH) |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Magnesioferrite | MgFe23+O4 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schneiderhöhnite | Fe2+Fe33+As53+O13 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Fe | ⓘ Wüstite | FeO |
| Fe | ⓘ Hematite var. Specularite | Fe2O3 |
| Fe | ⓘ Sewardite | CaFe23+(AsO4)2(OH)2 |
| Ni | Nickel | |
| Ni | ⓘ Nickeline | NiAs |
| Cu | Copper | |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| Cu | ⓘ Claraite | (Cu,Zn)15(CO3)4(AsO4)2(SO4)(OH)14 · 7H2O |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Cuprostibite | Cu2(Sb,Tl) |
| Cu | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| Cu | ⓘ Idaite | Cu5FeS6 |
| Cu | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Lautenthalite | PbCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| Cu | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| Cu | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Cu | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| Cu | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Cu | ⓘ Wherryite | Pb7Cu2(SO4)4(SiO4)2(OH)2 |
| Cu | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| Cu | ⓘ Steverustite | Pb52+(OH)5[Cu+(S6+O3S2-)3](H2O)2 |
| Zn | Zinc | |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Claraite | (Cu,Zn)15(CO3)4(AsO4)2(SO4)(OH)14 · 7H2O |
| Zn | ⓘ Gahnite | ZnAl2O4 |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Leiteite | Zn(As2O4) |
| Zn | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| Zn | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Zn | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| Zn | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Zincite | ZnO |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| As | ⓘ Atelestite | Bi2(AsO4)O(OH) |
| As | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| As | ⓘ Claraite | (Cu,Zn)15(CO3)4(AsO4)2(SO4)(OH)14 · 7H2O |
| As | ⓘ Leiteite | Zn(As2O4) |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Nickeline | NiAs |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Preisingerite | Bi3(AsO4)2O(OH) |
| As | ⓘ Rooseveltite | Bi(AsO4) |
| As | ⓘ Schneiderhöhnite | Fe2+Fe33+As53+O13 |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Sewardite | CaFe23+(AsO4)2(OH)2 |
| As | ⓘ Mimetite-Pyromorphite Series | |
| Se | Selenium | |
| Se | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| Y | Yttrium | |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Ag | ⓘ Freieslebenite | AgPbSbS3 |
| Ag | ⓘ Gustavite | AgPbBi3S6 |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Vikingite | Ag5Pb8Bi13S30 |
| Ag | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Schoenfliesite | Mg[Sn(OH)6] |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sb | Antimony | |
| Sb | ⓘ Native Antimony | Sb |
| Sb | ⓘ Berthierite | FeSb2S4 |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Cuprostibite | Cu2(Sb,Tl) |
| Sb | ⓘ Fülöppite | Pb3Sb8S15 |
| Sb | ⓘ Freieslebenite | AgPbSbS3 |
| Sb | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Valentinite | Sb2O3 |
| Sb | ⓘ Zinkenite | Pb9Sb22S42 |
| Te | Tellurium | |
| Te | ⓘ Tellurite | TeO2 |
| Te | ⓘ Tellurobismuthite | Bi2Te3 |
| Te | ⓘ Tetradymite | Bi2Te2S |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Ba | ⓘ Phillipsite Subgroup | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| W | Tungsten | |
