Cue Shire, Western Australia, Australiai
| Regional Level Types | |
|---|---|
| Cue Shire | Shire |
| Western Australia | State |
| Australia | Country |
This page is currently not sponsored. Click here to sponsor this page.
Gold was discovered in the Cue area in 1892, then Coolgardie 1893, and Kalgoorlie 1894. Together it led to the greatest goldrush in Australia's history. By 1903, gold accounted for 83% of Western Australia's income.
The credit for the discovery of gold at Cue should probably go to an aboriginal gentleman who went by the name of Governor. He gave a 10 ounce nugget he found at Cuddingwarra, which is 12 kilometres west of Cue, to prospector Michael Fitzgerald. However Governor directed Michael to what he said was the better gold area now known as Cue. Michael found in the first week 260 ounces of gold at the former Kintore Blow site, which was located in the Cue townsite. A friend of Michael Fitzgerald was Tom Cue, who travelled 80 kilometres north to Nannine, to register the claim on his friend's behalf. Because Tom's name was registered on the claim papers, the town that developed was named Cue.
By 1900, there was 10 000 people living at Cue, compared to 328 today. The population of the town declined after the combined effects of low gold prices, men leaving to join the army for World War One, and the Great Depression. There are a number of substantial historic buildings still standing in the town.
Cue's sister town was Day Dawn, 8 kilometres south west. Within a month of the Cue discovery, a gold reef shining in the sun, was discovered at Day Dawn. The Day Dawn, Rubicon and Day Dawn West Mines started here shortly after. These were consolidated into the Great Fingall Mine in 1898, named after the company who purchased it, the Great Fingall Consolidated Gold Mining Company. The mine closed in 1918, but during this time was considered one of the largest gold mines in Australia producing 1.2 million ounces.
The closure of the mine effectively led to the abandonment of Day Dawn. By 1921 the underground mine had collapsed, and by the 1930's, the only building to remain (as is today) was the Great Fingall Company mine office.
I found this quote about Day Dawn published in 1896, and reproduced in a heritage assessment, which gives an idea of the town at the time:
' The town itself is small and unpretentiously built, but the sanitation is dreadful. There are three fairly stocked stores, and one chemist shop, albeit the chemist is taking a 'well earned rest' in hospital suffering from typhoid and the shop is closed. There are three licenced houses, and with a few dwelling houses, hessian camps, and brush humpies, the town is complete. The prominent feature is the big mine set on a hillock at the end of town. It is called Day Dawn, and is consolidated with Rubicon and Day Dawn West. The mine is both conscentiously worked and developed, but no dividend has been paid yet. It employs 200 men and has been working for two years.'
Gold mines near Cue include Victory 1 km north; Cuddingwarra, Golden Gate and Black Swan South 8 kms west north-west; Big Bell 16 kms west north-west; City of Chester 10 kms north west; Day Dawn, Rubicon, Great Fingall and Golden Crown which are virtually next to each other 8 kms south-west
The credit for the discovery of gold at Cue should probably go to an aboriginal gentleman who went by the name of Governor. He gave a 10 ounce nugget he found at Cuddingwarra, which is 12 kilometres west of Cue, to prospector Michael Fitzgerald. However Governor directed Michael to what he said was the better gold area now known as Cue. Michael found in the first week 260 ounces of gold at the former Kintore Blow site, which was located in the Cue townsite. A friend of Michael Fitzgerald was Tom Cue, who travelled 80 kilometres north to Nannine, to register the claim on his friend's behalf. Because Tom's name was registered on the claim papers, the town that developed was named Cue.
By 1900, there was 10 000 people living at Cue, compared to 328 today. The population of the town declined after the combined effects of low gold prices, men leaving to join the army for World War One, and the Great Depression. There are a number of substantial historic buildings still standing in the town.
Cue's sister town was Day Dawn, 8 kilometres south west. Within a month of the Cue discovery, a gold reef shining in the sun, was discovered at Day Dawn. The Day Dawn, Rubicon and Day Dawn West Mines started here shortly after. These were consolidated into the Great Fingall Mine in 1898, named after the company who purchased it, the Great Fingall Consolidated Gold Mining Company. The mine closed in 1918, but during this time was considered one of the largest gold mines in Australia producing 1.2 million ounces.
