Zlatá Baňa, Prešov District, Prešov Region, Slovakiai
| Regional Level Types | |
|---|---|
| Zlatá Baňa | Municipality |
| Prešov District | District |
| Prešov Region | Region |
| Slovakia | Country |
This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Other Languages:
Slovak:
Zlatá Baňa, Prešov , Prešovský kraj, Slovensko
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities158 valid minerals.
Detailed Mineral List:
| ⓘ Acanthite Formula: Ag2S |
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ Akaganeite Formula: (Fe3+,Ni2+)8(OH,O)16Cl1.25 · nH2O |
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Albite var. Andesine Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ Allophane Formula: (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ Altaite Formula: PbTe |
| ⓘ Aluminite Formula: Al2(SO4)(OH)4 · 7H2O |
| ⓘ Alunite Formula: KAl3(SO4)2(OH)6 |
| ⓘ Ammoniojarosite Formula: (NH4)Fe3+3(SO4)2(OH)6 |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5(T8O22)W2 |
| ⓘ Anatase Formula: TiO2 |
| ⓘ 'Andorite' Formula: AgPbSb3S6 |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 |
| ⓘ Anhydrite Formula: CaSO4 |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| ⓘ Anorthite Formula: Ca(Al2Si2O8) |
| ⓘ Anorthite var. Bytownite Formula: (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ Anorthite var. Labradorite Formula: (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Argyrodite Formula: Ag8GeS6 |
| ⓘ Arsenolite Formula: As2O3 |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Barytocalcite Formula: BaCa(CO3)2 |
| ⓘ Berthierite Formula: FeSb2S4 |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ 'Bonchevite' |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Boulangerite Formula: Pb5Sb4S11 |
| ⓘ Bournonite Formula: PbCuSbS3 |
| ⓘ Breithauptite Formula: NiSb |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Calcite var. Manganese-bearing Calcite Formula: (Ca,Mn)CO3 |
| ⓘ Canfieldite Formula: Ag8SnS6 |
| ⓘ Celadonite Formula: K(MgFe3+◻)(Si4O10)(OH)2 |
| ⓘ Celestine Formula: SrSO4 |
| ⓘ Celestine var. Barium-bearing Celestine Formula: (Sr,Ba)SO4 |
| ⓘ Cerussite Formula: PbCO3 |
| ⓘ Cervantite Formula: Sb3+Sb5+O4 |
| ⓘ Cervelleite Formula: Ag4TeS |
| ⓘ 'Chabazite' |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Chalcostibite Formula: CuSbS2 |
| ⓘ Chamosite Formula: Fe2+5Al(AlSi3O10)(OH)8 |
| ⓘ 'Chlorite Group' |
| ⓘ Cinnabar Formula: HgS |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ Covellite Formula: CuS |
| ⓘ Cristobalite Formula: SiO2 |
| ⓘ Cubanite Formula: CuFe2S3 |
| ⓘ Dawsonite Formula: NaAlCO3(OH)2 |
| ⓘ Diaphorite Formula: Ag3Pb2Sb3S8 |
| ⓘ Diopside Formula: CaMgSi2O6 |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Dyscrasite Formula: Ag3Sb |
| ⓘ Emplectite Formula: CuBiS2 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Falkmanite Formula: Pb3Sb2S6 |
| ⓘ Fizélyite Formula: Ag5Pb14Sb21S48 |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorapophyllite-(K) Formula: KCa4(Si8O20)(F,OH) · 8H2O |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ 'Freibergite Subgroup' Formula: (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ Freieslebenite Formula: AgPbSbS3 |
| ⓘ Galena Formula: PbS |
| ⓘ Geocronite Formula: Pb14Sb6S23 |
| ⓘ Gersdorffite Formula: NiAsS |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Graphite Formula: C |
| ⓘ Greenockite Formula: CdS |
| ⓘ Greigite Formula: Fe2+Fe3+2S4 |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Gypsum var. Selenite Formula: CaSO4 · 2H2O |
| ⓘ Halloysite Formula: Al2Si2O5(OH)4 · n(H2O) |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Hematite var. Specularite Formula: Fe2O3 |
| ⓘ Hessite Formula: Ag2Te |
