Lengenbach Quarry, Fäld, Binn, Goms, Valais, Switzerlandi
| Regional Level Types | |
|---|---|
| Lengenbach Quarry | Quarry (Active) |
| Fäld | Village |
| Binn | Municipality |
| Goms | District |
| Valais | Canton |
| Switzerland | Country |
Lengenbach Quarry, Binn Valley, Valais, Switzerland
This page kindly sponsored by Mark Kucera
Latitude & Longitude (WGS84):
46° 21' 54'' North , 8° 13' 13'' East
Latitude & Longitude (decimal):
Type:
Quarry (Active) - last checked 2025
Deposit first discovered:
1730 (approx.)
Age:
252.17 ± 0.06 to 201.3 ± 0.2 Ma
Geologic Time:
Köppen climate type:
Name(s) in local language(s):
Grube Lengenbach, Im Feld (Imfeld; Feld; Fäld), Binntal, Wallis (Valais), Schweiz (Suisse; Svizzera)
World-famous metamorphosed arsenic sulphosalt/sulphide deposit in sugary Triassic dolomite.
Currently mined for specimens (in summer only). Located about 1 km southeast of Fäld.
For news on the current state of research, see the official website of the Lengenbach Research Association (FGL, Forschungsgemeinschaft Lengenbach), https://fglb.clubdesk.ch/clubdesk/www
Opened ca. 1850 according to the French-language Wikipedia page (but this appears to be incorrect according to other information?).
Early history of the quarry (translated from Stalder et al. (1968)):
The first exploration of what would later become the Lengenbach quarry dates from the first half of the 18th century. At the time, iron was mined in the Binn valley. In 1728, the district commissioner (Landrat) of Wallis ordered Governor (Landeshauptmann) J.-G. Courten to find experts to research and exploit the iron deposits in the Binn valley. 2 years later, Mandel and Aston, 2 Englishmen living in Paris (France), received the concession to exploit the iron deposits in the Binn valley. They discovered the rich pyrite veins in dolomite at Lengenbach and dug an exploratory tunnel (the Engländerstollen). Franz Jentsch unexpectedly rediscovered this tunnel in 1902 while drilling.
However, the locals opposed the lease contract with the Englishmen because the latter were not Catholic and rose up against them, so much so that in 1732 the district commissioner (Landrat) cancelled the lease contract.
It wasn't until the beginning of the 19th century that mineralogists discovered several minerals that were new to science at the time on the dump of the Engländerstollen.
In the second half of the 19th century, Pastor Theodor Walpen was living in Binn. He was greatly interested in minerals and also had some knowledge of them. He also saw an additional earning potential for the not exactly wealthy locals in the collection and sale of mineral specimens. The aforementioned mineralogists notified the pastor of the dolomite occurrence at Lengenbach.
In 1900, Walpen suggested the founding of the Dolomit-Aktiengesellschaft ("Dolomite Public Company"), which started the exploitation of the minerals at Lengenbach. Only men from Binn participated in the company, such as the brothers Franz and Leopold Jentsch, Anton Imhof (father of Joseph Imhof), and Leopold Tenisch. Franz Jentsch identified and appraised the specimens; Anton Imhof was the quarry manager; Leopold Tenisch was the blacksmith (the company had its own forge) and cook; and Leopold Jentsch was the accountant. While the company wasn't that large, it kept 8 men busy (miners and other workers). The technical expense at the time was also modest; the rock-cutting machine, which had been donated to the company by a certain Dr. Krantz from Germany, is still in use today [i.e. in 1968]. Drilling was done by hand. […] Blasting was still done with black powder, more rarely with dynamite. Blasting with black powder wasn't easy, because one always had to take care that the drill hole was dry. The rubble (around 99%) was removed with wooden wheelbarrows and gutters. […] Water was also pumped from the quarry by hand. Mineral specimens were transported daily to the hamlet of Giessen and offered for sale. Most of the specimens ended up abroad, as they were bought by Englishmen. Only the University of Freiburg im Üechtland had an excellent collection at the time. The return was much greater than it is today, because the price of mineral specimens from Lengenbach has largely remained the same, whereas workers' wages were 20 to 30 times lower at the time […].
The quarry had its heyday from 1900 to 1912.
Work ceased during the First World War due to difficulties in sales. The quarry fell into decline, and rock slides and avalanches filled it up with all sorts of rubble.
In 1945, Joseph Imhof started work in the quarry on a small scale again. He hired a few workers, but the costs soon became so high that work had to be stopped again. The largest realgar crystal ever found in Lengenbach (7 cm long, 3 cm wide, and weighing 90 g), currently housed in the Natural History Museum in Bern, dates from this time.
Joseph Imhof then started a campaign to find sufficient funding to reopen the quarry. In 1958, he found in Dr. Grossglauser an efficient sponsor who then contacted Mr. von Sinner, the then president of the museum commission in Bern, and submitted to him the plan to reopen the quarry. Mr. von Sinner was enthusiastic about the idea, which led to the foundation of the (Bernische) Arbeitsgemeinschaft Lengenbach, led by its technical manager and concession holder Joseph Imhof (1902-1969). This was done with the financial support of the Natural History Museum in Bern, the Mineralogical-Petrological Institute of the University of Bern, and the Bally-Museum Schönenwerd.
The quarry was first cleaned up with the help of heavy machinery. Wooden load-bearing beams dating back to the time of the Dolomit-Aktiengesellschaft were discovered. These beams had been used to support the then 7-meter-deep quarry. Spacious barracks were built, a trolley system on rails was installed to remove the rubble from the quarry, and the local creek was slightly diverted. Work began and soon the mineral-bearing veins were found again, together with the minerals that had not been found in a long time, such as baumhauerite, jordanite, hutchinsonite, lengenbachite, and so on. It did not take long before new species were discovered, such as sinnerite, nowackiite, and imhofite, which were named after the men who had either worked in or had been affiliated with the quarry.
Currently mined for specimens (in summer only). Located about 1 km southeast of Fäld.
For news on the current state of research, see the official website of the Lengenbach Research Association (FGL, Forschungsgemeinschaft Lengenbach), https://fglb.clubdesk.ch/clubdesk/www
Opened ca. 1850 according to the French-language Wikipedia page (but this appears to be incorrect according to other information?).
Early history of the quarry (translated from Stalder et al. (1968)):
The first exploration of what would later become the Lengenbach quarry dates from the first half of the 18th century. At the time, iron was mined in the Binn valley. In 1728, the district commissioner (Landrat) of Wallis ordered Governor (Landeshauptmann) J.-G. Courten to find experts to research and exploit the iron deposits in the Binn valley. 2 years later, Mandel and Aston, 2 Englishmen living in Paris (France), received the concession to exploit the iron deposits in the Binn valley. They discovered the rich pyrite veins in dolomite at Lengenbach and dug an exploratory tunnel (the Engländerstollen). Franz Jentsch unexpectedly rediscovered this tunnel in 1902 while drilling.
However, the locals opposed the lease contract with the Englishmen because the latter were not Catholic and rose up against them, so much so that in 1732 the district commissioner (Landrat) cancelled the lease contract.
It wasn't until the beginning of the 19th century that mineralogists discovered several minerals that were new to science at the time on the dump of the Engländerstollen.
In the second half of the 19th century, Pastor Theodor Walpen was living in Binn. He was greatly interested in minerals and also had some knowledge of them. He also saw an additional earning potential for the not exactly wealthy locals in the collection and sale of mineral specimens. The aforementioned mineralogists notified the pastor of the dolomite occurrence at Lengenbach.
In 1900, Walpen suggested the founding of the Dolomit-Aktiengesellschaft ("Dolomite Public Company"), which started the exploitation of the minerals at Lengenbach. Only men from Binn participated in the company, such as the brothers Franz and Leopold Jentsch, Anton Imhof (father of Joseph Imhof), and Leopold Tenisch. Franz Jentsch identified and appraised the specimens; Anton Imhof was the quarry manager; Leopold Tenisch was the blacksmith (the company had its own forge) and cook; and Leopold Jentsch was the accountant. While the company wasn't that large, it kept 8 men busy (miners and other workers). The technical expense at the time was also modest; the rock-cutting machine, which had been donated to the company by a certain Dr. Krantz from Germany, is still in use today [i.e. in 1968]. Drilling was done by hand. […] Blasting was still done with black powder, more rarely with dynamite. Blasting with black powder wasn't easy, because one always had to take care that the drill hole was dry. The rubble (around 99%) was removed with wooden wheelbarrows and gutters. […] Water was also pumped from the quarry by hand. Mineral specimens were transported daily to the hamlet of Giessen and offered for sale. Most of the specimens ended up abroad, as they were bought by Englishmen. Only the University of Freiburg im Üechtland had an excellent collection at the time. The return was much greater than it is today, because the price of mineral specimens from Lengenbach has largely remained the same, whereas workers' wages were 20 to 30 times lower at the time […].
The quarry had its heyday from 1900 to 1912.
Work ceased during the First World War due to difficulties in sales. The quarry fell into decline, and rock slides and avalanches filled it up with all sorts of rubble.
In 1945, Joseph Imhof started work in the quarry on a small scale again. He hired a few workers, but the costs soon became so high that work had to be stopped again. The largest realgar crystal ever found in Lengenbach (7 cm long, 3 cm wide, and weighing 90 g), currently housed in the Natural History Museum in Bern, dates from this time.
Joseph Imhof then started a campaign to find sufficient funding to reopen the quarry. In 1958, he found in Dr. Grossglauser an efficient sponsor who then contacted Mr. von Sinner, the then president of the museum commission in Bern, and submitted to him the plan to reopen the quarry. Mr. von Sinner was enthusiastic about the idea, which led to the foundation of the (Bernische) Arbeitsgemeinschaft Lengenbach, led by its technical manager and concession holder Joseph Imhof (1902-1969). This was done with the financial support of the Natural History Museum in Bern, the Mineralogical-Petrological Institute of the University of Bern, and the Bally-Museum Schönenwerd.
The quarry was first cleaned up with the help of heavy machinery. Wooden load-bearing beams dating back to the time of the Dolomit-Aktiengesellschaft were discovered. These beams had been used to support the then 7-meter-deep quarry. Spacious barracks were built, a trolley system on rails was installed to remove the rubble from the quarry, and the local creek was slightly diverted. Work began and soon the mineral-bearing veins were found again, together with the minerals that had not been found in a long time, such as baumhauerite, jordanite, hutchinsonite, lengenbachite, and so on. It did not take long before new species were discovered, such as sinnerite, nowackiite, and imhofite, which were named after the men who had either worked in or had been affiliated with the quarry.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
186 valid minerals. 51 (TL) - type locality of valid minerals. 1 (FRL) - first recorded locality of unapproved mineral/variety/etc. 10 erroneous literature entries.
Rock Types Recorded
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S References: |
| ⓘ Aktashite Formula: Cu6Hg3As4S12 Description: EDXS P. Roth, XRD N. Meisser, 2016. |
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Anatase Formula: TiO2 |
| ⓘ Anglesite Formula: PbSO4 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Argentobaumhauerite (TL) Formula: Ag1.5Pb22As33.5S72 Type Locality: References: Pring, Allan, Birch, William D., Sewell, David, Graeser, Stefan, Edenharter, Andreas, Criddle, Alan (1990) Baumhauerite-2a: A silver-bearing mineral with a baumhauerite-like supercell from Lengenbach, Switzerland. American Mineralogist, 75 (7-8) 915-922 [as "baumhauerite-2a"] |
| ⓘ Argentodufrénoysite (TL) Formula: Ag3Pb26As35S80 Type Locality: |
| ⓘ Argentoliveingite (TL) Formula: Ag3+xPb36-2xAs51+xS112 Type Locality: References: Hålenius, U., Hatert, F., Pasero, M., Mills, S. J. (2016) New minerals and nomenclature modifications approved in 2016, CNMNC Newsletter 32. Mineralogical Magazine, 80 (5) 915-922 doi:10.1180/minmag.2016.080.084 Topa, Dan, Kolitsch, Uwe, Graeser, Stefan, Makovicky, Emil, Stanley, Chris (2019) Argentoliveingite, Ag3+xPb36−2xAs51+xS112 (0 ≤ x < 0.5), a new homeotype of liveingite from Lengenbach, Binntal, Switzerland, and the crystal chemistry of the liveingite group. European Journal of Mineralogy, 31 (5-6) 1079-1097 doi:10.1127/ejm/2019/0031-2890 |
| ⓘ Argentotennantite-(Zn) Formula: Ag6(Cu4Zn2)As4S12S References: |
| ⓘ Argentotetrahedrite-(Zn) (TL) Formula: Ag6(Cu4Zn2)Sb4S12S Type Locality: |
| ⓘ Arsendescloizite Formula: PbZn(AsO4)(OH) References: |
| ⓘ 'Arsenic Sulphide Glass No. 1' Formula: AsS3 (approximately) |
| ⓘ Arseniosiderite Formula: Ca2Fe3+3(AsO4)3O2 · 3H2O References: EDXS by P. Roth, PXRD by N. Meisser, 2023Identified by Philippe Roth (2): XRD, SEM-EDS |
| ⓘ Arsenolamprite Formula: As |
| ⓘ Arsenolite Formula: As2O3 |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Baileychlore Formula: Zn5Al(AlSi3O10)(OH)8 |
| ⓘ Baryte Formula: BaSO4 |
| ✪ Baumhauerite (TL) Formula: Pb12As16S36 Type Locality: |
| ⓘ Bernardite Formula: TlAs5S8 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ Bianchite Formula: Zn(H2O)6(SO4) References: |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Boulangerite Formula: Pb5Sb4S11 |
| ⓘ Bournonite Formula: PbCuSbS3 Description: Extremely rare, always As-bearing/rich. |
| ⓘ Brannerite Formula: UTi2O6 |
| ⓘ Buynite (TL) Formula: TlPb14As17S40 Type Locality: |
| ⓘ ' Type Locality: Description: "Approval for this mineral has been withdrawn.
