Quimper, Finistère, Brittany, Francei
| Regional Level Types | |
|---|---|
| Quimper | Arrondissement |
| Finistère | Department |
| Brittany | Region |
| France | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Quimper | 63,849 (2018) |
| Concarneau | 21,397 (2016) |
| Douarnenez | 16,590 (2016) |
| Quimperlé | 12,312 (2016) |
| Fouesnant | 8,722 (2016) |
| Ergué-Gabéric | 7,326 (2016) |
Other Languages:
French:
Quimper, Finistère, Bretagne, France
German:
Quimper, Département Finistère, Bretagne, Frankreich
Italian:
Quimper, Finistère, Bretagna, Francia
Russian:
Кемпер, Финистер, Бретань, Франция
Simplified Chinese:
坎佩尔, 菲尼斯泰尔省, 布列塔尼半岛, 法国
Spanish:
Quimper, Finisterre, Bretón, Francia
Afrikaans:
Quimper, Finistère, Bretagne, Frankryk
Albanian:
Quimper, Finistère, Bretagne, Franca
Alemannic:
Quimper, Département Finistère, Bretagne, Frankreich
Arabic:
كامبار, فنستير, بريتاني, فرنسا
Aragonese:
Quimper, Finisterre, Bretanya, Francia
Armenian:
Կեմպեր, Ֆինիստեր, Բրետան, Ֆրանսիա
Asturian:
Quimper, Bretaña, Francia
Azeri:
Kemper, Finister, Bretan, Fransa
Bambara:
Quimper, Faransi
Basque:
Quimper, Finistère, Bretainia, Frantzia
Bavarian:
Quimper, Département Finistère, Bretagne, Frankreich
Belarusian:
Кемпер, Фіністэр, Брэтань, Францыя
Bengali:
কাঁপের, ফিনিস্তে, ব্রতাইন, ফ্রান্স
Breton:
Kemper, Penn-ar-Bed, Breizh, Bro-C'hall
Buginese:
Quimper, Perancis
Bulgarian:
Кемпер, Финистер, Бретан, Франция
Catalan:
Quimper, Finisterre, Bretanya, França
Cebuano:
Quimper, Finistère, Bretagne, Pransiya
Chechen:
Кемпер, Бретань, Франци
Chuvash:
Кемпер, Финистер, Бретань, Франци
Cornish:
Kemper, Penn-ar-Bed, Ranvro Breten Vian, Pow Frynk
Corsican:
Quimper, Francia
Croatian:
Quimper, Bretanja, Francuska
Czech:
Quimper, Finistère, Bretaň, Francie
Danish:
Quimper, Finistère, Bretagne, Frankrig
Dutch:
Quimper, Finistère, Bretagne, Frankrijk
Dutch Low Saxon:
Quimper, Frankriek
Esperanto:
Quimper, Finistère, Bretonio, Francio
Estonian:
Quimper, Finistère, Bretagne, Prantsusmaa
Faroese:
Quimper, Frakland
Farsi/Persian:
کمپر, فینیستر, برتاین , فرانسه
Finnish:
Quimper, Finistère, Bretagne, Ranska
Franco-Provençal:
Quimper, Finistèro, Bretagne, France
Friulian:
Quimper, France
Galician:
Quimper, Finistère, Bretaña, Francia
Georgian:
კემპერი, ფინისტერი, ბრეტანი, საფრანგეთი
Greek:
Καμπέρ, Φινιστέρ, Βρετάνη, Γαλλία
Greenlandic:
Quimper, Franskit Nunaat
Hebrew:
קמפר, פיניסטר, ברטאן, צרפת
Hungarian:
Quimper, Finistère, Bretagne, Franciaország
Icelandic:
Quimper, Finistère, Bretanía, Frakkland
Ido:
Quimper, Bretonia, Francia
Indonesian:
Quimper, Finistère, Bretagne, Perancis
Interlingua:
Quimper, Departimento Finistere, Region Britannia, Francia
Interlingue:
Quimper, Francia
Irish Gaelic:
Kemper, Penn-ar-Bed, An Bhriotáin, An Fhrainc
Jamaican Patois:
Quimper, Frans
Japanese:
カンペール, フィニステール県, ブルターニュ, フランス
Kabyle:
Quimper, Finistère, Bretagne, Fransa
Kongo:
Quimper, Finistère, Fwalansa
Korean:
캥페르, 피니스테르, 브르타뉴, 프랑스
Latin:
Coriosopitum, Finis Terrae, Britannia Minor, Francia
Latvian:
Kempēra, Finistēra, Bretaņa, Francija
Ligurian:
Quimper, Fransa
Limburgian:
Quimper, Finistère, Bretagne, Frankriek
Lithuanian:
Quimper, Finisteras, Bretanė, Prancūzija
Low Saxon/Low German:
Quimper, Finistère, Frankriek
Luxembourgish:
Quimper, Departement Finistère, Bretagne, Frankräich
Macedonian:
Кемпер, Финистер, Бретања, Франција
Malagasy:
Quimper, Finistère, Frantsa
Malay:
Quimper, Finistère, Bretagne, Perancis
Manx:
Kemper, Penn-ar-Bed, Yn Vritaan, Yn Rank
Mazanderani:
کویمپر, فرانسه
Minangkabau:
Quimper, Parancih
Minnan / Hokkien-Taiwanese:
Quimper, Finistère, Région Bretagne, Hoat-kok
Narom:
Tchîmpèr, Brétangne, France
Neapolitan:
Quimper, Franza
Nepali:
क्विम्पर, फ्रान्स
Norwegian:
Quimper, Finistère, Bretagne, Frankrike
Norwegian (Nynorsk):
Quimper, Finistère, Bretagne, Frankrike
Occitan:
Kemper, Finistèrra, Bretanha, França
Papiamento:
Quimper, Fransia
Picard:
