Vercelli Province, Piedmont, Italyi
| Regional Level Types | |
|---|---|
| Vercelli Province | Province |
| Piedmont | Region |
| Italy | Country |
This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Vercelli | 45,593 (2014) |
| Borgosesia | 10,967 (2014) |
| Santhià | 8,079 (2014) |
| Gattinara | 8,001 (2014) |
| Trino | 6,953 (2014) |
| Crescentino | 6,003 (2014) |
Other Languages:
French:
Province de Verceil, Piémont, Italie
German:
Provinz Vercelli, Piemont, Italien
Italian:
Provincia di Vercelli, Piemonte, Italia
Russian:
Провинция Верчелли, Пьемонт, Италия
Simplified Chinese:
韋爾切利省, 皮埃蒙特, 意大利
Spanish:
Provincia de Vercelli, Piamonte, Italia
Albanian:
Provinca e Verçelit, Piemonti, Italia
Alemannic:
Provinz Vercelli, Piemont, Italie
Arabic:
مقاطعة فرشيلي, بييمونتي, إيطاليا
Armenian:
Վերչելլի, Պիեմոնտ, Իտալիա
Asturian:
Provincia de Vercelli, Piemonte, Italia
Azeri:
Verçelli əyaləti, Pyemont, İtaliya
Basque:
Vercelliko probintzia, Piemonte, Italia
Belarusian:
Верчэлі , П’емонт, Італія
Bengali:
ভার্চেলি প্রদেশ, ইতালি
Breton:
Proviñs Vercelli, Piemont, Italia
Bulgarian:
Верчели, Пиемонт, Италия
Catalan:
Província de Vercelli, Piemont, Itàlia
Cebuano:
Provincia di Vercelli, Piemonte, Italya
Corsican:
Pruvincia di Vercelli, Piemonte, Italia
Czech:
Provincie Vercelli, Piemont, Itálie
Danish:
Vercelli, Piemonte, Italien
Dutch:
Vercelli, Piëmont, Italië
Esperanto:
Provinco Verĉelo, Piemonto, Italio
Estonian:
Vercelli provints, Piemonte, Itaalia
Farsi/Persian:
استان ورسلی, پیمونت, ایتالیا
Finnish:
Vercellin maakunta, Piemonte, Italia
Galician:
Provincia de Vercelli, Piemonte, Italia
Georgian:
ვერჩელის პროვინცია, პიემონტი, იტალია
Greek:
Βερτσέλλι , Πεδεμόντιο, Ιταλία
Gujarati:
વર્સેલી પ્રાંત, ઈટલી
Hindi:
वेर्सेली प्रांत, पिडमांट, इटली
Hungarian:
Vercelli megye, Piemont, Olaszország
Icelandic:
Vercelli, Fjallaland, Ítalía
Ido:
Provinco di Vercelli, Piemont, Italia
Indonesian:
Provinsi Vercelli, Piemonte, Italia
Interlingua:
provincia Vercelli, Pedemonte, Italia
Japanese:
ヴェルチェッリ県, ピエモンテ州, イタリア
Javanese:
Provinsi Vercelli, Piemonte, Itali
Judaeo-Spanish:
Provinsia de Verselli, Piemonte, Italia
Kannada:
ವೆರ್ಸೆಲ್ಲಿ ಪ್ರಾಂತ್ಯ, ಇಟಲಿ
Korean:
베르첼리현, 피에몬테주, 이탈리아
Latin:
Provincia Vercellensis (Provincia Vercellarum), Pedemontium, Italia
Latvian:
Verčelli province, Pjemonta, Itālija
Ligurian:
Provinsa de Verçelli, Piemonte, Italia
Lithuanian:
Verčelio provincija, Pjemontas, Italija
Lombard:
Provincia de Vercej, Piemont (Piemunt), Italia
Malay:
Wilayah Vercelli, Piemonte, Itali
Marathi:
वॉर्सेली प्रांत, प्यिमाँत, इटली
Minnan / Hokkien-Taiwanese:
Vercelli Séng, Piemonte, Italia
Neapolitan:
Pruvincia 'e Vercelli, Piemunte, Italia
Norwegian:
Vercelli, Piemonte, Italia
Norwegian (Nynorsk):
Provinsen Vercelli, Piemonte, Italia
Occitan:
Vercèlh, Piemont, Itàlia
Piedmontese:
Provincia ëd Vërsèj (Provincia 'd Varséj), Piemont, Italia
Polish:
Prowincja Vercelli, Piemont, Włochy
Portuguese:
Vercelli, Piemonte, Itália
Romanian:
Provincia Vercelli, Piemont, Italia
Scots:
Province o Vercelli, Piemont, Italy
Serbian:
Верчели, Пијемонт, Италија
Serbo-Croatian:
Vercelli, Pijemont, Italija
Sicilian:
Pruvincia di Vercelli, Piemunti, Italia
Sinhalese:
වර්සේලි පළාත, සිංහල
Slovenian:
Vercelli, Piemont, Italija
South Azerbaijani:
ورسلی اوستانی, ایتالیا
Swedish:
Vercelli, Piemonte, Italien
Tagalog:
Vercelli, Piemonte, Italya
Tamil:
வெர்ஸள்ளி மாகாணம், பியத்மாந்து, இத்தாலி
Tarantino:
Provinge de Vercelli, Piemonte, Itaglie
Telugu:
వెర్సెల్లి ప్రావిన్స్, ఇటలీ
Thai:
จังหวัดแวร์เชลลี, แคว้นปีเยมอนเต, อิตาลี
Turkish:
Vercelli ili, Piyemonte, İtalya
Ukrainian:
Верчеллі , П'ємонт, Італія
Urdu:
صوبہ ویرچیلی, پیعیمونتے, اطالیہ
Uzbek (Latin Script):
Vercelli, Italiya
Venetian:
Provincia de Vercełi, Piemonte, Itałia
Vietnamese:
Vercelli, Piemonte, Ý
Walser German:
Provinz Vercelli, Piemont, Italie
Waray:
Vercelli, Piemonte, Italya
Western Punjabi:
ضلع ورسلی, صوبہ پیغمونتے, اٹلی
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities125 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Albite var. Andesine Formula: (Na,Ca)[Al(Si,Al)Si2O8] References: |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ 'Almandine-Pyrope Series' |