| ⓘ 'Heulandite Subgroup' Formula: (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| ⓘ Hocartite Formula: Ag2(Fe2+,Zn)SnS4 |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ 'Hypersthene' Formula: (Mg,Fe)SiO3 |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Jalpaite Formula: Ag3CuS2 |
| ⓘ Jamesonite Formula: Pb4FeSb6S14 |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Jaskólskiite Formula: CuxPb2+x(Sb,Bi)2-xS5 (x ~ 0.15) |
| ⓘ Kaersutite Formula: NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Kermesite Formula: Sb2S2O |
| ⓘ 'K Feldspar' |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O |
| ⓘ Lepidocrocite Formula: Fe3+O(OH) |
| ⓘ 'Limonite' |
| ⓘ Luzonite Formula: Cu3AsS4 |
| ⓘ Maghemite Formula: (Fe3+0.67◻0.33)Fe3+2O4 |
| ⓘ Magnesioferrite Formula: MgFe3+2O4 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Magnetite var. Titanium-bearing Magnetite Formula: Fe2+(Fe3+,Ti)2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Melanterite Formula: Fe2+(H2O)6(SO4) · H2O |
| ⓘ 'Melnikovite' |
| ⓘ Metacinnabar Formula: HgS |
| ⓘ Metastibnite Formula: Sb2S3 |
| ⓘ Miargyrite Formula: AgSbS2 |
| ⓘ Millerite Formula: NiS |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) |
| ⓘ 'Monazite Group' Formula: REE(PO4) |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Native Antimony Formula: Sb |
| ⓘ Native Arsenic Formula: As |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Gold Formula: Au |
| ⓘ Native Gold var. Electrum Formula: (Au,Ag) |
| ⓘ Native Mercury Formula: Hg |
| ⓘ Native Silver Formula: Ag |
| ⓘ Native Silver var. Küstelite Formula: Ag |
| ⓘ Natrojarosite Formula: NaFe3(SO4)2(OH)6 |
| ⓘ Natrolite Formula: Na2Al2Si3O10 · 2H2O |
| ⓘ Nontronite Formula: Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ Opal Formula: SiO2 · nH2O |
| ⓘ Opal var. Hydrophane Formula: SiO2 · nH2O |
| ⓘ Opal var. Opal-AN Formula: SiO2 · nH2O |
| ⓘ Orpiment Formula: As2S3 |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Owyheeite Formula: Ag3Pb10Sb11S28 |
| ⓘ Pearceite Formula: [Ag6As2S7][Ag9CuS4] |
| ⓘ Petzite Formula: Ag3AuTe2 |
| ⓘ Pigeonite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ Plagionite Formula: Pb5Sb8S17 |
| ⓘ Plumosite Formula: Pb2Sb2S5 |
| ⓘ Polybasite Formula: [Ag6Sb2S7][Ag9CuS4] |
| ⓘ 'Polybasite-Tac' Formula: [Ag6Sb2S7][Ag9CuS4] |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 |
| ⓘ 'Psilomelane' |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Quartz var. Amethyst Formula: SiO2 |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Ramdohrite Formula: Pb5.9Fe0.1Mn0.1In0.1Cd0.2Ag2.8Sb10.8S24 |
| ⓘ Realgar Formula: As4S4 |
| ⓘ Rhodochrosite Formula: MnCO3 |
| ⓘ Rickardite Formula: Cu7Te5 |
| ⓘ Robinsonite Formula: Pb4Sb6S13 |
| ⓘ Romanèchite Formula: (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| ⓘ 'Roméite Group' Formula: A2(Sb5+)2O6Z |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Schwertmannite Formula: Fe3+16(OH,SO4)12-13O16 · 10-12H2O |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O |
| ⓘ Semseyite Formula: Pb9Sb8S21 |
| ⓘ Senarmontite Formula: Sb2O3 |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Siderite var. Manganese-bearing Siderite Formula: (Fe,Mn)CO3 |
| ⓘ Siderite var. Oligonite Formula: (Fe,Mn)CO3 |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Stannite Formula: Cu2FeSnS4 |
| ⓘ Stephanite Formula: Ag5SbS4 |
| ⓘ Stibarsen Formula: AsSb |
| ⓘ Stibiconite Formula: Sb3+Sb5+2O6(OH) |
| ⓘ Stibnite Formula: Sb2S3 |
| ⓘ 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ Sylvanite Formula: AgAuTe4 |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| ⓘ Titanite Formula: CaTiO(SiO4) |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Tridymite Formula: SiO2 |
| ⓘ Ullmannite Formula: NiSbS |
| ⓘ Valentinite Formula: Sb2O3 |
| ⓘ Valleriite Formula: (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| ⓘ Violarite Formula: Fe2+Ni3+2S4 |