The closure of the mine effectively led to the abandonment of Day Dawn. By 1921 the underground mine had collapsed, and by the 1930's, the only building to remain (as is today) was the Great Fingall Company mine office.
I found this quote about Day Dawn published in 1896, and reproduced in a heritage assessment, which gives an idea of the town at the time:
' The town itself is small and unpretentiously built, but the sanitation is dreadful. There are three fairly stocked stores, and one chemist shop, albeit the chemist is taking a 'well earned rest' in hospital suffering from typhoid and the shop is closed. There are three licenced houses, and with a few dwelling houses, hessian camps, and brush humpies, the town is complete. The prominent feature is the big mine set on a hillock at the end of town. It is called Day Dawn, and is consolidated with Rubicon and Day Dawn West. The mine is both conscentiously worked and developed, but no dividend has been paid yet. It employs 200 men and has been working for two years.'
Gold mines near Cue include Victory 1 km north; Cuddingwarra, Golden Gate and Black Swan South 8 kms west north-west; Big Bell 16 kms west north-west; City of Chester 10 kms north west; Day Dawn, Rubicon, Great Fingall and Golden Crown which are virtually next to each other 8 kms south-west
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities94 valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Antimony | 1.CA.05 | Sb |
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Stützite | 2.BA.65 | Ag5-xTe3, x = 0.24-0.36 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Breithauptite | 2.CC.05 | NiSb |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Mackinawite | 2.CC.25 | FeS |
| ⓘ | Altaite | 2.CD.10 | PbTe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Tellurobismuthite | 2.DC.05 | Bi2Te3 |
| ⓘ | Tetradymite | 2.DC.05 | Bi2Te2S |
| ⓘ | Tsumoite | 2.DC.05 | BiTe |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Ullmannite | 2.EB.25 | NiSbS |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Poubaite | 2.GC.40c | PbBi2(Se,Te,S)4 |
| ⓘ | Rucklidgeite | 2.GC.40c | PbBi2Te4 |
| ⓘ | Berthierite | 2.HA.20 | FeSb2S4 |
| ⓘ | Aikinite | 2.HB.05a | CuPbBiS3 |
| ⓘ | Volynskite | 2.JA.20 | AgBiTe2 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Chrysoberyl var. Alexandrite | 4.BA.05 | BeAl2O4 |
| ⓘ | 4.BA.05 | BeAl2O4 | |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Hematite var. Martite | 4.CB.05 | Fe2O3 |
| ⓘ | Corundum var. Ruby | 4.CB.05 | Al2O3 |
| ⓘ | var. Sapphire | 4.CB.05 | Al2O3 |
| ⓘ | Bismite | 4.CB.60 | Bi2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Ferberite | 4.DB.30 | FeWO4 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
| ⓘ | Tantalite-(Fe) | 4.DB.35 | Fe2+Ta2O6 |
| ⓘ | Columbite-(Mn) | 4.DB.35 | Mn2+Nb2O6 |
| ⓘ | Koechlinite | 4.DE.15 | Bi2MoO6 |
| ⓘ | Russellite | 4.DE.15 | Bi2WO6 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Wagnerite | 8.BB.15 | Mg2(PO4)F |
| ⓘ | Rockbridgeite | 8.BC.10 | (Fe2+0.5Fe3+0.5)2Fe3+3(PO4)3(OH)5 |
| Group 9 - Silicates | |||
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | var. Emerald | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Cordierite | 9.CJ.10 | Mg2Al4Si5O18 |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Hedenbergite | 9.DA.15 | CaFe2+Si2O6 |
| ⓘ | Anthophyllite | 9.DD.05 | ◻Mg2Mg5(Si8O22)(OH)2 |
| ⓘ | Cummingtonite | 9.DE.05 | ◻Mg2Mg5(Si8O22)(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Babingtonite | 9.DK.05 | Ca2Fe2+Fe3+Si5O14(OH) |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Minnesotaite | 9.EC.05 | Fe2+3Si4O10(OH)2 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Margarite | 9.EC.30 | CaAl2(Al2Si2O10)(OH)2 |
| ⓘ | Nontronite | 9.EC.40 | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ | Chamosite | 9.EC.55 | Fe2+5Al(AlSi3O10)(OH)8 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Cronstedtite | 9.ED.15 | Fe2+2Fe3+((Si,Fe3+)2O5)(OH)4 |
| ⓘ | Greenalite | 9.ED.15 | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Stilpnomelane | 9.EG.40 | K4Fe2+48[Si64Al8]O164(OH)52 · nH2O |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| Unclassified | |||
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Lepidolite' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Tantalite' | - | (Mn,Fe)(Ta,Nb)2O6 |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Zinnwaldite' | - | |