Quimper, Franche
Piedmontese:
Quimper, Finistère, Brëtagna, Fransa
Polish:
Quimper, Finistère, Bretania, Francja
Portuguese:
Quimper, Finistère, Bretanha, França
Romanian:
Quimper, Finistère, Bretania, Franța
Romansh:
Quimper, Frantscha
Sardinian:
Quimper, Bretagna, Frantza
Scots:
Quimper, Finistère, Breetany, Fraunce
Scottish Gaelic:
Kemper, Penn-ar-Bed, An Fhraing
Serbian:
Кемпер, Финистер, Бретања, Француска
Serbo-Croatian:
Quimper, Finistère, Bretanja, Francuska
Sicilian:
Quimper, Britagna, Francia
Slovak:
Quimper, Finistère, Bretónsko, Francúzsko
Slovenian:
Quimper, Finistère, Bretanja, Francija
South Azerbaijani:
کمپر, فرانسه
Swahili:
Quimper, Finistère, Bretagne, Ufaransa
Swedish:
Quimper, Finistère, Bretagne, Frankrike
Tamil:
குவிம்பர், பினிஸ்ட்டர், பிரான்சு
Tatar:
Кемпер, Бретань ярымутравы, Франция
Traditional Chinese:
金貝, 菲尼斯泰爾, 布禮斯大區, 法國
Turkish:
Quimper, Finistère, Bretonya, Fransa
Ukrainian:
Кемпер, Фіністер, Бретань, Франція
Urdu:
کیمپیغ, فینیستیر, بریتانیہ, فرانس
Uzbek (Latin Script):
Quimper, Bretan, Fransiya
Venetian:
Quimper, Bretagna, Fransa
Vietnamese:
Quimper, Finistère, Bretagne, Pháp
Volapük:
Quimper, Fransän
Walloon:
Quimper, France
Waray:
Quimper, Finistère, Bretagne, Fransya
Welsh:
Kemper, Penn-ar-Bed, Bretagne, Ffrainc
West Flemish:
Quimper, Bretagne, Vrankryk
Wolof:
Quimper, Faraas
Wu Chinese:
坎佩尔, 法国
Zulu:
Quimper, IFulansi
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities85 valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reported from at least 9 localities in this region. |
| ⓘ Albite var. Cleavelandite Formula: Na(AlSi3O8) Localities: Reported from at least 6 localities in this region. |
| ⓘ Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ Amblygonite Formula: LiAl(PO4)F |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5(T8O22)W2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Anatase Formula: TiO2 Localities: Reported from at least 10 localities in this region. |
| ⓘ Andalusite Formula: Al2(SiO4)O Localities: Reported from at least 14 localities in this region. |
| ⓘ Andalusite var. Chiastolite Formula: Al2(SiO4)O |
| ⓘ Antigorite Formula: Mg3(Si2O5)(OH)4 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A Localities: Reported from at least 12 localities in this region. |
| ⓘ Arsenopyrite Formula: FeAsS Localities: Reported from at least 21 localities in this region. |
| ⓘ Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ Berthierite Formula: FeSb2S4 Localities: Reported from at least 6 localities in this region. |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Localities: Reported from at least 11 localities in this region. |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Reported from at least 16 localities in this region. |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Boulangerite Formula: Pb5Sb4S11 |
| ⓘ Bournonite Formula: PbCuSbS3 |
| ⓘ Cacoxenite Formula: Fe3+24AlO6(PO4)17(OH)12 · 75H2O References: |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Cassiterite Formula: SnO2 Localities: Reported from at least 16 localities in this region. |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Ménez Albot, Edern, Quimper, Finistère, Brittany, France Plogoff Point, Plogoff, Quimper, Finistère, Brittany, France Porz Loédec, Cléden-Cap-Sizun, Quimper, Finistère, Brittany, France Pointe de Castel, Primelin, Quimper, Finistère, Brittany, France Pors Tarz, Primelin, Quimper, Finistère, Brittany, France |
| ⓘ 'Chlorite Group' Localities: Reported from at least 6 localities in this region. |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 |
| ⓘ Chrysotile Formula: Mg3(Si2O5)(OH)4 |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' |
| ⓘ Corundum Formula: Al2O3 Localities: Reported from at least 7 localities in this region. |
| ⓘ Corundum var. Sapphire Formula: Al2O3 |
