This page is currently not sponsored. Click here to sponsor this page.
Area:
29,486 km2
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Potsdam | 145,292 (2017) |
| Cottbus | 84,754 (2015) |
| Brandenburg an der Havel | 59,826 (2015) |
| Frankfurt (Oder) | 51,691 (2016) |
| Eberswalde | 41,980 (2015) |
| Oranienburg | 40,793 (2015) |
Other Languages:
French:
Brandebourg, Allemagne
German:
Brandenburg, Deutschland
Italian:
Brandeburgo, Germania
Russian:
Бранденбург, Германия
Simplified Chinese:
勃兰登堡, 德国
Spanish:
Brandeburgo, Alemania
Afrikaans:
Brandenburg, Duitsland
Albanian:
Brandenburgu, Gjermania
Alemannic:
Land Brandenburg, Deutschland
Amharic:
ብራንደንቡርክ, ጀርመን
Anglo-Saxon:
Brandenburg, Þēodscland
Arabic:
براندنبورغ, ألمانيا
Aragonese:
Brandemburgo, Alemanya
Armenian:
Բրանդենբուրգ, Գերմանիա
Asturian:
Brandemburgu, Alemaña
Aymara:
Brandenburg suyu, Alimaña
Azeri:
Brandenburq, Almaniya
Bashkir:
Бранденбург, Германия
Basque:
Brandenburgo, Alemania
Bavarian:
Brandnbuag, Deitschland
Belarusian:
Брандэнбург, Германія
Belarusian (Tarashkevitsa):
Брандэнбург, Нямеччына
Bengali:
ব্রান্ডেনবুর্গ, জার্মানি
Bosnian:
Brandenburg, Njemačka
Breton:
Brandenburg, Alamagn
Bulgarian:
Бранденбург, Германия
Catalan:
Brandenburg, Alemanya
Cebuano:
Brandenburg, Alemanya
Central Kurdish/Sorani:
براندنبورگ, ئەڵمانیا
Chechen:
Бранденбург, Германи
Chuvash:
Бранденбург, Германи
Classical Chinese:
勃蘭登堡, 德國
Cornish:
Brandenburg, Almayn
Corsican:
Brandenburg, Germania
Croatian:
Brandenburg, Njemačka
Czech:
Braniborsko, Německo
Danish:
Brandenburg, Tyskland
Dutch:
Brandenburg, Duitsland
Dutch Low Saxon:
Braandenbörg, Duutslaand
Esperanto:
Brandenburgio, Germanio
Estonian:
Brandenburg, Saksamaa
Farsi/Persian:
براندنبورگ, آلمان
Finnish:
Brandenburg, Saksa
Franco-Provençal:
Brandenburg, Alemagne
Friulian:
Brandenburg, Gjermanie
Galician:
Brandeburgo, Alemaña
Georgian:
ბრანდენბურგის მხარე, გერმანია
Greek:
Βρανδεμβούργο, Γερμανία
Guarani:
Brandeburgo, Alemáña
Gujarati:
બ્રાન્ડેનબર્ગ, જર્મની
Hakka:
Brandenburg, Tet-koet
Hebrew:
ברנדנבורג, גרמניה
Hindi:
ब्रैंडेनबर्ग, जर्मनी
Hungarian:
Brandenburg, Németország
Icelandic:
Brandenborg, Þýskaland
Ido:
Brandenburg, Germania
Iloko:
Brandenburg, Alemania
Indonesian:
Brandenburg, Jerman
Interlingua:
Brandeburgo, Germania
Interlingue:
Brandenburgia, Germania
Irish Gaelic:
Brandenburg, An Ghearmáin
Japanese:
ブランデンブルク州, ドイツ
Javanese:
Brandenburg, Jérman
Kannada:
ಬ್ರ್ಯಾಂಡನ್ಬರ್ಗ್, ಜರ್ಮನಿ
Kapampangan:
Brandenburg, Alemanya
Karakalpak:
Brandenburg, Germaniya
Kashubian:
Brandenbùrgiô, Miemieckô
Kazakh (Cyrillic Script):
Бранденбург, Германия
Kongo:
Brandenburg, Alemanyi
Korean:
브란덴부르크주, 독일
Kurdish (Latin Script):
Brandenburg, Almanya
