Bayan Obo deposit, Bayan Obo mining district, Baotou City, Inner Mongolia, Chinai
| Regional Level Types | |
|---|---|
| Bayan Obo deposit | Deposit (Active) |
| Bayan Obo mining district | Mining District |
| Baotou City | Prefecture-level City |
| Inner Mongolia | Autonomous Region |
| China | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
41° 47' 44'' North , 109° 58' 9'' East
Latitude & Longitude (decimal):
Type:
Deposit (Active) - last checked 2024
Deposit first discovered:
1927
Köppen climate type:
Other/historical names associated with this locality:
Bayun-Obo deposit; Baiyunebo deposit
Super large polygenic REE-Fe-Nb deposit (Bayan-Obo type), discovered as an iron deposit in 1927. REE minerals were discovered in 1936, and Nb-bearing ores in the late 1950s. Reserves are estimated at more than 40 million tons of REE minerals grading at 3-5.4% REE (70% of the world's known REE reserves), 1 million tons of Nb2O5, and 470 million tons of iron. The deposit also contains a vast amount of fluorite, which is contained in all ore types; reserves are estimated at 130 million tons.
Bayan Obo deposit is an extreme geological entity, containing around 333 Mt REE2O3 at 2 wt%. It also contains significant resources of Nb (2.16 Mt at 0.13 wt% Nb2O5) and Fe (>1500 Mt at 35 wt%). In addition, significant Sc2O3 resources have been estimated at about 0.14 Mt with an average grade of 100 ppm. Currently, the mined ore minerals are magnetite/hematite for iron and monazite/REE-fluorcarbonate for REE resources, with aeschynite, columbite, ilmenorutile, pyrochlore, fergusonite, and baotite for Nb.
The ore is transported to the industrial city of Baotou for processing (hydrometallurgical leaching). There, liquid waste fills a 10 km² surface pool (coordinates: 40.65 N, 109.70 E).
Bayan Obo is the world's largest REE deposit. The fluorite content of the ores also makes it the world's largest fluorite deposit.
The Bayan Obo deposit is 18 km long from east to west and 3 km wide from north to south, covering a total area of 48 km². The deposit is composed of three major orebodies: the main orebody, the eastern orebody, and the western orebody. These bodies are each mined via open pits.
The main and eastern orebodies mainly occur in the northern limb of the Bayan syncline. The orebody's shape is lenticular and thick bedded in the main orebody and irregular lenticular in the eastern orebody, exhibiting many fractures. The main and eastern orebodies underwent intense fluoritization and fenitization and hosted abundant REE and Nb mineralization. Fluorite appears in the fenitized dolomite, whereas riebeckite and phlogopite are observed in the K-rich slate. The ores are distributed along an E-W-striking belt.
The deposit occurs in an east-west trending Mesoproterozoic rift zone along the northern margin of the Sino-Korean Craton. Host strata are quartzite, slate, limestone, and dolomite. The latter is also the main host rock. The orebodies are stratiform and lenticular, with masses, bands, layers, veins, and disseminations. Besides clear features of hot water sedimentation, the deposit also exhibits Mg, Fe, Na and F metasomatism. Sm-Nd monazite isochron age for bastnäsite and riebeckite is 1,200 to 1,300 Ma, whereas Th-Pb and Sm-Nd age of Ba-REE-F carbonates and aeschynite is 474 to 402 Ma.
"Two groups of biotite and apatite have been divided, including primary magma-related ones with age of 1231 Ma, which is characterized by relatively high K/Rb ratios and temperature; and altered hydrothermal ones with ages of 280 to 240 Ma, which is characterized by relatively high XMg, AlIV, F, REE contents, high oxygen fugacity, and low temperature."
The deposit is hosted in a suit of low-grade metamorphic sedimentary rocks of the Mesoproterozoic Bayan Obo Group. Nine units, H1 to H9, are named in ascending order for these meta-sedimentary rocks. The oldest H1 to H2 units are mainly conglomerate and sandstone, the H3 to H5 units mainly include carbonaceous slates and sandstone, the H6 and H7 units mainly include calcareous slate and limestone. The H8 unit, which mainly includes dolomite, is now excluded from the Bayan Obo Group. The youngest unit, H9, mainly includes slates and schist. Orebodies occur as lenses or beds in variable sizes within the H8 dolomite.
Nearly 100 carbonatite dikes in the Bayan Obo region intrude the basement gneisses and overlying clastic sedimentary rocks. The carbonatite body and the No.1 dike yield igneous zircon, monazite, apatite, hornblende, and whole-rock ages of 1.42 to 1.24 Ga, consistent with the age of fenite in the slate of 1.36 to 1.29 Ga.
The carbonatite bodies have two distinct textures: (1) massive carbonatites, some of which display sideronitic textures with irregular shapes of magnetite grains filling the intersections between coarse- to medium-grained granular dolomite grains, and (2) banded layers with two origins—(b1) original flow lamination defined by magnetite grains and (b2) deformed foliations. Additionally, the orebodies exhibit veined mineralization, filling brittle fractures in magnetite and banded layers.
Aegirine from metamorphic rocks associated with the ore is peculiar in being colourless in thin section, possibly due to the lack of charge transfer transitions.
Ore types are classified into nine main types: massive Nb-REE-Fe ore, banded Nb-REE-Fe ore, aegirine-type Nb-REE-Fe ore, riebeckite-type Nb-REE-Fe ore, dolomite-type Nb-REE-Fe ore, aegirine-type Nb-REE ore, dolomite-type Nb-REE ore, diopside-type Nb ore, and biotite-type Nb-REE-Fe ore. The economic ore minerals are mainly monazite-(Ce), REE fluorocarbonate minerals (e.g., bastnäsite-(Ce) and parisite-(Ce), columbite-(Fe), aeschynite-(Ce), hematite, and magnetite).
The Bayan Obo deposit has variable alteration styles according to the concentration of sodium (Na), potassium (K), and fluoride (F) elements. Fluoride and sodium metasomatism are notably high in the Main and East ores, which caused strong Nb and REE mineralization. Based on the different compositions of altered minerals, the ores within the Bayan Obo deposit were classified into six types, containing dolomite-, fluorite-, aegirine-, riebeckite-, mica-, and massive magnetite-types. The distribution of ore types is obviously controlled by the fenitization between the dolomites and the wall rocks. In the upper layer of the orebody adjacent to the Bilute Formation, the ores are mainly mica- and riebeckite-types. Conversely, the lower layer dolomites are enriched in fluorite, exhibiting a pronounced zonation in their distribution.
Fluorite predominantly occurs in disseminated and banded forms within iron ores, often concentrated in areas enriched with iron minerals and rare earth minerals, accompanied by significant quantities of apatite. Within dolomite enriched in magnetite, relatively abundant occurrences of riebeckite, biotite, and aegirine are observed. A large amount of fluorite can also be found in dolomite rich in magnetite. Fluorite is present in two phases of dolomite: most is hosted in fine-grained dolomite, while a smaller amount is found in coarse-grained dolomite. The Mesoproterozoic fluorite metallogenic process is categorized into three stages: disseminated, massive, and banded.
Early Paleozoic riebeckite albitite within the Bayan Obo deposit occur as steeply NW-dipping dikes, striking NE-SW, intruding the Mesoproterozoic Bayan Obo Group H9 slate. The dikes are 50–100 m long and 1–5 m wide at outcrop, with sharp intrusive contacts against the host rocks. The mineral assemblage of the riebeckite albitite is dominated by albite and eckermannite, with minor pyrite and accessory minerals such as monazite, apatite, and zircon.
Bayan Obo deposit is an extreme geological entity, containing around 333 Mt REE2O3 at 2 wt%. It also contains significant resources of Nb (2.16 Mt at 0.13 wt% Nb2O5) and Fe (>1500 Mt at 35 wt%). In addition, significant Sc2O3 resources have been estimated at about 0.14 Mt with an average grade of 100 ppm. Currently, the mined ore minerals are magnetite/hematite for iron and monazite/REE-fluorcarbonate for REE resources, with aeschynite, columbite, ilmenorutile, pyrochlore, fergusonite, and baotite for Nb.
The ore is transported to the industrial city of Baotou for processing (hydrometallurgical leaching). There, liquid waste fills a 10 km² surface pool (coordinates: 40.65 N, 109.70 E).
Bayan Obo is the world's largest REE deposit. The fluorite content of the ores also makes it the world's largest fluorite deposit.
The Bayan Obo deposit is 18 km long from east to west and 3 km wide from north to south, covering a total area of 48 km². The deposit is composed of three major orebodies: the main orebody, the eastern orebody, and the western orebody. These bodies are each mined via open pits.
The main and eastern orebodies mainly occur in the northern limb of the Bayan syncline. The orebody's shape is lenticular and thick bedded in the main orebody and irregular lenticular in the eastern orebody, exhibiting many fractures. The main and eastern orebodies underwent intense fluoritization and fenitization and hosted abundant REE and Nb mineralization. Fluorite appears in the fenitized dolomite, whereas riebeckite and phlogopite are observed in the K-rich slate. The ores are distributed along an E-W-striking belt.
The deposit occurs in an east-west trending Mesoproterozoic rift zone along the northern margin of the Sino-Korean Craton. Host strata are quartzite, slate, limestone, and dolomite. The latter is also the main host rock. The orebodies are stratiform and lenticular, with masses, bands, layers, veins, and disseminations. Besides clear features of hot water sedimentation, the deposit also exhibits Mg, Fe, Na and F metasomatism. Sm-Nd monazite isochron age for bastnäsite and riebeckite is 1,200 to 1,300 Ma, whereas Th-Pb and Sm-Nd age of Ba-REE-F carbonates and aeschynite is 474 to 402 Ma.
"Two groups of biotite and apatite have been divided, including primary magma-related ones with age of 1231 Ma, which is characterized by relatively high K/Rb ratios and temperature; and altered hydrothermal ones with ages of 280 to 240 Ma, which is characterized by relatively high XMg, AlIV, F, REE contents, high oxygen fugacity, and low temperature."
The deposit is hosted in a suit of low-grade metamorphic sedimentary rocks of the Mesoproterozoic Bayan Obo Group. Nine units, H1 to H9, are named in ascending order for these meta-sedimentary rocks. The oldest H1 to H2 units are mainly conglomerate and sandstone, the H3 to H5 units mainly include carbonaceous slates and sandstone, the H6 and H7 units mainly include calcareous slate and limestone. The H8 unit, which mainly includes dolomite, is now excluded from the Bayan Obo Group. The youngest unit, H9, mainly includes slates and schist. Orebodies occur as lenses or beds in variable sizes within the H8 dolomite.
Nearly 100 carbonatite dikes in the Bayan Obo region intrude the basement gneisses and overlying clastic sedimentary rocks. The carbonatite body and the No.1 dike yield igneous zircon, monazite, apatite, hornblende, and whole-rock ages of 1.42 to 1.24 Ga, consistent with the age of fenite in the slate of 1.36 to 1.29 Ga.
The carbonatite bodies have two distinct textures: (1) massive carbonatites, some of which display sideronitic textures with irregular shapes of magnetite grains filling the intersections between coarse- to medium-grained granular dolomite grains, and (2) banded layers with two origins—(b1) original flow lamination defined by magnetite grains and (b2) deformed foliations. Additionally, the orebodies exhibit veined mineralization, filling brittle fractures in magnetite and banded layers.
Aegirine from metamorphic rocks associated with the ore is peculiar in being colourless in thin section, possibly due to the lack of charge transfer transitions.
Ore types are classified into nine main types: massive Nb-REE-Fe ore, banded Nb-REE-Fe ore, aegirine-type Nb-REE-Fe ore, riebeckite-type Nb-REE-Fe ore, dolomite-type Nb-REE-Fe ore, aegirine-type Nb-REE ore, dolomite-type Nb-REE ore, diopside-type Nb ore, and biotite-type Nb-REE-Fe ore. The economic ore minerals are mainly monazite-(Ce), REE fluorocarbonate minerals (e.g., bastnäsite-(Ce) and parisite-(Ce), columbite-(Fe), aeschynite-(Ce), hematite, and magnetite).
The Bayan Obo deposit has variable alteration styles according to the concentration of sodium (Na), potassium (K), and fluoride (F) elements. Fluoride and sodium metasomatism are notably high in the Main and East ores, which caused strong Nb and REE mineralization. Based on the different compositions of altered minerals, the ores within the Bayan Obo deposit were classified into six types, containing dolomite-, fluorite-, aegirine-, riebeckite-, mica-, and massive magnetite-types. The distribution of ore types is obviously controlled by the fenitization between the dolomites and the wall rocks. In the upper layer of the orebody adjacent to the Bilute Formation, the ores are mainly mica- and riebeckite-types. Conversely, the lower layer dolomites are enriched in fluorite, exhibiting a pronounced zonation in their distribution.
