Hemlo gold deposit, Bomby Township, Thunder Bay District, Ontario, Canadai
| Regional Level Types | |
|---|---|
| Hemlo gold deposit | Deposit |
| Bomby Township | Township |
| Thunder Bay District | District |
| Ontario | Province |
| Canada | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
48° 41' 39'' North , 85° 54' 38'' West
Latitude & Longitude (decimal):
Type:
Köppen climate type:
A large Archean gold deposit, located ca. 35 km E of Marathon.
The ores are hosted in highly deformed, sillimanite-grade rocks.
The model genesis of Hemlo includes premetamorphic porphyry mineralization, syn- to postmetamorphic shear zone-related mineralization, and postmetamorphic multistage exsolution and replacement mineralizations during cooling.
The ores are hosted in highly deformed, sillimanite-grade rocks.
The model genesis of Hemlo includes premetamorphic porphyry mineralization, syn- to postmetamorphic shear zone-related mineralization, and postmetamorphic multistage exsolution and replacement mineralizations during cooling.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities118 valid minerals. 5 (TL) - type locality of valid minerals.
Detailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Antimony | 1.CA.05 | Sb |
| ⓘ | Native Arsenic | 1.CA.05 | As |
| ⓘ | Stibarsen | 1.CA.05 | AsSb |
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Hessite | 2.BA.60 | Ag2Te |
| ⓘ | Petzite | 2.BA.75 | Ag3AuTe2 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Coloradoite | 2.CB.05a | HgTe |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Lenaite | 2.CB.10a | AgFeS2 |
| ⓘ | Wurtzite | 2.CB.45 | (Zn,Fe)S |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Breithauptite | 2.CC.05 | NiSb |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Altaite | 2.CD.10 | PbTe |
| ⓘ | Clausthalite | 2.CD.10 | PbSe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Cinnabar | 2.CD.15a | HgS |
| ⓘ | Pääkkönenite | 2.DB.05 | Sb2AsS2 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Calaverite | 2.EA.10 | AuTe2 |
| ⓘ | Melonite | 2.EA.20 | NiTe2 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Aurostibite | 2.EB.05a | AuSb2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Gudmundite | 2.EB.20 | FeSbS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Ullmannite | 2.EB.25 | NiSbS |
| ⓘ | Realgar | 2.FA.15a | As4S4 |
| ⓘ | Pararealgar | 2.FA.15b | As4S4 |
| ⓘ | Orpiment | 2.FA.30 | As2S3 |
| ⓘ | Kermesite | 2.FD.05 | Sb2S2O |
| ⓘ | Aktashite | 2.GA.30 | Cu6Hg3As4S12 |
| ⓘ | Routhierite | 2.GA.40 | Tl(Cu,Ag)(Hg,Zn)2(As,Sb)2S6 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | Seligmannite | 2.GA.50 | PbCuAsS3 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Galkhaite | 2.GB.20 | (Hg5Cu)CsAs4S12 |
| ⓘ | Tvalchrelidzeite | 2.GC.45 | Hg3SbAsS3 |
| ⓘ | Chalcostibite | 2.HA.05 | CuSbS2 |
| ⓘ | Berthierite | 2.HA.20 | FeSb2S4 |
| ⓘ | Clerite | 2.HA.20 | MnSb2S4 |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | Twinnite | 2.HC.05a | Pb0.8Tl0.1Sb1.3As0.8S4 |
| ⓘ | Baumhauerite | 2.HC.05b | Pb12As16S36 |
| ⓘ | Dufrénoysite | 2.HC.05d | Pb2As2S5 |
| ⓘ | Rathite | 2.HC.05d | Ag2Pb12-xTlx/2As18+x/2S40 |
| ⓘ | Parapierrotite | 2.HC.05f | TlSb5S8 |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Geocronite | 2.JB.30a | Pb14Sb6S23 |
| ⓘ | Zinkenite | 2.JB.35a | Pb9Sb22S42 |
| ⓘ | Biagioniite (TL) | 2.LA. | Tl2SbS2 |
