Otavi Constituency, Otjozondjupa Region, Namibiai
| Regional Level Types | |
|---|---|
| Otavi Constituency | Constituency |
| Otjozondjupa Region | Region |
| Namibia | Country |
This page is currently not sponsored. Click here to sponsor this page.
Otavi Constituency is an electoral constituency in the Otjozondjupa Region of Namibia. The constituency consists of the town of Otavi and the surrounding rural area.
The towns of Otavi, Tsumeb (to the north; in a different region) and Grootfontein (to the northeast; also in Otjozondjupa Region) define an area known as the "Otavi Triangle", also known as the Otavi Mountainland.
The towns of Otavi, Tsumeb (to the north; in a different region) and Grootfontein (to the northeast; also in Otjozondjupa Region) define an area known as the "Otavi Triangle", also known as the Otavi Mountainland.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities142 valid minerals. 16 (TL) - type locality of valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ Aegirine Formula: NaFe3+Si2O6 |
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ Alleghanyite Formula: Mn2+5(SiO4)2(OH)2 |
| ⓘ Anglesite Formula: PbSO4 |
| ⓘ Anhydrite Formula: CaSO4 |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Arcanite Formula: K2SO4 References: |
| ⓘ Ardealite Formula: Ca2(PO3OH)(SO4) · 4H2O |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Asisite (TL) Formula: Pb7SiO9Cl2 Type Locality: Habit: platy crystals Colour: light greenish-yellow to yellow Description: In polished sections, asisite is seen to occur as euhedral to subhedral lathlike grains in colorless barite in the interstices of coarsely crystalline hematophanite. Less perfect grains are intergrown with other minerals and partially fill fractures and cavities in the hematophanite. Other minerals present in the barite matrix are jacobsite (containing inclusions of hematite and native copper), blades of molybdophyllite, and serrated laths of chlorite. |
| ⓘ Austinite Formula: CaZn(AsO4)(OH) |
| ⓘ Austinite var. Copper-bearing Austinite Formula: Ca(Zn,Cu)(AsO4)(OH) |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 |
| ⓘ Barysilite Formula: Pb8Mn2+[Si2O7]3 |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Bastnäsite-(Ce) Formula: Ce(CO3)F |
| ⓘ Bayldonite Formula: PbCu3(AsO4)2(OH)2 |
| ⓘ Betekhtinite Formula: Pb2(Cu,Fe)22-24S15 |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Britvinite Formula: [Pb7(OH)3F(BO3)2(CO3)][Mg4.5(OH)3(Si5O14)] References: |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 |
| ⓘ Brucite Formula: Mg(OH)2 |
| ⓘ Brushite Formula: Ca(PO3OH) · 2H2O |
| ⓘ Cahnite Formula: Ca2[B(OH)4](AsO4) Description: Found in epithermal veins. |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 8 localities in this region. |
| ⓘ Carlfrancisite (TL) Formula: Mn2+3(Mn2+,Mg,Fe3+,Al)42[As3+O3]2(As5+O4)4[(Si,As5+)O4]6[(As5+,Si)O4]2(OH)42 Type Locality: References: Williams, P. A., Hatert, F., Pasero, M., Mills, S. J. (2012) New minerals and nomenclature modifications approved in 2012. CNMNC Newsletter No 14. Mineralogical Magazine, 76 (5) 1281-1288 doi:10.1180/minmag.2012.076.5.15 Hawthorne, Frank C., Abdu, Yassir A., Ball, Neil A., Pinch, William W. (2013) Carlfrancisite: Mn2+3(Mn2+,Mg,Fe3+,Al)42(As3+O3)2(As5+O4)4[(Si,As5+)O4]6[(As5+,Si)O4]2(OH)42, a new arseno-silicate mineral from the Kombat mine, Otavi Valley, Namibia. American Mineralogist, 98 (10) 1693-1696 doi:10.2138/am.2013.4426 |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Cerussite Formula: PbCO3 Localities: Description: Flawlessly transparent often heart-shaped twins.
Plate 19 from Wilson, Wendell. E.; Bartsch, Joel A.; Mauthner, Mark (2004) Masterpieces of the Mineral World. Houston Museum of Natural Science. [https://www.mindat.org/reference.php?id=18945017] |
| ⓘ Chalcocite Formula: Cu2S Localities: Reported from at least 6 localities in this region. |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: |
| ⓘ 'Chlorite Group' |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ 'Clay minerals' |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Colusite Formula: Cu13VAs3S16 |
| ⓘ Conichalcite Formula: CaCu(AsO4)(OH) Localities: Description: As "Barthite." |
| ⓘ Corkite Formula: PbFe3+3(PO4)(SO4)(OH)6 |
| ✪ Coronadite Formula: Pb(Mn4+6Mn3+2)O16 Description: Mindat photo ID: 870379 |
| ⓘ Covellite Formula: CuS Localities: |
| ⓘ Crednerite Formula: Cu+Mn3+O2 |
| ⓘ Crocoite Formula: PbCr6+O4 |
| ⓘ Cuprite Formula: Cu2O Localities: Guchab-Rodgerberg area, Otavi Constituency, Otjozondjupa Region, Namibia Otjikoto prospect, Platveld area, Otavi Constituency, Otjozondjupa Region, Namibia Gross Otavi Mine (Gross Otavi prospect), Otavi Constituency, Otjozondjupa Region, Namibia Finsterbergen prospect, Finsterbergen Farm 469, Otavi Constituency, Otjozondjupa Region, Namibia Kombat Mine, Kombat, Otavi Constituency, Otjozondjupa Region, Namibia |
| ⓘ Cuspidine Formula: Ca8(Si2O7)2F4 |
| ⓘ Damaraite (TL) Formula: Pb3Cl(OH)O2 Type Locality: |
| ✪ Defernite Formula: Ca6(CO3)1.58(Si2O7)0.21(OH)7[Cl0.50(OH)0.08(H2O)0.42] Habit: laths to 1cm. Description: About 2000 tons of defernite and hausmannite ore were mined. |
| ⓘ Descloizite Formula: PbZn(VO4)(OH) Localities: Reported from at least 13 localities in this region. |
| ⓘ Digenite Formula: Cu9S5 |
| ⓘ Dioptase Formula: CuSiO3 · H2O Localities: Reported from at least 6 localities in this region. |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Duftite Formula: PbCu(AsO4)(OH) |
| ⓘ Enargite Formula: Cu3AsS4 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Erikjonssonite (TL) Formula: (Pb32O21)[(V,Si,Mo,As)O4]4Cl9 Type Locality: References: Chukanov, Nikita V., Siidra, Oleg I., Polekhovsky, Yury S., Pekov, Igor V., Varlamov, Dmitry A., Ermolaeva, Vera N., Virus, Alla A. (2019) Erikjonssonite, (Pb32O21)[(V,Si,Mo,As)O4]4Cl9, a new mineral from the Kombat mine and structural classification of layered lead oxychlorides related to litharge. European Journal of Mineralogy, 31 (3) 619-628 doi:10.1127/ejm/2019/0031-2854 |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Galaxite Formula: Mn2+Al2O4 |
| ⓘ Galena Formula: PbS Localities: Reported from at least 7 localities in this region. |