| W | ⓘ Ferberite | FeWO4 |
| W | ⓘ Hübnerite | MnWO4 |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Stolzite | Pb(WO4) |
| W | ⓘ Tungstite | WO3 · H2O |
| W | ⓘ Welinite | Mn62+(W6+,Mg)2(SiO4)2(O,OH)6 |
| W | ⓘ Hydrokenoelsmoreite | ◻2W2O6(H2O) |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Tl | Thallium | |
| Tl | ⓘ Cuprostibite | Cu2(Sb,Tl) |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Chenite | Pb4Cu(SO4)2(OH)6 |
| Pb | ⓘ Cotunnite | PbCl2 |
| Pb | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| Pb | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| Pb | ⓘ Fülöppite | Pb3Sb8S15 |
| Pb | ⓘ Freieslebenite | AgPbSbS3 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Gustavite | AgPbBi3S6 |
| Pb | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| Pb | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Pb | ⓘ Lanarkite | Pb2(SO4)O |
| Pb | ⓘ Lautenthalite | PbCu4(SO4)2(OH)6 · 3H2O |
| Pb | ⓘ Native Lead | Pb |
| Pb | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Litharge | PbO |
| Pb | ⓘ Massicot | PbO |
| Pb | ⓘ Matlockite | PbFCl |
| Pb | ⓘ Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Parsonsite | Pb2(UO2)(PO4)2 |
| Pb | ⓘ Phosgenite | Pb2CO3Cl2 |
| Pb | ⓘ Plumbonacrite | Pb5O(OH)2(CO3)3 |
| Pb | ⓘ Plattnerite | PbO2 |
| Pb | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Scotlandite | PbSO3 |
| Pb | ⓘ Stolzite | Pb(WO4) |
| Pb | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Vikingite | Ag5Pb8Bi13S30 |
| Pb | ⓘ Wherryite | Pb7Cu2(SO4)4(SiO4)2(OH)2 |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Zinkenite | Pb9Sb22S42 |
| Pb | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Pb | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| Pb | ⓘ Mimetite-Pyromorphite Series | |
| Pb | ⓘ Steverustite | Pb52+(OH)5[Cu+(S6+O3S2-)3](H2O)2 |
| Bi | Bismuth | |
| Bi | ⓘ Atelestite | Bi2(AsO4)O(OH) |
| Bi | ⓘ Bismite | Bi2O3 |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Cannonite | Bi2(SO4)O(OH)2 |
| Bi | ⓘ Daubréeite | BiO(OH) |
| Bi | ⓘ Eulytine | Bi4(SiO4)3 |
| Bi | ⓘ Gustavite | AgPbBi3S6 |
| Bi | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Bi | ⓘ Preisingerite | Bi3(AsO4)2O(OH) |
| Bi | ⓘ Rooseveltite | Bi(AsO4) |
| Bi | ⓘ Tellurobismuthite | Bi2Te3 |
| Bi | ⓘ Tetradymite | Bi2Te2S |
| Bi | ⓘ Vikingite | Ag5Pb8Bi13S30 |
| Th | Thorium | |
| Th | ⓘ Thorite | Th(SiO4) |
| Th | ⓘ Thorite var. Uranothorite | (Th,U)SiO4 |
| U | Uranium | |
| U | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | ⓘ Liebigite | Ca2(UO2)(CO3)3 · 11H2O |
| U | ⓘ Parsonsite | Pb2(UO2)(PO4)2 |
| U | ⓘ Uraninite var. Pitchblende | UO2 |
| U | ⓘ Rutherfordine | (UO2)CO3 |
| U | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| U | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Thorite var. Uranothorite | (Th,U)SiO4 |
Fossils
There are 416 fossil localities from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 416 | ||||||
|---|---|---|---|---|---|---|---|
| Youngest Fossil Listed | 174 Ma (Early Jurassic) | ||||||
| Oldest Fossil Listed | 209 Ma (Late/Upper Triassic) | ||||||
| Stratigraphic Units |
| ||||||
| Fossils from Region | Click here to show the list. | ||||||