| ⓘ Altaite Formula: PbTe |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ Andalusite Formula: Al2(SiO4)O |
| ⓘ Anglesite Formula: PbSO4 References: |
| ⓘ Annabergite Formula: Ni3(AsO4)2 · 8H2O References: |
| ⓘ Anorthite Formula: Ca(Al2Si2O8) References: |
| ⓘ Anorthite var. Labradorite Formula: (Ca,Na)[Al(Al,Si)Si2O8] References: |
| ⓘ Antigorite Formula: Mg3(Si2O5)(OH)4 |
| ⓘ Antlerite Formula: Cu3(SO4)(OH)4 References: |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) References: |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ 'Ardennite' |
| ⓘ Ardennite-(As) Formula: Mn2+4Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ Axinite-(Fe) Formula: Ca2Fe2+Al2BSi4O15OH |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 References: |
| ⓘ Baddeleyite Formula: ZrO2 |
| ⓘ Bavenite Formula: Ca4Be2Al2Si9O26(OH)2 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ Beudantite Formula: PbFe3+3(AsO4)(SO4)(OH)6 References: |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Böhmite Formula: AlO(OH) |
| ⓘ Braunite Formula: Mn2+Mn3+6(SiO4)O8 |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 References: |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Calcite var. Manganese-bearing Calcite Formula: (Ca,Mn)CO3 |
| ⓘ 'Carbonate' |
| ⓘ Cerussite Formula: PbCO3 References: |
| ⓘ Chalcocite Formula: Cu2S References: |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Chamosite Formula: (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 References: |
| ⓘ Chlorapatite Formula: Ca5(PO4)3Cl |
| ⓘ 'Chlorite Group' |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ 'Columbite-Tantalite' |
| ⓘ Connellite Formula: Cu19(SO4)(OH)32Cl4 · 3H2O References: |
| ⓘ Cordierite Formula: (Mg,Fe)2Al3(AlSi5O18) |
| ⓘ Corundum Formula: Al2O3 |
| ⓘ Covellite Formula: CuS References: |
| ⓘ Cubanite Formula: CuFe2S3 References: |
| ⓘ Cuprite Formula: Cu2O References: |
| ⓘ Cyanotrichite Formula: Cu4Al2(SO4)(OH)12 · 2H2O References: |
| ⓘ Devilline Formula: CaCu4(SO4)2(OH)6 · 3H2O References: |
| ⓘ Diopside Formula: CaMgSi2O6 |
| ⓘ Dolomite Formula: CaMg(CO3)2 References: |
| ⓘ Dumortierite Formula: Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| ⓘ Enstatite Formula: Mg2Si2O6 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O References: |
| ⓘ Forsterite Formula: Mg2SiO4 |
| ⓘ Galena Formula: PbS |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Gersdorffite Formula: NiAsS |
| ⓘ Godlevskite Formula: (Ni,Fe)9S8 References: |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Graphite Formula: C |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Hercynite Formula: Fe2+Al2O4 |
| ⓘ Hessite Formula: Ag2Te |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ Ilmenite Formula: Fe2+TiO3 Localities: Reported from at least 9 localities in this region. |
| ⓘ Irarsite Formula: (Ir,Ru,Rh,Pt)AsS |
| ⓘ Isocubanite Formula: CuFe2S3 References: |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 References: |
| ⓘ 'K Feldspar' |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 |
| ⓘ Lanarkite Formula: Pb2(SO4)O References: |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O References: |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O References: |
| ⓘ Leadhillite Formula: Pb4(CO3)2(SO4)(OH)2 References: |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 References: |
| ⓘ Linnaeite Formula: Co2+Co3+2S4 |
| ⓘ Litharge Formula: PbO References: |
| ⓘ Mackinawite Formula: FeS Localities: Reported from at least 6 localities in this region. |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 References: |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Melonite Formula: NiTe2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Merenskyite Formula: PdTe2 Localities: |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Millerite Formula: NiS |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ 'Monazite Group' Formula: REE(PO4) References: |
| ⓘ Moncheite Formula: Pt(Te,Bi)2 |
| ⓘ Morenosite Formula: NiSO4 · 7H2O |