| ⓘ Ganophyllite Formula: (K,Na)xMn2+6(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| ⓘ Glaucochroite Formula: CaMn2+(SiO4) |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Grootfonteinite (TL) Formula: Pb3O(CO3)2 Type Locality: References: Hålenius, U.; Hatert, F.; Pasero, M.; Mills, S. J. (2015) New minerals and nomenclature modifications approved in 2015. Mineralogical Magazine, 79 (5). p.1223-1230. doi:10.1180/minmag.2015.079.5.16 Siidra, Oleg I., Jonsson, Erik, Chukanov, Nikita V., Nekrasova, Diana O., Pekov, Igor V., Depmeier, Wulf, Polekhovsky, Yury S., Yapaskurt, Vasiliy O. (2018) Grootfonteinite, Pb3O(CO3)2, a new mineral species from the Kombat Mine, Namibia, merotypically related to hydrocerussite. European Journal of Mineralogy, 30 (2) 383-391 doi:10.1127/ejm/2018/0030-2723 |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Harkerite Formula: Ca48Mg16[AlSi4O15(OH)]4(BO3)16(CO3)16 · 2(H2O,HCl) |
| ⓘ Hausmannite Formula: Mn2+Mn3+2O4 |
| ⓘ Hedyphane Formula: Ca2Pb3(AsO4)3Cl |
| ⓘ Helvine Formula: Be3Mn2+4(SiO4)3S |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Hematophanite Formula: Pb4Fe3O8(OH,Cl) |
| ⓘ Hereroite (TL) Formula: [Pb32(O,◻)21](AsO4)2[(Si,As,V,Mo)O4]2Cl10 Type Locality: |
| ⓘ Hillebrandite Formula: Ca2(SiO3)(OH)2 |
| ⓘ Holdawayite (TL) Formula: Mn6(CO3)2(OH)7(Cl,OH) Type Locality: |
| ⓘ Hollandite Formula: Ba(Mn4+6Mn3+2)O16 |
| ⓘ Hydroxylapatite Formula: Ca5(PO4)3(OH) |
| ⓘ Hydroxylapatite var. Carbonate-rich Hydroxylapatite Formula: Ca5(PO4,CO3)3(OH,O) |
| ⓘ Jacobsite Formula: Mn2+Fe3+2O4 |
| ⓘ Jaffeite (TL) Formula: Ca6(Si2O7)(OH)6 Type Locality: |
| ⓘ Janchevite (TL) Formula: Pb9V5+(O10.25◻0.75)Cl2.5 Type Locality: References: Hålenius, U., Hatert, F., Pasero, M., Mills, S. J. (2017) New minerals and nomenclature modifications approved in 2017, CNMNC Newsletter No 40. Mineralogical Magazine, 81 (6) 1577-1581 doi:10.1180/minmag.2017.081.096p.1579 |
| ⓘ Jerrygibbsite Formula: Mn2+9(SiO4)4(OH)2 |
| ⓘ Johninnesite (TL) Formula: Na2Mn2+9Mg7(OH)8[AsO4]2[Si6O17]2 Type Locality: |
| ⓘ Jordanite Formula: Pb14As6S23 Description: Irregular masses up to 1cm. |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Kentrolite Formula: Pb2Mn3+2(Si2O7)O2 |
| ⓘ Kirschsteinite ? Formula: CaFe2+(SiO4) References: |
| ⓘ Kombatite (TL) Formula: Pb14(VO4)2O9Cl4 Type Locality: Description: tiny 0.2 mm anhedral bright yellow grains embedded within calcite veins in hausmannite. References: |
| ⓘ Kutnohorite Formula: CaMn2+(CO3)2 |
| ⓘ Lautite Formula: CuAsS |
| ⓘ Leadhillite Formula: Pb4(CO3)2(SO4)(OH)2 |
| ⓘ Leucophoenicite Formula: Mn2+7(SiO4)3(OH)2 |
| ⓘ ' Formula: Pb7O6Cl2 Locality: Kombat Mine, Kombat, Otavi Constituency, Otjozondjupa Region, Namibia - erroneously reported |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Manganberzeliite Formula: (NaCa2)Mn2+2(AsO4)3 |
| ⓘ Manganite Formula: Mn3+O(OH) |
| ⓘ Manganosite Formula: MnO |
| ⓘ Melanotekite Formula: Pb2Fe3+2(Si2O7)O2 |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Milanriederite (TL) Formula: (Ca18[REE])Fe3+Al4(Mg4Al4)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 Localities: |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Molybdophyllite Formula: Pb8Mg9[Si10O28(OH)8O2(CO3)3] · H2O |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) |
| ⓘ Mottramite Formula: PbCu(VO4)(OH) Localities: Kombat Mine, Kombat, Otavi Constituency, Otjozondjupa Region, Namibia Gross Otavi Mine (Gross Otavi prospect), Otavi Constituency, Otjozondjupa Region, Namibia Kupferberg Mine, Otavi Constituency, Otjozondjupa Region, Namibia Rietfontein Farm 344, Otavi Constituency, Otjozondjupa Region, Namibia Otavi Constituency, Otjozondjupa Region, Namibia |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ✪ Nambulite Formula: LiMn2+4Si5O14(OH) |
| ⓘ Native Copper Formula: Cu |
| ⓘ Native Gold Formula: Au |
| ⓘ Native Lead Formula: Pb |
| ⓘ Native Silver Formula: Ag |
| ⓘ Natronambulite Formula: (Na,Li)(Mn,Ca)4Si5O14OH |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 |
| ⓘ Plancheite Formula: Cu8(Si8O22)(OH)4 · H2O Localities: Finsterbergen prospect, Finsterbergen Farm 469, Otavi Constituency, Otjozondjupa Region, Namibia Guchab-Rodgerberg area, Otavi Constituency, Otjozondjupa Region, Namibia Gross Otavi Mine (Gross Otavi prospect), Otavi Constituency, Otjozondjupa Region, Namibia Kupferberg Mine, Otavi Constituency, Otjozondjupa Region, Namibia Rodgerberg Mine, Guchab-Rodgerberg area, Otavi Constituency, Otjozondjupa Region, Namibia |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyrobelonite Formula: PbMn2+(VO4)(OH) |
| ⓘ Pyrochroite Formula: Mn(OH)2 |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl |
| ⓘ Pyrophyllite Formula: Al2Si4O10(OH)2 |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 11 localities in this region. |
| ⓘ Quartz var. Amethyst Formula: SiO2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Renierite Formula: (Cu+,Zn)11Fe4(Ge4+,As5+)2S16 |
| ⓘ Rhodochrosite Formula: MnCO3 |
| ⓘ Rhodonite Formula: CaMn3Mn[Si5O15] |
| ✪ Ribbeite (TL) Formula: Mn2+5(SiO4)2(OH)2 Type Locality: Description: Ribbeite occurs as pinkish lenses up to 5 cm thick and 20 cm long, within a 20 m-wide zone of intercalated manganese and iron ores. The individual ribbeite grains are small, typically less than 0.5 mm, and often associated with other minerals. It has a preferential association with other Mn-bearing carbonates and silicates. Several parageneses are known, and the following is a description of the type specimen, as given by Peacor et al. (1987):
“There are four distinct bands in the type specimen that seem to have been inherited from a sedimentary protolith, each dominated by different minerals.
1.) ...a 3 mm-wide band composed primarily of ribbeite and…subhedral pyrochroite…and a mcgovernite-like mineral.
2.) This grades moderately sharply into a 2 cm-wide band composed largely of ribbeite and chlorite, with minor spinels (jacobsite and galaxite) and calcite
3.) Manganoan calcite...intimately intergrown with ribbeite. The mcgovernite-like mineral occurs sparingly…The band containing ribbeite grades continuously into a 2 mm-wide band of manganoan calcite.
4.) The calcite unit in turn grades into a band consisting almost entirely of equigranular alleghanyite, but with some galaxite, jacobsite and calcite”
Peacor et al. (1987) discuss the occurrence of both ribbeite and alleghanyite with almost identical compositon only millimeters apart, but within separate domains of the rock.