Latin:
Brandenburgum, Germania
Latvian:
Brandenburga, Vācija
Ligurian:
Brandenburgo, Germania
Limburgian:
Brandeburg, Duitsland
Lithuanian:
Brandenburgas, Vokietija
Lombard:
Brandebùrgo, Germania
Low Saxon/Low German:
Brannenborg, Düütschland
Lower Sorbian:
Bramborska, Nimska
Luxembourgish:
Brandenburg, Däitschland
Macedonian:
Бранденбург, Германија
Malagasy:
Brandenburg, Alemaina
Malay:
Brandenburg, Jerman
Manx:
Brandenburg, Yn Ghermaan
Marathi:
ब्रांडेनबुर्ग, जर्मनी
Min Dong Chinese:
Brandenburg, Dáik-guók
Minangkabau:
Brandenburg, Jerman
Minnan / Hokkien-Taiwanese:
Brandenburg, Tek-kok
Mongolian:
Бранденбург, Герман
Nahuatl:
Brandenburg, Alemania
Narom:
Brandenbourg, Allemangne
Neapolitan:
Brandenburg, Germania
Nepali:
ब्रान्डेनबर्ग, जर्मनी
Northern Frisian:
Brandenbörj, Tjüschlönj
Northern Sami:
Brandenburg, Duiska
Norwegian:
Brandenburg, Tyskland
Norwegian (Nynorsk):
Brandenburg, Tyskland
Novial:
Brandenburg, Germania
Occitan:
Brandeborg, Alemanha
Ossetian:
Бранденбург, Герман
Papiamento:
Land Brandenburg, Alemania
Pashto:
براندنبورگ, المان
Pennsylvania German:
Brandenburg, Deitschland
Pfaelzisch:
Brandenburg, Deutschland
Picard:
Brandenburg, Alemanne
Piedmontese:
Brandeborgh, Almagna
Polish:
Brandenburgia, Niemcy
Portuguese:
Brandemburgo, Alemanha
Punjabi:
ਬ੍ਰਾਂਡਨਬੁਰਕ, ਜਰਮਨੀ
Quechua:
Brandenburg, Alimanya
Ripuarian:
Brandeborsch, Dütschland
Romanian:
Brandenburg, Germania
Romansh:
Brandenburg, Germania
Sardinian:
Brandenburg, Germania
Saterland Frisian:
Brandenbuurich, Düütsklound
Scots:
Brandenburg, Germany
Scottish Gaelic:
Brandenburg, A' Ghearmailt
Serbian:
Бранденбург, Њемачка
Serbo-Croatian:
Brandenburg, Njemačka
Sicilian:
Brandenburg, Girmania
Sindhi:
برانڊن برگ, جرمني
Sinhalese:
බ්රන්ඩෙන්බර්ග්, ජර්මනිය
Slovak:
Brandenbursko, Nemecko
Slovenian:
Brandenburg, Nemčija
South Azerbaijani:
براندنبورق, آلمان
Swahili:
Brandenburg, Ujerumani
Swedish:
Brandenburg, Tyskland
Tagalog:
Brandeburgo, Alemanya
Tamil:
பிரண்டென்பேர்க், ஜெர்மனி
Tatar:
Бранденбург, Алмания
Telugu:
బ్రాండెన్బర్గ్, జర్మనీ
Thai:
รัฐบรันเดินบวร์ค, ประเทศเยอรมนี
Traditional Chinese:
勃蘭登堡, 德國
Turkish:
Brandenburg, Almanya
Ukrainian:
Бранденбург, Німеччина
Upper Sorbian:
Braniborska, Němska
Urdu:
برندن برک, جرمنی
Uzbek (Latin Script):
Brandenburg, Germaniya
Venetian:
Brandiburgo, Germania
Vietnamese:
Brandenburg, Đức
Volapük:
Brandänburgän, Deutän
Walloon:
Brandenburg, Almagne
Waray:
Brandenburg, Alemanya
Welsh:
Brandenburg, Yr Almaen
West Flemish:
Brandenburg, Duutsland
West Frisian:
Brandenburch, Dútslân
Western Punjabi:
برانڈنبرگ, جرمنی
Wolof:
Brandenburg, Almaañ
Wu Chinese:
勃兰登堡, 德国
Yiddish:
בראנדנבורג, דייטשלאנד
Yoruba:
Brandenburg, Jẹ́mánì
Zazaki:
Brandenburg, Almanya
Zulu:
Brandenburg, IJalimani
Brandenburg (German: [ˈbʁandn̩bʊʁk]; Low German: Brannenborg; Lower Sorbian: Bramborska [ˈbrambɔrska]) is a state in the northeast of Germany bordering the states of Mecklenburg-Vorpommern, Lower Saxony, Saxony-Anhalt, and Saxony, as well as the country of Poland. With an area of 29,480 square kilometres (11,383 sq mi) and a population of 2.5 million residents, it is the fifth-largest German state by area and the tenth-most populous. Potsdam is the state capital and largest city, and other major towns are Cottbus, Brandenburg an der Havel and Frankfurt (Oder).
Brandenburg surrounds the national capital and city-state of Berlin, and together they form the Berlin/Brandenburg Metropolitan Region, the third-largest metropolitan area in Germany with a total population of about 6.2 million. There was an unsuccessful attempt to unify both states in 1996 and the states cooperate on many matters to this day.
Brandenburg originated in the Northern March in the 900s AD, from areas conquered from the Wends. It later became the Margraviate of Brandenburg, a major principality of the Holy Roman Empire. In the 15th century, it came under the rule of the House of Hohenzollern, which later also became the ruling house of the Duchy of Prussia and established Brandenburg-Prussia, the core of the later Kingdom of Prussia. From 1815 to 1947, Brandenburg was a province of Prussia.
Following the abolition of Prussia after World War II, Brandenburg was established as a state by the Soviet Military Administration in Germany, and became a state of the German Democratic Republic in 1949. In 1952, the state was dissolved and broken up into multiple regional districts. Following German reunification, Brandenburg was re-established in 1990 and became one of the five new states of the Federal Republic of Germany.
Brandenburg surrounds the national capital and city-state of Berlin, and together they form the Berlin/Brandenburg Metropolitan Region, the third-largest metropolitan area in Germany with a total population of about 6.2 million. There was an unsuccessful attempt to unify both states in 1996 and the states cooperate on many matters to this day.
Brandenburg originated in the Northern March in the 900s AD, from areas conquered from the Wends. It later became the Margraviate of Brandenburg, a major principality of the Holy Roman Empire. In the 15th century, it came under the rule of the House of Hohenzollern, which later also became the ruling house of the Duchy of Prussia and established Brandenburg-Prussia, the core of the later Kingdom of Prussia. From 1815 to 1947, Brandenburg was a province of Prussia.
