Obertalbach valley, Schladming, Liezen District, Styria, Austriai
| Regional Level Types | |
|---|---|
| Obertalbach valley | Valley |
| Schladming | Municipality |
| Liezen District | District |
| Styria | State |
| Austria | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
47° North , 13° East (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~14km
Type:
Köppen climate type:
Name(s) in local language(s):
Obertal, Schladminger Tauern, Schladming, Steiermark, Österreich
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities99 valid minerals. 2 (TL) - type locality of valid minerals.
Detailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Antimony | 1.CA.05 | Sb |
| ⓘ | Native Arsenic | 1.CA.05 | As |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Stibarsen | 1.CA.05 | AsSb |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Maucherite | 2.AB.15 | Ni11As8 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Parkerite | 2.BE.20 | Ni3(Bi,Pb)2S2 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Breithauptite | 2.CC.05 | NiSb |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Mackinawite | 2.CC.25 | FeS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Linnaeite | 2.DA.05 | Co2+Co3+2S4 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Pyrite var. Bravoite | 2.EB.05a | (Fe,Ni)S2 |
| ⓘ | 2.EB.05a | FeS2 | |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Pararammelsbergite | 2.EB.10e | NiAs2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Rammelsbergite | 2.EB.15a | NiAs2 |
| ⓘ | Safflorite | 2.EB.15a | (Co,Ni,Fe)As2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | var. Danaite | 2.EB.20 | (Fe0.90Co0.10)AsS - (Fe0.65Co0.35)AsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Gersdorffite (TL) | 2.EB.25 | NiAsS |
| ⓘ | Ullmannite | 2.EB.25 | NiSbS |
| ⓘ | Nickelskutterudite | 2.EC.05 | NiAs3 |
| ⓘ | Skutterudite | 2.EC.05 | CoAs3 |
| ⓘ | Wittichenite ? | 2.GA.20 | Cu3BiS3 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | 'Tetrahedrite Subgroup var. Bismuth-bearing Tetrahedrite' | 2.GB.05 | Cu6(Cu4(Fe/Zn)2)(Sb,Bi)4S12S |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Argentotetrahedrite-(Fe) | 2.GB.05 | Ag6(Cu4Fe2)Sb4S12S |
| ⓘ | Emplectite | 2.HA.05 | CuBiS2 |
| ⓘ | Meneghinite | 2.HB.05b | Pb13CuSb7S24 |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Arsenolite | 4.CB.50 | As2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Oxyplumboroméite | 4.DH. | Pb2Sb2O6O |
| ⓘ | Bindheimite | 4.DH.20 | Pb2Sb2O6O |
| ⓘ | Asbolane | 4.FL.30 | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Strontianite | 5.AB.15 | SrCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Beaverite-(Cu) | 7.BC.10 | Pb(Fe3+2Cu)(SO4)2(OH)6 |
| ⓘ | Caledonite | 7.BC.50 | Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Epsomite | 7.CB.40 | MgSO4 · 7H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Copiapite | 7.DB.35 | Fe2+Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Devilline ? | 7.DD.30 | CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Schulténite | 8.AD.30 | Pb(HAsO4) |
| ⓘ | Arsenbrackebuschite | 8.BG.05 | Pb2Fe3+(AsO4)2(OH) |
| ⓘ | Segnitite | 8.BL.10 | PbFe3+3AsO4(AsO3OH)(OH)6 |
| ⓘ | Stibiosegnitite | 8.BL.10 | Pb(Fe3+2.5Sb5+0.5)(AsO4)2(OH)6 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Vanadinite | 8.BN.05 | Pb5(VO4)3Cl |
| ⓘ | 'Unnamed (OH-analogue of Mimetite)' | 8.BN.05 | Pb5(AsO4)3(OH) |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Newberyite | 8.CE.10 | Mg(PO3OH) · 3H2O |
| ⓘ | Phosphorrösslerite | 8.CE.20 | Mg(PO3OH) · 7H2O |
| ⓘ | Annabergite | 8.CE.40 | Ni3(AsO4)2 · 8H2O |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Hörnesite | 8.CE.40 | Mg3(AsO4)2 · 8H2O |
| ⓘ | Symplesite | 8.CE.45 | Fe2+3(AsO4)2 · 8H2O |
| ⓘ | Struvite-(K) (TL) | 8.CH.40 | KMg(PO4) · 6H2O |
| ⓘ | Phaunouxite | 8.CJ.40 | Ca3(AsO4)2 · 11H2O |
| ⓘ | Rauenthalite | 8.CJ.40 | Ca3(AsO4)2 · 10H2O |
| ⓘ | Brushite | 8.CJ.50 | Ca(PO3OH) · 2H2O |