References: Peacor, Donald R., Dunn, Pete J., Su, Shu-Chun, Innes, John (1987) Ribbeite, a polymorph of alleghanyite and member of the leucophoenicite group from the Kombat mine, Namibia. American Mineralogist, 72 (1-2) 213-216 |
| ⓘ Richterite Formula: Na(CaNa)Mg5(Si8O22)(OH)2 |
| ⓘ Rickturnerite ? Formula: Pb7O4[Mg(OH)4](OH)Cl3 Habit: Minute fibres Colour: white, clear Description: A specimen of parkinsonite sent to the NHM in London for identification contains a small number of minute clear to white fibrous crystals, which appear to be rickturnerite. Due to the small size of the specimens, the identification is tentative and needs further work for confirmation. |
| ⓘ Roymillerite (TL) Formula: Pb24Mg9(Si10O28)(CO3)10(BO3)(SiO4)(OH)13O5 Type Locality: References: Hålenius, U., Hatert, F., Pasero, M., Mills, S. J. (2016) New minerals and nomenclature modifications approved in 2016, CNMNC Newsletter No. 33. Mineralogical Magazine, 80 (6) 1135-1144 doi:10.1180/minmag.2016.080.085 Chukanov, Nikita V., Jonsson, Erik, Aksenov, Sergey M., Britvin, Sergey N., Rastsvetaeva, Ramiza K., Belakovskiy, Dmitriy I., Van, Konstantin V. (2017) Roymillerite, Pb24Mg9(Si9AlO28)(SiO4)(BO3)(CO3)10(OH)14O4, a new mineral: mineralogical characterization and crystal chemistry. Physics and Chemistry of Minerals, 44 (10) 685-699 doi:10.1007/s00269-017-0893-2 |
| ⓘ Sahlinite Formula: Pb14(AsO4)2O9Cl4 |
| ⓘ Sakhaite Formula: Ca48Mg16(BO3)32(CO3)16 · 2(H2O,HCl) |
| ⓘ Serandite Formula: NaMn2+2Si3O8(OH) |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Smithsonite Formula: ZnCO3 Localities: Kombat Mine, Kombat, Otavi Constituency, Otjozondjupa Region, Namibia Baltika Mine, Baltika Farm 515, Otavi Constituency, Otjozondjupa Region, Namibia Auros Farm 595, Otavi Constituency, Otjozondjupa Region, Namibia Finsterbergen prospect, Finsterbergen Farm 469, Otavi Constituency, Otjozondjupa Region, Namibia Kupferberg Mine, Otavi Constituency, Otjozondjupa Region, Namibia |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 6 localities in this region. |
| ⓘ Sussexite Formula: Mn2+BO2(OH) |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S |
| ⓘ Tephroite Formula: Mn2+2(SiO4) |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| ⓘ Tsumebite Formula: Pb2Cu(PO4)(SO4)(OH) |
| ⓘ 'UM1990-59-SiO:AlBCHMg' Formula: Ca24Mg8(BO3)13Al0.75Si3(O,OH)12(CO3)8 · 8H2O |
| ⓘ 'Unnamed (Mcgovernite-like mineral)' Formula: (Mn,Mg,Fe3+)273As3+~12As5+~30Si~42O324(OH)252 |
| ⓘ Vanadinite Formula: Pb5(VO4)3Cl |
| ⓘ Vaterite Formula: CaCO3 References: |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ Vladkrivovichevite (TL) Formula: [Pb32O18][Pb4Mn2O]Cl14(BO3)8 · 2H2O Type Locality: |
| ⓘ Willemite Formula: Zn2SiO4 |
| ⓘ Wiserite Formula: (Mn2+,Mg)14(B2O5)4(OH)8 · (Si,Mg)(O,OH)4Cl References: |
| ⓘ Witherite Formula: BaCO3 |
| ⓘ Wulfenite Formula: Pb(MoO4) |
| ⓘ Yangite (TL) Formula: PbMnSi3O8 · H2O Type Locality: |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Lead | 1.AA.05 | Pb |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Betekhtinite | 2.BE.05 | Pb2(Cu,Fe)22-24S15 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Colusite | 2.CB.30 | Cu13VAs3S16 |
| ⓘ | Renierite | 2.CB.35a | (Cu+,Zn)11Fe4(Ge4+,As5+)2S16 |
| ⓘ | Lautite | 2.CB.40 | CuAsS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Jordanite | 2.JB.30a | Pb14As6S23 |
| ⓘ | Enargite | 2.KA.05 | Cu3AsS4 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Rickturnerite ? | 3.DB. | Pb7O4[Mg(OH)4](OH)Cl3 |
| ⓘ | Hematophanite | 3.DB.35 | Pb4Fe3O8(OH,Cl) |
| ⓘ | Asisite (TL) | 3.DB.40 | Pb7SiO9Cl2 |
| ⓘ | Janchevite (TL) | 3.DB.40 | Pb9V5+(O10.25◻0.75)Cl2.5 |
| ⓘ | Vladkrivovichevite (TL) | 3.DC.55 | [Pb32O18][Pb4Mn2O]Cl14(BO3)8 · 2H2O |
| ⓘ | 'Lorettoite' ? | 3.DC.60 | Pb7O6Cl2 |
| ⓘ | Damaraite (TL) | 3.DC.75 | Pb3Cl(OH)O2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Crednerite | 4.AB.05 | Cu+Mn3+O2 |
| ⓘ | Manganosite | 4.AB.25 | MnO |
| ⓘ | Galaxite | 4.BB.05 | Mn2+Al2O4 |
| ⓘ | Jacobsite | 4.BB.05 | Mn2+Fe3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hausmannite | 4.BB.10 | Mn2+Mn3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Coronadite | 4.DK.05a | Pb(Mn4+6Mn3+2)O16 |
| ⓘ | Hollandite | 4.DK.05a | Ba(Mn4+6Mn3+2)O16 |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Brucite | 4.FE.05 | Mg(OH)2 |
| ⓘ | Pyrochroite | 4.FE.05 | Mn(OH)2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Kutnohorite | 5.AB.10 | CaMn2+(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Witherite | 5.AB.15 | BaCO3 |
| ⓘ | Vaterite | 5.AB.20 | CaCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Holdawayite (TL) | 5.BA.20 | Mn6(CO3)2(OH)7(Cl,OH) |
| ⓘ | Defernite | 5.BA.25 | Ca6(CO3)1.58(Si2O7)0.21(OH)7[Cl0.50(OH)0.08(H2O)0.42] |
| ⓘ | Bastnäsite-(Ce) | 5.BD.20a | Ce(CO3)F |
| ⓘ | Grootfonteinite (TL) | 5.BE.40 | Pb3O(CO3)2 |
| ⓘ | Leadhillite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| Group 6 - Borates | |||
| ⓘ | Sakhaite | 6.AB.65 | Ca48Mg16(BO3)32(CO3)16 · 2(H2O,HCl) |
| ⓘ | Harkerite | 6.AB.70 | Ca48Mg16[AlSi4O15(OH)]4(BO3)16(CO3)16 · 2(H2O,HCl) |
| ⓘ | Cahnite | 6.AC.70 | Ca2[B(OH)4](AsO4) |
| ⓘ | Sussexite | 6.BA.15 | Mn2+BO2(OH) |
| ⓘ | Wiserite | 6.BA.20 | (Mn2+,Mg)14(B2O5)4(OH)8 · (Si,Mg)(O,OH)4Cl |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Arcanite | 7.AD.05 | K2SO4 |
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Crocoite | 7.FA.20 | PbCr6+O4 |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Manganberzeliite | 8.AC.25 | (NaCa2)Mn2+2(AsO4)3 |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Carlfrancisite (TL) | 8.BE.45 | Mn2+3(Mn2+,Mg,Fe3+,Al)42[As3+O3]2(As5+O4)4[(Si,As5+)O4]6[(As5+,Si)O4]2(OH)42 |
| ⓘ | Tsumebite | 8.BG.05 | Pb2Cu(PO4)(SO4)(OH) |
| ⓘ | Austinite | 8.BH.35 | CaZn(AsO4)(OH) |
| ⓘ | var. Copper-bearing Austinite | 8.BH.35 | Ca(Zn,Cu)(AsO4)(OH) |
| ⓘ | Conichalcite | 8.BH.35 | CaCu(AsO4)(OH) |
| ⓘ | Duftite | 8.BH.35 | PbCu(AsO4)(OH) |