| ⓘ | Thunderbayite (TL) | 2.LA. | TlAg3Au3Sb7S6 |
| ⓘ | Vaughanite (TL) | 2.LA.20 | TlHgSb4S7 |
| ⓘ | Criddleite (TL) | 2.LA.25 | TlAg2Au3Sb10S10 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Karelianite | 4.CB.05 | V3+2O3 |
| ⓘ | Perovskite | 4.CC.30 | CaTiO3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Ferberite | 4.DB.30 | FeWO4 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Hydroxycalcioroméite | 4.DH.20 | (Ca,Sb3+)2(Sb5+,Ti)2O6(OH) |
| ⓘ | Tomichite | 4.JB.55 | (V,Fe)4Ti3AsO13(OH) |
| ⓘ | Hemloite (TL) | 4.JB.60 | (Ti,V3+,Fe3+,Al)12(As3+,Sb3+)2O23(OH) |
| ⓘ | Cafarsite | 4.JC.05 | Ca5.9Mn1.7Fe3Ti3(AsO3)12 · 4-5H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Voltaite | 7.CC.25 | K2Fe2+5Fe3+3Al(SO4)12 · 18H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Crocoite | 7.FA.20 | PbCr6+O4 |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(La) | 9.BG.05b | (CaLa)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Pumpellyite-(Mg) | 9.BG.20 | Ca2MgAl2[Si2O6OH][SiO4](OH)2(OH) |
| ⓘ | Poppiite | 9.BG.20 | Ca2V3+V3+2[Si2O6OH][SiO4](OH)2O |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Cordierite | 9.CJ.10 | Mg2Al4Si5O18 |
| ⓘ | Armenite | 9.CM.05 | Ba(H2O)2Ca2Al3[Al3Si9O30] |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Anthophyllite | 9.DD.05 | ◻Mg2Mg5(Si8O22)(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Ferro-tschermakite | 9.DE.10 | ◻Ca2(Fe2+3Al2)(Al2Si6O22)(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite var. Fuchsite | 9.EC.15 | K(Al,Cr)3Si3O10(OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Roscoelite | 9.EC.15 | KV3+2(AlSi3O10)(OH)2 |
| ⓘ | Muscovite var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | var. Vanadium-bearing phlogopite | 9.EC.20 | K(Mg,V3+)3(AlSi3O10)(OH)2 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| ⓘ | Stilbite-Ca | 9.GE.10 | NaCa4(Si27Al9)O72 · 28H2O |
| Unclassified | |||
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Apophyllite Group' | - | AB4[Si8O20]X · 8H2O |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Pumpellyite Subgroup' | - | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'UM1973-24-Te:AgSb' | - | ~AgSbTe2 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Allanite-(La) | (CaLa)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| H | ⓘ Apophyllite Group | AB4[Si8O20]X · 8H2O |
| H | ⓘ Armenite | Ba(H2O)2Ca2Al3[Al3Si9O30] |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Cafarsite | Ca5.9Mn1.7Fe3Ti3(AsO3)12 · 4-5H2O |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Ferro-tschermakite | ◻Ca2(Fe32+Al2)(Al2Si6O22)(OH)2 |
| H | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hemloite | (Ti,V3+,Fe3+,Al)12(As3+,Sb3+)2O23(OH) |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Hydroxycalcioroméite | (Ca,Sb3+)2(Sb5+,Ti)2O6(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| H | ⓘ Pumpellyite-(Mg) | Ca2MgAl2[Si2O6OH][SiO4](OH)2(OH) |
| H | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Tomichite | (V,Fe)4Ti3AsO13(OH) |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Poppiite | Ca2V3+V23+[Si2O6OH][SiO4](OH)2O |
| H | ⓘ Phlogopite var. Vanadium-bearing phlogopite | K(Mg,V3+)3(AlSi3O10)(OH)2 |
| B | Boron | |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Allanite-(La) | (CaLa)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| O | ⓘ Apophyllite Group | AB4[Si8O20]X · 8H2O |
