This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| North Bath | 9,363 (2017) |
| Bath | 8,305 (2017) |
| Topsham | 5,931 (2017) |
| Woolwich | 2,922 (2017) |
| Phippsburg | 2,190 (2017) |
| Richmond | 1,760 (2017) |
Other Languages:
French:
comté de Sagadahoc, Maine, États-Unis
German:
Sagadahoc County, Maine, Vereinigte Staaten
Italian:
contea di Sagadahoc, Maine, Stati Uniti d'America
Russian:
Сагадахок, Мэн, Соединённые Штаты Америки
Simplified Chinese:
萨加达霍克县 , 缅因州, 美国
Spanish:
Condado de Sagadahoc, Maine, Estados Unidos
Albanian:
Sagadahoc County, Maine, Shtetet e Bashkuara të Amerikës
Arabic:
مقاطعة ساغداوك, مين, الولايات المتحدة
Armenian:
Սագադահոկ շրջան, Մեն, Ամերիկայի Միացյալ Նահանգներ
Basque:
Sagadahoc konderria , Maine
Bavarian:
Sagadahoc County, Maine, Vaoanigte Stootn
Bishnupriya Manipuri:
সগাডাহোক কাউন্টি, মেইন, তিলপারাষ্ট্র
Bulgarian:
Сагадахок, Мейн, Съединени американски щати
Cebuano:
Sagadahoc County, Maine
Dutch:
Sagadahoc County, Maine, Verenigde Staten
Farsi/Persian:
شهرستان ساگاداهاک، مین, مین, ایالات متحده آمریکا
Georgian:
საგადაჰოკის ოლქი, მენის შტატი, ამერიკის შეერთებული შტატები
Hebrew:
מחוז סגדהוק, מיין, ארצות הברית
Hungarian:
Sagadahoc megye, Maine, Amerikai Egyesült Államok
Irish Gaelic:
Contae Sagadahoc, Maine, Stáit Aontaithe Mheiriceá
Japanese:
サガダホク郡, メイン州, アメリカ合衆国
Low Saxon/Low German:
Sagadahoc County, Maine, USA
Min Dong Chinese:
Sagadahoc Gông, Maine
Minnan / Hokkien-Taiwanese:
Sagadahoc Kūn
Norwegian:
Sagadahoc County, Maine, USA
Polish:
Hrabstwo Sagadahoc, Maine, Stany Zjednoczone
Portuguese:
Condado de Sagadahoc, Maine, Estados Unidos
Romanian:
Comitatul Sagadahoc, Maine, Statele Unite ale Americii
Sardinian:
contea de Sagadahoc, Maine, Istados Unidos de Amèrica
Scottish Gaelic:
Sagadahoc County, Maine, Na Stàitean Aonaichte
Serbian:
Округ Сагадахок , Мејн, Сједињене Америчке Државе
Serbo-Croatian:
Sagadahoc County, Maine, Sjedinjene Američke Države
Swedish:
Sagadahoc County, Maine, USA
Traditional Chinese:
薩加達霍克縣, 緬因州, 美國
Turkish:
Sagadahoc County, Maine, Amerika Birleşik Devletleri
Ukrainian:
Саґадагок, Мен, Сполучені Штати Америки
Urdu:
ساگاڈیہاک کاؤنٹی، میئن, میئن, ریاستہائے متحدہ امریکا
Waray:
Condado han Sagadahoc, Maine, Estados Unidos
Western Punjabi:
سگاداہوک کاؤنٹی, مینے, امریکہ
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities100 valid minerals. 6 erroneous literature entries.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 References: |
| ⓘ Formula: NaFe3+Si2O6 Locality: Phippsburg, Sagadahoc County, Maine, USA - erroneously reported Description: No location given and no specimens known. References: |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reported from at least 44 localities in this region. |
| ⓘ Albite var. Cleavelandite Formula: Na(AlSi3O8) |
| ⓘ Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] Localities: Route 1 Road Cut, Woolwich, Sagadahoc County, Maine, USA Swamp #1 Quarry, Cathance River Nature Preserve, Topsham, Sagadahoc County, Maine, USA North Russell Brothers Quarry, Topsham, Sagadahoc County, Maine, USA Havey #1 & #2 Quarries, Topsham, Sagadahoc County, Maine, USA Swamp #2 quarry, Cathance River Nature Preserve, Topsham, Sagadahoc County, Maine, USA |
| ⓘ Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) Localities: Reported from at least 6 localities in this region. |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 Localities: Reported from at least 65 localities in this region. |
| ⓘ Anatase Formula: TiO2 |
| ⓘ Andalusite Formula: Al2(SiO4)O |
| ⓘ Annite Formula: KFe2+3(AlSi3O10)(OH)2 Localities: Reported from at least 29 localities in this region. |
| ⓘ Anorthite Formula: Ca(Al2Si2O8) |
| ⓘ Anthophyllite Formula: ◻Mg2Mg5(Si8O22)(OH)2 Locality: Georgetown, Sagadahoc County, Maine, USA |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A |
| ⓘ 'Apatite var. Carbonate-rich Apatite' Formula: Ca5(PO4)3(Cl/F/OH) References: |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O Localities: Reported from at least 9 localities in this region. |
| ⓘ Axinite-(Fe) Formula: Ca2Fe2+Al2BSi4O15OH References: |
| ⓘ 'Axinite Group' Locality: Bath, Sagadahoc County, Maine, USA |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 |
| ⓘ Babingtonite Formula: Ca2Fe2+Fe3+Si5O14(OH) |
