This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Porto | 249,633 (2018) |
| Vila Nova de Gaia | 70,811 (2018) |
| Felgueiras | 58,065 (2018) |
| Rio Tinto | 49,966 (2018) |
| Ermesinde | 39,420 (2018) |
| Maia | 36,426 (2014) |
Other Languages:
French:
Porto, Portugal
German:
Distrikt Porto, Portugal
Italian:
distretto di Porto, Portogallo
Portuguese:
Porto, Portugal
Russian:
Порту, Португалия
Simplified Chinese:
波爾圖區, 葡萄牙
Spanish:
Distrito de Oporto, Portugal
Arabic:
بورتو, البرتغال
Aragonese:
Destrito de Porto
Asturian:
Distritu de Porto
Basque:
Porto
Belarusian:
акруга Порту, Партугалія
Breton:
Distrig Porto
Bulgarian:
Порту, Португалия
Catalan:
districte de Porto, Portugal
Cebuano:
Distrito do Porto
Dutch:
Porto, Portugal
Esperanto:
distrikto Porto
Finnish:
Porton piiri, Portugali
Galician:
Distrito do Porto, Portugal
Indonesian:
Distrik Porto, Portugal
Japanese:
ポルト県, ポルトガル
Judaeo-Spanish:
Oporto
Korean:
포르투, 포르투갈
Latin:
Portus Cale
Limburgian:
Porto
Macedonian:
Порто, Португалија
Malay:
Daerah Porto
Minnan / Hokkien-Taiwanese:
Porto Koān
Mirandese:
Çtrito de l Porto
Norwegian:
Porto, Portugal
Quechua:
Porto distritu
Romanian:
Districtul Porto, Portugalia
Scots:
Porto Destrict
Serbian:
Порто, Португалија
Swedish:
Porto, Portugal
Traditional Chinese:
波圖區
Ukrainian:
Порту, Португалія
Urdu:
پورتو ضلع
Vietnamese:
Porto, Bồ Đào Nha
Waray:
Porto
Welsh:
Ardal Porto, Portiwgal
Western Punjabi:
ضلع پورتو
Eighteen municipalities:
Amarante
Baião
Felgueiras
Gondomar
Lousada
Maia
Marco de Canaveses
Matosinhos
Paços de Ferreira
Paredes
Penafiel
Porto
Póvoa de Varzim
Santo Tirso
Trofa
Valongo
Vila do Conde
Vila Nova de Gaia
Amarante
Baião
Felgueiras
Gondomar
Lousada
Maia
Marco de Canaveses
Matosinhos
Paços de Ferreira
Paredes
Penafiel
Porto
Póvoa de Varzim
Santo Tirso
Trofa
Valongo
Vila do Conde
Vila Nova de Gaia
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities86 valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S |
| ⓘ Albite Formula: Na(AlSi3O8) References: |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 Locality: Espinho, Porto, Portugal |
| ⓘ Amblygonite Formula: LiAl(PO4)F References: |
| ⓘ Andalusite Formula: Al2(SiO4)O Localities: |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A References: |
| ⓘ Arsenopyrite Formula: FeAsS Localities: Reported from at least 26 localities in this region. |
| ⓘ Augelite Formula: Al2(PO4)(OH)3 References: |
| ⓘ Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O References: |
| ⓘ Berthierite Formula: FeSb2S4 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ Beudantite Formula: PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bismuthinite Formula: Bi2S3 References: |
| ⓘ Carminite Formula: PbFe3+2(AsO4)2(OH)2 |
| ⓘ Cassiterite Formula: SnO2 Localities: Reported from at least 17 localities in this region. |
| ⓘ Cervantite Formula: Sb3+Sb5+O4 |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Childrenite Formula: Fe2+Al(PO4)(OH)2 · H2O References: |
| ⓘ 'Chlorite Group' References: |
| ⓘ Chrysoberyl Formula: BeAl2O4 References: |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' |
| ⓘ 'Columbite-Tantalite' References: |
| ⓘ Cookeite Formula: (LiAl4◻)[AlSi3O10](OH)8 References: |
| ⓘ Coquandite Formula: Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| ⓘ Covellite Formula: CuS References: |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Enargite Formula: Cu3AsS4 |