Fluorite predominantly occurs in disseminated and banded forms within iron ores, often concentrated in areas enriched with iron minerals and rare earth minerals, accompanied by significant quantities of apatite. Within dolomite enriched in magnetite, relatively abundant occurrences of riebeckite, biotite, and aegirine are observed. A large amount of fluorite can also be found in dolomite rich in magnetite. Fluorite is present in two phases of dolomite: most is hosted in fine-grained dolomite, while a smaller amount is found in coarse-grained dolomite. The Mesoproterozoic fluorite metallogenic process is categorized into three stages: disseminated, massive, and banded.
Early Paleozoic riebeckite albitite within the Bayan Obo deposit occur as steeply NW-dipping dikes, striking NE-SW, intruding the Mesoproterozoic Bayan Obo Group H9 slate. The dikes are 50–100 m long and 1–5 m wide at outcrop, with sharp intrusive contacts against the host rocks. The mineral assemblage of the riebeckite albitite is dominated by albite and eckermannite, with minor pyrite and accessory minerals such as monazite, apatite, and zircon.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities170 valid minerals. 30 (TL) - type locality of valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Arsenopyrite ? | 2.EB.20 | FeAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| Group 3 - Halides | |||
| ⓘ | Halite | 3.AA.20 | NaCl |
| ⓘ | Sylvite | 3.AA.20 | KCl |
| ⓘ | Sellaite | 3.AB.15 | MgF2 |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Zhangpeishanite (TL) | 3.DC.25 | BaFCl |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | 'Ixiolite-(Mn2+)-Ixiolite-(Fe2+) Series' | 4.. | |
| ⓘ | 'Pyrochlore Group var. Plumbopyrochlore (of Skorobogatova et al.)' | 4.00. | (Pb,Y,U,Ca)2-xNb2O6(OH) |
| ⓘ | '' | 4.00. | A2Nb2(O,OH)6Z |
| ⓘ | Chrysoberyl | 4.BA.05 | BeAl2O4 |
| ⓘ | Hercynite | 4.BB.05 | Fe2+Al2O4 |
| ⓘ | Jacobsite | 4.BB.05 | Mn2+Fe3+2O4 |
| ⓘ | Magnesiochromite | 4.BB.05 | MgCr2O4 |
| ⓘ | Magnesioferrite | 4.BB.05 | MgFe3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Hercynite var. Picotite | 4.BB.05 | (Fe,Mg)(Al,Cr)2O4 |
| ⓘ | Magnetite var. Mushketovite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Maghemite | 4.BB.15 | (Fe3+0.67◻0.33)Fe3+2O4 |
| ⓘ | Fuyuanite (TL) | 4.CB. | Mg7Nb6O18(OH)8 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Hematite var. Martite | 4.CB.05 | Fe2O3 |
| ⓘ | var. Specularite | 4.CB.05 | Fe2O3 |
| ⓘ | Oboniobite (TL) | 4.CC. | Mg4Nb2O9 |
| ⓘ | Perovskite | 4.CC.30 | CaTiO3 |
| ⓘ | Loparite | 4.CC.35 | (Na,REE)2Ti2O6 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Rutile var. Ilmenorutile | 4.DB.05 | (Ti,Nb)O2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | var. Niobium-bearing Rutile | 4.DB.05 | (Ti,Nb)O2 |
| ⓘ | Nioboixiolite-([]) (TL) | 4.DB.20 | (Nb0.8◻0.2)4+O2 |
| ⓘ | Samarskite-(Y) | 4.DB.25 | YFe3+Nb2O8 |
| ⓘ | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
| ⓘ | Columbite-(Mn) | 4.DB.35 | Mn2+Nb2O6 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | var. Niobium-bearing Anatase | 4.DD.05 | (Ti,Nb)O2 |
| ⓘ | Baddeleyite | 4.DE.35 | ZrO2 |
| ⓘ | Aeschynite-(Ce) | 4.DF.05 | Ce(TiNb)O6 |
| ⓘ | Aeschynite-(Nd) (TL) | 4.DF.05 | Nd(TiNb)O6 |
| ⓘ | Yulinite (TL) | 4.DF.05 | SrNb2O6 |
| ⓘ | Fersmite | 4.DG.05 | CaNb2O6 |
| ⓘ | Clinofergusonite-(Nd) (TL) | 4.DG.10 | (Nd,Ce)NbO4 |
| ⓘ | Clinofergusonite-(Ce) (TL) | 4.DG.10 | CeNbO4 |
| ⓘ | Fluorcalciopyrochlore (TL) | 4.DH.15 | (Ca,Na)2(Nb,Ti)2O6F |
| ⓘ | Oxyplumbopyrochlore (TL) | 4.DH.15 | Pb2Nb2O6O |
| ⓘ | Xianhuaite-(Ce) (TL) | 4.DL. | K2CeNb5O15 |
| ⓘ | Xianhuaite-(La) (TL) | 4.DL. | K2LaNb5O15 |
| ⓘ | Cerianite-(Ce) | 4.DL.05 | Ce4+O2 |
| ⓘ | Thorianite | 4.DL.05 | ThO2 |
| ⓘ | 'Aeschynite Group' | 4.DL.05 | AD2O6 |
| ⓘ | Zuolinite (TL) | 4.DM. | Ba2Sr(Nb4.5Fe3+0.5)O15 |
| ⓘ | Molybdite | 4.E0.10 | MoO3 |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Lepidocrocite | 4.FE.15 | Fe3+O(OH) |
| ⓘ | Magnesiohongruiite-(Fe3+) (TL) | 4.FL.70 | (Mg2Fe3+)Fe3+NbO7(OH) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Calcite var. Manganese-bearing Calcite | 5.AB.05 | (Ca,Mn)CO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Calcite var. Strontium-rich Calcite | 5.AB.05 | (Ca,Sr)CO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | var. Iron-bearing Dolomite | 5.AB.10 | Ca(Mg,Fe)(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Strontianite | 5.AB.15 | SrCO3 |
| ⓘ | var. Emmonite | 5.AB.15 | (Sr,Ca)CO3 |
| ⓘ | Aragonite var. Strontium-bearing Aragonite | 5.AB.15 | (Ca,Sr)CO3 |
| ⓘ | Norsethite | 5.AB.30 | BaMg(CO3)2 |
| ⓘ | Alstonite | 5.AB.35 | BaCa(CO3)2 |
| ⓘ | Paralstonite | 5.AB.40 | BaCa(CO3)2 |
| ⓘ | Barytocalcite | 5.AB.45 | BaCa(CO3)2 |
| ⓘ | Carbocernaite | 5.AB.50 | (Ca,Na)(Sr,Ce,Ba)(CO3)2 |
| ⓘ | Benstonite | 5.AB.55 | Ba6Ca6Mg(CO3)13 |
| ⓘ | Cordylite-(Ce) | 5.BD.05 | NaBaCe2(CO3)4F |
| ⓘ | 'Unnamed (Cordylite-like Calcium-Barium-Cerium Carbonate-Fluoride)' | 5.BD.05 | Ca◻Ba2Ce4[CO3]8F2 |
| ⓘ | 'Zhonghuacerite-(Ce)' | 5.BD.10 | Ba2Ce(CO3)3F |
| ⓘ | Cebaite-(Ce) (TL) | 5.BD.15 | Ba3Ce2(CO3)5F2 |
| ⓘ | 'Cebaite-(Nd)' | 5.BD.15 | Ba3(Nd,Ce)2(CO3)5F2 |
| ⓘ | Bastnäsite-(Ce) | 5.BD.20a | Ce(CO3)F |
| ⓘ | Bastnäsite-(Y) | 5.BD.20a | Y(CO3)F |
| ⓘ | Thorbastnäsite | 5.BD.20a | ThCa(CO3)2F2 · 3H2O |
| ⓘ | Parisite-(Ce) | 5.BD.20b | CaCe2(CO3)3F2 |
| ⓘ | Parisite-(Nd) (TL) | 5.BD.20b | Ca(Nd,Ce,La)2(CO3)3F2 |
| ⓘ | Synchysite-(Ce) | 5.BD.20c | CaCe(CO3)2F |
| ⓘ | Röntgenite-(Ce) | 5.BD.20d | Ca2(Ce,La)3(CO3)5F3 |
| ⓘ | Huanghoite-(Ce) (TL) | 5.BD.35 | BaCe(CO3)2F |
| ⓘ | Huanghoite-(Nd) (TL) | 5.BD.35 | BaNd(CO3)2F |
| ⓘ | Bayanoboite-(Y) (TL) | 5.BD.45 | Ba2Y(CO3)2F3 |
| ⓘ | Daqingshanite-(Ce) (TL) | 5.BF.15 | (Sr,Ca,Ba)3(Ce,La)(CO3)3-x(PO4)(OH,F)2x |
| ⓘ | Lanthanite-(Ce) | 5.CC.25 | Ce2(CO3)3 · 8H2O |
| ⓘ | Desautelsite | 5.DA.50 | Mg6Mn3+2(OH)16[CO3] · 4H2O |
| Group 6 - Borates | |||
| ⓘ | Boracite | 6.GA.05 | Mg3(B7O13)Cl |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Celestine | 7.AD.35 | SrSO4 |
| ⓘ | Alunite | 7.BC.10 | KAl3(SO4)2(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6(SO4) · H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Fergusonite-(Ce) | 7.GA.05 | CeNbO4 · 0.3H2O |
| ⓘ | 'Fergusonite-(Nd)' | 7.GA.05 | NdNbO4 |
| ⓘ | Fergusonite-(Y) | 7.GA.05 | YNbO4 |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Monazite-(La) | 8.AD.50 | La(PO4) |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Brockite | 8.CJ.45 | (Ca,Th,Ce)PO4 · H2O |
| ⓘ | Rhabdophane-(Ce) | 8.CJ.45 | Ce(PO4) · 0.6H2O |
| Group 9 - Silicates | |||
| ⓘ | Ferrisepiolite | 9.00. | (Fe3+,Fe2+,Mg)4((Si,Fe3+)6O15)(O,OH)2 · 6H2O |
| ⓘ | Fayalite | 9.AC.05 | Fe2+2(SiO4) |
| ⓘ | Forsterite | 9.AC.05 | Mg2(SiO4) |
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Thorite | 9.AD.30 | Th(SiO4) |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Thorite var. Uranothorite | 9.AD.30 | (Th,U)SiO4 |
| ⓘ | var. Ferrithorite | 9.AD.30 | (Th,Fe3+)[Si(O,OH)4] |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Norbergite | 9.AF.40 | Mg3(SiO4)F2 |
| ⓘ | Humite | 9.AF.50 | Mg7(SiO4)3F2 |
| ⓘ | Clinohumite | 9.AF.55 | Mg9(SiO4)4F2 |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Cerite-(CeCa) | 9.AG.20 | (Ce7Ca2)◻Mg(SiO4)3(SiO3OH)4(OH)3 |
| ⓘ | Britholite-(Ce) | 9.AH.25 | (Ce,Ca)5(SiO4)3OH |
| ⓘ | Fluorbritholite-(Ce) | 9.AH.25 | (Ce,Ca)5(SiO4)3F |
| ⓘ | Thortveitite | 9.BC.05 | Sc2Si2O7 |
| ⓘ | Barytolamprophyllite | 9.BE.25 | (Ba,Na)2(Na,Ti,Fe3+)4Ti2(Si2O7)2O(OH,F) |
| ⓘ | Bafertisite (TL) | 9.BE.55 | Ba2Fe2+4Ti2(Si2O7)2O2(OH)2F2 |
| ⓘ | Perrierite-(Ce) | 9.BE.70 | Ce4MgFe3+2Ti2(Si2O7)2O8 |
| ⓘ | Chevkinite-(Ce) | 9.BE.70 | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| ⓘ | Dingdaohengite-(Ce) (TL) | 9.BE.70 | (Ce,La)4Fe2+(Ti,Fe2+,Mg,Fe3+)2Ti2(Si2O7)2O8 |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Niobobaotite (TL) | 9.CE. | Ba4(Ti2.5Fe2+1.5)Nb4Si4O28Cl |
| ⓘ | Baotite (TL) | 9.CE.15 | Ba4(Ti,Nb,W)8O16(SiO3)4Cl |
| ⓘ | Bazzite | 9.CJ.05 | Be3Sc2(Si6O18) |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Enstatite | 9.DA.05 | Mg2Si2O6 |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Aegirine-augite | 9.DA.20 | (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 |
| ⓘ | Aegirine | 9.DA.25 | NaFe3+Si2O6 |
| ⓘ | Jervisite | 9.DA.25 | NaSc3+Si2O6 |
| ⓘ | Cummingtonite | 9.DE.05 | ◻Mg2Mg5(Si8O22)(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Ferro-hornblende | 9.DE.10 | ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 |
| ⓘ | Ferro-tschermakite | 9.DE.10 | ◻Ca2(Fe2+3Al2)(Al2Si6O22)(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Tschermakite | 9.DE.10 | ◻Ca2(Mg3Al2)(Al2Si6O22)(OH)2 |
| ⓘ | Ferro-edenite | 9.DE.15 | NaCa2Fe2+5(Si7Al)O22(OH)2 |
| ⓘ | Pargasite | 9.DE.15 | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| ⓘ | Richterite | 9.DE.20 | Na(CaNa)Mg5(Si8O22)(OH)2 |
