Eiskar lake, Obertalbach valley, Schladming, Liezen District, Styria, Austriai
| Regional Level Types | |
|---|---|
| Eiskar lake | Lake |
| Obertalbach valley | Valley |
| Schladming | Municipality |
| Liezen District | District |
| Styria | State |
| Austria | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
47° 16' 56'' North , 13° 43' 56'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Weißpriach | 306 (2018) | 9.7km |
| Untertal | 137 (2018) | 10.0km |
| Fastenberg | 135 (2018) | 11.5km |
| Lessach | 438 (2018) | 11.8km |
| Göriach | 337 (2018) | 12.1km |
Name(s) in local language(s):
Eiskarsee, Obertal, Schladminger Tauern, Schladming, Steiermark, Österreich
Old mines.
Two minerals are not yet completely identified: A Co-Ni-Fe-As-S phase and a Fe-Ni-Co-As phase (Kolitsch & Brandstätter, 2008).
Two minerals are not yet completely identified: A Co-Ni-Fe-As-S phase and a Fe-Ni-Co-As phase (Kolitsch & Brandstätter, 2008).
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ 'Apatite' Formula: Ca5(PO4)3A References: |
| ⓘ Arsenbrackebuschite Formula: Pb2Fe3+(AsO4)2(OH) |
| ⓘ Arsenopyrite Formula: FeAsS References: |
| ⓘ Calcite Formula: CaCO3 References: |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 References: |
| ⓘ Dolomite Formula: CaMg(CO3)2 References: |
| ⓘ Galena Formula: PbS |
| ⓘ Gersdorffite Formula: NiAsS |
| ⓘ Löllingite Formula: FeAs2 |
| ⓘ Native Bismuth Formula: Bi References: |
| ⓘ Schultenite Formula: Pb(HAsO4) |
| ⓘ Segnitite Formula: PbFe3+3AsO4(AsO3OH)(OH)6 |
| ⓘ Stibiosegnitite Formula: Pb(Fe3+2.5Sb5+0.5)(AsO4)2(OH)6 |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S References: |
| ⓘ 'Unnamed (OH-analogue of Mimetite)' Formula: Pb5(AsO4)3(OH) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Schultenite | 8.AD.30 | Pb(HAsO4) |
| ⓘ | Arsenbrackebuschite | 8.BG.05 | Pb2Fe3+(AsO4)2(OH) |
| ⓘ | Segnitite | 8.BL.10 | PbFe3+3AsO4(AsO3OH)(OH)6 |
| ⓘ | Stibiosegnitite | 8.BL.10 | Pb(Fe3+2.5Sb5+0.5)(AsO4)2(OH)6 |
| ⓘ | 'Unnamed (OH-analogue of Mimetite)' | 8.BN.05 | Pb5(AsO4)3(OH) |
| Group 9 - Silicates | |||
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| Unclassified | |||
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Schultenite | Pb(HAsO4) |
| H | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| H | ⓘ Arsenbrackebuschite | Pb2Fe3+(AsO4)2(OH) |
| H | ⓘ Unnamed (OH-analogue of Mimetite) | Pb5(AsO4)3(OH) |
| H | ⓘ Stibiosegnitite | Pb(Fe3+2.5Sb5+0.5)(AsO4)2(OH)6 |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| O | Oxygen | |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Schultenite | Pb(HAsO4) |
| O | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| O | ⓘ Arsenbrackebuschite | Pb2Fe3+(AsO4)2(OH) |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Unnamed (OH-analogue of Mimetite) | Pb5(AsO4)3(OH) |
| O | ⓘ Stibiosegnitite | Pb(Fe3+2.5Sb5+0.5)(AsO4)2(OH)6 |
| Mg | Magnesium | |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Al | Aluminium | |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | Silicon | |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| P | Phosphorus | |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Galena | PbS |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Ca | Calcium | |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Fe | Iron | |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| Fe | ⓘ Arsenbrackebuschite | Pb2Fe3+(AsO4)2(OH) |
| Fe | ⓘ Stibiosegnitite | Pb(Fe3+2.5Sb5+0.5)(AsO4)2(OH)6 |
| Ni | Nickel | |
| Ni | ⓘ Gersdorffite | NiAsS |
| Cu | Copper | |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Schultenite | Pb(HAsO4) |
| As | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| As | ⓘ Arsenbrackebuschite | Pb2Fe3+(AsO4)2(OH) |
| As | ⓘ Unnamed (OH-analogue of Mimetite) | Pb5(AsO4)3(OH) |
| As | ⓘ Stibiosegnitite | Pb(Fe3+2.5Sb5+0.5)(AsO4)2(OH)6 |
| Sb | Antimony | |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Stibiosegnitite | Pb(Fe3+2.5Sb5+0.5)(AsO4)2(OH)6 |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Schultenite | Pb(HAsO4) |
| Pb | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| Pb | ⓘ Arsenbrackebuschite | Pb2Fe3+(AsO4)2(OH) |
| Pb | ⓘ Unnamed (OH-analogue of Mimetite) | Pb5(AsO4)3(OH) |
| Pb | ⓘ Stibiosegnitite | Pb(Fe3+2.5Sb5+0.5)(AsO4)2(OH)6 |
| Bi | Bismuth | |
| Bi | ⓘ Native Bismuth | Bi |
Other Regions, Features and Areas containing this locality
Austria
- Lower Tauern (Niedere Tauern)Mountain Range
- Schladminger Tauern
Eurasian PlateTectonic Plate
- AlpsAccretionary Complex
EuropeContinent
- The AlpsMountain Range
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.