Dachang ore field, Nandan-Hechi Sn-W metallogenic belt, Guangxi, Chinai
| Regional Level Types | |
|---|---|
| Dachang ore field | Ore Field |
| Nandan-Hechi Sn-W metallogenic belt | Mineral Belt |
| Guangxi | Autonomous Region |
| China | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
24° North , 107° East (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~11km
Type:
Köppen climate type:
Other/historical names associated with this locality:
Dachang Sn-polymetallic ore field
Name(s) in local language(s):
大厂锡多金属矿田, 南丹县, 河池市, 广西壮族自治区, 中国
NW-trending tin polymetallic mineralization belt about 100 km long and 30 km wide, with four ore fields distributed along strike. There are more than 200 mineral deposits and occurrences of tin, tungsten, molybdenum, copper, lead, zinc, silver, and mercury, including two super-large deposits and 13 large-medium deposits. The orefield's cumulative proven tin resource is estimated at 1.5 million tons, while the combined resources of zinc, lead, antimony, and copper exceed 10 million tons. Furthermore, associated metals such as indium, tungsten, molybdenum, and silver have been identified in this region.
The Dachang tin-polymetallic orefield is developed within a belt of Lower
Devonian to Tertiary sediments, that intruded by the Cretaceous peraluminous Longxianggai granite. The sediments include Devonian black shales, limestones and argillaceous limestones, Carboniferous and Permian limestones and a younger Tertiary cover. Mineralization occurs in three forms, namely:
(1) Stratabound ore bodies, containing 60% of the tin resource at Dachang: The stratabound ore is composed of small cross-cutting and bedding plane veins developed within particular stratigraphic intervals. The stratabound bodies can contain up to 30% sulphide, mainly pyrrhotite, sphalerite, arsenopyrite and chalcopyrite with cassiterite. Some of the larger orebodies may have dimensions of up to 1100 x 700 x 15 m. These bodies can contain around 1% Sn and up to 4% Zn.
(2) Stockworks: Stockworks of 0.5 to 1 cm thickness veins with a density of 10 to 30 veins per meter have low average Zn and Sn contents and occur in limestones.
(3) Veins: They are found at the top of the deposits, are typically 0.1-0.2 m thick, extend for 50-200 m along strike and 100-300 m downdip and have high Zn (to 7.5%) and Sn (to 2%).
All of the different styles of ore are contained within an Upper Devonian unit composed of five sub-units, namely black siliceous rock, thick striped limestones, thin striped siliceous limestone, small peas limestone and large peas limestone. The orebodies are found adjacent to a major fault which cuts the Longxianggai granite several hundred metres below the ore zones.
Located about 20 km SSE of Nandan and NW of Hechi. Dachang Sn-polymetallic district, occupying about 168 km2, is located at the intersection of NW- and NE-trending faults along the eastern margin of the Youjiang basin.
The Dachang ore field is divided into three zones surrounding the Longxianggai granite. The western zone is represented by the Changpo–Tongkeng and Bali–Longtoushan Sn polymetallic deposits, while the central zone mainly includes the Lamo Zn–Cu and Chashan W-Sb deposits. There are some small- and medium-sized Sn polymetallic deposits in the eastern zone (such as Dafulou, Huile, and Kangma).
This deposit has a long mining history extending to the Song Dynasty (960 to 1279 CE).
Sn of 0.88 Mt at an average grade of 1.79 %.
Note:
Not to be confused with two other Dachang ore fields (in Qinglong County):
- Dachang Sb ore field
- Dachang Au ore field
NW-trending tin polymetallic mineralization belt about 100 km long and 30 km wide, with four ore fields distributed along strike. There are more than 200 mineral deposits and occurrences of tin, tungsten, molybdenum, copper, lead, zinc, silver, and mercury, including two super-large deposits and 13 large-medium deposits.
