State Line Chromite Mining District, USAi
| Regional Level Types | |
|---|---|
| State Line Chromite Mining District | Mining District |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
39° North , 76° West (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~11km
Type:
Köppen climate type:
This district include portions of both Lancaster and Chester Counties, Pennsylvania, and Cecil County, Maryland.
Smith and Barnes (2011) found only the following sulfides and arsenides for the Lancaster County portion of the State Line District: orcelite, polydymite, godlevskite, shandite, maucherite, nickeline, heazlewoodite, millerite, and digenite. Likewise, they found only the following PGE elements for the Lancaster County portion of the district: iridium, laurite, and sudburyite. R. C. Smith, II 3/5/2012.
Smith and Barnes (2011) found only the following sulfides and arsenides for the Lancaster County portion of the State Line District: orcelite, polydymite, godlevskite, shandite, maucherite, nickeline, heazlewoodite, millerite, and digenite. Likewise, they found only the following PGE elements for the Lancaster County portion of the district: iridium, laurite, and sudburyite. R. C. Smith, II 3/5/2012.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities91 valid minerals. 1 (TL) - type locality of valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reported from at least 11 localities in this region. |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5(T8O22)W2 |
| ⓘ Anatase Formula: TiO2 |
| ⓘ Anthophyllite Formula: ◻Mg2Mg5(Si8O22)(OH)2 |
| ⓘ Antigorite Formula: Mg3(Si2O5)(OH)4 Localities: Reported from at least 8 localities in this region. Habit: thin lamellar, laminae easily separable into translucent folia Colour: leek green to violet in "chromium" variety Description: Antigorite occurs both with typical leek green coloration and the violet coloration of so named "Chromium" Antigorite. Specimens of Chromium Antigorite were often reffered to as Kammererite, or Chromium Clinoclore, but this is inaccurate. (see www.pennminerals.com/museum.htm for a good image of an actual, and very rare, Kammererite from Woods Chrome). Specimens of Chromium Antigorite from this occurance even fall somewhat short of a true Antigorite identity, but is closest to this family member of the Sepentine group. |
| ⓘ Antigorite var. Chrome antigorite Formula: Mg3(Si2O5)(OH)4 References: |
| ⓘ Antigorite var. Williamsite Formula: Mg3(Si2O5)(OH)4 Localities: Line pit (Lowe's Chromite Mine), Fulton Township, Lancaster County, Pennsylvania, USA Wood's Chrome Mine, Texas, Little Britain Township, Lancaster County, Pennsylvania, USA Cedar Hill Quarry (Stoltzfuss Quarry), Fulton Township, Lancaster County, Pennsylvania, USA Jenkins Mine (Jenkins Corner; North Rock Springs), Fulton Township, Lancaster County, Pennsylvania, USA Habit: Micro-fiberous Colour: Emerald to apple green Description: A beautiful Apple Green variety, Williamsite, first described at Woods Chrome in 1849 by Lewis W. Williams, whom also first described Zaratite (Emerald Nickel) the same year. Williamsite is a semi-precious variety of Sepentine, usually in association with chromite. Although originally discovered at Wood's Chrome Mine, the occurance at Line Pit is renowned for occurances which are deemed to be of the finest quality. |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Arsenopalladinite Formula: Pd8(As,Sb)3 References: |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ Awaruite Formula: Ni3Fe |
| ⓘ Beidellite Formula: (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ Formula: Be3Al2(Si6O18) Locality: Wiant's Quarry (Weiant Quarry), Pilot, Cecil County, Maryland, USA - erroneously reported Description: Originally reported as beryl, Samuel G. Gordon (1920's) suggested that the supposed beryls were probably apatite. This was later proven by Earl V. Shannon who analysed some of these specimens which Gordon had sent him. |
| ⓘ 'Bloodstone' Formula: SiO2 |
| ⓘ Bornite Formula: Cu5FeS4 References: |
| ⓘ Braggite Formula: PdPt3S4 References: |