| ⓘ Bertrandite Formula: Be4(Si2O7)(OH)2 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Localities: Reported from at least 40 localities in this region. Description: Transparent, flawless, doubly terminated crystals to 12 cm were found in pockets in the 1890's. |
| ⓘ Beryl var. Aquamarine Localities: Reported from at least 6 localities in this region. |
| ⓘ Formula: Be3Al2(Si6O18) Locality: Topsham, Sagadahoc County, Maine, USA - erroneously reported Description: Emerald was a synonym for beryl in the 1790s when Vauquelin discovered that they were the same species. The usage of "emerald" continued in the scientific literature even until the 1830s. The cited reference merely copied out of date information. No beryl that would remotely be considered to be emerald has been found in the entire state of Maine, thus far. |
| ⓘ Beryl var. Heliodor Formula: Be3Al2(Si6O18) Localities: Reported from at least 7 localities in this region. |
| ⓘ Beryl var. Morganite Formula: Be3Al2(Si6O18) |
| ⓘ Beryllonite Formula: NaBePO4 |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Reported from at least 37 localities in this region. |
| ⓘ Bismuthinite Formula: Bi2S3 Localities: Description: Crystal 45 x ~2 cm long in granite pegmatite. Specimen broken up as collectors were unaware of its significant size. |
| ⓘ Bismutite Formula: (BiO)2CO3 |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 |
| ⓘ Brookite Formula: TiO2 |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Chamosite Formula: Fe2+5Al(AlSi3O10)(OH)8 References: |
| ⓘ Chrysoberyl Formula: BeAl2O4 |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) Localities: Description: Clinozoisite from this locality was mistakenly called axinite and is an error which has been continuously reported since the 1890's. |
| ⓘ Columbite-(Fe) Formula: Fe2+Nb2O6 Localities: Reported from at least 18 localities in this region. |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' |
| ⓘ Columbite-(Mn) Formula: Mn2+Nb2O6 |
| ⓘ 'Columbite-Tantalite' |
| ⓘ Cookeite Formula: (LiAl4◻)[AlSi3O10](OH)8 |
| ⓘ Cordierite Formula: Mg2Al4Si5O18 |
| ⓘ Diopside Formula: CaMgSi2O6 Localities: Reported from at least 6 localities in this region. |
| ⓘ Dumortierite Formula: Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| ⓘ Elbaite Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Eosphorite Formula: Mn2+Al(PO4)(OH)2 · H2O |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Euclase Formula: BeAl(SiO4)(OH) |
| ⓘ Euxenite-(Y) ? Formula: (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 Description: The only specimen chemically verified as polycrase-(Y) was merely labeled "Standpipe Hill". Because of the numerous prospects and quarries on Standpipe Hill, the precise occurrence may or may not be the actual Standpipe Hill Quarry. References: |
| ⓘ 'Feldspar Group' |
| ⓘ 'Feldspar Group var. Perthite' |
| ⓘ Fergusonite-(Y) Formula: YNbO4 |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Localities: Reported from at least 13 localities in this region. |
| ⓘ Fluorapatite var. Carbonate-rich Fluorapatite Formula: Ca5(PO4,CO3)3(F,O) References: |
| ⓘ Foitite Formula: ◻(Fe2+2Al)Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ Gahnite Formula: ZnAl2O4 |
| ⓘ Galena Formula: PbS |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Graphite ? Formula: C |
| ✪ Grayite Formula: (Th,Pb,Ca)(PO4) · H2O Description: Pale yellow crystals to 1 mm with xenotime-(Y) and thorgummite. |
| ⓘ Greifensteinite Formula: Ca2Fe2+5Be4(PO4)6(OH)4 · 6H2O |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 Localities: Herbert Haven Prospect, Phippsburg, Sagadahoc County, Maine, USA Basin Vesuvianite locality, Basin Quarry, Phippsburg, Sagadahoc County, Maine, USA Colby Farm Lime-Marble quarry, Phippsburg, Sagadahoc County, Maine, USA Basin Quarry, Phippsburg, Sagadahoc County, Maine, USA Poison Ivy Locality, Basin Quarry, Phippsburg, Sagadahoc County, Maine, USA |
| ⓘ 'Gummite' |
| ⓘ Formula: NaCa2(Fe2+4Fe3+)(Si6Al2)O22(OH)2 Localities: Description: No data have been collected to determine what species this mineral is. |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ Hydroxycalciomicrolite Formula: Ca1.5Ta2O6(OH) References: |
| ⓘ Hydroxylherderite Formula: CaBe(PO4)(OH) Localities: Fisher Quarry, Topsham, Sagadahoc County, Maine, USA Consolidated Feldspar Quarries, Georgetown, Sagadahoc County, Maine, USA Consolidated #1 Quarry, Highland Green, Topsham, Sagadahoc County, Maine, USA Consolidated #2 Quarry (Purington Quarry), Highland Green, Topsham, Sagadahoc County, Maine, USA ? (more information) |