Subsequent studies have shown that the material examined is uraninite, UO2."
CNMNC Newsletter No. 17, October 2013, page 3004; Mineralogical Magazine, 77, 2997-3005. |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Canfieldite Formula: Ag8SnS6 References: |
| ⓘ Canfieldite var. Tellurium-bearing Canfieldite Formula: Ag8(Sn,Ge)(S,Te)6 References: |
| ⓘ Černýite Formula: Cu2CdSnS4 |
| ⓘ Cerussite Formula: PbCO3 |
| ⓘ Chabournéite Formula: AgzTl8-x-zPb4+2xSb40-x-yAsyS68 with 0.00 < x < 0.40(9), 16.15(3)< y < 19.11(10), 0.04(4) < z < 0.11(6) |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Chrysocolla ? Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 Description: "Chrysocolla-like" mineral (Cannon, 2005). |
| ⓘ Cinnabar Formula: HgS |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Coffinite Formula: U(SiO4) · nH2O References: |
| ⓘ Coloradoite Formula: HgTe |
| ⓘ Coronadite Formula: Pb(Mn4+6Mn3+2)O16 References: |
| ⓘ Cotunnite Formula: PbCl2 |
| ⓘ Coulsonite Formula: Fe2+V3+2O4 Habit: Grains to 0.2 mm Description: Easily confused with magnetite. |
| ⓘ Covellite Formula: CuS |
| ⓘ Cuprite Formula: Cu2O |
| ⓘ Dalnegroite (TL) Formula: (Tl4Pb2)(As12Sb8)S34 Type Locality: |
| ⓘ Debattistiite (TL) Formula: Ag9Hg0.5As6S12Te2 Type Locality: |
| ⓘ Dekatriasartorite (TL) Formula: TlPb58As97S204 Type Locality: |
| ⓘ Dervillite Formula: Ag2AsS2 |
| ⓘ Diaphorite Formula: Ag3Pb2Sb3S8 |
| ⓘ Dickite Formula: Al2(Si2O5)(OH)4 Habit: Powders and minute mica-like tabular crystals Colour: White |
| ⓘ Dolomite Formula: CaMg(CO3)2 References: |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) Description: Dark brown crystals contain up to 30% of an uvite component; green crystals contain up to 5 wt% of Cr2O3 (Raber, 2011). |
| ⓘ Drechslerite (TL) Formula: Tl4(Sb4-xAsx)S8 (1 < x < 2) Type Locality: References: |
| ⓘ Dufrénoysite (TL) Formula: Pb2As2S5 Type Locality: References: |
| ⓘ Eckerite (TL) Formula: Ag2CuAsS3 Type Locality: References: Williams, P. A., Hatert, F., Pasero, M., Mills, S. J. (2015) New minerals and nomenclature modifications approved in 2014 and 2015. Newsletter No 23. Mineralogical Magazine, 79 (1) 51-58 doi:10.1180/minmag.2015.079.1.05 |
| ⓘ Edenharterite (TL) Formula: PbTlAs3S6 Type Locality: |
| ⓘ Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) Description: According to Raber (2011, translated from the original German): "another tourmaline species as dravite is as for today not known in the Lengenbach deposit." |
| ⓘ Enargite Formula: Cu3AsS4 Description: Single find in 1974. |
| ⓘ Enneasartorite (TL) Formula: Tl6Pb32As70S140 Type Locality: |
| ⓘ Epsomite Formula: MgSO4 · 7H2O |
| ⓘ Erniggliite (TL) Formula: Tl2SnAs2S6 Type Locality: References: |
| ⓘ Fangite Formula: Tl3AsS4 |
| ⓘ Ferrohexahydrite Formula: Fe2+(H2O)6(SO4) |
| ⓘ Ferrostalderite (TL) Formula: CuFe2TlAs2S6 Type Locality: References: Hålenius, U., Hatert, F., Pasero, M., Mills, S. J. (2015) New minerals and nomenclature modifications approved in 2015, CNMNC Newsletter No 24. Mineralogical Magazine, 79 (2) 247-251 doi:10.1180/minmag.2015.079.2.03 Biagioni, Cristian, Bindi, Luca, Nestola, Fabrizio, Cannon, Ralph, Roth, Philippe, Raber, Thomas (2016) Ferrostalderite, CuFe2TlAs2S6, a new mineral from Lengenbach, Switzerland: occurrence, crystal structure, and emphasis on the role of iron in sulfosalts. Mineralogical Magazine, 80 (1) 175-186 doi:10.1180/minmag.2015.079.7.10 |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ ' Description: The tourmalines at this locality contain a high molar fraction of uvite in their composition (up to 30%; Raber, 2011), but are still all dravites nevertheless. |
| ⓘ 'Freibergite Subgroup' Formula: (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 Description: Before the revision of the tetrahedrite group (Biagioni et al., 2020), 'freibergite' had a unclear status as a Ag-rich member between tetrahedrite and argentotetrahedrite. After revision, 'freibergite' is no longer a species (but a series) and the crystals investigated have now, in the light of the new nomenclature, to be considered as Ag-rich tetrahedrite-(Zn) |
| ⓘ Gabrielite (TL) Formula: Tl6Ag3Cu6(As,Sb)9S21 Type Locality: |
| ⓘ Galena Formula: PbS References: |
| ⓘ Galena var. Bismuth-bearing Galena Formula: (Pb,Bi,Ag)S |
| ⓘ Galena var. Silver-bearing Galena Formula: PbS with Ag |
| ⓘ Galena var. Steinmannite Formula: PbS |
| ⓘ Geocronite Formula: Pb14Sb6S23 |
| ⓘ Geuerite (TL) Formula: Ag2Tl4Pb4As22S40 Type Locality: |
| ⓘ Giuşcăite (TL) Formula: Ag2Tl4Pb4As20Sb2S40 Type Locality: |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Gorceixite Formula: BaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ 'Gorceixite-Goyazite Series' References: |
| ⓘ Goyazite Formula: SrAl3(PO4)(PO3OH)(OH)6 References: |
| ⓘ Graphite Formula: C |
| ⓘ Gratonite Formula: Pb9As4S15 |
| ⓘ Greenockite Formula: CdS |
| ⓘ Greigite Formula: Fe2+Fe3+2S4 Habit: Found in a mixture with scaly clay minerals Description: Probably formed by decomposition of arsenopyrite. |
| ⓘ Gypsum Formula: CaSO4 · 2H2O References: |
| ⓘ Halite Formula: NaCl |
| ⓘ Hatchite (TL) Formula: AgTlPbAs2S5 Type Locality: |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O |
| ⓘ Hendekasartorite (TL) Formula: Tl2Pb48As82S172 Type Locality: |
| ⓘ Heptasartorite (TL) Formula: Tl7Pb22As55S108 Type Locality: |
| ⓘ Hexahydrite Formula: Mg(H2O)6(SO4) |
| ⓘ Hörnesite Formula: Mg3(AsO4)2 · 8H2O |
| ⓘ Hutchinsonite (TL) Formula: TlPbAs5S9 Type Locality: |
| ⓘ Hydrocerussite Formula: Pb3(CO3)2(OH)2 |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Ilsemannite Formula: Mo3O8 · nH2O |
| ⓘ Imhofite (TL) Formula: Tl5.8As15.4S26 Type Locality: |
| ⓘ Incomsartorite (TL) Formula: Tl6Pb144As246S516 Type Locality: |
| ⓘ Interliveingite (TL) Formula: AgPb18As25S56 Type Locality: |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 References: |
| ⓘ Jentschite (TL) Formula: TlPbAs2SbS6 Type Locality: |
| ✪ Jordanite (TL) Formula: Pb14As6S23 Type Locality: |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Kësterite Formula: Cu2ZnSnS4 Description: Twinned pseudotetrahedral dark grey to black crystals, sometimes with bluish iridescence. |
| ⓘ 'K Feldspar' |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 |
| ⓘ Lafossaite Formula: Tl(Cl,Br) |
| ⓘ Leadhillite Formula: Pb4(CO3)2(SO4)(OH)2 References: |
| ✪ Lengenbachite (TL) Formula: Ag4Cu2Pb18As12S39 Type Locality: |
| ⓘ Lepidocrocite Formula: Fe3+O(OH) |
| ✪ Liveingite (TL) Formula: Pb20As24S56 Type Locality: |
| ⓘ Lorándite Formula: TlAsS2 |
| ⓘ Mackinawite ? Formula: FeS References: |
| ⓘ Magnesite Formula: MgCO3 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Habit: Massive |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Marrite (TL) Formula: AgPbAsS3 Type Locality: |
| ⓘ Marumoite (TL) Formula: Pb32As40S92 Type Locality: |
| ⓘ Metanováčekite Formula: Mg(UO2)2(AsO4)2 · 8H2O Description: XRD analyses by N. Meisser (Lausanne, CH) |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Microcline var. Hyalophane (FRL) Formula: (K,Ba)[Al(Si,Al)Si2O8] Type Locality: |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl |
| ⓘ Mohrite Formula: (NH4)2Fe(SO4)2 · 6H2O |
| ⓘ Molybdenite Formula: MoS2 Description:
|
| ⓘ 'Molybdenite-3R' Formula: MoS2 |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Fuchsite Formula: K(Al,Cr)3Si3O10(OH)2 |
| ⓘ Muscovite var. Oellacherite Formula: KAl2(AlSi3O10)(OH)2 Colour: pale green, due to a minor V3+ content References: |
| ⓘ Native Arsenic Formula: As |
| ⓘ Native Gold Formula: Au |
| ⓘ Native Silver Formula: Ag |
| ⓘ Native Sulphur Formula: S8 |
| ⓘ Nolanite Formula: V3+8Fe3+2O14(OH)2 |
| ⓘ Nowackiite (TL) Formula: Cu6Zn3As4S12 Type Locality: |
| ⓘ Orpiment Formula: As2S3 |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Paragonite Formula: NaAl2(AlSi3O10)(OH)2 |
| ⓘ Parapierrotite Formula: TlSb5S8 Description: XRD analyses by Prof. Nestola (Padua, I) and EDS by L. De Battisti (Milan, I), April 2014 |
| ⓘ Pararealgar Formula: As4S4 |
| ⓘ Pearceite Formula: [Ag6As2S7][Ag9CuS4] |
| ⓘ Pharmacolite Formula: Ca(HAsO4) · 2H2O |
| ⓘ Philrothite (TL) Formula: TlAs3S5 Type Locality: |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 |
| ⓘ Picotpaulite Formula: TlFe2S3 |
| ⓘ Picropharmacolite Formula: Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ Polybasite Formula: [Ag6Sb2S7][Ag9CuS4] |
| ⓘ Powellite ? Formula: Ca(MoO4) |
| ⓘ Formula: Ca2Al2Si3O10(OH)2 Description: Philippe Roth (in a personal communication to Vik Vanrusselt in July 2025):
"The deposit has undergone such a high degree of metamorphism that prehnite cannot possibly occur there in the first place. In those days, Swiss mineralogists were almost exclusively familiar with Alpine cleft minerals and far less with secondary minerals from ore deposits. When they spotted the small, hemimorphic, orthorhombic crystals, they thought it was prehnite. This serious mistake was quickly rectified." |
| ⓘ Proustite Formula: Ag3AsS3 Habit: Prismatic crystals to 1.5 mm |
| ⓘ Pyrargyrite Formula: Ag3SbS3 Description: Found on an old specimen in the collection at Cambridge, England. |
| ⓘ Pyrite Formula: FeS2 References: |
| ⓘ Pyrostilpnite Formula: Ag3SbS3 |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quadratite (TL) Formula: Ag(Cd,Pb)AsS3 Type Locality: |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Raberite (TL) Formula: Tl5Ag4As6SbS15 Type Locality: References: |
| ⓘ Raguinite Formula: TlFeS2 References: |
| ⓘ Ralphcannonite (TL) Formula: AgZn2TlAs2S6 Type Locality: |
| ✪ Rathite (TL) Formula: Ag2Pb12-xTlx/2As18+x/2S40 Type Locality: |
| ⓘ ' Description: "Rathite-I" has been proven to be identical with either dufrénoysite or rathite. The structure of "rathite-I" determined by Marumo and Nowacki (1965) is that of rathite. |
| ⓘ ' Description: "Rathite-III" is most probably a misidentified compound. The sample structurally studied by Le Bihan (1962) seems to be dufrénoysite. |
| ⓘ Formula: PbAs2S4 Description: "Rathite-IV" is possibly a separate species. Unit-cell parameters are close to those of argentoliveingite (triclinic-pseudomonoclinic), but rathite-IV is said to be monoclinic (Ozawa & Nowacki, 1974). The phase studied by Ozawa & Tachikawa (1996) using TEM seems to be a different phase. |
| ⓘ Realgar Formula: As4S4 |
| ⓘ Reckibachite Formula: Ag2Pb12As14Sb4S40 |
| ⓘ Rectorite Formula: (Na,Ca)Al4((Si,Al)8O20)(OH)4 · 2H2O References: |
| ⓘ Rectorite var. Rectorite-K Formula: (Na,Ca)Al4((Si,Al)8O20)(OH)4 · 2H2O |
| ⓘ Richardsollyite (TL) Formula: TlPbAsS3 Type Locality: References: |
| ⓘ Rosasite Formula: (Cu,Zn)2(CO3)(OH)2 |
| ⓘ Routhierite Formula: Tl(Cu,Ag)(Hg,Zn)2(As,Sb)2S6 |
| ⓘ Rozenite Formula: FeSO4 · 4H2O |
| ⓘ Rutile Formula: TiO2 Description: Typically flat dipyramidal, dark-red translucent crystals. Sometimes confused with sulphosalts.