| ⓘ Brucite Formula: Mg(OH)2 Localities: Reported from at least 6 localities in this region. Habit: tabular plates with pseudo-hexagonal edging. usually foliaed masses Colour: white to pale green, pearly to waxy luster, transparent in thin sections/plates Fluorescence: bright blue-white response Description: Worlds finest locality for the Brucite, hosting the largest crystal ever found (to 0.2m). Crystals from here are rich and well developed, in numerous modifications including large tabular crystals and occasional groups in rosettes. coloration from this locale tends towards pale green coloration in the richest specimens. |
| ⓘ Cacoxenite Formula: Fe3+24AlO6(PO4)17(OH)12 · 75H2O |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ 'Chlorite Group' |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 Localities: Reported from at least 20 localities in this region. |
| ⓘ 'Chromite-Magnesiochromite Series' Localities: Cedar Hill Quarry (Stoltzfuss Quarry), Fulton Township, Lancaster County, Pennsylvania, USA Haines & Kibblehouse Penn-Maryland Materials Quarry, Fulton Township, Lancaster County, Pennsylvania, USA Wood's Chrome Mine, Texas, Little Britain Township, Lancaster County, Pennsylvania, USA ? (more information) |
| ⓘ 'Chrysolite' |
| ⓘ Chrysotile Formula: Mg3(Si2O5)(OH)4 Localities: Reported from at least 7 localities in this region. |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 Localities: Reported from at least 8 localities in this region. |
| ⓘ Clinochlore var. Chromium-bearing Clinochlore Formula: Mg5(Al,Cr)2Si3O10(OH)8 Localities: Reported from at least 8 localities in this region. |
| ⓘ Coalingite Formula: Mg10Fe3+2(OH)24[CO3] · 2H2O Locality: Cedar Hill Quarry (Stoltzfuss Quarry), Fulton Township, Lancaster County, Pennsylvania, USA References: |
| ⓘ Desautelsite (TL) Formula: Mg6Mn3+2(OH)16[CO3] · 4H2O Type Locality: |
| ⓘ 'Deweylite' Localities: Reported from at least 6 localities in this region. |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: Wood's Chrome Mine, Texas, Little Britain Township, Lancaster County, Pennsylvania, USA Cedar Hill Quarry (Stoltzfuss Quarry), Fulton Township, Lancaster County, Pennsylvania, USA Wiant's Quarry (Weiant Quarry), Pilot, Cecil County, Maryland, USA Haines & Kibblehouse Penn-Maryland Materials Quarry, Fulton Township, Lancaster County, Pennsylvania, USA |
| ⓘ Dozyite Formula: Mg7Al2(Al2Si4O15)(OH)12 |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Dravite var. Chromium-bearing Dravite Formula: Na((Mg,Cr)3)(Al,Cr)6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Enstatite Formula: Mg2Si2O6 References: |
| ⓘ Erlichmanite Formula: OsS2 References: |
| ⓘ 'Fayalite-Forsterite Series' |
| ⓘ Ferronickelplatinum Formula: Pt2FeNi References: |
| ⓘ Forsterite Formula: Mg2(SiO4) Localities: Wood's Chrome Mine, Texas, Little Britain Township, Lancaster County, Pennsylvania, USA Line pit (Lowe's Mine), Cecil County, Maryland, USA Cedar Hill Quarry (Stoltzfuss Quarry), Fulton Township, Lancaster County, Pennsylvania, USA Line pit (Lowe's Chromite Mine), Fulton Township, Lancaster County, Pennsylvania, USA |
| ⓘ Galena Formula: PbS |
| ⓘ 'Garnierite' |
| ⓘ Gaspéite Formula: NiCO3 |
| ⓘ 'Genthite' |
| ⓘ Godlevskite Formula: (Ni,Fe)9S8 |
| ⓘ Heazlewoodite Formula: Ni3S2 |
| ⓘ Hematite Formula: Fe2O3 References: |
| ⓘ Hollingworthite Formula: (Rh,Pt,Pd)AsS |
| ⓘ Huntite Formula: CaMg3(CO3)4 Locality: Cedar Hill Quarry (Stoltzfuss Quarry), Fulton Township, Lancaster County, Pennsylvania, USA Habit: masses with subconchoidal fracture Colour: dull nearly opaque, egg shell white Fluorescence: non fluorescent Description: Huntite is soluable in water and has formed above the water table in reaction of serpentine and carbonic acids. The perceived rarity at the site is likely due to weathering, misidentification with magnesite and collectors in the past "cleaning" specimens found, prior to examination. fresh exposure collecting reveals Huntite occuring in plentiful amounts at Cedar Hill. References: |
| ⓘ Hydromagnesite Formula: Mg5(CO3)4(OH)2 · 4H2O Localities: Reported from at least 6 localities in this region. |
| ⓘ Ilmenite Formula: Fe2+TiO3 References: |
| ⓘ Irarsite Formula: (Ir,Ru,Rh,Pt)AsS |
| ⓘ Kotulskite Formula: Pd(Te,Bi)2-x (x ≈ 0.4) |
| ⓘ 'Lancasterite' |
| ⓘ Laurite Formula: RuS2 |
| ⓘ 'Limonite' |
| ⓘ Lizardite Formula: Mg3(Si2O5)(OH)4 |