| ⓘ Eosphorite Formula: Mn2+Al(PO4)(OH)2 · H2O References: |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Evansite Formula: Al3(PO4)(OH)6 · 6H2O |
| ⓘ 'Feldspar Group' Localities: Reported from at least 15 localities in this region. |
| ⓘ Ferronigerite-2N1S Formula: (Al,Fe,Zn)2(Al,Sn)6O11(OH) Localities: Tapada da Bemposta No.1 Mine, Seixoso Mining Field, Borba de Godim, Vila Cova da Lixa e Borba de Godim, Felgueiras, Porto, Portugal Vieiros Mines, Rebordelo, Amarante, Porto, Portugal Seixoso Mine, Seixoso Mining Field, Borba de Godim, Vila Cova da Lixa e Borba de Godim, Felgueiras, Porto, Portugal ? (more information) Colour: Reddish brown |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fülöppite Formula: Pb3Sb8S15 References: |
| ⓘ Gahnite Formula: ZnAl2O4 |
| ⓘ Galena Formula: PbS |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Goyazite Formula: SrAl3(PO4)(PO3OH)(OH)6 References: |
| ⓘ Graphite Formula: C References: |
| ⓘ Hematite Formula: Fe2O3 References: |
| ⓘ Heteromorphite Formula: Pb7Sb8S19 |
| ⓘ Hidalgoite Formula: PbAl3(AsO4)(SO4)(OH)6 |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Iodargyrite Formula: AgI |
| ⓘ Jamesonite Formula: Pb4FeSb6S14 |
| ⓘ Kermesite Formula: Sb2S2O |
| ⓘ 'K Feldspar' |
| ⓘ Klebelsbergite Formula: Sb4O4(SO4)(OH)2 |
| ⓘ Kyanite Formula: Al2(SiO4)O |
| ⓘ Lazulite Formula: MgAl2(PO4)2(OH)2 References: |
| ⓘ Lepidocrocite Formula: Fe3+O(OH) |
| ⓘ 'Limonite' |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 References: |
| ⓘ Mansfieldite Formula: AlAsO4 · 2H2O |
| ⓘ Meta-autunite Formula: Ca(UO2)2(PO4)2 · 6H2O References: |
| ⓘ Metastibnite Formula: Sb2S3 |
| ⓘ Metatorbernite Formula: Cu(UO2)2(PO4)2 · 8H2O References: |
| ⓘ 'Mica Group' |
| ⓘ 'Microlite Group' Formula: A2-mTa2X6-wZ1-n References: |
| ⓘ Mitridatite Formula: Ca2Fe3+3(PO4)3O2 · 3H2O References: |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Montebrasite Formula: LiAl(PO4)(OH) References: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Muscovite var. Phengite Formula: KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 References: |
| ⓘ Native Antimony Formula: Sb |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Copper Formula: Cu References: |
| ⓘ Native Gold Formula: Au Localities: Reported from at least 17 localities in this region. |
| ⓘ Native Gold var. Electrum Formula: (Au,Ag) |
| ⓘ Native Silver Formula: Ag |
| ⓘ Native Sulphur Formula: S8 |
| ⓘ Petalite Formula: LiAl(Si4O10) References: |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 References: |
| ⓘ 'Psilomelane' |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 30 localities in this region. |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 47 localities in this region. |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Sabugalite Formula: HAl(UO2)4(PO4)4 · 16H2O |
| ⓘ Salammoniac Formula: NH4Cl References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O |
| ⓘ Senarmontite Formula: Sb2O3 |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Sillimanite Formula: Al2(SiO4)O References: |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 8 localities in this region. |
| ⓘ Spodumene Formula: LiAlSi2O6 References: |
| ⓘ Staurolite Formula: Fe2+2Al9Si4O23(OH) |
| ⓘ Stibiconite Formula: Sb3+Sb5+2O6(OH) References: |
| ⓘ Stibnite Formula: Sb2S3 Localities: Reported from at least 21 localities in this region. |