| ⓘ Ice Formula: H2O Locality: Bath, Sagadahoc County, Maine, USA References: |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Ishikawaite Formula: U4+Fe2+Nb2O8 Localities: Reported from at least 7 localities in this region. |
| ⓘ 'K Feldspar' |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O Locality: Phippsburg, Sagadahoc County, Maine, USA Description: Found in veins in gneiss. Chemical analyses by Dufrenoy (1835). Reported by Jackson (1837) that it was near The Basin Locality. |
| ⓘ Lazulite Formula: MgAl2(PO4)2(OH)2 Locality: Phippsburg, Sagadahoc County, Maine, USA |
| ⓘ 'Lepidolite' |
| ⓘ Löllingite ? Formula: FeAs2 Description: "Scorodite as occasional pale-green scoriaceous crusts on lollingite." No test data with specimen. More likely arsenopyrite. |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 10 localities in this region. |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Meionite Formula: Ca4Al6Si6O24CO3 |
| ⓘ Formula: Fe2+(H2O)6(SO4) · H2O Locality: Coombs Quarries, Bowdoin, Sagadahoc County, Maine, USA - erroneously reported |
| ⓘ Meta-autunite Formula: Ca(UO2)2(PO4)2 · 6H2O Localities: Reported from at least 7 localities in this region. |
| ⓘ Metatorbernite Formula: Cu(UO2)2(PO4)2 · 8H2O Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Mica Group' |
| ⓘ Microcline Formula: K(AlSi3O8) Localities: Reported from at least 77 localities in this region. |
| ⓘ 'Microlite Group' Formula: A2-mTa2X6-wZ1-n Description: Green octahedra. |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) Localities: Reported from at least 8 localities in this region. |
| ⓘ 'Monazite Group' Formula: REE(PO4) |
| ⓘ Montebrasite Formula: LiAl(PO4)(OH) |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 77 localities in this region. |
| ⓘ Muscovite var. Fuchsite Formula: K(Al,Cr)3Si3O10(OH)2 |
| ✪ Muscovite var. Schernikite Formula: KAl2(AlSi3O10)(OH)2 Habit: parallel-growth, rhombic cross-section fibers forming tessellated, cleavable prismatic or tabular crystals Colour: pink Description: First locality outside of the Gillette Quarry, Haddam, Conn. References: |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Nontronite Formula: Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O Localities: Reported from at least 7 localities in this region. |
| ⓘ Opal Formula: SiO2 · nH2O |
| ⓘ Opal var. Opal-AN Formula: SiO2 · nH2O |
| ⓘ Formula: K(AlSi3O8) Locality: North Topsham Quarry, Topsham, Sagadahoc County, Maine, USA - erroneously reported Description: Orthoclase is an obsolete identification of K-feldspar when applied to granite pegmatite. The name has been used indiscriminately for microcline. |
| ⓘ Pargasite ? Formula: NaCa2(Mg4Al)(Si6Al2)O22(OH)2 Description: This amphibole has never been chemically analyzed and the name pargasite was used in the early to mid-nineteenth century as the species always found in skarns. |
| ⓘ Perhamite Formula: Ca3Al7.7Si3P4O23.5(OH)14.1 · 8H2O References: |
| ⓘ Phenakite Formula: Be2SiO4 |
| ⓘ Phosphuranylite Formula: KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Pyrrhotite Formula: Fe1-xS References: |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 90 localities in this region. Description: Outstanding transparent quartz crystals to 12 cm long with deep horizontal striations have been found here. |
| ⓘ Quartz var. Amethyst Formula: SiO2 |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Quartz var. Citrine ? Formula: SiO2 |
| ⓘ Quartz var. Rose Quartz Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 Localities: Reported from at least 15 localities in this region. |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Formula: YFe3+Nb2O8 |
| ⓘ 'Scapolite' |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schoepite Formula: (UO2)8O2(OH)12 · 12H2O |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: Reported from at least 23 localities in this region. |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O Description: Probably derived from alteration of arsenopyrite, but no specimen known to test. |
| ⓘ Sillimanite Formula: Al2(SiO4)O |
| ⓘ 'Smectite Group' Formula: A0.3D2-3[T4O10]Z2 · nH2O References: |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 References: |