| ⓘ Magnesiochromite Formula: MgCr2O4 Localities: Description: Analysis of multiple samples of chrome-ore from Woods Mine are all well within the magnesiochromite composition space. See Pearre and Heyl. (Pearre, Nancy C., and Allen Van Heyl. Chromite and other mineral deposits in serpentine rocks of the Piedmont Upland, Maryland, Pennsylvania and Delaware. No. 1082. US Government Printing Office, 1960.) |
| ⓘ 'Magnesioferrite-Magnetite Series' References: |
| ⓘ Magnesite Formula: MgCO3 Localities: Reported from at least 11 localities in this region. |
| ⓘ Magnesite var. Iron-bearing Magnesite Formula: (Mg,Fe)CO3 References: |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 8 localities in this region. |
| ⓘ Majakite Formula: PdNiAs |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Malanite Formula: Cu+(Ir3+Pt4+)S4 |
| ⓘ Margarite Formula: CaAl2(Al2Si2O10)(OH)2 |
| ⓘ Maucherite Formula: Ni11As8 Localities: Wood's Chrome Mine, Texas, Little Britain Township, Lancaster County, Pennsylvania, USA Line pit (Lowe's Mine), Cecil County, Maryland, USA Line pit (Lowe's Chromite Mine), Fulton Township, Lancaster County, Pennsylvania, USA West Nottingham Township, Chester County, Pennsylvania, USA Cedar Hill Quarry (Stoltzfuss Quarry), Fulton Township, Lancaster County, Pennsylvania, USA ? (more information) |
| ⓘ Mcguinnessite Formula: (Mg,Cu)2(CO3)(OH)2 |
| ⓘ Melonite Formula: NiTe2 |
| ⓘ Menshikovite Formula: Pd3Ni2As3 |
| ⓘ Millerite Formula: NiS |
| ⓘ Nakauriite Formula: Cu8(SO4)4(CO3)(OH)6 · 48H2O Localities: Habit: compact fiberous Colour: Sky blueto pale blue Fluorescence: none |
| ⓘ Naldrettite Formula: Pd2Sb |
| ⓘ Native Iridium Formula: (Ir,Os,Ru) |
| ⓘ Native Iron Formula: Fe |
| ⓘ Native Palladium ? Formula: (Pd,Pt) |
| ⓘ Native Platinum Formula: Pt |
| ⓘ Nickeline Formula: NiAs |
| ⓘ Omeiite Formula: OsAs2 |
| ⓘ Opal Formula: SiO2 · nH2O |
| ⓘ Palladoarsenide Formula: Pd2As |
| ⓘ 'Pimelite' Formula: Ni3Si4O10(OH)2 · 4H2O |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ Pokrovskite Formula: Mg2(CO3)(OH)2 Locality: Cedar Hill Quarry (Stoltzfuss Quarry), Fulton Township, Lancaster County, Pennsylvania, USA References: |
| ⓘ Polydymite Formula: Ni2+Ni3+2S4 |
| ⓘ Pyrite Formula: FeS2 Localities: Wood's Chrome Mine, Texas, Little Britain Township, Lancaster County, Pennsylvania, USA Line pit (Lowe's Mine), Cecil County, Maryland, USA Cedar Hill Quarry (Stoltzfuss Quarry), Fulton Township, Lancaster County, Pennsylvania, USA Wiant's Quarry (Weiant Quarry), Pilot, Cecil County, Maryland, USA Line pit (Lowe's Chromite Mine), Fulton Township, Lancaster County, Pennsylvania, USA |
| ⓘ Pyroaurite Formula: Mg6Fe3+2(OH)16[CO3] · 4H2O Localities: Wood's Chrome Mine, Texas, Little Britain Township, Lancaster County, Pennsylvania, USA Line pit (Lowe's Mine), Cecil County, Maryland, USA Cedar Hill Quarry (Stoltzfuss Quarry), Fulton Township, Lancaster County, Pennsylvania, USA Line pit (Lowe's Chromite Mine), Fulton Township, Lancaster County, Pennsylvania, USA |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 13 localities in this region. |
| ⓘ Quartz var. Carnelian Formula: SiO2 |
| ⓘ Quartz var. Chalcedony Formula: SiO2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Quartz var. Moss Agate Formula: SiO2 |
| ⓘ Quartz var. Prase Formula: SiO2 |
| ⓘ Ruarsite Formula: (Ru,Os)AsS |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Sepiolite Formula: Mg4(Si6O15)(OH)2 · 6H2O |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 Localities: Reported from at least 16 localities in this region. Colour: various colors due to impurities. Often light green to emerald green (Williamsite variety) Description: A beautiful Apple Green variety, Williamsite, first described at Woods Chrome in 1849 by Lewis W. Williams, whom also first described Zaratite (Emerald Nickel) the same year. Williamsite is a semi-precious variety of Sepentine, usually in association with chromite. Although originally discovered at Wood's Chrome Mine, the occurance at Line Pit is renowned for occurances which are deemed to be of the finest quality. |
| ⓘ 'Serpentine Subgroup var. Marmolite' Formula: D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| ⓘ 'Serpentine Subgroup var. Picrolite' Formula: D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| ⓘ Shandite Formula: Ni3Pb2S2 |
| ⓘ Sobolevskite Formula: PdBi |
| ⓘ Sperrylite Formula: PtAs2 |
| ⓘ Stevensite Formula: (Ca,Na)xMg3-x(Si4O10)(OH)2 Locality: Cedar Hill Quarry (Stoltzfuss Quarry), Fulton Township, Lancaster County, Pennsylvania, USA References: |