| ⓘ Digenite Formula: Cu9S5 |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Dufrénite Formula: Ca0.5Fe2+Fe3+5(PO4)4(OH)6 · 2H2O |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: Reported from at least 10 localities in this region. |
| ⓘ 'Feldspar Group' |
| ⓘ Fluorite Formula: CaF2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Fülöppite Formula: Pb3Sb8S15 |
| ⓘ Galena Formula: PbS Localities: Reported from at least 8 localities in this region. |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 Localities: Reported from at least 21 localities in this region. |
| ⓘ Glaucophane Formula: ◻Na2(Mg3Al2)Si8O22(OH)2 |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Gypsum Formula: CaSO4 · 2H2O References: |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ Hydroxylapatite Formula: Ca5(PO4)3(OH) |
| ⓘ Idaite Formula: Cu5FeS6 |
| ⓘ Ilmenite Formula: Fe2+TiO3 Localities: Reported from at least 15 localities in this region. |
| ⓘ Jamesonite Formula: Pb4FeSb6S14 |
| ⓘ 'Jet' |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Kermesite Formula: Sb2S2O |
| ⓘ 'K Feldspar' |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 |
| ⓘ Klebelsbergite Formula: Sb4O4(SO4)(OH)2 References: |
| ⓘ Kyanite Formula: Al2(SiO4)O Localities: Reported from at least 12 localities in this region. |
| ⓘ 'Lepidolite' |
| ⓘ 'Leucoxene' |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 11 localities in this region. |
| ⓘ Magnetite var. Titanium-bearing Magnetite Formula: Fe2+(Fe3+,Ti)2O4 |
| ⓘ Marcasite Formula: FeS2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Maucherite Formula: Ni11As8 |
| ⓘ 'Melnikovite' |
| ⓘ Meneghinite Formula: Pb13CuSb7S24 |
| ⓘ Microcline Formula: K(AlSi3O8) Localities: Reported from at least 12 localities in this region. |
| ⓘ 'Microlite Group' Formula: A2-mTa2X6-wZ1-n Description: U/Ca-bearing microlite. |
| ⓘ Millerite Formula: NiS |
| ⓘ 'Monazite Group' Formula: REE(PO4) Localities: Reported from at least 7 localities in this region. |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 20 localities in this region. |
| ⓘ Native Antimony Formula: Sb Localities: Reported from at least 7 localities in this region. |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Gold Formula: Au Localities: Reported from at least 9 localities in this region. |
| ⓘ Native Gold var. Electrum Formula: (Au,Ag) |
| ⓘ Native Silver Formula: Ag |
| ⓘ Natron Formula: Na2CO3 · 10H2O |
| ⓘ Orthoclase Formula: K(AlSi3O8) Localities: Reported from at least 8 localities in this region. |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ Plagionite Formula: Pb5Sb8S17 |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 20 localities in this region. |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Reported from at least 9 localities in this region. |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 35 localities in this region. |
| ⓘ Quartz var. Agate Formula: SiO2 References: |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Röntgenite-(Ce) Formula: Ca2(Ce,La)3(CO3)5F3 References: |
| ⓘ Rutile Formula: TiO2 Localities: Reported from at least 15 localities in this region. |
| ⓘ Sanidine Formula: K(AlSi3O8) |
| ⓘ Scheelite Formula: Ca(WO4) Localities: Reported from at least 8 localities in this region. |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Semseyite Formula: Pb9Sb8S21 |
| ⓘ Senarmontite Formula: Sb2O3 |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Sillimanite Formula: Al2(SiO4)O Localities: Reported from at least 7 localities in this region. |
| ⓘ Smithsonite Formula: ZnCO3 |
| ⓘ Smythite Formula: (Fe,Ni)3+xS4 (x=0-0.3) |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 14 localities in this region. |
| ⓘ Staurolite Formula: Fe2+2Al9Si4O23(OH) Localities: Reported from at least 23 localities in this region. |
| ⓘ Stibiconite Formula: Sb3+Sb5+2O6(OH) |