| ⓘ | Descloizite | 8.BH.40 | PbZn(VO4)(OH) |
| ⓘ | Mottramite | 8.BH.40 | PbCu(VO4)(OH) |
| ⓘ | Pyrobelonite | 8.BH.40 | PbMn2+(VO4)(OH) |
| ⓘ | Bayldonite | 8.BH.45 | PbCu3(AsO4)2(OH)2 |
| ⓘ | Corkite | 8.BL.05 | PbFe3+3(PO4)(SO4)(OH)6 |
| ⓘ | Hydroxylapatite var. Carbonate-rich Hydroxylapatite | 8.BN.05 | Ca5(PO4,CO3)3(OH,O) |
| ⓘ | Hedyphane | 8.BN.05 | Ca2Pb3(AsO4)3Cl |
| ⓘ | Hydroxylapatite | 8.BN.05 | Ca5(PO4)3(OH) |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Vanadinite | 8.BN.05 | Pb5(VO4)3Cl |
| ⓘ | Kombatite (TL) | 8.BO.20 | Pb14(VO4)2O9Cl4 |
| ⓘ | Sahlinite | 8.BO.20 | Pb14(AsO4)2O9Cl4 |
| ⓘ | Hereroite (TL) | 8.BO.50 | [Pb32(O,◻)21](AsO4)2[(Si,As,V,Mo)O4]2Cl10 |
| ⓘ | Erikjonssonite (TL) | 8.BO.50 | (Pb32O21)[(V,Si,Mo,As)O4]4Cl9 |
| ⓘ | Ardealite | 8.CJ.50 | Ca2(PO3OH)(SO4) · 4H2O |
| ⓘ | Brushite | 8.CJ.50 | Ca(PO3OH) · 2H2O |
| Group 9 - Silicates | |||
| ⓘ | Willemite | 9.AA.05 | Zn2SiO4 |
| ⓘ | Glaucochroite | 9.AC.05 | CaMn2+(SiO4) |
| ⓘ | Kirschsteinite ? | 9.AC.05 | CaFe2+(SiO4) |
| ⓘ | Tephroite | 9.AC.05 | Mn2+2(SiO4) |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Alleghanyite | 9.AF.45 | Mn2+5(SiO4)2(OH)2 |
| ⓘ | Leucophoenicite | 9.AF.60 | Mn2+7(SiO4)3(OH)2 |
| ⓘ | Ribbeite (TL) | 9.AF.65 | Mn2+5(SiO4)2(OH)2 |
| ⓘ | Jerrygibbsite | 9.AF.70 | Mn2+9(SiO4)4(OH)2 |
| ⓘ | Barysilite | 9.BC.20 | Pb8Mn2+[Si2O7]3 |
| ⓘ | Jaffeite (TL) | 9.BE.12 | Ca6(Si2O7)(OH)6 |
| ⓘ | Cuspidine | 9.BE.17 | Ca8(Si2O7)2F4 |
| ⓘ | Kentrolite | 9.BE.80 | Pb2Mn3+2(Si2O7)O2 |
| ⓘ | Melanotekite | 9.BE.80 | Pb2Fe3+2(Si2O7)O2 |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Milanriederite (TL) | 9.BG.35 | (Ca18[REE])Fe3+Al4(Mg4Al4)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 |
| ⓘ | Dioptase | 9.CJ.30 | CuSiO3 · H2O |
| ⓘ | Aegirine | 9.DA.25 | NaFe3+Si2O6 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Richterite | 9.DE.20 | Na(CaNa)Mg5(Si8O22)(OH)2 |
| ⓘ | Serandite | 9.DG.05 | NaMn2+2Si3O8(OH) |
| ⓘ | Hillebrandite | 9.DG.40 | Ca2(SiO3)(OH)2 |
| ⓘ | Johninnesite (TL) | 9.DH.70 | Na2Mn2+9Mg7(OH)8[AsO4]2[Si6O17]2 |
| ⓘ | Nambulite | 9.DK.05 | LiMn2+4Si5O14(OH) |
| ⓘ | Natronambulite | 9.DK.05 | (Na,Li)(Mn,Ca)4Si5O14OH |
| ⓘ | Rhodonite | 9.DK.05 | CaMn3Mn[Si5O15] |
| ⓘ | Plancheite | 9.DP.55 | Cu8(Si8O22)(OH)4 · H2O |
| ⓘ | Yangite (TL) | 9.EA.52 | PbMnSi3O8 · H2O |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Pyrophyllite | 9.EC.10 | Al2Si4O10(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Ganophyllite | 9.EG.30 | (K,Na)xMn2+6(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| ⓘ | Britvinite | 9.EG.70 | [Pb7(OH)3F(BO3)2(CO3)][Mg4.5(OH)3(Si5O14)] |
| ⓘ | Roymillerite (TL) | 9.EG.70 | Pb24Mg9(Si10O28)(CO3)10(BO3)(SiO4)(OH)13O5 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Helvine | 9.FB.10 | Be3Mn2+4(SiO4)3S |
| ⓘ | Molybdophyllite | 9.HH.25 | Pb8Mg9[Si10O28(OH)8O2(CO3)3] · H2O |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Clay minerals' | - | |
| ⓘ | 'Unnamed (Mcgovernite-like mineral)' | - | (Mn,Mg,Fe3+)273As3+~12As5+~30Si~42O324(OH)252 |
| ⓘ | 'UM1990-59-SiO:AlBCHMg' | - | Ca24Mg8(BO3)13Al0.75Si3(O,OH)12(CO3)8 · 8H2O |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Alleghanyite | Mn52+(SiO4)2(OH)2 |
| H | ⓘ Ardealite | Ca2(PO3OH)(SO4) · 4H2O |
| H | ⓘ Austinite | CaZn(AsO4)(OH) |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Austinite var. Copper-bearing Austinite | Ca(Zn,Cu)(AsO4)(OH) |
| H | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Brushite | Ca(PO3OH) · 2H2O |
| H | ⓘ Brucite | Mg(OH)2 |
| H | ⓘ Cahnite | Ca2[B(OH)4](AsO4) |
| H | ⓘ Hydroxylapatite var. Carbonate-rich Hydroxylapatite | Ca5(PO4,CO3)3(OH,O) |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| H | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| H | ⓘ Damaraite | Pb3Cl(OH)O2 |
| H | ⓘ Defernite | Ca6(CO3)1.58(Si2O7)0.21(OH)7[Cl0.50(OH)0.08(H2O)0.42] |
| H | ⓘ Descloizite | PbZn(VO4)(OH) |
| H | ⓘ Dioptase | CuSiO3 · H2O |
| H | ⓘ Duftite | PbCu(AsO4)(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Ganophyllite | (K,Na)xMn62+(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Harkerite | Ca48Mg16[AlSi4O15(OH)]4(BO3)16(CO3)16 · 2(H2O,HCl) |
| H | ⓘ Hematophanite | Pb4Fe3O8(OH,Cl) |
| H | ⓘ Hillebrandite | Ca2(SiO3)(OH)2 |
| H | ⓘ Holdawayite | Mn6(CO3)2(OH)7(Cl,OH) |
| H | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| H | ⓘ Jaffeite | Ca6(Si2O7)(OH)6 |
| H | ⓘ Jerrygibbsite | Mn92+(SiO4)4(OH)2 |
| H | ⓘ Johninnesite | Na2Mn92+Mg7(OH)8[AsO4]2[Si6O17]2 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Leucophoenicite | Mn72+(SiO4)3(OH)2 |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Molybdophyllite | Pb8Mg9[Si10O28(OH)8O2(CO3)3] · H2O |
| H | ⓘ Mottramite | PbCu(VO4)(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Nambulite | LiMn42+Si5O14(OH) |
| H | ⓘ Natronambulite | (Na,Li)(Mn,Ca)4Si5O14OH |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| H | ⓘ Pyrobelonite | PbMn2+(VO4)(OH) |
| H | ⓘ Pyrochroite | Mn(OH)2 |
| H | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| H | ⓘ Ribbeite | Mn52+(SiO4)2(OH)2 |
| H | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| H | ⓘ Sakhaite | Ca48Mg16(BO3)32(CO3)16 · 2(H2O,HCl) |
| H | ⓘ Serandite | NaMn22+Si3O8(OH) |
| H | ⓘ Sussexite | Mn2+BO2(OH) |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Wiserite | (Mn2+,Mg)14(B2O5)4(OH)8 · (Si,Mg)(O,OH)4Cl |
| H | ⓘ Unnamed (Mcgovernite-like mineral) | (Mn,Mg,Fe3+)273As3+~12As5+~30Si~42O324(OH)252 |
| H | ⓘ Britvinite | [Pb7(OH)3F(BO3)2(CO3)][Mg4.5(OH)3(Si5O14)] |
| H | ⓘ Rickturnerite | Pb7O4[Mg(OH)4](OH)Cl3 |
| H | ⓘ Vladkrivovichevite | [Pb32O18][Pb4Mn2O]Cl14(BO3)8 · 2H2O |
| H | ⓘ Carlfrancisite | Mn32+(Mn2+,Mg,Fe3+,Al)42[As3+O3]2(As5+O4)4[(Si,As5+)O4]6[(As5+,Si)O4]2(OH)42 |
| H | ⓘ Yangite | PbMnSi3O8 · H2O |
| H | ⓘ Roymillerite | Pb24Mg9(Si10O28)(CO3)10(BO3)(SiO4)(OH)13O5 |
| H | ⓘ UM1990-59-SiO:AlBCHMg | Ca24Mg8(BO3)13Al0.75Si3(O,OH)12(CO3)8 · 8H2O |