| ⓘ Stibiopalladinite Formula: Pd5Sb2 |
| ⓘ Sudburyite Formula: PdSb |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 Localities: Reported from at least 12 localities in this region. |
| ⓘ Tellurobismuthite Formula: Bi2Te3 |
| ⓘ Telluropalladinite Formula: Pd9Te4 |
| ⓘ Tetraferroplatinum Formula: PtFe |
| ⓘ Tulameenite Formula: Pt2CuFe |
| ⓘ 'UM1965-08-OH:FeMgNi' Formula: Fe-Mg-Ni-O-H |
| ⓘ Ungavaite Formula: Pd4Sb3 |
| ⓘ Uvarovite Formula: Ca3Cr3+2(SiO4)3 |
| ⓘ Vavřínite ? Formula: Ni2SbTe2 |
| ⓘ Vermiculite Formula: Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ Vincentite Formula: Pd3As |
| ⓘ Vysotskite Formula: PdS |
| ⓘ 'Wad' |
| ⓘ Wüstite Formula: FeO |
| ⓘ Zaratite Formula: Ni3(CO3)(OH)4 · 4H2O ? Localities: Reported from at least 6 localities in this region. |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Iron | 1.AE.05 | Fe |
| ⓘ | Awaruite | 1.AE.20 | Ni3Fe |
| ⓘ | Native Iridium | 1.AF.10 | (Ir,Os,Ru) |
| ⓘ | Native Palladium ? | 1.AF.10 | (Pd,Pt) |
| ⓘ | Native Platinum | 1.AF.10 | Pt |
| ⓘ | Ferronickelplatinum | 1.AG.40 | Pt2FeNi |
| ⓘ | Tetraferroplatinum | 1.AG.40 | PtFe |
| ⓘ | Tulameenite | 1.AG.40 | Pt2CuFe |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Maucherite | 2.AB.15 | Ni11As8 |
| ⓘ | Vincentite | 2.AC.05b | Pd3As |
| ⓘ | Arsenopalladinite | 2.AC.10c | Pd8(As,Sb)3 |
| ⓘ | Stibiopalladinite | 2.AC.20a | Pd5Sb2 |
| ⓘ | Menshikovite | 2.AC.20c | Pd3Ni2As3 |
| ⓘ | Palladoarsenide | 2.AC.25a | Pd2As |
| ⓘ | Naldrettite | 2.AC.25d | Pd2Sb |
| ⓘ | Majakite | 2.AC.25e | PdNiAs |
| ⓘ | Ungavaite | 2.AC.35b | Pd4Sb3 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Heazlewoodite | 2.BB.05 | Ni3S2 |
| ⓘ | Godlevskite | 2.BB.15 | (Ni,Fe)9S8 |
| ⓘ | Telluropalladinite | 2.BC.30 | Pd9Te4 |
| ⓘ | Shandite | 2.BE.15 | Ni3Pb2S2 |
| ⓘ | Kotulskite | 2.CC.05 | Pd(Te,Bi)2-x (x ≈ 0.4) |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Sobolevskite | 2.CC.05 | PdBi |
| ⓘ | Sudburyite | 2.CC.05 | PdSb |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Vavřínite ? | 2.CC.30 | Ni2SbTe2 |
| ⓘ | Braggite | 2.CC.35a | PdPt3S4 |
| ⓘ | Vysotskite | 2.CC.35a | PdS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Malanite | 2.DA.05 | Cu+(Ir3+Pt4+)S4 |
| ⓘ | Polydymite | 2.DA.05 | Ni2+Ni3+2S4 |
| ⓘ | Tellurobismuthite | 2.DC.05 | Bi2Te3 |
| ⓘ | Melonite | 2.EA.20 | NiTe2 |
| ⓘ | Erlichmanite | 2.EB.05a | OsS2 |
| ⓘ | Laurite | 2.EB.05a | RuS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Sperrylite | 2.EB.05a | PtAs2 |
| ⓘ | Omeiite | 2.EB.15a | OsAs2 |
| ⓘ | Ruarsite | 2.EB.20 | (Ru,Os)AsS |
| ⓘ | Hollingworthite | 2.EB.25 | (Rh,Pt,Pd)AsS |
| ⓘ | Irarsite | 2.EB.25 | (Ir,Ru,Rh,Pt)AsS |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Wüstite | 4.AB.25 | FeO |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Magnesiochromite | 4.BB.05 | MgCr2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | var. Moss Agate | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Prase | 4.DA.05 | SiO2 |
| ⓘ | var. Carnelian | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brucite | 4.FE.05 | Mg(OH)2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Magnesite var. Iron-bearing Magnesite | 5.AB.05 | (Mg,Fe)CO3 |
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Gaspéite | 5.AB.05 | NiCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Huntite | 5.AB.25 | CaMg3(CO3)4 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Mcguinnessite | 5.BA.10 | (Mg,Cu)2(CO3)(OH)2 |
| ⓘ | Pokrovskite | 5.BA.10 | Mg2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Hydromagnesite | 5.DA.05 | Mg5(CO3)4(OH)2 · 4H2O |
| ⓘ | Zaratite | 5.DA.15 | Ni3(CO3)(OH)4 · 4H2O ? |
| ⓘ | Desautelsite (TL) | 5.DA.50 | Mg6Mn3+2(OH)16[CO3] · 4H2O |
| ⓘ | Pyroaurite | 5.DA.50 | Mg6Fe3+2(OH)16[CO3] · 4H2O |
| ⓘ | Coalingite | 5.DA.55 | Mg10Fe3+2(OH)24[CO3] · 2H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Nakauriite | 7.DG.30 | Cu8(SO4)4(CO3)(OH)6 · 48H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Cacoxenite | 8.DC.40 | Fe3+24AlO6(PO4)17(OH)12 · 75H2O |
| Group 9 - Silicates | |||
| ⓘ | Chrysotile | 9.00. | Mg3(Si2O5)(OH)4 |
| ⓘ | Forsterite | 9.AC.05 | Mg2(SiO4) |