Reserves: 1.5 Mt Sn; 6.8 Mt Zn; 1.8 Mt Pb; 0.4 Mt Cu; 8775 t In
Note:
Not to be confused with two other Dachan ore fields (in another province):
- Dachang Au ore field
- Dachang Sb ore field
The Dachang tin-polymetallic orefield is developed within a belt of Lower
Devonian to Tertiary sediments, that intruded by the Cretaceous peraluminous Longxianggai granite. The sediments include Devonian black shales, limestones and argillaceous limestones, Carboniferous and Permian limestones and a younger Tertiary cover. Mineralization occurs in three forms, namely:
(1) Stratabound ore bodies, containing 60% of the tin resource at Dachang: The stratabound ore is composed of small cross-cutting and bedding plane veins developed within particular stratigraphic intervals. The stratabound bodies can contain up to 30% sulphide, mainly pyrrhotite, sphalerite, arsenopyrite and chalcopyrite with cassiterite. Some of the larger orebodies may have dimensions of up to 1100 x 700 x 15 m. These bodies can contain around 1% Sn and up to 4% Zn.
(2) Stockworks: Stockworks of 0.5 to 1 cm thickness veins with a density of 10 to 30 veins per meter have low average Zn and Sn contents and occur in limestones.
(3) Veins: They are found at the top of the deposits, are typically 0.1-0.2 m thick, extend for 50-200 m along strike and 100-300 m downdip and have high Zn (to 7.5%) and Sn (to 2%).
All of the different styles of ore are contained within an Upper Devonian unit composed of five sub-units, namely black siliceous rock, thick striped limestones, thin striped siliceous limestone, small peas limestone and large peas limestone. The orebodies are found adjacent to a major fault which cuts the Longxianggai granite several hundred metres below the ore zones.
Located about 20 km SSE of Nandan and NW of Hechi. Dachang Sn-polymetallic district, occupying about 168 km2, is located at the intersection of NW- and NE-trending faults along the eastern margin of the Youjiang basin.
The Dachang ore field is divided into three zones surrounding the Longxianggai granite. The western zone is represented by the Changpo–Tongkeng and Bali–Longtoushan Sn polymetallic deposits, while the central zone mainly includes the Lamo Zn–Cu and Chashan W-Sb deposits. There are some small- and medium-sized Sn polymetallic deposits in the eastern zone (such as Dafulou, Huile, and Kangma).
This deposit has a long mining history extending to the Song Dynasty (960 to 1279 CE).
Sn of 0.88 Mt at an average grade of 1.79 %.
Note:
Not to be confused with two other Dachang ore fields (in Qinglong County):
- Dachang Sb ore field
- Dachang Au ore field
NW-trending tin polymetallic mineralization belt about 100 km long and 30 km wide, with four ore fields distributed along strike. There are more than 200 mineral deposits and occurrences of tin, tungsten, molybdenum, copper, lead, zinc, silver, and mercury, including two super-large deposits and 13 large-medium deposits.
Reserves: 1.5 Mt Sn; 6.8 Mt Zn; 1.8 Mt Pb; 0.4 Mt Cu; 8775 t In
Note:
Not to be confused with two other Dachan ore fields (in another province):
- Dachang Au ore field
- Dachang Sb ore field
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities107 valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold var. Electrum | 1.AA.05 | (Au,Ag) |
| ⓘ | 1.AA.05 | Au | |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | var. Küstelite | 1.AA.05 | Ag |