| H | ⓘ Milanriederite | (Ca18[REE])Fe3+Al4(Mg4Al4)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 |
| Li | Lithium | |
| Li | ⓘ Nambulite | LiMn42+Si5O14(OH) |
| Li | ⓘ Natronambulite | (Na,Li)(Mn,Ca)4Si5O14OH |
| Be | Beryllium | |
| Be | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| B | Boron | |
| B | ⓘ Cahnite | Ca2[B(OH)4](AsO4) |
| B | ⓘ Harkerite | Ca48Mg16[AlSi4O15(OH)]4(BO3)16(CO3)16 · 2(H2O,HCl) |
| B | ⓘ Sakhaite | Ca48Mg16(BO3)32(CO3)16 · 2(H2O,HCl) |
| B | ⓘ Sussexite | Mn2+BO2(OH) |
| B | ⓘ Wiserite | (Mn2+,Mg)14(B2O5)4(OH)8 · (Si,Mg)(O,OH)4Cl |
| B | ⓘ Britvinite | [Pb7(OH)3F(BO3)2(CO3)][Mg4.5(OH)3(Si5O14)] |
| B | ⓘ Vladkrivovichevite | [Pb32O18][Pb4Mn2O]Cl14(BO3)8 · 2H2O |
| B | ⓘ Roymillerite | Pb24Mg9(Si10O28)(CO3)10(BO3)(SiO4)(OH)13O5 |
| B | ⓘ UM1990-59-SiO:AlBCHMg | Ca24Mg8(BO3)13Al0.75Si3(O,OH)12(CO3)8 · 8H2O |
| C | Carbon | |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Hydroxylapatite var. Carbonate-rich Hydroxylapatite | Ca5(PO4,CO3)3(OH,O) |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Defernite | Ca6(CO3)1.58(Si2O7)0.21(OH)7[Cl0.50(OH)0.08(H2O)0.42] |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Harkerite | Ca48Mg16[AlSi4O15(OH)]4(BO3)16(CO3)16 · 2(H2O,HCl) |
| C | ⓘ Holdawayite | Mn6(CO3)2(OH)7(Cl,OH) |
| C | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| C | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Molybdophyllite | Pb8Mg9[Si10O28(OH)8O2(CO3)3] · H2O |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Sakhaite | Ca48Mg16(BO3)32(CO3)16 · 2(H2O,HCl) |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Vaterite | CaCO3 |
| C | ⓘ Witherite | BaCO3 |
| C | ⓘ Britvinite | [Pb7(OH)3F(BO3)2(CO3)][Mg4.5(OH)3(Si5O14)] |
| C | ⓘ Grootfonteinite | Pb3O(CO3)2 |
| C | ⓘ Roymillerite | Pb24Mg9(Si10O28)(CO3)10(BO3)(SiO4)(OH)13O5 |
| C | ⓘ UM1990-59-SiO:AlBCHMg | Ca24Mg8(BO3)13Al0.75Si3(O,OH)12(CO3)8 · 8H2O |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Aegirine | NaFe3+Si2O6 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Alleghanyite | Mn52+(SiO4)2(OH)2 |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Arcanite | K2SO4 |
| O | ⓘ Ardealite | Ca2(PO3OH)(SO4) · 4H2O |
| O | ⓘ Asisite | Pb7SiO9Cl2 |
| O | ⓘ Austinite | CaZn(AsO4)(OH) |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Austinite var. Copper-bearing Austinite | Ca(Zn,Cu)(AsO4)(OH) |
| O | ⓘ Barysilite | Pb8Mn2+[Si2O7]3 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| O | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Brushite | Ca(PO3OH) · 2H2O |
| O | ⓘ Brucite | Mg(OH)2 |
| O | ⓘ Cahnite | Ca2[B(OH)4](AsO4) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Hydroxylapatite var. Carbonate-rich Hydroxylapatite | Ca5(PO4,CO3)3(OH,O) |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| O | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| O | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| O | ⓘ Crednerite | Cu+Mn3+O2 |
| O | ⓘ Crocoite | PbCr6+O4 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Cuspidine | Ca8(Si2O7)2F4 |
| O | ⓘ Damaraite | Pb3Cl(OH)O2 |
| O | ⓘ Defernite | Ca6(CO3)1.58(Si2O7)0.21(OH)7[Cl0.50(OH)0.08(H2O)0.42] |
| O | ⓘ Descloizite | PbZn(VO4)(OH) |
| O | ⓘ Dioptase | CuSiO3 · H2O |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Duftite | PbCu(AsO4)(OH) |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Galaxite | Mn2+Al2O4 |
| O | ⓘ Ganophyllite | (K,Na)xMn62+(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| O | ⓘ Glaucochroite | CaMn2+(SiO4) |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Harkerite | Ca48Mg16[AlSi4O15(OH)]4(BO3)16(CO3)16 · 2(H2O,HCl) |
| O | ⓘ Hausmannite | Mn2+Mn23+O4 |
| O | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| O | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hematophanite | Pb4Fe3O8(OH,Cl) |
| O | ⓘ Hillebrandite | Ca2(SiO3)(OH)2 |
| O | ⓘ Holdawayite | Mn6(CO3)2(OH)7(Cl,OH) |
| O | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| O | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| O | ⓘ Jacobsite | Mn2+Fe23+O4 |
| O | ⓘ Jaffeite | Ca6(Si2O7)(OH)6 |
| O | ⓘ Jerrygibbsite | Mn92+(SiO4)4(OH)2 |
| O | ⓘ Johninnesite | Na2Mn92+Mg7(OH)8[AsO4]2[Si6O17]2 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kentrolite | Pb2Mn23+(Si2O7)O2 |
| O | ⓘ Kirschsteinite | CaFe2+(SiO4) |
| O | ⓘ Kombatite | Pb14(VO4)2O9Cl4 |
| O | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| O | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Leucophoenicite | Mn72+(SiO4)3(OH)2 |
| O | ⓘ Lorettoite | Pb7O6Cl2 |
| O | ⓘ Manganberzeliite | (NaCa2)Mn22+(AsO4)3 |
| O | ⓘ Manganosite | MnO |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Melanotekite | Pb2Fe23+(Si2O7)O2 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Molybdophyllite | Pb8Mg9[Si10O28(OH)8O2(CO3)3] · H2O |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Mottramite | PbCu(VO4)(OH) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Nambulite | LiMn42+Si5O14(OH) |
| O | ⓘ Natronambulite | (Na,Li)(Mn,Ca)4Si5O14OH |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| O | ⓘ Pyrobelonite | PbMn2+(VO4)(OH) |
| O | ⓘ Pyrochroite | Mn(OH)2 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| O | ⓘ Ribbeite | Mn52+(SiO4)2(OH)2 |
| O | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| O | ⓘ Sahlinite | Pb14(AsO4)2O9Cl4 |
| O | ⓘ Sakhaite | Ca48Mg16(BO3)32(CO3)16 · 2(H2O,HCl) |
| O | ⓘ Serandite | NaMn22+Si3O8(OH) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Sussexite | Mn2+BO2(OH) |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Tephroite | Mn22+(SiO4) |
| O | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| O | ⓘ Vanadinite | Pb5(VO4)3Cl |
| O | ⓘ Vaterite | CaCO3 |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Willemite | Zn2SiO4 |
| O | ⓘ Wiserite | (Mn2+,Mg)14(B2O5)4(OH)8 · (Si,Mg)(O,OH)4Cl |
| O | ⓘ Witherite | BaCO3 |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Unnamed (Mcgovernite-like mineral) | (Mn,Mg,Fe3+)273As3+~12As5+~30Si~42O324(OH)252 |