| ⓘ | 'Melnikovite' | - | |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| H | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Cronstedtite | Fe22+Fe3+((Si,Fe3+)2O5)(OH)4 |
| H | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Greenalite | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| H | ⓘ Minnesotaite | Fe32+Si4O10(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Zinnwaldite | |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Li | Lithium | |
| Li | ⓘ Zinnwaldite | |
| Be | Beryllium | |
| Be | ⓘ Chrysoberyl var. Alexandrite | BeAl2O4 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Chrysoberyl | BeAl2O4 |
| Be | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Chrysoberyl var. Alexandrite | BeAl2O4 |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bismite | Bi2O3 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Chrysoberyl | BeAl2O4 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Cordierite | Mg2Al4Si5O18 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Cronstedtite | Fe22+Fe3+((Si,Fe3+)2O5)(OH)4 |
| O | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Ferberite | FeWO4 |
| O | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| O | ⓘ Tantalite-(Fe) | Fe2+Ta2O6 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Greenalite | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| O | ⓘ Hedenbergite | CaFe2+Si2O6 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Koechlinite | Bi2MoO6 |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| O | ⓘ Hematite var. Martite | Fe2O3 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Minnesotaite | Fe32+Si4O10(OH)2 |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| O | ⓘ Corundum var. Ruby | Al2O3 |
| O | ⓘ Russellite | Bi2WO6 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Corundum var. Sapphire | Al2O3 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Wagnerite | Mg2(PO4)F |
| O | ⓘ Zinnwaldite | |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Wagnerite | Mg2(PO4)F |
| F | ⓘ Zinnwaldite | |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Cordierite | Mg2Al4Si5O18 |
| Mg | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Wagnerite | Mg2(PO4)F |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Chrysoberyl var. Alexandrite | BeAl2O4 |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Al | ⓘ Chrysoberyl | BeAl2O4 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Cordierite | Mg2Al4Si5O18 |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Corundum var. Ruby | Al2O3 |
| Al | ⓘ Corundum var. Sapphire | Al2O3 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Zinnwaldite | |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Cordierite | Mg2Al4Si5O18 |
| Si | ⓘ Cronstedtite | Fe22+Fe3+((Si,Fe3+)2O5)(OH)4 |
| Si | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Greenalite | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| Si | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Minnesotaite | Fe32+Si4O10(OH)2 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Zinnwaldite | |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| P | ⓘ Wagnerite | Mg2(PO4)F |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Aikinite | CuPbBiS3 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Berthierite | FeSb2S4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Galena | PbS |
| S | ⓘ Mackinawite | FeS |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Poubaite | PbBi2(Se,Te,S)4 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stannite | Cu2FeSnS4 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Tetradymite | Bi2Te2S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Ullmannite | NiSbS |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| K | ⓘ Zinnwaldite | |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Ca | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Mn | Manganese | |
| Mn | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| Fe | ⓘ Berthierite | FeSb2S4 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Cronstedtite | Fe22+Fe3+((Si,Fe3+)2O5)(OH)4 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ferberite | FeWO4 |