| ⓘ 'Wad' |
| ⓘ Weissite Formula: Cu2-xTe |
| ⓘ Wittichenite Formula: Cu3BiS3 |
| ⓘ Wurtzite Formula: (Zn,Fe)S |
| ⓘ Xenotime-(Y) Formula: Y(PO4) |
| ⓘ Zinkenite Formula: Pb9Sb22S42 |
| ⓘ Zircon Formula: Zr(SiO4) |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold var. Electrum | 1.AA.05 | (Au,Ag) |
| ⓘ | 1.AA.05 | Au | |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | var. Küstelite | 1.AA.05 | Ag |
| ⓘ | Native Mercury | 1.AD.05 | Hg |
| ⓘ | Native Antimony | 1.CA.05 | Sb |
| ⓘ | Native Arsenic | 1.CA.05 | As |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Stibarsen | 1.CA.05 | AsSb |
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Plumosite | 2.00. | Pb2Sb2S5 |
| ⓘ | Dyscrasite | 2.AA.35 | Ag3Sb |
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Rickardite | 2.BA.30 | Cu7Te5 |
| ⓘ | Weissite | 2.BA.30 | Cu2-xTe |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Jalpaite | 2.BA.45 | Ag3CuS2 |
| ⓘ | Cervelleite | 2.BA.60 | Ag4TeS |
| ⓘ | Hessite | 2.BA.60 | Ag2Te |
| ⓘ | Argyrodite | 2.BA.70 | Ag8GeS6 |
| ⓘ | Canfieldite | 2.BA.70 | Ag8SnS6 |
| ⓘ | Petzite | 2.BA.75 | Ag3AuTe2 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Metacinnabar | 2.CB.05a | HgS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Hocartite | 2.CB.15a | Ag2(Fe2+,Zn)SnS4 |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Wurtzite | 2.CB.45 | (Zn,Fe)S |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Breithauptite | 2.CC.05 | NiSb |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Altaite | 2.CD.10 | PbTe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Cinnabar | 2.CD.15a | HgS |
| ⓘ | Greigite | 2.DA.05 | Fe2+Fe3+2S4 |
| ⓘ | Violarite | 2.DA.05 | Fe2+Ni3+2S4 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Metastibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Sylvanite | 2.EA.05 | AgAuTe4 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Ullmannite | 2.EB.25 | NiSbS |
| ⓘ | Realgar | 2.FA.15a | As4S4 |
| ⓘ | Orpiment | 2.FA.30 | As2S3 |
| ⓘ | Kermesite | 2.FD.05 | Sb2S2O |
| ⓘ | Valleriite | 2.FD.30 | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| ⓘ | Wittichenite | 2.GA.20 | Cu3BiS3 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | 'Polybasite-Tac' | 2.GB. | [Ag6Sb2S7][Ag9CuS4] |
| ⓘ | 'Freibergite Subgroup' | 2.GB.05 | (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Stephanite | 2.GB.10 | Ag5SbS4 |
| ⓘ | Pearceite | 2.GB.15 | [Ag6As2S7][Ag9CuS4] |
| ⓘ | Polybasite | 2.GB.15 | [Ag6Sb2S7][Ag9CuS4] |
| ⓘ | Chalcostibite | 2.HA.05 | CuSbS2 |
| ⓘ | Emplectite | 2.HA.05 | CuBiS2 |
| ⓘ | Miargyrite | 2.HA.10 | AgSbS2 |
| ⓘ | Berthierite | 2.HA.20 | FeSb2S4 |
| ⓘ | Jaskólskiite | 2.HB.05c | CuxPb2+x(Sb,Bi)2-xS5 (x ~ 0.15) |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | Plagionite | 2.HC.10b | Pb5Sb8S17 |
| ⓘ | Semseyite | 2.HC.10d | Pb9Sb8S21 |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Falkmanite | 2.HC.15 | Pb3Sb2S6 |
| ⓘ | Robinsonite | 2.HC.20 | Pb4Sb6S13 |
| ⓘ | Owyheeite | 2.HC.35 | Ag3Pb10Sb11S28 |
| ⓘ | Diaphorite | 2.JB.05 | Ag3Pb2Sb3S8 |
| ⓘ | Freieslebenite | 2.JB.15 | AgPbSbS3 |
| ⓘ | Geocronite | 2.JB.30a | Pb14Sb6S23 |
| ⓘ | Zinkenite | 2.JB.35a | Pb9Sb22S42 |
| ⓘ | Fizélyite | 2.JB.40a | Ag5Pb14Sb21S48 |
| ⓘ | Ramdohrite | 2.JB.40a | Pb5.9Fe0.1Mn0.1In0.1Cd0.2Ag2.8Sb10.8S24 |
| ⓘ | Luzonite | 2.KA.10 | Cu3AsS4 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Magnesioferrite | 4.BB.05 | MgFe3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | var. Titanium-bearing Magnetite | 4.BB.05 | Fe2+(Fe3+,Ti)2O4 |
| ⓘ | Maghemite | 4.BB.15 | (Fe3+0.67◻0.33)Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Hematite var. Specularite | 4.CB.05 | Fe2O3 |
| ⓘ | Arsenolite | 4.CB.50 | As2O3 |
| ⓘ | Senarmontite | 4.CB.50 | Sb2O3 |
