Kalgoorlie Consolidated Gold Mines, Kalgoorlie-Boulder, Kalgoorlie-Boulder Shire, Western Australia, Australiai
| Regional Level Types | |
|---|---|
| Kalgoorlie Consolidated Gold Mines | Group of Mines |
| Kalgoorlie-Boulder | - not defined - |
| Kalgoorlie-Boulder Shire | Shire |
| Western Australia | State |
| Australia | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
30° 46' 30'' South , 121° 30' 18'' East
Latitude & Longitude (decimal):
Type:
Group of Mines
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Boulder | 5,178 (2017) | 1.5km |
| Williamstown | 161 (2018) | 3.5km |
| Kalgoorlie | 31,107 (2014) | 4.4km |
| Stoneville | 2,841 (2016) | 26.9km |
| Coolgardie | 802 (2016) | 38.1km |
Other/historical names associated with this locality:
Golden Mile Mines; Kalgoorlie Super Pit; Kalgurli Mine; Kalgoorlie Gold Deposit
A group of gold mines essentially developed on one major gold deposit, now mostly incorporated into one large open pit, currently operating.
One of the largest mesozonal gold deposits in the world, contains >1,457 tonnes Au. Ca. 20% of it occurs as tellurides.
The Golden Mile is located on the eastern edge of Kalgoorlie-Boulder. Paddy Hannan discovered gold here in 1893. It led to one of the largest gold rushes in Australia's history. After a couple of years when the alluvial gold had been exhausted, companies were floated in London to mine the reef gold. This continued through the Twentieth Century, with the initial large number of mines gradually consolidated until 1989, when only one lease remained covering the entire field. At this point, the Fimiston Superpit was developed. Some geology information from modern studies is under this locality.
Specimens outside of museums from the initial mining days would be rare, as most was destroyed to extract the gold. In 1903, the British Museum studied its collection of tellurides from the Golden Mile. Of 48 specimens studied, 29 contained calaverite, 10 sylvanite or possibly krennerite, 14 petzite, 28 coloradorite, and 3 altaite. 25 samples showed more than one telluride on the same specimen, and 11 had 3 different kinds.
Calaverite was the first to be discovered at the Golden Mile by Richard Eades (Simpson Minerals of W.A. 1948) in 1896, and is considered the most abundant and richest in gold of the tellurides. The museum had specimens of considerable size, including one from the Associated Gold Mine 63cm x 18cm. They were described as bronze-yellow in colour with a bright metallic lustre.
Sylvanite was less common, silver white in colour with a brilliant lustre. While no crystals were available at the time, E.S. Simpson described krennerite from crystals seen at the Kalgurli Mine. The museum describes petzite from the samples as iron black, with a metallic lustre. Coloradoite as abundant, iron black with a marked conchoidal fracture. The first record of altaite in Western Australia came from the Great Boulder Proprietary Mine, as yellow-grey coloured sometimes with a yellowish tarnish, and three perfect cleavages at right angles to each other.
Other minerals with the tellurides were also noted. Gold was described as loosely fine crystallised aggregates (sponge gold), yellow ocherous coloured (mustard gold), and bright films (paint gold). The Great Proprietary Mine found 70 pounds of sponge gold in a single pocket. There was also abundant thicker, more lumpy masses of gold in the specimens.
Also found was fahlerz, an old name for a point in the tennantite-
tetrahedrite series, resembling petzite and coloradoite at the location, but a darker iron-black, dull, with a black streak. The massive mineral was found in small patches on four specimens.
Four crystals, 1cm across,of magnetite was found on one specimen from the Kalgurli Mine. Calcite on one specimen from the Hannans Block 45 Mine. Dolomite on most of the specimens as grey compact bands interfoliated with the greenish schist. Small schorl needles 2-3mm in length embedded in iron pyrite and rock. Very minor chalcopyrite in coloradoite in one specimen. Fibrous gypsum veins penetrating the rock of one specimen.
The matrix was described as pale greenish sericite schist with a silvery reflection. Minute grains and crystals of iron pyrites were scattered through most specimens, however tellurides were embedded in the schist as irregular masses of variable sizes, but did not impregnate the rocks as fine grains. Chlorite was common as darker green material, and bands of grey granular dolomite. Ilmenite was noted on one specimen, largely altered to leucoxene, with a knotted appearance.