| O | ⓘ Armenite | Ba(H2O)2Ca2Al3[Al3Si9O30] |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Cafarsite | Ca5.9Mn1.7Fe3Ti3(AsO3)12 · 4-5H2O |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Cordierite | Mg2Al4Si5O18 |
| O | ⓘ Crocoite | PbCr6+O4 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Ferberite | FeWO4 |
| O | ⓘ Ferro-tschermakite | ◻Ca2(Fe32+Al2)(Al2Si6O22)(OH)2 |
| O | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemloite | (Ti,V3+,Fe3+,Al)12(As3+,Sb3+)2O23(OH) |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Karelianite | V23+O3 |
| O | ⓘ Kermesite | Sb2S2O |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Hydroxycalcioroméite | (Ca,Sb3+)2(Sb5+,Ti)2O6(OH) |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Perovskite | CaTiO3 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| O | ⓘ Pumpellyite-(Mg) | Ca2MgAl2[Si2O6OH][SiO4](OH)2(OH) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Tomichite | (V,Fe)4Ti3AsO13(OH) |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| O | ⓘ Fayalite-Forsterite Series | |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Poppiite | Ca2V3+V23+[Si2O6OH][SiO4](OH)2O |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Phlogopite var. Vanadium-bearing phlogopite | K(Mg,V3+)3(AlSi3O10)(OH)2 |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Cordierite | Mg2Al4Si5O18 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Pumpellyite-(Mg) | Ca2MgAl2[Si2O6OH][SiO4](OH)2(OH) |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Mg | ⓘ Fayalite-Forsterite Series | |
| Mg | ⓘ Phlogopite var. Vanadium-bearing phlogopite | K(Mg,V3+)3(AlSi3O10)(OH)2 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Allanite-(La) | (CaLa)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Armenite | Ba(H2O)2Ca2Al3[Al3Si9O30] |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Cordierite | Mg2Al4Si5O18 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Ferro-tschermakite | ◻Ca2(Fe32+Al2)(Al2Si6O22)(OH)2 |
| Al | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Hemloite | (Ti,V3+,Fe3+,Al)12(As3+,Sb3+)2O23(OH) |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| Al | ⓘ Pumpellyite-(Mg) | Ca2MgAl2[Si2O6OH][SiO4](OH)2(OH) |
| Al | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Phlogopite var. Vanadium-bearing phlogopite | K(Mg,V3+)3(AlSi3O10)(OH)2 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Allanite-(La) | (CaLa)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Apophyllite Group | AB4[Si8O20]X · 8H2O |
| Si | ⓘ Armenite | Ba(H2O)2Ca2Al3[Al3Si9O30] |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Cordierite | Mg2Al4Si5O18 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Ferro-tschermakite | ◻Ca2(Fe32+Al2)(Al2Si6O22)(OH)2 |
| Si | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| Si | ⓘ Pumpellyite-(Mg) | Ca2MgAl2[Si2O6OH][SiO4](OH)2(OH) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Si | ⓘ Fayalite-Forsterite Series | |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Poppiite | Ca2V3+V23+[Si2O6OH][SiO4](OH)2O |
| Si | ⓘ Phlogopite var. Vanadium-bearing phlogopite | K(Mg,V3+)3(AlSi3O10)(OH)2 |
| P | Phosphorus | |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Aktashite | Cu6Hg3As4S12 |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Baumhauerite | Pb12As16S36 |
| S | ⓘ Berthierite | FeSb2S4 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chalcostibite | CuSbS2 |