| ⓘ Sphalerite Formula: ZnS Localities: Colour: black |
| ⓘ Spodumene Formula: LiAlSi2O6 |
| ⓘ Spodumene var. Kunzite Formula: LiAlSi2O6 Locality: Georgetown, Sagadahoc County, Maine, USA |
| ⓘ Stibiotantalite Formula: Sb3+TaO4 |
| ⓘ 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O Locality: Phippsburg, Sagadahoc County, Maine, USA |
| ⓘ Tantalite-(Mn) Formula: Mn2+Ta2O6 |
| ⓘ 'Tapiolite' Formula: (Fe,Mn)(Ta,Nb)2O6 |
| ⓘ Tapiolite-(Fe) Formula: Fe2+Ta2O6 |
| ⓘ Thorianite Formula: ThO2 |
| ✪ Thorite var. Thorogummite Formula: (Th,U)(SiO4)1-x(OH)4x Description: Sharp yellow rod-like crystals to several mm with simple pyramids |
| ⓘ Titanite Formula: CaTiO(SiO4) |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 |
| ⓘ Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O Localities: |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
| ⓘ 'Tourmaline var. Indicolite' |
| ⓘ 'Tourmaline var. Rubellite' |
| ⓘ 'Tourmaline var. Verdelite' |
| ⓘ Uraninite Formula: UO2 Localities: Reported from at least 12 localities in this region. Description: The uraninites from this locality are among the finest in the world for brightness and sharpness of crystals. The largest crystals are about 2.5 cm in each direction. Chemical analysis shows them to be essentially unoxidized. |
| ⓘ Uranophane Formula: Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ Vivianite Formula: Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ Xenotime-(Y) Formula: Y(PO4) |
| ⓘ Zircon Formula: Zr(SiO4) Localities: Reported from at least 11 localities in this region. |
| ⓘ Zircon var. Cyrtolite Formula: Zr[(SiO4),(OH)4] References: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Graphite ? | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Löllingite ? | 2.EB.15a | FeAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | 'Microlite Group' | 4.00. | A2-mTa2X6-wZ1-n |
| ⓘ | Ice | 4.AA.05 | H2O |
| ⓘ | Chrysoberyl | 4.BA.05 | BeAl2O4 |
| ⓘ | Gahnite | 4.BB.05 | ZnAl2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | var. Citrine ? | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Rose Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Opal var. Opal-AN | 4.DA.10 | SiO2 · nH2O |
| ⓘ | 4.DA.10 | SiO2 · nH2O | |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Tapiolite-(Fe) | 4.DB.10 | Fe2+Ta2O6 |
| ⓘ | Ishikawaite | 4.DB.25 | U4+Fe2+Nb2O8 |
| ⓘ | Samarskite-(Y) ? | 4.DB.25 | YFe3+Nb2O8 |
| ⓘ | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
| ⓘ | Columbite-(Mn) | 4.DB.35 | Mn2+Nb2O6 |
| ⓘ | Tantalite-(Mn) | 4.DB.35 | Mn2+Ta2O6 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brookite | 4.DD.10 | TiO2 |
| ⓘ | Stibiotantalite | 4.DE.30 | Sb3+TaO4 |
| ⓘ | Euxenite-(Y) ? | 4.DG.05 | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| ⓘ | Hydroxycalciomicrolite | 4.DH.15 | Ca1.5Ta2O6(OH) |
| ⓘ | Thorianite | 4.DL.05 | ThO2 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| ⓘ | Schoepite | 4.GA.05 | (UO2)8O2(OH)12 · 12H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Melanterite ? | 7.CB.35 | Fe2+(H2O)6(SO4) · H2O |
| ⓘ | Fergusonite-(Y) | 7.GA.05 | YNbO4 |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Beryllonite | 8.AA.10 | NaBePO4 |
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Hydroxylherderite | 8.BA.10 | CaBe(PO4)(OH) |
| ⓘ | Montebrasite | 8.BB.05 | LiAl(PO4)(OH) |
| ⓘ | Lazulite | 8.BB.40 | MgAl2(PO4)2(OH)2 |
| ⓘ | Fluorapatite var. Carbonate-rich Fluorapatite | 8.BN.05 | Ca5(PO4,CO3)3(F,O) |
| ⓘ | 8.BN.05 | Ca5(PO4)3F | |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Vivianite | 8.CE.40 | Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ | Grayite | 8.CJ.45 | (Th,Pb,Ca)(PO4) · H2O |
| ⓘ | Greifensteinite | 8.DA.10 | Ca2Fe2+5Be4(PO4)6(OH)4 · 6H2O |
| ⓘ | Eosphorite | 8.DD.20 | Mn2+Al(PO4)(OH)2 · H2O |
| ⓘ | Perhamite | 8.DO.20 | Ca3Al7.7Si3P4O23.5(OH)14.1 · 8H2O |
| ⓘ | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ | Meta-autunite | 8.EB.10 | Ca(UO2)2(PO4)2 · 6H2O |
| ⓘ | Metatorbernite | 8.EB.10 | Cu(UO2)2(PO4)2 · 8H2O |
| ⓘ | Phosphuranylite | 8.EC.10 | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Phenakite | 9.AA.05 | Be2SiO4 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Thorite var. Thorogummite | 9.AD.30 | (Th,U)(SiO4)1-x(OH)4x |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | var. Cyrtolite | 9.AD.30 | Zr[(SiO4),(OH)4] |