| O | ⓘ Britvinite | [Pb7(OH)3F(BO3)2(CO3)][Mg4.5(OH)3(Si5O14)] |
| O | ⓘ Rickturnerite | Pb7O4[Mg(OH)4](OH)Cl3 |
| O | ⓘ Vladkrivovichevite | [Pb32O18][Pb4Mn2O]Cl14(BO3)8 · 2H2O |
| O | ⓘ Hereroite | [Pb32(O,◻)21](AsO4)2[(Si,As,V,Mo)O4]2Cl10 |
| O | ⓘ Carlfrancisite | Mn32+(Mn2+,Mg,Fe3+,Al)42[As3+O3]2(As5+O4)4[(Si,As5+)O4]6[(As5+,Si)O4]2(OH)42 |
| O | ⓘ Yangite | PbMnSi3O8 · H2O |
| O | ⓘ Grootfonteinite | Pb3O(CO3)2 |
| O | ⓘ Roymillerite | Pb24Mg9(Si10O28)(CO3)10(BO3)(SiO4)(OH)13O5 |
| O | ⓘ UM1990-59-SiO:AlBCHMg | Ca24Mg8(BO3)13Al0.75Si3(O,OH)12(CO3)8 · 8H2O |
| O | ⓘ Janchevite | Pb9V5+(O10.25◻0.75)Cl2.5 |
| O | ⓘ Milanriederite | (Ca18[REE])Fe3+Al4(Mg4Al4)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 |
| O | ⓘ Erikjonssonite | (Pb32O21)[(V,Si,Mo,As)O4]4Cl9 |
| F | Fluorine | |
| F | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Cuspidine | Ca8(Si2O7)2F4 |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Britvinite | [Pb7(OH)3F(BO3)2(CO3)][Mg4.5(OH)3(Si5O14)] |
| Na | Sodium | |
| Na | ⓘ Aegirine | NaFe3+Si2O6 |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Ganophyllite | (K,Na)xMn62+(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| Na | ⓘ Johninnesite | Na2Mn92+Mg7(OH)8[AsO4]2[Si6O17]2 |
| Na | ⓘ Manganberzeliite | (NaCa2)Mn22+(AsO4)3 |
| Na | ⓘ Natronambulite | (Na,Li)(Mn,Ca)4Si5O14OH |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| Na | ⓘ Serandite | NaMn22+Si3O8(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Brucite | Mg(OH)2 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Harkerite | Ca48Mg16[AlSi4O15(OH)]4(BO3)16(CO3)16 · 2(H2O,HCl) |
| Mg | ⓘ Johninnesite | Na2Mn92+Mg7(OH)8[AsO4]2[Si6O17]2 |
| Mg | ⓘ Molybdophyllite | Pb8Mg9[Si10O28(OH)8O2(CO3)3] · H2O |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Sakhaite | Ca48Mg16(BO3)32(CO3)16 · 2(H2O,HCl) |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Mg | ⓘ Wiserite | (Mn2+,Mg)14(B2O5)4(OH)8 · (Si,Mg)(O,OH)4Cl |
| Mg | ⓘ Unnamed (Mcgovernite-like mineral) | (Mn,Mg,Fe3+)273As3+~12As5+~30Si~42O324(OH)252 |
| Mg | ⓘ Britvinite | [Pb7(OH)3F(BO3)2(CO3)][Mg4.5(OH)3(Si5O14)] |
| Mg | ⓘ Rickturnerite | Pb7O4[Mg(OH)4](OH)Cl3 |
| Mg | ⓘ Carlfrancisite | Mn32+(Mn2+,Mg,Fe3+,Al)42[As3+O3]2(As5+O4)4[(Si,As5+)O4]6[(As5+,Si)O4]2(OH)42 |
| Mg | ⓘ Roymillerite | Pb24Mg9(Si10O28)(CO3)10(BO3)(SiO4)(OH)13O5 |
| Mg | ⓘ UM1990-59-SiO:AlBCHMg | Ca24Mg8(BO3)13Al0.75Si3(O,OH)12(CO3)8 · 8H2O |
| Mg | ⓘ Milanriederite | (Ca18[REE])Fe3+Al4(Mg4Al4)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Galaxite | Mn2+Al2O4 |
| Al | ⓘ Ganophyllite | (K,Na)xMn62+(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| Al | ⓘ Harkerite | Ca48Mg16[AlSi4O15(OH)]4(BO3)16(CO3)16 · 2(H2O,HCl) |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Carlfrancisite | Mn32+(Mn2+,Mg,Fe3+,Al)42[As3+O3]2(As5+O4)4[(Si,As5+)O4]6[(As5+,Si)O4]2(OH)42 |
| Al | ⓘ UM1990-59-SiO:AlBCHMg | Ca24Mg8(BO3)13Al0.75Si3(O,OH)12(CO3)8 · 8H2O |
| Al | ⓘ Milanriederite | (Ca18[REE])Fe3+Al4(Mg4Al4)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Aegirine | NaFe3+Si2O6 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Alleghanyite | Mn52+(SiO4)2(OH)2 |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Asisite | Pb7SiO9Cl2 |
| Si | ⓘ Barysilite | Pb8Mn2+[Si2O7]3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Cuspidine | Ca8(Si2O7)2F4 |
| Si | ⓘ Defernite | Ca6(CO3)1.58(Si2O7)0.21(OH)7[Cl0.50(OH)0.08(H2O)0.42] |
| Si | ⓘ Dioptase | CuSiO3 · H2O |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Ganophyllite | (K,Na)xMn62+(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| Si | ⓘ Glaucochroite | CaMn2+(SiO4) |
| Si | ⓘ Harkerite | Ca48Mg16[AlSi4O15(OH)]4(BO3)16(CO3)16 · 2(H2O,HCl) |
| Si | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Si | ⓘ Hillebrandite | Ca2(SiO3)(OH)2 |
| Si | ⓘ Jaffeite | Ca6(Si2O7)(OH)6 |
| Si | ⓘ Jerrygibbsite | Mn92+(SiO4)4(OH)2 |
| Si | ⓘ Johninnesite | Na2Mn92+Mg7(OH)8[AsO4]2[Si6O17]2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Kentrolite | Pb2Mn23+(Si2O7)O2 |
| Si | ⓘ Kirschsteinite | CaFe2+(SiO4) |
| Si | ⓘ Leucophoenicite | Mn72+(SiO4)3(OH)2 |
| Si | ⓘ Melanotekite | Pb2Fe23+(Si2O7)O2 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Molybdophyllite | Pb8Mg9[Si10O28(OH)8O2(CO3)3] · H2O |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Nambulite | LiMn42+Si5O14(OH) |
| Si | ⓘ Natronambulite | (Na,Li)(Mn,Ca)4Si5O14OH |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| Si | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Si | ⓘ Ribbeite | Mn52+(SiO4)2(OH)2 |
| Si | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| Si | ⓘ Serandite | NaMn22+Si3O8(OH) |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Tephroite | Mn22+(SiO4) |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Willemite | Zn2SiO4 |
| Si | ⓘ Wiserite | (Mn2+,Mg)14(B2O5)4(OH)8 · (Si,Mg)(O,OH)4Cl |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Unnamed (Mcgovernite-like mineral) | (Mn,Mg,Fe3+)273As3+~12As5+~30Si~42O324(OH)252 |
| Si | ⓘ Britvinite | [Pb7(OH)3F(BO3)2(CO3)][Mg4.5(OH)3(Si5O14)] |
| Si | ⓘ Hereroite | [Pb32(O,◻)21](AsO4)2[(Si,As,V,Mo)O4]2Cl10 |
| Si | ⓘ Carlfrancisite | Mn32+(Mn2+,Mg,Fe3+,Al)42[As3+O3]2(As5+O4)4[(Si,As5+)O4]6[(As5+,Si)O4]2(OH)42 |
| Si | ⓘ Yangite | PbMnSi3O8 · H2O |
| Si | ⓘ Roymillerite | Pb24Mg9(Si10O28)(CO3)10(BO3)(SiO4)(OH)13O5 |
| Si | ⓘ UM1990-59-SiO:AlBCHMg | Ca24Mg8(BO3)13Al0.75Si3(O,OH)12(CO3)8 · 8H2O |
| Si | ⓘ Milanriederite | (Ca18[REE])Fe3+Al4(Mg4Al4)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 |
| Si | ⓘ Erikjonssonite | (Pb32O21)[(V,Si,Mo,As)O4]4Cl9 |
| P | Phosphorus | |
| P | ⓘ Ardealite | Ca2(PO3OH)(SO4) · 4H2O |
| P | ⓘ Brushite | Ca(PO3OH) · 2H2O |
| P | ⓘ Hydroxylapatite var. Carbonate-rich Hydroxylapatite | Ca5(PO4,CO3)3(OH,O) |
| P | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| P | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| S | Sulfur | |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Arcanite | K2SO4 |