| ⓘ | Native Antimony | 1.CA.05 | Sb |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Canfieldite | 2.BA.70 | Ag8SnS6 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | var. Marmatite | 2.CB.05a | (Zn,Fe)S |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Hocartite | 2.CB.15a | Ag2(Fe2+,Zn)SnS4 |
| ⓘ | Kësterite | 2.CB.15a | Cu2ZnSnS4 |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Herzenbergite | 2.CD.05 | SnS |
| ⓘ | Teallite | 2.CD.05 | PbSnS2 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | var. Bismuth-bearing Galena | 2.CD.10 | (Pb,Bi,Ag)S |
| ⓘ | Rhodostannite | 2.DA.10 | Cu+(Fe2+0.5Sn4+1.5)S4 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Gudmundite | 2.EB.20 | FeSbS |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | Součekite | 2.GA.50 | CuPbBi(S,Se)3 |
| ⓘ | 'Freibergite Subgroup' | 2.GB.05 | (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | 'var. Silver-bearing Tetrahedrite' | 2.GB.05 | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| ⓘ | Tetrahedrite-(Zn) | 2.GB.05 | Cu6(Cu4Zn2)Sb4S12S |
| ⓘ | Miargyrite | 2.HA.10 | AgSbS2 |
| ⓘ | Berthierite | 2.HA.20 | FeSb2S4 |
| ⓘ | Aramayoite | 2.HA.25 | Ag3Sb2(Bi,Sb)S6 |
| ⓘ | Meneghinite | 2.HB.05b | Pb13CuSb7S24 |
| ⓘ | Kobellite | 2.HB.10a | Pb22Cu4(Bi,Sb)30S69 |
| ⓘ | Tintinaite | 2.HB.10a | Pb22Cu4(Sb,Bi)30S69 |
| ⓘ | Giessenite ? | 2.HB.10b | Pb27Cu2(Bi,Sb)19S57 |
| ⓘ | Izoklakeite ? | 2.HB.10b | Pb27(Cu,Fe,Ag)2(Sb,Bi)19S57 |
| ⓘ | Eclarite | 2.HB.10c | (Cu,Fe)Pb9Bi12S28 |
| ⓘ | Benavidesite | 2.HB.15 | Pb4MnSb6S14 |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | var. Manganese-bearing Jamesonite | 2.HB.15 | Pb4(Fe,Mn)Sb6S14 |
| ⓘ | Fülöppite | 2.HC.10a | Pb3Sb8S15 |
| ⓘ | Plagionite | 2.HC.10b | Pb5Sb8S17 |
| ⓘ | Heteromorphite | 2.HC.10c | Pb7Sb8S19 |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Dadsonite | 2.HC.30 | Pb23Sb25S60Cl |
| ⓘ | Franckeite | 2.HF.25b | Fe2+(Pb,Sn2+)6Sn4+2Sb2S14 |
| ⓘ | Pavonite | 2.JA.05a | AgBi3S5 |
| ⓘ | Benjaminite | 2.JA.05e | Ag3Bi7S12 |
| ⓘ | Matildite | 2.JA.20 | AgBiS2 |
| ⓘ | Diaphorite | 2.JB.05 | Ag3Pb2Sb3S8 |
| ⓘ | Galenobismutite | 2.JB.25e | PbBi2S4 |
| ⓘ | Weibullite | 2.JB.25h | Pb5Bi8Se7S11 |
| ⓘ | Geocronite | 2.JB.30a | Pb14Sb6S23 |
| ⓘ | Jordanite | 2.JB.30a | Pb14As6S23 |
| ⓘ | Zinkenite | 2.JB.35a | Pb9Sb22S42 |
| ⓘ | Gustavite | 2.JB.40a | AgPbBi3S6 |
| ⓘ | Lillianite | 2.JB.40a | Pb3-2xAgxBi2+xS6 |
| ⓘ | Ramdohrite | 2.JB.40a | Pb5.9Fe0.1Mn0.1In0.1Cd0.2Ag2.8Sb10.8S24 |
| ⓘ | 'Schirmerite' | 2.JB.40d | PbAgBi3S6 - Pb3Ag1.5Bi3.5S9 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Ferberite | 4.DB.30 | FeWO4 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Triploidite | 8.BB.15 | Mn2+2(PO4)(OH) |
| ⓘ | Adamite | 8.BB.30 | Zn2(AsO4)(OH) |
| Group 9 - Silicates | |||
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Pyrope | 9.AD.25 | Mg3Al2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Thorite | 9.AD.30 | Th(SiO4) |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Malayaite | 9.AG.15 | CaSnO(SiO4) |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Enstatite | 9.DA.05 | Mg2Si2O6 |
| ⓘ | Ferrosilite | 9.DA.05 | Fe2+2Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Hedenbergite | 9.DA.15 | CaFe2+Si2O6 |
| ⓘ | Johannsenite | 9.DA.15 | CaMn2+Si2O6 |