| ⓘ | Euclase | 9.AE.10 | BeAl(SiO4)(OH) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Dumortierite | 9.AJ.10 | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| ⓘ | Uranophane | 9.AK.15 | Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| ⓘ | Axinite-(Fe) | 9.BD.20 | Ca2Fe2+Al2BSi4O15OH |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Beryl var. Aquamarine | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | 9.CJ.05 | Be3Al2(Si6O18) | |
| ⓘ | var. Emerald ? | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | var. Morganite | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | var. Heliodor | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Cordierite | 9.CJ.10 | Mg2Al4Si5O18 |
| ⓘ | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Foitite | 9.CK.05 | ◻(Fe2+2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Aegirine ? | 9.DA.25 | NaFe3+Si2O6 |
| ⓘ | Spodumene var. Kunzite | 9.DA.30 | LiAlSi2O6 |
| ⓘ | 9.DA.30 | LiAlSi2O6 | |
| ⓘ | Anthophyllite | 9.DD.05 | ◻Mg2Mg5(Si8O22)(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Hastingsite ? | 9.DE.15 | NaCa2(Fe2+4Fe3+)(Si6Al2)O22(OH)2 |
| ⓘ | Pargasite ? | 9.DE.15 | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| ⓘ | Babingtonite | 9.DK.05 | Ca2Fe2+Fe3+Si5O14(OH) |
| ⓘ | Muscovite var. Fuchsite | 9.EC.15 | K(Al,Cr)3Si3O10(OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | var. Schernikite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Annite | 9.EC.20 | KFe2+3(AlSi3O10)(OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Nontronite | 9.EC.40 | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ | Chamosite | 9.EC.55 | Fe2+5Al(AlSi3O10)(OH)8 |
| ⓘ | Cookeite | 9.EC.55 | (LiAl4◻)[AlSi3O10](OH)8 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase ? | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | Albite var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | var. Cleavelandite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Meionite | 9.FB.15 | Ca4Al6Si6O24CO3 |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Gummite' | - | |
| ⓘ | 'Tourmaline var. Indicolite' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Lepidolite' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Tourmaline var. Rubellite' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ | 'Tapiolite' | - | (Fe,Mn)(Ta,Nb)2O6 |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'var. Verdelite' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Feldspar Group var. Perthite' | - | |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Columbite-Tantalite' | - | |
| ⓘ | 'Smectite Group' | - | A0.3D2-3[T4O10]Z2 · nH2O |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Axinite Group' | - | |
| ⓘ | 'Apatite var. Carbonate-rich Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| H | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| H | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| H | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| H | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Euclase | BeAl(SiO4)(OH) |
| H | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| H | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Grayite | (Th,Pb,Ca)(PO4) · H2O |
| H | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| H | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| H | ⓘ Hydroxylherderite | CaBe(PO4)(OH) |
| H | ⓘ Ice | H2O |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| H | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| H | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| H | ⓘ Montebrasite | LiAl(PO4)(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| H | ⓘ Perhamite | Ca3Al7.7Si3P4O23.5(OH)14.1 · 8H2O |
| H | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| H | ⓘ Muscovite var. Schernikite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schoepite | (UO2)8O2(OH)12 · 12H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| H | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Zircon var. Cyrtolite | Zr[(SiO4),(OH)4] |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| H | ⓘ Greifensteinite | Ca2Fe52+Be4(PO4)6(OH)4 · 6H2O |
| H | ⓘ Apatite var. Carbonate-rich Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Hydroxycalciomicrolite | Ca1.5Ta2O6(OH) |
| Li | Lithium | |