| S | ⓘ Ardealite | Ca2(PO3OH)(SO4) · 4H2O |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Betekhtinite | Pb2(Cu,Fe)22-24S15 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Colusite | Cu13VAs3S16 |
| S | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Enargite | Cu3AsS4 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| S | ⓘ Jordanite | Pb14As6S23 |
| S | ⓘ Lautite | CuAsS |
| S | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Renierite | (Cu+,Zn)11Fe4(Ge4+,As5+)2S16 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| Cl | Chlorine | |
| Cl | ⓘ Asisite | Pb7SiO9Cl2 |
| Cl | ⓘ Damaraite | Pb3Cl(OH)O2 |
| Cl | ⓘ Defernite | Ca6(CO3)1.58(Si2O7)0.21(OH)7[Cl0.50(OH)0.08(H2O)0.42] |
| Cl | ⓘ Harkerite | Ca48Mg16[AlSi4O15(OH)]4(BO3)16(CO3)16 · 2(H2O,HCl) |
| Cl | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| Cl | ⓘ Hematophanite | Pb4Fe3O8(OH,Cl) |
| Cl | ⓘ Holdawayite | Mn6(CO3)2(OH)7(Cl,OH) |
| Cl | ⓘ Kombatite | Pb14(VO4)2O9Cl4 |
| Cl | ⓘ Lorettoite | Pb7O6Cl2 |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Sahlinite | Pb14(AsO4)2O9Cl4 |
| Cl | ⓘ Sakhaite | Ca48Mg16(BO3)32(CO3)16 · 2(H2O,HCl) |
| Cl | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cl | ⓘ Wiserite | (Mn2+,Mg)14(B2O5)4(OH)8 · (Si,Mg)(O,OH)4Cl |
| Cl | ⓘ Rickturnerite | Pb7O4[Mg(OH)4](OH)Cl3 |
| Cl | ⓘ Vladkrivovichevite | [Pb32O18][Pb4Mn2O]Cl14(BO3)8 · 2H2O |
| Cl | ⓘ Hereroite | [Pb32(O,◻)21](AsO4)2[(Si,As,V,Mo)O4]2Cl10 |
| Cl | ⓘ Janchevite | Pb9V5+(O10.25◻0.75)Cl2.5 |
| Cl | ⓘ Erikjonssonite | (Pb32O21)[(V,Si,Mo,As)O4]4Cl9 |
| K | Potassium | |
| K | ⓘ Arcanite | K2SO4 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Ganophyllite | (K,Na)xMn62+(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Ardealite | Ca2(PO3OH)(SO4) · 4H2O |
| Ca | ⓘ Austinite | CaZn(AsO4)(OH) |
| Ca | ⓘ Austinite var. Copper-bearing Austinite | Ca(Zn,Cu)(AsO4)(OH) |
| Ca | ⓘ Brushite | Ca(PO3OH) · 2H2O |
| Ca | ⓘ Cahnite | Ca2[B(OH)4](AsO4) |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Hydroxylapatite var. Carbonate-rich Hydroxylapatite | Ca5(PO4,CO3)3(OH,O) |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Ca | ⓘ Cuspidine | Ca8(Si2O7)2F4 |
| Ca | ⓘ Defernite | Ca6(CO3)1.58(Si2O7)0.21(OH)7[Cl0.50(OH)0.08(H2O)0.42] |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Glaucochroite | CaMn2+(SiO4) |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Harkerite | Ca48Mg16[AlSi4O15(OH)]4(BO3)16(CO3)16 · 2(H2O,HCl) |
| Ca | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| Ca | ⓘ Hillebrandite | Ca2(SiO3)(OH)2 |
| Ca | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| Ca | ⓘ Jaffeite | Ca6(Si2O7)(OH)6 |
| Ca | ⓘ Kirschsteinite | CaFe2+(SiO4) |
| Ca | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| Ca | ⓘ Manganberzeliite | (NaCa2)Mn22+(AsO4)3 |
| Ca | ⓘ Natronambulite | (Na,Li)(Mn,Ca)4Si5O14OH |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Ca | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Sakhaite | Ca48Mg16(BO3)32(CO3)16 · 2(H2O,HCl) |
| Ca | ⓘ Vaterite | CaCO3 |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ UM1990-59-SiO:AlBCHMg | Ca24Mg8(BO3)13Al0.75Si3(O,OH)12(CO3)8 · 8H2O |
| Ca | ⓘ Milanriederite | (Ca18[REE])Fe3+Al4(Mg4Al4)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| V | Vanadium | |
| V | ⓘ Colusite | Cu13VAs3S16 |
| V | ⓘ Descloizite | PbZn(VO4)(OH) |
| V | ⓘ Kombatite | Pb14(VO4)2O9Cl4 |
| V | ⓘ Mottramite | PbCu(VO4)(OH) |
| V | ⓘ Pyrobelonite | PbMn2+(VO4)(OH) |
| V | ⓘ Vanadinite | Pb5(VO4)3Cl |
| V | ⓘ Hereroite | [Pb32(O,◻)21](AsO4)2[(Si,As,V,Mo)O4]2Cl10 |
| V | ⓘ Janchevite | Pb9V5+(O10.25◻0.75)Cl2.5 |
| V | ⓘ Erikjonssonite | (Pb32O21)[(V,Si,Mo,As)O4]4Cl9 |
| Cr | Chromium | |
| Cr | ⓘ Crocoite | PbCr6+O4 |
| Mn | Manganese | |
| Mn | ⓘ Alleghanyite | Mn52+(SiO4)2(OH)2 |
| Mn | ⓘ Barysilite | Pb8Mn2+[Si2O7]3 |
| Mn | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Mn | ⓘ Crednerite | Cu+Mn3+O2 |
| Mn | ⓘ Galaxite | Mn2+Al2O4 |
| Mn | ⓘ Ganophyllite | (K,Na)xMn62+(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| Mn | ⓘ Glaucochroite | CaMn2+(SiO4) |
| Mn | ⓘ Hausmannite | Mn2+Mn23+O4 |
| Mn | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Mn | ⓘ Holdawayite | Mn6(CO3)2(OH)7(Cl,OH) |
| Mn | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| Mn | ⓘ Jacobsite | Mn2+Fe23+O4 |
| Mn | ⓘ Jerrygibbsite | Mn92+(SiO4)4(OH)2 |
| Mn | ⓘ Johninnesite | Na2Mn92+Mg7(OH)8[AsO4]2[Si6O17]2 |
| Mn | ⓘ Kentrolite | Pb2Mn23+(Si2O7)O2 |
| Mn | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| Mn | ⓘ Leucophoenicite | Mn72+(SiO4)3(OH)2 |
| Mn | ⓘ Manganberzeliite | (NaCa2)Mn22+(AsO4)3 |
| Mn | ⓘ Manganosite | MnO |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Nambulite | LiMn42+Si5O14(OH) |
| Mn | ⓘ Natronambulite | (Na,Li)(Mn,Ca)4Si5O14OH |
| Mn | ⓘ Pyrobelonite | PbMn2+(VO4)(OH) |
| Mn | ⓘ Pyrochroite | Mn(OH)2 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Mn | ⓘ Ribbeite | Mn52+(SiO4)2(OH)2 |
| Mn | ⓘ Serandite | NaMn22+Si3O8(OH) |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Sussexite | Mn2+BO2(OH) |
| Mn | ⓘ Tephroite | Mn22+(SiO4) |
| Mn | ⓘ Wiserite | (Mn2+,Mg)14(B2O5)4(OH)8 · (Si,Mg)(O,OH)4Cl |
| Mn | ⓘ Unnamed (Mcgovernite-like mineral) | (Mn,Mg,Fe3+)273As3+~12As5+~30Si~42O324(OH)252 |
| Mn | ⓘ Vladkrivovichevite | [Pb32O18][Pb4Mn2O]Cl14(BO3)8 · 2H2O |
| Mn | ⓘ Carlfrancisite | Mn32+(Mn2+,Mg,Fe3+,Al)42[As3+O3]2(As5+O4)4[(Si,As5+)O4]6[(As5+,Si)O4]2(OH)42 |
| Mn | ⓘ Yangite | PbMnSi3O8 · H2O |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Aegirine | NaFe3+Si2O6 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Betekhtinite | Pb2(Cu,Fe)22-24S15 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hematophanite | Pb4Fe3O8(OH,Cl) |
| Fe | ⓘ Jacobsite | Mn2+Fe23+O4 |
