St Agnes, Cornwall, England, UKi
| Regional Level Types | |
|---|---|
| St Agnes | Civil Parish |
| Cornwall | County |
| England | Constituent Country |
| UK | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Saint Agnes | 2,820 (2014) |
| Mount Hawke | 1,511 (2017) |
Museums in region:
Other Languages:
Cornish:
Breanek, Kernow, Pow Sows, Ruwvaneth Unys
French:
St Agnes, Cornouailles, Angleterre, Royaume-Uni
German:
St Agnes, Cornwall, England, Vereinigtes Königreich
Italian:
St Agnes, Cornovaglia, Inghilterra, Regno Unito
Russian:
Сент-Агнес, Корнуолл, Англия, Великобритания
Spanish:
St Agnes, Cornualles, Inglaterra, Reino Unido
Arabic:
سانت اغنس, كورنوال, إنجلترا, المملكة المتحدة
Basque:
St Agnes , Kornualles, Ingalaterra, Erresuma Batua
Bengali:
সেন্ট এগেন্স, কর্নওয়াল, ইংল্যান্ড, যুক্তরাজ্য
Cebuano:
St. Agnes, Cornwall, Inglatera, Hiniusang Gingharian
Dutch:
St. Agnes, Cornwall, Engeland, Verenigd Koninkrijk
Farsi/Persian:
سنت اگنس، کورنوال, کورنوال, انگلستان, بریتانیا
Gujarati:
સેન્ટ એગ્નેસ, કોર્નવોલ, ઈંગ્લેન્ડ, યુનાઇટેડ કિંગડમ
Japanese:
セイント・アグネス, コーンウォール, イングランド, イギリス
Kannada:
ಸೇಂಟ್ ಆಗ್ನೆಸ್, ಕಾರ್ನ್ವಾಲ್, ಇಂಗ್ಲೆಂಡ್, ಯುನೈಟೆಡ್ ಕಿಂಗ್ಡಂ
Korean:
세인트 아그네스, 콘월주, 잉글랜드, 영국
Latin:
St Agnes , Cornubia, Anglia, Britanniarum regnum
Lithuanian:
Sent Agnesas, Kornvalis, Anglija, Jungtinė Karalystė
Polish:
St Agnes, Kornwalia, Anglia, Wielka Brytania
Portuguese:
St Agnes, Cornualha, Inglaterra, Reino Unido
Swedish:
St Agnes, Cornwall, England, Storbritannien
Tamil:
ஸ்ட ஆக்னஸ், கோர்ன்வால், இங்கிலாந்து, ஐக்கிய இராச்சியம்
Telugu:
సెయింట్ ఆగ్నెస్, కార్న్వాల్, ఇంగ్లాండు, యునైటెడ్ కింగ్డమ్
Urdu:
سینٹ اجنیس, کورنوال, انگلستان, مملکت متحدہ
Welsh:
St Agnes, Cernyw, Lloegr, Y Deyrnas Unedig
This entry is for the civil parish that also contains a large coastal village of the same name.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities85 valid minerals. 2 (TL) - type locality of valid minerals. 2 erroneous literature entries.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S |
| ⓘ Agardite-(Ce) Formula: CeCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Anatase Formula: TiO2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Andalusite Formula: Al2(SiO4)O |
| ⓘ Anglesite Formula: PbSO4 |
| ⓘ Antlerite Formula: Cu3(SO4)(OH)4 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A Localities: Reported from at least 6 localities in this region. |
| ⓘ Arsenopyrite Formula: FeAsS Localities: Reported from at least 10 localities in this region. |
| ⓘ Atacamite Formula: Cu2(OH)3Cl |
| ⓘ Auriacusite Formula: Fe3+Cu2+(AsO4)O |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bismite Formula: Bi2O3 |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ Bismutite Formula: (BiO)2CO3 Description: Originally thought to be eulytine, however Clark et al. proved it to be bismutite. |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Botallackite Formula: Cu2(OH)3Cl |
| ⓘ Bournonite Formula: PbCuSbS3 |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 |
| ⓘ Bukovskýite Formula: Fe3+2(AsO4)(SO4)(OH) · 9H2O |
| ⓘ Carbonatecyanotrichite Formula: Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| ⓘ Cassiterite Formula: SnO2 Localities: Reported from at least 56 localities in this region. |
| ⓘ Cassiterite var. Dough tin Formula: SnO2 References: |
| ⓘ Cassiterite var. Toad's Eye Tin Formula: SnO2 |
| ⓘ Cassiterite var. Wood Tin Formula: SnO2 Localities: Reported from at least 9 localities in this region. |
| ⓘ Cerussite Formula: PbCO3 |
| ⓘ Cervantite Formula: Sb3+Sb5+O4 Locality: Wheal Kine (Wheal Kind), St Agnes Consols (Polberro Consols), St Agnes, Cornwall, England, UK References: |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O |
| ⓘ Chalcoalumite Formula: CuAl4(SO4)(OH)12 · 3H2O |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcophyllite Formula: Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O References: |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 44 localities in this region. |
| ⓘ Chlorargyrite Formula: AgCl |