| S | ⓘ Cinnabar | HgS |
| S | ⓘ Covellite | CuS |
| S | ⓘ Criddleite | TlAg2Au3Sb10S10 |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Dufrénoysite | Pb2As2S5 |
| S | ⓘ Galena | PbS |
| S | ⓘ Galkhaite | (Hg5Cu)CsAs4S12 |
| S | ⓘ Geocronite | Pb14Sb6S23 |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Gudmundite | FeSbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Kermesite | Sb2S2O |
| S | ⓘ Lenaite | AgFeS2 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Orpiment | As2S3 |
| S | ⓘ Parapierrotite | TlSb5S8 |
| S | ⓘ Pararealgar | As4S4 |
| S | ⓘ Pääkkönenite | Sb2AsS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Rathite | Ag2Pb12-xTlx/2As18+x/2S40 |
| S | ⓘ Realgar | As4S4 |
| S | ⓘ Routhierite | Tl(Cu,Ag)(Hg,Zn)2(As,Sb)2S6 |
| S | ⓘ Seligmannite | PbCuAsS3 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Tvalchrelidzeite | Hg3SbAsS3 |
| S | ⓘ Twinnite | Pb0.8Tl0.1Sb1.3As0.8S4 |
| S | ⓘ Ullmannite | NiSbS |
| S | ⓘ Vaughanite | TlHgSb4S7 |
| S | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| S | ⓘ Wurtzite | (Zn,Fe)S |
| S | ⓘ Zinkenite | Pb9Sb22S42 |
| S | ⓘ Clerite | MnSb2S4 |
| S | ⓘ Biagioniite | Tl2SbS2 |
| S | ⓘ Thunderbayite | TlAg3Au3Sb7S6 |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| K | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Phlogopite var. Vanadium-bearing phlogopite | K(Mg,V3+)3(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Allanite-(La) | (CaLa)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Armenite | Ba(H2O)2Ca2Al3[Al3Si9O30] |
| Ca | ⓘ Cafarsite | Ca5.9Mn1.7Fe3Ti3(AsO3)12 · 4-5H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Ferro-tschermakite | ◻Ca2(Fe32+Al2)(Al2Si6O22)(OH)2 |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Hydroxycalcioroméite | (Ca,Sb3+)2(Sb5+,Ti)2O6(OH) |
| Ca | ⓘ Perovskite | CaTiO3 |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| Ca | ⓘ Pumpellyite-(Mg) | Ca2MgAl2[Si2O6OH][SiO4](OH)2(OH) |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ca | ⓘ Poppiite | Ca2V3+V23+[Si2O6OH][SiO4](OH)2O |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Cafarsite | Ca5.9Mn1.7Fe3Ti3(AsO3)12 · 4-5H2O |
| Ti | ⓘ Hemloite | (Ti,V3+,Fe3+,Al)12(As3+,Sb3+)2O23(OH) |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Hydroxycalcioroméite | (Ca,Sb3+)2(Sb5+,Ti)2O6(OH) |
| Ti | ⓘ Perovskite | CaTiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Ti | ⓘ Tomichite | (V,Fe)4Ti3AsO13(OH) |
| V | Vanadium | |
| V | ⓘ Hemloite | (Ti,V3+,Fe3+,Al)12(As3+,Sb3+)2O23(OH) |
| V | ⓘ Karelianite | V23+O3 |
| V | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| V | ⓘ Tomichite | (V,Fe)4Ti3AsO13(OH) |
| V | ⓘ Poppiite | Ca2V3+V23+[Si2O6OH][SiO4](OH)2O |
| V | ⓘ Phlogopite var. Vanadium-bearing phlogopite | K(Mg,V3+)3(AlSi3O10)(OH)2 |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Crocoite | PbCr6+O4 |
| Cr | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Mn | Manganese | |
| Mn | ⓘ Cafarsite | Ca5.9Mn1.7Fe3Ti3(AsO3)12 · 4-5H2O |
| Mn | ⓘ Clerite | MnSb2S4 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Allanite-(La) | (CaLa)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Berthierite | FeSb2S4 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Cafarsite | Ca5.9Mn1.7Fe3Ti3(AsO3)12 · 4-5H2O |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ferberite | FeWO4 |