| ⓘ | Aegirine | 9.DA.25 | NaFe3+Si2O6 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Phengite | 9.EC.15 | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Siderophyllite | 9.EC.20 | KFe2+2Al(Al2Si2O10)(OH)2 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | var. Ripidolite | 9.EC.55 | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Microcline var. Hyalophane | 9.FA.30 | (K,Ba)[Al(Si,Al)Si2O8] |
| ⓘ | 9.FA.30 | K(AlSi3O8) | |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Sanidine | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | 'Zeolite Group' | 9.G0. | |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Andorite' | - | AgPbSb3S6 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Melnikovite' | - | |
| ⓘ | 'Clinopyroxene Subgroup' | - | |
| ⓘ | 'Andradite-Grossular Series' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Ferberite-Hübnerite Series' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Axinite Group' | - | |
| ⓘ | 'Protolithionite' | - | |
| ⓘ | 'Pyrobitumen' | - | |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Adamite | Zn2(AsO4)(OH) |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| H | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| H | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Triploidite | Mn22+(PO4)(OH) |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Adamite | Zn2(AsO4)(OH) |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Aegirine | NaFe3+Si2O6 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Enstatite | Mg2Si2O6 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Ferberite | FeWO4 |
| O | ⓘ Ferrosilite | Fe22+Si2O6 |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hedenbergite | CaFe2+Si2O6 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Johannsenite | CaMn2+Si2O6 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malayaite | CaSnO(SiO4) |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| O | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Sanidine | K(AlSi3O8) |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | ⓘ Thorite | Th(SiO4) |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Triploidite | Mn22+(PO4)(OH) |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Andradite-Grossular Series | |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Ferberite-Hübnerite Series | |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Na | Sodium | |
| Na | ⓘ Aegirine | NaFe3+Si2O6 |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Enstatite | Mg2Si2O6 |
| Mg | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Mg | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Mg | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Al | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Al | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Al | ⓘ Sanidine | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Andradite-Grossular Series | |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Aegirine | NaFe3+Si2O6 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Enstatite | Mg2Si2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Ferrosilite | Fe22+Si2O6 |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Si | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Si | ⓘ Johannsenite | CaMn2+Si2O6 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Malayaite | CaSnO(SiO4) |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Si | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Si | ⓘ Sanidine | K(AlSi3O8) |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | ⓘ Thorite | Th(SiO4) |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Andradite-Grossular Series | |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Triploidite | Mn22+(PO4)(OH) |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Andorite | AgPbSb3S6 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Aramayoite | Ag3Sb2(Bi,Sb)S6 |
| S | ⓘ Benavidesite | Pb4MnSb6S14 |
| S | ⓘ Benjaminite | Ag3Bi7S12 |
| S | ⓘ Berthierite | FeSb2S4 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Canfieldite | Ag8SnS6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Dadsonite | Pb23Sb25S60Cl |
| S | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| S | ⓘ Eclarite | (Cu,Fe)Pb9Bi12S28 |
| S | ⓘ Fülöppite | Pb3Sb8S15 |
| S | ⓘ Franckeite | Fe2+(Pb,Sn2+)6Sn24+Sb2S14 |
| S | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| S | ⓘ Galena | PbS |
| S | ⓘ Galenobismutite | PbBi2S4 |
| S | ⓘ Geocronite | Pb14Sb6S23 |
| S | ⓘ Giessenite | Pb27Cu2(Bi,Sb)19S57 |
| S | ⓘ Gudmundite | FeSbS |
| S | ⓘ Gustavite | AgPbBi3S6 |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Herzenbergite | SnS |
| S | ⓘ Heteromorphite | Pb7Sb8S19 |
| S | ⓘ Hocartite | Ag2(Fe2+,Zn)SnS4 |
| S | ⓘ Izoklakeite | Pb27(Cu,Fe,Ag)2(Sb,Bi)19S57 |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Jordanite | Pb14As6S23 |
| S | ⓘ Kësterite | Cu2ZnSnS4 |
| S | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| S | ⓘ Lillianite | Pb3-2xAgxBi2+xS6 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Matildite | AgBiS2 |
| S | ⓘ Meneghinite | Pb13CuSb7S24 |
| S | ⓘ Miargyrite | AgSbS2 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pavonite | AgBi3S5 |
| S | ⓘ Plagionite | Pb5Sb8S17 |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Ramdohrite | Pb5.9Fe0.1Mn0.1In0.1Cd0.2Ag2.8Sb10.8S24 |
| S | ⓘ Rhodostannite | Cu+(Fe2+0.5Sn4+1.5)S4 |
| S | ⓘ Schirmerite | PbAgBi3S6 - Pb3Ag1.5Bi3.5S9 |
| S | ⓘ Součekite | CuPbBi(S,Se)3 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stannite | Cu2FeSnS4 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Teallite | PbSnS2 |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Tintinaite | Pb22Cu4(Sb,Bi)30S69 |
| S | ⓘ Weibullite | Pb5Bi8Se7S11 |
| S | ⓘ Zinkenite | Pb9Sb22S42 |
| S | ⓘ Sphalerite var. Marmatite | (Zn,Fe)S |
| S | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| S | ⓘ Galena var. Bismuth-bearing Galena | (Pb,Bi,Ag)S |
| S | ⓘ Jamesonite var. Manganese-bearing Jamesonite | Pb4(Fe,Mn)Sb6S14 |
| S | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| Cl | Chlorine | |
| Cl | ⓘ Dadsonite | Pb23Sb25S60Cl |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| K | ⓘ Sanidine | K(AlSi3O8) |
| K | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Ca | ⓘ Johannsenite | CaMn2+Si2O6 |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Malayaite | CaSnO(SiO4) |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Andradite-Grossular Series | |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Mn | Manganese | |
| Mn | ⓘ Benavidesite | Pb4MnSb6S14 |
| Mn | ⓘ Johannsenite | CaMn2+Si2O6 |
