South Mountain batholith, Nova Scotia, Canadai
| Regional Level Types | |
|---|---|
| South Mountain batholith | Batholith |
| Nova Scotia | Province |
| Canada | Country |
This page is currently not sponsored. Click here to sponsor this page.
Peraluminous granitoid laccolithic complex : Early granodiorites and monzogranites and late leucomonzonites and leucogranites.
A large geological area, The South Mountain Batholith comprises much of South-Western Nova Scotia.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities99 valid minerals. 1 (TL) - type locality of valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reported from at least 8 localities in this region. Colour: White |
| ⓘ 'Alkali Feldspar' References: Kontak, Daniel J., Ansdell, Kevin, Dostal, Jaroslav, Halter, Werner, Martin, Robert, Williams-Jones, Anthony E. (2001) The nature and origin of pegmatites in a fluorine-rich leucogranite, East Kemptville Tin Deposit, Nova Scotia, Canada. Transactions of the Royal Society of Edinburgh: Earth Sciences, 92 (2) 173-200 doi:10.1017/s0263593300000122 |
| ⓘ Amblygonite Formula: LiAl(PO4)F Localities: Description: MinDat, on the pages for amblygonote and montebrasite, indicates that virtually all reported amblygonite from granites is actually montebrasite. Further, a chemical analysis by Walker and Parsons (1924) shows that the material is very low in fluorine and high in water/hydroxyl. |
| ⓘ Anatase Formula: TiO2 Localities: Habit: Most commonly as bipyramids to about 2mm. Also as flattened tabular crystals and plates. Small numbers of tiny rosettes ("anatase roses"). Colour: Black, rarely inky blue. Description: First collected by the Nova Scotia Mineral and Gem Society and visitors from Ontario. It is localized to a brecciated rock along the northeastern end of the pit. Not reported from the rest of the mine.
Associated with adularia, chlorite, quartz, bertrandite, and other minerals. Rarely found on or included in quartz. Some palm sized pieces contained hundreds of crystals. |
| ⓘ Andalusite Formula: Al2(SiO4)O |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Localities: East Kemptville Tin-Indium Project (East Kemptville Tin Mine), East Kemptville, Argyle, Yarmouth Co., Nova Scotia, Canada Reeves pit (Reeves tin pit), New Ross, Lunenburg Co., Nova Scotia, Canada Bayer's Lake pegmatites (south), Halifax Co., Nova Scotia, Canada Bayer's Lake pegmatites (north), Halifax Co., Nova Scotia, Canada Colour: Cream, green |
| ⓘ Arsenopyrite Formula: FeAsS Localities: East Kemptville Tin-Indium Project (East Kemptville Tin Mine), East Kemptville, Argyle, Yarmouth Co., Nova Scotia, Canada Walker Moly prospect (New Russell prospect), New Ross, Lunenburg Co., Nova Scotia, Canada Turner tin prospect, New Ross, Lunenburg Co., Nova Scotia, Canada Herring Cove traverse, Halifax Co., Nova Scotia, Canada |
| ⓘ Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Bertrandite Formula: Be4(Si2O7)(OH)2 Habit: Butterfly-twins and plates. The edges of the crystals show many complex faces. Colour: White, colorless. Description: These were common in a very localized part of the mine. Associated with anatase on clinochlore. Most formed butterfly twins to 1 cm, but more commonly to 5 mm. |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 |
| ⓘ Brookite Formula: TiO2 Habit: Bladed crystals with very complex faces around the edges. Striated along their length. Colour: Dark brown. Description: The brookites were found localised to the northeast corner of the quarry. Associated with bertrandite, anatase, and clinochlore. Far less common than anatase. Crystals to 2 mm. |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Cassiterite Formula: SnO2 Localities: Reported from at least 6 localities in this region. Habit: Sometimes twinned. Colour: Dark brown. |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: East Kemptville Tin-Indium Project (East Kemptville Tin Mine), East Kemptville, Argyle, Yarmouth Co., Nova Scotia, Canada Walker Moly prospect (New Russell prospect), New Ross, Lunenburg Co., Nova Scotia, Canada Turner tin prospect, New Ross, Lunenburg Co., Nova Scotia, Canada Millet Brook U-Ag deposit, Windsor, Hants Co., Nova Scotia, Canada Long Lake prospect, Lunenburg Co., Nova Scotia, Canada |