| Li | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Li | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | ⓘ Spodumene var. Kunzite | LiAlSi2O6 |
| Li | ⓘ Montebrasite | LiAl(PO4)(OH) |
| Li | ⓘ Spodumene | LiAlSi2O6 |
| Be | Beryllium | |
| Be | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Be | ⓘ Beryllonite | NaBePO4 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Chrysoberyl | BeAl2O4 |
| Be | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Be | ⓘ Euclase | BeAl(SiO4)(OH) |
| Be | ⓘ Hydroxylherderite | CaBe(PO4)(OH) |
| Be | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| Be | ⓘ Phenakite | Be2SiO4 |
| Be | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| Be | ⓘ Greifensteinite | Ca2Fe52+Be4(PO4)6(OH)4 · 6H2O |
| B | Boron | |
| B | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| B | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| B | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline var. Indicolite | |
| B | ⓘ Tourmaline var. Rubellite | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| B | ⓘ Tourmaline var. Verdelite | |
| C | Carbon | |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| C | ⓘ Graphite | C |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Aegirine | NaFe3+Si2O6 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| O | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| O | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| O | ⓘ Beryllonite | NaBePO4 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Brookite | TiO2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| O | ⓘ Chrysoberyl | BeAl2O4 |
| O | ⓘ Quartz var. Citrine | SiO2 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| O | ⓘ Cordierite | Mg2Al4Si5O18 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| O | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| O | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Euclase | BeAl(SiO4)(OH) |
| O | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| O | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| O | ⓘ Fergusonite-(Y) | YNbO4 |
| O | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| O | ⓘ Tapiolite-(Fe) | Fe2+Ta2O6 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| O | ⓘ Gahnite | ZnAl2O4 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Grayite | (Th,Pb,Ca)(PO4) · H2O |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| O | ⓘ Hydroxylherderite | CaBe(PO4)(OH) |
| O | ⓘ Ice | H2O |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Tourmaline var. Indicolite | |
| O | ⓘ Ishikawaite | U4+Fe2+Nb2O8 |
| O | ⓘ Spodumene var. Kunzite | LiAlSi2O6 |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| O | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| O | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| O | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| O | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| O | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Montebrasite | LiAl(PO4)(OH) |
| O | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| O | ⓘ Perhamite | Ca3Al7.7Si3P4O23.5(OH)14.1 · 8H2O |
| O | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| O | ⓘ Phenakite | Be2SiO4 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Quartz var. Rose Quartz | SiO2 |
| O | ⓘ Tourmaline var. Rubellite | |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Muscovite var. Schernikite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Schoepite | (UO2)8O2(OH)12 · 12H2O |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Spodumene | LiAlSi2O6 |
| O | ⓘ Stibiotantalite | Sb3+TaO4 |
| O | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | ⓘ Tapiolite | (Fe,Mn)(Ta,Nb)2O6 |
| O | ⓘ Thorianite | ThO2 |
| O | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| O | ⓘ Tourmaline var. Verdelite | |
| O | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| O | ⓘ Zircon var. Cyrtolite | Zr[(SiO4),(OH)4] |
| O | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| O | ⓘ Greifensteinite | Ca2Fe52+Be4(PO4)6(OH)4 · 6H2O |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Apatite var. Carbonate-rich Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Hydroxycalciomicrolite | Ca1.5Ta2O6(OH) |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Apatite var. Carbonate-rich Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Aegirine | NaFe3+Si2O6 |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Beryllonite | NaBePO4 |