Altered rocks from the upper portion of the lode are soft, clayey and yellow but retain their schistose character. Only limonite and fine grained gold was found. The reference notes several other species claimed by other sources, but not identified in its study, including emmonsite, silver chloride, native tellurium, roscoelite, hessite, amalgam, and native mercury.
Kalgoorlite and Coolgardite were announced as new species in 1898 and 1901 respectively, but by 1903 these were proven to be combinations of known tellurides rather than a new species. In 2016, the similarly named Kalgoorlieite was announced as a new species by the IMA, discovered by Kirsten Rempel and Christopher Stanley, from existing telluride specimens held by the School of Mines Kalgoorlie. Kalgoorlieite is microscopic small grain sized material, as the fourth known oxygen-free As-Te mineral.
More geology information under 'Kalgoorlie-Boulder' and 'Fimiston Open Pit (Superpit)'.
One of the largest mesozonal gold deposits in the world, contains >1,457 tonnes Au. Ca. 20% of it occurs as tellurides.
The Golden Mile is located on the eastern edge of Kalgoorlie-Boulder. Paddy Hannan discovered gold here in 1893. It led to one of the largest gold rushes in Australia's history. After a couple of years when the alluvial gold had been exhausted, companies were floated in London to mine the reef gold. This continued through the Twentieth Century, with the initial large number of mines gradually consolidated until 1989, when only one lease remained covering the entire field. At this point, the Fimiston Superpit was developed. Some geology information from modern studies is under this locality.
Specimens outside of museums from the initial mining days would be rare, as most was destroyed to extract the gold. In 1903, the British Museum studied its collection of tellurides from the Golden Mile. Of 48 specimens studied, 29 contained calaverite, 10 sylvanite or possibly krennerite, 14 petzite, 28 coloradorite, and 3 altaite. 25 samples showed more than one telluride on the same specimen, and 11 had 3 different kinds.
Calaverite was the first to be discovered at the Golden Mile by Richard Eades (Simpson Minerals of W.A. 1948) in 1896, and is considered the most abundant and richest in gold of the tellurides. The museum had specimens of considerable size, including one from the Associated Gold Mine 63cm x 18cm. They were described as bronze-yellow in colour with a bright metallic lustre.
Sylvanite was less common, silver white in colour with a brilliant lustre. While no crystals were available at the time, E.S. Simpson described krennerite from crystals seen at the Kalgurli Mine. The museum describes petzite from the samples as iron black, with a metallic lustre. Coloradoite as abundant, iron black with a marked conchoidal fracture. The first record of altaite in Western Australia came from the Great Boulder Proprietary Mine, as yellow-grey coloured sometimes with a yellowish tarnish, and three perfect cleavages at right angles to each other.
Other minerals with the tellurides were also noted. Gold was described as loosely fine crystallised aggregates (sponge gold), yellow ocherous coloured (mustard gold), and bright films (paint gold). The Great Proprietary Mine found 70 pounds of sponge gold in a single pocket. There was also abundant thicker, more lumpy masses of gold in the specimens.
Also found was fahlerz, an old name for a point in the tennantite-
tetrahedrite series, resembling petzite and coloradoite at the location, but a darker iron-black, dull, with a black streak. The massive mineral was found in small patches on four specimens.
Four crystals, 1cm across,of magnetite was found on one specimen from the Kalgurli Mine. Calcite on one specimen from the Hannans Block 45 Mine. Dolomite on most of the specimens as grey compact bands interfoliated with the greenish schist. Small schorl needles 2-3mm in length embedded in iron pyrite and rock. Very minor chalcopyrite in coloradoite in one specimen. Fibrous gypsum veins penetrating the rock of one specimen.
The matrix was described as pale greenish sericite schist with a silvery reflection. Minute grains and crystals of iron pyrites were scattered through most specimens, however tellurides were embedded in the schist as irregular masses of variable sizes, but did not impregnate the rocks as fine grains. Chlorite was common as darker green material, and bands of grey granular dolomite. Ilmenite was noted on one specimen, largely altered to leucoxene, with a knotted appearance.