Rarely prismatic.
May be Cr-rich. References: |
| ✪ Sartorite (TL) Formula: PbAs2S4 Type Locality: References: |
| ⓘ 'Sartorite Group' |
| ⓘ 'Scapolite' |
| ⓘ Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Description: According to Raber (2011, translated from the original German): "another tourmaline species as dravite is as for today not known in the Lengenbach deposit." |
| ⓘ Schulténite Formula: Pb(HAsO4) |
| ⓘ 'Scleroclase' |
| ⓘ Seligmannite (TL) Formula: PbCuAsS3 Type Locality: References: |
| ⓘ Sicherite (TL) Formula: TlAg2(As,Sb)3S6 Type Locality: |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Sinnerite (TL) Formula: Cu6As4S9 Type Locality: References: |
| ⓘ 'Smectite Group' Formula: A0.3D2-3[T4O10]Z2 · nH2O Habit: Crusts Colour: White to pale pink |
| ⓘ Smithite (TL) Formula: AgAsS2 Type Locality: |
| ⓘ Smythite Formula: (Fe,Ni)3+xS4 (x=0-0.3) |
| ⓘ Spaltiite (TL) Formula: Tl2Cu2As2S5 Type Locality: |
| ✪ Sphalerite Formula: ZnS |
| ⓘ Sphalerite var. Honigblende Formula: ZnS Colour: yellow Description: Coloured yellow by manganese impurities according to Ertl (1983). |
| ⓘ Stalderite (TL) Formula: Tl(Cu,Ag)(Zn,Fe,Hg)2(As,Sb)2S6 Type Locality: |
| ⓘ Starkeyite Formula: MgSO4 · 4H2O |
| ⓘ Stephanite Formula: Ag5SbS4 Description: Stephanite was identified only on an old specimen kept in a collection at Cambridge, England, UK. |
| ⓘ Stibnite Formula: Sb2S3 |
| ⓘ Struvite-(K) (TL) Formula: KMg(PO4) · 6H2O Type Locality: References: |
| ⓘ Sylvite Formula: KCl |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ Tennantite-(Fe) Formula: Cu6(Cu4Fe2+2)As4S12S Description: Extremely rare. References: |
| ⓘ Tennantite-(Hg) (TL) Formula: Cu6(Cu4Hg2)As4S12S Type Locality: |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S |
| ⓘ Tennantite-(Zn) (TL) Formula: Cu6(Cu4Zn2)As4S12S Type Locality: References: |
| ⓘ Tennantite-(Zn) var. Binnite (of Des Cloizeaux) Formula: Cu6[Cu4(Fe,Zn)2]As4S13 |
| ⓘ 'Tetrahedrite Group' Formula: M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S Habit: The sharp tetraheda have all analysed as tennantite Description: So far all the "tetrahedrite" from here has been analysed as tennantite. Please see: http://www.mindat.org/forum.php?read,106,358305,358305,page=1#msg-358305
However it is reported as rare in Mineralogie der Grube Lengenbach,Binntal-Wallis.
Sonderdruck aus dem Jahrbuch des Naturhistorischen Museums Bern
Band 11-1990-1992 door B.Hofmann, H.A.Stalder en S.Graeser.
ISBN-3-907-088-04-2
|
| ⓘ Tetrahedrite-(Zn) Formula: Cu6(Cu4Zn2)Sb4S12S |
| ⓘ Thalcusite Formula: Tl2Cu3FeS4 References: |
| ⓘ Thorite Formula: Th(SiO4) |
| ⓘ Thorite var. Thorogummite Formula: (Th,U)(SiO4)1-x(OH)4x |
| ⓘ Tochilinite Formula: Fe2+5-6(Mg,Fe2+)5S6(OH)10 |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z Description: According to Raber (2011, translated from the original German): "another tourmaline species as dravite is as for today not known in the Lengenbach deposit." |
| ⓘ Trechmannite (TL) Formula: AgAsS2 Type Locality: |
| ⓘ 'Unnamed (Ag-Fe endmember of Routhierite Group)' Formula: AgFe2TlAs2S6 |
| ⓘ 'Unnamed (Ag-Hg-Sn-Te Sulphide)' Formula: Ag-Hg-Sn-Te-S |
| ⓘ Uraninite Formula: UO2 |
| ⓘ Wallisite (TL) Formula: (Cu,Ag)TlPbAs2S5 Type Locality: |
| ⓘ Formula: TlSbS2 Habit: Barrel-shaped, steel-grey, tiny crystals Description: Topa et al. (2019) have shown that the As-rich 'weissbergite' from Lengenbach has a distinct structure and is a distinct mineral: the new species drechslerite. As-free or As-poor weissbergite has not been reported from the quarry.
TOPA, D., GRAESER, S., STÖGER, B., RABER, T., Stanley, C. (2019): Drechslerite, IMA 2019-061. CNMNC Newsletter No. 52; Mineralogical Magazine: 83; https://doi.org/10.1180/mgm.2019.73 |
| ⓘ Wulfenite Formula: Pb(MoO4) |
| ⓘ Wurtzite Formula: (Zn,Fe)S |
| ⓘ 'Wurtzite-2H' Formula: (Zn,Fe)S |
| ⓘ Xanthoconite Formula: Ag3AsS3 |
| ⓘ Formula: Y(PO4) |
| ⓘ 'Zeolite Group' |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Arsenic | 1.CA.05 | As |
| ⓘ | Arsenolamprite | 1.CA.10 | As |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Canfieldite | 2.BA.70 | Ag8SnS6 |
| ⓘ | var. Tellurium-bearing Canfieldite | 2.BA.70 | Ag8(Sn,Ge)(S,Te)6 |
| ⓘ | Thalcusite | 2.BD.30 | Tl2Cu3FeS4 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Coloradoite | 2.CB.05a | HgTe |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | var. Honigblende | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Černýite | 2.CB.15a | Cu2CdSnS4 |
| ⓘ | Kësterite | 2.CB.15a | Cu2ZnSnS4 |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Wurtzite | 2.CB.45 | (Zn,Fe)S |
| ⓘ | Picotpaulite | 2.CB.60 | TlFe2S3 |
| ⓘ | Raguinite | 2.CB.60 | TlFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Smythite | 2.CC.10 | (Fe,Ni)3+xS4 (x=0-0.3) |
| ⓘ | Mackinawite ? | 2.CC.25 | FeS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | var. Silver-bearing Galena | 2.CD.10 | PbS with Ag |
| ⓘ | var. Bismuth-bearing Galena | 2.CD.10 | (Pb,Bi,Ag)S |
| ⓘ | var. Steinmannite | 2.CD.10 | PbS |
| ⓘ | Cinnabar | 2.CD.15a | HgS |
| ⓘ | Greigite | 2.DA.05 | Fe2+Fe3+2S4 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Realgar | 2.FA.15a | As4S4 |
| ⓘ | Pararealgar | 2.FA.15b | As4S4 |
| ⓘ | Orpiment | 2.FA.30 | As2S3 |
| ⓘ | Tochilinite | 2.FD.35 | Fe2+5-6(Mg,Fe2+)5S6(OH)10 |
| ⓘ | Eckerite (TL) | 2.GA. | Ag2CuAsS3 |
| ⓘ | Proustite | 2.GA.05 | Ag3AsS3 |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | Pyrostilpnite | 2.GA.10 | Ag3SbS3 |
| ⓘ | Xanthoconite | 2.GA.10 | Ag3AsS3 |
| ⓘ | Aktashite | 2.GA.30 | Cu6Hg3As4S12 |
| ⓘ | Nowackiite (TL) | 2.GA.30 | Cu6Zn3As4S12 |
| ⓘ | Routhierite | 2.GA.40 | Tl(Cu,Ag)(Hg,Zn)2(As,Sb)2S6 |
| ⓘ | Stalderite (TL) | 2.GA.40 | Tl(Cu,Ag)(Zn,Fe,Hg)2(As,Sb)2S6 |
| ⓘ | Ralphcannonite (TL) | 2.GA.40 | AgZn2TlAs2S6 |
| ⓘ | Ferrostalderite (TL) | 2.GA.40 | CuFe2TlAs2S6 |
| ⓘ | 'Unnamed (Ag-Fe endmember of Routhierite Group)' | 2.GA.40 | AgFe2TlAs2S6 |
| ⓘ | Erniggliite (TL) | 2.GA.45 | Tl2SnAs2S6 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | Seligmannite (TL) | 2.GA.50 | PbCuAsS3 |
| ⓘ | Argentotetrahedrite-(Zn) (TL) | 2.GB. | Ag6(Cu4Zn2)Sb4S12S |
| ⓘ | Tennantite-(Hg) (TL) | 2.GB. | Cu6(Cu4Hg2)As4S12S |
| ⓘ | Argentotennantite-(Zn) | 2.GB.05 | Ag6(Cu4Zn2)As4S12S |
| ⓘ | 'Freibergite Subgroup' | 2.GB.05 | (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Tennantite-(Zn) var. Binnite (of Des Cloizeaux) | 2.GB.05 | Cu6[Cu4(Fe,Zn)2]As4S13 |
| ⓘ | (TL) | 2.GB.05 | Cu6(Cu4Zn2)As4S12S |
| ⓘ | Tetrahedrite-(Zn) | 2.GB.05 | Cu6(Cu4Zn2)Sb4S12S |
| ⓘ | Tennantite-(Fe) | 2.GB.05 | Cu6(Cu4Fe2+2)As4S12S |
| ⓘ | Stephanite | 2.GB.10 | Ag5SbS4 |
| ⓘ | Pearceite | 2.GB.15 | [Ag6As2S7][Ag9CuS4] |
| ⓘ | Polybasite | 2.GB.15 | [Ag6Sb2S7][Ag9CuS4] |
| ⓘ | Hatchite (TL) | 2.GC.05 | AgTlPbAs2S5 |
| ⓘ | Wallisite (TL) | 2.GC.05 | (Cu,Ag)TlPbAs2S5 |
| ⓘ | Sinnerite (TL) | 2.GC.10 | Cu6As4S9 |
| ⓘ | Quadratite (TL) | 2.GC.25 | Ag(Cd,Pb)AsS3 |
| ⓘ | Smithite (TL) | 2.GC.30 | AgAsS2 |
| ⓘ | Trechmannite (TL) | 2.GC.35 | AgAsS2 |
| ⓘ | Debattistiite (TL) | 2.GC.35 | Ag9Hg0.5As6S12Te2 |
| ⓘ | Interliveingite (TL) | 2.HB. | AgPb18As25S56 |
| ⓘ | Reckibachite | 2.HB. | Ag2Pb12As14Sb4S40 |
| ⓘ | Sartorite (TL) | 2.HC.05a | PbAs2S4 |
| ⓘ | Argentobaumhauerite (TL) | 2.HC.05b | Ag1.5Pb22As33.5S72 |
| ⓘ | Baumhauerite (TL) | 2.HC.05b | Pb12As16S36 |
| ⓘ | Liveingite (TL) | 2.HC.05c | Pb20As24S56 |
| ⓘ | Argentoliveingite (TL) | 2.HC.05c | Ag3+xPb36-2xAs51+xS112 |
| ⓘ | Dufrénoysite (TL) | 2.HC.05d | Pb2As2S5 |
| ⓘ | Rathite (TL) | 2.HC.05d | Ag2Pb12-xTlx/2As18+x/2S40 |
| ⓘ | Rathite-IV ? | 2.HC.05d | PbAs2S4 |
| ⓘ | Argentodufrénoysite (TL) | 2.HC.05d | Ag3Pb26As35S80 |
| ⓘ | Heptasartorite (TL) | 2.HC.05e | Tl7Pb22As55S108 |
| ⓘ | Hendekasartorite (TL) | 2.HC.05e | Tl2Pb48As82S172 |
| ⓘ | Incomsartorite (TL) | 2.HC.05e | Tl6Pb144As246S516 |
| ⓘ | Dekatriasartorite (TL) | 2.HC.05e | TlPb58As97S204 |
| ⓘ | Parapierrotite | 2.HC.05f | TlSb5S8 |
| ⓘ | Philrothite (TL) | 2.HC.05f | TlAs3S5 |
| ⓘ | Marumoite (TL) | 2.HC.05g | Pb32As40S92 |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Enneasartorite (TL) | 2.HD. | Tl6Pb32As70S140 |
| ⓘ | Buynite (TL) | 2.HD. | TlPb14As17S40 |
| ⓘ | Giuşcăite (TL) | 2.HD. | Ag2Tl4Pb4As20Sb2S40 |
| ⓘ | Lorándite | 2.HD.05 | TlAsS2 |
| ⓘ | Weissbergite ? | 2.HD.05 | TlSbS2 |
| ⓘ | Chabournéite | 2.HD.05e | AgzTl8-x-zPb4+2xSb40-x-yAsyS68 with 0.00 < x < 0.40(9), 16.15(3)< y < 19.11(10), 0.04(4) < z < 0.11(6) |
| ⓘ | Dalnegroite (TL) | 2.HD.05e | (Tl4Pb2)(As12Sb8)S34 |
| ⓘ | Richardsollyite (TL) | 2.HD.15 | TlPbAsS3 |
| ⓘ | Imhofite (TL) | 2.HD.30 | Tl5.8As15.4S26 |
| ⓘ | Edenharterite (TL) | 2.HD.35 | PbTlAs3S6 |
| ⓘ | Jentschite (TL) | 2.HD.40 | TlPbAs2SbS6 |
| ⓘ | Hutchinsonite (TL) | 2.HD.45 | TlPbAs5S9 |
| ⓘ | Bernardite | 2.HD.50 | TlAs5S8 |