| ⓘ | Arfvedsonite | 9.DE.25 | NaNa2(Fe2+4Fe3+)Si8O22(OH)2 |
| ⓘ | Eckermannite | 9.DE.25 | NaNa2(Mg4Al}Si8O22(OH)2 |
| ⓘ | Glaucophane | 9.DE.25 | ◻Na2(Mg3Al2)Si8O22(OH)2 |
| ⓘ | Magnesio-riebeckite | 9.DE.25 | ◻Na2(Mg3Fe3+2)(Si8O22)(OH)2 |
| ⓘ | Magnesio-arfvedsonite | 9.DE.25 | NaNa2(Mg4Fe3+)(Si8O22)(OH)2 |
| ⓘ | Riebeckite | 9.DE.25 | ◻Na2(Fe2+3Fe3+2)Si8O22(OH)2 |
| ⓘ | Magnesio-fluoro-riebeckite (TL) | 9.DE.25 | ◻Na2(Mg3Fe3+2)(Si8O22)F2 |
| ⓘ | Scandio-fluoro-eckermannite (TL) | 9.DE.25 | NaNa2(Mg4Sc)(Si8O22)F2 |
| ⓘ | Muscovite var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Tainiolite | 9.EC.15 | KLiMg2(Si4O10)F2 |
| ⓘ | Muscovite var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Fluorophlogopite | 9.EC.20 | KMg3(Si3Al)O10F2 |
| ⓘ | Yangzhumingite (TL) | 9.EC.20 | KMg2.5(Si4O10)F2 |
| ⓘ | Fluorotetraferriphlogopite (TL) | 9.EC.20 | KMg3(Fe3+Si3O10)F2 |
| ⓘ | Kinoshitalite | 9.EC.35 | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| ⓘ | Fluorokinoshitalite (TL) | 9.EC.35 | BaMg3(Al2Si2O10)F2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Nontronite | 9.EC.40 | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ | Halloysite | 9.ED.10 | Al2Si2O5(OH)4 · n(H2O) |
| ⓘ | var. Ferrian Halloysite | 9.ED.10 | Al2(Si2O5)(OH)4 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Andesine | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | var. Labradorite | 9.FA.35 | (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ | Albite var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | 'Zeolite Group' | 9.G0. | |
| ⓘ | Magbasite (TL) | 9.HA.25 | KBaFe3+Mg7Si8O22(OH)2F6 |
| Unclassified | |||
| ⓘ | 'Aeschynite' | - | |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Bastnäsite' | - | (Ce/Nd/Y/REE)(CO3)F |
| ⓘ | 'Beiyinite' | - | |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Calcium Amphibole Subgroup var. Hornblende' | - | AnCa2(Z2+5-mZ3+m)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Oborite' | - | |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Rhabdophane' | - | |
| ⓘ | 'Cerite' | - | |
| ⓘ | 'Leucoxene' | - | |
| ⓘ | 'Feldspar Group var. Perthite' | - | |
| ⓘ | 'Parisite' | - | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| ⓘ | 'Synchysite' | - | Ca(Ce/Nd/Y/REE)(CO3)2F |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Cordylite' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Fergusonite' | - | |
| ⓘ | 'Lanthanite' | - | REE3+2(CO3)3 · 8H2O |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Calcium Amphibole Subgroup' | - | AnCa2(C2+5-mC3+m)(Si8-(n+m)Al(n+m))W2 |
| ⓘ | 'Hydrogoethite' | - | 3Fe2O3 · 4H2O |
| ⓘ | 'Britholite Group' | - | (REE,Ca)5[(Si,P)O4]3X |
| ⓘ | 'Chevkinite Group' | - | |
| ⓘ | 'Cebaite' | - | |
| ⓘ | 'Nioboaeschynite' | - | |
| ⓘ | 'Unnamed (Ca-Ba Carbonate)' | - | (Ca,Sr)2Ba[CO3]3 |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ | 'Alkali amphibole' | - | |
| ⓘ | 'Iron oxide' | - | |
| ⓘ | 'UM1986-64-SiO:NbREETi' | - | ~(Nd,Ce,REE)6Ti24Nb4Si12O91 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| H | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| H | ⓘ Barytolamprophyllite | (Ba,Na)2(Na,Ti,Fe3+)4Ti2(Si2O7)2O(OH,F) |
| H | ⓘ Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Britholite-(Ce) | (Ce,Ca)5(SiO4)3OH |
| H | ⓘ Brockite | (Ca,Th,Ce)PO4 · H2O |
| H | ⓘ Cerite-(CeCa) | (Ce7Ca2)◻Mg(SiO4)3(SiO3OH)4(OH)3 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| H | ⓘ Daqingshanite-(Ce) | (Sr,Ca,Ba)3(Ce,La)(CO3)3-x(PO4)(OH,F)2x |
| H | ⓘ Desautelsite | Mg6Mn23+(OH)16[CO3] · 4H2O |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Eckermannite | NaNa2(Mg4Al}Si8O22(OH)2 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Ferro-edenite | NaCa2Fe52+(Si7Al)O22(OH)2 |
| H | ⓘ Fergusonite-(Ce) | CeNbO4 · 0.3H2O |
| H | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| H | ⓘ Ferro-tschermakite | ◻Ca2(Fe32+Al2)(Al2Si6O22)(OH)2 |
| H | ⓘ Glaucophane | ◻Na2(Mg3Al2)Si8O22(OH)2 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| H | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| H | ⓘ Lanthanite-(Ce) | Ce2(CO3)3 · 8H2O |
| H | ⓘ Lepidocrocite | Fe3+O(OH) |
| H | ⓘ Magnesio-riebeckite | ◻Na2(Mg3Fe23+)(Si8O22)(OH)2 |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Magbasite | KBaFe3+Mg7Si8O22(OH)2F6 |
| H | ⓘ Magnesio-arfvedsonite | NaNa2(Mg4Fe3+)(Si8O22)(OH)2 |
| H | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Pyrochlore Group var. Plumbopyrochlore (of Skorobogatova et al.) | (Pb,Y,U,Ca)2-xNb2O6(OH) |
| H | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| H | ⓘ Rhabdophane-(Ce) | Ce(PO4) · 0.6H2O |
| H | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| H | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Thorbastnäsite | ThCa(CO3)2F2 · 3H2O |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Tschermakite | ◻Ca2(Mg3Al2)(Al2Si6O22)(OH)2 |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Lanthanite | REE23+(CO3)3 · 8H2O |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Halloysite var. Ferrian Halloysite | Al2(Si2O5)(OH)4 |
| H | ⓘ Thorite var. Ferrithorite | (Th,Fe3+)[Si(O,OH)4] |
| H | ⓘ Hydrogoethite | 3Fe2O3 · 4H2O |
| H | ⓘ Ferrisepiolite | (Fe3+,Fe2+,Mg)4((Si,Fe3+)6O15)(O,OH)2 · 6H2O |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| H | ⓘ Fuyuanite | Mg7Nb6O18(OH)8 |
| H | ⓘ Magnesiohongruiite-(Fe3+) | (Mg2Fe3+)Fe3+NbO7(OH) |
| Li | Lithium | |
| Li | ⓘ Tainiolite | KLiMg2(Si4O10)F2 |
| Be | Beryllium | |
| Be | ⓘ Bazzite | Be3Sc2(Si6O18) |
| Be | ⓘ Chrysoberyl | BeAl2O4 |
| B | Boron | |
| B | ⓘ Boracite | Mg3(B7O13)Cl |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Alstonite | BaCa(CO3)2 |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Barytocalcite | BaCa(CO3)2 |
| C | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| C | ⓘ Bastnäsite-(Y) | Y(CO3)F |
| C | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| C | ⓘ Benstonite | Ba6Ca6Mg(CO3)13 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Carbocernaite | (Ca,Na)(Sr,Ce,Ba)(CO3)2 |
| C | ⓘ Cebaite-(Ce) | Ba3Ce2(CO3)5F2 |
| C | ⓘ Cordylite-(Ce) | NaBaCe2(CO3)4F |
| C | ⓘ Daqingshanite-(Ce) | (Sr,Ca,Ba)3(Ce,La)(CO3)3-x(PO4)(OH,F)2x |
| C | ⓘ Desautelsite | Mg6Mn23+(OH)16[CO3] · 4H2O |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Huanghoite-(Ce) | BaCe(CO3)2F |
| C | ⓘ Lanthanite-(Ce) | Ce2(CO3)3 · 8H2O |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| C | ⓘ Norsethite | BaMg(CO3)2 |
| C | ⓘ Paralstonite | BaCa(CO3)2 |
| C | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| C | ⓘ Parisite-(Nd) | Ca(Nd,Ce,La)2(CO3)3F2 |
| C | ⓘ Röntgenite-(Ce) | Ca2(Ce,La)3(CO3)5F3 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Strontianite | SrCO3 |
| C | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| C | ⓘ Thorbastnäsite | ThCa(CO3)2F2 · 3H2O |
| C | ⓘ Zhonghuacerite-(Ce) | Ba2Ce(CO3)3F |
| C | ⓘ Cebaite-(Nd) | Ba3(Nd,Ce)2(CO3)5F2 |
| C | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| C | ⓘ Strontianite var. Emmonite | (Sr,Ca)CO3 |
| C | ⓘ Calcite var. Strontium-rich Calcite | (Ca,Sr)CO3 |
| C | ⓘ Lanthanite | REE23+(CO3)3 · 8H2O |
| C | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| C | ⓘ Aragonite var. Strontium-bearing Aragonite | (Ca,Sr)CO3 |
| C | ⓘ Unnamed (Cordylite-like Calcium-Barium-Cerium Carbonate-Fluoride) | Ca◻Ba2Ce4[CO3]8F2 |
| C | ⓘ Unnamed (Ca-Ba Carbonate) | (Ca,Sr)2Ba[CO3]3 |
| C | ⓘ Bayanoboite-(Y) | Ba2Y(CO3)2F3 |
| C | ⓘ Huanghoite-(Nd) | BaNd(CO3)2F |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Aegirine | NaFe3+Si2O6 |
| O | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| O | ⓘ Aeschynite-(Ce) | Ce(TiNb)O6 |
| O | ⓘ Aeschynite-(Nd) | Nd(TiNb)O6 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Alstonite | BaCa(CO3)2 |
| O | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Barytolamprophyllite | (Ba,Na)2(Na,Ti,Fe3+)4Ti2(Si2O7)2O(OH,F) |
| O | ⓘ Barytocalcite | BaCa(CO3)2 |
| O | ⓘ Baddeleyite | ZrO2 |
| O | ⓘ Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| O | ⓘ Baotite | Ba4(Ti,Nb,W)8O16(SiO3)4Cl |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| O | ⓘ Bastnäsite-(Y) | Y(CO3)F |
| O | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| O | ⓘ Bazzite | Be3Sc2(Si6O18) |
| O | ⓘ Benstonite | Ba6Ca6Mg(CO3)13 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Boracite | Mg3(B7O13)Cl |
| O | ⓘ Britholite-(Ce) | (Ce,Ca)5(SiO4)3OH |
| O | ⓘ Brockite | (Ca,Th,Ce)PO4 · H2O |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Carbocernaite | (Ca,Na)(Sr,Ce,Ba)(CO3)2 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Cebaite-(Ce) | Ba3Ce2(CO3)5F2 |
| O | ⓘ Celestine | SrSO4 |
| O | ⓘ Cerianite-(Ce) | Ce4+O2 |
| O | ⓘ Cerite-(CeCa) | (Ce7Ca2)◻Mg(SiO4)3(SiO3OH)4(OH)3 |
| O | ⓘ Chrysoberyl | BeAl2O4 |
| O | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Cordylite-(Ce) | NaBaCe2(CO3)4F |