| ⓘ Native Copper Formula: Cu |
| ⓘ Native Gold Formula: Au |
| ⓘ Native Iron Formula: Fe |
| ⓘ Native Lead Formula: Pb References: |
| ⓘ Native Sulphur Formula: S8 References: |
| ⓘ 'Olivine Group' Formula: M2SiO4 |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ 'Orthopyroxene Subgroup' |
| ⓘ Paralaurionite Formula: PbCl(OH) References: |
| ⓘ Pargasite Formula: NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 Localities: Reported from at least 7 localities in this region. |
| ⓘ Perovskite Formula: CaTiO3 |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 References: |
| ⓘ Piemontite Formula: (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| ⓘ Pilsenite Formula: Bi4Te3 |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ 'Plumasite' References: |
| ⓘ Posnjakite Formula: Cu4(SO4)(OH)6 · H2O References: |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Pyrite var. Bravoite Formula: (Fe,Ni)S2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl References: |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 |
| ⓘ Pyroxmangite Formula: Mn2+SiO3 |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Reported from at least 6 localities in this region. |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Rhodochrosite Formula: MnCO3 |
| ⓘ Rhodonite Formula: CaMn3Mn[Si5O15] |
| ⓘ Romanèchite Formula: (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| ⓘ Rozenite Formula: FeSO4 · 4H2O References: |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Samaniite Formula: Cu2Fe5Ni2S8 References: |
| ⓘ Sarkinite Formula: Mn2+2(AsO4)(OH) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Siderite Formula: FeCO3 References: |
| ⓘ Sillimanite Formula: Al2(SiO4)O |
| ⓘ Sperrylite Formula: PtAs2 |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Spinel Formula: MgAl2O4 |
| ⓘ Staurolite Formula: Fe2+2Al9Si4O23(OH) |
| ⓘ Stibiconite Formula: Sb3+Sb5+2O6(OH) References: Franco Luca Bonino's collectionIdentification: Visual Identification |
| ⓘ Stibnite Formula: Sb2S3 References: Franco Luca Bonino's collectionIdentification: Visual Identification |
| ⓘ Symplesite Formula: Fe2+3(AsO4)2 · 8H2O References: |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ Tephroite Formula: Mn2+2SiO4 |
| ⓘ Titanite Formula: CaTi(SiO4)O |
| ⓘ Troilite Formula: FeS |
| ⓘ Valentinite Formula: Sb2O3 References: |
| ⓘ Valleriite Formula: (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ Zircon Formula: Zr(SiO4) |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) References: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Lead | 1.AA.05 | Pb |
| ⓘ | Native Iron | 1.AE.05 | Fe |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Hessite | 2.BA.60 | Ag2Te |
| ⓘ | Samaniite | 2.BB. | Cu2Fe5Ni2S8 |
| ⓘ | Godlevskite | 2.BB.15 | (Ni,Fe)9S8 |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Isocubanite | 2.CB.55b | CuFe2S3 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Troilite | 2.CC.10 | FeS |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Mackinawite | 2.CC.25 | FeS |
| ⓘ | Altaite | 2.CD.10 | PbTe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Linnaeite | 2.DA.05 | Co2+Co3+2S4 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Pilsenite | 2.DC.05 | Bi4Te3 |
| ⓘ | Melonite | 2.EA.20 | NiTe2 |
| ⓘ | Merenskyite | 2.EA.20 | PdTe2 |
| ⓘ | Moncheite | 2.EA.20 | Pt(Te,Bi)2 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite var. Bravoite | 2.EB.05a | (Fe,Ni)S2 |
| ⓘ | 2.EB.05a | FeS2 | |
| ⓘ | Sperrylite | 2.EB.05a | PtAs2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Irarsite | 2.EB.25 | (Ir,Ru,Rh,Pt)AsS |
| ⓘ | Valleriite | 2.FD.30 | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Group 3 - Halides | |||
| ⓘ | Connellite | 3.DA.25 | Cu19(SO4)(OH)32Cl4 · 3H2O |
| ⓘ | Paralaurionite | 3.DC.05 | PbCl(OH) |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Litharge | 4.AC.20 | PbO |
| ⓘ | Hercynite | 4.BB.05 | Fe2+Al2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Valentinite | 4.CB.55 | Sb2O3 |
| ⓘ | Perovskite | 4.CC.30 | CaTiO3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Baddeleyite | 4.DE.35 | ZrO2 |