| ⓘ 'Chlorite Group' Localities: Reported from at least 18 localities in this region. |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinoclase Formula: Cu3(AsO4)(OH)3 |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ Connellite Formula: Cu19(SO4)(OH)32Cl4 · 3H2O |
| ⓘ Covellite Formula: CuS |
| ⓘ Cuprite Formula: Cu2O Localities: Reported from at least 6 localities in this region. |
| ⓘ Cuprite var. Chalcotrichite Formula: Cu2O |
| ⓘ Digenite Formula: Cu9S5 |
| ⓘ Enargite Formula: Cu3AsS4 |
| ⓘ 'Enysite' |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O |
| ⓘ Formula: Bi4(SiO4)3 Locality: Wheal Coates, St Agnes, Cornwall, England, UK - erroneously reported Description: A specimen from J.H. Collins in the collection of the Royal Cornwall Museum, Truro (catalogue no. 1588), is labelled as eulytine from Wheal Coates, but has been shown by Clark et al. (1986) to contain no eulytine at all, but turned out to be bismutite. |
| ⓘ Fluorite Formula: CaF2 Localities: Reported from at least 15 localities in this region. |
| ⓘ Galena Formula: PbS Localities: Reported from at least 10 localities in this region. |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Gersdorffite Formula: NiAsS |
| ⓘ 'Glauconite' Formula: K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| ⓘ Goethite Formula: Fe3+O(OH) Localities: Reported from at least 6 localities in this region. |
| ⓘ Gratonite Formula: Pb9As4S15 |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 6 localities in this region. |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ 'K Feldspar' |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O |
| ⓘ 'Limonite' Localities: Reported from at least 7 localities in this region. |
| ⓘ Löllingite Formula: FeAs2 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Lushington Cove, Porthtowan, St Agnes, Cornwall, England, UK Wheal Charlotte (Great Wheal Charlotte), Porthtowan, St Agnes, Cornwall, England, UK Wheal Kitty (Kitty and Penhalls United Mine; incl. Goonlaze Mine; Wheal Osborne), St Agnes, Cornwall, England, UK Wheal Music, Porthtowan, St Agnes, Cornwall, England, UK Tywarnhayle Mine (Wheal Rock), Porthtowan, St Agnes, Cornwall, England, UK |
| ⓘ Marcasite Formula: FeS2 References: |
| ⓘ Matildite Formula: AgBiS2 |
| ⓘ Melanterite Formula: Fe2+(H2O)6(SO4) · H2O |
| ⓘ 'Monazite Group' Formula: REE(PO4) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Copper Formula: Cu Localities: Reported from at least 6 localities in this region. |
| ⓘ Native Sulphur Formula: S8 |
| ⓘ Olivenite Formula: Cu2(AsO4)(OH) |
| ⓘ Orpiment Formula: As2S3 |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 |
| ⓘ 'Petroleum' |
| ⓘ 'Petroleum var. Bitumen' |
| ⓘ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ Phenakite Formula: Be2SiO4 |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 34 localities in this region. |
| ⓘ Pyrite var. Bravoite Formula: (Fe,Ni)S2 References: |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 43 localities in this region. |
| ⓘ Quartz var. Amethyst Formula: SiO2 References: |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 Locality: Wheal Tye, Wheal Lushington (West Wheal Towan), Porthtowan, St Agnes, Cornwall, England, UK References: Paul De Bondt collection.Identified by Paul De Bondt: Visual Identification |
| ⓘ Realgar Formula: As4S4 |
| ⓘ Rosasite Formula: (Cu,Zn)2(CO3)(OH)2 |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: Wheal Coates, St Agnes, Cornwall, England, UK Trevaunance Cove, St Agnes, Cornwall, England, UK Wheal Pink, Penhalls Mine, Wheal Kitty (Kitty and Penhalls United Mine; incl. Goonlaze Mine; Wheal Osborne), St Agnes, Cornwall, England, UK New Wheal Kitty (Livingstone Consols), West Wheal Kitty group, St Agnes, Cornwall, England, UK |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O |
| ⓘ Serpierite Formula: Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O References: |
| ⓘ Siderite Formula: FeCO3 Localities: Reported from at least 8 localities in this region. |
| ⓘ Skutterudite Formula: CoAs3 |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 26 localities in this region. |