| Na | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Cordierite | Mg2Al4Si5O18 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Al | ⓘ Chrysoberyl | BeAl2O4 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Al | ⓘ Cordierite | Mg2Al4Si5O18 |
| Al | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Al | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Al | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Euclase | BeAl(SiO4)(OH) |
| Al | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Al | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Al | ⓘ Gahnite | ZnAl2O4 |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Al | ⓘ Spodumene var. Kunzite | LiAlSi2O6 |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| Al | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Montebrasite | LiAl(PO4)(OH) |
| Al | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Al | ⓘ Perhamite | Ca3Al7.7Si3P4O23.5(OH)14.1 · 8H2O |
| Al | ⓘ Muscovite var. Schernikite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Spodumene | LiAlSi2O6 |
| Al | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| Al | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Aegirine | NaFe3+Si2O6 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| Si | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Si | ⓘ Quartz var. Citrine | SiO2 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Si | ⓘ Cordierite | Mg2Al4Si5O18 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Si | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Euclase | BeAl(SiO4)(OH) |
| Si | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Si | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Si | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| Si | ⓘ Spodumene var. Kunzite | LiAlSi2O6 |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Si | ⓘ Perhamite | Ca3Al7.7Si3P4O23.5(OH)14.1 · 8H2O |
| Si | ⓘ Phenakite | Be2SiO4 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Quartz var. Rose Quartz | SiO2 |
| Si | ⓘ Muscovite var. Schernikite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Spodumene | LiAlSi2O6 |
| Si | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| Si | ⓘ Zircon var. Cyrtolite | Zr[(SiO4),(OH)4] |
| Si | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | ⓘ Beryllonite | NaBePO4 |
| P | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| P | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Grayite | (Th,Pb,Ca)(PO4) · H2O |
| P | ⓘ Hydroxylherderite | CaBe(PO4)(OH) |
| P | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| P | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| P | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Montebrasite | LiAl(PO4)(OH) |
| P | ⓘ Perhamite | Ca3Al7.7Si3P4O23.5(OH)14.1 · 8H2O |
| P | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| P | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Greifensteinite | Ca2Fe52+Be4(PO4)6(OH)4 · 6H2O |
| P | ⓘ Apatite | Ca5(PO4)3A |
| P | ⓘ Apatite var. Carbonate-rich Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Galena | PbS |
| S | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| Cl | Chlorine | |
| Cl | ⓘ Apatite var. Carbonate-rich Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| K | ⓘ Muscovite var. Schernikite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ca | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Grayite | (Th,Pb,Ca)(PO4) · H2O |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Hydroxylherderite | CaBe(PO4)(OH) |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Ca | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Perhamite | Ca3Al7.7Si3P4O23.5(OH)14.1 · 8H2O |
| Ca | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Greifensteinite | Ca2Fe52+Be4(PO4)6(OH)4 · 6H2O |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ca | ⓘ Apatite var. Carbonate-rich Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | ⓘ Hydroxycalciomicrolite | Ca1.5Ta2O6(OH) |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brookite | TiO2 |
| Ti | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Cr | Chromium | |
| Cr | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Mn | Manganese | |