| ⓘ 'Tantalite' Formula: (Mn,Fe)(Ta,Nb)2O6 Localities: Vieiros Mines, Rebordelo, Amarante, Porto, Portugal Gestaçô Mines, Gestaçô, Baião, Porto, Portugal Teixo Mines, Teixeira, Teixeira e Teixeiró, Baião, Porto, Portugal Vieiros Mining Field, Canadelo, Olo e Canadelo, Amarante, Porto, Portugal Seixoso Mining Field, Borba de Godim, Vila Cova da Lixa e Borba de Godim, Felgueiras, Porto, Portugal |
| ⓘ Tetrahedrite-(Fe) Formula: Cu6(Cu4Fe2+2)Sb4S12S References: |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| ⓘ Titanite Formula: CaTiO(SiO4) |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z References: |
| ⓘ Triplite Formula: Mn2+2(PO4)F |
| ⓘ Tripuhyite Formula: Fe3+Sb5+O4 References: |
| ⓘ Valentinite Formula: Sb2O3 |
| ⓘ Vivianite Formula: Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ 'Wolframite Group' Localities: Reported from at least 7 localities in this region. |
| ⓘ Wollastonite Formula: Ca3(Si3O9) References: |
| ⓘ Zinconigerite-2N1S Formula: (Zn,Al,Mg)2(Al,Sn)6O11(OH) References: |
| ⓘ 'Zinnwaldite' References: |
| ⓘ Zircon Formula: Zr(SiO4) References: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold var. Electrum | 1.AA.05 | (Au,Ag) |
| ⓘ | 1.AA.05 | Au | |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Antimony | 1.CA.05 | Sb |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Metastibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Kermesite | 2.FD.05 | Sb2S2O |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Tetrahedrite-(Fe) | 2.GB.05 | Cu6(Cu4Fe2+2)Sb4S12S |
| ⓘ | Berthierite | 2.HA.20 | FeSb2S4 |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | Fülöppite | 2.HC.10a | Pb3Sb8S15 |
| ⓘ | Heteromorphite | 2.HC.10c | Pb7Sb8S19 |
| ⓘ | Enargite | 2.KA.05 | Cu3AsS4 |
| Group 3 - Halides | |||
| ⓘ | Iodargyrite | 3.AA.10 | AgI |
| ⓘ | Salammoniac | 3.AA.25 | NH4Cl |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | 'Microlite Group' | 4.00. | A2-mTa2X6-wZ1-n |
| ⓘ | Quartz var. Chalcedony | 4.00.05 | SiO2 |
| ⓘ | 4.00.05 | SiO2 | |
| ⓘ | var. Smoky Quartz | 4.00.05 | SiO2 |
| ⓘ | Chrysoberyl | 4.BA.05 | BeAl2O4 |
| ⓘ | Gahnite | 4.BB.05 | ZnAl2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Senarmontite | 4.CB.50 | Sb2O3 |
| ⓘ | Valentinite | 4.CB.55 | Sb2O3 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Tripuhyite | 4.DB.05 | Fe3+Sb5+O4 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Cervantite | 4.DE.30 | Sb3+Sb5+O4 |
| ⓘ | Stibiconite | 4.DH.20 | Sb3+Sb5+2O6(OH) |
| ⓘ | Ferronigerite-2N1S | 4.FC.20 | (Al,Fe,Zn)2(Al,Sn)6O11(OH) |
| ⓘ | Zinconigerite-2N1S | 4.FC.20 | (Zn,Al,Mg)2(Al,Sn)6O11(OH) |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| ⓘ | Lepidocrocite | 4.FE.15 | Fe3+O(OH) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Klebelsbergite | 7.BB.35 | Sb4O4(SO4)(OH)2 |
| ⓘ | Coquandite | 7.DE.35 | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Amblygonite | 8.BB.05 | LiAl(PO4)F |
| ⓘ | Montebrasite | 8.BB.05 | LiAl(PO4)(OH) |
| ⓘ | Triplite | 8.BB.10 | Mn2+2(PO4)F |
| ⓘ | Lazulite | 8.BB.40 | MgAl2(PO4)2(OH)2 |
| ⓘ | Augelite | 8.BE.05 | Al2(PO4)(OH)3 |
| ⓘ | Carminite | 8.BH.30 | PbFe3+2(AsO4)2(OH)2 |
| ⓘ | Beudantite | 8.BL.05 | PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ | Hidalgoite | 8.BL.05 | PbAl3(AsO4)(SO4)(OH)6 |
| ⓘ | Goyazite | 8.BL.10 | SrAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Mansfieldite | 8.CD.10 | AlAsO4 · 2H2O |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Vivianite | 8.CE.40 | Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ | Childrenite | 8.DD.20 | Fe2+Al(PO4)(OH)2 · H2O |