| ⓘ Stannite (TL) Formula: Cu2FeSnS4 Localities: Reported from at least 6 localities in this region. |
| ⓘ Formula: SrAl3(PO4)(SO4)(OH)6 Locality: Wheal Coates, St Agnes, Cornwall, England, UK - erroneously reported |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S |
| ⓘ Tenorite Formula: CuO Localities: Reported from at least 6 localities in this region. |
| ⓘ Thénardite Formula: Na2SO4 |
| ⓘ Titanite Formula: CaTiO(SiO4) |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 Localities: Reported from at least 10 localities in this region. |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z Localities: Reported from at least 14 localities in this region. |
| ⓘ 'Tourmaline var. Indicolite' |
| ⓘ Varlamoffite Formula: Sn1-xFexO2-x(OH) |
| ⓘ Vivianite (TL) Formula: Fe2+Fe2+2(PO4)2 · 8H2O Type Locality: |
| ⓘ 'Wolframite Group' Localities: Reported from at least 6 localities in this region. |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Stannite (TL) | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Pyrite var. Bravoite | 2.EB.05a | (Fe,Ni)S2 |
| ⓘ | 2.EB.05a | FeS2 | |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Skutterudite | 2.EC.05 | CoAs3 |
| ⓘ | Realgar | 2.FA.15a | As4S4 |
| ⓘ | Orpiment | 2.FA.30 | As2S3 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | Matildite | 2.JA.20 | AgBiS2 |
| ⓘ | Gratonite | 2.JB.55 | Pb9As4S15 |
| ⓘ | Enargite | 2.KA.05 | Cu3AsS4 |
| Group 3 - Halides | |||
| ⓘ | Chlorargyrite | 3.AA.15 | AgCl |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Atacamite | 3.DA.10a | Cu2(OH)3Cl |
| ⓘ | Botallackite | 3.DA.10b | Cu2(OH)3Cl |
| ⓘ | Connellite | 3.DA.25 | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Cuprite var. Chalcotrichite | 4.AA.10 | Cu2O |
| ⓘ | 4.AA.10 | Cu2O | |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Bismite | 4.CB.60 | Bi2O3 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Varlamoffite | 4.DB.05 | Sn1-xFexO2-x(OH) |
| ⓘ | Cassiterite var. Wood Tin | 4.DB.05 | SnO2 |
| ⓘ | var. Toad's Eye Tin | 4.DB.05 | SnO2 |
| ⓘ | var. Dough tin | 4.DB.05 | SnO2 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Cervantite | 4.DE.30 | Sb3+Sb5+O4 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Rosasite | 5.BA.10 | (Cu,Zn)2(CO3)(OH)2 |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Thénardite | 7.AD.25 | Na2SO4 |
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Antlerite | 7.BB.15 | Cu3(SO4)(OH)4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6(SO4) · H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Serpierite | 7.DD.30 | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| ⓘ | Chalcoalumite | 7.DD.75 | CuAl4(SO4)(OH)12 · 3H2O |
| ⓘ | Carbonatecyanotrichite | 7.DE.10 | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Olivenite | 8.BB.30 | Cu2(AsO4)(OH) |
| ⓘ | Auriacusite | 8.BB.30 | Fe3+Cu2+(AsO4)O |
| ⓘ | Clinoclase | 8.BE.20 | Cu3(AsO4)(OH)3 |
| ⓘ | Svanbergite ? | 8.BL.05 | SrAl3(PO4)(SO4)(OH)6 |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Vivianite (TL) | 8.CE.40 | Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ | Bukovskýite | 8.DB.40 | Fe3+2(AsO4)(SO4)(OH) · 9H2O |
| ⓘ | Chalcophyllite | 8.DF.30 | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ | Agardite-(Ce) | 8.DL.15 | CeCu6(AsO4)3(OH)6 · 3H2O |
| Group 9 - Silicates | |||
| ⓘ | Phenakite | 9.AA.05 | Be2SiO4 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Eulytine ? | 9.AD.40 | Bi4(SiO4)3 |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Enysite' | - | |
| ⓘ | 'Glauconite' | - | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| ⓘ | 'Tourmaline var. Indicolite' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Petroleum var. Bitumen' | - | |
| ⓘ | '' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Agardite-(Ce) | CeCu6(AsO4)3(OH)6 · 3H2O |
| H | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| H | ⓘ Atacamite | Cu2(OH)3Cl |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Botallackite | Cu2(OH)3Cl |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Bukovskýite | Fe23+(AsO4)(SO4)(OH) · 9H2O |