Altered rocks from the upper portion of the lode are soft, clayey and yellow but retain their schistose character. Only limonite and fine grained gold was found. The reference notes several other species claimed by other sources, but not identified in its study, including emmonsite, silver chloride, native tellurium, roscoelite, hessite, amalgam, and native mercury.
Kalgoorlite and Coolgardite were announced as new species in 1898 and 1901 respectively, but by 1903 these were proven to be combinations of known tellurides rather than a new species. In 2016, the similarly named Kalgoorlieite was announced as a new species by the IMA, discovered by Kirsten Rempel and Christopher Stanley, from existing telluride specimens held by the School of Mines Kalgoorlie. Kalgoorlieite is microscopic small grain sized material, as the fourth known oxygen-free As-Te mineral.
More geology information under 'Kalgoorlie-Boulder' and 'Fimiston Open Pit (Superpit)'.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities108 valid minerals. 3 (TL) - type locality of valid minerals. 1 (FRL) - first recorded locality of unapproved mineral/variety/etc.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold var. Electrum | 1.AA.05 | (Au,Ag) |
| ⓘ | 1.AA.05 | Au | |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Mercury | 1.AD.05 | Hg |
| ⓘ | Native Arsenic | 1.CA.05 | As |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Native Tellurium | 1.CC.10 | Te |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Berzelianite | 2.BA.20 | Cu2-xSe (x ≈ 0.12) |
| ⓘ | Umangite | 2.BA.25 | Cu3Se2 |
| ⓘ | Rickardite | 2.BA.30 | Cu7Te5 |
| ⓘ | Weissite | 2.BA.30 | Cu2-xTe |
| ⓘ | Eucairite | 2.BA.50 | AgCuSe |
| ⓘ | Aguilarite | 2.BA.55 | Ag4SeS |
| ⓘ | Naumannite | 2.BA.55 | Ag2Se |
| ⓘ | Hessite | 2.BA.60 | Ag2Te |
| ⓘ | Stützite | 2.BA.65 | Ag5-xTe3, x = 0.24-0.36 |
| ⓘ | Petzite | 2.BA.75 | Ag3AuTe2 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Coloradoite | 2.CB.05a | HgTe |
| ⓘ | Metacinnabar | 2.CB.05a | HgS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | var. Marmatite | 2.CB.05a | (Zn,Fe)S |
| ⓘ | Metacinnabar var. Selenium-bearing Metacinnabar | 2.CB.05a | Hg(S,Se) |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Altaite | 2.CD.10 | PbTe |
| ⓘ | Clausthalite | 2.CD.10 | PbSe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Cinnabar | 2.CD.15a | HgS |
| ⓘ | Polydymite | 2.DA.05 | Ni2+Ni3+2S4 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Montbrayite | 2.DB.20 | (Au,Ag,Sb,Bi,Pb)23(Te,Sb,Bi,Pb)38 |
| ⓘ | Tellurantimony | 2.DC.05 | Sb2Te3 |
| ⓘ | Tetradymite | 2.DC.05 | Bi2Te2S |
| ⓘ | Sylvanite | 2.EA.05 | AgAuTe4 |
| ⓘ | Calaverite | 2.EA.10 | AuTe2 |
| ⓘ | Kostovite | 2.EA.15 | CuAuTe4 |
| ⓘ | Krennerite | 2.EA.15 | Au3AgTe8 |
| ⓘ | Melonite | 2.EA.20 | NiTe2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Frohbergite | 2.EB.10a | FeTe2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Mattagamite | 2.EB.10a | CoTe2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Realgar | 2.FA.15a | As4S4 |
| ⓘ | Orpiment | 2.FA.30 | As2S3 |
| ⓘ | Kalgoorlieite (TL) | 2.FA.40 | As2Te3 |
| ⓘ | Proustite | 2.GA.05 | Ag3AsS3 |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | Seligmannite | 2.GA.50 | PbCuAsS3 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | Nagyágite | 2.HB.20a | [Pb3(Pb,Sb)3S6](Au,Te)3 |
| ⓘ | Enargite | 2.KA.05 | Cu3AsS4 |
| Group 3 - Halides | |||
| ⓘ | Chlorargyrite | 3.AA.15 | AgCl |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Nolanite | 4.CB.40 | V3+8Fe3+2O14(OH)2 |