| ⓘ | Sicherite (TL) | 2.HD.55 | TlAg2(As,Sb)3S6 |
| ⓘ | Geuerite (TL) | 2.HD.55 | Ag2Tl4Pb4As22S40 |
| ⓘ | Gabrielite (TL) | 2.HD.60 | Tl6Ag3Cu6(As,Sb)9S21 |
| ⓘ | Drechslerite (TL) | 2.HD.70 | Tl4(Sb4-xAsx)S8 (1 < x < 2) |
| ⓘ | Lengenbachite (TL) | 2.HF.30 | Ag4Cu2Pb18As12S39 |
| ⓘ | Diaphorite | 2.JB.05 | Ag3Pb2Sb3S8 |
| ⓘ | Marrite (TL) | 2.JB.15 | AgPbAsS3 |
| ⓘ | Geocronite | 2.JB.30a | Pb14Sb6S23 |
| ⓘ | Jordanite (TL) | 2.JB.30a | Pb14As6S23 |
| ⓘ | Gratonite | 2.JB.55 | Pb9As4S15 |
| ⓘ | Enargite | 2.KA.05 | Cu3AsS4 |
| ⓘ | Fangite | 2.KA.15 | Tl3AsS4 |
| ⓘ | Dervillite | 2.LA.10 | Ag2AsS2 |
| ⓘ | Raberite (TL) | 2.LA.70 | Tl5Ag4As6SbS15 |
| ⓘ | Spaltiite (TL) | 2.LA.75 | Tl2Cu2As2S5 |
| Group 3 - Halides | |||
| ⓘ | Halite | 3.AA.20 | NaCl |
| ⓘ | Sylvite | 3.AA.20 | KCl |
| ⓘ | Lafossaite | 3.AA.25 | Tl(Cl,Br) |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Cotunnite | 3.AB.85 | PbCl2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Coulsonite | 4.BB.05 | Fe2+V3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Nolanite | 4.CB.40 | V3+8Fe3+2O14(OH)2 |
| ⓘ | Arsenolite | 4.CB.50 | As2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brannerite | 4.DH.05 | UTi2O6 |
| ⓘ | Coronadite | 4.DK.05a | Pb(Mn4+6Mn3+2)O16 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| ⓘ | Lepidocrocite | 4.FE.15 | Fe3+O(OH) |
| ⓘ | Ilsemannite | 4.FJ.15 | Mo3O8 · nH2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Rosasite | 5.BA.10 | (Cu,Zn)2(CO3)(OH)2 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Hydrocerussite | 5.BE.10 | Pb3(CO3)2(OH)2 |
| ⓘ | Leadhillite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Rozenite | 7.CB.15 | FeSO4 · 4H2O |
| ⓘ | Starkeyite | 7.CB.15 | MgSO4 · 4H2O |
| ⓘ | Bianchite | 7.CB.25 | Zn(H2O)6(SO4) |
| ⓘ | Ferrohexahydrite | 7.CB.25 | Fe2+(H2O)6(SO4) |
| ⓘ | Hexahydrite | 7.CB.25 | Mg(H2O)6(SO4) |
| ⓘ | Epsomite | 7.CB.40 | MgSO4 · 7H2O |
| ⓘ | Mohrite | 7.CC.60 | (NH4)2Fe(SO4)2 · 6H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Powellite ? | 7.GA.05 | Ca(MoO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Schulténite | 8.AD.30 | Pb(HAsO4) |
| ⓘ | Xenotime-(Y) ? | 8.AD.35 | Y(PO4) |
| ⓘ | Arsendescloizite | 8.BH.35 | PbZn(AsO4)(OH) |
| ⓘ | Gorceixite | 8.BL.10 | BaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Goyazite | 8.BL.10 | SrAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Hörnesite | 8.CE.40 | Mg3(AsO4)2 · 8H2O |
| ⓘ | Picropharmacolite | 8.CH.15 | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| ⓘ | Struvite-(K) (TL) | 8.CH.40 | KMg(PO4) · 6H2O |
| ⓘ | Pharmacolite | 8.CJ.50 | Ca(HAsO4) · 2H2O |
| ⓘ | Arseniosiderite | 8.DH.30 | Ca2Fe3+3(AsO4)3O2 · 3H2O |
| ⓘ | Metanováčekite | 8.EB.10 | Mg(UO2)2(AsO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Coffinite | 9.AD.30 | U(SiO4) · nH2O |
| ⓘ | Thorite | 9.AD.30 | Th(SiO4) |
| ⓘ | var. Thorogummite | 9.AD.30 | (Th,U)(SiO4)1-x(OH)4x |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Elbaite ? | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl ? | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Prehnite ? | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite var. Fuchsite | 9.EC.15 | K(Al,Cr)3Si3O10(OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Paragonite | 9.EC.15 | NaAl2(AlSi3O10)(OH)2 |
| ⓘ | Muscovite var. Oellacherite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Baileychlore | 9.EC.55 | Zn5Al(AlSi3O10)(OH)8 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Rectorite | 9.EC.60 | (Na,Ca)Al4((Si,Al)8O20)(OH)4 · 2H2O |
| ⓘ | var. Rectorite-K | 9.EC.60 | (Na,Ca)Al4((Si,Al)8O20)(OH)4 · 2H2O |
| ⓘ | Dickite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Chrysocolla ? | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Microcline var. Hyalophane (TL) | 9.FA.30 | (K,Ba)[Al(Si,Al)Si2O8] |
| ⓘ | 9.FA.30 | K(AlSi3O8) | |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | 'Zeolite Group' | 9.G0. | |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Molybdenite-3R' | - | MoS2 |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Fluor-uvite-Uvite Series' ? | - | |
| ⓘ | 'Rathite-I' ? | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Smectite Group' | - | A0.3D2-3[T4O10]Z2 · nH2O |
| ⓘ | 'Rathite III' ? | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Tetrahedrite Group' | - | M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
| ⓘ | 'Arsenic Sulphide Glass No. 1' | - | AsS3 (approximately) |
| ⓘ | 'Sartorite Group' | - | |
| ⓘ | 'Gorceixite-Goyazite Series' | - | |
| ⓘ | 'Wurtzite-2H' | - | (Zn,Fe)S |
| ⓘ | 'Cadmoxite' ? (TL) | - | |
| ⓘ | 'Unnamed (Ag-Hg-Sn-Te Sulphide)' | - | Ag-Hg-Sn-Te-S |
| ⓘ | 'Scleroclase' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| H | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| H | ⓘ Baileychlore | Zn5Al(AlSi3O10)(OH)8 |
| H | ⓘ Bianchite | Zn(H2O)6(SO4) |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Coffinite | U(SiO4) · nH2O |
| H | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Epsomite | MgSO4 · 7H2O |
| H | ⓘ Ferrohexahydrite | Fe2+(H2O)6(SO4) |
| H | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| H | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| H | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Ilsemannite | Mo3O8 · nH2O |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Lepidocrocite | Fe3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Metanováčekite | Mg(UO2)2(AsO4)2 · 8H2O |
| H | ⓘ Mohrite | (NH4)2Fe(SO4)2 · 6H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Nolanite | V83+Fe23+O14(OH)2 |
| H | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| H | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Rectorite | (Na,Ca)Al4((Si,Al)8O20)(OH)4 · 2H2O |
| H | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| H | ⓘ Rozenite | FeSO4 · 4H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Schulténite | Pb(HAsO4) |
| H | ⓘ Starkeyite | MgSO4 · 4H2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| H | ⓘ Tochilinite | Fe2+5-6(Mg,Fe2+)5S6(OH)10 |
| H | ⓘ Fluor-uvite-Uvite Series | |
| H | ⓘ Muscovite var. Oellacherite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| H | ⓘ Struvite-(K) | KMg(PO4) · 6H2O |
| H | ⓘ Gorceixite-Goyazite Series | |
| H | ⓘ Rectorite var. Rectorite-K | (Na,Ca)Al4((Si,Al)8O20)(OH)4 · 2H2O |
| Li | Lithium | |
| Li | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| B | ⓘ Fluor-uvite-Uvite Series | |
| C | Carbon | |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| N | Nitrogen | |
| N | ⓘ Mohrite | (NH4)2Fe(SO4)2 · 6H2O |
| O | Oxygen | |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Arsenolite | As2O3 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| O | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| O | ⓘ Baileychlore | Zn5Al(AlSi3O10)(OH)8 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bianchite | Zn(H2O)6(SO4) |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Brannerite | UTi2O6 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Coffinite | U(SiO4) · nH2O |
| O | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| O | ⓘ Coulsonite | Fe2+V23+O4 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Epsomite | MgSO4 · 7H2O |
| O | ⓘ Ferrohexahydrite | Fe2+(H2O)6(SO4) |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| O | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| O | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| O | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Ilsemannite | Mo3O8 · nH2O |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Lepidocrocite | Fe3+O(OH) |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Metanováčekite | Mg(UO2)2(AsO4)2 · 8H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Mohrite | (NH4)2Fe(SO4)2 · 6H2O |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Nolanite | V83+Fe23+O14(OH)2 |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| O | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| O | ⓘ Powellite | Ca(MoO4) |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rectorite | (Na,Ca)Al4((Si,Al)8O20)(OH)4 · 2H2O |
| O | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| O | ⓘ Rozenite | FeSO4 · 4H2O |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Schulténite | Pb(HAsO4) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Starkeyite | MgSO4 · 4H2O |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Thorite | Th(SiO4) |
| O | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| O | ⓘ Tochilinite | Fe2+5-6(Mg,Fe2+)5S6(OH)10 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Fluor-uvite-Uvite Series | |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Muscovite var. Oellacherite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| O | ⓘ Struvite-(K) | KMg(PO4) · 6H2O |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Gorceixite-Goyazite Series | |