| Mn | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| Mn | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Mn | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Tapiolite | (Fe,Mn)(Ta,Nb)2O6 |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Aegirine | NaFe3+Si2O6 |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Fe | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Fe | ⓘ Tapiolite-(Fe) | Fe2+Ta2O6 |
| Fe | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Ishikawaite | U4+Fe2+Nb2O8 |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| Fe | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Tapiolite | (Fe,Mn)(Ta,Nb)2O6 |
| Fe | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | ⓘ Greifensteinite | Ca2Fe52+Be4(PO4)6(OH)4 · 6H2O |
| Cu | Copper | |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| Cu | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Zn | Zinc | |
| Zn | ⓘ Gahnite | ZnAl2O4 |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Y | Yttrium | |
| Y | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Y | ⓘ Fergusonite-(Y) | YNbO4 |
| Y | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Zr | ⓘ Zircon var. Cyrtolite | Zr[(SiO4),(OH)4] |
| Nb | Niobium | |
| Nb | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Nb | ⓘ Fergusonite-(Y) | YNbO4 |
| Nb | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Nb | ⓘ Ishikawaite | U4+Fe2+Nb2O8 |
| Nb | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Nb | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Nb | ⓘ Tapiolite | (Fe,Mn)(Ta,Nb)2O6 |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sb | Antimony | |
| Sb | ⓘ Stibiotantalite | Sb3+TaO4 |
| Ce | Cerium | |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ce | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Ta | Tantalum | |
| Ta | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ta | ⓘ Tapiolite-(Fe) | Fe2+Ta2O6 |
| Ta | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
| Ta | ⓘ Microlite Group | A2-mTa2X6-wZ1-n |
| Ta | ⓘ Stibiotantalite | Sb3+TaO4 |
| Ta | ⓘ Tapiolite | (Fe,Mn)(Ta,Nb)2O6 |
| Ta | ⓘ Hydroxycalciomicrolite | Ca1.5Ta2O6(OH) |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Grayite | (Th,Pb,Ca)(PO4) · H2O |
| Bi | Bismuth | |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Th | Thorium | |
| Th | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Th | ⓘ Grayite | (Th,Pb,Ca)(PO4) · H2O |
| Th | ⓘ Thorianite | ThO2 |
| Th | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| U | Uranium | |
| U | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| U | ⓘ Ishikawaite | U4+Fe2+Nb2O8 |
| U | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| U | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| U | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| U | ⓘ Schoepite | (UO2)8O2(OH)12 · 12H2O |
| U | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| U | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Sagadahoc_County,_Maine |
|---|---|
| Wikidata ID: | Q507216 |
| GeoNames ID: | 4977278 |
Localities in this Region
- Maine
- Sagadahoc County
- ⭔Arrowsic
- ⭔Bath
- ⭔Bowdoin
- ⭔Bowdoinham
- ⭔Georgetown
- ⭔Perkins
- ⭔Phippsburg
- ⭔Richmond
- ⭔Topsham
- Sagadahoc County
- Maine
- Sagadahoc County
- Topsham
- Booker Quarry
- ⭔Cathance River Nature Preserve
- Chapman Quarry
- Consolidated #3 Quarry
- DiBiasso Quarry
- East Russell Brothers Quarry
- Fisher Quarry
- Garland Quarry
- Given #1 Quarry
- Given #2 Quarry
- Graves Quarry
- Gustin Quarry
- Havey #1 & #2 Quarries
- ⭔Highland Green
- Ingalls Quarry
- Lost Quarry
- Mallet Quarry
- Mount Ararat Quarries
- North Russell Brothers Quarry
- North Topsham Quarry
- Ordway Quarry
- Pejepscot Quarry
- Porcupine Hill Quarry
- Powers Mountain Quarries
- Prout Farm prospect
- Railroad Quarry
- Rumrill Quarry
- Russell Brothers Quarry
- Russo Quarry
- Square Pit (Consolidated #4 Quarry)
- Standpipe Hill Quarries
- Staples Quarry
- Trenton Quarry
- Trufant prospect
- Undivided Quarry
- Unnamed prospect #1 & 2
- Unnamed prospect #3
- Unnamed prospect #4
- William Willes #1 Quarry
- William Willes #2 Quarry
- ⭔West Bath
- ⭔Woolwich
- Topsham
- Sagadahoc County
Other Regions, Features and Areas that Intersect
Atlantic OceanOcean
North AmericaContinent
North America PlateTectonic Plate
- Ganderia DomainDomain
- GranderiaPassive Margin
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Fisher Quarry, Topsham, Sagadahoc County, Maine, USA