Kuusamo, North Ostrobothnia, Finlandi
| Regional Level Types | |
|---|---|
| Kuusamo | Municipality |
| North Ostrobothnia | Region |
| Finland | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Kuusamo | 17,400 (2014) |
Other Languages:
Finnish:
Kuusamo, Pohjois-Pohjanmaan maakunta, Suomi
French:
Kuusamo, Ostrobotnie du Nord, Finlande
German:
Kuusamo, Nordösterbotten, Finnland
Italian:
Kuusamo, Ostrobotnia Settentrionale, Finlandia
Russian:
Куусамо, Северная Остроботния, Финляндия
Simplified Chinese:
庫薩莫, 北博滕區, 芬兰
Spanish:
Kuusamo, Región de Ostrobotnia del Norte, Finlandia
Swedish:
Kuusamo, Norra Österbotten, Finland
Albanian:
Kuusamo, Ostrobothnia Veriore, Finlanda
Asturian:
Kuusamo, Ostrobotnia del Norte, Finlandia
Basque:
Kuusamo, Ipar Ostrobotnia, Finlandia
Belarusian:
Кусама, Паўночная Астработнія, Фінляндыя
Bulgarian:
Куусамо, Финландия
Catalan:
Kuusamo, Ostrobòtnia del Nord, Finlàndia
Cebuano:
Kuusamo, Pohjois-Pohjanmaa, Finlandia
Czech:
Kuusamo, Severní Pohjanmaa, Finsko
Danish:
Kuusamo, Norra Österbotten, Finland
Dutch:
Kuusamo, Pohjois-Pohjanmaa, Finland
Esperanto:
Kuusamo, Norda Ostrobotnio, Finnlando
Estonian:
Kuusamo linn, Põhja-Pohjanmaa, Soome
Farsi/Persian:
کوسامو, اوستروبوتنیای شمالی, فنلاند
Galician:
Kuusamo, Ostrobotnia do Norte, Finlandia
Greek:
Κουουσάμο, Βόρεια Οστροβόθνια, Φινλανδία
Hebrew:
קוסאמו, אוסטרובוטניה הצפונית, פינלנד
Hill Mari:
Куусамо, Финлянди
Hungarian:
Kuusamo, Észak-Pohjanmaa, Finnország
Interlingue:
Kuusamo, Finland
Japanese:
クーサモ, 北ポフヤンマー県, フィンランド
Korean:
쿠사모, 북포흐얀마 지역, 핀란드
Lithuanian:
Kūsamas, Šiaurės Pohjanma, Suomija
Luxembourgish:
Kuusamo, Nordösterbotten, Finnland
Northern Sami:
Kuusamo, Davvi-Pohjanmaa eanangoddi, Suopma
Norwegian:
Kuusamo, Norra Österbotten, Finland
Norwegian (Nynorsk):
Kuusamo, Norra Österbotten, Finland
Polish:
Kuusamo, Ostrobotnia Północna, Finlandia
Portuguese:
Kuusamo, Ostrobótnia do Norte, Finlândia
Romanian:
Kuusamo, Ostrobotnia de Nord, Finlanda
Serbian:
Кусамо, Северна Остроботнија, Финска
Serbo-Croatian:
Kuusamo, Sjeverna Ostrobotnija, Finska
Slovak:
Kuusamo, Pohjois-Pohjanmaa, Fínsko
Slovenian:
Kuusamo, Finska
Traditional Chinese:
庫薩莫, 芬蘭
Turkish:
Kuusamo, Kuzey Ostrobotniya, Finlandiya
Ukrainian:
Куусамо, Північна Пог'янмаа, Фінляндія
Urdu:
کووسامو, شمالی اوستروبوثنیہ, فن لینڈ
Vietnamese:
Kuusamo, Phía Bắc Ostrobothnia, Phần Lan
West Frisian:
Kuusamo, Finlân
Kuusamo (Finnish: [ˈkuːsɑmo]; Northern Sami: Guossán; Inari Sami: Kuáccám; Russian: Куусамо) is a town and municipality in Finland.
Note on the mineral list:
Sederholmite, trüstedite, wilkmanite, kullerudite and mäikinenite were found during prospecting work carried out by the Outokumpu Co. during 1961-1963. The minerals occurred in veinlets in albitites associated with uranium mineralisation. The information given by all the primary sources for these species (the type descriptions) is the Kuusamo area, which Kitka River Valley is a part of. A reading of Vuorelainen (1962) reveals that the TL for all species is veinlets in albitites at Kitka River, cf. also Hytönen (1999), and see also messageboard at http://www.mindat.org/mesg-7-316414.html.