| Fe | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Fe | ⓘ Tantalite-(Fe) | Fe2+Ta2O6 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Greenalite | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| Fe | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Mackinawite | FeS |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Hematite var. Martite | Fe2O3 |
| Fe | ⓘ Minnesotaite | Fe32+Si4O10(OH)2 |
| Fe | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Fe | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| Fe | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Fe | ⓘ Zinnwaldite | |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Ni | Nickel | |
| Ni | ⓘ Breithauptite | NiSb |
| Ni | ⓘ Ullmannite | NiSbS |
| Cu | Copper | |
| Cu | ⓘ Aikinite | CuPbBiS3 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Löllingite | FeAs2 |
| Se | Selenium | |
| Se | ⓘ Poubaite | PbBi2(Se,Te,S)4 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Nb | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Nb | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Mo | Molybdenum | |
| Mo | ⓘ Koechlinite | Bi2MoO6 |
| Mo | ⓘ Molybdenite | MoS2 |
| Ag | Silver | |
| Ag | ⓘ Stützite | Ag5-xTe3, x = 0.24-0.36 |
| Ag | ⓘ Volynskite | AgBiTe2 |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sb | Antimony | |
| Sb | ⓘ Native Antimony | Sb |
| Sb | ⓘ Berthierite | FeSb2S4 |
| Sb | ⓘ Breithauptite | NiSb |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Ullmannite | NiSbS |
| Te | Tellurium | |
| Te | ⓘ Altaite | PbTe |
| Te | ⓘ Poubaite | PbBi2(Se,Te,S)4 |
| Te | ⓘ Rucklidgeite | PbBi2Te4 |
| Te | ⓘ Stützite | Ag5-xTe3, x = 0.24-0.36 |
| Te | ⓘ Tellurobismuthite | Bi2Te3 |
| Te | ⓘ Tetradymite | Bi2Te2S |
| Te | ⓘ Tsumoite | BiTe |
| Te | ⓘ Volynskite | AgBiTe2 |
| Ta | Tantalum | |
| Ta | ⓘ Tantalite-(Fe) | Fe2+Ta2O6 |
| Ta | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| W | Tungsten | |
| W | ⓘ Ferberite | FeWO4 |
| W | ⓘ Russellite | Bi2WO6 |
| W | ⓘ Scheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Aikinite | CuPbBiS3 |
| Pb | ⓘ Altaite | PbTe |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Poubaite | PbBi2(Se,Te,S)4 |
| Pb | ⓘ Rucklidgeite | PbBi2Te4 |
| Bi | Bismuth | |
| Bi | ⓘ Aikinite | CuPbBiS3 |
| Bi | ⓘ Bismite | Bi2O3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Koechlinite | Bi2MoO6 |
| Bi | ⓘ Poubaite | PbBi2(Se,Te,S)4 |
| Bi | ⓘ Rucklidgeite | PbBi2Te4 |
| Bi | ⓘ Russellite | Bi2WO6 |
| Bi | ⓘ Tellurobismuthite | Bi2Te3 |
| Bi | ⓘ Tetradymite | Bi2Te2S |
| Bi | ⓘ Tsumoite | BiTe |
| Bi | ⓘ Volynskite | AgBiTe2 |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Localities in this Region
- Western Australia
- Cue Shire
- Coodardy Station
- Cue
- Big Bell Gold Mine (Paton's Find; Murchison Bell)
- Callie Soak (Good Shot; Socialist)
- Cuddingwarra Goldfield
- Black Swan Mine
- Black Swan Rapier 2 Mine
- Black Swan Rapier 3 Mine
- Black Swan Rapier Mine
- Black Swan South Gold Mine
- Blue Bell Proprietary Co Ltd Mine
- Canterbury Mine
- Canterbury West Mine
- Chester East Mine
- Chieftain Central Pit
- Chieftain North pit
- Chieftain South pit
- Chunderloo Mine
- City of Chester East prospect
- City of Chester Gold Mine
- City of Sydney East Mine
- City of Sydney Mine
- City of Sydney North Mine
- City of Sydney West Mine
- Coventry Mine
- Coventry South Mine
- Cuddingwarra-Golden Crown pit
- Cuddingwarra North prospect
- Cuddingwarra South prospect
- Discovery Shoot deposit
- Dubbo prospect
- Fairlight prospect
- Fleece Pool prospect
- Fortune of War Gold Mine
- Fortune of War Mine
- Gem of Cuddingwarra
- Golden Chariot Mine
- Golden Gate Gold Mine
- Golden Gate North prospect
- Golden King Victory United Mine
- Greymouth Mine
- Jim's Find
- Lady Muriel Mine
- Lady Muriel South Mine
- Lady Muriel South West 1
- Lady Muriel South West 2
- Lady Rosie Mine
- Laura Mine
- Never Can Tell Mine
- Rheingold South Mine
- Rhinegold Mine
- Royal Mint Mine
- Siege of Paris Gold Mine
- Snake Mine
- South Victory Mine
- South Victory North 1
- South Victory North 2
- South Victory South Mine
- Victory United Gold Mine
- Well Caught Mine
- William Mine
- Cue Goldfield
- ⭔Caledonian Hill gold area
- Cue One Gold Mine (Cue No 1; Cue No 1 Proprietary)
- Cue Victory Gold Mine
- Eclipse Gold Mine
- Gem of Cue Gold Mine (Gladstone)
- Hidden Treasure Gold Mine
- Light of Asia Gold Mine
- New Eldorado Gold Mine (Eldorado; Three Crowns)
- Red White and Blue Gold Mine
- Salisbury Gold Mine
- Tasmania Gold Mine
- Volunteer group
- Curtis Find P.A.