| O | ⓘ Rectorite var. Rectorite-K | (Na,Ca)Al4((Si,Al)8O20)(OH)4 · 2H2O |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Fluor-uvite-Uvite Series | |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Halite | NaCl |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Na | ⓘ Rectorite | (Na,Ca)Al4((Si,Al)8O20)(OH)4 · 2H2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | ⓘ Rectorite var. Rectorite-K | (Na,Ca)Al4((Si,Al)8O20)(OH)4 · 2H2O |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Epsomite | MgSO4 · 7H2O |
| Mg | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| Mg | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Metanováčekite | Mg(UO2)2(AsO4)2 · 8H2O |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| Mg | ⓘ Starkeyite | MgSO4 · 4H2O |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tochilinite | Fe2+5-6(Mg,Fe2+)5S6(OH)10 |
| Mg | ⓘ Fluor-uvite-Uvite Series | |
| Mg | ⓘ Struvite-(K) | KMg(PO4) · 6H2O |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Baileychlore | Zn5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Al | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Rectorite | (Na,Ca)Al4((Si,Al)8O20)(OH)4 · 2H2O |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Fluor-uvite-Uvite Series | |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Muscovite var. Oellacherite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Gorceixite-Goyazite Series | |
| Al | ⓘ Rectorite var. Rectorite-K | (Na,Ca)Al4((Si,Al)8O20)(OH)4 · 2H2O |
| Si | Silicon | |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Baileychlore | Zn5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Coffinite | U(SiO4) · nH2O |
| Si | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Rectorite | (Na,Ca)Al4((Si,Al)8O20)(OH)4 · 2H2O |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Thorite | Th(SiO4) |
| Si | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| Si | ⓘ Fluor-uvite-Uvite Series | |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Muscovite var. Oellacherite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Rectorite var. Rectorite-K | (Na,Ca)Al4((Si,Al)8O20)(OH)4 · 2H2O |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Struvite-(K) | KMg(PO4) · 6H2O |
| P | ⓘ Apatite | Ca5(PO4)3A |
| P | ⓘ Gorceixite-Goyazite Series | |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Aktashite | Cu6Hg3As4S12 |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Argentotennantite-(Zn) | Ag6(Cu4Zn2)As4S12S |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Argentobaumhauerite | Ag1.5Pb22As33.5S72 |
| S | ⓘ Baumhauerite | Pb12As16S36 |
| S | ⓘ Bernardite | TlAs5S8 |
| S | ⓘ Bianchite | Zn(H2O)6(SO4) |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Canfieldite | Ag8SnS6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chabournéite | AgzTl8-x-zPb4+2xSb40-x-yAsyS68 with 0.00 < x < 0.40(9), 16.15(3)< y < 19.11(10), 0.04(4) < z < 0.11(6) |
| S | ⓘ Cinnabar | HgS |
| S | ⓘ Covellite | CuS |
| S | ⓘ Černýite | Cu2CdSnS4 |
| S | ⓘ Dervillite | Ag2AsS2 |
| S | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| S | ⓘ Dufrénoysite | Pb2As2S5 |
| S | ⓘ Edenharterite | PbTlAs3S6 |
| S | ⓘ Enargite | Cu3AsS4 |
| S | ⓘ Epsomite | MgSO4 · 7H2O |
| S | ⓘ Erniggliite | Tl2SnAs2S6 |
| S | ⓘ Fangite | Tl3AsS4 |
| S | ⓘ Ferrohexahydrite | Fe2+(H2O)6(SO4) |
| S | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| S | ⓘ Galena | PbS |
| S | ⓘ Geocronite | Pb14Sb6S23 |
| S | ⓘ Gratonite | Pb9As4S15 |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Greigite | Fe2+Fe23+S4 |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Hatchite | AgTlPbAs2S5 |
| S | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| S | ⓘ Hutchinsonite | TlPbAs5S9 |
| S | ⓘ Imhofite | Tl5.8As15.4S26 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Jordanite | Pb14As6S23 |
| S | ⓘ Kësterite | Cu2ZnSnS4 |
| S | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Lengenbachite | Ag4Cu2Pb18As12S39 |
| S | ⓘ Liveingite | Pb20As24S56 |
| S | ⓘ Lorándite | TlAsS2 |
| S | ⓘ Mackinawite | FeS |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Marrite | AgPbAsS3 |
| S | ⓘ Mohrite | (NH4)2Fe(SO4)2 · 6H2O |
| S | ⓘ Molybdenite-3R | MoS2 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Nowackiite | Cu6Zn3As4S12 |
| S | ⓘ Orpiment | As2S3 |
| S | ⓘ Parapierrotite | TlSb5S8 |
| S | ⓘ Pararealgar | As4S4 |
| S | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| S | ⓘ Picotpaulite | TlFe2S3 |
| S | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| S | ⓘ Proustite | Ag3AsS3 |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrostilpnite | Ag3SbS3 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Raguinite | TlFeS2 |
| S | ⓘ Rathite | Ag2Pb12-xTlx/2As18+x/2S40 |
| S | ⓘ Realgar | As4S4 |
| S | ⓘ Routhierite | Tl(Cu,Ag)(Hg,Zn)2(As,Sb)2S6 |
| S | ⓘ Rozenite | FeSO4 · 4H2O |
| S | ⓘ Sartorite | PbAs2S4 |
| S | ⓘ Seligmannite | PbCuAsS3 |
| S | ⓘ Sinnerite | Cu6As4S9 |
| S | ⓘ Smithite | AgAsS2 |
| S | ⓘ Smythite | (Fe,Ni)3+xS4 (x=0-0.3) |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stalderite | Tl(Cu,Ag)(Zn,Fe,Hg)2(As,Sb)2S6 |
| S | ⓘ Starkeyite | MgSO4 · 4H2O |
| S | ⓘ Stephanite | Ag5SbS4 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Thalcusite | Tl2Cu3FeS4 |
| S | ⓘ Tochilinite | Fe2+5-6(Mg,Fe2+)5S6(OH)10 |
| S | ⓘ Trechmannite | AgAsS2 |
| S | ⓘ Wallisite | (Cu,Ag)TlPbAs2S5 |
| S | ⓘ Weissbergite | TlSbS2 |
| S | ⓘ Wurtzite | (Zn,Fe)S |
| S | ⓘ Xanthoconite | Ag3AsS3 |
| S | ⓘ Jentschite | TlPbAs2SbS6 |
| S | ⓘ Tennantite-(Zn) var. Binnite (of Des Cloizeaux) | Cu6[Cu4(Fe,Zn)2]As4S13 |
| S | ⓘ Quadratite | Ag(Cd,Pb)AsS3 |
| S | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| S | ⓘ Sicherite | TlAg2(As,Sb)3S6 |
| S | ⓘ Canfieldite var. Tellurium-bearing Canfieldite | Ag8(Sn,Ge)(S,Te)6 |
| S | ⓘ Gabrielite | Tl6Ag3Cu6(As,Sb)9S21 |
| S | ⓘ Marumoite | Pb32As40S92 |
| S | ⓘ Sphalerite var. Honigblende | ZnS |
| S | ⓘ Tetrahedrite Group | M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
| S | ⓘ Arsenic Sulphide Glass No. 1 | AsS3 (approximately) |
| S | ⓘ Galena var. Bismuth-bearing Galena | (Pb,Bi,Ag)S |
| S | ⓘ Dalnegroite | (Tl4Pb2)(As12Sb8)S34 |
| S | ⓘ Wurtzite-2H | (Zn,Fe)S |
| S | ⓘ Debattistiite | Ag9Hg0.5As6S12Te2 |
| S | ⓘ Raberite | Tl5Ag4As6SbS15 |
| S | ⓘ Rathite-IV | PbAs2S4 |
| S | ⓘ Philrothite | TlAs3S5 |
| S | ⓘ Spaltiite | Tl2Cu2As2S5 |
| S | ⓘ Eckerite | Ag2CuAsS3 |
| S | ⓘ Ralphcannonite | AgZn2TlAs2S6 |
| S | ⓘ Ferrostalderite | CuFe2TlAs2S6 |
| S | ⓘ Heptasartorite | Tl7Pb22As55S108 |
| S | ⓘ Enneasartorite | Tl6Pb32As70S140 |
| S | ⓘ Hendekasartorite | Tl2Pb48As82S172 |
| S | ⓘ Argentoliveingite | Ag3+xPb36-2xAs51+xS112 |
| S | ⓘ Incomsartorite | Tl6Pb144As246S516 |
| S | ⓘ Richardsollyite | TlPbAsS3 |
| S | ⓘ Argentodufrénoysite | Ag3Pb26As35S80 |
| S | ⓘ Dekatriasartorite | TlPb58As97S204 |
| S | ⓘ Unnamed (Ag-Hg-Sn-Te Sulphide) | Ag-Hg-Sn-Te-S |
| S | ⓘ Unnamed (Ag-Fe endmember of Routhierite Group) | AgFe2TlAs2S6 |
| S | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| S | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| S | ⓘ Tennantite-(Fe) | Cu6(Cu4Fe22+)As4S12S |
| S | ⓘ Argentotetrahedrite-(Zn) | Ag6(Cu4Zn2)Sb4S12S |
| S | ⓘ Drechslerite | Tl4(Sb4-xAsx)S8 (1 < x < 2) |
| S | ⓘ Tennantite-(Hg) | Cu6(Cu4Hg2)As4S12S |
| S | ⓘ Interliveingite | AgPb18As25S56 |
| S | ⓘ Buynite | TlPb14As17S40 |
| S | ⓘ Giuşcăite | Ag2Tl4Pb4As20Sb2S40 |
| S | ⓘ Reckibachite | Ag2Pb12As14Sb4S40 |
| S | ⓘ Geuerite | Ag2Tl4Pb4As22S40 |
| S | ⓘ Galena var. Steinmannite | PbS |
| Cl | Chlorine | |
| Cl | ⓘ Cotunnite | PbCl2 |
| Cl | ⓘ Halite | NaCl |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Sylvite | KCl |
| Cl | ⓘ Lafossaite | Tl(Cl,Br) |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| K | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Sylvite | KCl |
| K | ⓘ Muscovite var. Oellacherite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Struvite-(K) | KMg(PO4) · 6H2O |
| Ca | Calcium | |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| Ca | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| Ca | ⓘ Powellite | Ca(MoO4) |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Rectorite | (Na,Ca)Al4((Si,Al)8O20)(OH)4 · 2H2O |
| Ca | ⓘ Fluor-uvite-Uvite Series | |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ca | ⓘ Rectorite var. Rectorite-K | (Na,Ca)Al4((Si,Al)8O20)(OH)4 · 2H2O |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brannerite | UTi2O6 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| V | Vanadium | |
| V | ⓘ Coulsonite | Fe2+V23+O4 |
| V | ⓘ Nolanite | V83+Fe23+O14(OH)2 |
| Cr | Chromium | |
| Cr | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Mn | Manganese | |