| ⓘ | Uvarovite | 9.AD.25 | Ca3Cr3+2(SiO4)3 |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Beryl ? | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Dravite var. Chromium-bearing Dravite | 9.CK.05 | Na((Mg,Cr)3)(Al,Cr)6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Enstatite | 9.DA.05 | Mg2Si2O6 |
| ⓘ | Anthophyllite | 9.DD.05 | ◻Mg2Mg5(Si8O22)(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | 'Pimelite' | 9.EC.22 | Ni3Si4O10(OH)2 · 4H2O |
| ⓘ | Margarite | 9.EC.30 | CaAl2(Al2Si2O10)(OH)2 |
| ⓘ | Beidellite | 9.EC.40 | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ | Stevensite | 9.EC.45 | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| ⓘ | Vermiculite | 9.EC.50 | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | var. Chromium-bearing Clinochlore | 9.EC.55 | Mg5(Al,Cr)2Si3O10(OH)8 |
| ⓘ | Dozyite | 9.EC.60 | Mg7Al2(Al2Si4O15)(OH)12 |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Lizardite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Antigorite var. Williamsite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | var. Chrome antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Sepiolite | 9.EE.25 | Mg4(Si6O15)(OH)2 · 6H2O |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Deweylite' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Wad' | - | |
| ⓘ | 'Lancasterite' | - | |
| ⓘ | 'Bloodstone' | - | SiO2 |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Chromite-Magnesiochromite Series' | - | |
| ⓘ | 'Magnesioferrite-Magnetite Series' | - | |
| ⓘ | 'Chrysolite' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Serpentine Subgroup var. Marmolite' | - | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| ⓘ | 'Garnierite' | - | |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Genthite' | - | |
| ⓘ | 'Serpentine Subgroup var. Picrolite' | - | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'UM1965-08-OH:FeMgNi' | - | Fe-Mg-Ni-O-H |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Beidellite | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| H | ⓘ Brucite | Mg(OH)2 |
| H | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| H | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Coalingite | Mg10Fe23+(OH)24[CO3] · 2H2O |
| H | ⓘ Desautelsite | Mg6Mn23+(OH)16[CO3] · 4H2O |
| H | ⓘ Dozyite | Mg7Al2(Al2Si4O15)(OH)12 |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| H | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| H | ⓘ Lizardite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| H | ⓘ Mcguinnessite | (Mg,Cu)2(CO3)(OH)2 |
| H | ⓘ Nakauriite | Cu8(SO4)4(CO3)(OH)6 · 48H2O |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Pokrovskite | Mg2(CO3)(OH)2 |
| H | ⓘ Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| H | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Zaratite | Ni3(CO3)(OH)4 · 4H2O ? |
| H | ⓘ Pimelite | Ni3Si4O10(OH)2 · 4H2O |
| H | ⓘ Dravite var. Chromium-bearing Dravite | Na((Mg,Cr)3)(Al,Cr)6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Serpentine Subgroup var. Marmolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| H | ⓘ Antigorite var. Williamsite | Mg3(Si2O5)(OH)4 |
| H | ⓘ UM1965-08-OH:FeMgNi | Fe-Mg-Ni-O-H |
| H | ⓘ Antigorite var. Chrome antigorite | Mg3(Si2O5)(OH)4 |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Dravite var. Chromium-bearing Dravite | Na((Mg,Cr)3)(Al,Cr)6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Magnesite var. Iron-bearing Magnesite | (Mg,Fe)CO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Coalingite | Mg10Fe23+(OH)24[CO3] · 2H2O |
| C | ⓘ Desautelsite | Mg6Mn23+(OH)16[CO3] · 4H2O |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Gaspéite | NiCO3 |
| C | ⓘ Huntite | CaMg3(CO3)4 |
| C | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Mcguinnessite | (Mg,Cu)2(CO3)(OH)2 |
| C | ⓘ Nakauriite | Cu8(SO4)4(CO3)(OH)6 · 48H2O |
| C | ⓘ Pokrovskite | Mg2(CO3)(OH)2 |
| C | ⓘ Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| C | ⓘ Zaratite | Ni3(CO3)(OH)4 · 4H2O ? |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Beidellite | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| O | ⓘ Magnesite var. Iron-bearing Magnesite | (Mg,Fe)CO3 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Brucite | Mg(OH)2 |
| O | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Coalingite | Mg10Fe23+(OH)24[CO3] · 2H2O |