- Day Dawn Goldfield
- Harris' Find Gold Mine
- Little Bell Gold Mine
- Welcome deposit
- Glen Station
- Lakeside Station
- Cue Shire
- Western Australia
- Cue Shire
- Lakeside Station
- Madoonga Station
- Nallan Station
- Poona
- Aga Khan Mine
- Catherine Trench
- Cook Mine
- Doreen prospect
- Emerald Pool mine (Emerald Gem mine; East Poona mine)
- Garnet and beryl shafts
- Ginos prospect
- Goodwin Mine
- Great Eastern Mine
- Lees Trench
- Mid-Section mine
- Murchison Beryl Crown Lands Mine
- Patons lode
- Poona East Iron prospect
- Poona Fluorite prospect
- Poona Goodwin
- Poona North
- Poona Talc occurrence
- Quartz Blow opencut mine
- Reward Claim (Mount Ryan lease)
- Ruby mine
- Russellite pegmatite
- Solomon open cut (King Solomons mine)
- The Raj
- Tin Hill (White Lode; White Hill; Tin Shafts; White Tin Lode; Poona Tin Mine; Pride of Poona; Harrison and Hewitts Lode)
- Watkins Mine
- White Lode
- Quinns gold area
- Reedy's Goldfield
- Boomerang Gold Mine
- Callisto Gold Mine
- Culculli Gold Mine
- Culculli North Gold Mine (Thompsons Bore)
- Emu NorthMine (Mararoa; Emu gold mine)
- Jack Ryan Gold Mine (Rand)
- Kurara Gold Mine
- Midway Gold Mine
- Missing Link Gold Mine
- South Emu Opencut (South Emu Gold Mine)
- Triton Gold Mine
- Turn of the Tide Gold Mine
- The Island Goldfield (Austin)
- Blackman's Find Gold Mine (Moonlight)
- Chicago Gold Mine (Chicago United; Shamrock; Island Eureka South)
- Golconda Gold Mine
- Ironclad Gold Mine (Island Lake Austin)
- Island Eureka Gold Mine
- Louise Gold Mine
- Mainland Consols Gold Mine (Mainland; Daly's; Last Chance)
- Moyagee Gold Mine
- New Orient Gold Mine (Orient)
- ⭔Webb's Patch gold area
- Tuckabianna Goldfield
- Causton's Gold Mine
- Comet Gold Mine
- Comet North Gold Mine
- Eaglehawk Gold Mine
- Eclipse Gold Mine
- Eelya (Mount Eelya; Colonel; Rapier; Hollandaire)
- Friars Gold Mine
- Genesis Gold Mine
- Gilt Edge Gold Mine
- Jaffas Folly Gold Mine
- Jasper Queen Gold Mine
- Jules Reward Gold Mine
- Katies Gold Mine
- Little John Gold Mine
- Mercury Gold Mine
- Pinnacles Gold Mine
- Sherwood Gold Mine
- Tuckabianna Gold Mine
- Tuckabianna West Gold Mine
- Venus Gold Mine
- White Well Gold Mine
- Tuckanarra Goldfield
- Twelve Mile Well
- Cue Shire
Other Regions, Features and Areas that Intersect
Australia
- Western Australia
- Warakurna Large Igneous ProvinceGeologic Province
- West Australian ElementCraton
- Yilgarn CratonCraton
Australian PlateTectonic Plate
- West Australian Craton
- Western Yilgarn CratonCraton
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.




Light of Asia Gold Mine, Cue Goldfield, Cue, Cue Shire, Western Australia, Australia