Note on the mineral list:
Sederholmite, trüstedite, wilkmanite, kullerudite and mäikinenite were found during prospecting work carried out by the Outokumpu Co. during 1961-1963. The minerals occurred in veinlets in albitites associated with uranium mineralisation. The information given by all the primary sources for these species (the type descriptions) is the Kuusamo area, which Kitka River Valley is a part of. A reading of Vuorelainen (1962) reveals that the TL for all species is veinlets in albitites at Kitka River, cf. also Hytönen (1999), and see also messageboard at http://www.mindat.org/mesg-7-316414.html.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities121 valid minerals. 6 (TL) - type locality of valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ Aegirine-augite Formula: (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reported from at least 15 localities in this region. |
| ⓘ Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ Altaite Formula: PbTe Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5(T8O22)W2 |
| ⓘ Analcime Formula: Na(AlSi2O6) · H2O |
| ⓘ Anatase Formula: TiO2 |
| ⓘ Ancylite-(Ce) Formula: CeSr(CO3)2(OH) · H2O |
| ⓘ 'Andradite-Schorlomite Series' Description: Garnets from Iivaara alkaline-intrusion vary between Ti-rich andradite and schorlomite. References: |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A Localities: Reported from at least 8 localities in this region. |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ 'Bastnäsite' Formula: (Ce/Nd/Y/REE)(CO3)F |
| ⓘ Bastnäsite-(Ce) Formula: Ce(CO3)F |
| ⓘ Bijvoetite-(Y) Formula: Y8(UO2)16(CO3)16O8(OH)8 · 39H2O References: |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Reported from at least 15 localities in this region. |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Brannerite Formula: UTi2O6 |
| ⓘ Calaverite Formula: AuTe2 |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 13 localities in this region. |
| ⓘ Cancrinite Formula: (Na,Ca,◻)8(Al6Si6O24)(CO3,SO4)2 · 2H2O References: Sahama., Th. G. (1958) A complex form of natural nepheline from Iivaara, Finland. American Mineralogist, 43 (1-2) 165 |
| ⓘ 'Carbonate' |
| ⓘ Cattierite Formula: CoS2 Localities: Description: Selenian |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 15 localities in this region. |
| ⓘ Chlorapatite Formula: Ca5(PO4)3Cl |
| ⓘ 'Chlorite Group' Localities: Reported from at least 11 localities in this region. |
| ⓘ Chloritoid Formula: Fe2+Al2O(SiO4)(OH)2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 |
| ⓘ Clausthalite Formula: PbSe |
| ⓘ 'Clay minerals' |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinochlore var. Ripidolite Formula: (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| ⓘ 'Clinopyroxene Subgroup' |
| ⓘ Cobaltite Formula: CoAsS Localities: Reported from at least 7 localities in this region. |
| ⓘ Cobaltpentlandite Formula: Co9S8 Localities: Reported from at least 8 localities in this region. |
| ⓘ Columbite-(Fe) Formula: Fe2+Nb2O6 References: |
| ⓘ Covellite Formula: CuS |
| ⓘ Crichtonite Formula: Sr(Mn,Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH)38 |
| ⓘ 'Davidite' |
| ⓘ Davidite-(Ce) Formula: Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| ⓘ Diamond Formula: C |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: Reported from at least 9 localities in this region. |
| ⓘ Dolomite var. Iron-bearing Dolomite Formula: Ca(Mg,Fe)(CO3)2 |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Enstatite Formula: Mg2Si2O6 |
| ⓘ Enstatite var. Bronzite Formula: (Mg,Fe2+)2[SiO3]2 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: Reported from at least 6 localities in this region. |
| ⓘ Euxenite-(Y) Formula: (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 References: |
| ⓘ 'Fayalite-Forsterite Series' |
| ⓘ 'Feldspar Group' |
| ⓘ Ferberite Formula: FeWO4 |
| ⓘ Ferroselite Formula: FeSe2 |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorapatite var. Strontium-bearing Apatite Formula: (Ca,Sr)5(PO4)3F |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Forsterite Formula: Mg2(SiO4) |
| ⓘ Forsterite var. Peridot Formula: Mg2SiO4 |
| ⓘ Frohbergite Formula: FeTe2 |
| ⓘ Galena Formula: PbS |
| ⓘ Galena var. U-Galena |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ 'Garnet Group var. Titanium-bearing Garnet' Formula: X3Z2(SiO4)3 |