| ⓘ | Pharmacolite | 8.CJ.50 | Ca(HAsO4) · 2H2O |
| ⓘ | Pitticite | 8.DB.05 | (Fe, AsO4, H2O) (?) |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| Group 9 - Silicates | |||
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Chamosite | 9.EC.55 | Fe2+5Al(AlSi3O10)(OH)8 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Asbestos' | - | |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Manganese Oxides' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Tetrahedrite Group' | - | M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
| ⓘ | 'Unnamed (K-Mg Phosphate Hydrate)' | - | KMg2H(PO4)2 · 15H2O |
| ⓘ | 'Cerussite-Strontianite Series' | - | |
| ⓘ | 'Rhombohedral Carbonate' | - | (Ca/Mg/Fe/Mn etc)CO3 |
| ⓘ | 'Unnamed (Mn-Fe-Pb-Sb Oxyhydroxide)' | - | Mn-Fe-Pb-Sb-O-H |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| H | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Brushite | Ca(PO3OH) · 2H2O |
| H | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| H | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| H | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Epsomite | MgSO4 · 7H2O |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Newberyite | Mg(PO3OH) · 3H2O |
| H | ⓘ Phosphorrösslerite | Mg(PO3OH) · 7H2O |
| H | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Phaunouxite | Ca3(AsO4)2 · 11H2O |
| H | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| H | ⓘ Rauenthalite | Ca3(AsO4)2 · 10H2O |
| H | ⓘ Schulténite | Pb(HAsO4) |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| H | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| H | ⓘ Arsenbrackebuschite | Pb2Fe3+(AsO4)2(OH) |
| H | ⓘ Struvite-(K) | KMg(PO4) · 6H2O |
| H | ⓘ Unnamed (K-Mg Phosphate Hydrate) | KMg2H(PO4)2 · 15H2O |
| H | ⓘ Unnamed (OH-analogue of Mimetite) | Pb5(AsO4)3(OH) |
| H | ⓘ Unnamed (Mn-Fe-Pb-Sb Oxyhydroxide) | Mn-Fe-Pb-Sb-O-H |
| H | ⓘ Stibiosegnitite | Pb(Fe3+2.5Sb5+0.5)(AsO4)2(OH)6 |
| B | Boron | |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Strontianite | SrCO3 |
| C | ⓘ Cerussite-Strontianite Series | |
| C | ⓘ Rhombohedral Carbonate | (Ca/Mg/Fe/Mn etc)CO3 |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| O | ⓘ Arsenolite | As2O3 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| O | ⓘ Bindheimite | Pb2Sb2O6O |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Brushite | Ca(PO3OH) · 2H2O |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Epsomite | MgSO4 · 7H2O |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Newberyite | Mg(PO3OH) · 3H2O |
| O | ⓘ Phosphorrösslerite | Mg(PO3OH) · 7H2O |
| O | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Phaunouxite | Ca3(AsO4)2 · 11H2O |
| O | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rauenthalite | Ca3(AsO4)2 · 10H2O |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schulténite | Pb(HAsO4) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| O | ⓘ Strontianite | SrCO3 |
| O | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Vanadinite | Pb5(VO4)3Cl |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Arsenbrackebuschite | Pb2Fe3+(AsO4)2(OH) |
| O | ⓘ Struvite-(K) | KMg(PO4) · 6H2O |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Unnamed (K-Mg Phosphate Hydrate) | KMg2H(PO4)2 · 15H2O |
| O | ⓘ Oxyplumboroméite | Pb2Sb2O6O |
| O | ⓘ Unnamed (OH-analogue of Mimetite) | Pb5(AsO4)3(OH) |
| O | ⓘ Cerussite-Strontianite Series | |
| O | ⓘ Rhombohedral Carbonate | (Ca/Mg/Fe/Mn etc)CO3 |
| O | ⓘ Unnamed (Mn-Fe-Pb-Sb Oxyhydroxide) | Mn-Fe-Pb-Sb-O-H |
| O | ⓘ Stibiosegnitite | Pb(Fe3+2.5Sb5+0.5)(AsO4)2(OH)6 |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Mg | Magnesium | |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Epsomite | MgSO4 · 7H2O |
| Mg | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| Mg | ⓘ Newberyite | Mg(PO3OH) · 3H2O |
| Mg | ⓘ Phosphorrösslerite | Mg(PO3OH) · 7H2O |
| Mg | ⓘ Struvite-(K) | KMg(PO4) · 6H2O |
| Mg | ⓘ Unnamed (K-Mg Phosphate Hydrate) | KMg2H(PO4)2 · 15H2O |