| Mn | ⓘ Ramdohrite | Pb5.9Fe0.1Mn0.1In0.1Cd0.2Ag2.8Sb10.8S24 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Triploidite | Mn22+(PO4)(OH) |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Mn | ⓘ Ferberite-Hübnerite Series | |
| Mn | ⓘ Jamesonite var. Manganese-bearing Jamesonite | Pb4(Fe,Mn)Sb6S14 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Aegirine | NaFe3+Si2O6 |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Berthierite | FeSb2S4 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Eclarite | (Cu,Fe)Pb9Bi12S28 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ferberite | FeWO4 |
| Fe | ⓘ Ferrosilite | Fe22+Si2O6 |
| Fe | ⓘ Franckeite | Fe2+(Pb,Sn2+)6Sn24+Sb2S14 |
| Fe | ⓘ Gudmundite | FeSbS |
| Fe | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hocartite | Ag2(Fe2+,Zn)SnS4 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Izoklakeite | Pb27(Cu,Fe,Ag)2(Sb,Bi)19S57 |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Ramdohrite | Pb5.9Fe0.1Mn0.1In0.1Cd0.2Ag2.8Sb10.8S24 |
| Fe | ⓘ Rhodostannite | Cu+(Fe2+0.5Sn4+1.5)S4 |
| Fe | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Sphalerite var. Marmatite | (Zn,Fe)S |
| Fe | ⓘ Andradite-Grossular Series | |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | ⓘ Ferberite-Hübnerite Series | |
| Fe | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Fe | ⓘ Jamesonite var. Manganese-bearing Jamesonite | Pb4(Fe,Mn)Sb6S14 |
| Cu | Copper | |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Eclarite | (Cu,Fe)Pb9Bi12S28 |
| Cu | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Cu | ⓘ Giessenite | Pb27Cu2(Bi,Sb)19S57 |
| Cu | ⓘ Izoklakeite | Pb27(Cu,Fe,Ag)2(Sb,Bi)19S57 |
| Cu | ⓘ Kësterite | Cu2ZnSnS4 |
| Cu | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Cu | ⓘ Meneghinite | Pb13CuSb7S24 |
| Cu | ⓘ Rhodostannite | Cu+(Fe2+0.5Sn4+1.5)S4 |
| Cu | ⓘ Součekite | CuPbBi(S,Se)3 |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Tintinaite | Pb22Cu4(Sb,Bi)30S69 |
| Cu | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Cu | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| Zn | Zinc | |
| Zn | ⓘ Adamite | Zn2(AsO4)(OH) |
| Zn | ⓘ Hocartite | Ag2(Fe2+,Zn)SnS4 |
| Zn | ⓘ Kësterite | Cu2ZnSnS4 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Sphalerite var. Marmatite | (Zn,Fe)S |
| Zn | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Zn | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| As | Arsenic | |
| As | ⓘ Adamite | Zn2(AsO4)(OH) |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Jordanite | Pb14As6S23 |
| Se | Selenium | |
| Se | ⓘ Součekite | CuPbBi(S,Se)3 |
| Se | ⓘ Weibullite | Pb5Bi8Se7S11 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Andorite | AgPbSb3S6 |
| Ag | ⓘ Aramayoite | Ag3Sb2(Bi,Sb)S6 |
| Ag | ⓘ Benjaminite | Ag3Bi7S12 |
| Ag | ⓘ Canfieldite | Ag8SnS6 |
| Ag | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| Ag | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Ag | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Ag | ⓘ Gustavite | AgPbBi3S6 |
| Ag | ⓘ Hocartite | Ag2(Fe2+,Zn)SnS4 |
| Ag | ⓘ Izoklakeite | Pb27(Cu,Fe,Ag)2(Sb,Bi)19S57 |
| Ag | ⓘ Lillianite | Pb3-2xAgxBi2+xS6 |
| Ag | ⓘ Matildite | AgBiS2 |
| Ag | ⓘ Miargyrite | AgSbS2 |
| Ag | ⓘ Pavonite | AgBi3S5 |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Ramdohrite | Pb5.9Fe0.1Mn0.1In0.1Cd0.2Ag2.8Sb10.8S24 |
