Rudňany, Spišská Nová Ves District, Košice Region, Slovakiai
| Regional Level Types | |
|---|---|
| Rudňany | Municipality |
| Spišská Nová Ves District | District |
| Košice Region | Region |
| Slovakia | Country |
This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Other/historical names associated with this locality:
Koterbachy; Kotterbach; Ötösbánya; Porács; Poráč
Other Languages:
French:
Rudňany, Spišská Nová Ves, Košice, Slovaquie
German:
Rudňany, Bezirk Zipser Neudorf, Košický kraj, Slowakei
Italian:
Rudňany, distretto di Spišská Nová Ves, regione di Košice, Slovacchia
Slovak:
Rudňany, Spišská Nová Ves , Košický kraj, Slovensko
Spanish:
Rudňany, Distrito de Spišská Nová Ves, Región de Košice, Eslovaquia
Basque:
Rudňany, Spišská Nová Vesko barrutia, Košice eskualdea, Eslovakia
Catalan:
Rudňany, districte de Spišská Nová Ves, Regió de Košice, Eslovàquia
Czech:
Rudňany, okres Spišská Nová Ves, Košický kraj, Slovensko
Dutch:
Rudňany, Okres Spišská Nová Ves, Košice, Slowakije
Esperanto:
Rudňany, Distrikto Spišská Nová Ves, Regiono Košice, Slovakio
Hungarian:
Ötösbánya, Iglói járás, Kassa megye, Szlovákia
Malay:
Rudňany, Daerah Spišská Nová Ves, Daerah Košice, Slovakia
Polish:
Rudňany, Powiat Nowa Wieś Spiska, Kraj koszycki, Słowacja
Portuguese:
Rudňany, Spišská Nová Ves, Košice, Eslováquia
Romanian:
Rudňany, Districtul Spišská Nová Ves, Košice, Slovacia
Serbian:
Рудњани, Округ Спишка Нова Вес, Кошички крај, Словачка
Serbo-Croatian:
Rudnjani, Okrug Spiška Nova Ves, Košički kraj, Slovačka
Silesian:
Rudňany, Słowacyjo
Ukrainian:
Рудняни, Спішска Нова Вес, Кошицький край, Словаччина
Waray:
Rudňany, Spišská Nová Ves, Košice, Eslovakya
Rudňany (Hungarian: Ötösbánya) is a village and municipality in the Spišská Nová Ves District in the Košice Region of central-eastern Slovakia.
The village lies at an altitude of 547 metres and covers an area of 13.63 km².
In historical records, the village was first mentioned in 1255. By the 13th century, silver and copper were mined in the area. Mercury was a by-product of mining processes. Around 1895, an iron ore smelting company, Vitkovické ironworks, was founded and following the end of the 2nd World War it became the largest of its kind in Slovakia.
Hydrothermal carbonate-quartz-baryte veins with sulphides.
Mining on Cu-Ag-Au ores in medieval times and later during the 18th to 20th centuries.
The village lies at an altitude of 547 metres and covers an area of 13.63 km².
In historical records, the village was first mentioned in 1255. By the 13th century, silver and copper were mined in the area. Mercury was a by-product of mining processes. Around 1895, an iron ore smelting company, Vitkovické ironworks, was founded and following the end of the 2nd World War it became the largest of its kind in Slovakia.
Hydrothermal carbonate-quartz-baryte veins with sulphides.