| ⓘ | Quartz var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Tivanite (TL) | 4.DB.45 | V3+TiO3(OH) |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Gibbsite | 4.FE.10 | Al(OH)3 |
| ⓘ | Tomichite (TL) | 4.JB.55 | (V,Fe)4Ti3AsO13(OH) |
| ⓘ | Emmonsite | 4.JM.10 | Fe3+2(TeO3)3 · 2H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Magnesite var. Mesitine Spar | 5.AB.05 | (Mg,Fe)CO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Celestine | 7.AD.35 | SrSO4 |
| ⓘ | Alunite | 7.BC.10 | KAl3(SO4)2(OH)6 |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6(SO4) · H2O |
| ⓘ | Epsomite | 7.CB.40 | MgSO4 · 7H2O |
| ⓘ | Coquimbite | 7.CB.55 | AlFe3(SO4)6(H2O)12 · 6H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Montanite | 7.CD.60 | Bi2(TeO6) · nH2O |
| ⓘ | Copiapite | 7.DB.35 | Fe2+Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Chloritoid | 9.AF.85 | Fe2+Al2O(SiO4)(OH)2 |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite var. Fuchsite | 9.EC.15 | K(Al,Cr)3Si3O10(OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Roscoelite | 9.EC.15 | KV3+2(AlSi3O10)(OH)2 |
| ⓘ | Muscovite var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Chamosite | 9.EC.55 | Fe2+5Al(AlSi3O10)(OH)8 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Chamosite var. Daphnite | 9.EC.55 | (Fe,Mg)5Al(Si,Al)4O10(OH)8 |
| ⓘ | Clinochlore var. Diabantite | 9.EC.55 | (Mg,Fe,Al)6((Si,Al)4O10)(OH)8 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Halloysite | 9.ED.10 | Al2Si2O5(OH)4 · n(H2O) |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Andesine | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | var. Labradorite | 9.FA.35 | (Ca,Na)[Al(Al,Si)Si2O8] |
| Unclassified | |||
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Amphibole Supergroup var. Uralite' | - | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Wad' | - | |
| ⓘ | 'Leucoxene' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'Speculite' | - | AuTe2 |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Manganese Oxides' | - | |
| ⓘ | 'Saussurite' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Wad var. Cobalt-bearing Wad' | - | |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ | 'UM1989-02-AsTe:AgAuPb' | - | Au3(Ag,Pb)As2Te3 |
| ⓘ | 'Kalgoorlite' (TL) | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| H | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| H | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| H | ⓘ Chamosite var. Daphnite | (Fe,Mg)5Al(Si,Al)4O10(OH)8 |
| H | ⓘ Clinochlore var. Diabantite | (Mg,Fe,Al)6((Si,Al)4O10)(OH)8 |
| H | ⓘ Emmonsite | Fe23+(TeO3)3 · 2H2O |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Epsomite | MgSO4 · 7H2O |
| H | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| H | ⓘ Gibbsite | Al(OH)3 |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| H | ⓘ Montanite | Bi2(TeO6) · nH2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Nolanite | V83+Fe23+O14(OH)2 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Tivanite | V3+TiO3(OH) |
| H | ⓘ Tomichite | (V,Fe)4Ti3AsO13(OH) |
| H | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Magnesite var. Mesitine Spar | (Mg,Fe)CO3 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Celestine | SrSO4 |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| O | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| O | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Chamosite var. Daphnite | (Fe,Mg)5Al(Si,Al)4O10(OH)8 |