| ⓘ Hedleyite Formula: Bi7Te3 |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 6 localities in this region. |
| ⓘ Hibbingite Formula: Fe2+2(OH)3Cl |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ Hydromagnesite Formula: Mg5(CO3)4(OH)2 · 4H2O |
| ⓘ Ilmenite Formula: Fe2+TiO3 Localities: Reported from at least 10 localities in this region. |
| ⓘ Jaipurite Formula: CoS |
| ⓘ Kasolite Formula: Pb(UO2)(SiO4) · H2O |
| ⓘ Kawazulite Formula: Bi2Te2Se |
| ⓘ Kinoshitalite Formula: (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| ⓘ Kitkaite (TL) Formula: NiTeSe Localities: Type Locality: Kitka River Valley, Kuusamo, North Ostrobothnia, Finland |
| ⓘ Kullerudite (TL) Formula: NiSe2 Localities: Type Locality: Kitka River Valley, Kuusamo, North Ostrobothnia, Finland |
| ⓘ Kyanite Formula: Al2(SiO4)O |
| ⓘ Linnaeite Formula: Co2+Co3+2S4 |
| ⓘ Mackinawite Formula: FeS |
| ⓘ Magnesio-hornblende Formula: ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 15 localities in this region. |
| ⓘ Maldonite Formula: Au2Bi |
| ⓘ Marathonite Formula: Pd25Ge9 |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Masuyite Formula: Pb(UO2)3O3(OH)2 · 3H2O |
| ⓘ Mattagamite Formula: CoTe2 |
| ⓘ Mäkinenite (TL) Formula: NiSe Localities: Type Locality: Kitka River Valley, Kuusamo, North Ostrobothnia, Finland |
| ⓘ Melonite Formula: NiTe2 |
| ⓘ 'Mica Group' |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ 'Microperthite' |
| ⓘ Millerite Formula: NiS |
| ⓘ Molybdenite Formula: MoS2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) |
| ⓘ 'Monazite Group' Formula: REE(PO4) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 13 localities in this region. |
| ⓘ Muscovite var. Fuchsite Formula: K(Al,Cr)3Si3O10(OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 13 localities in this region. |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Gold Formula: Au Localities: Reported from at least 13 localities in this region. |
| ⓘ Native Iron Formula: Fe |
| ⓘ Native Selenium Formula: Se |
| ⓘ Native Sulphur Formula: S8 References: |
| ⓘ Native Tellurium Formula: Te |
| ⓘ Natrolite Formula: Na2Al2Si3O10 · 2H2O |
| ⓘ Nepheline Formula: Na3K(Al4Si4O16) References: Sahama., Th. G. (1958) A complex form of natural nepheline from Iivaara, Finland. American Mineralogist, 43 (1-2) 165 Kramm, U., Kogarko, L.N., Kononova, V.A., Vartiainen, H. (1993) The Kola Alkaline Province of the CIS and Finland: Precise RbSr ages define 380–360 Ma age range for all magmatism. Lithos, 30 (1) 33-44 doi:10.1016/0024-4937(93)90004-v |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Paragonite Formula: NaAl2(AlSi3O10)(OH)2 |
| ⓘ Paraguanajuatite Formula: Bi2Se3 |
| ⓘ Pectolite Formula: NaCa2Si3O8(OH) |
| ⓘ Penroseite Formula: (Ni,Co,Cu)Se2 |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 |
| ⓘ Perovskite Formula: CaTiO3 |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ Polydymite Formula: Ni2+Ni3+2S4 |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 18 localities in this region. |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Pyrope Formula: Mg3Al2(SiO4)3 |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Reported from at least 17 localities in this region. |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 17 localities in this region. |
| ⓘ Rammelsbergite Formula: NiAs2 |
| ⓘ Richetite Formula: (Fe3+,Mg)Pb 8.6(UO2)36O36(OH)24 · 41H2O References: |
| ⓘ Rucklidgeite Formula: PbBi2Te4 |
| ⓘ Rutile Formula: TiO2 Localities: Reported from at least 11 localities in this region. |
| ⓘ Sayrite Formula: Pb2(UO2)5O6(OH)2 · 4H2O |
| ⓘ Scheelite Formula: Ca(WO4) Localities: Reported from at least 6 localities in this region. |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Schorlomite Formula: Ca3Ti2(SiO4)(Fe3+O4)2 Description: Originally described as "iivaarite" References: Kramm, U., Kogarko, L.N., Kononova, V.A., Vartiainen, H. (1993) The Kola Alkaline Province of the CIS and Finland: Precise RbSr ages define 380–360 Ma age range for all magmatism. Lithos, 30 (1) 33-44 doi:10.1016/0024-4937(93)90004-v |
| ⓘ Sederholmite (TL) Formula: NiSe Localities: Type Locality: Kitka River Valley, Kuusamo, North Ostrobothnia, Finland |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 |
| ⓘ Siegenite Formula: CoNi2S4 |
| ⓘ Sodalite Formula: Na4(Si3Al3)O12Cl |