| Mn | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Fe | Iron | |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Coulsonite | Fe2+V23+O4 |
| Fe | ⓘ Ferrohexahydrite | Fe2+(H2O)6(SO4) |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Greigite | Fe2+Fe23+S4 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Lepidocrocite | Fe3+O(OH) |
| Fe | ⓘ Mackinawite | FeS |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Mohrite | (NH4)2Fe(SO4)2 · 6H2O |
| Fe | ⓘ Nolanite | V83+Fe23+O14(OH)2 |
| Fe | ⓘ Picotpaulite | TlFe2S3 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Raguinite | TlFeS2 |
| Fe | ⓘ Rozenite | FeSO4 · 4H2O |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Smythite | (Fe,Ni)3+xS4 (x=0-0.3) |
| Fe | ⓘ Stalderite | Tl(Cu,Ag)(Zn,Fe,Hg)2(As,Sb)2S6 |
| Fe | ⓘ Thalcusite | Tl2Cu3FeS4 |
| Fe | ⓘ Tochilinite | Fe2+5-6(Mg,Fe2+)5S6(OH)10 |
| Fe | ⓘ Wurtzite | (Zn,Fe)S |
| Fe | ⓘ Tennantite-(Zn) var. Binnite (of Des Cloizeaux) | Cu6[Cu4(Fe,Zn)2]As4S13 |
| Fe | ⓘ Wurtzite-2H | (Zn,Fe)S |
| Fe | ⓘ Ferrostalderite | CuFe2TlAs2S6 |
| Fe | ⓘ Unnamed (Ag-Fe endmember of Routhierite Group) | AgFe2TlAs2S6 |
| Fe | ⓘ Tennantite-(Fe) | Cu6(Cu4Fe22+)As4S12S |
| Ni | Nickel | |
| Ni | ⓘ Smythite | (Fe,Ni)3+xS4 (x=0-0.3) |
| Cu | Copper | |
| Cu | ⓘ Aktashite | Cu6Hg3As4S12 |
| Cu | ⓘ Argentotennantite-(Zn) | Ag6(Cu4Zn2)As4S12S |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Černýite | Cu2CdSnS4 |
| Cu | ⓘ Enargite | Cu3AsS4 |
| Cu | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Cu | ⓘ Kësterite | Cu2ZnSnS4 |
| Cu | ⓘ Lengenbachite | Ag4Cu2Pb18As12S39 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Nowackiite | Cu6Zn3As4S12 |
| Cu | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| Cu | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Cu | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Cu | ⓘ Routhierite | Tl(Cu,Ag)(Hg,Zn)2(As,Sb)2S6 |
| Cu | ⓘ Seligmannite | PbCuAsS3 |
| Cu | ⓘ Sinnerite | Cu6As4S9 |
| Cu | ⓘ Stalderite | Tl(Cu,Ag)(Zn,Fe,Hg)2(As,Sb)2S6 |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Thalcusite | Tl2Cu3FeS4 |
| Cu | ⓘ Wallisite | (Cu,Ag)TlPbAs2S5 |
| Cu | ⓘ Tennantite-(Zn) var. Binnite (of Des Cloizeaux) | Cu6[Cu4(Fe,Zn)2]As4S13 |
| Cu | ⓘ Gabrielite | Tl6Ag3Cu6(As,Sb)9S21 |
| Cu | ⓘ Spaltiite | Tl2Cu2As2S5 |
| Cu | ⓘ Eckerite | Ag2CuAsS3 |
| Cu | ⓘ Ferrostalderite | CuFe2TlAs2S6 |
| Cu | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| Cu | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| Cu | ⓘ Tennantite-(Fe) | Cu6(Cu4Fe22+)As4S12S |
| Cu | ⓘ Argentotetrahedrite-(Zn) | Ag6(Cu4Zn2)Sb4S12S |
| Cu | ⓘ Tennantite-(Hg) | Cu6(Cu4Hg2)As4S12S |
| Zn | Zinc | |
| Zn | ⓘ Argentotennantite-(Zn) | Ag6(Cu4Zn2)As4S12S |
| Zn | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| Zn | ⓘ Baileychlore | Zn5Al(AlSi3O10)(OH)8 |
| Zn | ⓘ Bianchite | Zn(H2O)6(SO4) |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Kësterite | Cu2ZnSnS4 |
| Zn | ⓘ Nowackiite | Cu6Zn3As4S12 |
| Zn | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Zn | ⓘ Routhierite | Tl(Cu,Ag)(Hg,Zn)2(As,Sb)2S6 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Stalderite | Tl(Cu,Ag)(Zn,Fe,Hg)2(As,Sb)2S6 |
| Zn | ⓘ Wurtzite | (Zn,Fe)S |
| Zn | ⓘ Tennantite-(Zn) var. Binnite (of Des Cloizeaux) | Cu6[Cu4(Fe,Zn)2]As4S13 |
| Zn | ⓘ Sphalerite var. Honigblende | ZnS |
| Zn | ⓘ Wurtzite-2H | (Zn,Fe)S |
| Zn | ⓘ Ralphcannonite | AgZn2TlAs2S6 |
| Zn | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| Zn | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| Zn | ⓘ Argentotetrahedrite-(Zn) | Ag6(Cu4Zn2)Sb4S12S |
| Ge | Germanium | |
| Ge | ⓘ Canfieldite var. Tellurium-bearing Canfieldite | Ag8(Sn,Ge)(S,Te)6 |
| As | Arsenic | |
| As | ⓘ Aktashite | Cu6Hg3As4S12 |
| As | ⓘ Arsenolite | As2O3 |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Arsenolamprite | As |
| As | ⓘ Argentotennantite-(Zn) | Ag6(Cu4Zn2)As4S12S |
| As | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| As | ⓘ Native Arsenic | As |
| As | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| As | ⓘ Argentobaumhauerite | Ag1.5Pb22As33.5S72 |
| As | ⓘ Baumhauerite | Pb12As16S36 |
| As | ⓘ Bernardite | TlAs5S8 |
| As | ⓘ Chabournéite | AgzTl8-x-zPb4+2xSb40-x-yAsyS68 with 0.00 < x < 0.40(9), 16.15(3)< y < 19.11(10), 0.04(4) < z < 0.11(6) |
| As | ⓘ Dervillite | Ag2AsS2 |
| As | ⓘ Dufrénoysite | Pb2As2S5 |
| As | ⓘ Edenharterite | PbTlAs3S6 |
| As | ⓘ Enargite | Cu3AsS4 |
| As | ⓘ Erniggliite | Tl2SnAs2S6 |
| As | ⓘ Fangite | Tl3AsS4 |
| As | ⓘ Gratonite | Pb9As4S15 |
| As | ⓘ Hatchite | AgTlPbAs2S5 |
| As | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| As | ⓘ Hutchinsonite | TlPbAs5S9 |
| As | ⓘ Imhofite | Tl5.8As15.4S26 |
| As | ⓘ Jordanite | Pb14As6S23 |
| As | ⓘ Lengenbachite | Ag4Cu2Pb18As12S39 |
| As | ⓘ Liveingite | Pb20As24S56 |
| As | ⓘ Lorándite | TlAsS2 |
| As | ⓘ Marrite | AgPbAsS3 |
| As | ⓘ Metanováčekite | Mg(UO2)2(AsO4)2 · 8H2O |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Nowackiite | Cu6Zn3As4S12 |
| As | ⓘ Orpiment | As2S3 |
| As | ⓘ Pararealgar | As4S4 |
| As | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| As | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| As | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| As | ⓘ Proustite | Ag3AsS3 |
| As | ⓘ Rathite | Ag2Pb12-xTlx/2As18+x/2S40 |
| As | ⓘ Realgar | As4S4 |
| As | ⓘ Routhierite | Tl(Cu,Ag)(Hg,Zn)2(As,Sb)2S6 |
| As | ⓘ Sartorite | PbAs2S4 |
| As | ⓘ Schulténite | Pb(HAsO4) |
| As | ⓘ Seligmannite | PbCuAsS3 |
| As | ⓘ Sinnerite | Cu6As4S9 |
| As | ⓘ Smithite | AgAsS2 |
| As | ⓘ Stalderite | Tl(Cu,Ag)(Zn,Fe,Hg)2(As,Sb)2S6 |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Trechmannite | AgAsS2 |
| As | ⓘ Wallisite | (Cu,Ag)TlPbAs2S5 |
| As | ⓘ Xanthoconite | Ag3AsS3 |
| As | ⓘ Jentschite | TlPbAs2SbS6 |
| As | ⓘ Tennantite-(Zn) var. Binnite (of Des Cloizeaux) | Cu6[Cu4(Fe,Zn)2]As4S13 |
| As | ⓘ Quadratite | Ag(Cd,Pb)AsS3 |
| As | ⓘ Sicherite | TlAg2(As,Sb)3S6 |
| As | ⓘ Gabrielite | Tl6Ag3Cu6(As,Sb)9S21 |
| As | ⓘ Marumoite | Pb32As40S92 |
| As | ⓘ Arsenic Sulphide Glass No. 1 | AsS3 (approximately) |
| As | ⓘ Dalnegroite | (Tl4Pb2)(As12Sb8)S34 |
| As | ⓘ Debattistiite | Ag9Hg0.5As6S12Te2 |
| As | ⓘ Raberite | Tl5Ag4As6SbS15 |
| As | ⓘ Rathite-IV | PbAs2S4 |
| As | ⓘ Philrothite | TlAs3S5 |
| As | ⓘ Spaltiite | Tl2Cu2As2S5 |
| As | ⓘ Eckerite | Ag2CuAsS3 |
| As | ⓘ Ralphcannonite | AgZn2TlAs2S6 |
| As | ⓘ Ferrostalderite | CuFe2TlAs2S6 |
| As | ⓘ Heptasartorite | Tl7Pb22As55S108 |
| As | ⓘ Enneasartorite | Tl6Pb32As70S140 |
| As | ⓘ Hendekasartorite | Tl2Pb48As82S172 |
| As | ⓘ Argentoliveingite | Ag3+xPb36-2xAs51+xS112 |
| As | ⓘ Incomsartorite | Tl6Pb144As246S516 |
| As | ⓘ Richardsollyite | TlPbAsS3 |
| As | ⓘ Argentodufrénoysite | Ag3Pb26As35S80 |
| As | ⓘ Dekatriasartorite | TlPb58As97S204 |
| As | ⓘ Unnamed (Ag-Fe endmember of Routhierite Group) | AgFe2TlAs2S6 |
| As | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| As | ⓘ Tennantite-(Fe) | Cu6(Cu4Fe22+)As4S12S |
| As | ⓘ Drechslerite | Tl4(Sb4-xAsx)S8 (1 < x < 2) |
| As | ⓘ Tennantite-(Hg) | Cu6(Cu4Hg2)As4S12S |
| As | ⓘ Interliveingite | AgPb18As25S56 |
| As | ⓘ Buynite | TlPb14As17S40 |
| As | ⓘ Giuşcăite | Ag2Tl4Pb4As20Sb2S40 |
| As | ⓘ Reckibachite | Ag2Pb12As14Sb4S40 |
| As | ⓘ Geuerite | Ag2Tl4Pb4As22S40 |
| Br | Bromine | |
| Br | ⓘ Lafossaite | Tl(Cl,Br) |
| Sr | Strontium | |
| Sr | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| Sr | ⓘ Gorceixite-Goyazite Series | |
| Y | Yttrium | |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Ilsemannite | Mo3O8 · nH2O |
| Mo | ⓘ Molybdenite-3R | MoS2 |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Powellite | Ca(MoO4) |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Argentotennantite-(Zn) | Ag6(Cu4Zn2)As4S12S |
| Ag | ⓘ Argentobaumhauerite | Ag1.5Pb22As33.5S72 |
| Ag | ⓘ Canfieldite | Ag8SnS6 |
| Ag | ⓘ Chabournéite | AgzTl8-x-zPb4+2xSb40-x-yAsyS68 with 0.00 < x < 0.40(9), 16.15(3)< y < 19.11(10), 0.04(4) < z < 0.11(6) |
| Ag | ⓘ Dervillite | Ag2AsS2 |
| Ag | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| Ag | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Ag | ⓘ Hatchite | AgTlPbAs2S5 |
| Ag | ⓘ Lengenbachite | Ag4Cu2Pb18As12S39 |
| Ag | ⓘ Marrite | AgPbAsS3 |
| Ag | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| Ag | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Ag | ⓘ Proustite | Ag3AsS3 |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Pyrostilpnite | Ag3SbS3 |
| Ag | ⓘ Rathite | Ag2Pb12-xTlx/2As18+x/2S40 |
| Ag | ⓘ Routhierite | Tl(Cu,Ag)(Hg,Zn)2(As,Sb)2S6 |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Smithite | AgAsS2 |
| Ag | ⓘ Stalderite | Tl(Cu,Ag)(Zn,Fe,Hg)2(As,Sb)2S6 |
| Ag | ⓘ Stephanite | Ag5SbS4 |
| Ag | ⓘ Trechmannite | AgAsS2 |