| O | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| O | ⓘ Daqingshanite-(Ce) | (Sr,Ca,Ba)3(Ce,La)(CO3)3-x(PO4)(OH,F)2x |
| O | ⓘ Desautelsite | Mg6Mn23+(OH)16[CO3] · 4H2O |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Eckermannite | NaNa2(Mg4Al}Si8O22(OH)2 |
| O | ⓘ Enstatite | Mg2Si2O6 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Fayalite | Fe22+(SiO4) |
| O | ⓘ Clinofergusonite-(Nd) | (Nd,Ce)NbO4 |
| O | ⓘ Ferro-edenite | NaCa2Fe52+(Si7Al)O22(OH)2 |
| O | ⓘ Fergusonite-(Ce) | CeNbO4 · 0.3H2O |
| O | ⓘ Fergusonite-(Nd) | NdNbO4 |
| O | ⓘ Fergusonite-(Y) | YNbO4 |
| O | ⓘ Clinofergusonite-(Ce) | CeNbO4 |
| O | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| O | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| O | ⓘ Ferro-tschermakite | ◻Ca2(Fe32+Al2)(Al2Si6O22)(OH)2 |
| O | ⓘ Fersmite | CaNb2O6 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Fluorbritholite-(Ce) | (Ce,Ca)5(SiO4)3F |
| O | ⓘ Forsterite | Mg2(SiO4) |
| O | ⓘ Glaucophane | ◻Na2(Mg3Al2)Si8O22(OH)2 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hercynite | Fe2+Al2O4 |
| O | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| O | ⓘ Huanghoite-(Ce) | BaCe(CO3)2F |
| O | ⓘ Humite | Mg7(SiO4)3F2 |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Rutile var. Ilmenorutile | (Ti,Nb)O2 |
| O | ⓘ Ixiolite-(Mn2+)-Ixiolite-(Fe2+) Series | |
| O | ⓘ Jacobsite | Mn2+Fe23+O4 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Jervisite | NaSc3+Si2O6 |
| O | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| O | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| O | ⓘ Lanthanite-(Ce) | Ce2(CO3)3 · 8H2O |
| O | ⓘ Lepidocrocite | Fe3+O(OH) |
| O | ⓘ Loparite | (Na,REE)2Ti2O6 |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Magnesiochromite | MgCr2O4 |
| O | ⓘ Magnesioferrite | MgFe23+O4 |
| O | ⓘ Magnesio-riebeckite | ◻Na2(Mg3Fe23+)(Si8O22)(OH)2 |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| O | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| O | ⓘ Magbasite | KBaFe3+Mg7Si8O22(OH)2F6 |
| O | ⓘ Maghemite | (Fe3+0.67◻0.33)Fe23+O4 |
| O | ⓘ Magnesio-arfvedsonite | NaNa2(Mg4Fe3+)(Si8O22)(OH)2 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Hematite var. Martite | Fe2O3 |
| O | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Molybdite | MoO3 |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Monazite-(La) | La(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| O | ⓘ Norbergite | Mg3(SiO4)F2 |
| O | ⓘ Norsethite | BaMg(CO3)2 |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Paralstonite | BaCa(CO3)2 |
| O | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| O | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| O | ⓘ Parisite-(Nd) | Ca(Nd,Ce,La)2(CO3)3F2 |
| O | ⓘ Perovskite | CaTiO3 |
| O | ⓘ Perrierite-(Ce) | Ce4MgFe23+Ti2(Si2O7)2O8 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Pyrochlore Group var. Plumbopyrochlore (of Skorobogatova et al.) | (Pb,Y,U,Ca)2-xNb2O6(OH) |
| O | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rhabdophane-(Ce) | Ce(PO4) · 0.6H2O |
| O | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| O | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| O | ⓘ Röntgenite-(Ce) | Ca2(Ce,La)3(CO3)5F3 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Strontianite | SrCO3 |
| O | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| O | ⓘ Thorbastnäsite | ThCa(CO3)2F2 · 3H2O |
| O | ⓘ Thorianite | ThO2 |
| O | ⓘ Thorite | Th(SiO4) |
| O | ⓘ Thortveitite | Sc2Si2O7 |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Tschermakite | ◻Ca2(Mg3Al2)(Al2Si6O22)(OH)2 |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zhonghuacerite-(Ce) | Ba2Ce(CO3)3F |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Hematite var. Specularite | Fe2O3 |
| O | ⓘ Cebaite-(Nd) | Ba3(Nd,Ce)2(CO3)5F2 |
| O | ⓘ Chevkinite-(Ce) | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| O | ⓘ Tainiolite | KLiMg2(Si4O10)F2 |
| O | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| O | ⓘ Thorite var. Uranothorite | (Th,U)SiO4 |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Strontianite var. Emmonite | (Sr,Ca)CO3 |
| O | ⓘ Calcite var. Strontium-rich Calcite | (Ca,Sr)CO3 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Hercynite var. Picotite | (Fe,Mg)(Al,Cr)2O4 |
| O | ⓘ Magnetite var. Mushketovite | Fe2+Fe23+O4 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Anatase var. Niobium-bearing Anatase | (Ti,Nb)O2 |
| O | ⓘ Rutile var. Niobium-bearing Rutile | (Ti,Nb)O2 |
| O | ⓘ Lanthanite | REE23+(CO3)3 · 8H2O |
| O | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Aragonite var. Strontium-bearing Aragonite | (Ca,Sr)CO3 |
| O | ⓘ Halloysite var. Ferrian Halloysite | Al2(Si2O5)(OH)4 |
| O | ⓘ Dingdaohengite-(Ce) | (Ce,La)4Fe2+(Ti,Fe2+,Mg,Fe3+)2Ti2(Si2O7)2O8 |
| O | ⓘ Fluorophlogopite | KMg3(Si3Al)O10F2 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Thorite var. Ferrithorite | (Th,Fe3+)[Si(O,OH)4] |
| O | ⓘ Hydrogoethite | 3Fe2O3 · 4H2O |
| O | ⓘ Britholite Group | (REE,Ca)5[(Si,P)O4]3X |
| O | ⓘ Fluorokinoshitalite | BaMg3(Al2Si2O10)F2 |
| O | ⓘ Yangzhumingite | KMg2.5(Si4O10)F2 |
| O | ⓘ Fluorotetraferriphlogopite | KMg3(Fe3+Si3O10)F2 |
| O | ⓘ Fluorcalciopyrochlore | (Ca,Na)2(Nb,Ti)2O6F |
| O | ⓘ Oxyplumbopyrochlore | Pb2Nb2O6O |
| O | ⓘ Ferrisepiolite | (Fe3+,Fe2+,Mg)4((Si,Fe3+)6O15)(O,OH)2 · 6H2O |
| O | ⓘ Aeschynite Group | AD2O6 |
| O | ⓘ Unnamed (Cordylite-like Calcium-Barium-Cerium Carbonate-Fluoride) | Ca◻Ba2Ce4[CO3]8F2 |
| O | ⓘ Magnesio-fluoro-riebeckite | ◻Na2(Mg3Fe23+)(Si8O22)F2 |
| O | ⓘ Unnamed (Ca-Ba Carbonate) | (Ca,Sr)2Ba[CO3]3 |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| O | ⓘ UM1986-64-SiO:NbREETi | ~(Nd,Ce,REE)6Ti24Nb4Si12O91 |
| O | ⓘ Nioboixiolite-([]) | (Nb0.8◻0.2)4+O2 |
| O | ⓘ Niobobaotite | Ba4(Ti2.5Fe2+1.5)Nb4Si4O28Cl |
| O | ⓘ Bayanoboite-(Y) | Ba2Y(CO3)2F3 |
| O | ⓘ Oboniobite | Mg4Nb2O9 |
| O | ⓘ Scandio-fluoro-eckermannite | NaNa2(Mg4Sc)(Si8O22)F2 |
| O | ⓘ Fuyuanite | Mg7Nb6O18(OH)8 |
| O | ⓘ Xianhuaite-(Ce) | K2CeNb5O15 |
| O | ⓘ Huanghoite-(Nd) | BaNd(CO3)2F |
| O | ⓘ Magnesiohongruiite-(Fe3+) | (Mg2Fe3+)Fe3+NbO7(OH) |
| O | ⓘ Zuolinite | Ba2Sr(Nb4.5Fe3+0.5)O15 |
| O | ⓘ Xianhuaite-(La) | K2LaNb5O15 |
| O | ⓘ Yulinite | SrNb2O6 |
| F | Fluorine | |
| F | ⓘ Barytolamprophyllite | (Ba,Na)2(Na,Ti,Fe3+)4Ti2(Si2O7)2O(OH,F) |
| F | ⓘ Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| F | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| F | ⓘ Bastnäsite-(Y) | Y(CO3)F |
| F | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Cebaite-(Ce) | Ba3Ce2(CO3)5F2 |
| F | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| F | ⓘ Cordylite-(Ce) | NaBaCe2(CO3)4F |
| F | ⓘ Daqingshanite-(Ce) | (Sr,Ca,Ba)3(Ce,La)(CO3)3-x(PO4)(OH,F)2x |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorbritholite-(Ce) | (Ce,Ca)5(SiO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| F | ⓘ Huanghoite-(Ce) | BaCe(CO3)2F |
| F | ⓘ Humite | Mg7(SiO4)3F2 |
| F | ⓘ Magbasite | KBaFe3+Mg7Si8O22(OH)2F6 |
| F | ⓘ Norbergite | Mg3(SiO4)F2 |
| F | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| F | ⓘ Parisite-(Nd) | Ca(Nd,Ce,La)2(CO3)3F2 |
| F | ⓘ Röntgenite-(Ce) | Ca2(Ce,La)3(CO3)5F3 |
| F | ⓘ Sellaite | MgF2 |
| F | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| F | ⓘ Thorbastnäsite | ThCa(CO3)2F2 · 3H2O |
| F | ⓘ Zhonghuacerite-(Ce) | Ba2Ce(CO3)3F |
| F | ⓘ Cebaite-(Nd) | Ba3(Nd,Ce)2(CO3)5F2 |
| F | ⓘ Tainiolite | KLiMg2(Si4O10)F2 |
| F | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| F | ⓘ Fluorophlogopite | KMg3(Si3Al)O10F2 |
| F | ⓘ Zhangpeishanite | BaFCl |
| F | ⓘ Fluorokinoshitalite | BaMg3(Al2Si2O10)F2 |
| F | ⓘ Yangzhumingite | KMg2.5(Si4O10)F2 |
| F | ⓘ Fluorotetraferriphlogopite | KMg3(Fe3+Si3O10)F2 |
| F | ⓘ Fluorcalciopyrochlore | (Ca,Na)2(Nb,Ti)2O6F |
| F | ⓘ Unnamed (Cordylite-like Calcium-Barium-Cerium Carbonate-Fluoride) | Ca◻Ba2Ce4[CO3]8F2 |
| F | ⓘ Magnesio-fluoro-riebeckite | ◻Na2(Mg3Fe23+)(Si8O22)F2 |
| F | ⓘ Bayanoboite-(Y) | Ba2Y(CO3)2F3 |
| F | ⓘ Scandio-fluoro-eckermannite | NaNa2(Mg4Sc)(Si8O22)F2 |
| F | ⓘ Huanghoite-(Nd) | BaNd(CO3)2F |
| Na | Sodium | |
| Na | ⓘ Aegirine | NaFe3+Si2O6 |
| Na | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| Na | ⓘ Barytolamprophyllite | (Ba,Na)2(Na,Ti,Fe3+)4Ti2(Si2O7)2O(OH,F) |
| Na | ⓘ Carbocernaite | (Ca,Na)(Sr,Ce,Ba)(CO3)2 |
| Na | ⓘ Cordylite-(Ce) | NaBaCe2(CO3)4F |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Eckermannite | NaNa2(Mg4Al}Si8O22(OH)2 |
| Na | ⓘ Ferro-edenite | NaCa2Fe52+(Si7Al)O22(OH)2 |
| Na | ⓘ Glaucophane | ◻Na2(Mg3Al2)Si8O22(OH)2 |
| Na | ⓘ Halite | NaCl |
| Na | ⓘ Jervisite | NaSc3+Si2O6 |
| Na | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Na | ⓘ Loparite | (Na,REE)2Ti2O6 |
| Na | ⓘ Magnesio-riebeckite | ◻Na2(Mg3Fe23+)(Si8O22)(OH)2 |