Mining on Cu-Ag-Au ores in medieval times and later during the 18th to 20th centuries.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities97 valid minerals. 2 erroneous literature entries.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Anhydrite Formula: CaSO4 |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| ⓘ Annabergite Formula: Ni3(AsO4)2 · 8H2O |
| ⓘ Anorthite Formula: Ca(Al2Si2O8) |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Arsenopyrite var. Danaite Formula: (Fe0.90Co0.10)AsS - (Fe0.65Co0.35)AsS |
| ⓘ Axinite-(Fe) Formula: Ca2Fe2+Al2BSi4O15OH |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Boulangerite Formula: Pb5Sb4S11 |
| ⓘ Bournonite Formula: PbCuSbS3 |
| ⓘ Breithauptite Formula: NiSb |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Celestine Formula: SrSO4 |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ 'Chlorite Group' |
| ⓘ 'Chrome-Spinel (of Dana)' |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 |
| ⓘ Cinnabar Formula: HgS |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinoclase Formula: Cu3(AsO4)(OH)3 |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ Cornwallite Formula: Cu5(AsO4)2(OH)4 |
| ⓘ Cosalite Formula: Pb2Bi2S5 |
| ⓘ Covellite Formula: CuS |
| ⓘ Cubanite Formula: CuFe2S3 |
| ⓘ Cuprite Formula: Cu2O References: |
| ⓘ Delafossite Formula: Cu+Fe3+O2 |
| ⓘ Dickite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Digenite Formula: Cu9S5 |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Dolomite var. Iron-bearing Dolomite Formula: Ca(Mg,Fe)(CO3)2 |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Enargite Formula: Cu3AsS4 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Epsomite Formula: MgSO4 · 7H2O |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Formula: CaF2 |
| ⓘ Galena Formula: PbS |
| ⓘ Gersdorffite Formula: NiAsS |
| ⓘ Glaucodot Formula: (Co0.50Fe0.50)AsS |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Grumiplucite Formula: HgBi2S4 Localities: Habit: acicular crystals up to 1 cm in size associated with cinnabar and Hg-rich tetrahedrite Colour: grey-black to lead grey |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Hauchecornite Formula: Ni9BiSbS8 |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Hematite var. Martite Formula: Fe2O3 |
| ⓘ Hematite var. Specularite Formula: Fe2O3 |
| ⓘ Hexahydrite Formula: Mg(H2O)6(SO4) |
| ⓘ Idaite Formula: Cu5FeS6 |
| ⓘ Jamesonite Formula: Pb4FeSb6S14 |
| ⓘ Jamesonite var. Sakharovaite Formula: (Pb,Bi)4FeSb6S14 |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ 'Limonite' |
| ⓘ Lindströmite Formula: Cu3Pb3Bi7S15 |
| ⓘ Magnesiochromite Formula: MgCr2O4 |
| ⓘ Magnesite Formula: MgCO3 |
| ⓘ Magnesite var. Iron-bearing Magnesite Formula: (Mg,Fe)CO3 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Magnetite var. Mushketovite Formula: Fe2+Fe3+2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Manganite Formula: Mn3+O(OH) |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Melanterite Formula: Fe2+(H2O)6(SO4) · H2O |
| ⓘ 'Melnikovite' |
| ⓘ Millerite Formula: NiS |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Fuchsite Formula: K(Al,Cr)3Si3O10(OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Nacrite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Copper Formula: Cu |
| ⓘ Native Gold Formula: Au |
| ⓘ Native Mercury Formula: Hg |
| ⓘ Native Silver Formula: Ag |
| ⓘ Nickelskutterudite Formula: NiAs3 |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 |
| ⓘ Formula: Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| ⓘ Piemontite Formula: (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| ⓘ Polydymite Formula: Ni2+Ni3+2S4 |
| ⓘ 'Psilomelane' |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 |
| ⓘ Retgersite Formula: NiSO4 · 6H2O |
| ⓘ Romanèchite Formula: (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Schwertmannite Formula: Fe3+16(OH,SO4)12-13O16 · 10-12H2O |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ 'Siderogel' Formula: ~FeO(OH) · nH2O |
| ⓘ Skutterudite Formula: CoAs3 |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Spinel Formula: MgAl2O4 |
| ⓘ 'Stibioenargite' Formula: Cu3(Sb,As)S4 |
| ⓘ Stibnite Formula: Sb2S3 |
| ⓘ Stilpnomelane Formula: K4Fe2+48[Si64Al8]O164(OH)52 · nH2O |
| ⓘ Strontianite Formula: SrCO3 |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S |
| ⓘ Tenorite Formula: CuO |
| ⓘ Tetrahedrite-(Hg) Formula: Cu6(Cu4Hg2)Sb4S12S References: |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| ⓘ 'Tetrahedrite Subgroup var. Mercury-bearing Tetrahedrite' Formula: Cu6[Cu4(Zn,Fe,Hg)2]Sb4S13 |