| ⓘ 'Sodic plagioclase' |
| ⓘ Spinel Formula: MgAl2O4 |
| ⓘ Staurolite Formula: Fe2+2Al9Si4O23(OH) |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Tellurobismuthite Formula: Bi2Te3 |
| ⓘ Thorite Formula: Th(SiO4) References: |
| ⓘ Titanite Formula: CaTiO(SiO4) |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Trüstedtite (TL) Formula: Ni3Se4 Localities: Type Locality: Kitka River Valley, Kuusamo, North Ostrobothnia, Finland |
| ⓘ Ulvöspinel Formula: TiFe2+2O4 |
| ⓘ Uraninite Formula: UO2 Localities: Reported from at least 11 localities in this region. |
| ⓘ Vaesite Formula: NiS2 Localities: Description: Selenian |
| ⓘ Wilkmanite (TL) Formula: Ni3Se4 Localities: Type Locality: Kitka River Valley, Kuusamo, North Ostrobothnia, Finland |
| ⓘ Wollastonite Formula: Ca3(Si3O9) |
| ⓘ Xenotime-(Y) Formula: Y(PO4) |
| ⓘ 'Zeolite Group' |
| ⓘ Zircon Formula: Zr(SiO4) |
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Iron | 1.AE.05 | Fe |
| ⓘ | Marathonite | 1.B0.05 | Pd25Ge9 |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Diamond | 1.CB.10a | C |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| ⓘ | Native Selenium | 1.CC.10 | Se |
| ⓘ | Native Tellurium | 1.CC.10 | Te |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Maldonite | 2.AA.40 | Au2Bi |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Cobaltpentlandite | 2.BB.15 | Co9S8 |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Sederholmite (TL) | 2.CC.05 | NiSe |
| ⓘ | Jaipurite | 2.CC.05 | CoS |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Mäkinenite (TL) | 2.CC.20 | NiSe |
| ⓘ | Mackinawite | 2.CC.25 | FeS |
| ⓘ | Altaite | 2.CD.10 | PbTe |
| ⓘ | Clausthalite | 2.CD.10 | PbSe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | var. U-Galena | 2.CD.10 | PbS |
| ⓘ | Wilkmanite (TL) | 2.D0.15 | Ni3Se4 |
| ⓘ | Linnaeite | 2.DA.05 | Co2+Co3+2S4 |
| ⓘ | Polydymite | 2.DA.05 | Ni2+Ni3+2S4 |
| ⓘ | Siegenite | 2.DA.05 | CoNi2S4 |
| ⓘ | Trüstedtite (TL) | 2.DA.05 | Ni3Se4 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Hedleyite | 2.DC.05 | Bi7Te3 |
| ⓘ | Kawazulite | 2.DC.05 | Bi2Te2Se |
| ⓘ | Paraguanajuatite | 2.DC.05 | Bi2Se3 |
| ⓘ | Tellurobismuthite | 2.DC.05 | Bi2Te3 |
| ⓘ | Calaverite | 2.EA.10 | AuTe2 |
| ⓘ | Kitkaite (TL) | 2.EA.20 | NiTeSe |
| ⓘ | Melonite | 2.EA.20 | NiTe2 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Cattierite | 2.EB.05a | CoS2 |
| ⓘ | Penroseite | 2.EB.05a | (Ni,Co,Cu)Se2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Vaesite | 2.EB.05a | NiS2 |
| ⓘ | Ferroselite | 2.EB.10a | FeSe2 |
| ⓘ | Frohbergite | 2.EB.10a | FeTe2 |
| ⓘ | Kullerudite (TL) | 2.EB.10a | NiSe2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Mattagamite | 2.EB.10a | CoTe2 |
| ⓘ | Rammelsbergite | 2.EB.15a | NiAs2 |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Rucklidgeite | 2.GC.40c | PbBi2Te4 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Hibbingite | 3.DA.10a | Fe2+2(OH)3Cl |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Ulvöspinel | 4.BB.05 | TiFe2+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Perovskite | 4.CC.30 | CaTiO3 |
| ⓘ | Crichtonite | 4.CC.40 | Sr(Mn,Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH)38 |
| ⓘ | Davidite-(Ce) | 4.CC.40 | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Ferberite | 4.DB.30 | FeWO4 |
| ⓘ | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Euxenite-(Y) | 4.DG.05 | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| ⓘ | Brannerite | 4.DH.05 | UTi2O6 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | Richetite | 4.GB.15 | (Fe3+,Mg)Pb 8.6(UO2)36O36(OH)24 · 41H2O |
| ⓘ | Masuyite | 4.GB.35 | Pb(UO2)3O3(OH)2 · 3H2O |
| ⓘ | Sayrite | 4.GB.50 | Pb2(UO2)5O6(OH)2 · 4H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | var. Iron-bearing Dolomite | 5.AB.10 | Ca(Mg,Fe)(CO3)2 |
| ⓘ | Bastnäsite-(Ce) | 5.BD.20a | Ce(CO3)F |
| ⓘ | Hydromagnesite | 5.DA.05 | Mg5(CO3)4(OH)2 · 4H2O |
| ⓘ | Ancylite-(Ce) | 5.DC.05 | CeSr(CO3)2(OH) · H2O |
| ⓘ | Bijvoetite-(Y) | 5.EB.20 | Y8(UO2)16(CO3)16O8(OH)8 · 39H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Chlorapatite | 8.BN.05 | Ca5(PO4)3Cl |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | var. Strontium-bearing Apatite | 8.BN.05 | (Ca,Sr)5(PO4)3F |
| Group 9 - Silicates | |||
| ⓘ | Forsterite | 9.AC.05 | Mg2(SiO4) |