| ⓘ Stibnite Formula: Sb2S3 Localities: Reported from at least 10 localities in this region. |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ 'Tantalite' Formula: (Mn,Fe)(Ta,Nb)2O6 |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| ⓘ Titanite Formula: CaTiO(SiO4) |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z Localities: Reported from at least 19 localities in this region. |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Tripuhyite Formula: Fe3+Sb5+O4 |
| ⓘ Valentinite Formula: Sb2O3 References: |
| ⓘ Vivianite Formula: Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ 'Wolframite Group' |
| ⓘ Zinkenite Formula: Pb9Sb22S42 |
| ⓘ Zircon Formula: Zr(SiO4) Localities: Reported from at least 9 localities in this region. |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold var. Electrum | 1.AA.05 | (Au,Ag) |
| ⓘ | 1.AA.05 | Au | |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Antimony | 1.CA.05 | Sb |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Maucherite | 2.AB.15 | Ni11As8 |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Idaite | 2.CB.15a | Cu5FeS6 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Smythite | 2.CC.10 | (Fe,Ni)3+xS4 (x=0-0.3) |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Kermesite | 2.FD.05 | Sb2S2O |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Berthierite | 2.HA.20 | FeSb2S4 |
| ⓘ | Meneghinite | 2.HB.05b | Pb13CuSb7S24 |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | Fülöppite | 2.HC.10a | Pb3Sb8S15 |
| ⓘ | Plagionite | 2.HC.10b | Pb5Sb8S17 |
| ⓘ | Semseyite | 2.HC.10d | Pb9Sb8S21 |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Zinkenite | 2.JB.35a | Pb9Sb22S42 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | 'Microlite Group' | 4.00. | A2-mTa2X6-wZ1-n |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | var. Titanium-bearing Magnetite | 4.BB.05 | Fe2+(Fe3+,Ti)2O4 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Corundum var. Sapphire | 4.CB.05 | Al2O3 |
| ⓘ | Senarmontite | 4.CB.50 | Sb2O3 |
| ⓘ | Valentinite | 4.CB.55 | Sb2O3 |
| ⓘ | Quartz var. Agate | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Tripuhyite | 4.DB.05 | Fe3+Sb5+O4 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Stibiconite | 4.DH.20 | Sb3+Sb5+2O6(OH) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Röntgenite-(Ce) | 5.BD.20d | Ca2(Ce,La)3(CO3)5F3 |
| ⓘ | Natron | 5.CB.10 | Na2CO3 · 10H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Klebelsbergite | 7.BB.35 | Sb4O4(SO4)(OH)2 |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Amblygonite | 8.BB.05 | LiAl(PO4)F |
| ⓘ | Hydroxylapatite | 8.BN.05 | Ca5(PO4)3(OH) |
| ⓘ | Vivianite | 8.CE.40 | Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ | Cacoxenite | 8.DC.40 | Fe3+24AlO6(PO4)17(OH)12 · 75H2O |
| ⓘ | Dufrénite | 8.DK.15 | Ca0.5Fe2+Fe3+5(PO4)4(OH)6 · 2H2O |
| ⓘ | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 · 10-12H2O |
| Group 9 - Silicates | |||
| ⓘ | Chrysotile | 9.00. | Mg3(Si2O5)(OH)4 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | var. Chiastolite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Glaucophane | 9.DE.25 | ◻Na2(Mg3Al2)Si8O22(OH)2 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Sanidine | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | var. Cleavelandite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Lepidolite' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Tantalite' | - | (Mn,Fe)(Ta,Nb)2O6 |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Melnikovite' | - | |
| ⓘ | 'Leucoxene' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Jet' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| H | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Glaucophane | ◻Na2(Mg3Al2)Si8O22(OH)2 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Klebelsbergite | Sb4O4(SO4)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Natron | Na2CO3 · 10H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| Li | Lithium | |