| O | ⓘ Desautelsite | Mg6Mn23+(OH)16[CO3] · 4H2O |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dozyite | Mg7Al2(Al2Si4O15)(OH)12 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Enstatite | Mg2Si2O6 |
| O | ⓘ Forsterite | Mg2(SiO4) |
| O | ⓘ Gaspéite | NiCO3 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Huntite | CaMg3(CO3)4 |
| O | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| O | ⓘ Lizardite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Magnesiochromite | MgCr2O4 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| O | ⓘ Mcguinnessite | (Mg,Cu)2(CO3)(OH)2 |
| O | ⓘ Quartz var. Moss Agate | SiO2 |
| O | ⓘ Nakauriite | Cu8(SO4)4(CO3)(OH)6 · 48H2O |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Pokrovskite | Mg2(CO3)(OH)2 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| O | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Uvarovite | Ca3Cr23+(SiO4)3 |
| O | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Wüstite | FeO |
| O | ⓘ Zaratite | Ni3(CO3)(OH)4 · 4H2O ? |
| O | ⓘ Quartz var. Prase | SiO2 |
| O | ⓘ Pimelite | Ni3Si4O10(OH)2 · 4H2O |
| O | ⓘ Bloodstone | SiO2 |
| O | ⓘ Fayalite-Forsterite Series | |
| O | ⓘ Chromite-Magnesiochromite Series | |
| O | ⓘ Magnesioferrite-Magnetite Series | |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Dravite var. Chromium-bearing Dravite | Na((Mg,Cr)3)(Al,Cr)6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Quartz var. Carnelian | SiO2 |
| O | ⓘ Serpentine Subgroup var. Marmolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| O | ⓘ Antigorite var. Williamsite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ UM1965-08-OH:FeMgNi | Fe-Mg-Ni-O-H |
| O | ⓘ Antigorite var. Chrome antigorite | Mg3(Si2O5)(OH)4 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Beidellite | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | ⓘ Dravite var. Chromium-bearing Dravite | Na((Mg,Cr)3)(Al,Cr)6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Magnesite var. Iron-bearing Magnesite | (Mg,Fe)CO3 |
| Mg | ⓘ Brucite | Mg(OH)2 |
| Mg | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Coalingite | Mg10Fe23+(OH)24[CO3] · 2H2O |
| Mg | ⓘ Desautelsite | Mg6Mn23+(OH)16[CO3] · 4H2O |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dozyite | Mg7Al2(Al2Si4O15)(OH)12 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Enstatite | Mg2Si2O6 |
| Mg | ⓘ Forsterite | Mg2(SiO4) |
| Mg | ⓘ Huntite | CaMg3(CO3)4 |
| Mg | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| Mg | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Mg | ⓘ Lizardite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Magnesiochromite | MgCr2O4 |
| Mg | ⓘ Mcguinnessite | (Mg,Cu)2(CO3)(OH)2 |
| Mg | ⓘ Pokrovskite | Mg2(CO3)(OH)2 |
| Mg | ⓘ Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| Mg | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Mg | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Mg | ⓘ Fayalite-Forsterite Series | |
| Mg | ⓘ Chromite-Magnesiochromite Series | |
| Mg | ⓘ Magnesioferrite-Magnetite Series | |
| Mg | ⓘ Dravite var. Chromium-bearing Dravite | Na((Mg,Cr)3)(Al,Cr)6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Serpentine Subgroup var. Marmolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Mg | ⓘ Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Mg | ⓘ Antigorite var. Williamsite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ UM1965-08-OH:FeMgNi | Fe-Mg-Ni-O-H |
| Mg | ⓘ Antigorite var. Chrome antigorite | Mg3(Si2O5)(OH)4 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Beidellite | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Dozyite | Mg7Al2(Al2Si4O15)(OH)12 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Al | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Dravite var. Chromium-bearing Dravite | Na((Mg,Cr)3)(Al,Cr)6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Serpentine Subgroup var. Marmolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Al | ⓘ Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Beidellite | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Dozyite | Mg7Al2(Al2Si4O15)(OH)12 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Enstatite | Mg2Si2O6 |
| Si | ⓘ Forsterite | Mg2(SiO4) |