| Fe | ⓘ Kirschsteinite | CaFe2+(SiO4) |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Melanotekite | Pb2Fe23+(Si2O7)O2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Renierite | (Cu+,Zn)11Fe4(Ge4+,As5+)2S16 |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Unnamed (Mcgovernite-like mineral) | (Mn,Mg,Fe3+)273As3+~12As5+~30Si~42O324(OH)252 |
| Fe | ⓘ Carlfrancisite | Mn32+(Mn2+,Mg,Fe3+,Al)42[As3+O3]2(As5+O4)4[(Si,As5+)O4]6[(As5+,Si)O4]2(OH)42 |
| Fe | ⓘ Milanriederite | (Ca18[REE])Fe3+Al4(Mg4Al4)(◻4)◻[Si2O7]4[(SiO4)10](OH)(OH)9 |
| Cu | Copper | |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Austinite var. Copper-bearing Austinite | Ca(Zn,Cu)(AsO4)(OH) |
| Cu | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| Cu | ⓘ Betekhtinite | Pb2(Cu,Fe)22-24S15 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Colusite | Cu13VAs3S16 |
| Cu | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Crednerite | Cu+Mn3+O2 |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Dioptase | CuSiO3 · H2O |
| Cu | ⓘ Duftite | PbCu(AsO4)(OH) |
| Cu | ⓘ Enargite | Cu3AsS4 |
| Cu | ⓘ Lautite | CuAsS |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Mottramite | PbCu(VO4)(OH) |
| Cu | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| Cu | ⓘ Renierite | (Cu+,Zn)11Fe4(Ge4+,As5+)2S16 |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| Zn | Zinc | |
| Zn | ⓘ Austinite | CaZn(AsO4)(OH) |
| Zn | ⓘ Austinite var. Copper-bearing Austinite | Ca(Zn,Cu)(AsO4)(OH) |
| Zn | ⓘ Descloizite | PbZn(VO4)(OH) |
| Zn | ⓘ Renierite | (Cu+,Zn)11Fe4(Ge4+,As5+)2S16 |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Willemite | Zn2SiO4 |
| Ge | Germanium | |
| Ge | ⓘ Renierite | (Cu+,Zn)11Fe4(Ge4+,As5+)2S16 |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Austinite | CaZn(AsO4)(OH) |
| As | ⓘ Austinite var. Copper-bearing Austinite | Ca(Zn,Cu)(AsO4)(OH) |
| As | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| As | ⓘ Cahnite | Ca2[B(OH)4](AsO4) |
| As | ⓘ Colusite | Cu13VAs3S16 |
| As | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| As | ⓘ Duftite | PbCu(AsO4)(OH) |
| As | ⓘ Enargite | Cu3AsS4 |
| As | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| As | ⓘ Johninnesite | Na2Mn92+Mg7(OH)8[AsO4]2[Si6O17]2 |
| As | ⓘ Jordanite | Pb14As6S23 |
| As | ⓘ Lautite | CuAsS |
| As | ⓘ Manganberzeliite | (NaCa2)Mn22+(AsO4)3 |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Renierite | (Cu+,Zn)11Fe4(Ge4+,As5+)2S16 |
| As | ⓘ Sahlinite | Pb14(AsO4)2O9Cl4 |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Unnamed (Mcgovernite-like mineral) | (Mn,Mg,Fe3+)273As3+~12As5+~30Si~42O324(OH)252 |
| As | ⓘ Hereroite | [Pb32(O,◻)21](AsO4)2[(Si,As,V,Mo)O4]2Cl10 |
| As | ⓘ Carlfrancisite | Mn32+(Mn2+,Mg,Fe3+,Al)42[As3+O3]2(As5+O4)4[(Si,As5+)O4]6[(As5+,Si)O4]2(OH)42 |
| As | ⓘ Erikjonssonite | (Pb32O21)[(V,Si,Mo,As)O4]4Cl9 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Mo | ⓘ Hereroite | [Pb32(O,◻)21](AsO4)2[(Si,As,V,Mo)O4]2Cl10 |
| Mo | ⓘ Erikjonssonite | (Pb32O21)[(V,Si,Mo,As)O4]4Cl9 |
| Ag | Silver | |
| Ag | ⓘ Native Silver | Ag |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sb | Antimony | |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| Ba | ⓘ Witherite | BaCO3 |
| Ce | Cerium | |
| Ce | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Asisite | Pb7SiO9Cl2 |
| Pb | ⓘ Barysilite | Pb8Mn2+[Si2O7]3 |
| Pb | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| Pb | ⓘ Betekhtinite | Pb2(Cu,Fe)22-24S15 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| Pb | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Pb | ⓘ Crocoite | PbCr6+O4 |
| Pb | ⓘ Damaraite | Pb3Cl(OH)O2 |
| Pb | ⓘ Descloizite | PbZn(VO4)(OH) |
| Pb | ⓘ Duftite | PbCu(AsO4)(OH) |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| Pb | ⓘ Hematophanite | Pb4Fe3O8(OH,Cl) |
| Pb | ⓘ Jordanite | Pb14As6S23 |
| Pb | ⓘ Kentrolite | Pb2Mn23+(Si2O7)O2 |
| Pb | ⓘ Kombatite | Pb14(VO4)2O9Cl4 |
| Pb | ⓘ Native Lead | Pb |
| Pb | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Lorettoite | Pb7O6Cl2 |
| Pb | ⓘ Melanotekite | Pb2Fe23+(Si2O7)O2 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Molybdophyllite | Pb8Mg9[Si10O28(OH)8O2(CO3)3] · H2O |
| Pb | ⓘ Mottramite | PbCu(VO4)(OH) |
| Pb | ⓘ Pyrobelonite | PbMn2+(VO4)(OH) |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Sahlinite | Pb14(AsO4)2O9Cl4 |
| Pb | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| Pb | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Britvinite | [Pb7(OH)3F(BO3)2(CO3)][Mg4.5(OH)3(Si5O14)] |
| Pb | ⓘ Rickturnerite | Pb7O4[Mg(OH)4](OH)Cl3 |
| Pb | ⓘ Vladkrivovichevite | [Pb32O18][Pb4Mn2O]Cl14(BO3)8 · 2H2O |
| Pb | ⓘ Hereroite | [Pb32(O,◻)21](AsO4)2[(Si,As,V,Mo)O4]2Cl10 |
| Pb | ⓘ Yangite | PbMnSi3O8 · H2O |
| Pb | ⓘ Grootfonteinite | Pb3O(CO3)2 |
| Pb | ⓘ Roymillerite | Pb24Mg9(Si10O28)(CO3)10(BO3)(SiO4)(OH)13O5 |
| Pb | ⓘ Janchevite | Pb9V5+(O10.25◻0.75)Cl2.5 |
| Pb | ⓘ Erikjonssonite | (Pb32O21)[(V,Si,Mo,As)O4]4Cl9 |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Otavi_Constituency |
|---|---|
| Wikidata ID: | Q3711701 |
| GeoNames ID: | 11428998 |
Localities in this Region
- Otjozondjupa Region
- Otjozondjupa Region
- Otavi Constituency
- Kombat
- Kombat Mine
- Asis West sector
- 11 level
- Asis West sector
- Kombat Mine
- Kupferberg Mine
- Lucas Post
- Otavi prospect
- Otjikoto Mine
- ⭔Platveld area
- Rietfontein Farm 344
- Rohrers
- Uisib Farm
- Uitsabpad
- Kombat
- Otavi Constituency
Other Regions, Features and Areas that Intersect
AfricaContinent
African PlateTectonic Plate
- Congo Craton
- Angolan ShieldShield
- Damara Orogenic BeltOrogenic Belt
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Chetty, D., Frimmel, H. E. (2000) The role of evaporites in the genesis of base metal sulphide mineralisation in the Northern Platform of the Pan-African Damara Belt, Namibia: geochemical and fluid inclusion evidence from carbonate wall rock alteration. Mineralium Deposita, 35 (4) 364-376 doi:10.1007/s001260050247
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Kombat Mine, Kombat, Otavi Constituency, Otjozondjupa Region, Namibia