Following the abolition of Prussia after World War II, Brandenburg was established as a state by the Soviet Military Administration in Germany, and became a state of the German Democratic Republic in 1949. In 1952, the state was dissolved and broken up into multiple regional districts. Following German reunification, Brandenburg was re-established in 1990 and became one of the five new states of the Federal Republic of Germany.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities91 valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold var. Electrum | 1.AA.05 | (Au,Ag) |
| ⓘ | 1.AA.05 | Au | |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Iron | 1.AE.05 | Fe |
| ⓘ | var. Kamacite | 1.AE.05 | (Fe,Ni) |
| ⓘ | var. Martensite | 1.AE.05 | Fe |
| ⓘ | Taenite | 1.AE.10 | (Ni,Fe) |
| ⓘ | Tetrataenite | 1.AE.10 | FeNi |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Djurleite | 2.BA.05 | Cu31S16 |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Stromeyerite | 2.BA.40 | AgCuS |
| ⓘ | Eucairite | 2.BA.50 | AgCuSe |
| ⓘ | Naumannite | 2.BA.55 | Ag2Se |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Klockmannite | 2.CA.05b | CuSe |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Idaite | 2.CB.15a | Cu5FeS6 |
| ⓘ | Wassonite | 2.CB.50 | TiS |
| ⓘ | Isocubanite | 2.CB.55b | CuFe2S3 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Troilite | 2.CC.10 | FeS |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Alabandite | 2.CD.10 | MnS |
| ⓘ | Clausthalite | 2.CD.10 | PbSe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Oldhamite | 2.CD.10 | CaS |
| ⓘ | Keilite | 2.CD.10 | (Fe2+,Mg)S |
| ⓘ | Zolenskyite | 2.DA. | FeCr2S4 |
| ⓘ | Daubréelite | 2.DA.05 | Fe2+Cr3+2S4 |
| ⓘ | Linnaeite | 2.DA.05 | Co2+Co3+2S4 |
| ⓘ | Polydymite | 2.DA.05 | Ni2+Ni3+2S4 |
| ⓘ | Brezinaite | 2.DA.15 | Cr3S4 |
| ⓘ | Heideite | 2.DA.15 | (Fe,Cr)1.15(Ti,Fe)2S4 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite var. Bravoite | 2.EB.05a | (Fe,Ni)S2 |
| ⓘ | 2.EB.05a | FeS2 | |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Rammelsbergite | 2.EB.15a | NiAs2 |
| ⓘ | Safflorite | 2.EB.15a | (Co,Ni,Fe)As2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Djerfisherite | 2.FC.05 | K6(Fe,Cu,Ni)25S26Cl |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | Schapbachite | 2.JA.15 | Ag0.4Pb0.2Bi0.4S |
| ⓘ | Cosalite | 2.JB.10 | Pb2Bi2S5 |
| ⓘ | Enargite | 2.KA.05 | Cu3AsS4 |
| Group 3 - Halides | |||
| ⓘ | Halite | 3.AA.20 | NaCl |
| ⓘ | Salammoniac | 3.AA.25 | NH4Cl |
| ⓘ | Laurionite | 3.DC.05 | PbCl(OH) |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz var. Agate | 4.DA.05 | SiO2 |
| ⓘ | var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | var. Onyx | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Prase | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Lepidocrocite | 4.FE.15 | Fe3+O(OH) |
| ⓘ | Ranciéite | 4.FL.40 | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Celestine | 7.AD.35 | SrSO4 |
| ⓘ | Szomolnokite | 7.CB.05 | FeSO4 · H2O |
| ⓘ | Rozenite | 7.CB.15 | FeSO4 · 4H2O |
| ⓘ | Chalcanthite ? | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Hexahydrite | 7.CB.25 | Mg(H2O)6(SO4) |
| ⓘ | Melanterite ? | 7.CB.35 | Fe2+(H2O)6(SO4) · H2O |
| ⓘ | Epsomite | 7.CB.40 | MgSO4 · 7H2O |
| ⓘ | Coquimbite | 7.CB.55 | AlFe3(SO4)6(H2O)12 · 6H2O |
| ⓘ | Halotrichite | 7.CB.85 | Fe2+Al2(SO4)4 · 22H2O |