| Si | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Si | ⓘ Lizardite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Si | ⓘ Quartz var. Moss Agate | SiO2 |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Si | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Uvarovite | Ca3Cr23+(SiO4)3 |
| Si | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Quartz var. Prase | SiO2 |
| Si | ⓘ Pimelite | Ni3Si4O10(OH)2 · 4H2O |
| Si | ⓘ Bloodstone | SiO2 |
| Si | ⓘ Fayalite-Forsterite Series | |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Dravite var. Chromium-bearing Dravite | Na((Mg,Cr)3)(Al,Cr)6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Carnelian | SiO2 |
| Si | ⓘ Serpentine Subgroup var. Marmolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Si | ⓘ Antigorite var. Williamsite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Antigorite var. Chrome antigorite | Mg3(Si2O5)(OH)4 |
| P | Phosphorus | |
| P | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Braggite | PdPt3S4 |
| S | ⓘ Erlichmanite | OsS2 |
| S | ⓘ Galena | PbS |
| S | ⓘ Godlevskite | (Ni,Fe)9S8 |
| S | ⓘ Heazlewoodite | Ni3S2 |
| S | ⓘ Hollingworthite | (Rh,Pt,Pd)AsS |
| S | ⓘ Irarsite | (Ir,Ru,Rh,Pt)AsS |
| S | ⓘ Laurite | RuS2 |
| S | ⓘ Malanite | Cu+(Ir3+Pt4+)S4 |
| S | ⓘ Millerite | NiS |
| S | ⓘ Nakauriite | Cu8(SO4)4(CO3)(OH)6 · 48H2O |
| S | ⓘ Polydymite | Ni2+Ni23+S4 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Ruarsite | (Ru,Os)AsS |
| S | ⓘ Shandite | Ni3Pb2S2 |
| S | ⓘ Vysotskite | PdS |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Beidellite | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Huntite | CaMg3(CO3)4 |
| Ca | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Ca | ⓘ Stevensite | (Ca,Na)xMg3-x(Si4O10)(OH)2 |
| Ca | ⓘ Uvarovite | Ca3Cr23+(SiO4)3 |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Cr | ⓘ Magnesiochromite | MgCr2O4 |
| Cr | ⓘ Uvarovite | Ca3Cr23+(SiO4)3 |
| Cr | ⓘ Chromite-Magnesiochromite Series | |
| Cr | ⓘ Dravite var. Chromium-bearing Dravite | Na((Mg,Cr)3)(Al,Cr)6(Si6O18)(BO3)3(OH)3(OH) |
| Mn | Manganese | |
| Mn | ⓘ Desautelsite | Mg6Mn23+(OH)16[CO3] · 4H2O |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Serpentine Subgroup var. Marmolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Mn | ⓘ Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Awaruite | Ni3Fe |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Magnesite var. Iron-bearing Magnesite | (Mg,Fe)CO3 |
| Fe | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Coalingite | Mg10Fe23+(OH)24[CO3] · 2H2O |
| Fe | ⓘ Ferronickelplatinum | Pt2FeNi |
| Fe | ⓘ Godlevskite | (Ni,Fe)9S8 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Native Iron | Fe |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Tetraferroplatinum | PtFe |
| Fe | ⓘ Tulameenite | Pt2CuFe |
| Fe | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Wüstite | FeO |
| Fe | ⓘ Fayalite-Forsterite Series | |
| Fe | ⓘ Chromite-Magnesiochromite Series | |
| Fe | ⓘ Magnesioferrite-Magnetite Series | |
| Fe | ⓘ Serpentine Subgroup var. Marmolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Fe | ⓘ Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Fe | ⓘ UM1965-08-OH:FeMgNi | Fe-Mg-Ni-O-H |
| Ni | Nickel | |
| Ni | ⓘ Awaruite | Ni3Fe |
| Ni | ⓘ Ferronickelplatinum | Pt2FeNi |
| Ni | ⓘ Gaspéite | NiCO3 |
| Ni | ⓘ Godlevskite | (Ni,Fe)9S8 |
| Ni | ⓘ Heazlewoodite | Ni3S2 |
| Ni | ⓘ Majakite | PdNiAs |
| Ni | ⓘ Maucherite | Ni11As8 |
| Ni | ⓘ Melonite | NiTe2 |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Nickeline | NiAs |
| Ni | ⓘ Polydymite | Ni2+Ni23+S4 |
| Ni | ⓘ Shandite | Ni3Pb2S2 |
| Ni | ⓘ Zaratite | Ni3(CO3)(OH)4 · 4H2O ? |
| Ni | ⓘ Pimelite | Ni3Si4O10(OH)2 · 4H2O |
| Ni | ⓘ Serpentine Subgroup var. Marmolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Ni | ⓘ Menshikovite | Pd3Ni2As3 |
| Ni | ⓘ Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Ni | ⓘ Vavřínite | Ni2SbTe2 |
| Ni | ⓘ UM1965-08-OH:FeMgNi | Fe-Mg-Ni-O-H |
| Cu | Copper | |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Malanite | Cu+(Ir3+Pt4+)S4 |
| Cu | ⓘ Mcguinnessite | (Mg,Cu)2(CO3)(OH)2 |
| Cu | ⓘ Nakauriite | Cu8(SO4)4(CO3)(OH)6 · 48H2O |
| Cu | ⓘ Tulameenite | Pt2CuFe |
| Zn | Zinc | |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Serpentine Subgroup var. Marmolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Zn | ⓘ Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| As | Arsenic | |