| Mg | ⓘ Rhombohedral Carbonate | (Ca/Mg/Fe/Mn etc)CO3 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| P | Phosphorus | |
| P | ⓘ Brushite | Ca(PO3OH) · 2H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Newberyite | Mg(PO3OH) · 3H2O |
| P | ⓘ Phosphorrösslerite | Mg(PO3OH) · 7H2O |
| P | ⓘ Struvite-(K) | KMg(PO4) · 6H2O |
| P | ⓘ Apatite | Ca5(PO4)3A |
| P | ⓘ Unnamed (K-Mg Phosphate Hydrate) | KMg2H(PO4)2 · 15H2O |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Tetrahedrite Subgroup var. Bismuth-bearing Tetrahedrite | Cu6(Cu4(Fe/Zn)2)(Sb,Bi)4S12S |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| S | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Emplectite | CuBiS2 |
| S | ⓘ Epsomite | MgSO4 · 7H2O |
| S | ⓘ Galena | PbS |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Linnaeite | Co2+Co23+S4 |
| S | ⓘ Mackinawite | FeS |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Meneghinite | Pb13CuSb7S24 |
| S | ⓘ Millerite | NiS |
| S | ⓘ Parkerite | Ni3(Bi,Pb)2S2 |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Ullmannite | NiSbS |
| S | ⓘ Wittichenite | Cu3BiS3 |
| S | ⓘ Arsenopyrite var. Danaite | (Fe0.90Co0.10)AsS - (Fe0.65Co0.35)AsS |
| S | ⓘ Tetrahedrite Group | M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
| S | ⓘ Argentotetrahedrite-(Fe) | Ag6(Cu4Fe2)Sb4S12S |
| Cl | Chlorine | |
| Cl | ⓘ Vanadinite | Pb5(VO4)3Cl |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| K | ⓘ Struvite-(K) | KMg(PO4) · 6H2O |
| K | ⓘ Unnamed (K-Mg Phosphate Hydrate) | KMg2H(PO4)2 · 15H2O |
| Ca | Calcium | |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Brushite | Ca(PO3OH) · 2H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| Ca | ⓘ Phaunouxite | Ca3(AsO4)2 · 11H2O |
| Ca | ⓘ Rauenthalite | Ca3(AsO4)2 · 10H2O |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ca | ⓘ Rhombohedral Carbonate | (Ca/Mg/Fe/Mn etc)CO3 |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| V | Vanadium | |
| V | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Mn | Manganese | |
| Mn | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| Mn | ⓘ Rhombohedral Carbonate | (Ca/Mg/Fe/Mn etc)CO3 |
| Mn | ⓘ Unnamed (Mn-Fe-Pb-Sb Oxyhydroxide) | Mn-Fe-Pb-Sb-O-H |
| Fe | Iron | |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Tetrahedrite Subgroup var. Bismuth-bearing Tetrahedrite | Cu6(Cu4(Fe/Zn)2)(Sb,Bi)4S12S |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Fe | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Mackinawite | FeS |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| Fe | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| Fe | ⓘ Arsenbrackebuschite | Pb2Fe3+(AsO4)2(OH) |
| Fe | ⓘ Arsenopyrite var. Danaite | (Fe0.90Co0.10)AsS - (Fe0.65Co0.35)AsS |
| Fe | ⓘ Argentotetrahedrite-(Fe) | Ag6(Cu4Fe2)Sb4S12S |
| Fe | ⓘ Rhombohedral Carbonate | (Ca/Mg/Fe/Mn etc)CO3 |
| Fe | ⓘ Unnamed (Mn-Fe-Pb-Sb Oxyhydroxide) | Mn-Fe-Pb-Sb-O-H |
| Fe | ⓘ Stibiosegnitite | Pb(Fe3+2.5Sb5+0.5)(AsO4)2(OH)6 |
| Co | Cobalt | |
| Co | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Co | ⓘ Linnaeite | Co2+Co23+S4 |
| Co | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Co | ⓘ Skutterudite | CoAs3 |
| Co | ⓘ Arsenopyrite var. Danaite | (Fe0.90Co0.10)AsS - (Fe0.65Co0.35)AsS |
| Ni | Nickel | |
| Ni | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| Ni | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| Ni | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| Ni | ⓘ Breithauptite | NiSb |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Maucherite | Ni11As8 |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Nickelskutterudite | NiAs3 |
| Ni | ⓘ Nickeline | NiAs |
| Ni | ⓘ Pararammelsbergite | NiAs2 |
| Ni | ⓘ Parkerite | Ni3(Bi,Pb)2S2 |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Rammelsbergite | NiAs2 |
| Ni | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Ni | ⓘ Ullmannite | NiSbS |
| Cu | Copper | |