| ⓘ | Stibiconite | 4.DH.20 | Sb3+Sb5+2O6(OH) |
| ⓘ | Romanèchite | 4.DK.10 | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| ⓘ | Böhmite | 4.FE.15 | AlO(OH) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | var. Manganese-bearing Calcite | 5.AB.05 | (Ca,Mn)CO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Leadhillite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Antlerite | 7.BB.15 | Cu3(SO4)(OH)4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Lanarkite | 7.BD.40 | Pb2(SO4)O |
| ⓘ | Rozenite | 7.CB.15 | FeSO4 · 4H2O |
| ⓘ | Morenosite | 7.CB.40 | NiSO4 · 7H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Posnjakite | 7.DD.10 | Cu4(SO4)(OH)6 · H2O |
| ⓘ | Devilline | 7.DD.30 | CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Cyanotrichite | 7.DE.10 | Cu4Al2(SO4)(OH)12 · 2H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Sarkinite | 8.BB.15 | Mn2+2(AsO4)(OH) |
| ⓘ | Beudantite | 8.BL.05 | PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ | Chlorapatite | 8.BN.05 | Ca5(PO4)3Cl |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Annabergite | 8.CE.40 | Ni3(AsO4)2 · 8H2O |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Symplesite | 8.CE.45 | Fe2+3(AsO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Forsterite | 9.AC.05 | Mg2SiO4 |
| ⓘ | Tephroite | 9.AC.05 | Mn2+2SiO4 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Braunite | 9.AG.05 | Mn2+Mn3+6(SiO4)O8 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Dumortierite | 9.AJ.10 | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| ⓘ | Axinite-(Fe) | 9.BD.20 | Ca2Fe2+Al2BSi4O15OH |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Piemontite | 9.BG.05a | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Ardennite-(As) | 9.BJ.40 | Mn2+4Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Cordierite | 9.CJ.10 | (Mg,Fe)2Al3(AlSi5O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Enstatite | 9.DA.05 | Mg2Si2O6 |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Pargasite | 9.DE.15 | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| ⓘ | Bavenite | 9.DF.25 | Ca4Be2Al2Si9O26(OH)2 |
| ⓘ | Rhodonite | 9.DK.05 | CaMn3Mn[Si5O15] |
| ⓘ | Pyroxmangite | 9.DO.05 | Mn2+SiO3 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Chamosite | 9.EC.55 | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Andesine | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | var. Labradorite | 9.FA.35 | (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Almandine-Pyrope Series' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Columbite-Tantalite' | - | |
| ⓘ | 'Orthopyroxene Subgroup' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Olivine Group' | - | M2SiO4 |
| ⓘ | 'Ardennite' | - | |
| ⓘ | 'Plumasite' | - | |
| ⓘ | 'Carbonate' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| H | ⓘ Ardennite-(As) | Mn42+Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| H | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Böhmite | AlO(OH) |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| H | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| H | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Morenosite | NiSO4 · 7H2O |
| H | ⓘ Paralaurionite | PbCl(OH) |
| H | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| H | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| H | ⓘ Rozenite | FeSO4 · 4H2O |
| H | ⓘ Sarkinite | Mn22+(AsO4)(OH) |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| H | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Be | Beryllium | |
| Be | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| B | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Ardennite-(As) | Mn42+Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Baddeleyite | ZrO2 |
| O | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| O | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Böhmite | AlO(OH) |