| O | ⓘ Clinochlore var. Diabantite | (Mg,Fe,Al)6((Si,Al)4O10)(OH)8 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Emmonsite | Fe23+(TeO3)3 · 2H2O |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Epsomite | MgSO4 · 7H2O |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| O | ⓘ Gibbsite | Al(OH)3 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| O | ⓘ Montanite | Bi2(TeO6) · nH2O |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Nolanite | V83+Fe23+O14(OH)2 |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Tivanite | V3+TiO3(OH) |
| O | ⓘ Tomichite | (V,Fe)4Ti3AsO13(OH) |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Fayalite-Forsterite Series | |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Magnesite var. Mesitine Spar | (Mg,Fe)CO3 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| F | Fluorine | |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Chamosite var. Daphnite | (Fe,Mg)5Al(Si,Al)4O10(OH)8 |
| Mg | ⓘ Clinochlore var. Diabantite | (Mg,Fe,Al)6((Si,Al)4O10)(OH)8 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Epsomite | MgSO4 · 7H2O |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Fayalite-Forsterite Series | |
| Mg | ⓘ Magnesite var. Mesitine Spar | (Mg,Fe)CO3 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| Al | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Al | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| Al | ⓘ Chamosite var. Daphnite | (Fe,Mg)5Al(Si,Al)4O10(OH)8 |
| Al | ⓘ Clinochlore var. Diabantite | (Mg,Fe,Al)6((Si,Al)4O10)(OH)8 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Al | ⓘ Gibbsite | Al(OH)3 |
| Al | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Si | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Chamosite var. Daphnite | (Fe,Mg)5Al(Si,Al)4O10(OH)8 |
| Si | ⓘ Clinochlore var. Diabantite | (Mg,Fe,Al)6((Si,Al)4O10)(OH)8 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Si | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Fayalite-Forsterite Series | |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Aguilarite | Ag4SeS |
| S | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Celestine | SrSO4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Cinnabar | HgS |
| S | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| S | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| S | ⓘ Covellite | CuS |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Enargite | Cu3AsS4 |
| S | ⓘ Epsomite | MgSO4 · 7H2O |
| S | ⓘ Galena | PbS |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| S | ⓘ Metacinnabar | HgS |
| S | ⓘ Nagyágite | [Pb3(Pb,Sb)3S6](Au,Te)3 |
| S | ⓘ Orpiment | As2S3 |
| S | ⓘ Polydymite | Ni2+Ni23+S4 |
| S | ⓘ Proustite | Ag3AsS3 |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Realgar | As4S4 |
| S | ⓘ Seligmannite | PbCuAsS3 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetradymite | Bi2Te2S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Sphalerite var. Marmatite | (Zn,Fe)S |
| S | ⓘ Metacinnabar var. Selenium-bearing Metacinnabar | Hg(S,Se) |
| Cl | Chlorine | |
| Cl | ⓘ Chlorargyrite | AgCl |
| Cl | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| K | Potassium | |
| K | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| K | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Tivanite | V3+TiO3(OH) |
| Ti | ⓘ Tomichite | (V,Fe)4Ti3AsO13(OH) |
| Ti | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| V | Vanadium | |
| V | ⓘ Nolanite | V83+Fe23+O14(OH)2 |
| V | ⓘ Roscoelite | KV23+(AlSi3O10)(OH)2 |
| V | ⓘ Tivanite | V3+TiO3(OH) |