| Ag | ⓘ Schirmerite | PbAgBi3S6 - Pb3Ag1.5Bi3.5S9 |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Ag | ⓘ Native Silver var. Küstelite | Ag |
| Ag | ⓘ Galena var. Bismuth-bearing Galena | (Pb,Bi,Ag)S |
| Cd | Cadmium | |
| Cd | ⓘ Ramdohrite | Pb5.9Fe0.1Mn0.1In0.1Cd0.2Ag2.8Sb10.8S24 |
| In | Indium | |
| In | ⓘ Ramdohrite | Pb5.9Fe0.1Mn0.1In0.1Cd0.2Ag2.8Sb10.8S24 |
| Sn | Tin | |
| Sn | ⓘ Canfieldite | Ag8SnS6 |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Franckeite | Fe2+(Pb,Sn2+)6Sn24+Sb2S14 |
| Sn | ⓘ Herzenbergite | SnS |
| Sn | ⓘ Hocartite | Ag2(Fe2+,Zn)SnS4 |
| Sn | ⓘ Kësterite | Cu2ZnSnS4 |
| Sn | ⓘ Malayaite | CaSnO(SiO4) |
| Sn | ⓘ Rhodostannite | Cu+(Fe2+0.5Sn4+1.5)S4 |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sn | ⓘ Teallite | PbSnS2 |
| Sb | Antimony | |
| Sb | ⓘ Andorite | AgPbSb3S6 |
| Sb | ⓘ Native Antimony | Sb |
| Sb | ⓘ Aramayoite | Ag3Sb2(Bi,Sb)S6 |
| Sb | ⓘ Benavidesite | Pb4MnSb6S14 |
| Sb | ⓘ Berthierite | FeSb2S4 |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Dadsonite | Pb23Sb25S60Cl |
| Sb | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| Sb | ⓘ Fülöppite | Pb3Sb8S15 |
| Sb | ⓘ Franckeite | Fe2+(Pb,Sn2+)6Sn24+Sb2S14 |
| Sb | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Sb | ⓘ Geocronite | Pb14Sb6S23 |
| Sb | ⓘ Giessenite | Pb27Cu2(Bi,Sb)19S57 |
| Sb | ⓘ Gudmundite | FeSbS |
| Sb | ⓘ Heteromorphite | Pb7Sb8S19 |
| Sb | ⓘ Izoklakeite | Pb27(Cu,Fe,Ag)2(Sb,Bi)19S57 |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Sb | ⓘ Meneghinite | Pb13CuSb7S24 |
| Sb | ⓘ Miargyrite | AgSbS2 |
| Sb | ⓘ Plagionite | Pb5Sb8S17 |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Ramdohrite | Pb5.9Fe0.1Mn0.1In0.1Cd0.2Ag2.8Sb10.8S24 |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Tintinaite | Pb22Cu4(Sb,Bi)30S69 |
| Sb | ⓘ Zinkenite | Pb9Sb22S42 |
| Sb | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Sb | ⓘ Jamesonite var. Manganese-bearing Jamesonite | Pb4(Fe,Mn)Sb6S14 |
| Sb | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| Ba | Barium | |
| Ba | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| W | Tungsten | |
| W | ⓘ Ferberite | FeWO4 |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Ferberite-Hübnerite Series | |
| Au | Gold | |
| Au | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Andorite | AgPbSb3S6 |
| Pb | ⓘ Benavidesite | Pb4MnSb6S14 |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Dadsonite | Pb23Sb25S60Cl |
| Pb | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| Pb | ⓘ Eclarite | (Cu,Fe)Pb9Bi12S28 |
| Pb | ⓘ Fülöppite | Pb3Sb8S15 |
| Pb | ⓘ Franckeite | Fe2+(Pb,Sn2+)6Sn24+Sb2S14 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Galenobismutite | PbBi2S4 |
| Pb | ⓘ Geocronite | Pb14Sb6S23 |
| Pb | ⓘ Giessenite | Pb27Cu2(Bi,Sb)19S57 |
| Pb | ⓘ Gustavite | AgPbBi3S6 |
| Pb | ⓘ Heteromorphite | Pb7Sb8S19 |
| Pb | ⓘ Izoklakeite | Pb27(Cu,Fe,Ag)2(Sb,Bi)19S57 |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Jordanite | Pb14As6S23 |
| Pb | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Pb | ⓘ Lillianite | Pb3-2xAgxBi2+xS6 |
| Pb | ⓘ Meneghinite | Pb13CuSb7S24 |
| Pb | ⓘ Plagionite | Pb5Sb8S17 |
| Pb | ⓘ Ramdohrite | Pb5.9Fe0.1Mn0.1In0.1Cd0.2Ag2.8Sb10.8S24 |
| Pb | ⓘ Schirmerite | PbAgBi3S6 - Pb3Ag1.5Bi3.5S9 |
| Pb | ⓘ Součekite | CuPbBi(S,Se)3 |
| Pb | ⓘ Teallite | PbSnS2 |
| Pb | ⓘ Tintinaite | Pb22Cu4(Sb,Bi)30S69 |
| Pb | ⓘ Weibullite | Pb5Bi8Se7S11 |