| Ag | ⓘ Wallisite | (Cu,Ag)TlPbAs2S5 |
| Ag | ⓘ Xanthoconite | Ag3AsS3 |
| Ag | ⓘ Quadratite | Ag(Cd,Pb)AsS3 |
| Ag | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Ag | ⓘ Sicherite | TlAg2(As,Sb)3S6 |
| Ag | ⓘ Canfieldite var. Tellurium-bearing Canfieldite | Ag8(Sn,Ge)(S,Te)6 |
| Ag | ⓘ Gabrielite | Tl6Ag3Cu6(As,Sb)9S21 |
| Ag | ⓘ Galena var. Bismuth-bearing Galena | (Pb,Bi,Ag)S |
| Ag | ⓘ Debattistiite | Ag9Hg0.5As6S12Te2 |
| Ag | ⓘ Raberite | Tl5Ag4As6SbS15 |
| Ag | ⓘ Eckerite | Ag2CuAsS3 |
| Ag | ⓘ Ralphcannonite | AgZn2TlAs2S6 |
| Ag | ⓘ Argentoliveingite | Ag3+xPb36-2xAs51+xS112 |
| Ag | ⓘ Argentodufrénoysite | Ag3Pb26As35S80 |
| Ag | ⓘ Unnamed (Ag-Hg-Sn-Te Sulphide) | Ag-Hg-Sn-Te-S |
| Ag | ⓘ Unnamed (Ag-Fe endmember of Routhierite Group) | AgFe2TlAs2S6 |
| Ag | ⓘ Argentotetrahedrite-(Zn) | Ag6(Cu4Zn2)Sb4S12S |
| Ag | ⓘ Interliveingite | AgPb18As25S56 |
| Ag | ⓘ Giuşcăite | Ag2Tl4Pb4As20Sb2S40 |
| Ag | ⓘ Reckibachite | Ag2Pb12As14Sb4S40 |
| Ag | ⓘ Geuerite | Ag2Tl4Pb4As22S40 |
| Cd | Cadmium | |
| Cd | ⓘ Černýite | Cu2CdSnS4 |
| Cd | ⓘ Greenockite | CdS |
| Cd | ⓘ Quadratite | Ag(Cd,Pb)AsS3 |
| Sn | Tin | |
| Sn | ⓘ Canfieldite | Ag8SnS6 |
| Sn | ⓘ Černýite | Cu2CdSnS4 |
| Sn | ⓘ Erniggliite | Tl2SnAs2S6 |
| Sn | ⓘ Kësterite | Cu2ZnSnS4 |
| Sn | ⓘ Canfieldite var. Tellurium-bearing Canfieldite | Ag8(Sn,Ge)(S,Te)6 |
| Sn | ⓘ Unnamed (Ag-Hg-Sn-Te Sulphide) | Ag-Hg-Sn-Te-S |
| Sb | Antimony | |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Chabournéite | AgzTl8-x-zPb4+2xSb40-x-yAsyS68 with 0.00 < x < 0.40(9), 16.15(3)< y < 19.11(10), 0.04(4) < z < 0.11(6) |
| Sb | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| Sb | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Sb | ⓘ Geocronite | Pb14Sb6S23 |
| Sb | ⓘ Parapierrotite | TlSb5S8 |
| Sb | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Pyrostilpnite | Ag3SbS3 |
| Sb | ⓘ Routhierite | Tl(Cu,Ag)(Hg,Zn)2(As,Sb)2S6 |
| Sb | ⓘ Stalderite | Tl(Cu,Ag)(Zn,Fe,Hg)2(As,Sb)2S6 |
| Sb | ⓘ Stephanite | Ag5SbS4 |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Weissbergite | TlSbS2 |
| Sb | ⓘ Jentschite | TlPbAs2SbS6 |
| Sb | ⓘ Sicherite | TlAg2(As,Sb)3S6 |
| Sb | ⓘ Gabrielite | Tl6Ag3Cu6(As,Sb)9S21 |
| Sb | ⓘ Dalnegroite | (Tl4Pb2)(As12Sb8)S34 |
| Sb | ⓘ Raberite | Tl5Ag4As6SbS15 |
| Sb | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| Sb | ⓘ Argentotetrahedrite-(Zn) | Ag6(Cu4Zn2)Sb4S12S |
| Sb | ⓘ Drechslerite | Tl4(Sb4-xAsx)S8 (1 < x < 2) |
| Sb | ⓘ Giuşcăite | Ag2Tl4Pb4As20Sb2S40 |
| Sb | ⓘ Reckibachite | Ag2Pb12As14Sb4S40 |
| Te | Tellurium | |
| Te | ⓘ Coloradoite | HgTe |
| Te | ⓘ Canfieldite var. Tellurium-bearing Canfieldite | Ag8(Sn,Ge)(S,Te)6 |
| Te | ⓘ Debattistiite | Ag9Hg0.5As6S12Te2 |
| Te | ⓘ Unnamed (Ag-Hg-Sn-Te Sulphide) | Ag-Hg-Sn-Te-S |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| Ba | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Ba | ⓘ Gorceixite-Goyazite Series | |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Hg | Mercury | |
| Hg | ⓘ Aktashite | Cu6Hg3As4S12 |
| Hg | ⓘ Cinnabar | HgS |
| Hg | ⓘ Coloradoite | HgTe |
| Hg | ⓘ Routhierite | Tl(Cu,Ag)(Hg,Zn)2(As,Sb)2S6 |
| Hg | ⓘ Stalderite | Tl(Cu,Ag)(Zn,Fe,Hg)2(As,Sb)2S6 |
| Hg | ⓘ Debattistiite | Ag9Hg0.5As6S12Te2 |
| Hg | ⓘ Unnamed (Ag-Hg-Sn-Te Sulphide) | Ag-Hg-Sn-Te-S |
| Hg | ⓘ Tennantite-(Hg) | Cu6(Cu4Hg2)As4S12S |
| Tl | Thallium | |
| Tl | ⓘ Bernardite | TlAs5S8 |
| Tl | ⓘ Chabournéite | AgzTl8-x-zPb4+2xSb40-x-yAsyS68 with 0.00 < x < 0.40(9), 16.15(3)< y < 19.11(10), 0.04(4) < z < 0.11(6) |
| Tl | ⓘ Edenharterite | PbTlAs3S6 |
| Tl | ⓘ Erniggliite | Tl2SnAs2S6 |
| Tl | ⓘ Fangite | Tl3AsS4 |
| Tl | ⓘ Hatchite | AgTlPbAs2S5 |
| Tl | ⓘ Hutchinsonite | TlPbAs5S9 |
| Tl | ⓘ Imhofite | Tl5.8As15.4S26 |
| Tl | ⓘ Lorándite | TlAsS2 |
| Tl | ⓘ Parapierrotite | TlSb5S8 |
| Tl | ⓘ Picotpaulite | TlFe2S3 |
| Tl | ⓘ Raguinite | TlFeS2 |
| Tl | ⓘ Rathite | Ag2Pb12-xTlx/2As18+x/2S40 |
| Tl | ⓘ Routhierite | Tl(Cu,Ag)(Hg,Zn)2(As,Sb)2S6 |
| Tl | ⓘ Stalderite | Tl(Cu,Ag)(Zn,Fe,Hg)2(As,Sb)2S6 |
| Tl | ⓘ Thalcusite | Tl2Cu3FeS4 |
| Tl | ⓘ Wallisite | (Cu,Ag)TlPbAs2S5 |
| Tl | ⓘ Weissbergite | TlSbS2 |
| Tl | ⓘ Jentschite | TlPbAs2SbS6 |
| Tl | ⓘ Sicherite | TlAg2(As,Sb)3S6 |
| Tl | ⓘ Gabrielite | Tl6Ag3Cu6(As,Sb)9S21 |
| Tl | ⓘ Lafossaite | Tl(Cl,Br) |
| Tl | ⓘ Dalnegroite | (Tl4Pb2)(As12Sb8)S34 |
| Tl | ⓘ Raberite | Tl5Ag4As6SbS15 |
| Tl | ⓘ Philrothite | TlAs3S5 |
| Tl | ⓘ Spaltiite | Tl2Cu2As2S5 |
| Tl | ⓘ Ralphcannonite | AgZn2TlAs2S6 |
| Tl | ⓘ Ferrostalderite | CuFe2TlAs2S6 |
| Tl | ⓘ Heptasartorite | Tl7Pb22As55S108 |
| Tl | ⓘ Enneasartorite | Tl6Pb32As70S140 |
| Tl | ⓘ Hendekasartorite | Tl2Pb48As82S172 |
| Tl | ⓘ Incomsartorite | Tl6Pb144As246S516 |
| Tl | ⓘ Richardsollyite | TlPbAsS3 |
| Tl | ⓘ Dekatriasartorite | TlPb58As97S204 |
| Tl | ⓘ Unnamed (Ag-Fe endmember of Routhierite Group) | AgFe2TlAs2S6 |
| Tl | ⓘ Drechslerite | Tl4(Sb4-xAsx)S8 (1 < x < 2) |
| Tl | ⓘ Buynite | TlPb14As17S40 |
| Tl | ⓘ Giuşcăite | Ag2Tl4Pb4As20Sb2S40 |
| Tl | ⓘ Geuerite | Ag2Tl4Pb4As22S40 |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| Pb | ⓘ Argentobaumhauerite | Ag1.5Pb22As33.5S72 |
| Pb | ⓘ Baumhauerite | Pb12As16S36 |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Chabournéite | AgzTl8-x-zPb4+2xSb40-x-yAsyS68 with 0.00 < x < 0.40(9), 16.15(3)< y < 19.11(10), 0.04(4) < z < 0.11(6) |
| Pb | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Pb | ⓘ Cotunnite | PbCl2 |
| Pb | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| Pb | ⓘ Dufrénoysite | Pb2As2S5 |
| Pb | ⓘ Edenharterite | PbTlAs3S6 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Geocronite | Pb14Sb6S23 |
| Pb | ⓘ Gratonite | Pb9As4S15 |
| Pb | ⓘ Hatchite | AgTlPbAs2S5 |
| Pb | ⓘ Hutchinsonite | TlPbAs5S9 |
| Pb | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| Pb | ⓘ Jordanite | Pb14As6S23 |
| Pb | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Lengenbachite | Ag4Cu2Pb18As12S39 |
| Pb | ⓘ Liveingite | Pb20As24S56 |
| Pb | ⓘ Marrite | AgPbAsS3 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Rathite | Ag2Pb12-xTlx/2As18+x/2S40 |
| Pb | ⓘ Sartorite | PbAs2S4 |
| Pb | ⓘ Schulténite | Pb(HAsO4) |
| Pb | ⓘ Seligmannite | PbCuAsS3 |
| Pb | ⓘ Wallisite | (Cu,Ag)TlPbAs2S5 |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Jentschite | TlPbAs2SbS6 |
| Pb | ⓘ Quadratite | Ag(Cd,Pb)AsS3 |
| Pb | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Pb | ⓘ Marumoite | Pb32As40S92 |
| Pb | ⓘ Galena var. Bismuth-bearing Galena | (Pb,Bi,Ag)S |
| Pb | ⓘ Dalnegroite | (Tl4Pb2)(As12Sb8)S34 |
| Pb | ⓘ Rathite-IV | PbAs2S4 |
| Pb | ⓘ Heptasartorite | Tl7Pb22As55S108 |
| Pb | ⓘ Enneasartorite | Tl6Pb32As70S140 |
| Pb | ⓘ Hendekasartorite | Tl2Pb48As82S172 |
| Pb | ⓘ Argentoliveingite | Ag3+xPb36-2xAs51+xS112 |
| Pb | ⓘ Incomsartorite | Tl6Pb144As246S516 |
| Pb | ⓘ Richardsollyite | TlPbAsS3 |
| Pb | ⓘ Argentodufrénoysite | Ag3Pb26As35S80 |
| Pb | ⓘ Dekatriasartorite | TlPb58As97S204 |
| Pb | ⓘ Interliveingite | AgPb18As25S56 |
| Pb | ⓘ Buynite | TlPb14As17S40 |
| Pb | ⓘ Giuşcăite | Ag2Tl4Pb4As20Sb2S40 |
| Pb | ⓘ Reckibachite | Ag2Pb12As14Sb4S40 |
| Pb | ⓘ Geuerite | Ag2Tl4Pb4As22S40 |
| Pb | ⓘ Galena var. Steinmannite | PbS |
| Bi | Bismuth | |
| Bi | ⓘ Galena var. Bismuth-bearing Galena | (Pb,Bi,Ag)S |
| Th | Thorium | |
| Th | ⓘ Thorite | Th(SiO4) |
| Th | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| U | Uranium | |
| U | ⓘ Brannerite | UTi2O6 |
| U | ⓘ Coffinite | U(SiO4) · nH2O |
| U | ⓘ Metanováčekite | Mg(UO2)2(AsO4)2 · 8H2O |
| U | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| U | ⓘ Uraninite | UO2 |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Lengenbach_Quarry |
|---|---|
| Wikidata ID: | Q16894103 |
Mindat Articles
17 Rarest Minerals of Lengenbach Switzerland by Nekkhi MurtishiOther Regions, Features and Areas containing this locality
Eurasian PlateTectonic Plate
- AlpsAccretionary Complex
EuropeContinent
- The AlpsMountain Range
Switzerland
- Valais
- Binn ValleyValley
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Forschungsgemeinschaft Lengenbach (n.d.) Lengenbach Research Association, FGL. https://fglb.clubdesk.ch/clubdesk/www
Trechmann, Charles O. (1907) Crystallography of Sartorite from Binn. Mineralogical Magazine and Journal of the Mineralogical Society, 14 (66) 212-229 doi:10.1180/minmag.1907.014.66.06
Graeser, Stefan (1965) Die Mineralfundstellen im Dolomit des Binnatales. Schweizerische Mineralogische und Petrographische Mitteilungen, 45 (2). p.597-795. doi:10.5169/SEALS-35205
Graeser, Stefan (1967) Ein Vorkommen von Lorandit (TlAsS2) in der Schweiz. Contributions to Mineralogy and Petrology, 16 (1) 45-50 doi:10.1007/bf00371607
Stalder, H. A. - Ed. (1968) Die Mineralfundstelle Lengenbach im Binnatal. Naturhistorisches Museum der Stadt Bern. 84 pp.