| ⓘ | Eosphorite | 8.DD.20 | Mn2+Al(PO4)(OH)2 · H2O |
| ⓘ | Evansite | 8.DF.10 | Al3(PO4)(OH)6 · 6H2O |
| ⓘ | Mitridatite | 8.DH.30 | Ca2Fe3+3(PO4)3O2 · 3H2O |
| ⓘ | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ | Meta-autunite | 8.EB.10 | Ca(UO2)2(PO4)2 · 6H2O |
| ⓘ | Metatorbernite | 8.EB.10 | Cu(UO2)2(PO4)2 · 8H2O |
| ⓘ | Sabugalite | 8.EB.55 | HAl(UO2)4(PO4)4 · 16H2O |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Spodumene | 9.DA.30 | LiAlSi2O6 |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Phengite | 9.EC.15 | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| ⓘ | Cookeite | 9.EC.55 | (LiAl4◻)[AlSi3O10](OH)8 |
| ⓘ | Petalite | 9.EF.05 | LiAl(Si4O10) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Tantalite' | - | (Mn,Fe)(Ta,Nb)2O6 |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Zinnwaldite' | - | |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Columbite-Tantalite' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | ⓘ Augelite | Al2(PO4)(OH)3 |
| H | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| H | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| H | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| H | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| H | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Evansite | Al3(PO4)(OH)6 · 6H2O |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| H | ⓘ Klebelsbergite | Sb4O4(SO4)(OH)2 |
| H | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| H | ⓘ Lepidocrocite | Fe3+O(OH) |
| H | ⓘ Mansfieldite | AlAsO4 · 2H2O |
| H | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| H | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| H | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| H | ⓘ Montebrasite | LiAl(PO4)(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Ferronigerite-2N1S | (Al,Fe,Zn)2(Al,Sn)6O11(OH) |
| H | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| H | ⓘ Sabugalite | HAl(UO2)4(PO4)4 · 16H2O |
| H | ⓘ Salammoniac | NH4Cl |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| H | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| H | ⓘ Zinnwaldite | |
| H | ⓘ Zinconigerite-2N1S | (Zn,Al,Mg)2(Al,Sn)6O11(OH) |
| Li | Lithium | |
| Li | ⓘ Amblygonite | LiAl(PO4)F |
| Li | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Li | ⓘ Montebrasite | LiAl(PO4)(OH) |
| Li | ⓘ Petalite | LiAl(Si4O10) |
| Li | ⓘ Spodumene | LiAlSi2O6 |
| Li | ⓘ Zinnwaldite | |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Chrysoberyl | BeAl2O4 |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Siderite | FeCO3 |
| N | Nitrogen | |
| N | ⓘ Salammoniac | NH4Cl |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Amblygonite | LiAl(PO4)F |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | ⓘ Augelite | Al2(PO4)(OH)3 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Cervantite | Sb3+Sb5+O4 |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| O | ⓘ Chrysoberyl | BeAl2O4 |
| O | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| O | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Evansite | Al3(PO4)(OH)6 · 6H2O |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Gahnite | ZnAl2O4 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Kermesite | Sb2S2O |