| Pb | ⓘ Zinkenite | Pb9Sb22S42 |
| Pb | ⓘ Galena var. Bismuth-bearing Galena | (Pb,Bi,Ag)S |
| Pb | ⓘ Jamesonite var. Manganese-bearing Jamesonite | Pb4(Fe,Mn)Sb6S14 |
| Bi | Bismuth | |
| Bi | ⓘ Aramayoite | Ag3Sb2(Bi,Sb)S6 |
| Bi | ⓘ Benjaminite | Ag3Bi7S12 |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Eclarite | (Cu,Fe)Pb9Bi12S28 |
| Bi | ⓘ Galenobismutite | PbBi2S4 |
| Bi | ⓘ Giessenite | Pb27Cu2(Bi,Sb)19S57 |
| Bi | ⓘ Gustavite | AgPbBi3S6 |
| Bi | ⓘ Izoklakeite | Pb27(Cu,Fe,Ag)2(Sb,Bi)19S57 |
| Bi | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Bi | ⓘ Lillianite | Pb3-2xAgxBi2+xS6 |
| Bi | ⓘ Matildite | AgBiS2 |
| Bi | ⓘ Pavonite | AgBi3S5 |
| Bi | ⓘ Schirmerite | PbAgBi3S6 - Pb3Ag1.5Bi3.5S9 |
| Bi | ⓘ Součekite | CuPbBi(S,Se)3 |
| Bi | ⓘ Tintinaite | Pb22Cu4(Sb,Bi)30S69 |
| Bi | ⓘ Weibullite | Pb5Bi8Se7S11 |
| Bi | ⓘ Galena var. Bismuth-bearing Galena | (Pb,Bi,Ag)S |
| Th | Thorium | |
| Th | ⓘ Thorite | Th(SiO4) |
Localities in this Region
Other Regions, Features and Areas that Intersect
AsiaContinent
China
- Giant Sb metallogenic beltMineral Belt
- Guangxi
- Hechi
- Dachang orefieldOre Field
- Nandan-Hechi Sn-W metallogenic beltMineral Belt
- Hechi
- Youjiang metallogenic provinceMineral Province
Eurasian Plate
- Eastern Yangtze CratonCraton
- Nanpanjiang BasinBasin
Yangtze PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Xilin, Li (1986) New advances in the study of jamesonite-group minerals from the Dachang ore field, Guangxi, China. Chinese Journal of Geochemistry, 5 (3) 290-295 doi:10.1007/bf02864883
Jiang, Shao-Yong, Han, Fa, Shen, Jian-Zhong, Palmer, Martin R. (1999) Chemical and Rb–Sr, Sm–Nd isotopic systematics of tourmaline from the Dachang Sn-polymetallic ore deposit, Guangxi Province, P.R. China. Chemical Geology, 157 (1) 49-67 doi:10.1016/s0009-2541(98)00200-9
Pašava, Jan, Kříbek, Bohdan, Dobeš, Petr, Vavřín, Ivan, Žák, Karel, Delian, Fan, Tao, Zhang, Boiron, Marie-Christine (2003) Tin–polymetallic sulfide deposits in the eastern part of the Dachang tin field (South China) and the role of black shales in their origin. Mineralium Deposita, 38 (1) 39-66 doi:10.1007/s00126-002-0269-4
Fan, Delian; Zhang, Tao; Ye, Jie; Pašava, J.; Kribek, B.; Dobes, P.; Varrin, I.; Zak, K. (2004) Geochemistry and origin of tin–polymetallic sulfide deposits hosted by the Devonian black shale series near Dachang, Guangxi, China. Ore Geology Reviews, 24 (1). doi:10.1016/j.oregeorev.2003.08.006
Ju, Minghui, Zhao, Chongbin, Dai, Tagen, Yang, Jianwen (2011) Finite element modeling of pore-fluid flow in the Dachang ore district, Guangxi, China: Implications for hydrothermal mineralization. Geoscience Frontiers, 2 (3) 463-474 doi:10.1016/j.gsf.2011.05.008
Gan, Chengshi; Wang, Yuejun; Zhang, Yuzhi; Qian, Xin (2022) Petrogenesis of Late Cretaceous granites and implications for W-Sn mineralization in the Youjiang Basin, South China. Ore Geology Reviews, 144. doi:10.1016/j.oregeorev.2022.104846
Guo, Jia; Zhang, Gangyang; Xiang, Lu; Zhang, Rongqing; Zhang, Lipeng; Sun, Weidong (2022) Combined mica and apatite chemical compositions to trace magmatic-hydrothermal evolution of fertile granites in the Dachang Sn-polymetallic district, South China. Ore Geology Reviews, 151. doi:10.1016/j.oregeorev.2022.105168
Dachang ore field, Nandan-Hechi Sn-W metallogenic belt, Guangxi, China