| ⓘ | Valentinite | 4.CB.55 | Sb2O3 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | Opal var. Opal-AN | 4.DA.10 | SiO2 · nH2O |
| ⓘ | 4.DA.10 | SiO2 · nH2O | |
| ⓘ | Tridymite | 4.DA.10 | SiO2 |
| ⓘ | Opal var. Hydrophane | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Cristobalite | 4.DA.15 | SiO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Cervantite | 4.DE.30 | Sb3+Sb5+O4 |
| ⓘ | 'Roméite Group' | 4.DH. | A2(Sb5+)2O6Z |
| ⓘ | Stibiconite | 4.DH.20 | Sb3+Sb5+2O6(OH) |
| ⓘ | Akaganeite | 4.DK.05 | (Fe3+,Ni2+)8(OH,O)16Cl1.25 · nH2O |
| ⓘ | Romanèchite | 4.DK.10 | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| ⓘ | Lepidocrocite | 4.FE.15 | Fe3+O(OH) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | var. Manganese-bearing Calcite | 5.AB.05 | (Ca,Mn)CO3 |
| ⓘ | Siderite var. Oligonite | 5.AB.05 | (Fe,Mn)CO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | var. Manganese-bearing Siderite | 5.AB.05 | (Fe,Mn)CO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Barytocalcite | 5.AB.45 | BaCa(CO3)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Dawsonite | 5.BB.10 | NaAlCO3(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Celestine var. Barium-bearing Celestine | 7.AD.35 | (Sr,Ba)SO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Celestine | 7.AD.35 | SrSO4 |
| ⓘ | Alunite | 7.BC.10 | KAl3(SO4)2(OH)6 |
| ⓘ | Ammoniojarosite | 7.BC.10 | (NH4)Fe3+3(SO4)2(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Natrojarosite | 7.BC.10 | NaFe3(SO4)2(OH)6 |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6(SO4) · H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | var. Selenite | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Aluminite | 7.DC.05 | Al2(SO4)(OH)4 · 7H2O |
| ⓘ | Schwertmannite | 7.DE.15 | Fe3+16(OH,SO4)12-13O16 · 10-12H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| Group 9 - Silicates | |||
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Pigeonite | 9.DA.10 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Kaersutite | 9.DE.15 | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Fluorapophyllite-(K) | 9.EA.15 | KCa4(Si8O20)(F,OH) · 8H2O |
| ⓘ | Celadonite | 9.EC.15 | K(MgFe3+◻)(Si4O10)(OH)2 |
| ⓘ | Muscovite var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Nontronite | 9.EC.40 | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ | Chamosite | 9.EC.55 | Fe2+5Al(AlSi3O10)(OH)8 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Halloysite | 9.ED.10 | Al2Si2O5(OH)4 · n(H2O) |
| ⓘ | Allophane | 9.ED.20 | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Andesine | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | var. Bytownite | 9.FA.35 | (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ | var. Labradorite | 9.FA.35 | (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ | Albite var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Natrolite | 9.GA.05 | Na2Al2Si3O10 · 2H2O |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Andorite' | - | AgPbSb3S6 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chabazite' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Heulandite Subgroup' | - | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| ⓘ | 'Hypersthene' | - | (Mg,Fe)SiO3 |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Wad' | - | |
| ⓘ | 'Melnikovite' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Bonchevite' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Akaganeite | (Fe3+,Ni2+)8(OH,O)16Cl1.25 · nH2O |
| H | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| H | ⓘ Aluminite | Al2(SO4)(OH)4 · 7H2O |