| Na | ⓘ Magnesio-arfvedsonite | NaNa2(Mg4Fe3+)(Si8O22)(OH)2 |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Na | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| Na | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | ⓘ Fluorcalciopyrochlore | (Ca,Na)2(Nb,Ti)2O6F |
| Na | ⓘ Magnesio-fluoro-riebeckite | ◻Na2(Mg3Fe23+)(Si8O22)F2 |
| Na | ⓘ Scandio-fluoro-eckermannite | NaNa2(Mg4Sc)(Si8O22)F2 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Benstonite | Ba6Ca6Mg(CO3)13 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Boracite | Mg3(B7O13)Cl |
| Mg | ⓘ Cerite-(CeCa) | (Ce7Ca2)◻Mg(SiO4)3(SiO3OH)4(OH)3 |
| Mg | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| Mg | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Desautelsite | Mg6Mn23+(OH)16[CO3] · 4H2O |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Eckermannite | NaNa2(Mg4Al}Si8O22(OH)2 |
| Mg | ⓘ Enstatite | Mg2Si2O6 |
| Mg | ⓘ Forsterite | Mg2(SiO4) |
| Mg | ⓘ Glaucophane | ◻Na2(Mg3Al2)Si8O22(OH)2 |
| Mg | ⓘ Humite | Mg7(SiO4)3F2 |
| Mg | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Magnesiochromite | MgCr2O4 |
| Mg | ⓘ Magnesioferrite | MgFe23+O4 |
| Mg | ⓘ Magnesio-riebeckite | ◻Na2(Mg3Fe23+)(Si8O22)(OH)2 |
| Mg | ⓘ Magbasite | KBaFe3+Mg7Si8O22(OH)2F6 |
| Mg | ⓘ Magnesio-arfvedsonite | NaNa2(Mg4Fe3+)(Si8O22)(OH)2 |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Norbergite | Mg3(SiO4)F2 |
| Mg | ⓘ Norsethite | BaMg(CO3)2 |
| Mg | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Mg | ⓘ Perrierite-(Ce) | Ce4MgFe23+Ti2(Si2O7)2O8 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Sellaite | MgF2 |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Tschermakite | ◻Ca2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Mg | ⓘ Tainiolite | KLiMg2(Si4O10)F2 |
| Mg | ⓘ Hercynite var. Picotite | (Fe,Mg)(Al,Cr)2O4 |
| Mg | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Mg | ⓘ Dingdaohengite-(Ce) | (Ce,La)4Fe2+(Ti,Fe2+,Mg,Fe3+)2Ti2(Si2O7)2O8 |
| Mg | ⓘ Fluorophlogopite | KMg3(Si3Al)O10F2 |
| Mg | ⓘ Fluorokinoshitalite | BaMg3(Al2Si2O10)F2 |
| Mg | ⓘ Yangzhumingite | KMg2.5(Si4O10)F2 |
| Mg | ⓘ Fluorotetraferriphlogopite | KMg3(Fe3+Si3O10)F2 |
| Mg | ⓘ Ferrisepiolite | (Fe3+,Fe2+,Mg)4((Si,Fe3+)6O15)(O,OH)2 · 6H2O |
| Mg | ⓘ Magnesio-fluoro-riebeckite | ◻Na2(Mg3Fe23+)(Si8O22)F2 |
| Mg | ⓘ Oboniobite | Mg4Nb2O9 |
| Mg | ⓘ Scandio-fluoro-eckermannite | NaNa2(Mg4Sc)(Si8O22)F2 |
| Mg | ⓘ Fuyuanite | Mg7Nb6O18(OH)8 |
| Mg | ⓘ Magnesiohongruiite-(Fe3+) | (Mg2Fe3+)Fe3+NbO7(OH) |
| Al | Aluminium | |
| Al | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Chrysoberyl | BeAl2O4 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Eckermannite | NaNa2(Mg4Al}Si8O22(OH)2 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Ferro-edenite | NaCa2Fe52+(Si7Al)O22(OH)2 |
| Al | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Al | ⓘ Ferro-tschermakite | ◻Ca2(Fe32+Al2)(Al2Si6O22)(OH)2 |
| Al | ⓘ Glaucophane | ◻Na2(Mg3Al2)Si8O22(OH)2 |
| Al | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| Al | ⓘ Hercynite | Fe2+Al2O4 |
| Al | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Al | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Tschermakite | ◻Ca2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Hercynite var. Picotite | (Fe,Mg)(Al,Cr)2O4 |
| Al | ⓘ Halloysite var. Ferrian Halloysite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Fluorophlogopite | KMg3(Si3Al)O10F2 |
| Al | ⓘ Calcium Amphibole Subgroup | AnCa2(C2+5-mCm3+)(Si8-(n+m)Al(n+m))W2 |
| Al | ⓘ Fluorokinoshitalite | BaMg3(Al2Si2O10)F2 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Aegirine | NaFe3+Si2O6 |
| Si | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Barytolamprophyllite | (Ba,Na)2(Na,Ti,Fe3+)4Ti2(Si2O7)2O(OH,F) |
| Si | ⓘ Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| Si | ⓘ Baotite | Ba4(Ti,Nb,W)8O16(SiO3)4Cl |
| Si | ⓘ Bazzite | Be3Sc2(Si6O18) |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Britholite-(Ce) | (Ce,Ca)5(SiO4)3OH |
| Si | ⓘ Cerite-(CeCa) | (Ce7Ca2)◻Mg(SiO4)3(SiO3OH)4(OH)3 |
| Si | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Eckermannite | NaNa2(Mg4Al}Si8O22(OH)2 |
| Si | ⓘ Enstatite | Mg2Si2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Fayalite | Fe22+(SiO4) |
| Si | ⓘ Ferro-edenite | NaCa2Fe52+(Si7Al)O22(OH)2 |
| Si | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Si | ⓘ Ferro-tschermakite | ◻Ca2(Fe32+Al2)(Al2Si6O22)(OH)2 |
| Si | ⓘ Fluorbritholite-(Ce) | (Ce,Ca)5(SiO4)3F |
| Si | ⓘ Forsterite | Mg2(SiO4) |
| Si | ⓘ Glaucophane | ◻Na2(Mg3Al2)Si8O22(OH)2 |
| Si | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| Si | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Si | ⓘ Humite | Mg7(SiO4)3F2 |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Jervisite | NaSc3+Si2O6 |
| Si | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Si | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Si | ⓘ Magnesio-riebeckite | ◻Na2(Mg3Fe23+)(Si8O22)(OH)2 |
| Si | ⓘ Magbasite | KBaFe3+Mg7Si8O22(OH)2F6 |
| Si | ⓘ Magnesio-arfvedsonite | NaNa2(Mg4Fe3+)(Si8O22)(OH)2 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Si | ⓘ Norbergite | Mg3(SiO4)F2 |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Si | ⓘ Perrierite-(Ce) | Ce4MgFe23+Ti2(Si2O7)2O8 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| Si | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Thorite | Th(SiO4) |
| Si | ⓘ Thortveitite | Sc2Si2O7 |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Tschermakite | ◻Ca2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Chevkinite-(Ce) | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| Si | ⓘ Tainiolite | KLiMg2(Si4O10)F2 |
| Si | ⓘ Thorite var. Uranothorite | (Th,U)SiO4 |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Halloysite var. Ferrian Halloysite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Dingdaohengite-(Ce) | (Ce,La)4Fe2+(Ti,Fe2+,Mg,Fe3+)2Ti2(Si2O7)2O8 |
| Si | ⓘ Fluorophlogopite | KMg3(Si3Al)O10F2 |
| Si | ⓘ Calcium Amphibole Subgroup | AnCa2(C2+5-mCm3+)(Si8-(n+m)Al(n+m))W2 |
| Si | ⓘ Thorite var. Ferrithorite | (Th,Fe3+)[Si(O,OH)4] |
| Si | ⓘ Britholite Group | (REE,Ca)5[(Si,P)O4]3X |
| Si | ⓘ Fluorokinoshitalite | BaMg3(Al2Si2O10)F2 |
| Si | ⓘ Yangzhumingite | KMg2.5(Si4O10)F2 |
| Si | ⓘ Fluorotetraferriphlogopite | KMg3(Fe3+Si3O10)F2 |
| Si | ⓘ Ferrisepiolite | (Fe3+,Fe2+,Mg)4((Si,Fe3+)6O15)(O,OH)2 · 6H2O |
| Si | ⓘ Magnesio-fluoro-riebeckite | ◻Na2(Mg3Fe23+)(Si8O22)F2 |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Si | ⓘ UM1986-64-SiO:NbREETi | ~(Nd,Ce,REE)6Ti24Nb4Si12O91 |
| Si | ⓘ Niobobaotite | Ba4(Ti2.5Fe2+1.5)Nb4Si4O28Cl |
| Si | ⓘ Scandio-fluoro-eckermannite | NaNa2(Mg4Sc)(Si8O22)F2 |
| P | Phosphorus | |
| P | ⓘ Brockite | (Ca,Th,Ce)PO4 · H2O |
| P | ⓘ Daqingshanite-(Ce) | (Sr,Ca,Ba)3(Ce,La)(CO3)3-x(PO4)(OH,F)2x |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Monazite-(La) | La(PO4) |
| P | ⓘ Rhabdophane-(Ce) | Ce(PO4) · 0.6H2O |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3A |
| P | ⓘ Britholite Group | (REE,Ca)5[(Si,P)O4]3X |
| S | Sulfur | |
| S | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Celestine | SrSO4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| Cl | Chlorine | |
| Cl | ⓘ Baotite | Ba4(Ti,Nb,W)8O16(SiO3)4Cl |
| Cl | ⓘ Boracite | Mg3(B7O13)Cl |
| Cl | ⓘ Halite | NaCl |
| Cl | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Cl | ⓘ Sylvite | KCl |
| Cl | ⓘ Zhangpeishanite | BaFCl |
| Cl | ⓘ Niobobaotite | Ba4(Ti2.5Fe2+1.5)Nb4Si4O28Cl |
| K | Potassium | |
| K | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| K | ⓘ Magbasite | KBaFe3+Mg7Si8O22(OH)2F6 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Sylvite | KCl |
| K | ⓘ Tainiolite | KLiMg2(Si4O10)F2 |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Fluorophlogopite | KMg3(Si3Al)O10F2 |
| K | ⓘ Yangzhumingite | KMg2.5(Si4O10)F2 |
| K | ⓘ Fluorotetraferriphlogopite | KMg3(Fe3+Si3O10)F2 |
| K | ⓘ Xianhuaite-(Ce) | K2CeNb5O15 |
| K | ⓘ Xianhuaite-(La) | K2LaNb5O15 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Alstonite | BaCa(CO3)2 |
| Ca | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Barytocalcite | BaCa(CO3)2 |
| Ca | ⓘ Benstonite | Ba6Ca6Mg(CO3)13 |
| Ca | ⓘ Britholite-(Ce) | (Ce,Ca)5(SiO4)3OH |
| Ca | ⓘ Brockite | (Ca,Th,Ce)PO4 · H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Carbocernaite | (Ca,Na)(Sr,Ce,Ba)(CO3)2 |
| Ca | ⓘ Cerite-(CeCa) | (Ce7Ca2)◻Mg(SiO4)3(SiO3OH)4(OH)3 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Daqingshanite-(Ce) | (Sr,Ca,Ba)3(Ce,La)(CO3)3-x(PO4)(OH,F)2x |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Ferro-edenite | NaCa2Fe52+(Si7Al)O22(OH)2 |
| Ca | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Ca | ⓘ Ferro-tschermakite | ◻Ca2(Fe32+Al2)(Al2Si6O22)(OH)2 |
| Ca | ⓘ Fersmite | CaNb2O6 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorbritholite-(Ce) | (Ce,Ca)5(SiO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Ca | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Ca | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Paralstonite | BaCa(CO3)2 |