| ⓘ | var. Peridot | 9.AC.05 | Mg2SiO4 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Pyrope | 9.AD.25 | Mg3Al2(SiO4)3 |
| ⓘ | Schorlomite | 9.AD.25 | Ca3Ti2(SiO4)(Fe3+O4)2 |
| ⓘ | Thorite | 9.AD.30 | Th(SiO4) |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Chloritoid | 9.AF.85 | Fe2+Al2O(SiO4)(OH)2 |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Kasolite | 9.AK.15 | Pb(UO2)(SiO4) · H2O |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Enstatite | 9.DA.05 | Mg2Si2O6 |
| ⓘ | var. Bronzite | 9.DA.05 | (Mg,Fe2+)2[SiO3]2 |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Aegirine-augite | 9.DA.20 | (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Magnesio-hornblende | 9.DE.10 | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Pectolite | 9.DG.05 | NaCa2Si3O8(OH) |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite var. Fuchsite | 9.EC.15 | K(Al,Cr)3Si3O10(OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Paragonite | 9.EC.15 | NaAl2(AlSi3O10)(OH)2 |
| ⓘ | Muscovite var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Kinoshitalite | 9.EC.35 | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | var. Ripidolite | 9.EC.55 | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| ⓘ | Nepheline | 9.FA.05 | Na3K(Al4Si4O16) |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Cancrinite | 9.FB.05 | (Na,Ca,◻)8(Al6Si6O24)(CO3,SO4)2 · 2H2O |
| ⓘ | Sodalite | 9.FB.10 | Na4(Si3Al3)O12Cl |
| ⓘ | 'Zeolite Group' | 9.G0. | |
| ⓘ | Natrolite | 9.GA.05 | Na2Al2Si3O10 · 2H2O |
| ⓘ | Analcime | 9.GB.05 | Na(AlSi2O6) · H2O |
| Unclassified | |||
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Bastnäsite' | - | (Ce/Nd/Y/REE)(CO3)F |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Clay minerals' | - | |
| ⓘ | 'Davidite' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Clinopyroxene Subgroup' | - | |
| ⓘ | 'Andradite-Schorlomite Series' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Microperthite' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ | 'Carbonate' | - | |
| ⓘ | 'Sodic plagioclase' | - | |
| ⓘ | 'Garnet Group var. Titanium-bearing Garnet' | - | X3Z2(SiO4)3 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Analcime | Na(AlSi2O6) · H2O |
| H | ⓘ Ancylite-(Ce) | CeSr(CO3)2(OH) · H2O |
| H | ⓘ Bijvoetite-(Y) | Y8(UO2)16(CO3)16O8(OH)8 · 39H2O |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Cancrinite | (Na,Ca,◻)8(Al6Si6O24)(CO3,SO4)2 · 2H2O |
| H | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Crichtonite | Sr(Mn,Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH)38 |
| H | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| H | ⓘ Hibbingite | Fe22+(OH)3Cl |
| H | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| H | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| H | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| H | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| H | ⓘ Masuyite | Pb(UO2)3O3(OH)2 · 3H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| H | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| H | ⓘ Pectolite | NaCa2Si3O8(OH) |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Richetite | (Fe3+,Mg)Pb 8.6(UO2)36O36(OH)24 · 41H2O |
| H | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| H | ⓘ Sayrite | Pb2(UO2)5O6(OH)2 · 4H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ancylite-(Ce) | CeSr(CO3)2(OH) · H2O |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| C | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| C | ⓘ Bijvoetite-(Y) | Y8(UO2)16(CO3)16O8(OH)8 · 39H2O |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cancrinite | (Na,Ca,◻)8(Al6Si6O24)(CO3,SO4)2 · 2H2O |
| C | ⓘ Diamond | C |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| C | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Analcime | Na(AlSi2O6) · H2O |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Ancylite-(Ce) | CeSr(CO3)2(OH) · H2O |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| O | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| O | ⓘ Bijvoetite-(Y) | Y8(UO2)16(CO3)16O8(OH)8 · 39H2O |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Brannerite | UTi2O6 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cancrinite | (Na,Ca,◻)8(Al6Si6O24)(CO3,SO4)2 · 2H2O |