| V | ⓘ Tomichite | (V,Fe)4Ti3AsO13(OH) |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Mn | Manganese | |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Fe | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| Fe | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| Fe | ⓘ Chamosite var. Daphnite | (Fe,Mg)5Al(Si,Al)4O10(OH)8 |
| Fe | ⓘ Clinochlore var. Diabantite | (Mg,Fe,Al)6((Si,Al)4O10)(OH)8 |
| Fe | ⓘ Emmonsite | Fe23+(TeO3)3 · 2H2O |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Frohbergite | FeTe2 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| Fe | ⓘ Nolanite | V83+Fe23+O14(OH)2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Tomichite | (V,Fe)4Ti3AsO13(OH) |
| Fe | ⓘ Sphalerite var. Marmatite | (Zn,Fe)S |
| Fe | ⓘ Fayalite-Forsterite Series | |
| Fe | ⓘ Magnesite var. Mesitine Spar | (Mg,Fe)CO3 |
| Co | Cobalt | |
| Co | ⓘ Mattagamite | CoTe2 |
| Ni | Nickel | |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Melonite | NiTe2 |
| Ni | ⓘ Polydymite | Ni2+Ni23+S4 |
| Cu | Copper | |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Berzelianite | Cu2-xSe (x ≈ 0.12) |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Enargite | Cu3AsS4 |
| Cu | ⓘ Eucairite | AgCuSe |
| Cu | ⓘ Kostovite | CuAuTe4 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Rickardite | Cu7Te5 |
| Cu | ⓘ Seligmannite | PbCuAsS3 |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Umangite | Cu3Se2 |
| Cu | ⓘ Weissite | Cu2-xTe |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Sphalerite var. Marmatite | (Zn,Fe)S |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Native Arsenic | As |
| As | ⓘ Enargite | Cu3AsS4 |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Orpiment | As2S3 |
| As | ⓘ Proustite | Ag3AsS3 |
| As | ⓘ Realgar | As4S4 |
| As | ⓘ Seligmannite | PbCuAsS3 |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Tomichite | (V,Fe)4Ti3AsO13(OH) |
| As | ⓘ Kalgoorlieite | As2Te3 |
| As | ⓘ UM1989-02-AsTe:AgAuPb | Au3(Ag,Pb)As2Te3 |
| Se | Selenium | |
| Se | ⓘ Aguilarite | Ag4SeS |
| Se | ⓘ Berzelianite | Cu2-xSe (x ≈ 0.12) |
| Se | ⓘ Clausthalite | PbSe |
| Se | ⓘ Eucairite | AgCuSe |
| Se | ⓘ Naumannite | Ag2Se |
| Se | ⓘ Umangite | Cu3Se2 |
| Se | ⓘ Metacinnabar var. Selenium-bearing Metacinnabar | Hg(S,Se) |
| Sr | Strontium | |
| Sr | ⓘ Celestine | SrSO4 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Ag | Silver | |
| Ag | ⓘ Aguilarite | Ag4SeS |
| Ag | ⓘ Chlorargyrite | AgCl |
| Ag | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Ag | ⓘ Eucairite | AgCuSe |
| Ag | ⓘ Hessite | Ag2Te |
| Ag | ⓘ Krennerite | Au3AgTe8 |
| Ag | ⓘ Montbrayite | (Au,Ag,Sb,Bi,Pb)23(Te,Sb,Bi,Pb)38 |
| Ag | ⓘ Naumannite | Ag2Se |
| Ag | ⓘ Petzite | Ag3AuTe2 |
| Ag | ⓘ Proustite | Ag3AsS3 |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Stützite | Ag5-xTe3, x = 0.24-0.36 |
| Ag | ⓘ Sylvanite | AgAuTe4 |
| Ag | ⓘ UM1989-02-AsTe:AgAuPb | Au3(Ag,Pb)As2Te3 |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| Sb | Antimony | |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Montbrayite | (Au,Ag,Sb,Bi,Pb)23(Te,Sb,Bi,Pb)38 |
| Sb | ⓘ Nagyágite | [Pb3(Pb,Sb)3S6](Au,Te)3 |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tellurantimony | Sb2Te3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Te | Tellurium | |
| Te | ⓘ Altaite | PbTe |
| Te | ⓘ Calaverite | AuTe2 |
| Te | ⓘ Coloradoite | HgTe |
| Te | ⓘ Emmonsite | Fe23+(TeO3)3 · 2H2O |
| Te | ⓘ Frohbergite | FeTe2 |
| Te | ⓘ Hessite | Ag2Te |
| Te | ⓘ Kostovite | CuAuTe4 |
| Te | ⓘ Krennerite | Au3AgTe8 |
| Te | ⓘ Mattagamite | CoTe2 |
| Te | ⓘ Melonite | NiTe2 |
| Te | ⓘ Montanite | Bi2(TeO6) · nH2O |
| Te | ⓘ Montbrayite | (Au,Ag,Sb,Bi,Pb)23(Te,Sb,Bi,Pb)38 |
| Te | ⓘ Nagyágite | [Pb3(Pb,Sb)3S6](Au,Te)3 |