| O | ⓘ Klebelsbergite | Sb4O4(SO4)(OH)2 |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| O | ⓘ Lepidocrocite | Fe3+O(OH) |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Mansfieldite | AlAsO4 · 2H2O |
| O | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| O | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| O | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| O | ⓘ Montebrasite | LiAl(PO4)(OH) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Ferronigerite-2N1S | (Al,Fe,Zn)2(Al,Sn)6O11(OH) |
| O | ⓘ Petalite | LiAl(Si4O10) |
| O | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Sabugalite | HAl(UO2)4(PO4)4 · 16H2O |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Senarmontite | Sb2O3 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spodumene | LiAlSi2O6 |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| O | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Triplite | Mn22+(PO4)F |
| O | ⓘ Tripuhyite | Fe3+Sb5+O4 |
| O | ⓘ Valentinite | Sb2O3 |
| O | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Zinnwaldite | |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Zinconigerite-2N1S | (Zn,Al,Mg)2(Al,Sn)6O11(OH) |
| O | ⓘ Apatite | Ca5(PO4)3A |
| F | Fluorine | |
| F | ⓘ Amblygonite | LiAl(PO4)F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Triplite | Mn22+(PO4)F |
| F | ⓘ Zinnwaldite | |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| Mg | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Mg | ⓘ Zinconigerite-2N1S | (Zn,Al,Mg)2(Al,Sn)6O11(OH) |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Amblygonite | LiAl(PO4)F |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Augelite | Al2(PO4)(OH)3 |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| Al | ⓘ Chrysoberyl | BeAl2O4 |
| Al | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Al | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Evansite | Al3(PO4)(OH)6 · 6H2O |
| Al | ⓘ Gahnite | ZnAl2O4 |
| Al | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| Al | ⓘ Mansfieldite | AlAsO4 · 2H2O |
| Al | ⓘ Montebrasite | LiAl(PO4)(OH) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Ferronigerite-2N1S | (Al,Fe,Zn)2(Al,Sn)6O11(OH) |
| Al | ⓘ Petalite | LiAl(Si4O10) |
| Al | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Al | ⓘ Sabugalite | HAl(UO2)4(PO4)4 · 16H2O |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spodumene | LiAlSi2O6 |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Zinnwaldite | |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Zinconigerite-2N1S | (Zn,Al,Mg)2(Al,Sn)6O11(OH) |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Petalite | LiAl(Si4O10) |
| Si | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Spodumene | LiAlSi2O6 |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Zinnwaldite | |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| P | Phosphorus | |
| P | ⓘ Amblygonite | LiAl(PO4)F |
| P | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | ⓘ Augelite | Al2(PO4)(OH)3 |
| P | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| P | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| P | ⓘ Evansite | Al3(PO4)(OH)6 · 6H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| P | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| P | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| P | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| P | ⓘ Montebrasite | LiAl(PO4)(OH) |
| P | ⓘ Sabugalite | HAl(UO2)4(PO4)4 · 16H2O |
| P | ⓘ Triplite | Mn22+(PO4)F |