| Ca | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| Ca | ⓘ Parisite-(Nd) | Ca(Nd,Ce,La)2(CO3)3F2 |
| Ca | ⓘ Perovskite | CaTiO3 |
| Ca | ⓘ Pyrochlore Group var. Plumbopyrochlore (of Skorobogatova et al.) | (Pb,Y,U,Ca)2-xNb2O6(OH) |
| Ca | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Röntgenite-(Ce) | Ca2(Ce,La)3(CO3)5F3 |
| Ca | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ca | ⓘ Thorbastnäsite | ThCa(CO3)2F2 · 3H2O |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Tschermakite | ◻Ca2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ca | ⓘ Strontianite var. Emmonite | (Sr,Ca)CO3 |
| Ca | ⓘ Calcite var. Strontium-rich Calcite | (Ca,Sr)CO3 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Ca | ⓘ Aragonite var. Strontium-bearing Aragonite | (Ca,Sr)CO3 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ca | ⓘ Calcium Amphibole Subgroup | AnCa2(C2+5-mCm3+)(Si8-(n+m)Al(n+m))W2 |
| Ca | ⓘ Britholite Group | (REE,Ca)5[(Si,P)O4]3X |
| Ca | ⓘ Fluorcalciopyrochlore | (Ca,Na)2(Nb,Ti)2O6F |
| Ca | ⓘ Unnamed (Cordylite-like Calcium-Barium-Cerium Carbonate-Fluoride) | Ca◻Ba2Ce4[CO3]8F2 |
| Ca | ⓘ Unnamed (Ca-Ba Carbonate) | (Ca,Sr)2Ba[CO3]3 |
| Sc | Scandium | |
| Sc | ⓘ Bazzite | Be3Sc2(Si6O18) |
| Sc | ⓘ Jervisite | NaSc3+Si2O6 |
| Sc | ⓘ Thortveitite | Sc2Si2O7 |
| Sc | ⓘ Scandio-fluoro-eckermannite | NaNa2(Mg4Sc)(Si8O22)F2 |
| Ti | Titanium | |
| Ti | ⓘ Aeschynite-(Ce) | Ce(TiNb)O6 |
| Ti | ⓘ Aeschynite-(Nd) | Nd(TiNb)O6 |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Barytolamprophyllite | (Ba,Na)2(Na,Ti,Fe3+)4Ti2(Si2O7)2O(OH,F) |
| Ti | ⓘ Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| Ti | ⓘ Baotite | Ba4(Ti,Nb,W)8O16(SiO3)4Cl |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile var. Ilmenorutile | (Ti,Nb)O2 |
| Ti | ⓘ Loparite | (Na,REE)2Ti2O6 |
| Ti | ⓘ Perovskite | CaTiO3 |
| Ti | ⓘ Perrierite-(Ce) | Ce4MgFe23+Ti2(Si2O7)2O8 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Ti | ⓘ Chevkinite-(Ce) | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| Ti | ⓘ Anatase var. Niobium-bearing Anatase | (Ti,Nb)O2 |
| Ti | ⓘ Rutile var. Niobium-bearing Rutile | (Ti,Nb)O2 |
| Ti | ⓘ Dingdaohengite-(Ce) | (Ce,La)4Fe2+(Ti,Fe2+,Mg,Fe3+)2Ti2(Si2O7)2O8 |
| Ti | ⓘ Fluorcalciopyrochlore | (Ca,Na)2(Nb,Ti)2O6F |
| Ti | ⓘ UM1986-64-SiO:NbREETi | ~(Nd,Ce,REE)6Ti24Nb4Si12O91 |
| Ti | ⓘ Niobobaotite | Ba4(Ti2.5Fe2+1.5)Nb4Si4O28Cl |
| Cr | Chromium | |
| Cr | ⓘ Magnesiochromite | MgCr2O4 |
| Cr | ⓘ Hercynite var. Picotite | (Fe,Mg)(Al,Cr)2O4 |
| Mn | Manganese | |
| Mn | ⓘ Desautelsite | Mg6Mn23+(OH)16[CO3] · 4H2O |
| Mn | ⓘ Ixiolite-(Mn2+)-Ixiolite-(Fe2+) Series | |
| Mn | ⓘ Jacobsite | Mn2+Fe23+O4 |
| Mn | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Mn | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Aegirine | NaFe3+Si2O6 |
| Fe | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Barytolamprophyllite | (Ba,Na)2(Na,Ti,Fe3+)4Ti2(Si2O7)2O(OH,F) |
| Fe | ⓘ Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Fayalite | Fe22+(SiO4) |
| Fe | ⓘ Ferro-edenite | NaCa2Fe52+(Si7Al)O22(OH)2 |
| Fe | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Fe | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Fe | ⓘ Ferro-tschermakite | ◻Ca2(Fe32+Al2)(Al2Si6O22)(OH)2 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hercynite | Fe2+Al2O4 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Ixiolite-(Mn2+)-Ixiolite-(Fe2+) Series | |
| Fe | ⓘ Jacobsite | Mn2+Fe23+O4 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Lepidocrocite | Fe3+O(OH) |
| Fe | ⓘ Magnesioferrite | MgFe23+O4 |
| Fe | ⓘ Magnesio-riebeckite | ◻Na2(Mg3Fe23+)(Si8O22)(OH)2 |
| Fe | ⓘ Magbasite | KBaFe3+Mg7Si8O22(OH)2F6 |
| Fe | ⓘ Maghemite | (Fe3+0.67◻0.33)Fe23+O4 |
| Fe | ⓘ Magnesio-arfvedsonite | NaNa2(Mg4Fe3+)(Si8O22)(OH)2 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Hematite var. Martite | Fe2O3 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| Fe | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Fe | ⓘ Perrierite-(Ce) | Ce4MgFe23+Ti2(Si2O7)2O8 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| Fe | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Hematite var. Specularite | Fe2O3 |
| Fe | ⓘ Chevkinite-(Ce) | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | ⓘ Hercynite var. Picotite | (Fe,Mg)(Al,Cr)2O4 |
| Fe | ⓘ Magnetite var. Mushketovite | Fe2+Fe23+O4 |
| Fe | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Fe | ⓘ Dingdaohengite-(Ce) | (Ce,La)4Fe2+(Ti,Fe2+,Mg,Fe3+)2Ti2(Si2O7)2O8 |
| Fe | ⓘ Thorite var. Ferrithorite | (Th,Fe3+)[Si(O,OH)4] |
| Fe | ⓘ Hydrogoethite | 3Fe2O3 · 4H2O |
| Fe | ⓘ Fluorotetraferriphlogopite | KMg3(Fe3+Si3O10)F2 |
| Fe | ⓘ Ferrisepiolite | (Fe3+,Fe2+,Mg)4((Si,Fe3+)6O15)(O,OH)2 · 6H2O |
| Fe | ⓘ Magnesio-fluoro-riebeckite | ◻Na2(Mg3Fe23+)(Si8O22)F2 |
| Fe | ⓘ Niobobaotite | Ba4(Ti2.5Fe2+1.5)Nb4Si4O28Cl |
| Fe | ⓘ Magnesiohongruiite-(Fe3+) | (Mg2Fe3+)Fe3+NbO7(OH) |
| Fe | ⓘ Zuolinite | Ba2Sr(Nb4.5Fe3+0.5)O15 |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Cobaltite | CoAsS |
| Sr | Strontium | |
| Sr | ⓘ Carbocernaite | (Ca,Na)(Sr,Ce,Ba)(CO3)2 |
| Sr | ⓘ Celestine | SrSO4 |
| Sr | ⓘ Daqingshanite-(Ce) | (Sr,Ca,Ba)3(Ce,La)(CO3)3-x(PO4)(OH,F)2x |
| Sr | ⓘ Strontianite | SrCO3 |
| Sr | ⓘ Strontianite var. Emmonite | (Sr,Ca)CO3 |
| Sr | ⓘ Calcite var. Strontium-rich Calcite | (Ca,Sr)CO3 |
| Sr | ⓘ Aragonite var. Strontium-bearing Aragonite | (Ca,Sr)CO3 |
| Sr | ⓘ Unnamed (Ca-Ba Carbonate) | (Ca,Sr)2Ba[CO3]3 |
| Sr | ⓘ Zuolinite | Ba2Sr(Nb4.5Fe3+0.5)O15 |
| Sr | ⓘ Yulinite | SrNb2O6 |
| Y | Yttrium | |
| Y | ⓘ Bastnäsite-(Y) | Y(CO3)F |
| Y | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Y | ⓘ Fergusonite-(Y) | YNbO4 |
| Y | ⓘ Pyrochlore Group var. Plumbopyrochlore (of Skorobogatova et al.) | (Pb,Y,U,Ca)2-xNb2O6(OH) |
| Y | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Y | ⓘ Bayanoboite-(Y) | Ba2Y(CO3)2F3 |
| Zr | Zirconium | |
| Zr | ⓘ Baddeleyite | ZrO2 |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Aeschynite-(Ce) | Ce(TiNb)O6 |
| Nb | ⓘ Aeschynite-(Nd) | Nd(TiNb)O6 |
| Nb | ⓘ Baotite | Ba4(Ti,Nb,W)8O16(SiO3)4Cl |
| Nb | ⓘ Clinofergusonite-(Nd) | (Nd,Ce)NbO4 |
| Nb | ⓘ Fergusonite-(Ce) | CeNbO4 · 0.3H2O |
| Nb | ⓘ Fergusonite-(Nd) | NdNbO4 |
| Nb | ⓘ Fergusonite-(Y) | YNbO4 |
| Nb | ⓘ Clinofergusonite-(Ce) | CeNbO4 |
| Nb | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Nb | ⓘ Fersmite | CaNb2O6 |
| Nb | ⓘ Rutile var. Ilmenorutile | (Ti,Nb)O2 |
| Nb | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Nb | ⓘ Pyrochlore Group var. Plumbopyrochlore (of Skorobogatova et al.) | (Pb,Y,U,Ca)2-xNb2O6(OH) |
| Nb | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| Nb | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Nb | ⓘ Anatase var. Niobium-bearing Anatase | (Ti,Nb)O2 |
| Nb | ⓘ Rutile var. Niobium-bearing Rutile | (Ti,Nb)O2 |
| Nb | ⓘ Fluorcalciopyrochlore | (Ca,Na)2(Nb,Ti)2O6F |
| Nb | ⓘ Oxyplumbopyrochlore | Pb2Nb2O6O |
| Nb | ⓘ UM1986-64-SiO:NbREETi | ~(Nd,Ce,REE)6Ti24Nb4Si12O91 |
| Nb | ⓘ Nioboixiolite-([]) | (Nb0.8◻0.2)4+O2 |
| Nb | ⓘ Niobobaotite | Ba4(Ti2.5Fe2+1.5)Nb4Si4O28Cl |
| Nb | ⓘ Oboniobite | Mg4Nb2O9 |
| Nb | ⓘ Fuyuanite | Mg7Nb6O18(OH)8 |
| Nb | ⓘ Xianhuaite-(Ce) | K2CeNb5O15 |
| Nb | ⓘ Magnesiohongruiite-(Fe3+) | (Mg2Fe3+)Fe3+NbO7(OH) |
| Nb | ⓘ Zuolinite | Ba2Sr(Nb4.5Fe3+0.5)O15 |
| Nb | ⓘ Xianhuaite-(La) | K2LaNb5O15 |
| Nb | ⓘ Yulinite | SrNb2O6 |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Molybdite | MoO3 |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Ba | Barium | |
| Ba | ⓘ Alstonite | BaCa(CO3)2 |
| Ba | ⓘ Barytolamprophyllite | (Ba,Na)2(Na,Ti,Fe3+)4Ti2(Si2O7)2O(OH,F) |
| Ba | ⓘ Barytocalcite | BaCa(CO3)2 |
| Ba | ⓘ Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| Ba | ⓘ Baotite | Ba4(Ti,Nb,W)8O16(SiO3)4Cl |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Benstonite | Ba6Ca6Mg(CO3)13 |
| Ba | ⓘ Carbocernaite | (Ca,Na)(Sr,Ce,Ba)(CO3)2 |
| Ba | ⓘ Cebaite-(Ce) | Ba3Ce2(CO3)5F2 |
| Ba | ⓘ Cordylite-(Ce) | NaBaCe2(CO3)4F |
| Ba | ⓘ Daqingshanite-(Ce) | (Sr,Ca,Ba)3(Ce,La)(CO3)3-x(PO4)(OH,F)2x |
| Ba | ⓘ Huanghoite-(Ce) | BaCe(CO3)2F |
| Ba | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Ba | ⓘ Magbasite | KBaFe3+Mg7Si8O22(OH)2F6 |
| Ba | ⓘ Norsethite | BaMg(CO3)2 |
| Ba | ⓘ Paralstonite | BaCa(CO3)2 |
| Ba | ⓘ Zhonghuacerite-(Ce) | Ba2Ce(CO3)3F |
| Ba | ⓘ Cebaite-(Nd) | Ba3(Nd,Ce)2(CO3)5F2 |
| Ba | ⓘ Zhangpeishanite | BaFCl |
| Ba | ⓘ Fluorokinoshitalite | BaMg3(Al2Si2O10)F2 |
| Ba | ⓘ Unnamed (Cordylite-like Calcium-Barium-Cerium Carbonate-Fluoride) | Ca◻Ba2Ce4[CO3]8F2 |
| Ba | ⓘ Unnamed (Ca-Ba Carbonate) | (Ca,Sr)2Ba[CO3]3 |
| Ba | ⓘ Niobobaotite | Ba4(Ti2.5Fe2+1.5)Nb4Si4O28Cl |
| Ba | ⓘ Bayanoboite-(Y) | Ba2Y(CO3)2F3 |
| Ba | ⓘ Huanghoite-(Nd) | BaNd(CO3)2F |