| ⓘ Titanite Formula: CaTiO(SiO4) |
| ⓘ Tripuhyite Formula: Fe3+Sb5+O4 |
| ⓘ Ullmannite Formula: NiSbS |
| ⓘ Violarite Formula: Fe2+Ni3+2S4 |
| ⓘ 'Wad' |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Mercury | 1.AD.05 | Hg |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Hauchecornite | 2.BB.10 | Ni9BiSbS8 |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Idaite | 2.CB.15a | Cu5FeS6 |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Breithauptite | 2.CC.05 | NiSb |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Cinnabar | 2.CD.15a | HgS |
| ⓘ | Polydymite | 2.DA.05 | Ni2+Ni3+2S4 |
| ⓘ | Violarite | 2.DA.05 | Fe2+Ni3+2S4 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Glaucodot | 2.EB.10c | (Co0.50Fe0.50)AsS |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | var. Danaite | 2.EB.20 | (Fe0.90Co0.10)AsS - (Fe0.65Co0.35)AsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Ullmannite | 2.EB.25 | NiSbS |
| ⓘ | Nickelskutterudite | 2.EC.05 | NiAs3 |
| ⓘ | Skutterudite | 2.EC.05 | CoAs3 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | 'var. Mercury-bearing Tetrahedrite' | 2.GB.05 | Cu6[Cu4(Zn,Fe,Hg)2]Sb4S13 |
| ⓘ | Tetrahedrite-(Hg) | 2.GB.05 | Cu6(Cu4Hg2)Sb4S12S |
| ⓘ | Lindströmite | 2.HB.05a | Cu3Pb3Bi7S15 |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | var. Sakharovaite | 2.HB.15 | (Pb,Bi)4FeSb6S14 |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Grumiplucite | 2.JA.05b | HgBi2S4 |
| ⓘ | Cosalite | 2.JB.10 | Pb2Bi2S5 |
| ⓘ | Enargite | 2.KA.05 | Cu3AsS4 |
| Group 3 - Halides | |||
| ⓘ | Fluorite ? | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Delafossite | 4.AB.15 | Cu+Fe3+O2 |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Magnesiochromite | 4.BB.05 | MgCr2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Magnetite var. Mushketovite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | var. Martite | 4.CB.05 | Fe2O3 |
| ⓘ | var. Specularite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Tripuhyite | 4.DB.05 | Fe3+Sb5+O4 |
| ⓘ | Romanèchite | 4.DK.10 | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Magnesite var. Iron-bearing Magnesite | 5.AB.05 | (Mg,Fe)CO3 |
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | var. Iron-bearing Dolomite | 5.AB.10 | Ca(Mg,Fe)(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Strontianite | 5.AB.15 | SrCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Celestine | 7.AD.35 | SrSO4 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Hexahydrite | 7.CB.25 | Mg(H2O)6(SO4) |
| ⓘ | Retgersite | 7.CB.30 | NiSO4 · 6H2O |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6(SO4) · H2O |
| ⓘ | Epsomite | 7.CB.40 | MgSO4 · 7H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Schwertmannite | 7.DE.15 | Fe3+16(OH,SO4)12-13O16 · 10-12H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Cornwallite | 8.BD.05 | Cu5(AsO4)2(OH)4 |
| ⓘ | Clinoclase | 8.BE.20 | Cu3(AsO4)(OH)3 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Annabergite | 8.CE.40 | Ni3(AsO4)2 · 8H2O |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Picropharmacolite ? | 8.CH.15 | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| Group 9 - Silicates | |||
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Axinite-(Fe) | 9.BD.20 | Ca2Fe2+Al2BSi4O15OH |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Piemontite | 9.BG.05a | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite var. Fuchsite | 9.EC.15 | K(Al,Cr)3Si3O10(OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Dickite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Nacrite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Stilpnomelane | 9.EG.40 | K4Fe2+48[Si64Al8]O164(OH)52 · nH2O |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| Unclassified | |||
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Siderogel' | - | ~FeO(OH) · nH2O |
| ⓘ | 'Wad' | - | |
| ⓘ | 'Melnikovite' | - | |
| ⓘ | 'Stibioenargite' | - | Cu3(Sb,As)S4 |
| ⓘ | 'Chrome-Spinel (of Dana)' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| H | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Epsomite | MgSO4 · 7H2O |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| H | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| H | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| H | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| H | ⓘ Retgersite | NiSO4 · 6H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Siderogel | ~FeO(OH) · nH2O |