| P | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Berthierite | FeSb2S4 |
| S | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| S | ⓘ Covellite | CuS |
| S | ⓘ Enargite | Cu3AsS4 |
| S | ⓘ Fülöppite | Pb3Sb8S15 |
| S | ⓘ Galena | PbS |
| S | ⓘ Heteromorphite | Pb7Sb8S19 |
| S | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Kermesite | Sb2S2O |
| S | ⓘ Klebelsbergite | Sb4O4(SO4)(OH)2 |
| S | ⓘ Metastibnite | Sb2S3 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Tetrahedrite-(Fe) | Cu6(Cu4Fe22+)Sb4S12S |
| Cl | Chlorine | |
| Cl | ⓘ Salammoniac | NH4Cl |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| K | ⓘ Zinnwaldite | |
| Ca | Calcium | |
| Ca | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| Ca | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Mn | Manganese | |
| Mn | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| Mn | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Mn | ⓘ Triplite | Mn22+(PO4)F |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | Iron | |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Berthierite | FeSb2S4 |
| Fe | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Lepidocrocite | Fe3+O(OH) |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| Fe | ⓘ Ferronigerite-2N1S | (Al,Fe,Zn)2(Al,Sn)6O11(OH) |
| Fe | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Fe | ⓘ Tripuhyite | Fe3+Sb5+O4 |
| Fe | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| Fe | ⓘ Zinnwaldite | |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | ⓘ Tetrahedrite-(Fe) | Cu6(Cu4Fe22+)Sb4S12S |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Enargite | Cu3AsS4 |
| Cu | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Tetrahedrite-(Fe) | Cu6(Cu4Fe22+)Sb4S12S |
| Zn | Zinc | |
| Zn | ⓘ Gahnite | ZnAl2O4 |
| Zn | ⓘ Ferronigerite-2N1S | (Al,Fe,Zn)2(Al,Sn)6O11(OH) |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Zinconigerite-2N1S | (Zn,Al,Mg)2(Al,Sn)6O11(OH) |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| As | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| As | ⓘ Enargite | Cu3AsS4 |
| As | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| As | ⓘ Mansfieldite | AlAsO4 · 2H2O |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Sr | Strontium | |
| Sr | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Ag | ⓘ Iodargyrite | AgI |
| Ag | ⓘ Native Silver | Ag |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Ferronigerite-2N1S | (Al,Fe,Zn)2(Al,Sn)6O11(OH) |
| Sn | ⓘ Zinconigerite-2N1S | (Zn,Al,Mg)2(Al,Sn)6O11(OH) |
| Sb | Antimony | |
| Sb | ⓘ Native Antimony | Sb |
| Sb | ⓘ Berthierite | FeSb2S4 |
| Sb | ⓘ Cervantite | Sb3+Sb5+O4 |
| Sb | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| Sb | ⓘ Fülöppite | Pb3Sb8S15 |
| Sb | ⓘ Heteromorphite | Pb7Sb8S19 |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Kermesite | Sb2S2O |
| Sb | ⓘ Klebelsbergite | Sb4O4(SO4)(OH)2 |
| Sb | ⓘ Metastibnite | Sb2S3 |
| Sb | ⓘ Senarmontite | Sb2O3 |
| Sb | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Tripuhyite | Fe3+Sb5+O4 |
| Sb | ⓘ Valentinite | Sb2O3 |
| Sb | ⓘ Tetrahedrite-(Fe) | Cu6(Cu4Fe22+)Sb4S12S |
| I | Iodine | |
| I | ⓘ Iodargyrite | AgI |
| Ta | Tantalum | |
| Ta | ⓘ Microlite Group | A2-mTa2X6-wZ1-n |
| Ta | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Au | Gold | |
| Au | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| Pb | ⓘ Fülöppite | Pb3Sb8S15 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Heteromorphite | Pb7Sb8S19 |