| Ba | ⓘ Zuolinite | Ba2Sr(Nb4.5Fe3+0.5)O15 |
| La | Lanthanum | |
| La | ⓘ Daqingshanite-(Ce) | (Sr,Ca,Ba)3(Ce,La)(CO3)3-x(PO4)(OH,F)2x |
| La | ⓘ Monazite-(La) | La(PO4) |
| La | ⓘ Parisite-(Nd) | Ca(Nd,Ce,La)2(CO3)3F2 |
| La | ⓘ Röntgenite-(Ce) | Ca2(Ce,La)3(CO3)5F3 |
| La | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| La | ⓘ Dingdaohengite-(Ce) | (Ce,La)4Fe2+(Ti,Fe2+,Mg,Fe3+)2Ti2(Si2O7)2O8 |
| La | ⓘ Xianhuaite-(La) | K2LaNb5O15 |
| Ce | Cerium | |
| Ce | ⓘ Aeschynite-(Ce) | Ce(TiNb)O6 |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ce | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| Ce | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Ce | ⓘ Britholite-(Ce) | (Ce,Ca)5(SiO4)3OH |
| Ce | ⓘ Brockite | (Ca,Th,Ce)PO4 · H2O |
| Ce | ⓘ Carbocernaite | (Ca,Na)(Sr,Ce,Ba)(CO3)2 |
| Ce | ⓘ Cebaite-(Ce) | Ba3Ce2(CO3)5F2 |
| Ce | ⓘ Cerianite-(Ce) | Ce4+O2 |
| Ce | ⓘ Cerite-(CeCa) | (Ce7Ca2)◻Mg(SiO4)3(SiO3OH)4(OH)3 |
| Ce | ⓘ Cordylite-(Ce) | NaBaCe2(CO3)4F |
| Ce | ⓘ Daqingshanite-(Ce) | (Sr,Ca,Ba)3(Ce,La)(CO3)3-x(PO4)(OH,F)2x |
| Ce | ⓘ Clinofergusonite-(Nd) | (Nd,Ce)NbO4 |
| Ce | ⓘ Fergusonite-(Ce) | CeNbO4 · 0.3H2O |
| Ce | ⓘ Clinofergusonite-(Ce) | CeNbO4 |
| Ce | ⓘ Fluorbritholite-(Ce) | (Ce,Ca)5(SiO4)3F |
| Ce | ⓘ Huanghoite-(Ce) | BaCe(CO3)2F |
| Ce | ⓘ Lanthanite-(Ce) | Ce2(CO3)3 · 8H2O |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Ce | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| Ce | ⓘ Parisite-(Nd) | Ca(Nd,Ce,La)2(CO3)3F2 |
| Ce | ⓘ Perrierite-(Ce) | Ce4MgFe23+Ti2(Si2O7)2O8 |
| Ce | ⓘ Rhabdophane-(Ce) | Ce(PO4) · 0.6H2O |
| Ce | ⓘ Röntgenite-(Ce) | Ca2(Ce,La)3(CO3)5F3 |
| Ce | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ce | ⓘ Zhonghuacerite-(Ce) | Ba2Ce(CO3)3F |
| Ce | ⓘ Cebaite-(Nd) | Ba3(Nd,Ce)2(CO3)5F2 |
| Ce | ⓘ Chevkinite-(Ce) | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| Ce | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| Ce | ⓘ Dingdaohengite-(Ce) | (Ce,La)4Fe2+(Ti,Fe2+,Mg,Fe3+)2Ti2(Si2O7)2O8 |
| Ce | ⓘ Unnamed (Cordylite-like Calcium-Barium-Cerium Carbonate-Fluoride) | Ca◻Ba2Ce4[CO3]8F2 |
| Ce | ⓘ UM1986-64-SiO:NbREETi | ~(Nd,Ce,REE)6Ti24Nb4Si12O91 |
| Ce | ⓘ Xianhuaite-(Ce) | K2CeNb5O15 |
| Nd | Neodymium | |
| Nd | ⓘ Aeschynite-(Nd) | Nd(TiNb)O6 |
| Nd | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Nd | ⓘ Clinofergusonite-(Nd) | (Nd,Ce)NbO4 |
| Nd | ⓘ Fergusonite-(Nd) | NdNbO4 |
| Nd | ⓘ Parisite-(Nd) | Ca(Nd,Ce,La)2(CO3)3F2 |
| Nd | ⓘ Cebaite-(Nd) | Ba3(Nd,Ce)2(CO3)5F2 |
| Nd | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| Nd | ⓘ UM1986-64-SiO:NbREETi | ~(Nd,Ce,REE)6Ti24Nb4Si12O91 |
| Nd | ⓘ Huanghoite-(Nd) | BaNd(CO3)2F |
| Ta | Tantalum | |
| Ta | ⓘ Ixiolite-(Mn2+)-Ixiolite-(Fe2+) Series | |
| W | Tungsten | |
| W | ⓘ Baotite | Ba4(Ti,Nb,W)8O16(SiO3)4Cl |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Pyrochlore Group var. Plumbopyrochlore (of Skorobogatova et al.) | (Pb,Y,U,Ca)2-xNb2O6(OH) |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Oxyplumbopyrochlore | Pb2Nb2O6O |
| Th | Thorium | |
| Th | ⓘ Brockite | (Ca,Th,Ce)PO4 · H2O |
| Th | ⓘ Thorbastnäsite | ThCa(CO3)2F2 · 3H2O |
| Th | ⓘ Thorianite | ThO2 |
| Th | ⓘ Thorite | Th(SiO4) |
| Th | ⓘ Thorite var. Uranothorite | (Th,U)SiO4 |
| Th | ⓘ Thorite var. Ferrithorite | (Th,Fe3+)[Si(O,OH)4] |
| U | Uranium | |
| U | ⓘ Pyrochlore Group var. Plumbopyrochlore (of Skorobogatova et al.) | (Pb,Y,U,Ca)2-xNb2O6(OH) |
| U | ⓘ Thorite var. Uranothorite | (Th,U)SiO4 |
Geochronology
Mineralization age: Mesoproterozoic to Ordovician : 1354 ± 59 Ma to 455.6 ± 28.3 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Phanerozoic | |||||||||||||
| Paleozoic | |||||||||||||
| Ordovician | |||||||||||||
| Late/Upper Ordovician |
| ||||||||||||
| Precambrian | |||||||||||||
| Proterozoic | |||||||||||||
| Mesoproterozoic | |||||||||||||
| Ectasian |
| ||||||||||||
Localities in this Region
- Inner Mongolia
- Baotou City
- Bayan Obo mining district
- Baotou City
Other Regions, Features and Areas containing this locality
AsiaContinent
- Gobi DesertDesert
Eurasian PlateTectonic Plate
- North China Craton
- Western Block
- Yinshan BlockShield
- Western Block
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Nakai, S., Masuda, A., Shimizu, H., Lu, Qi (1989) La-Ba dating and Nd and Sr isotope studies on the Baiyun Obo rare earth element ore deposits, Inner Mongolia, China. Economic Geology, 84 (8) 2296-2299 doi:10.2113/gsecongeo.84.8.2296
Drew, Lawrence J., Qingrun, Meng, Weijun, Sun (1990) The Bayan Obo iron-rare-earth-niobium deposits, Inner Mongolia, China. Lithos, 26 (1) 43-65 doi:10.1016/0024-4937(90)90040-8
Chao, E.C.T., Back, J.M., Minkin, J.A., Yinchen, Ren (1992) Host-rock controlled epigenetic, hydrothermal metasomatic origin of the Bayan Obo REEFe-Nb ore deposit, Inner Mongolia, P.R.C. Applied Geochemistry, 7 (5) 443-458 doi:10.1016/0883-2927(92)90005-n
Conrad, James E., McKee, Edwin H. (1992) 40 Ar/ 39 Ar dating of vein amphibole from the Bayan Obo iron-rare earth element-niobium deposit, Inner Mongolia, China; constraints on mineralization and deposition of the Bayan Obo Group. Economic Geology, 87 (1) 185-188 doi:10.2113/gsecongeo.87.1.185
Zhongxin, Yuan, Ge, Bai, Chenyu, Wu, Zhongqin, Zhang, Xianjiang, Ye (1992) Geological features and genesis of the Bayan Obo REE ore deposit, Inner Mongolia, China. Applied Geochemistry, 7 (5) 429-442 doi:10.1016/0883-2927(92)90004-m
Campbell, Linda S., Henderson, Paul (1997) Apatite paragenesis in the Bayan Obo REE-Nb-Fe ore deposit, Inner Mongolia, China. Lithos, 42 (1) 89-103 doi:10.1016/s0024-4937(97)00038-8
Le Bas, M. J., Spiro, B., Xueming, Yang (1997) Oxygen, carbon and strontium isotope study of the carbonatitic dolomite host of the Bayan Obo Fe-Nb-REE deposit, Inner Mongolia, N China. Mineralogical Magazine, 61 (407) 531-541 doi:10.1180/minmag.1997.061.407.05
Smith, M. P., Henderson, P., Peishan, Zhang (1999) Reaction relationships in the Bayan Obo Fe-REE-Nb deposit Inner Mongolia, China: implications for the relative stability of rare-earth element phosphates and fluorocarbonates. Contributions to Mineralogy and Petrology, 134 (2) 294-310 doi:10.1007/s004100050485
Smith, M.P, Henderson, P, Campbell, L.S (2000) Fractionation of the REE during hydrothermal processes: constraints from the Bayan Obo Fe-REE-Nb deposit, Inner Mongolia, China. Geochimica et Cosmochimica Acta, 64 (18) 3141-3160 doi:10.1016/s0016-7037(00)00416-6
Smith, M. P., Henderson, P. (2000) Preliminary Fluid Inclusion Constraints on Fluid Evolution in
the Bayan Obo Fe-REE-Nb Deposit, Inner Mongolia, China. Economic Geology, 95 (7) 1371-1388 doi:10.2113/gsecongeo.95.7.1371
Yang, Zhuming, Smith, Martin, Henderson, Paul, LeBas, Michael J., Tao, Kejie, Zhang, Peishan (2001) Compositional variation of aeschynite-group minerals in the Bayan Obo Nb-REE-Fe ore deposit, Inner Mongolia, China. European Journal of Mineralogy, 13 (6) 1207-1214 doi:10.1127/0935-1221/2001/0013-1207
Orris, Greta J., Grauch, Richard I. (2002) Rare Earth Element Mines, Deposits, and Occurrences. Open-File Report 2002-189. US Geological Survey doi:10.3133/ofr02189
Yang, X.-M., Yang, X.-Y., Zheng, Y.-F., Le Bas, M. J. (2003) A rare earth element-rich carbonatite dyke at Bayan Obo, Inner Mongolia, North China. Mineralogy and Petrology, 78 (1) 93-110 doi:10.1007/s00710-002-0220-5
Fan, Hong-Rui; Xie, Yi-Han; Wang, Kai-Yi; Tao, Ke-Jie; Wilde, Simon A. (2004) REE Daughter Minerals Trapped in Fluid Inclusions in the Giant Bayan Obo REE-Nb-Fe Deposit, Inner Mongolia, China. International Geology Review, 46 (7). 638-645 doi:10.2747/0020-6814.46.7.638
Fan, Hong-Rui; Xie, Yi-Han; Wang, Kai-Yi; Wilde, Simon A. (2004) Methane-rich fluid inclusions in skarn near the giant REE–Nb–Fe deposit at Bayan Obo, Northern China. Ore Geology Reviews, 25 (3-4). 301-309 doi:10.1016/j.oregeorev.2004.05.001
Shimazaki, Hidehiko, Yang, Zhuming, Miyawaki, Ritsuro, Shigeoka, Masako (2008) Scandium-Bearing Minerals in the Bayan Obo Nb-REE-Fe Deposit, Inner Mongolia, China. Resource Geology, 58 (1) 80-86 doi:10.1111/j.1751-3928.2007.00045.x
Xu, J., Yang, G. G, Li, G., Wu, Z., Shen, G. (2008) Dingdaohengite-(Ce) from the Bayan Obo REE-Nb-Fe Mine, China: Both a true polymorph of perrierite-(Ce) and a titanic analog at the C1 site of chevkinite subgroup. American Mineralogist, 93 (5) 740-744 doi:10.2138/am.2008.2543
Berger, Vladimir I.; Singer, Donald A.; Orris, Greta J. (2009) Carbonatites of the World, Explored Deposits of Nb and REE—Database and Grade and Tonnage Models . Open-File Report 2009-1139. US Geological Survey doi:10.3133/ofr20091139
www.theguardian.com (n.d.) https://www.theguardian.com/environment/2012/aug/07/china-rare-earth-village-pollution