| ⓘ | Tschermigite | 7.CC.20 | (NH4)Al(SO4)2 · 12H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | var. Selenite | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Copiapite | 7.DB.35 | Fe2+Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ | Magnesiocopiapite | 7.DB.35 | MgFe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ | Aluminite | 7.DC.05 | Al2(SO4)(OH)4 · 7H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Merrillite | 8.AC.45 | Ca9NaMg(PO4)7 |
| ⓘ | Chlorapatite | 8.BN.05 | Ca5(PO4)3Cl |
| Group 9 - Silicates | |||
| ⓘ | Forsterite | 9.AC.05 | Mg2(SiO4) |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Enstatite | 9.DA.05 | Mg2Si2O6 |
| ⓘ | Muscovite var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | var. Leverrierite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Chamosite | 9.EC.55 | Fe2+5Al(AlSi3O10)(OH)8 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Amber' | - | |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Glauconite' | - | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Manganomelane' | - | |
| ⓘ | 'Clinopyroxene Subgroup' | - | |
| ⓘ | 'Petrified Wood' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Petroleum var. Bitumen' | - | |
| ⓘ | '' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Meteoritic Iron' | - | |
| ⓘ | 'Plessite' | - | |
| ⓘ | 'Orthopyroxene Subgroup' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Organic material' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Aluminite | Al2(SO4)(OH)4 · 7H2O |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| H | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| H | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Epsomite | MgSO4 · 7H2O |
| H | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| H | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Laurionite | PbCl(OH) |
| H | ⓘ Lepidocrocite | Fe3+O(OH) |
| H | ⓘ Magnesiocopiapite | MgFe43+(SO4)6(OH)2 · 20H2O |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| H | ⓘ Rozenite | FeSO4 · 4H2O |
| H | ⓘ Salammoniac | NH4Cl |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Szomolnokite | FeSO4 · H2O |
| H | ⓘ Tschermigite | (NH4)Al(SO4)2 · 12H2O |
| H | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| H | ⓘ Muscovite var. Leverrierite | KAl2(AlSi3O10)(OH)2 |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| N | Nitrogen | |
| N | ⓘ Salammoniac | NH4Cl |
| N | ⓘ Tschermigite | (NH4)Al(SO4)2 · 12H2O |
| O | Oxygen | |
| O | ⓘ Quartz var. Agate | SiO2 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Aluminite | Al2(SO4)(OH)4 · 7H2O |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Celestine | SrSO4 |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| O | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| O | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Enstatite | Mg2Si2O6 |
| O | ⓘ Epsomite | MgSO4 · 7H2O |
| O | ⓘ Forsterite | Mg2(SiO4) |
| O | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Laurionite | PbCl(OH) |
| O | ⓘ Lepidocrocite | Fe3+O(OH) |
| O | ⓘ Magnesiocopiapite | MgFe43+(SO4)6(OH)2 · 20H2O |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Quartz var. Onyx | SiO2 |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| O | ⓘ Rozenite | FeSO4 · 4H2O |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Szomolnokite | FeSO4 · H2O |
| O | ⓘ Tschermigite | (NH4)Al(SO4)2 · 12H2O |
| O | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| O | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| O | ⓘ Quartz var. Prase | SiO2 |
