Medas, Gondomar, Porto, Portugali
| Regional Level Types | |
|---|---|
| Medas | Civil Parish |
| Gondomar | Municipality |
| Porto | District |
| Portugal | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Other Languages:
French:
Medas, Gondomar, Porto, Portugal
German:
Medas, Gondomar, Distrikt Porto, Portugal
Portuguese:
Medas, Gondomar, Porto, Portugal
Russian:
Медаш, Гондомар, Порту, Португалия
Simplified Chinese:
Medas, 贡多马尔, 波爾圖區, 葡萄牙
Spanish:
Medas, Gondomar, Distrito de Oporto, Portugal
Asturian:
Medas, Gondomar, Distritu de Porto
Cebuano:
Medas, Gondomar, Distrito do Porto
Dutch:
Medas, Gondomar, Porto, Portugal
Kazakh (Cyrillic Script):
Медаш
Turkish:
Medas, Gondomar, Portekiz
Parish of Gondomar municipality. Due to an administrative merger held in Jan 2013 a new and bigger parish was formed "União das Freguesias de Melres e Medas".
Registered mining concessions (up to 1962):
2161 Alto do Castelo no. 3 (As-Au), registered on 15-03-1946
2153 Tapada (As-Au), registered on 12-03-1946
2154 Pinheirinhos (As-Au), registered on 12-03-1946
1949 Alto do Castelo (As-Au-Ag), registered on 29-09-1938
313 Lugar de Vila Cova (As-Au), registered on 03-03-1900
263 Formiga (As), registered on 02-04-1897
232 Ribeiro do Sobrido (As-Au), registered on 11-01-1890 - Banjas mining field
206 Ribeiro do Rebentão (As), registered on 23-02-1888
186 Bouço (As), registered on 08-01-1886 - cancelled on 09-05-1951
172 Lugar da Fontinha (As), registered on 26-08-1884
168 Ribeiro da Serra (As-Au), registered on 24-05-1884
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities18 valid minerals.
Detailed Mineral List:
| ⓘ Berthierite Formula: FeSb2S4 |
| ⓘ Cervantite Formula: Sb3+Sb5+O4 |
| ⓘ Coquandite Formula: Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Fülöppite Formula: Pb3Sb8S15 References: |
| ⓘ Kermesite Formula: Sb2S2O |
| ⓘ Klebelsbergite Formula: Sb4O4(SO4)(OH)2 |
| ⓘ Metastibnite Formula: Sb2S3 |
| ⓘ Native Antimony Formula: Sb |
| ⓘ Native Gold Formula: Au |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Senarmontite Formula: Sb2O3 |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Stibiconite Formula: Sb3+Sb5+2O6(OH) References: |
| ⓘ Stibnite Formula: Sb2S3 |
| ⓘ Tetrahedrite-(Fe) Formula: Cu6(Cu4Fe2+2)Sb4S12S References: |
| ⓘ Valentinite Formula: Sb2O3 |
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Antimony | 1.CA.05 | Sb |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Metastibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Kermesite | 2.FD.05 | Sb2S2O |
| ⓘ | Tetrahedrite-(Fe) | 2.GB.05 | Cu6(Cu4Fe2+2)Sb4S12S |
| ⓘ | Berthierite | 2.HA.20 | FeSb2S4 |
| ⓘ | Fülöppite | 2.HC.10a | Pb3Sb8S15 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Senarmontite | 4.CB.50 | Sb2O3 |
| ⓘ | Valentinite | 4.CB.55 | Sb2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cervantite | 4.DE.30 | Sb3+Sb5+O4 |
| ⓘ | Stibiconite | 4.DH.20 | Sb3+Sb5+2O6(OH) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Klebelsbergite | 7.BB.35 | Sb4O4(SO4)(OH)2 |
| ⓘ | Coquandite | 7.DE.35 | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| H | ⓘ Klebelsbergite | Sb4O4(SO4)(OH)2 |
| H | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| C | Carbon | |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| O | Oxygen | |
| O | ⓘ Cervantite | Sb3+Sb5+O4 |
| O | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Kermesite | Sb2S2O |
| O | ⓘ Klebelsbergite | Sb4O4(SO4)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Senarmontite | Sb2O3 |
| O | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| O | ⓘ Valentinite | Sb2O3 |
| Mg | Magnesium | |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Si | Silicon | |
| Si | ⓘ Quartz | SiO2 |
| S | Sulfur | |
| S | ⓘ Berthierite | FeSb2S4 |
| S | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| S | ⓘ Fülöppite | Pb3Sb8S15 |
| S | ⓘ Kermesite | Sb2S2O |
| S | ⓘ Klebelsbergite | Sb4O4(SO4)(OH)2 |
| S | ⓘ Metastibnite | Sb2S3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Tetrahedrite-(Fe) | Cu6(Cu4Fe22+)Sb4S12S |
| Ca | Calcium | |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Fe | Iron | |
| Fe | ⓘ Berthierite | FeSb2S4 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Tetrahedrite-(Fe) | Cu6(Cu4Fe22+)Sb4S12S |
| Cu | Copper | |
| Cu | ⓘ Tetrahedrite-(Fe) | Cu6(Cu4Fe22+)Sb4S12S |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| Sb | Antimony | |
| Sb | ⓘ Native Antimony | Sb |
| Sb | ⓘ Berthierite | FeSb2S4 |
| Sb | ⓘ Cervantite | Sb3+Sb5+O4 |
| Sb | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| Sb | ⓘ Fülöppite | Pb3Sb8S15 |
| Sb | ⓘ Kermesite | Sb2S2O |
| Sb | ⓘ Klebelsbergite | Sb4O4(SO4)(OH)2 |
| Sb | ⓘ Metastibnite | Sb2S3 |
| Sb | ⓘ Senarmontite | Sb2O3 |
| Sb | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Valentinite | Sb2O3 |
| Sb | ⓘ Tetrahedrite-(Fe) | Cu6(Cu4Fe22+)Sb4S12S |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Fülöppite | Pb3Sb8S15 |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikidata ID: | Q1916042 |
|---|---|
| GeoNames ID: | 8012713 |
Localities in this Region
- Porto
- Gondomar
Other Regions, Features and Areas that Intersect
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Fontinha Mine, Medas, Gondomar, Porto, Portugal