| H | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Schwertmannite | Fe163+(OH,SO4)12-13O16 · 10-12H2O |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Magnesite var. Iron-bearing Magnesite | (Mg,Fe)CO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Strontianite | SrCO3 |
| C | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Magnesite var. Iron-bearing Magnesite | (Mg,Fe)CO3 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Celestine | SrSO4 |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Delafossite | Cu+Fe3+O2 |
| O | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Epsomite | MgSO4 · 7H2O |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Magnesiochromite | MgCr2O4 |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Hematite var. Martite | Fe2O3 |
| O | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| O | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Retgersite | NiSO4 · 6H2O |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Siderogel | ~FeO(OH) · nH2O |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| O | ⓘ Strontianite | SrCO3 |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Tripuhyite | Fe3+Sb5+O4 |
| O | ⓘ Hematite var. Specularite | Fe2O3 |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Schwertmannite | Fe163+(OH,SO4)12-13O16 · 10-12H2O |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Magnetite var. Mushketovite | Fe2+Fe23+O4 |
| O | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| F | Fluorine | |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Magnesite var. Iron-bearing Magnesite | (Mg,Fe)CO3 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Epsomite | MgSO4 · 7H2O |
| Mg | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Magnesiochromite | MgCr2O4 |
| Mg | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Al | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Si | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| S | Sulfur | |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Celestine | SrSO4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Cinnabar | HgS |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Cosalite | Pb2Bi2S5 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Enargite | Cu3AsS4 |
| S | ⓘ Epsomite | MgSO4 · 7H2O |
| S | ⓘ Galena | PbS |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Hauchecornite | Ni9BiSbS8 |
| S | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| S | ⓘ Idaite | Cu5FeS6 |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Lindströmite | Cu3Pb3Bi7S15 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| S | ⓘ Millerite | NiS |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Polydymite | Ni2+Ni23+S4 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Retgersite | NiSO4 · 6H2O |
| S | ⓘ Jamesonite var. Sakharovaite | (Pb,Bi)4FeSb6S14 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Ullmannite | NiSbS |
| S | ⓘ Violarite | Fe2+Ni23+S4 |
| S | ⓘ Grumiplucite | HgBi2S4 |
| S | ⓘ Schwertmannite | Fe163+(OH,SO4)12-13O16 · 10-12H2O |
| S | ⓘ Stibioenargite | Cu3(Sb,As)S4 |
| S | ⓘ Tetrahedrite Subgroup var. Mercury-bearing Tetrahedrite | Cu6[Cu4(Zn,Fe,Hg)2]Sb4S13 |
| S | ⓘ Arsenopyrite var. Danaite | (Fe0.90Co0.10)AsS - (Fe0.65Co0.35)AsS |
| S | ⓘ Tetrahedrite-(Hg) | Cu6(Cu4Hg2)Sb4S12S |
| K | Potassium | |
| K | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| Ca | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Ti | Titanium | |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Cr | ⓘ Magnesiochromite | MgCr2O4 |
| Mn | Manganese | |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Fe | Iron | |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Magnesite var. Iron-bearing Magnesite | (Mg,Fe)CO3 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Delafossite | Cu+Fe3+O2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Fe | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Idaite | Cu5FeS6 |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Hematite var. Martite | Fe2O3 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Jamesonite var. Sakharovaite | (Pb,Bi)4FeSb6S14 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Siderogel | ~FeO(OH) · nH2O |
| Fe | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| Fe | ⓘ Tripuhyite | Fe3+Sb5+O4 |
| Fe | ⓘ Violarite | Fe2+Ni23+S4 |
| Fe | ⓘ Hematite var. Specularite | Fe2O3 |
| Fe | ⓘ Schwertmannite | Fe163+(OH,SO4)12-13O16 · 10-12H2O |
| Fe | ⓘ Tetrahedrite Subgroup var. Mercury-bearing Tetrahedrite | Cu6[Cu4(Zn,Fe,Hg)2]Sb4S13 |
| Fe | ⓘ Magnetite var. Mushketovite | Fe2+Fe23+O4 |