| O | ⓘ Fayalite-Forsterite Series | |
| O | ⓘ Muscovite var. Leverrierite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Halite | NaCl |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Enstatite | Mg2Si2O6 |
| Mg | ⓘ Epsomite | MgSO4 · 7H2O |
| Mg | ⓘ Forsterite | Mg2(SiO4) |
| Mg | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Mg | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| Mg | ⓘ Magnesiocopiapite | MgFe43+(SO4)6(OH)2 · 20H2O |
| Mg | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| Mg | ⓘ Fayalite-Forsterite Series | |
| Mg | ⓘ Keilite | (Fe2+,Mg)S |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Aluminite | Al2(SO4)(OH)4 · 7H2O |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Al | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Al | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Tschermigite | (NH4)Al(SO4)2 · 12H2O |
| Al | ⓘ Muscovite var. Leverrierite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | ⓘ Quartz var. Agate | SiO2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Enstatite | Mg2Si2O6 |
| Si | ⓘ Forsterite | Mg2(SiO4) |
| Si | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz var. Onyx | SiO2 |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Quartz var. Prase | SiO2 |
| Si | ⓘ Fayalite-Forsterite Series | |
| Si | ⓘ Muscovite var. Leverrierite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| P | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Alabandite | MnS |
| S | ⓘ Aluminite | Al2(SO4)(OH)4 · 7H2O |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| S | ⓘ Brezinaite | Cr3S4 |
| S | ⓘ Celestine | SrSO4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| S | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| S | ⓘ Cosalite | Pb2Bi2S5 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Daubréelite | Fe2+Cr23+S4 |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Djerfisherite | K6(Fe,Cu,Ni)25S26Cl |
| S | ⓘ Djurleite | Cu31S16 |
| S | ⓘ Enargite | Cu3AsS4 |
| S | ⓘ Epsomite | MgSO4 · 7H2O |
| S | ⓘ Galena | PbS |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| S | ⓘ Heideite | (Fe,Cr)1.15(Ti,Fe)2S4 |
| S | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| S | ⓘ Idaite | Cu5FeS6 |
| S | ⓘ Isocubanite | CuFe2S3 |
| S | ⓘ Linnaeite | Co2+Co23+S4 |
| S | ⓘ Magnesiocopiapite | MgFe43+(SO4)6(OH)2 · 20H2O |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| S | ⓘ Millerite | NiS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Oldhamite | CaS |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Polydymite | Ni2+Ni23+S4 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Rozenite | FeSO4 · 4H2O |
| S | ⓘ Schapbachite | Ag0.4Pb0.2Bi0.4S |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stromeyerite | AgCuS |
| S | ⓘ Szomolnokite | FeSO4 · H2O |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Troilite | FeS |
| S | ⓘ Tschermigite | (NH4)Al(SO4)2 · 12H2O |
| S | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| S | ⓘ Keilite | (Fe2+,Mg)S |
| S | ⓘ Wassonite | TiS |
| S | ⓘ Zolenskyite | FeCr2S4 |
| Cl | Chlorine | |
| Cl | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| Cl | ⓘ Djerfisherite | K6(Fe,Cu,Ni)25S26Cl |
| Cl | ⓘ Halite | NaCl |
| Cl | ⓘ Laurionite | PbCl(OH) |
| Cl | ⓘ Salammoniac | NH4Cl |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Djerfisherite | K6(Fe,Cu,Ni)25S26Cl |
| K | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Muscovite var. Leverrierite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Oldhamite | CaS |