| H | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| H | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Olivenite | Cu2(AsO4)(OH) |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Varlamoffite | Sn1-xFexO2-x(OH) |
| H | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Phenakite | Be2SiO4 |
| B | Boron | |
| B | ⓘ Tourmaline var. Indicolite | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ Agardite-(Ce) | CeCu6(AsO4)3(OH)6 · 3H2O |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| O | ⓘ Atacamite | Cu2(OH)3Cl |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bismite | Bi2O3 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Botallackite | Cu2(OH)3Cl |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Bukovskýite | Fe23+(AsO4)(SO4)(OH) · 9H2O |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Cervantite | Sb3+Sb5+O4 |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| O | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| O | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Eulytine | Bi4(SiO4)3 |
| O | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Tourmaline var. Indicolite | |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Olivenite | Cu2(AsO4)(OH) |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Phenakite | Be2SiO4 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Thénardite | Na2SO4 |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Varlamoffite | Sn1-xFexO2-x(OH) |
| O | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| O | ⓘ Cassiterite var. Wood Tin | SnO2 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Cassiterite var. Toad's Eye Tin | SnO2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Auriacusite | Fe3+Cu2+(AsO4)O |
| O | ⓘ Cassiterite var. Dough tin | SnO2 |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Thénardite | Na2SO4 |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| Al | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| Al | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Eulytine | Bi4(SiO4)3 |
| Si | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Phenakite | Be2SiO4 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| P | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Bukovskýite | Fe23+(AsO4)(SO4)(OH) · 9H2O |
| S | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| S | ⓘ Covellite | CuS |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Enargite | Cu3AsS4 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Gratonite | Pb9As4S15 |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Matildite | AgBiS2 |
| S | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| S | ⓘ Orpiment | As2S3 |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Realgar | As4S4 |
| S | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stannite | Cu2FeSnS4 |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Thénardite | Na2SO4 |
| Cl | Chlorine | |
| Cl | ⓘ Atacamite | Cu2(OH)3Cl |
| Cl | ⓘ Botallackite | Cu2(OH)3Cl |
| Cl | ⓘ Chlorargyrite | AgCl |
| Cl | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Fe | Iron | |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| Fe | ⓘ Bukovskýite | Fe23+(AsO4)(SO4)(OH) · 9H2O |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Fe | ⓘ Varlamoffite | Sn1-xFexO2-x(OH) |
| Fe | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| Fe | ⓘ Auriacusite | Fe3+Cu2+(AsO4)O |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Co | ⓘ Skutterudite | CoAs3 |
| Ni | Nickel | |
| Ni | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Cu | Copper | |
| Cu | ⓘ Agardite-(Ce) | CeCu6(AsO4)3(OH)6 · 3H2O |
| Cu | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| Cu | ⓘ Atacamite | Cu2(OH)3Cl |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Botallackite | Cu2(OH)3Cl |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Carbonatecyanotrichite | Cu4Al2(CO3,SO4)(OH)12 · 2H2O |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| Cu | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| Cu | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Enargite | Cu3AsS4 |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Olivenite | Cu2(AsO4)(OH) |