| Fe | ⓘ Ferro-tschermakite | ◻Ca2(Fe32+Al2)(Al2Si6O22)(OH)2 |
| Fe | ⓘ Gudmundite | FeSbS |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hemloite | (Ti,V3+,Fe3+,Al)12(As3+,Sb3+)2O23(OH) |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Lenaite | AgFeS2 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Tomichite | (V,Fe)4Ti3AsO13(OH) |
| Fe | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Wurtzite | (Zn,Fe)S |
| Fe | ⓘ Fayalite-Forsterite Series | |
| Ni | Nickel | |
| Ni | ⓘ Breithauptite | NiSb |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Melonite | NiTe2 |
| Ni | ⓘ Ullmannite | NiSbS |
| Cu | Copper | |
| Cu | ⓘ Aktashite | Cu6Hg3As4S12 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chalcostibite | CuSbS2 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Galkhaite | (Hg5Cu)CsAs4S12 |
| Cu | ⓘ Routhierite | Tl(Cu,Ag)(Hg,Zn)2(As,Sb)2S6 |
| Cu | ⓘ Seligmannite | PbCuAsS3 |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Zn | Zinc | |
| Zn | ⓘ Routhierite | Tl(Cu,Ag)(Hg,Zn)2(As,Sb)2S6 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Wurtzite | (Zn,Fe)S |
| As | Arsenic | |
| As | ⓘ Aktashite | Cu6Hg3As4S12 |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Native Arsenic | As |
| As | ⓘ Baumhauerite | Pb12As16S36 |
| As | ⓘ Cafarsite | Ca5.9Mn1.7Fe3Ti3(AsO3)12 · 4-5H2O |
| As | ⓘ Dufrénoysite | Pb2As2S5 |
| As | ⓘ Galkhaite | (Hg5Cu)CsAs4S12 |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Hemloite | (Ti,V3+,Fe3+,Al)12(As3+,Sb3+)2O23(OH) |
| As | ⓘ Orpiment | As2S3 |
| As | ⓘ Pararealgar | As4S4 |
| As | ⓘ Pääkkönenite | Sb2AsS2 |
| As | ⓘ Rathite | Ag2Pb12-xTlx/2As18+x/2S40 |
| As | ⓘ Realgar | As4S4 |
| As | ⓘ Routhierite | Tl(Cu,Ag)(Hg,Zn)2(As,Sb)2S6 |
| As | ⓘ Seligmannite | PbCuAsS3 |
| As | ⓘ Stibarsen | AsSb |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Tomichite | (V,Fe)4Ti3AsO13(OH) |
| As | ⓘ Tvalchrelidzeite | Hg3SbAsS3 |
| As | ⓘ Twinnite | Pb0.8Tl0.1Sb1.3As0.8S4 |
| Se | Selenium | |
| Se | ⓘ Clausthalite | PbSe |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ag | Silver | |
| Ag | ⓘ Criddleite | TlAg2Au3Sb10S10 |
| Ag | ⓘ Hessite | Ag2Te |
| Ag | ⓘ Lenaite | AgFeS2 |
| Ag | ⓘ Petzite | Ag3AuTe2 |
| Ag | ⓘ Rathite | Ag2Pb12-xTlx/2As18+x/2S40 |
| Ag | ⓘ Routhierite | Tl(Cu,Ag)(Hg,Zn)2(As,Sb)2S6 |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ UM1973-24-Te:AgSb | ~AgSbTe2 |
| Ag | ⓘ Thunderbayite | TlAg3Au3Sb7S6 |
| Sb | Antimony | |
| Sb | ⓘ Native Antimony | Sb |
| Sb | ⓘ Aurostibite | AuSb2 |
| Sb | ⓘ Berthierite | FeSb2S4 |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Breithauptite | NiSb |
| Sb | ⓘ Chalcostibite | CuSbS2 |
| Sb | ⓘ Criddleite | TlAg2Au3Sb10S10 |
| Sb | ⓘ Geocronite | Pb14Sb6S23 |
| Sb | ⓘ Gudmundite | FeSbS |
| Sb | ⓘ Hemloite | (Ti,V3+,Fe3+,Al)12(As3+,Sb3+)2O23(OH) |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Kermesite | Sb2S2O |
| Sb | ⓘ Hydroxycalcioroméite | (Ca,Sb3+)2(Sb5+,Ti)2O6(OH) |
| Sb | ⓘ Parapierrotite | TlSb5S8 |
| Sb | ⓘ Pääkkönenite | Sb2AsS2 |
| Sb | ⓘ Routhierite | Tl(Cu,Ag)(Hg,Zn)2(As,Sb)2S6 |
| Sb | ⓘ Stibarsen | AsSb |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Tvalchrelidzeite | Hg3SbAsS3 |
| Sb | ⓘ Twinnite | Pb0.8Tl0.1Sb1.3As0.8S4 |
| Sb | ⓘ Ullmannite | NiSbS |
| Sb | ⓘ Vaughanite | TlHgSb4S7 |
| Sb | ⓘ Zinkenite | Pb9Sb22S42 |
| Sb | ⓘ Clerite | MnSb2S4 |