| H | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| H | ⓘ Ammoniojarosite | (NH4)Fe33+(SO4)2(OH)6 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Dawsonite | NaAlCO3(OH)2 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| H | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| H | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Lepidocrocite | Fe3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| H | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| H | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| H | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| H | ⓘ Schwertmannite | Fe163+(OH,SO4)12-13O16 · 10-12H2O |
| H | ⓘ Opal var. Hydrophane | SiO2 · nH2O |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Barytocalcite | BaCa(CO3)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dawsonite | NaAlCO3(OH)2 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Siderite var. Oligonite | (Fe,Mn)CO3 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Siderite var. Manganese-bearing Siderite | (Fe,Mn)CO3 |
| N | Nitrogen | |
| N | ⓘ Ammoniojarosite | (NH4)Fe33+(SO4)2(OH)6 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Akaganeite | (Fe3+,Ni2+)8(OH,O)16Cl1.25 · nH2O |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| O | ⓘ Aluminite | Al2(SO4)(OH)4 · 7H2O |
| O | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Ammoniojarosite | (NH4)Fe33+(SO4)2(OH)6 |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Arsenolite | As2O3 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Celestine var. Barium-bearing Celestine | (Sr,Ba)SO4 |
| O | ⓘ Barytocalcite | BaCa(CO3)2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| O | ⓘ Celestine | SrSO4 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Cervantite | Sb3+Sb5+O4 |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Cristobalite | SiO2 |
| O | ⓘ Dawsonite | NaAlCO3(OH)2 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| O | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| O | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kermesite | Sb2S2O |
| O | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Lepidocrocite | Fe3+O(OH) |
| O | ⓘ Magnesioferrite | MgFe23+O4 |
| O | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| O | ⓘ Maghemite | (Fe3+0.67◻0.33)Fe23+O4 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| O | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| O | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Siderite var. Oligonite | (Fe,Mn)CO3 |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| O | ⓘ Roméite Group | A2(Sb5+)2O6Z |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Senarmontite | Sb2O3 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| O | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Tridymite | SiO2 |
| O | ⓘ Valentinite | Sb2O3 |
| O | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| O | ⓘ Hematite var. Specularite | Fe2O3 |
| O | ⓘ Schwertmannite | Fe163+(OH,SO4)12-13O16 · 10-12H2O |
| O | ⓘ Opal var. Hydrophane | SiO2 · nH2O |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Siderite var. Manganese-bearing Siderite | (Fe,Mn)CO3 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Na | ⓘ Dawsonite | NaAlCO3(OH)2 |
| Na | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Na | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Na | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| Na | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Na | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Mg | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Mg | ⓘ Magnesioferrite | MgFe23+O4 |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Al | ⓘ Aluminite | Al2(SO4)(OH)4 · 7H2O |