Ribár, B., Nicca, Ch., Nowacki, W. (1969) Dreidimensionale Verfeinerung der Kristallstruktur von Dufrenoysit, Pb8As8S20. Zeitschrift für Kristallographie, 130 (1). 15-40 doi:10.1524/zkri.1969.130.1-6.15
Dillen, H. (1978) Nieuwe mineralen van Lengenbach (Zwitserland) [New minerals from Lengenbach (Switzerland)]. Geonieuws, 3 (10) 136
Williams, Timothy B., Pring, Allan (1988) Structure of lengenbachite: A high-resolution transmission electron microscope study. American Mineralogist, 73 (11-12) 1426-1433
Pring, Allan, Birch, William D., Sewell, David, Graeser, Stefan, Edenharter, Andreas, Criddle, Alan (1990) Baumhauerite-2a: A silver-bearing mineral with a baumhauerite-like supercell from Lengenbach, Switzerland. American Mineralogist, 75 (7-8) 915-922
Graeser, Stefan, Schwander, Hans (1992) Edenharterite (TlPbAs3S6): a new mineral from Lengenbach, Binntal (Switzerland) European Journal of Mineralogy, 4 (6) 1265-1270 doi:10.1127/ejm/4/6/1265
Hofmann, B. A. (1994) Formation of a sulfide melt during Alpine metamorphism of the Lengenbach polymetallic sulfide mineralization, Binntal, Switzerland. Mineralium Deposita, 29 (5) 439-442 doi:10.1007/bf01886964
Berlepsch, P. (1996) Crystal structure and crystal chemistry of the homeotypes edenharterite (TlPbAs3S6) and jentschite (TlPbAs2SbS6) from Lengenbach, Binntal (Switzerland) Schweizerische mineralogische und petrographische Mitteilungen, 76. 147-157
Hofmann, B. A., Knill, M. D. (1996) Geochemistry and genesis of the Lengenbach Pb-Zn-As-Tl-Ba-mineralisation, Binn Valley, Switzerland. Mineralium Deposita, 31 (4) 319-339 doi:10.1007/bf02280795
Graeser, Stefan, Edenharter, Andreas (1997) Jentschite (TlPbAs2SbS6) – a new sulphosalt mineral from Lengenbach, Binntal (Switzerland) Mineralogical Magazine, 61 (404) 131-137 doi:10.1180/minmag.1997.061.404.13
Gräser, S., Lustenhouwer, W., Berlepsch, P. (1998) Quadratite Ag(Cd,Pb)(As,Sb)S3 - a new sulfide mineral from Lengenbach, Binntal (Switzerland) Schweizerische mineralogische und petrographische Mitteilungen, 78 (3) 489-494
Graeser, Stefan, Berlepsch, Peter, Makovicky, Emil, Balić-Zǔnić, Tonči (2001) Sicherite, TlAg2(As,Sb)3S6, a new sulfosalt mineral from Lengenbach (Binntal, Switzerland): Description and structure determination. American Mineralogist, 86 (9) 1087-1093 doi:10.2138/am-2001-8-916
Graeser, S., Topa, D., Balić-Žunić, T., Makovicky, E. (2006) Gabrielite, Tl2AgCu2As3S7, a new species of thallium sulfosalt from Lengenbach, Binntal, Switzerland. The Canadian Mineralogist, 44 (1) 135-140 doi:10.2113/gscanmin.44.1.135
Balić-Žunić, T., Makovicky, E., Karanović, L., Poleti, D., Graeser, S. (2006) The crystal structure of gabrielite, Tl2AgCu2As3S7, a new species of thallium sulfosalt from Lengenbach, Switzerland. The Canadian Mineralogist, 44 (1) 141-158 doi:10.2113/gscanmin.44.1.141
Graeser, Stefan, Postl, Walter, Bojar, Hans-Peter Berlepsch, Armbruster, Thomas, Raber, Thomas, Ettinger, Karl, Walter, Franz (2008) Struvite-(K), KMgPO4·6H2O, the potassium equivalent of struvite a new mineral. European Journal of Mineralogy, 20 (4) 629-633 doi:10.1127/0935-1221/2008/0020-1810
Nestola, F., Guastoni, A., Bindi, L., Secco, L. (2009) Dalnegroite, Tl5–xPb2x(As,Sb)2l–xS34, a new thallium sulphosalt from Lengenbach quarry, Binntal, Switzerland. Mineralogical Magazine, 73 (6) 1027-1032 doi:10.1180/minmag.2009.073.6.1027
Bindi, L., Nestola, F., Guastoni, A., Secco, L. (2010) The crystal structure of dalnegroite, Tl5−xPb2x(As,Sb)21−xS34: a masterpiece of structural complexity. Mineralogical Magazine, 74 (6) 999-1012 doi:10.1180/minmag.2010.074.6.999
Bindi, L., Nestola, F., Guastoni, A., Zorzi, F., Peruzzo, L., Raber, T. (2012) Te-rich canfieldite, Ag8Sn(S,Te)6, from Lengenbach quarry, Binntal, Canton Valais, Switzerland: occurrence, description and crystal structure. The Canadian Mineralogist, 50 (1) 111-118 doi:10.3749/canmin.50.1.111
Guastoni, A., Bindi, L., Nestola, F. (2012) Debattistiite, Ag9Hg0.5As6S12Te2, a new Te-bearing sulfosalt from Lengenbach quarry, Binn valley, Switzerland: description and crystal structure. Mineralogical Magazine, 76 (3) 743-750 doi:10.1180/minmag.2012.076.3.21
Bindi, L., Nestola, F., Guastoni, A., Peruzzo, L., Ecker, M., Carampin, R. (2012) Raberite, Tl5Ag4As6SbS15, a new Tl-bearing sulfosalt from Lengenbach quarry, Binn valley, Switzerland: description and crystal structure. Mineralogical Magazine, 76 (5) 1153-1163 doi:10.1180/minmag.2012.076.5.07
Bindi, Luca, Makovicky, Emil, Nestola, Fabrizio, De Battisti, Luca (2013) Sinnerite, Cu6As4S9, from the Lengenbach quarry, Binn Valley, Switzerland: description and re-investigation of the crystal structure. The Canadian Mineralogist, 51 (6) 851-860 doi:10.3749/canmin.51.6.851
Bindi, L., Nestola, F., De Battisti, L., Guastoni, A. (2013) Dervillite, Ag2AsS2, from Lengenbach quarry, Binn valley, Switzerland: occurrence and crystal structure. Mineralogical Magazine, 77 (8) 3105-3112 doi:10.1180/minmag.2013.077.8.05
Bindi, L., Nestola, F., Makovicky, E., Guastoni, A., De Battisti, L. (2014) Tl-bearing sulfosalt from the Lengenbach quarry, Binn Valley, Switzerland: Philrothite, TlAs3S5. Mineralogical Magazine, 78 (1) 1-9 doi:10.1180/minmag.2014.078.1.01
Williams, P. A., Hatert, F., Pasero, M., Mills, S. J. (2014) New minerals and nomenclature modifications approved in 2014, CNMNC Newsletter No 20. Mineralogical Magazine, 78 (3) 549-558 doi:10.1180/minmag.2014.078.3.05
Williams, P. A., Hatert, F., Pasero, M., Mills, S. J. (2015) New minerals and nomenclature modifications approved in 2014 and 2015. Newsletter No 23. Mineralogical Magazine, 79 (1) 51-58 doi:10.1180/minmag.2015.079.1.05
Makovicky, Emil, Topa, Dan (2015) Crystal chemical formula for sartorite homologues. Mineralogical Magazine, 79 (1) 25-31 doi:10.1180/minmag.2015.079.1.03
Hålenius, U., Hatert, F., Pasero, M., Mills, S. J. (2015) New minerals and nomenclature modifications approved in 2015, CNMNC Newsletter No 24. Mineralogical Magazine, 79 (2) 247-251 doi:10.1180/minmag.2015.079.2.03
Hålenius, U., Hatert, F., Pasero, M., Mills, S. J. (2015) New minerals and nomenclature modifications approved in 2015, CNMNC Newsletter no 28. Mineralogical Magazine, 79 (7) 1859-1864 doi:10.1180/minmag.2015.079.7.18
Bindi, L., Nestola, F., Graeser, S., Tropper, P., Raber, T. (2015) Eckerite, Ag2CuAsS3, a new Cu-bearing sulfosalt from Lengenbach quarry, Binn valley, Switzerland: description and crystal structure. Mineralogical Magazine, 79 (3) 687-694 doi:10.1180/minmag.2015.079.3.13
Bindi, Luca, Biagioni, Cristian, Raber, Thomas, Roth, Philippe, Nestola, Fabrizio (2015) Ralphcannonite, AgZn2TlAs2S6, a new mineral of the routhierite isotypic series from Lengenbach, Binn Valley, Switzerland. Mineralogical Magazine, 79 (5) 1089-1098 doi:10.1180/minmag.2015.079.5.05
Hålenius, U., Hatert, F., Pasero, M., Mills, S. J. (2016) New minerals and nomenclature modifications approved in 2016, CNMNC Newsletter No. 33. Mineralogical Magazine, 80 (6) 1135-1144 doi:10.1180/minmag.2016.080.085
Hålenius, U., Hatert, F., Pasero, M., Mills, S. J. (2016) New minerals and nomenclature modifications approved in 2016, CNMNC Newsletter 32. Mineralogical Magazine, 80 (5) 915-922 doi:10.1180/minmag.2016.080.084
Biagioni, Cristian, Bindi, Luca, Nestola, Fabrizio, Cannon, Ralph, Roth, Philippe, Raber, Thomas (2016) Ferrostalderite, CuFe2TlAs2S6, a new mineral from Lengenbach, Switzerland: occurrence, crystal structure, and emphasis on the role of iron in sulfosalts. Mineralogical Magazine, 80 (1) 175-186 doi:10.1180/minmag.2015.079.7.10
Topa, Dan, Makovicky, Emil (2016) Argentobaumhauerite: name, chemistry, crystal structure, comparison with baumhauerite, and position in the Lengenbach mineralization sequence. Mineralogical Magazine, 80 (5) 819-840 doi:10.1180/minmag.2016.080.025
Meisser, Nicolas, Roth, Philippe, Nestola, Fabrizio, Biagioni, Cristian, Bindi, Luca, Robyr, Martin (2017) Richardsollyite, TlPbAsS3, a new sulfosalt from the Lengenbach quarry, Binn Valley, Switzerland. European Journal of Mineralogy, 29 (4) 679-688 doi:10.1127/ejm/2017/0029-2649
Topa, Dan, Makovicky, Emil, Stoeger, Berthold, Stanley, Chris (2017) Heptasartorite, Tl7Pb22As55S108, enneasartorite, Tl6Pb32As70S140 and hendekasartorite, Tl2Pb48As82S172, three members of the anion-omission series of ‘sartorites’ from the Lengenbach quarry at Binntal, Wallis, Switzerland. European Journal of Mineralogy, 29 (4) 701-712 doi:10.1127/ejm/2017/0029-2634
Makovicky, Emil, Topa, Dan, Stoeger, Berthold (2018) The crystal structures of heptasartorite, Tl7Pb22As55S108, and enneasartorite, Tl6Pb32As70S140, two members of an anion-omission series of complex sulfosalts from Lengenbach, the Swiss Alps, and comparison with the structures of As-Sb sartorite homologues. European Journal of Mineralogy, 30 (1) 149-164 doi:10.1127/ejm/2018/0030-2706
Raber, Thomas, Roth, Philippe (2018) The Lengenbach Quarry in Switzerland: Classic Locality for Rare Thallium Sulfosalts. Minerals, 8 (9) 409 doi:10.3390/min8090409
Topa, Dan, Kolitsch, Uwe (2018) The crystal chemistry of rathite based on new electron-microprobe data and single-crystal structure refinements: the role of thallium. Minerals, 8 (10) 466 doi:10.3390/min8100466
Topa, Dan, Kolitsch, Uwe, Graeser, Stefan, Makovicky, Emil, Stanley, Chris (2019) Argentoliveingite, Ag3+xPb36−2xAs51+xS112 (0 ≤ x < 0.5), a new homeotype of liveingite from Lengenbach, Binntal, Switzerland, and the crystal chemistry of the liveingite group. European Journal of Mineralogy, 31 (5-6) 1079-1097 doi:10.1127/ejm/2019/0031-2890
www.mineralienatlas.de (2020) https://www.mineralienatlas.de/lexikon/index.php/Schweiz/Wallis%2C%20Kanton/Goms%2C%20Bezirk/Binn/F%C3%A4ld%20%28Imfeld%2C%20Im%20Feld%29/Grube%20Lengenbach
www.landschaftspark-binntal.ch (2020) https://www.landschaftspark-binntal.ch/de/meta/karte.php?offer=2100
Miyawaki, Ritsuro, Hatert, Frédéric, Pasero, Marco, Mills, Stuart J. (2020) IMA Commission on New Minerals, Nomenclature and Classification (CNMNC) – Newsletter 58. European Journal of Mineralogy, 32 (6) 645-651 doi:10.5194/ejm-32-645-2020
Biagioni, Cristian, Sejkora, Jiří, Raber, Thomas, Roth, Philippe, Moëlo, Yves, Dolníček, Zdenĕk, Pasero, Marco (2021) Tennantite-(Hg), Cu6(Cu4Hg2)As4S13, a new tetrahedrite-group mineral from the Lengenbach quarry, Binn, Switzerland. Mineralogical Magazine, 85 (5) 744-751 doi:10.1180/mgm.2021.59
www.landschaftspark-binntal.ch (2021) https://www.landschaftspark-binntal.ch/en/discovery-experience/summer-activities/minerals-and-stones.php?offer=2100
Miyawaki, Ritsuro, Hatert, Frédéric, Pasero, Marco, Mills, Stuart J. (2021) IMA Commission on New Minerals, Nomenclature and Classification (CNMNC) – Newsletter 59. European Journal of Mineralogy, 33 (1) 139-143 doi:10.5194/ejm-33-139-2021
Sejkora, Jiří, Biagioni, Cristian, Števko, Martin, Raber, Thomas, Roth, Philippe, Vrtiška, Luboš (2022) Argentotetrahedrite-(Zn), Ag6(Cu4Zn2)Sb4S13, a new member of the tetrahedrite group. Mineralogical Magazine, 86 (2) 319-330 doi:10.1180/mgm.2022.21
www.urnerwochenblatt.ch (n.d.) https://www.urnerwochenblatt.ch/artikel/sicherit-neues-thalium-sulfosalz
Lengenbach Quarry, Fäld, Binn, Goms, Valais, Switzerland