| Cu | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Cu | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Auriacusite | Fe3+Cu2+(AsO4)O |
| Zn | Zinc | |
| Zn | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Zn | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Agardite-(Ce) | CeCu6(AsO4)3(OH)6 · 3H2O |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Bukovskýite | Fe23+(AsO4)(SO4)(OH) · 9H2O |
| As | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| As | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Enargite | Cu3AsS4 |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Gratonite | Pb9As4S15 |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Olivenite | Cu2(AsO4)(OH) |
| As | ⓘ Orpiment | As2S3 |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Realgar | As4S4 |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Skutterudite | CoAs3 |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Auriacusite | Fe3+Cu2+(AsO4)O |
| Sr | Strontium | |
| Sr | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Chlorargyrite | AgCl |
| Ag | ⓘ Matildite | AgBiS2 |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sn | ⓘ Varlamoffite | Sn1-xFexO2-x(OH) |
| Sn | ⓘ Cassiterite var. Wood Tin | SnO2 |
| Sn | ⓘ Cassiterite var. Toad's Eye Tin | SnO2 |
| Sn | ⓘ Cassiterite var. Dough tin | SnO2 |
| Sb | Antimony | |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Cervantite | Sb3+Sb5+O4 |
| Ce | Cerium | |
| Ce | ⓘ Agardite-(Ce) | CeCu6(AsO4)3(OH)6 · 3H2O |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Gratonite | Pb9As4S15 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Bi | Bismuth | |
| Bi | ⓘ Bismite | Bi2O3 |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Eulytine | Bi4(SiO4)3 |
| Bi | ⓘ Matildite | AgBiS2 |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/St_Agnes,_Cornwall |
|---|---|
| Wikidata ID: | Q1025776 |
| GeoNames ID: | 2638870 |
Localities in this Region
- England
- Cornwall
- St Agnes
- Beacon Quarry
- Blackwater
- Blue Hills Mine (incl. Wheal Dellick; Wheal Dragon; Wheal Glynn)
- Bowling Green Mine
- Cameron Quarry
- Chapel Porth beach
- East Blue Hills Mine (incl. Wheal Budnock; Wheal Grass)
- East Wheal Charlotte
- East Wheal Ellen
- East Wheal Music
- Goonbell
- Gooninis Mine
- Great St Vincent Mine
- Green Island
- Hanover Cove (Vugga Hayle)
- Mawla Lane End
- Mithian
- Mount Hawke
- Porthtowan
- St Agnes
- Cornwall
- England
- Cornwall
- St Agnes
- Porthtowan
- Wheal Lushington (West Wheal Towan)
- Wheal Music
- Wheal Towan (Towan Consols)
- Skinners Bottom
- St Agnes Consols (Polberro Consols)
- Balnoon Mine
- Carnmeal Mine
- New Polberro Mine
- North Seal Hole Mine
- Pell Mine (Great Pell Mine)
- Polberro Mines
- Seal Hole Mine
- Trevaunance Mine (Wheal Trevaunance)
- Turnavore Mine
- West Polberro Mine
- Wheal Coit (Wheal Quoit)
- Wheal Kine (Wheal Kind)
- Wheal Park (Park Mine)
- Wheal Prosper
- Wheal Pye (Wheal Pie)
- Trevaunance Cove
- Victoria Mine
- West Wheal Kitty group
- Wheal Barrow (?)
- Wheal Bungay
- Wheal Coates
- Wheal Comfort
- Wheal Devonshire
- Wheal Kitty (Kitty and Penhalls United Mine; incl. Goonlaze Mine; Wheal Osborne)
- Wheal Luna
- Wheal Ocean (North Blue Hills Mine)
- Wheal Owla (Wheal Owles)
- Wheal Prudence
- Wheal Rose village
- Wheal Turton
- Porthtowan
- St Agnes
- Cornwall
Other Regions, Features and Areas that Intersect
British and Irish IslesGroup of Islands
Eurasian PlateTectonic Plate
- Rheno-Hercynian BeltOrogenic Belt
EuropeContinent
UK
- England
- Cornubian mining districtMining District
- Cornwall
- Camborne-Redruth and St Day Mining DistrictMining District
- St Agnes Mining DistrictMining District
- Cornwall National LandscapeNational Landscape
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions






Blue Hills Mine, St Agnes, Cornwall, England, UK