| Fe | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Fe | ⓘ Arsenopyrite var. Danaite | (Fe0.90Co0.10)AsS - (Fe0.65Co0.35)AsS |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Co | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Co | ⓘ Skutterudite | CoAs3 |
| Co | ⓘ Arsenopyrite var. Danaite | (Fe0.90Co0.10)AsS - (Fe0.65Co0.35)AsS |
| Ni | Nickel | |
| Ni | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| Ni | ⓘ Breithauptite | NiSb |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Hauchecornite | Ni9BiSbS8 |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Nickelskutterudite | NiAs3 |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Polydymite | Ni2+Ni23+S4 |
| Ni | ⓘ Retgersite | NiSO4 · 6H2O |
| Ni | ⓘ Ullmannite | NiSbS |
| Ni | ⓘ Violarite | Fe2+Ni23+S4 |
| Cu | Copper | |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| Cu | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Delafossite | Cu+Fe3+O2 |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Enargite | Cu3AsS4 |
| Cu | ⓘ Idaite | Cu5FeS6 |
| Cu | ⓘ Lindströmite | Cu3Pb3Bi7S15 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Stibioenargite | Cu3(Sb,As)S4 |
| Cu | ⓘ Tetrahedrite Subgroup var. Mercury-bearing Tetrahedrite | Cu6[Cu4(Zn,Fe,Hg)2]Sb4S13 |
| Cu | ⓘ Tetrahedrite-(Hg) | Cu6(Cu4Hg2)Sb4S12S |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Tetrahedrite Subgroup var. Mercury-bearing Tetrahedrite | Cu6[Cu4(Zn,Fe,Hg)2]Sb4S13 |
| As | Arsenic | |
| As | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| As | ⓘ Enargite | Cu3AsS4 |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| As | ⓘ Nickelskutterudite | NiAs3 |
| As | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| As | ⓘ Skutterudite | CoAs3 |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Stibioenargite | Cu3(Sb,As)S4 |
| As | ⓘ Arsenopyrite var. Danaite | (Fe0.90Co0.10)AsS - (Fe0.65Co0.35)AsS |
| Sr | Strontium | |
| Sr | ⓘ Celestine | SrSO4 |
| Sr | ⓘ Strontianite | SrCO3 |
| Ag | Silver | |
| Ag | ⓘ Native Silver | Ag |
| Sb | Antimony | |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Breithauptite | NiSb |
| Sb | ⓘ Hauchecornite | Ni9BiSbS8 |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Jamesonite var. Sakharovaite | (Pb,Bi)4FeSb6S14 |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Tripuhyite | Fe3+Sb5+O4 |
| Sb | ⓘ Ullmannite | NiSbS |
| Sb | ⓘ Stibioenargite | Cu3(Sb,As)S4 |
| Sb | ⓘ Tetrahedrite Subgroup var. Mercury-bearing Tetrahedrite | Cu6[Cu4(Zn,Fe,Hg)2]Sb4S13 |
| Sb | ⓘ Tetrahedrite-(Hg) | Cu6(Cu4Hg2)Sb4S12S |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Hg | Mercury | |
| Hg | ⓘ Cinnabar | HgS |
| Hg | ⓘ Native Mercury | Hg |
| Hg | ⓘ Grumiplucite | HgBi2S4 |
| Hg | ⓘ Tetrahedrite Subgroup var. Mercury-bearing Tetrahedrite | Cu6[Cu4(Zn,Fe,Hg)2]Sb4S13 |
| Hg | ⓘ Tetrahedrite-(Hg) | Cu6(Cu4Hg2)Sb4S12S |
| Pb | Lead | |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Cosalite | Pb2Bi2S5 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Lindströmite | Cu3Pb3Bi7S15 |
| Pb | ⓘ Jamesonite var. Sakharovaite | (Pb,Bi)4FeSb6S14 |
| Bi | Bismuth | |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Cosalite | Pb2Bi2S5 |
| Bi | ⓘ Hauchecornite | Ni9BiSbS8 |
| Bi | ⓘ Lindströmite | Cu3Pb3Bi7S15 |
| Bi | ⓘ Jamesonite var. Sakharovaite | (Pb,Bi)4FeSb6S14 |
| Bi | ⓘ Grumiplucite | HgBi2S4 |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Rud%C5%88any |
|---|---|
| Wikidata ID: | Q727800 |
| GeoNames ID: | 723705 |
Localities in this Region
- Košice Region
- Spišská Nová Ves District
Other Regions, Features and Areas that Intersect
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Radvanec, Martin; Grecula, Pavol; Žák, Karel (2004) Siderite mineralization of the Gemericum superunit (Western Carpathians, Slovakia): review and a revised genetic model. Ore Geology Reviews, 24 (3). doi:10.1016/j.oregeorev.2003.07.004
Hurai, V. (2005) “Siderite mineralization of the Gemericum superunit (Western Carpathians, Slovakia): review and a revised genetic model” [Ore Geology Reviews 24, 267–298]—a discussion. Ore Geology Reviews, 26 (1). doi:10.1016/j.oregeorev.2004.05.003
Žák, K.; Radvanec, M.; Grecula, P. (2005) Siderite mineralization of the Gemericum Superunit (Western Carpathians, Slovakia): review and a revised genetic model [Ore Geology Reviews 24, 267–298]—a reply. Ore Geology Reviews, 26 (1). doi:10.1016/j.oregeorev.2004.05.004
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther RegionsReferences




Rudňany, Spišská Nová Ves District, Košice Region, Slovakia