| Al | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| Al | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Al | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Dawsonite | NaAlCO3(OH)2 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| Al | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Al | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Si | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Cristobalite | SiO2 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| Si | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Si | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| Si | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Si | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Tridymite | SiO2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Opal var. Hydrophane | SiO2 · nH2O |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Aluminite | Al2(SO4)(OH)4 · 7H2O |
| S | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| S | ⓘ Ammoniojarosite | (NH4)Fe33+(SO4)2(OH)6 |
| S | ⓘ Andorite | AgPbSb3S6 |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Polybasite-Tac | [Ag6Sb2S7][Ag9CuS4] |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Argyrodite | Ag8GeS6 |
| S | ⓘ Celestine var. Barium-bearing Celestine | (Sr,Ba)SO4 |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Berthierite | FeSb2S4 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Canfieldite | Ag8SnS6 |
| S | ⓘ Celestine | SrSO4 |
| S | ⓘ Cervelleite | Ag4TeS |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chalcostibite | CuSbS2 |
| S | ⓘ Cinnabar | HgS |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| S | ⓘ Emplectite | CuBiS2 |
| S | ⓘ Falkmanite | Pb3Sb2S6 |
| S | ⓘ Fizélyite | Ag5Pb14Sb21S48 |
| S | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| S | ⓘ Freieslebenite | AgPbSbS3 |
| S | ⓘ Galena | PbS |
| S | ⓘ Geocronite | Pb14Sb6S23 |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Greigite | Fe2+Fe23+S4 |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Hocartite | Ag2(Fe2+,Zn)SnS4 |
| S | ⓘ Jalpaite | Ag3CuS2 |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Jaskólskiite | CuxPb2+x(Sb,Bi)2-xS5 (x ~ 0.15) |
| S | ⓘ Kermesite | Sb2S2O |
| S | ⓘ Luzonite | Cu3AsS4 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| S | ⓘ Metacinnabar | HgS |
| S | ⓘ Metastibnite | Sb2S3 |
| S | ⓘ Miargyrite | AgSbS2 |
| S | ⓘ Millerite | NiS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| S | ⓘ Orpiment | As2S3 |
| S | ⓘ Owyheeite | Ag3Pb10Sb11S28 |
| S | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| S | ⓘ Plagionite | Pb5Sb8S17 |
| S | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Ramdohrite | Pb5.9Fe0.1Mn0.1In0.1Cd0.2Ag2.8Sb10.8S24 |
| S | ⓘ Realgar | As4S4 |
| S | ⓘ Robinsonite | Pb4Sb6S13 |
| S | ⓘ Semseyite | Pb9Sb8S21 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stannite | Cu2FeSnS4 |
| S | ⓘ Stephanite | Ag5SbS4 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Ullmannite | NiSbS |
| S | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| S | ⓘ Violarite | Fe2+Ni23+S4 |
| S | ⓘ Wittichenite | Cu3BiS3 |
| S | ⓘ Wurtzite | (Zn,Fe)S |
| S | ⓘ Zinkenite | Pb9Sb22S42 |
| S | ⓘ Plumosite | Pb2Sb2S5 |
| S | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| S | ⓘ Schwertmannite | Fe163+(OH,SO4)12-13O16 · 10-12H2O |
| Cl | Chlorine | |
| Cl | ⓘ Akaganeite | (Fe3+,Ni2+)8(OH,O)16Cl1.25 · nH2O |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| K | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| K | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Barytocalcite | BaCa(CO3)2 |
| Ca | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Ca | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Ca | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Ti | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| Mn | Manganese | |
| Mn | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Mn | ⓘ Siderite var. Oligonite | (Fe,Mn)CO3 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Ramdohrite | Pb5.9Fe0.1Mn0.1In0.1Cd0.2Ag2.8Sb10.8S24 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Mn | ⓘ Siderite var. Manganese-bearing Siderite | (Fe,Mn)CO3 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Akaganeite | (Fe3+,Ni2+)8(OH,O)16Cl1.25 · nH2O |