| O | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| O | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Crichtonite | Sr(Mn,Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH)38 |
| O | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Enstatite | Mg2Si2O6 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| O | ⓘ Ferberite | FeWO4 |
| O | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Forsterite | Mg2(SiO4) |
| O | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hibbingite | Fe22+(OH)3Cl |
| O | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| O | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Masuyite | Pb(UO2)3O3(OH)2 · 3H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Nepheline | Na3K(Al4Si4O16) |
| O | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| O | ⓘ Pectolite | NaCa2Si3O8(OH) |
| O | ⓘ Perovskite | CaTiO3 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Richetite | (Fe3+,Mg)Pb 8.6(UO2)36O36(OH)24 · 41H2O |
| O | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Sayrite | Pb2(UO2)5O6(OH)2 · 4H2O |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Schorlomite | Ca3Ti2(SiO4)(Fe3+O4)2 |
| O | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Thorite | Th(SiO4) |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Ulvöspinel | TiFe22+O4 |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Enstatite var. Bronzite | (Mg,Fe2+)2[SiO3]2 |
| O | ⓘ Forsterite var. Peridot | Mg2SiO4 |
| O | ⓘ Andradite-Schorlomite Series | |
| O | ⓘ Fayalite-Forsterite Series | |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Fluorapatite var. Strontium-bearing Apatite | (Ca,Sr)5(PO4)3F |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| O | ⓘ Garnet Group var. Titanium-bearing Garnet | X3Z2(SiO4)3 |
| F | Fluorine | |
| F | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| F | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Fluorapatite var. Strontium-bearing Apatite | (Ca,Sr)5(PO4)3F |
| Na | Sodium | |
| Na | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Na | ⓘ Cancrinite | (Na,Ca,◻)8(Al6Si6O24)(CO3,SO4)2 · 2H2O |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Na | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Na | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Na | ⓘ Pectolite | NaCa2Si3O8(OH) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Enstatite | Mg2Si2O6 |
| Mg | ⓘ Forsterite | Mg2(SiO4) |
| Mg | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| Mg | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Mg | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Mg | ⓘ Richetite | (Fe3+,Mg)Pb 8.6(UO2)36O36(OH)24 · 41H2O |
| Mg | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Enstatite var. Bronzite | (Mg,Fe2+)2[SiO3]2 |
| Mg | ⓘ Forsterite var. Peridot | Mg2SiO4 |
| Mg | ⓘ Fayalite-Forsterite Series | |
| Mg | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Al | Aluminium | |
| Al | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Cancrinite | (Na,Ca,◻)8(Al6Si6O24)(CO3,SO4)2 · 2H2O |
| Al | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Al | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Al | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Al | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Cancrinite | (Na,Ca,◻)8(Al6Si6O24)(CO3,SO4)2 · 2H2O |
| Si | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Enstatite | Mg2Si2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Forsterite | Mg2(SiO4) |
| Si | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Si | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Si | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Si | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Pectolite | NaCa2Si3O8(OH) |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Schorlomite | Ca3Ti2(SiO4)(Fe3+O4)2 |
| Si | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Thorite | Th(SiO4) |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Enstatite var. Bronzite | (Mg,Fe2+)2[SiO3]2 |
| Si | ⓘ Forsterite var. Peridot | Mg2SiO4 |
| Si | ⓘ Andradite-Schorlomite Series | |
| Si | ⓘ Fayalite-Forsterite Series | |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Garnet Group var. Titanium-bearing Garnet | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Fluorapatite var. Strontium-bearing Apatite | (Ca,Sr)5(PO4)3F |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Cancrinite | (Na,Ca,◻)8(Al6Si6O24)(CO3,SO4)2 · 2H2O |