| Pb | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Bi | Bismuth | |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| U | Uranium | |
| U | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| U | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| U | ⓘ Sabugalite | HAl(UO2)4(PO4)4 · 16H2O |
Fossils
There are 31 fossil localities from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 31 | |||||||||
|---|---|---|---|---|---|---|---|---|---|---|
| Youngest Fossil Listed | 299 Ma (Permian) | |||||||||
| Oldest Fossil Listed | 466 Ma (Middle Ordovician) | |||||||||
| Stratigraphic Units |
| |||||||||
| Fossils from Region | Click here to show the list. | |||||||||
| Fossil Localities | Click to show 5 fossil localities |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Porto_District |
|---|---|
| Wikidata ID: | Q322792 |
| GeoNames ID: | 2735941 |
Localities in this Region
- Porto
- ⭔Amarante
- ⭔Aboadela, Sanche e Várzea
- ⭔Amarante (São Gonçalo), Madalena, Cepelos e Gatão
- ⭔Ansiāes
- ⭔Bustelo, Carneiro e Carvalho de Rei
- ⭔Candemil
- ⭔Figueiró (Santiago e Santa Cristina)
- ⭔Fregim
- ⭔Freixo de Cima e de Baixo
- ⭔Fridão
- ⭔Gondar
- ⭔Gouveia (São Simão)
- ⭔Jazente
- ⭔Lomba
- ⭔Louredo
- ⭔Lufrei
- ⭔Mancelos
- ⭔Olo e Canadelo
- ⭔Padronelo
- ⭔Rebordelo
- ⭔Salvador do Monte
- ⭔Telões
- ⭔Travanca
- ⭔Vila Caiz
- ⭔Vila Chã do Marão
- ⭔Vila Garcia, Aboim e Chapa
- ⭔Vila Meã
- ⭔Baião
- ⭔Espinho
- ⭔Felgueiras
- ⭔Aião
- ⭔Airães
- ⭔Friande
- ⭔Idães
- ⭔Jugueiros
- ⭔Macieira da Lixa e Caramos
- ⭔Margaride (Santa Eulália) - Várzea - Lagares - Varziela e Moure
- ⭔Moure
- ⭔Pedreira, Rande e Sernande
- ⭔Penacova
- ⭔Pinheiro
- ⭔Pombeiro de Ribavizela
- ⭔Refontoura
- ⭔Regilde
- ⭔Revinhade
- ⭔Sendim
- ⭔Torrados e Sousa
- ⭔Unhão e Lordelo
- ⭔Vila Cova da Lixa e Borba de Godim
- ⭔Vila Fria e Vizela (São Jorge)
- ⭔Vila Verde e Santão
- ⭔Gondomar
- ⭔Lousada
- ⭔Maia
- ⭔Marco de Canaveses
- ⭔Alpendorada, Várzea e Torrão
- ⭔Avessadas e Rosém
- ⭔Banho e Carvalhosa
- ⭔Bem Viver
- ⭔Constance
- ⭔Marco
- ⭔Paredes de Viadores e Manhuncelos
- ⭔Penhalonga e Paços de Gaiolo
- ⭔Sande e São Lourenço do Douro
- ⭔Santo Isidoro e Livração
- ⭔Soalhães
- ⭔Sobretâmega
- ⭔Tabuado
- ⭔Várzea, Aliviada e Folhada
- ⭔Vila Boa de Quires e Maureles
- ⭔Vila Boa do Bispo
- ⭔Matosinhos
- ⭔Amarante
- Porto
- Matosinhos
- ⭔Paços de Ferreira
- ⭔Paredes
- ⭔Penafiel
- ⭔Abragão
- ⭔Boelhe
- ⭔Bustelo
- ⭔Cabeça Santa
- ⭔Canelas
- ⭔Capela
- ⭔Castelões
- ⭔Croca
- ⭔Duas Igrejas
- ⭔Eja
- ⭔Fonte Arcada
- ⭔Galegos
- ⭔Guilhufe e Urrô
- ⭔Irivo
- ⭔Lagares e Figueira
- ⭔Luzim e Vila Cova
- ⭔Oldrões
- ⭔Paço de Sousa
- ⭔Penafiel
- ⭔Perozelo
- ⭔Rans
- ⭔Recezinhos (São Mamede)
- ⭔Recezinhos (São Martinho)
- ⭔Rio de Moinhos
- ⭔Rio Mau
- ⭔Sebolido
- ⭔Termas de São Vicente
- ⭔Valpedre
- ⭔Porto
- ⭔Póvoa de Varzim
- ⭔Santo Tirso
- ⭔Trofa
- ⭔Valongo
- ⭔Vila do Conde
- ⭔Árvore
- ⭔Aveleda
- ⭔Azurara
- ⭔Bagunte, Ferreiró, Outeiro Maior e Parada
- ⭔Fajozes
- ⭔Fornelo e Vairão
- ⭔Gião
- ⭔Guilhabreu
- ⭔Junqueira
- ⭔Labruge
- ⭔Macieira da Maia
- ⭔Malta e Canidelo
- ⭔Mindelo
- ⭔Modivas
- ⭔Parada
- ⭔Retorta e Tougues
- ⭔Rio Mau e Arcos
- ⭔Touguinha e Touguinhó
- ⭔Vila Chã
- ⭔Vila do Conde
- ⭔Vilar de Pinheiro
- ⭔Vilar e Mosteiró
- ⭔Vila Nova de Gaia
Other Regions, Features and Areas that Intersect
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions
São Pedro da Cova Mine, São Pedro da Cova, Gondomar, Porto, Portugal