| O | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| O | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| O | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| O | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| O | ⓘ Enstatite | Mg2Si2O6 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| O | ⓘ Forsterite | Mg2SiO4 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hercynite | Fe2+Al2O4 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| O | ⓘ Lanarkite | Pb2(SO4)O |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Litharge | PbO |
| O | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Morenosite | NiSO4 · 7H2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Paralaurionite | PbCl(OH) |
| O | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| O | ⓘ Perovskite | CaTiO3 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Pyroxmangite | Mn2+SiO3 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| O | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| O | ⓘ Rozenite | FeSO4 · 4H2O |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Sarkinite | Mn22+(AsO4)(OH) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| O | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Tephroite | Mn22+SiO4 |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Valentinite | Sb2O3 |
| O | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Almandine-Pyrope Series | |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Olivine Group | M2SiO4 |
| F | Fluorine | |
| F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Na | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Ardennite-(As) | Mn42+Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Mg | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Enstatite | Mg2Si2O6 |
| Mg | ⓘ Forsterite | Mg2SiO4 |
| Mg | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Mg | ⓘ Almandine-Pyrope Series | |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Ardennite-(As) | Mn42+Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Böhmite | AlO(OH) |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| Al | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Hercynite | Fe2+Al2O4 |
| Al | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Almandine-Pyrope Series | |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Ardennite-(As) | Mn42+Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Si | ⓘ Enstatite | Mg2Si2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Si | ⓘ Forsterite | Mg2SiO4 |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Pyroxmangite | Mn2+SiO3 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Tephroite | Mn22+SiO4 |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Almandine-Pyrope Series | |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Olivine Group | M2SiO4 |
| P | Phosphorus | |
| P | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| S | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Galena | PbS |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Godlevskite | (Ni,Fe)9S8 |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Irarsite | (Ir,Ru,Rh,Pt)AsS |
| S | ⓘ Isocubanite | CuFe2S3 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Lanarkite | Pb2(SO4)O |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Linnaeite | Co2+Co23+S4 |
| S | ⓘ Mackinawite | FeS |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Millerite | NiS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Morenosite | NiSO4 · 7H2O |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Rozenite | FeSO4 · 4H2O |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Troilite | FeS |
| S | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| S | ⓘ Samaniite | Cu2Fe5Ni2S8 |
| Cl | Chlorine | |
| Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| Cl | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cl | ⓘ Paralaurionite | PbCl(OH) |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Ca | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Perovskite | CaTiO3 |
| Ca | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Perovskite | CaTiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Mn | Manganese | |
| Mn | ⓘ Ardennite-(As) | Mn42+Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 |