| Te | ⓘ Petzite | Ag3AuTe2 |
| Te | ⓘ Rickardite | Cu7Te5 |
| Te | ⓘ Stützite | Ag5-xTe3, x = 0.24-0.36 |
| Te | ⓘ Sylvanite | AgAuTe4 |
| Te | ⓘ Tellurantimony | Sb2Te3 |
| Te | ⓘ Native Tellurium | Te |
| Te | ⓘ Tetradymite | Bi2Te2S |
| Te | ⓘ Weissite | Cu2-xTe |
| Te | ⓘ Speculite | AuTe2 |
| Te | ⓘ Kalgoorlieite | As2Te3 |
| Te | ⓘ UM1989-02-AsTe:AgAuPb | Au3(Ag,Pb)As2Te3 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Calaverite | AuTe2 |
| Au | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Au | ⓘ Native Gold | Au |
| Au | ⓘ Kostovite | CuAuTe4 |
| Au | ⓘ Krennerite | Au3AgTe8 |
| Au | ⓘ Montbrayite | (Au,Ag,Sb,Bi,Pb)23(Te,Sb,Bi,Pb)38 |
| Au | ⓘ Nagyágite | [Pb3(Pb,Sb)3S6](Au,Te)3 |
| Au | ⓘ Petzite | Ag3AuTe2 |
| Au | ⓘ Sylvanite | AgAuTe4 |
| Au | ⓘ Speculite | AuTe2 |
| Au | ⓘ UM1989-02-AsTe:AgAuPb | Au3(Ag,Pb)As2Te3 |
| Hg | Mercury | |
| Hg | ⓘ Cinnabar | HgS |
| Hg | ⓘ Coloradoite | HgTe |
| Hg | ⓘ Native Mercury | Hg |
| Hg | ⓘ Metacinnabar | HgS |
| Hg | ⓘ Metacinnabar var. Selenium-bearing Metacinnabar | Hg(S,Se) |
| Pb | Lead | |
| Pb | ⓘ Altaite | PbTe |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Clausthalite | PbSe |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Montbrayite | (Au,Ag,Sb,Bi,Pb)23(Te,Sb,Bi,Pb)38 |
| Pb | ⓘ Nagyágite | [Pb3(Pb,Sb)3S6](Au,Te)3 |
| Pb | ⓘ Seligmannite | PbCuAsS3 |
| Pb | ⓘ UM1989-02-AsTe:AgAuPb | Au3(Ag,Pb)As2Te3 |
| Bi | Bismuth | |
| Bi | ⓘ Montanite | Bi2(TeO6) · nH2O |
| Bi | ⓘ Montbrayite | (Au,Ag,Sb,Bi,Pb)23(Te,Sb,Bi,Pb)38 |
| Bi | ⓘ Tetradymite | Bi2Te2S |
Geochronology
Mineralization age: Neoarchean : 2629 ± 9 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | ||||||
|---|---|---|---|---|---|---|---|
| Precambrian | |||||||
| Archean | |||||||
| Neoarchean |
| ||||||
Localities in this Region
- Western Australia
- Kalgoorlie-Boulder Shire
- Kalgoorlie-Boulder
- Kalgoorlie Consolidated Gold Mines
- Associated Gold Mine
- Bank of England Gold Mine (Kalgoorlie Bank of England)
- Block 45 Gold Mine
- Boulder Consols No. 1 Gold Mine
- Boulder Main Reef Gold Mine (Great Boulder Main Reef; Boulder South Extended)
- Boulder North Extended Gold Mine
- Brookman Brothers Boulder Gold Mine
- Central Boulder Gold Mine (Revell Cross; Blue Gap; Central and West Boulder)
- Chaffers Gold Mine
- Croesus Gold Mine (Hannans Croesus; Croesus Proprietary)
- Croesus South United Gold Mine (Croesus South)
- Drysdale gold prospect
- Federal Gold Mine
- Fimiston Open Pit mine (Super Pit gold mine)
- Genevieve Gold Mine
- Golden Gate Gold Mine
- Golden Horseshoe Gold Mine
- Golden Link Gold Mine (Eclipse)
- Golden Pike Gold Mine (Hannans Golden Pike)
- Golden Treasure Gold Mine (Hannans Golden Treasure)
- Great Boulder Gold Mine (Phantom Lode; Great Boulder South; Great Boulder North; Great Boulder Extended)
- Kalgoorlie Consolidated Gold Mines
- Kalgoorlie-Boulder
- Kalgoorlie-Boulder Shire
- Western Australia
- Kalgoorlie-Boulder Shire
- Kalgoorlie-Boulder
- Kalgoorlie Consolidated Gold Mines
- Hainault Gold Mine
- Hannans Central Extended Gold Mine
- Hannans Star Gold Mine
- Hidden Secret Gold Mine (Hidden Treasure)
- Idaho Gold Mine (Idaho Pit; Idaho Extended; Aberdare; Star of Aberdare; South Star; Morning Star; Morning Star Extended; Ilannans Golden Morning Star)
- Ivanhoe Gold Mine
- Ivanhoe Venture Gold Mine
- Kalgoorlie Mint and Iron King Gold Mine (Mint and Iron King; Royal Mint and Iron King; Coolgardie Mint and Iron King)
- Lake View Consols Gold Mine (Lake View and Star)
- Lakeview Mine
- Mount Ferrum Gold Mine (Hannans Mount Ferrum; A.W.A.)