| Fe | ⓘ Ammoniojarosite | (NH4)Fe33+(SO4)2(OH)6 |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Berthierite | FeSb2S4 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Greigite | Fe2+Fe23+S4 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hocartite | Ag2(Fe2+,Zn)SnS4 |
| Fe | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Lepidocrocite | Fe3+O(OH) |
| Fe | ⓘ Magnesioferrite | MgFe23+O4 |
| Fe | ⓘ Maghemite | (Fe3+0.67◻0.33)Fe23+O4 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| Fe | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| Fe | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Fe | ⓘ Siderite var. Oligonite | (Fe,Mn)CO3 |
| Fe | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Ramdohrite | Pb5.9Fe0.1Mn0.1In0.1Cd0.2Ag2.8Sb10.8S24 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Fe | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| Fe | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Fe | ⓘ Violarite | Fe2+Ni23+S4 |
| Fe | ⓘ Wurtzite | (Zn,Fe)S |
| Fe | ⓘ Hematite var. Specularite | Fe2O3 |
| Fe | ⓘ Schwertmannite | Fe163+(OH,SO4)12-13O16 · 10-12H2O |
| Fe | ⓘ Siderite var. Manganese-bearing Siderite | (Fe,Mn)CO3 |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Ni | Nickel | |
| Ni | ⓘ Akaganeite | (Fe3+,Ni2+)8(OH,O)16Cl1.25 · nH2O |
| Ni | ⓘ Breithauptite | NiSb |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Ullmannite | NiSbS |
| Ni | ⓘ Violarite | Fe2+Ni23+S4 |
| Cu | Copper | |
| Cu | ⓘ Polybasite-Tac | [Ag6Sb2S7][Ag9CuS4] |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chalcostibite | CuSbS2 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Emplectite | CuBiS2 |
| Cu | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Cu | ⓘ Jalpaite | Ag3CuS2 |
| Cu | ⓘ Jaskólskiite | CuxPb2+x(Sb,Bi)2-xS5 (x ~ 0.15) |
| Cu | ⓘ Luzonite | Cu3AsS4 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| Cu | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Cu | ⓘ Rickardite | Cu7Te5 |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Cu | ⓘ Weissite | Cu2-xTe |
| Cu | ⓘ Wittichenite | Cu3BiS3 |
| Zn | Zinc | |
| Zn | ⓘ Hocartite | Ag2(Fe2+,Zn)SnS4 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Wurtzite | (Zn,Fe)S |
| Ge | Germanium | |
| Ge | ⓘ Argyrodite | Ag8GeS6 |
| As | Arsenic | |
| As | ⓘ Arsenolite | As2O3 |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Native Arsenic | As |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Luzonite | Cu3AsS4 |
| As | ⓘ Orpiment | As2S3 |
| As | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| As | ⓘ Realgar | As4S4 |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Stibarsen | AsSb |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Sr | Strontium | |
| Sr | ⓘ Celestine var. Barium-bearing Celestine | (Sr,Ba)SO4 |
| Sr | ⓘ Celestine | SrSO4 |
| Y | Yttrium | |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Andorite | AgPbSb3S6 |
| Ag | ⓘ Polybasite-Tac | [Ag6Sb2S7][Ag9CuS4] |
| Ag | ⓘ Argyrodite | Ag8GeS6 |
| Ag | ⓘ Canfieldite | Ag8SnS6 |
| Ag | ⓘ Cervelleite | Ag4TeS |
| Ag | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| Ag | ⓘ Dyscrasite | Ag3Sb |
| Ag | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Ag | ⓘ Fizélyite | Ag5Pb14Sb21S48 |
| Ag | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Ag | ⓘ Freieslebenite | AgPbSbS3 |
| Ag | ⓘ Hessite | Ag2Te |
| Ag | ⓘ Hocartite | Ag2(Fe2+,Zn)SnS4 |
| Ag | ⓘ Jalpaite | Ag3CuS2 |
| Ag | ⓘ Miargyrite | AgSbS2 |
| Ag | ⓘ Owyheeite | Ag3Pb10Sb11S28 |
| Ag | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| Ag | ⓘ Petzite | Ag3AuTe2 |