| Li | ⓘ Amblygonite | LiAl(PO4)F |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Natron | Na2CO3 · 10H2O |
| C | ⓘ Röntgenite-(Ce) | Ca2(Ce,La)3(CO3)5F3 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Quartz var. Agate | SiO2 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Amblygonite | LiAl(PO4)F |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Andalusite var. Chiastolite | Al2(SiO4)O |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Glaucophane | ◻Na2(Mg3Al2)Si8O22(OH)2 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kermesite | Sb2S2O |
| O | ⓘ Klebelsbergite | Sb4O4(SO4)(OH)2 |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Natron | Na2CO3 · 10H2O |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Röntgenite-(Ce) | Ca2(Ce,La)3(CO3)5F3 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Sanidine | K(AlSi3O8) |
| O | ⓘ Corundum var. Sapphire | Al2O3 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Senarmontite | Sb2O3 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Tripuhyite | Fe3+Sb5+O4 |
| O | ⓘ Valentinite | Sb2O3 |
| O | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| F | Fluorine | |
| F | ⓘ Amblygonite | LiAl(PO4)F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Röntgenite-(Ce) | Ca2(Ce,La)3(CO3)5F3 |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Glaucophane | ◻Na2(Mg3Al2)Si8O22(OH)2 |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Natron | Na2CO3 · 10H2O |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Glaucophane | ◻Na2(Mg3Al2)Si8O22(OH)2 |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Amblygonite | LiAl(PO4)F |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Al | ⓘ Andalusite var. Chiastolite | Al2(SiO4)O |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Glaucophane | ◻Na2(Mg3Al2)Si8O22(OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Sanidine | K(AlSi3O8) |
| Al | ⓘ Corundum var. Sapphire | Al2O3 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Quartz var. Agate | SiO2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Andalusite var. Chiastolite | Al2(SiO4)O |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Glaucophane | ◻Na2(Mg3Al2)Si8O22(OH)2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Sanidine | K(AlSi3O8) |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Amblygonite | LiAl(PO4)F |
| P | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| P | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| P | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Berthierite | FeSb2S4 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Fülöppite | Pb3Sb8S15 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Idaite | Cu5FeS6 |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Kermesite | Sb2S2O |
| S | ⓘ Klebelsbergite | Sb4O4(SO4)(OH)2 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Meneghinite | Pb13CuSb7S24 |
| S | ⓘ Millerite | NiS |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Plagionite | Pb5Sb8S17 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Semseyite | Pb9Sb8S21 |
| S | ⓘ Smythite | (Fe,Ni)3+xS4 (x=0-0.3) |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Zinkenite | Pb9Sb22S42 |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Sanidine | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Röntgenite-(Ce) | Ca2(Ce,La)3(CO3)5F3 |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Ti | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Mn | Manganese | |
| Mn | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Berthierite | FeSb2S4 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Idaite | Cu5FeS6 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Smythite | (Fe,Ni)3+xS4 (x=0-0.3) |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Fe | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| Fe | ⓘ Tripuhyite | Fe3+Sb5+O4 |