| S | ⓘ Cattierite | CoS2 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Cobaltpentlandite | Co9S8 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Galena | PbS |
| S | ⓘ Linnaeite | Co2+Co23+S4 |
| S | ⓘ Mackinawite | FeS |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Millerite | NiS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Polydymite | Ni2+Ni23+S4 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Siegenite | CoNi2S4 |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Vaesite | NiS2 |
| S | ⓘ Jaipurite | CoS |
| Cl | Chlorine | |
| Cl | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| Cl | ⓘ Hibbingite | Fe22+(OH)3Cl |
| Cl | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| K | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Nepheline | Na3K(Al4Si4O16) |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Cancrinite | (Na,Ca,◻)8(Al6Si6O24)(CO3,SO4)2 · 2H2O |
| Ca | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Ca | ⓘ Pectolite | NaCa2Si3O8(OH) |
| Ca | ⓘ Perovskite | CaTiO3 |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Schorlomite | Ca3Ti2(SiO4)(Fe3+O4)2 |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Andradite-Schorlomite Series | |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Fluorapatite var. Strontium-bearing Apatite | (Ca,Sr)5(PO4)3F |
| Ca | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brannerite | UTi2O6 |
| Ti | ⓘ Crichtonite | Sr(Mn,Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH)38 |
| Ti | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Ti | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Perovskite | CaTiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Schorlomite | Ca3Ti2(SiO4)(Fe3+O4)2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Ti | ⓘ Ulvöspinel | TiFe22+O4 |
| Ti | ⓘ Andradite-Schorlomite Series | |
| V | Vanadium | |
| V | ⓘ Crichtonite | Sr(Mn,Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH)38 |
| V | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Crichtonite | Sr(Mn,Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH)38 |
| Cr | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Cr | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Mn | Manganese | |
| Mn | ⓘ Crichtonite | Sr(Mn,Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH)38 |
| Mn | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Crichtonite | Sr(Mn,Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH)38 |
| Fe | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ferberite | FeWO4 |
| Fe | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Fe | ⓘ Ferroselite | FeSe2 |
| Fe | ⓘ Frohbergite | FeTe2 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hibbingite | Fe22+(OH)3Cl |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Native Iron | Fe |
| Fe | ⓘ Mackinawite | FeS |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Richetite | (Fe3+,Mg)Pb 8.6(UO2)36O36(OH)24 · 41H2O |
| Fe | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Schorlomite | Ca3Ti2(SiO4)(Fe3+O4)2 |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Ulvöspinel | TiFe22+O4 |
| Fe | ⓘ Enstatite var. Bronzite | (Mg,Fe2+)2[SiO3]2 |
| Fe | ⓘ Andradite-Schorlomite Series | |
| Fe | ⓘ Fayalite-Forsterite Series | |
| Fe | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Co | Cobalt | |
| Co | ⓘ Cattierite | CoS2 |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Cobaltpentlandite | Co9S8 |
| Co | ⓘ Linnaeite | Co2+Co23+S4 |
| Co | ⓘ Mattagamite | CoTe2 |
| Co | ⓘ Penroseite | (Ni,Co,Cu)Se2 |
| Co | ⓘ Siegenite | CoNi2S4 |
| Co | ⓘ Jaipurite | CoS |
| Ni | Nickel | |
| Ni | ⓘ Kitkaite | NiTeSe |
| Ni | ⓘ Kullerudite | NiSe2 |
| Ni | ⓘ Melonite | NiTe2 |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Mäkinenite | NiSe |
| Ni | ⓘ Penroseite | (Ni,Co,Cu)Se2 |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Polydymite | Ni2+Ni23+S4 |
| Ni | ⓘ Rammelsbergite | NiAs2 |
| Ni | ⓘ Sederholmite | NiSe |
| Ni | ⓘ Siegenite | CoNi2S4 |
| Ni | ⓘ Trüstedtite | Ni3Se4 |
| Ni | ⓘ Vaesite | NiS2 |
| Ni | ⓘ Wilkmanite | Ni3Se4 |
| Cu | Copper | |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Penroseite | (Ni,Co,Cu)Se2 |
| Ge | Germanium | |
| Ge | ⓘ Marathonite | Pd25Ge9 |
| As | Arsenic | |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Rammelsbergite | NiAs2 |