| Sb | ⓘ UM1973-24-Te:AgSb | ~AgSbTe2 |
| Sb | ⓘ Biagioniite | Tl2SbS2 |
| Sb | ⓘ Thunderbayite | TlAg3Au3Sb7S6 |
| Te | Tellurium | |
| Te | ⓘ Altaite | PbTe |
| Te | ⓘ Calaverite | AuTe2 |
| Te | ⓘ Coloradoite | HgTe |
| Te | ⓘ Hessite | Ag2Te |
| Te | ⓘ Melonite | NiTe2 |
| Te | ⓘ Petzite | Ag3AuTe2 |
| Te | ⓘ UM1973-24-Te:AgSb | ~AgSbTe2 |
| Cs | Caesium | |
| Cs | ⓘ Galkhaite | (Hg5Cu)CsAs4S12 |
| Ba | Barium | |
| Ba | ⓘ Armenite | Ba(H2O)2Ca2Al3[Al3Si9O30] |
| Ba | ⓘ Baryte | BaSO4 |
| La | Lanthanum | |
| La | ⓘ Allanite-(La) | (CaLa)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ce | Cerium | |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| W | Tungsten | |
| W | ⓘ Ferberite | FeWO4 |
| W | ⓘ Scheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Aurostibite | AuSb2 |
| Au | ⓘ Calaverite | AuTe2 |
| Au | ⓘ Criddleite | TlAg2Au3Sb10S10 |
| Au | ⓘ Native Gold | Au |
| Au | ⓘ Petzite | Ag3AuTe2 |
| Au | ⓘ Thunderbayite | TlAg3Au3Sb7S6 |
| Hg | Mercury | |
| Hg | ⓘ Aktashite | Cu6Hg3As4S12 |
| Hg | ⓘ Cinnabar | HgS |
| Hg | ⓘ Coloradoite | HgTe |
| Hg | ⓘ Galkhaite | (Hg5Cu)CsAs4S12 |
| Hg | ⓘ Routhierite | Tl(Cu,Ag)(Hg,Zn)2(As,Sb)2S6 |
| Hg | ⓘ Tvalchrelidzeite | Hg3SbAsS3 |
| Hg | ⓘ Vaughanite | TlHgSb4S7 |
| Tl | Thallium | |
| Tl | ⓘ Criddleite | TlAg2Au3Sb10S10 |
| Tl | ⓘ Parapierrotite | TlSb5S8 |
| Tl | ⓘ Rathite | Ag2Pb12-xTlx/2As18+x/2S40 |
| Tl | ⓘ Routhierite | Tl(Cu,Ag)(Hg,Zn)2(As,Sb)2S6 |
| Tl | ⓘ Twinnite | Pb0.8Tl0.1Sb1.3As0.8S4 |
| Tl | ⓘ Vaughanite | TlHgSb4S7 |
| Tl | ⓘ Biagioniite | Tl2SbS2 |
| Tl | ⓘ Thunderbayite | TlAg3Au3Sb7S6 |
| Pb | Lead | |
| Pb | ⓘ Altaite | PbTe |
| Pb | ⓘ Baumhauerite | Pb12As16S36 |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Clausthalite | PbSe |
| Pb | ⓘ Crocoite | PbCr6+O4 |
| Pb | ⓘ Dufrénoysite | Pb2As2S5 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Geocronite | Pb14Sb6S23 |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Rathite | Ag2Pb12-xTlx/2As18+x/2S40 |
| Pb | ⓘ Seligmannite | PbCuAsS3 |
| Pb | ⓘ Twinnite | Pb0.8Tl0.1Sb1.3As0.8S4 |
| Pb | ⓘ Zinkenite | Pb9Sb22S42 |
Geochronology
Mineralization age: Archean : 2816 Ma to 2578 ± 3 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Precambrian | |||||||||||||||||||||||||
| Archean | |||||||||||||||||||||||||
| Neoarchean |
| ||||||||||||||||||||||||
| Mesoarchean |
| ||||||||||||||||||||||||
Localities in this Region
- Ontario
- Thunder Bay District
- Bomby Township
- Hemlo gold deposit
- Bomby Township
- Thunder Bay District
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Cameron, Eion M. (1986) Gold and Copper-Zinc Metallogeny Hemlo — Manitouwadge — Winston Lake Ontario, Canada. Journal of Geochemical Exploration, 26 (2) 187-188 doi:10.1016/0375-6742(86)90067-1
Harris, Donald C., Roberts, Andrew C., Gilles Laflamme, J. H., Stanley, Chris J. (1988) Criddleite, TlAg2Au3Sb10S10, a New Gold-Bearing Mineral from Hemlo, Ontario, Canada. Mineralogical Magazine, 52 (368) 691-697 doi:10.1180/minmag.1988.052.368.13
Corfu, F., Muir, T.L. (1989) The Hemlo-Heron Bay greenstone belt and Hemlo Au-Mo deposit, Superior Province, Ontario, Canada 1. Sequence of igneous activity determined by zircon U-Pb geochronology. Chemical Geology: Isotope Geoscience section, 79 (3). 183-200 doi:10.1016/0168-9622(89)90029-8