| Ca | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| Ca | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| Ca | ⓘ Merrillite | Ca9NaMg(PO4)7 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Heideite | (Fe,Cr)1.15(Ti,Fe)2S4 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Wassonite | TiS |
| Cr | Chromium | |
| Cr | ⓘ Brezinaite | Cr3S4 |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Daubréelite | Fe2+Cr23+S4 |
| Cr | ⓘ Heideite | (Fe,Cr)1.15(Ti,Fe)2S4 |
| Cr | ⓘ Zolenskyite | FeCr2S4 |
| Mn | Manganese | |
| Mn | ⓘ Alabandite | MnS |
| Mn | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| Fe | Iron | |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| Fe | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| Fe | ⓘ Daubréelite | Fe2+Cr23+S4 |
| Fe | ⓘ Djerfisherite | K6(Fe,Cu,Ni)25S26Cl |
| Fe | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| Fe | ⓘ Heideite | (Fe,Cr)1.15(Ti,Fe)2S4 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Idaite | Cu5FeS6 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Native Iron | Fe |
| Fe | ⓘ Isocubanite | CuFe2S3 |
| Fe | ⓘ Native Iron var. Kamacite | (Fe,Ni) |
| Fe | ⓘ Lepidocrocite | Fe3+O(OH) |
| Fe | ⓘ Magnesiocopiapite | MgFe43+(SO4)6(OH)2 · 20H2O |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Rozenite | FeSO4 · 4H2O |
| Fe | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Szomolnokite | FeSO4 · H2O |
| Fe | ⓘ Taenite | (Ni,Fe) |
| Fe | ⓘ Tetrataenite | FeNi |
| Fe | ⓘ Troilite | FeS |
| Fe | ⓘ Fayalite-Forsterite Series | |
| Fe | ⓘ Native Iron var. Martensite | Fe |
| Fe | ⓘ Keilite | (Fe2+,Mg)S |
| Fe | ⓘ Zolenskyite | FeCr2S4 |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Linnaeite | Co2+Co23+S4 |
| Co | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Ni | Nickel | |
| Ni | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| Ni | ⓘ Djerfisherite | K6(Fe,Cu,Ni)25S26Cl |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Native Iron var. Kamacite | (Fe,Ni) |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Polydymite | Ni2+Ni23+S4 |
| Ni | ⓘ Rammelsbergite | NiAs2 |
| Ni | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Ni | ⓘ Taenite | (Ni,Fe) |
| Ni | ⓘ Tetrataenite | FeNi |
| Cu | Copper | |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Djerfisherite | K6(Fe,Cu,Ni)25S26Cl |
| Cu | ⓘ Djurleite | Cu31S16 |
| Cu | ⓘ Enargite | Cu3AsS4 |
| Cu | ⓘ Eucairite | AgCuSe |
| Cu | ⓘ Idaite | Cu5FeS6 |
| Cu | ⓘ Isocubanite | CuFe2S3 |
| Cu | ⓘ Klockmannite | CuSe |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Stromeyerite | AgCuS |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Enargite | Cu3AsS4 |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Rammelsbergite | NiAs2 |
| As | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Se | Selenium | |
| Se | ⓘ Clausthalite | PbSe |
| Se | ⓘ Eucairite | AgCuSe |
| Se | ⓘ Klockmannite | CuSe |
| Se | ⓘ Naumannite | Ag2Se |
| Sr | Strontium | |
| Sr | ⓘ Celestine | SrSO4 |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ag | Silver | |
| Ag | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Ag | ⓘ Eucairite | AgCuSe |
| Ag | ⓘ Naumannite | Ag2Se |
| Ag | ⓘ Schapbachite | Ag0.4Pb0.2Bi0.4S |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Stromeyerite | AgCuS |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Au | Gold | |
| Au | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Clausthalite | PbSe |