| As | ⓘ Arsenopalladinite | Pd8(As,Sb)3 |
| As | ⓘ Hollingworthite | (Rh,Pt,Pd)AsS |
| As | ⓘ Irarsite | (Ir,Ru,Rh,Pt)AsS |
| As | ⓘ Majakite | PdNiAs |
| As | ⓘ Maucherite | Ni11As8 |
| As | ⓘ Nickeline | NiAs |
| As | ⓘ Omeiite | OsAs2 |
| As | ⓘ Palladoarsenide | Pd2As |
| As | ⓘ Ruarsite | (Ru,Os)AsS |
| As | ⓘ Sperrylite | PtAs2 |
| As | ⓘ Vincentite | Pd3As |
| As | ⓘ Menshikovite | Pd3Ni2As3 |
| Ru | Ruthenium | |
| Ru | ⓘ Irarsite | (Ir,Ru,Rh,Pt)AsS |
| Ru | ⓘ Native Iridium | (Ir,Os,Ru) |
| Ru | ⓘ Laurite | RuS2 |
| Ru | ⓘ Ruarsite | (Ru,Os)AsS |
| Rh | Rhodium | |
| Rh | ⓘ Hollingworthite | (Rh,Pt,Pd)AsS |
| Rh | ⓘ Irarsite | (Ir,Ru,Rh,Pt)AsS |
| Pd | Palladium | |
| Pd | ⓘ Arsenopalladinite | Pd8(As,Sb)3 |
| Pd | ⓘ Braggite | PdPt3S4 |
| Pd | ⓘ Hollingworthite | (Rh,Pt,Pd)AsS |
| Pd | ⓘ Kotulskite | Pd(Te,Bi)2-x (x ≈ 0.4) |
| Pd | ⓘ Majakite | PdNiAs |
| Pd | ⓘ Native Palladium | (Pd,Pt) |
| Pd | ⓘ Palladoarsenide | Pd2As |
| Pd | ⓘ Sobolevskite | PdBi |
| Pd | ⓘ Stibiopalladinite | Pd5Sb2 |
| Pd | ⓘ Sudburyite | PdSb |
| Pd | ⓘ Telluropalladinite | Pd9Te4 |
| Pd | ⓘ Vincentite | Pd3As |
| Pd | ⓘ Vysotskite | PdS |
| Pd | ⓘ Menshikovite | Pd3Ni2As3 |
| Pd | ⓘ Naldrettite | Pd2Sb |
| Pd | ⓘ Ungavaite | Pd4Sb3 |
| Sb | Antimony | |
| Sb | ⓘ Arsenopalladinite | Pd8(As,Sb)3 |
| Sb | ⓘ Stibiopalladinite | Pd5Sb2 |
| Sb | ⓘ Sudburyite | PdSb |
| Sb | ⓘ Naldrettite | Pd2Sb |
| Sb | ⓘ Ungavaite | Pd4Sb3 |
| Sb | ⓘ Vavřínite | Ni2SbTe2 |
| Te | Tellurium | |
| Te | ⓘ Kotulskite | Pd(Te,Bi)2-x (x ≈ 0.4) |
| Te | ⓘ Melonite | NiTe2 |
| Te | ⓘ Telluropalladinite | Pd9Te4 |
| Te | ⓘ Tellurobismuthite | Bi2Te3 |
| Te | ⓘ Vavřínite | Ni2SbTe2 |
| Os | Osmium | |
| Os | ⓘ Erlichmanite | OsS2 |
| Os | ⓘ Native Iridium | (Ir,Os,Ru) |
| Os | ⓘ Omeiite | OsAs2 |
| Os | ⓘ Ruarsite | (Ru,Os)AsS |
| Ir | Iridium | |
| Ir | ⓘ Irarsite | (Ir,Ru,Rh,Pt)AsS |
| Ir | ⓘ Native Iridium | (Ir,Os,Ru) |
| Ir | ⓘ Malanite | Cu+(Ir3+Pt4+)S4 |
| Pt | Platinum | |
| Pt | ⓘ Braggite | PdPt3S4 |
| Pt | ⓘ Ferronickelplatinum | Pt2FeNi |
| Pt | ⓘ Hollingworthite | (Rh,Pt,Pd)AsS |
| Pt | ⓘ Irarsite | (Ir,Ru,Rh,Pt)AsS |
| Pt | ⓘ Malanite | Cu+(Ir3+Pt4+)S4 |
| Pt | ⓘ Native Palladium | (Pd,Pt) |
| Pt | ⓘ Native Platinum | Pt |
| Pt | ⓘ Sperrylite | PtAs2 |
| Pt | ⓘ Tetraferroplatinum | PtFe |
| Pt | ⓘ Tulameenite | Pt2CuFe |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Shandite | Ni3Pb2S2 |
| Bi | Bismuth | |
| Bi | ⓘ Kotulskite | Pd(Te,Bi)2-x (x ≈ 0.4) |
| Bi | ⓘ Sobolevskite | PdBi |
| Bi | ⓘ Tellurobismuthite | Bi2Te3 |
Localities in this Region
- Maryland
- Cecil County
- Bald Friar Quarry (Deland Mining and Milling Company)
- Bald Friar Quarry #2
- Browns Farm Placer (Cox Chromite Placer)
- Caldwell Quarries (Caldwell Quarry)
- Cedar Run Prospect (Run East of Rock Springs)
- Conowingo Marble and Mineral Quarry
- Dawson Quarry
- Lincoln Farm Placer
- Line pit (Lowe's Mine)
- McVey Quarry
- ⭔Pilot
- Preston Farm Pits
- Reynolds Farm Placer
- Riley Sand Chrome Property (Riley Quarry)
- Schofield Sand Chrome Deposit (Schofield Placer)
- Southwest Rock Springs Pits (Prospects Near Rock Springs)
- Stevenson Farm Placer
- Taylor Quarry
- Tweed Property (Tweed Placer)
- ⭔West Placer Area (Preston Placer; Sweigarts Run; Swaggarts Run; West Placer; Thornbottom Run)
- Cecil County
- Maryland
- Cecil County
- Pennsylvania
- Chester County
- Lancaster County
- Fulton Township
- Little Britain Township
Other Regions, Features and Areas that Intersect
North AmericaContinent
North America PlateTectonic Plate
- Laurentides DomainPassive Margin
- PedmontiaAccretionary Complex
- Piedmontia DomainDomain
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Pearre, N. C.; Van Heyl, A. (1960) Chromite and other mineral deposits in serpentine rocks of the Piedmont Upland, Maryland, Pennsylvania, and Delaware. Bulletin 1082k. US Geological Survey doi:10.3133/b1082k pp.707-833
Hower, James C., O'Keefe, Jennifer M.K., Latham, Roger Earl, Dai, Shifeng, Silva, Luis F.O., Henke, Kevin R., Thorson, Jon S. (2024) Organic petrology, palynology, and geochemistry of soils from serpentine barrens, Chester and Lancaster counties, Pennsylvania: Notes on maceral development. International Journal of Coal Geology, 289. doi:10.1016/j.coal.2024.104532
State Line Chromite Mining District, USA