Corfu, F., Muir, T.L. (1989) The Hemlo-Heron Bay greenstone belt and Hemlo Au-Mo deposit, Superior Province, Ontario, Canada 2. Timing of metamorphism, alteration and Au mineralization from titanite, rutile, and monazite U-Pb geochronology. Chemical Geology: Isotope Geoscience section, 79 (3). 201-223 doi:10.1016/0168-9622(89)90030-4
Harris, Donald C., Roberts, Andrew C., Criddle, Alan J. (1989) Vaughanite, TlHgSb4S7, a new mineral from Hemlo, Ontario, Canada. Mineralogical Magazine, 53 (369) 79-83 doi:10.1180/minmag.1989.053.369.08
Pan, Yuanming, Fleet, Michael E. (1991) Vanadian allanite-(La) and Vanadian allanite-(Ce) from the Hemlo gold deposit, Ontario, Canada. Mineralogical Magazine, 55 (381) 497-507 doi:10.1180/minmag.1991.055.381.01
Pan, Yuanming, Fleet, Michael E. (1992) Mineral chemistry and geochemistry of vanadian silicates in the Hemlo gold deposit, Ontario, Canada. Contributions to Mineralogy and Petrology, 109 (4) 511-525 doi:10.1007/bf00306553
Pan, Yuanming, Fleet, Michael E. (1992) Calc-silicate alteration in the Hemlo gold deposit, Ontario; mineral assemblages, P-T-X constraints, and significance. Economic Geology, 87 (4) 1104-1120 doi:10.2113/gsecongeo.87.4.1104
Pan, Yuanming, Fleet, Michael E., Macrae, Neil D. (1993) Oriented monazite inclusions in apatite porphyroblasts from the Hemlo gold deposit, Ontario, Canada. Mineralogical Magazine, 57 (389) 697-707 doi:10.1180/minmag.1993.057.389.14
Kuhns, Roger J., Sawkins, F. J., Ito, Emi (1994) Magmatism, metamorphism and deformation at Hemlo, Ontario, and the timing of Au-Mo mineralization in the Golden Giant Mine. Economic Geology, 89 (4) 720-756 doi:10.2113/gsecongeo.89.4.720
Pan, Yuanming; Fleet, Michael E. (1995) The late Archean Hemlo gold deposit, Ontario, Canada: a review and synthesis. Ore Geology Reviews, 9 (6). doi:10.1016/0169-1368(95)00003-k
Fleet, Michael E., Seller, Michael H. (1997) Rare earth elements, protoliths, and alteration at the Hemlo gold deposit, Ontario, Canada, and comparison with argillic and sericitic alteration in the Highland Valley porphyry district, British Columbia, Canada. Economic Geology, 92 (5) 551-568 doi:10.2113/gsecongeo.92.5.551
Powell, Wayne G., Pattison, David R. M. (1997) An exsolution origin for low-temperature sulfides at the Hemlo gold deposit, Ontario, Canada. Economic Geology, 92 (5) 569-577 doi:10.2113/gsecongeo.92.5.569
Lin, Shoufa (2001) Stratigraphic and Structural Setting of the Hemlo Gold Deposit, Ontario, Canada. Economic Geology, 96 (3) 477-507 doi:10.2113/gsecongeo.96.3.477
Muir, T.L (2002) The Hemlo gold deposit, Ontario, Canada: principal deposit characteristics and constraints on mineralization. Ore Geology Reviews, 21 (1). doi:10.1016/s0169-1368(02)00066-5
Muir, T L (2003) Structural evolution of the Hemlo greenstone belt in the vicinity of the world-class Hemlo gold deposit. Canadian Journal of Earth Sciences, 40 (3) 395-430 doi:10.1139/e03-004
Tomkins, A. G., Pattison, D. R. M., Zaleski, E. (2004) The Hemlo Gold Deposit, Ontario: An Example of Melting and Mobilization of a Precious Metal-Sulfosalt Assemblage during Amphibolite Facies Metamorphism and Deformation. Economic Geology, 99 (6) 1063-1084 doi:10.2113/gsecongeo.99.6.1063
Tomkins, A. G., Frost, B. R., Pattison, D. R.M. (2006) Arsenopyrite melting during metamorphism of sulfide ore deposits. The Canadian Mineralogist, 44 (5). 1045-1062 doi:10.2113/gscanmin.44.5.1045




Hemlo gold deposit, Bomby Township, Thunder Bay District, Ontario, Canada