| Pb | ⓘ Cosalite | Pb2Bi2S5 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Laurionite | PbCl(OH) |
| Pb | ⓘ Schapbachite | Ag0.4Pb0.2Bi0.4S |
| Bi | Bismuth | |
| Bi | ⓘ Cosalite | Pb2Bi2S5 |
| Bi | ⓘ Schapbachite | Ag0.4Pb0.2Bi0.4S |
Fossils
There are 2457 fossil localities from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 2457 |
|---|---|
| Youngest Fossil Listed | 0.01 Ma (Pleistocene) |
| Oldest Fossil Listed | 530 Ma (Cambrian) |
| Stratigraphic Units | Click here to view 17 stratigraphic units. |
| Fossils from Region | Click here to show the list. |
| Fossil Localities | Click to show 54 fossil localities |
- Brandenburg
- Middle Jurassic🐚 Geschiebe from Arendsee-Weggun
- Middle Jurassic🐚 Geschiebe from Milmersdorf
- Miocene🐚 Gosda-Heidemuehl
- Pleistocene🐚 Jänschwalde open lignite mine
- Miocene🐚 Kausche
- Mesozoic🐚 Kb Gartz 1/65 well
- Pleistocene🐚 Lenzen
- Paleozoic🐚 Ostracodes of Beyrichienkalk
- Cambrian🐚 Sewekow
- Cenozoic🐚 Spremberg 15/1957
- Cenozoic🐚 Spremberg 29/1958
- Miocene🐚 Spremberg 29/57
- Cenozoic🐚 Spremberg 5/1955 bei Graustein
- Miocene🐚 Tetta
- Miocene🐚 Tranitz
- Cenozoic🐚 Welzow-Sud 16/1957
- Cretaceous🐚 Zippelsförde 1/64 core
- Barnim
- Dahme-Spreewald
- Elbe-Elster
- Brandenburg
- Elbe-Elster
- Märkisch-Oderland
- Oberspreewald-Lausitz
- Cenozoic🐚 Altdobern 3/1961
- Miocene🐚 Annahuette
- Miocene🐚 Gosda-Heidemuehl
- Miocene🐚 Hoerlitz bei Senftenberg
- Miocene🐚 Klettwitz
- Miocene🐚 Meuro
- Miocene🐚 Reppist
- Miocene🐚 Schipkau
- Miocene🐚 Sedlitz
- Miocene🐚 Senftenberg A
- Miocene🐚 Vetschau 2/26
- Miocene🐚 Wischgrun bei Klettwitz A
- Miocene🐚 Wischgrun bei Klettwitz B
- Miocene🐚 Zschipkau near Senftenberg
- Calau
- Großräschen
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Brandenburg |
|---|---|
| Wikidata ID: | Q1208 |
| GeoNames ID: | 2945356 |
Localities in this Region
- Brandenburg
- ⭔Barnim
- ⭔Brandenburg an der Havel
- ⭔Cottbus
- ⭔Dahme-Spreewald
- ⭔Elbe-Elster
- Crinitz
- ⭔Doberlug-Kirchhain
- Elsterland
- Rückersdorf
- Tröbitz
- Finsterwalde
- Lichterfeld-Schacksdorf
- Plessa
- Röder
- Sallgast
- Schönborn
- Uebigau-Warenbrück
- Domsdorf
- Wilhelm mine
- ⭔Frankfurt (Oder)
- ⭔Havelland
- ⭔Märkisch-Oderland
- ⭔Oberhavel
- ⭔Fürstenberg/Havel
- Furstenberg/Havel
- Linum meteorite
- Mildenberg
- ⭔Oberspreewald-Lausitz
- Brandenburg
- Oberspreewald-Lausitz
- Lauchhammer
- ⭔Lübbenau
- ⭔Neu-Seeland
- ⭔Schipkau
- Schwarzheide-Ost Victoria
- Schwarzheide
- ⭔Senftenberg
- Brieske
- Friedrich-Ernst Mine
- Hohenbocka sand pit
- Hosena
- Hosena sand pit
- Koschenberg quarry
- ⭔Rauno
- Reppist
- Sauo
- Sedlitz
- Victoria II Mine
- ⭔Oder-Spree
- Bad Saarow
- ⭔Eisenhüttenstadt
- Blast furnace
- Schönfließ
- Vogelsang
- Fürstenwalde/Spree
- Beust adit
- Rauen
- Reichenwalde
- Storkow
- ⭔Ostprignitz-Ruppin
- ⭔Potsdam-Mittelmark
- ⭔Potsdam
- ⭔Prignitz
- Pritzwalk
- ⭔Spree-Neiße
- Altdöbern
- Kausche
- Döbern-Land
- Felixsee
- Döbern
- ⭔Drebkau
- Merkur
- Felixsee
- Jämlitz
- ⭔Neuhausen/Spree
- ⭔Spremberg
- ⭔Welzow
- Altdöbern
- ⭔Teltow-Fläming
- ⭔Uckermark
- ⭔Uckermark historical region
- Oberspreewald-Lausitz
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
- AvaloniaVolcanic Arc
- KupferschieferMining Field
- Rheno-Hercynian BeltOrogenic Belt
- Saxo-Thuringian BeltOrogenic Belt
EuropeContinent
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions
Marga Mine, Brieske, Senftenberg, Oberspreewald-Lausitz, Brandenburg, Germany