| Cu | ⓘ Tetrahedrite Subgroup var. Bismuth-bearing Tetrahedrite | Cu6(Cu4(Fe/Zn)2)(Sb,Bi)4S12S |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Emplectite | CuBiS2 |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Meneghinite | Pb13CuSb7S24 |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Wittichenite | Cu3BiS3 |
| Cu | ⓘ Argentotetrahedrite-(Fe) | Ag6(Cu4Fe2)Sb4S12S |
| Zn | Zinc | |
| Zn | ⓘ Tetrahedrite Subgroup var. Bismuth-bearing Tetrahedrite | Cu6(Cu4(Fe/Zn)2)(Sb,Bi)4S12S |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| As | ⓘ Arsenolite | As2O3 |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Native Arsenic | As |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Maucherite | Ni11As8 |
| As | ⓘ Nickelskutterudite | NiAs3 |
| As | ⓘ Nickeline | NiAs |
| As | ⓘ Pararammelsbergite | NiAs2 |
| As | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Phaunouxite | Ca3(AsO4)2 · 11H2O |
| As | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| As | ⓘ Rammelsbergite | NiAs2 |
| As | ⓘ Rauenthalite | Ca3(AsO4)2 · 10H2O |
| As | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| As | ⓘ Schulténite | Pb(HAsO4) |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| As | ⓘ Skutterudite | CoAs3 |
| As | ⓘ Stibarsen | AsSb |
| As | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Arsenbrackebuschite | Pb2Fe3+(AsO4)2(OH) |
| As | ⓘ Arsenopyrite var. Danaite | (Fe0.90Co0.10)AsS - (Fe0.65Co0.35)AsS |
| As | ⓘ Unnamed (OH-analogue of Mimetite) | Pb5(AsO4)3(OH) |
| As | ⓘ Stibiosegnitite | Pb(Fe3+2.5Sb5+0.5)(AsO4)2(OH)6 |
| Sr | Strontium | |
| Sr | ⓘ Strontianite | SrCO3 |
| Sr | ⓘ Cerussite-Strontianite Series | |
| Mo | Molybdenum | |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Argentotetrahedrite-(Fe) | Ag6(Cu4Fe2)Sb4S12S |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sb | Antimony | |
| Sb | ⓘ Tetrahedrite Subgroup var. Bismuth-bearing Tetrahedrite | Cu6(Cu4(Fe/Zn)2)(Sb,Bi)4S12S |
| Sb | ⓘ Native Antimony | Sb |
| Sb | ⓘ Bindheimite | Pb2Sb2O6O |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Breithauptite | NiSb |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Meneghinite | Pb13CuSb7S24 |
| Sb | ⓘ Stibarsen | AsSb |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Ullmannite | NiSbS |
| Sb | ⓘ Oxyplumboroméite | Pb2Sb2O6O |
| Sb | ⓘ Argentotetrahedrite-(Fe) | Ag6(Cu4Fe2)Sb4S12S |
| Sb | ⓘ Unnamed (Mn-Fe-Pb-Sb Oxyhydroxide) | Mn-Fe-Pb-Sb-O-H |
| Sb | ⓘ Stibiosegnitite | Pb(Fe3+2.5Sb5+0.5)(AsO4)2(OH)6 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ce | Cerium | |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Pb | ⓘ Bindheimite | Pb2Sb2O6O |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Meneghinite | Pb13CuSb7S24 |
| Pb | ⓘ Parkerite | Ni3(Bi,Pb)2S2 |
| Pb | ⓘ Schulténite | Pb(HAsO4) |
| Pb | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| Pb | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Arsenbrackebuschite | Pb2Fe3+(AsO4)2(OH) |
| Pb | ⓘ Oxyplumboroméite | Pb2Sb2O6O |
| Pb | ⓘ Unnamed (OH-analogue of Mimetite) | Pb5(AsO4)3(OH) |
| Pb | ⓘ Cerussite-Strontianite Series | |
| Pb | ⓘ Unnamed (Mn-Fe-Pb-Sb Oxyhydroxide) | Mn-Fe-Pb-Sb-O-H |
| Pb | ⓘ Stibiosegnitite | Pb(Fe3+2.5Sb5+0.5)(AsO4)2(OH)6 |
| Bi | Bismuth | |
| Bi | ⓘ Tetrahedrite Subgroup var. Bismuth-bearing Tetrahedrite | Cu6(Cu4(Fe/Zn)2)(Sb,Bi)4S12S |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Emplectite | CuBiS2 |
| Bi | ⓘ Parkerite | Ni3(Bi,Pb)2S2 |
| Bi | ⓘ Wittichenite | Cu3BiS3 |
Localities in this Region
- Styria
- Liezen District
- Schladming
- Liezen District
- Styria
- Liezen District
- Schladming
- Obertalbach valley
- Schladming
- Liezen District
Other Regions, Features and Areas containing this locality
Austria
- Lower Tauern (Niedere Tauern)Mountain Range
- Schladminger Tauern
Eurasian PlateTectonic Plate
- AlpsAccretionary Complex
EuropeContinent
- The AlpsMountain Range
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Obertalbach valley, Schladming, Liezen District, Styria, Austria