| Se | Selenium | |
| Se | ⓘ Clausthalite | PbSe |
| Se | ⓘ Ferroselite | FeSe2 |
| Se | ⓘ Kawazulite | Bi2Te2Se |
| Se | ⓘ Kitkaite | NiTeSe |
| Se | ⓘ Kullerudite | NiSe2 |
| Se | ⓘ Mäkinenite | NiSe |
| Se | ⓘ Paraguanajuatite | Bi2Se3 |
| Se | ⓘ Penroseite | (Ni,Co,Cu)Se2 |
| Se | ⓘ Sederholmite | NiSe |
| Se | ⓘ Native Selenium | Se |
| Se | ⓘ Trüstedtite | Ni3Se4 |
| Se | ⓘ Wilkmanite | Ni3Se4 |
| Sr | Strontium | |
| Sr | ⓘ Ancylite-(Ce) | CeSr(CO3)2(OH) · H2O |
| Sr | ⓘ Crichtonite | Sr(Mn,Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH)38 |
| Sr | ⓘ Fluorapatite var. Strontium-bearing Apatite | (Ca,Sr)5(PO4)3F |
| Y | Yttrium | |
| Y | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Y | ⓘ Bijvoetite-(Y) | Y8(UO2)16(CO3)16O8(OH)8 · 39H2O |
| Y | ⓘ Crichtonite | Sr(Mn,Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH)38 |
| Y | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Y | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Nb | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Pd | Palladium | |
| Pd | ⓘ Marathonite | Pd25Ge9 |
| Te | Tellurium | |
| Te | ⓘ Altaite | PbTe |
| Te | ⓘ Calaverite | AuTe2 |
| Te | ⓘ Frohbergite | FeTe2 |
| Te | ⓘ Hedleyite | Bi7Te3 |
| Te | ⓘ Kawazulite | Bi2Te2Se |
| Te | ⓘ Kitkaite | NiTeSe |
| Te | ⓘ Mattagamite | CoTe2 |
| Te | ⓘ Melonite | NiTe2 |
| Te | ⓘ Rucklidgeite | PbBi2Te4 |
| Te | ⓘ Native Tellurium | Te |
| Te | ⓘ Tellurobismuthite | Bi2Te3 |
| Ba | Barium | |
| Ba | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Ce | Cerium | |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ce | ⓘ Ancylite-(Ce) | CeSr(CO3)2(OH) · H2O |
| Ce | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| Ce | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Ce | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Ce | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Nd | Neodymium | |
| Nd | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Ta | Tantalum | |
| Ta | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| W | Tungsten | |
| W | ⓘ Ferberite | FeWO4 |
| W | ⓘ Scheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Calaverite | AuTe2 |
| Au | ⓘ Native Gold | Au |
| Au | ⓘ Maldonite | Au2Bi |
| Pb | Lead | |
| Pb | ⓘ Altaite | PbTe |
| Pb | ⓘ Clausthalite | PbSe |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| Pb | ⓘ Masuyite | Pb(UO2)3O3(OH)2 · 3H2O |
| Pb | ⓘ Richetite | (Fe3+,Mg)Pb 8.6(UO2)36O36(OH)24 · 41H2O |
| Pb | ⓘ Rucklidgeite | PbBi2Te4 |
| Pb | ⓘ Sayrite | Pb2(UO2)5O6(OH)2 · 4H2O |
| Bi | Bismuth | |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Hedleyite | Bi7Te3 |
| Bi | ⓘ Kawazulite | Bi2Te2Se |
| Bi | ⓘ Maldonite | Au2Bi |
| Bi | ⓘ Paraguanajuatite | Bi2Se3 |
| Bi | ⓘ Rucklidgeite | PbBi2Te4 |
| Bi | ⓘ Tellurobismuthite | Bi2Te3 |
| Th | Thorium | |
| Th | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Th | ⓘ Thorite | Th(SiO4) |
| U | Uranium | |
| U | ⓘ Bijvoetite-(Y) | Y8(UO2)16(CO3)16O8(OH)8 · 39H2O |
| U | ⓘ Brannerite | UTi2O6 |
| U | ⓘ Crichtonite | Sr(Mn,Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH)38 |
| U | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| U | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| U | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| U | ⓘ Masuyite | Pb(UO2)3O3(OH)2 · 3H2O |
| U | ⓘ Richetite | (Fe3+,Mg)Pb 8.6(UO2)36O36(OH)24 · 41H2O |
| U | ⓘ Sayrite | Pb2(UO2)5O6(OH)2 · 4H2O |
| U | ⓘ Uraninite | UO2 |
Geochronology
Mineralization age: Late/Upper Devonian : 373.3 ± 8.1 Ma to 367.4 ± 4.9 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | |||||||||
|---|---|---|---|---|---|---|---|---|---|---|
| Phanerozoic | ||||||||||
| Paleozoic | ||||||||||
| Devonian | ||||||||||
| Late/Upper Devonian |
| |||||||||
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Kuusamo |
|---|---|
| Wikidata ID: | Q207999 |
| GeoNames ID: | 649925 |
Localities in this Region
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
- Baltic Shield
- Karelia CratonCraton
EuropeContinent
Finland
- North Ostrobothnia
- Kuusamo
Finland/Russia
- Karelian-Kola Alkaline Ultramafic and Carbonatitic ProvinceGeologic Province
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesGeochronologyFossilsOther DatabasesLocalities in RegionOther RegionsReferences





Juomasuo, Kuusamo, North Ostrobothnia, Finland