- North Boulder Gold Mine
- North Kalgoorlie mine
- North Kalgurli Gold Mine
- Oroya Brownhill Gold Mine (Brownhill lease; Oroya Block North; Oroya Block South)
- Paringa Gold Mine (Paringa Extended; Croesus South)
- Perseverance Gold Mine (Boulder Perseverance Mine)
- Shotover Gold Mine
- Trafalgar Gold Mine
- True Blue Gold Mine (True Blue Hannans)
- Union Jack Gold Mine (Kalgoorlie United)
- Kalgoorlie Consolidated Gold Mines
- Kalgoorlie-Boulder
- Kalgoorlie-Boulder Shire
Other Regions, Features and Areas containing this locality
Australia
- Western Australia
- Kambalda Nickel Metallogenic ProvinceGeologic Province
- West Australian ElementCraton
- Yilgarn CratonCraton
Australian PlateTectonic Plate
- West Australian Craton
- Eastern Yilgarn CratonCraton
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Spencer, L. J. (1903) Mineralogical notes on Western Australian Tellurides: the non-existence of ‘Kalgoorlite’ and ‘Coolgardite’ as mineral species. Mineralogical Magazine and Journal of the Mineralogical Society, 13 (61) 268-290 doi:10.1180/minmag.1903.13.61.07
Phillips, G.Neil; Groves, David I.; Kerrich, Robert (1996) Factors in the formation of the giant Kalgoorlie gold deposit. Ore Geology Reviews, 10 (3-6). p.295-317. doi:10.1016/0169-1368(95)00028-3
Shackleton, J. M.; Spry, P. G.; Bateman, R. (2003) Telluride mineralogy of the Golden Mile deposit, Kalgoorlie, Western Australia. The Canadian Mineralogist, 41 (6). 1503-1524 doi:10.2113/gscanmin.41.6.1503
Bindi, L.; Rossell, M. D.; Van Tendeloo, G.; Spry, P. G.; Cipriani, C. (2004) Inferred phase relations in part of the system Au-Ag-Te: an integrated analytical study of gold ore from the Golden Mile, Kalgoorlie, Australia. Mineralogy and Petrology, 83 (3-4). 283-293 doi:10.1007/s00710-004-0065-1
Mueller, Andreas G., Muhling, Janet R. (2013) Silver-rich telluride mineralization at Mount Charlotte and Au–Ag zonation in the giant Golden Mile deposit, Kalgoorlie, Western Australia. Mineralium Deposita, 48 (3) 295-311 doi:10.1007/s00126-012-0425-4
Steadman, J. A., Large, R. R., Meffre, S., Olin, P. H., Danyushevsky, L. V., Gregory, D. D., Belousov, I., Lounejeva, E., Ireland, T. R., Holden, P. (2015) Synsedimentary to Early Diagenetic Gold in Black Shale-Hosted Pyrite Nodules at the Golden Mile Deposit, Kalgoorlie, Western Australia. Economic Geology, 110 (5) 1157-1191 doi:10.2113/econgeo.110.5.1157
Vielreicher, Noreen Mary, Groves, David Ian, McNaughton, Neal Jesse (2016) The giant Kalgoorlie Gold Field revisited. Geoscience Frontiers, 7 (3) 359-374 doi:10.1016/j.gsf.2015.07.006
Quick NavTopCommoditiesMineral ListRock TypesGeochronologyLocalities in RegionOther RegionsReferences




Kalgoorlie Consolidated Gold Mines, Kalgoorlie-Boulder, Kalgoorlie-Boulder Shire, Western Australia, Australia