| Mn | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Mn | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Mn | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Mn | ⓘ Pyroxmangite | Mn2+SiO3 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Mn | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Mn | ⓘ Sarkinite | Mn22+(AsO4)(OH) |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Tephroite | Mn22+SiO4 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Fe | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Fe | ⓘ Godlevskite | (Ni,Fe)9S8 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hercynite | Fe2+Al2O4 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Native Iron | Fe |
| Fe | ⓘ Isocubanite | CuFe2S3 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Mackinawite | FeS |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Rozenite | FeSO4 · 4H2O |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| Fe | ⓘ Troilite | FeS |
| Fe | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Almandine-Pyrope Series | |
| Fe | ⓘ Samaniite | Cu2Fe5Ni2S8 |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Co | ⓘ Linnaeite | Co2+Co23+S4 |
| Ni | Nickel | |
| Ni | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| Ni | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Godlevskite | (Ni,Fe)9S8 |
| Ni | ⓘ Melonite | NiTe2 |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Morenosite | NiSO4 · 7H2O |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Samaniite | Cu2Fe5Ni2S8 |
| Cu | Copper | |
| Cu | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Isocubanite | CuFe2S3 |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| Cu | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Cu | ⓘ Samaniite | Cu2Fe5Ni2S8 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Ardennite-(As) | Mn42+Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 |
| As | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Irarsite | (Ir,Ru,Rh,Pt)AsS |
| As | ⓘ Sarkinite | Mn22+(AsO4)(OH) |
| As | ⓘ Sperrylite | PtAs2 |
| As | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| Zr | Zirconium | |
| Zr | ⓘ Baddeleyite | ZrO2 |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ru | Ruthenium | |
| Ru | ⓘ Irarsite | (Ir,Ru,Rh,Pt)AsS |
| Rh | Rhodium | |
| Rh | ⓘ Irarsite | (Ir,Ru,Rh,Pt)AsS |
| Pd | Palladium | |
| Pd | ⓘ Merenskyite | PdTe2 |
| Ag | Silver | |
| Ag | ⓘ Hessite | Ag2Te |
| Sb | Antimony | |
| Sb | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Valentinite | Sb2O3 |
| Te | Tellurium | |
| Te | ⓘ Altaite | PbTe |
| Te | ⓘ Hessite | Ag2Te |
| Te | ⓘ Melonite | NiTe2 |
| Te | ⓘ Merenskyite | PdTe2 |
| Te | ⓘ Moncheite | Pt(Te,Bi)2 |
| Te | ⓘ Pilsenite | Bi4Te3 |
| Ba | Barium | |
| Ba | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Ir | Iridium | |
| Ir | ⓘ Irarsite | (Ir,Ru,Rh,Pt)AsS |
| Pt | Platinum | |
| Pt | ⓘ Irarsite | (Ir,Ru,Rh,Pt)AsS |
| Pt | ⓘ Moncheite | Pt(Te,Bi)2 |
| Pt | ⓘ Sperrylite | PtAs2 |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Altaite | PbTe |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Lanarkite | Pb2(SO4)O |
| Pb | ⓘ Native Lead | Pb |
| Pb | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Litharge | PbO |
| Pb | ⓘ Paralaurionite | PbCl(OH) |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Bi | Bismuth | |
| Bi | ⓘ Moncheite | Pt(Te,Bi)2 |
| Bi | ⓘ Pilsenite | Bi4Te3 |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Province_of_Vercelli |
|---|---|
| Wikidata ID: | Q15096 |
| GeoNames ID: | 3164564 |
Localities in this Region
- Piedmont
- Piedmont
- Vercelli Province
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
- Adriatic-Apulian ForelandAccretionary Complex
- AlpsAccretionary Complex
Europe
- The AlpsMountain Range
- Ivrea ZoneTerrane
- Monte Rosa massifMassif
Italy
- Piedmont
- Vercelli Province
- Mastallone ValleyValley
- Sesia ValleyValley
- Vercelli Province
- Po PlainPlains
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions
Feglierec Mine, Otro Valley, Alagna Valsesia, Vercelli Province, Piedmont, Italy