| Ag | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Ag | ⓘ Ramdohrite | Pb5.9Fe0.1Mn0.1In0.1Cd0.2Ag2.8Sb10.8S24 |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Stephanite | Ag5SbS4 |
| Ag | ⓘ Sylvanite | AgAuTe4 |
| Ag | ⓘ Native Silver var. Küstelite | Ag |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| Cd | ⓘ Ramdohrite | Pb5.9Fe0.1Mn0.1In0.1Cd0.2Ag2.8Sb10.8S24 |
| In | Indium | |
| In | ⓘ Ramdohrite | Pb5.9Fe0.1Mn0.1In0.1Cd0.2Ag2.8Sb10.8S24 |
| Sn | Tin | |
| Sn | ⓘ Canfieldite | Ag8SnS6 |
| Sn | ⓘ Hocartite | Ag2(Fe2+,Zn)SnS4 |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sb | Antimony | |
| Sb | ⓘ Andorite | AgPbSb3S6 |
| Sb | ⓘ Native Antimony | Sb |
| Sb | ⓘ Polybasite-Tac | [Ag6Sb2S7][Ag9CuS4] |
| Sb | ⓘ Berthierite | FeSb2S4 |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Breithauptite | NiSb |
| Sb | ⓘ Cervantite | Sb3+Sb5+O4 |
| Sb | ⓘ Chalcostibite | CuSbS2 |
| Sb | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| Sb | ⓘ Dyscrasite | Ag3Sb |
| Sb | ⓘ Falkmanite | Pb3Sb2S6 |
| Sb | ⓘ Fizélyite | Ag5Pb14Sb21S48 |
| Sb | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Sb | ⓘ Freieslebenite | AgPbSbS3 |
| Sb | ⓘ Geocronite | Pb14Sb6S23 |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Jaskólskiite | CuxPb2+x(Sb,Bi)2-xS5 (x ~ 0.15) |
| Sb | ⓘ Kermesite | Sb2S2O |
| Sb | ⓘ Metastibnite | Sb2S3 |
| Sb | ⓘ Miargyrite | AgSbS2 |
| Sb | ⓘ Owyheeite | Ag3Pb10Sb11S28 |
| Sb | ⓘ Plagionite | Pb5Sb8S17 |
| Sb | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Sb | ⓘ Ramdohrite | Pb5.9Fe0.1Mn0.1In0.1Cd0.2Ag2.8Sb10.8S24 |
| Sb | ⓘ Robinsonite | Pb4Sb6S13 |
| Sb | ⓘ Roméite Group | A2(Sb5+)2O6Z |
| Sb | ⓘ Semseyite | Pb9Sb8S21 |
| Sb | ⓘ Senarmontite | Sb2O3 |
| Sb | ⓘ Stephanite | Ag5SbS4 |
| Sb | ⓘ Stibarsen | AsSb |
| Sb | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Ullmannite | NiSbS |
| Sb | ⓘ Valentinite | Sb2O3 |
| Sb | ⓘ Zinkenite | Pb9Sb22S42 |
| Sb | ⓘ Plumosite | Pb2Sb2S5 |
| Te | Tellurium | |
| Te | ⓘ Altaite | PbTe |
| Te | ⓘ Cervelleite | Ag4TeS |
| Te | ⓘ Hessite | Ag2Te |
| Te | ⓘ Petzite | Ag3AuTe2 |
| Te | ⓘ Rickardite | Cu7Te5 |
| Te | ⓘ Sylvanite | AgAuTe4 |
| Te | ⓘ Weissite | Cu2-xTe |
| Ba | Barium | |
| Ba | ⓘ Celestine var. Barium-bearing Celestine | (Sr,Ba)SO4 |
| Ba | ⓘ Barytocalcite | BaCa(CO3)2 |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Ce | Cerium | |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Au | ⓘ Native Gold | Au |
| Au | ⓘ Petzite | Ag3AuTe2 |
| Au | ⓘ Sylvanite | AgAuTe4 |
| Hg | Mercury | |
| Hg | ⓘ Cinnabar | HgS |
| Hg | ⓘ Native Mercury | Hg |
| Hg | ⓘ Metacinnabar | HgS |
| Pb | Lead | |
| Pb | ⓘ Altaite | PbTe |
| Pb | ⓘ Andorite | AgPbSb3S6 |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| Pb | ⓘ Falkmanite | Pb3Sb2S6 |
| Pb | ⓘ Fizélyite | Ag5Pb14Sb21S48 |
| Pb | ⓘ Freieslebenite | AgPbSbS3 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Geocronite | Pb14Sb6S23 |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Jaskólskiite | CuxPb2+x(Sb,Bi)2-xS5 (x ~ 0.15) |
| Pb | ⓘ Owyheeite | Ag3Pb10Sb11S28 |
| Pb | ⓘ Plagionite | Pb5Sb8S17 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Ramdohrite | Pb5.9Fe0.1Mn0.1In0.1Cd0.2Ag2.8Sb10.8S24 |
| Pb | ⓘ Robinsonite | Pb4Sb6S13 |
| Pb | ⓘ Semseyite | Pb9Sb8S21 |
| Pb | ⓘ Zinkenite | Pb9Sb22S42 |
| Pb | ⓘ Plumosite | Pb2Sb2S5 |
| Bi | Bismuth | |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Emplectite | CuBiS2 |
| Bi | ⓘ Jaskólskiite | CuxPb2+x(Sb,Bi)2-xS5 (x ~ 0.15) |
| Bi | ⓘ Wittichenite | Cu3BiS3 |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Localities in this Region
- Prešov Region
- Prešov District
- Zlatá Baňa
- Prešov District
Other Regions, Features and Areas that Intersect
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.




Base metal deposit, Zlatá Baňa deposit, Zlatá Baňa, Prešov District, Prešov Region, Slovakia