Ribeiro Da Costa, Isabel, Rodrigues, Pedro C.R., Barriga, Fernando J.A.S., Rona, Peter A., Nunes, Carla D., Vaz, Pedro D. (2014) Colourless aegirine in metamorphic rocks from Bayan Obo (Inner Mongolia): lack of charge transfer transitions as possible explanation. European Journal of Mineralogy, 25 (6) 987-993 doi:10.1127/0935-1221/2013/0025-2283
Smith, M.P.; Campbell, L.S.; Kynicky, J. (2015) A review of the genesis of the world class Bayan Obo Fe–REE–Nb deposits, Inner Mongolia, China: Multistage processes and outstanding questions. Ore Geology Reviews, 64. doi:10.1016/j.oregeorev.2014.03.007
Zhu, Xiang-kun; Sun, Jian; Pan, Chenxu (2015) Sm–Nd isotopic constraints on rare-earth mineralization in the Bayan Obo ore deposit, Inner Mongolia, China. Ore Geology Reviews, 64. doi:10.1016/j.oregeorev.2014.05.015
Lai, Xiaodong, Yang, Xiaoyong, Santosh, M., Liu, Yulong, Ling, Mingxing (2015) New data of the Bayan Obo Fe–REE–Nb deposit, Inner Mongolia: Implications for ore genesis. Precambrian Research, 263. 108-122 doi:10.1016/j.precamres.2015.03.013
Fan, Hong-Rui; Yang, Kui-Feng; Hu, Fang-Fang; Liu, Shang; Wang, Kai-Yi (2016) The giant Bayan Obo REE-Nb-Fe deposit, China: Controversy and ore genesis. Geoscience Frontiers, 7 (3). 335-344 doi:10.1016/j.gsf.2015.11.005
Liu, Shang; Fan, Hong-Rui; Yang, Kui-Feng; Hu, Fang-Fang; Rusk, Brian; Liu, Xuan; Li, Xiao-Chun; Yang, Zhan-Feng; Wang, Qi-Wei; Wang, Kai-Yi (2018) Fenitization in the giant Bayan Obo REE-Nb-Fe deposit: Implication for REE mineralization. Ore Geology Reviews, 94. doi:10.1016/j.oregeorev.2018.02.006
Liu, Shang; Ding, Lin; Fan, Hong-Rui; Yang, Kui-Feng; Tang, Yan-Wen; She, Hai-Dong; Hao, Mei-zhen (2020) Hydrothermal genesis of Nb mineralization in the giant Bayan Obo REE-Nb-Fe deposit (China): Implicated by petrography and geochemistry of Nb-bearing minerals. Precambrian Research, 348. 105864 doi:10.1016/j.precamres.2020.105864
Liu, Shang, Ding, Lin, Fan, Hong-Rui (2020) Thermodynamic Constraints on REE Mineral Paragenesis in the Bayan Obo REE-Nb-Fe Deposit, China. Minerals, 10 (6) 495 doi:10.3390/min10060495
She, Hai-Dong; Fan, Hong-Rui; Yang, Kui-Feng; Li, Xiao-Chun; Wang, Qi-Wei; Zhang, Li-Feng; Liu, Shang; Li, Xing-Hui; Dai, Zhi-Hui (2021) In situ trace elements of magnetite in the Bayan Obo REE-Nb-Fe deposit: Implications for the genesis of mesoproterozoic iron mineralization. Ore Geology Reviews, 139. 104574 doi:10.1016/j.oregeorev.2021.104574
www.mineralienatlas.de (n.d.) https://www.mineralienatlas.de/lexikon/index.php/China/Innere%20Mongolei%20%28Neimenggu%29/Baotou/Vereinigtes%20Darhan-Mumingan-Banner/Bayan%20Obo/Bayan%20Obo%20SE-Fe-Nb-Lagerst%C3%A4tte
www.ejatlas.org (2021) https://www.ejatlas.org/print/bayan-obo-world-biggest-rare-earths-mine-baogang-group-baotou-inner-mongolia-china
Li, Hong-Tao; Yang, Kui-Feng; Gao, Yu-Pu; Zhao, Jian; Yuan, Xing-Yu; Li, Xiao-Chun; Fan, Hong-Rui (2022) Age and origin of the H9 member from the Bayan Obo Group: Implications for the genesis of the giant Bayan Obo Fe-Nb-REE deposit, China. Ore Geology Reviews, 146. doi:10.1016/j.oregeorev.2022.104927
Tian, Pengfei, Yang, Xiaoyong, Xiao, Yulun, Yuan, Wanming, He, Zifei (2022) In Situ Monazite U–Pb Ages in Thin Sections from the Giant Bayan Obo Fe–REE–Nb Deposit, Inner Mongolia: Implications for Formation Sequences. Minerals, 12 (10) 1237 doi:10.3390/min12101237
[1]Liu, Taotao, Song, Wenlei, Kynicky, Jindrich, Yang, Jinkun, Chen, Qian, Tang, Haiyan (2022) Automated Quantitative Characterization REE Ore Mineralogy from the Giant Bayan Obo Deposit, Inner Mongolia, China. Minerals, 12 (4) 426 doi:10.3390/min12040426
Wei, Chun-wan; Xu, Cheng; Deng, Miao; Song, Wen-lei; Shi, Aiguo; Li, Zhuoqi; Fan, Chaoxi; Kuang, Guangxi (2022) Origin of metasomatic fluids in the Bayan Obo rare-earth-element deposit. Ore Geology Reviews, 141. 104654 doi:10.1016/j.oregeorev.2021.104654
xueshu.baidu.com (n.d.) https://xueshu.baidu.com/usercenter/paper/show?paperid=b57cf3303ca8b8d6d66689141401de61
Yi-Li, Chang-Ke, Hong-She, Deng-Wang, Xu, Cheng, An-Wang, Rui-Li, Zi-Peng, Ze-Zhu, Kui-Yang, Chen, Wei, Jian-Zi, Wen-Song, Yong-Zhao, Zhang, Li, Yu, Hong, Guo, Bin, Sheng-Zhou, Xing-Yuan, Jing-Liu (2023) Geology and mineralization of the Bayan Obo supergiant carbonatite-type REE-Nb-Fe deposit in Inner Mongolia, China: A review. China Geology, 6 (4) 716-750 doi:10.31035/cg2023082
[2]Zhu, Xue-Feng, Zhang, Chi, Huang, Xiao-Wen, Song, Wen-Lei, Lu, Li-Na, Hu, Qing-Cheng, Shao, Ya-Qin (2024) Principal component analysis of mineral and element composition of ores from the Bayan Obo Nb-Fe-REE deposit: Implication for mineralization process and ore classification. Ore Geology Reviews, 167. 105972 doi:10.1016/j.oregeorev.2024.105972
[3]Zhang, Ji’en, Fan, Hongrui, Xiao, Wenjiao, Xu, Xingwang, Wakabayashi, John, Zhang, Lili, Zhao, Yonggang, Wang, Qiwei, Zhao, Yulong, Wang, Kaiyi (2024) Configuration of Carbonatite Constrained in Preintrusion Transpositional Foliation in the Bayan Obo Giant Rare Earth Element Deposit, China. Economic Geology, 119 (4) 853-869 doi:10.5382/econgeo.5076
[4]Huang, Yong-Shu, Li, Xiao-Chun, Xu, Xing-Wang, Li, Qiu-Li, Guo, Qian, Liu, Yu, Tang, Guo-Qiang, Li, Xian-Hua, Fan, Hong-Rui (2024) New discovery of the Early Paleozoic carbonatite in Bayan Obo (China): Insights into the giant REE accumulation. Ore Geology Reviews, 170. 106156 doi:10.1016/j.oregeorev.2024.106156
He, Lanfang, Li, Liang, Liu, Yun, Yang, Zhanfeng, Zhao, Yonggang, Yang, Kuifang, Chen, Rujun, Fan, Hongrui (2024) Audio magnetotelluric view of the giant carbonatite-hosted Bayan Obo REE deposit, Inner Mongolia, northern China. Ore Geology Reviews, 172. 106208 doi:10.1016/j.oregeorev.2024.106208
Yang, Bo, Yang, Li, Zhao, Yong-Gang, Yan, Guo-Ying, Liu, Jian-Yong, Meng, Wen-Xiang, Yu, Jun-Fang, Chen, Lei, Li, Xiao-Chun, Li, Xian-Hua (2024) Aeschynite Group Minerals Are a Potential Recovery Target for Niobium Resources at the Giant Bayan Obo Nb–REE–Fe Deposit in China. Minerals, 14 (10). doi:10.3390/min14101029
[5]Liang, Pei, Wang, Junyi, Li, Bicheng, Xie, Yuling, Han, Jinsheng, Xia, Jiaming, Li, Bingbing, Chen, Li (2024) Multi-stage REE mineralization in the Bayan Obo Fe-REE-Nb deposit: Constraints from biotite and apatite geochemistry. Ore Geology Reviews, 174. 106312 doi:10.1016/j.oregeorev.2024.106312
[6]Liu, Shuang-Liang, Liu, Xuan, Fan, Hong-Rui, Butcher, Alan R, Lahaye, Yann, Michallik, Radoslaw M., Jolis, Ester M., Lukkari, Sari, Yang, Kui-Feng, Wang, Qi-Wei, et al. (2025) Scandium distribution in the Bayan Obo REE-Nb-Fe deposit, China: A multi-scale geochemical perspective. Ore Geology Reviews, 177. 106466 doi:10.1016/j.oregeorev.2025.106466
[7]Jin, Hailong, Sun, Qing, Chen, Biao, Wei, Wei, Liu, Yanjiang, Li, Qiang (2025) Evaluated Utilization of Middle–Heavy REE Resources in Bayan Obo Deposit: Insight from Geochemical Composition and Process Mineralogy. Minerals, 15 (3). doi:10.3390/min15030212
Ren, Chenghao, Jia, Hongxiang, Wang, Dongsheng, She, Hongquan, Li, Jinwen, Chen, Hui (2025) Fe, Mg, Sr-Nd-Pb, C-O isotopes and geochemical constraints on the genesis of Bayan Obo Fe-REE-Nb deposit, Inner Mongolia, Northern China. Ore Geology Reviews, 180. 106525 doi:10.1016/j.oregeorev.2025.106525
Chen, Qian; Song, Wenlei; Xu, Cheng; Xue, Shanna; Xu, Danni; Chen, Biao (2025) Mineralogical and geochemical study of Nb mineralization in the giant Bayan Obo deposit. Ore Geology Reviews, 184. 106771 doi:10.1016/j.oregeorev.2025.106771
She, Hai-Dong; Fan, Hong-Rui; Chen, Biao; Yang, Kui-Feng; Li, Xiao-Chun; Wang, Qi-Wei (2025) The occurrence and distribution of thorium in the giant Bayan Obo REE-Nb-Fe polymetallic deposit, China. Ore Geology Reviews, 186. 106883 doi:10.1016/j.oregeorev.2025.106883
[8]Liu, Si-Han; Wang, Chun-Lian; Sun, Jian; Hu, Gu-Yue; Wang, Dong; Ke, Chang-Hui; Liu, Xue; Liu, Yan-Ting; You, Chao (2025) The genesis of giant fluorite resources in Bayan Obo Fe-Nb-REE deposit, Inner Mongolia of China. Ore Geology Reviews, 187. 106959 doi:10.1016/j.oregeorev.2025.106959
Fan, Chenzi; Yu, Hong; Gu, Xiangping; Zeng, Pusheng; Chen, Zhenyu (2025) Parisite-(Nd), ideally CaNd2(CO3)3F2, a new mineral from Bayan Obo Fe-Nb-REE deposit, Inner Mongolia, China. Mineralogical Magazine, 89 (3). 370-379 doi:10.1180/mgm.2024.90
[9]Liu, Nanxi; Yang, Kuifeng; Qiu, Zhengjie; She, Haidong; Hu, Fangfang; Fan, Hongrui (2026) Superposed effect of Early Paleozoic alkaline magmatic-hydrothermal activity on the Bayan Obo deposit. Ore Geology Reviews, 192. 107249 doi:10.1016/j.oregeorev.2026.107249
Zhao, Yulong; Zhang, Ji’en; Xiao, Wenjiao; Fan, Hongrui; Wakabayashi, John; Xue, Guoqiang; Zhao, Yonggang; Liu, Yun; Wang, Kaiyi (2026) Multicarbonatites of the world’s largest REE deposit juxtaposed by Mesozoic thrusts at Bayan Obo, China. Ore Geology Reviews, 193. p.107312. doi:10.1016/j.oregeorev.2026.107312
Quick NavTopCommoditiesMineral ListRock TypesGeochronologyLocalities in RegionOther RegionsReferences
Bayan Obo deposit, Bayan Obo mining district, Baotou City, Inner Mongolia, China