| Fossil Localities | Click to show 19 fossil localities |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Loz%C3%A8re |
|---|---|
| Wikidata ID: | Q12580 |
| GeoNames ID: | 2997288 |
Localities in this Region
- Occitanie
- Lozère
- ⭔Florac
- ⭔Barre-des-Cévennes
- ⭔Bassurels
- ⭔Bédouès-Cocurès
- ⭔Cans et Cévennes
- ⭔Cassagnas
- ⭔Florac Trois Rivières
- ⭔Fraissinet-de-Fourques
- ⭔Gabriac
- ⭔Gatuzières
- ⭔Gorges du Tarn Causses
- ⭔Hures-la-Parade
- ⭔Ispagnac
- ⭔La Malène
- ⭔Le Collet-de-Dèze
- ⭔Le Pompidou
- ⭔Le Rozier
- ⭔Les Bondons
- ⭔Mas-Saint-Chély
- ⭔Massegros Causses Gorges
- ⭔Meyrueis
- ⭔Moissac-Vallée-Française
- ⭔Molezon
- ⭔Pont-de-Montvert-Sud-Mont-Lozère
- ⭔Rousses
- ⭔Saint-André-de-Lancize
- ⭔Saint-Étienne-Vallée-Française
- ⭔Saint-Germain-de-Calberte
- ⭔Saint-Hilaire-de-Lavit
- ⭔Saint-Julien-des-Points
- ⭔Saint-Martin-de-Boubaux
- ⭔Saint-Martin-de-Lansuscle
- ⭔Saint-Michel-de-Dèze
- ⭔Saint-Pierre-des-Tripiers
- ⭔Saint-Privat-de-Vallongue
- ⭔Sainte-Croix-Vallée-Française
- ⭔Vebron
- ⭔Ventalon-en-Cévennes
- ⭔Vialas
- ⭔Mende
- ⭔Albaret-le-Comtal
- ⭔Albaret-Sainte-Marie
- ⭔Allenc
- ⭔Altier
- ⭔Antrenas
- ⭔Arzenc-d'Apcher
- ⭔Arzenc-de-Randon
- ⭔Auroux
- ⭔Badaroux
- ⭔Balsièges
- ⭔Banassac-Canilhac
- ⭔Barjac
- ⭔Bel-Air-Val-d'Ance
- ⭔Blavignac
- ⭔Bourgs sur Colagne
- ⭔Brenoux
- ⭔Brion
- ⭔Chadenet
- ⭔Chanac
- ⭔Chastanier
- ⭔Chastel-Nouvel
- ⭔Châteauneuf-de-Randon
- ⭔Chauchailles
- ⭔Chaudeyrac
- ⭔Chaulhac
- ⭔Cheylard-l'Évêque
- ⭔Cubières
- ⭔Cubiérettes
- ⭔Cultures
- ⭔Esclanèdes
- ⭔Fontans
- ⭔Fournels
- ⭔Gabrias
- ⭔Grandrieu
- ⭔Grandvals
- ⭔Grèzes
- ⭔Florac
- Lozère
- Occitanie
- Lozère
- Mende
- ⭔Julianges
- ⭔La Bastide-Puylaurent
- ⭔La Canourgue
- ⭔La Fage-Montivernoux
- ⭔La Fage-Saint-Julien
- ⭔La Panouse
- ⭔La Tieule
- ⭔Lachamp-Ribennes
- ⭔Lajo
- ⭔Langogne
- ⭔Lanuéjols
- ⭔Laubert
- ⭔Laval-du-Tarn
- ⭔Le Born
- ⭔Le Buisson
- ⭔Le Malzieu-Forain
- ⭔Le Malzieu-Ville
- ⭔Les Bessons
- ⭔Les Hermaux
- ⭔Les Laubies
- ⭔Les Monts-Verts
- ⭔Les Salces
- ⭔Les Salelles
- ⭔Luc
- ⭔Marchastel
- ⭔Marvejols
- ⭔Mende Commune
- ⭔Mont Lozère et Goulet
- ⭔Montbel
- ⭔Montrodat
- ⭔Monts-de-Randon
- ⭔Nasbinals
- ⭔Naussac-Fontanes
- ⭔Noalhac
- ⭔Palhers
- ⭔Paulhac-en-Margeride
- ⭔Pelouse
- ⭔Peyre-en-Aubrac
- ⭔Pied-de-Borne
- ⭔Pierrefiche
- Pont de Travette
- ⭔Pourcharesses
- ⭔Prévenchères
- ⭔Prinsuéjols-Malbouzon
- ⭔Prunières
- ⭔Recoules-d'Aubrac
- ⭔Recoules-de-Fumas
- ⭔Rimeize
- ⭔Rocles
- ⭔Saint-Alban-sur-Limagnole
- ⭔Saint-André-Capcèze
- ⭔Saint-Bauzile
- ⭔Saint-Bonnet-de-Chirac
- ⭔Saint-Bonnet-Laval
- ⭔Saint-Chély-d'Apcher
- ⭔Saint-Denis-en-Margeride
- ⭔Saint-Étienne-du-Valdonnez
- ⭔Saint-Flour-de-Mercoire
- ⭔Saint-Frézal-d'Albuges
- ⭔Saint-Gal
- ⭔Saint-Germain-du-Teil
- ⭔Saint-Jean-la-Fouillouse
- ⭔Saint-Juéry
- ⭔Saint-Laurent-de-Muret
- ⭔Saint-Laurent-de-Veyrès
- ⭔Saint-Léger-de-Peyre
- ⭔Saint-Léger-du-Malzieu
- ⭔Saint-Paul-le-Froid
- ⭔Saint-Pierre-de-Nogaret
- ⭔Saint-Pierre-le-Vieux
- ⭔Saint-Privat-du-Fau
- ⭔Saint-Saturnin
- ⭔Saint-Sauveur-de-Ginestoux
- ⭔Sainte-Eulalie
- ⭔Sainte-Hélène
- ⭔Serverette
- ⭔Termes
- ⭔Trélans
- ⭔Villefort
- Mt Mirat
- Mende
- Lozère
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
- Moldanubian BeltOrogenic Belt
EuropeContinent
France
- Massif CentralHighland Region
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Lozère, Occitanie, France