| Fe | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Ni | Nickel | |
| Ni | ⓘ Maucherite | Ni11As8 |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Smythite | (Fe,Ni)3+xS4 (x=0-0.3) |
| Cu | Copper | |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Idaite | Cu5FeS6 |
| Cu | ⓘ Meneghinite | Pb13CuSb7S24 |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Zn | Zinc | |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Maucherite | Ni11As8 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Ag | Silver | |
| Ag | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Ag | ⓘ Native Silver | Ag |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sb | Antimony | |
| Sb | ⓘ Native Antimony | Sb |
| Sb | ⓘ Berthierite | FeSb2S4 |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Fülöppite | Pb3Sb8S15 |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Kermesite | Sb2S2O |
| Sb | ⓘ Klebelsbergite | Sb4O4(SO4)(OH)2 |
| Sb | ⓘ Meneghinite | Pb13CuSb7S24 |
| Sb | ⓘ Plagionite | Pb5Sb8S17 |
| Sb | ⓘ Semseyite | Pb9Sb8S21 |
| Sb | ⓘ Senarmontite | Sb2O3 |
| Sb | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Tripuhyite | Fe3+Sb5+O4 |
| Sb | ⓘ Valentinite | Sb2O3 |
| Sb | ⓘ Zinkenite | Pb9Sb22S42 |
| La | Lanthanum | |
| La | ⓘ Röntgenite-(Ce) | Ca2(Ce,La)3(CO3)5F3 |
| Ce | Cerium | |
| Ce | ⓘ Röntgenite-(Ce) | Ca2(Ce,La)3(CO3)5F3 |
| Ta | Tantalum | |
| Ta | ⓘ Microlite Group | A2-mTa2X6-wZ1-n |
| Ta | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Fülöppite | Pb3Sb8S15 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Meneghinite | Pb13CuSb7S24 |
| Pb | ⓘ Plagionite | Pb5Sb8S17 |
| Pb | ⓘ Semseyite | Pb9Sb8S21 |
| Pb | ⓘ Zinkenite | Pb9Sb22S42 |
| Bi | Bismuth | |
| Bi | ⓘ Native Bismuth | Bi |
| U | Uranium | |
| U | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
Fossils
There are 46 fossil localities from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 46 |
|---|---|
| Youngest Fossil Listed | 129 Ma (Early/Lower Cretaceous) |
| Oldest Fossil Listed | 461 Ma (Middle Ordovician) |
| Stratigraphic Units | Click here to view 6 stratigraphic units. |
| Fossils from Region | Click here to show the list. |
| Fossil Localities | Click to show 2 fossil localities |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Quimper |
|---|---|
| Wikidata ID: | Q342 |
| GeoNames ID: | 2984700 |
Localities in this Region
- Brittany
- Finistère
- Quimper
- ⭔Arzano
- ⭔Audierne
- ⭔Bannalec
- ⭔Baye
- ⭔Bénodet
- ⭔Beuzec-Cap-Sizun
- ⭔Briec
- ⭔Cléden-Cap-Sizun
- ⭔Clohars-Carnoët
- ⭔Clohars-Fouesnant
- ⭔Combrit
- ⭔Concarneau
- ⭔Confort-Meilars
- ⭔Douarnenez
- ⭔Edern
- ⭔Elliant
- ⭔Ergué-Gabéric
- ⭔Fouesnant
- ⭔Gouesnach
- ⭔Goulien
- ⭔Gourlizon
- ⭔Guengat
- ⭔Guiler-sur-Goyen
- ⭔Guilligomarc'h
- ⭔Guilvinec
- ⭔Île-Tudy
- ⭔Kerlaz
- ⭔La Forêt-Fouesnant
- ⭔Landrévarzec
- ⭔Landudal
- ⭔Landudec
- ⭔Langolen
- ⭔Le Juch
- ⭔Le Trévoux
- ⭔Locronan
- ⭔Loctudy
- ⭔Locunolé
- ⭔Mahalon
- ⭔Melgven
- ⭔Mellac
- ⭔Moëlan-sur-Mer
- ⭔Névez
- Quimper
- Finistère
- Brittany
- Finistère
- Quimper
- Névez
- ⭔Penmarc'h
- ⭔Peumerit
- ⭔Pleuven
- ⭔Plobannalec-Lesconil
- ⭔Plogastel-Saint-Germain
- ⭔Plogoff
- ⭔Plogonnec
- ⭔Plomelin
- ⭔Plomeur
- ⭔Plonéis
- ⭔Plonéour-Lanvern
- ⭔Plouhinec
- ⭔Plovan
- ⭔Plozévet
- ⭔Pluguffan
- ⭔Pont-Aven
- ⭔Pont-Croix
- ⭔Pont-l'Abbé
- ⭔Pouldergat
- ⭔Pouldreuzic
- ⭔Poullan-sur-Mer
- ⭔Primelin
- ⭔Quéménéven
- ⭔Querrien
- ⭔Quimper
- ⭔Quimperlé
- ⭔Rédené
- ⭔Riec-sur-Bélon
- ⭔Rosporden
- ⭔Saint-Evarzec
- ⭔Saint-Jean-Trolimon
- ⭔Saint-Thurien
- ⭔Saint-Yvi
- ⭔Scaër
- ⭔Sein Island
- ⭔Tourch
- ⭔Treffiagat
- ⭔Tréguennec
- ⭔Trégunc
- ⭔Tréméoc
- ⭔Tréméven
- ⭔Tréogat
- Quimper
- Finistère
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
- Armorican BasinOrogenic Belt
- Saxo-Thuringian BeltOrogenic Belt
EuropeContinent
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.





Quimper, Finistère, Brittany, France