| ⓘ Childrenite Formula: Fe2+Al(PO4)(OH)2 · H2O Habit: Prismatic, in bowtie shaped sprays. Colour: Brown |
| ⓘ 'Childrenite-Eosphorite Series' Habit: Prismatic crystals, sometimes in bowtie sprays. Colour: Brown. References: Mandarino, J. A., Richardson, J. M. G., Dunn, P. J., Spooner, E. T. C. (1984) Triplite from East Kemptville, Nova Scotia. Mineralogical Magazine, 48 (346) 142-143 doi:10.1180/minmag.1984.048.346.21 |
| ⓘ 'Chlorite Group' Description: Replaces biotite. |
| ⓘ Columbite-(Fe) Formula: Fe2+Nb2O6 |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' Localities: |
| ⓘ 'Cordierite-Sekaninaite Series' |
| ⓘ Covellite Formula: CuS Localities: Walker Moly prospect (New Russell prospect), New Ross, Lunenburg Co., Nova Scotia, Canada Turner tin prospect, New Ross, Lunenburg Co., Nova Scotia, Canada Millet Brook U-Ag deposit, Windsor, Hants Co., Nova Scotia, Canada Governor Lake pegmatite, Halifax Co., Nova Scotia, Canada East Kemptville Tin-Indium Project (East Kemptville Tin Mine), East Kemptville, Argyle, Yarmouth Co., Nova Scotia, Canada |
| ⓘ Dickite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Digenite Formula: Cu9S5 |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Dumortierite Formula: Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| ⓘ Durangite Formula: NaAl(AsO4)F Localities: Description: "Re-examination of specimens from tis locality failed to reveal any durangite (Trail 1970)"
E.F. Foord, M.R. Oakman, and C.H. Maxwell, "Durangite from the Black Range, New Mexico, and New Data on Durangite from Durango and Cornwall", Canadian Mineralogist, 1985. |
| ⓘ Eosphorite Formula: Mn2+Al(PO4)(OH)2 · H2O Description: Molybdenite mine, Larder River |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ 'Feldspar Group' Localities: |
| ⓘ 'Feldspar Group var. Perthite' |
| ⓘ Ferberite Formula: FeWO4 |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorapatite var. Manganapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorite Formula: CaF2 Localities: Reported from at least 9 localities in this region. Habit: Cubes, generally less than 1cm. Colour: Purple (common), yellow (rare) Fluorescence: None Description: Very common, often covering large surfaces of boulders. Frequently covered in a white clay mineral. Sometimes sprinkled with pyrite. Associated with most other minerals. |
| ⓘ Gahnite Formula: ZnAl2O4 |
| ⓘ Galena Formula: PbS |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ 'Gummite' |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: Habit: Bladed crystals in sprays. Colour: Colorless. Description: Microscopic crystals. |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Heulandite-Ca Formula: (Ca,Na)5(Si27Al9)O72 · 26H2O |
| ⓘ 'Heulandite Subgroup' Formula: (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O Habit: Coffin shaped. Colour: White. Description: Visual and Raman ID of heulandite. They could also be clinoptilolite. Associated with quartz and pyrite. |
| ⓘ Hisingerite Formula: Fe3+2(Si2O5)(OH)4 · 2H2O Habit: Botryoidal Description: Richardson adds hisingerite to a paragenetic sequence plot, with a question mark behind the name. More recent WDS testing on very good material gives Si and Fe, with a bit of Al as an impurity. The material is red, botryoidal, and resinous, with a conchoidal fracture, all fitting most closely with hisingerite. |
| ⓘ Hübnerite Formula: MnWO4 |
| ⓘ Hydroxylapatite Formula: Ca5(PO4)3(OH) |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ 'Ilmenite-Pyrophanite Series' Description: MnO up to 23%. |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Kellyite Formula: Mn2+2Al(AlSiO5)(OH)4 References: |
| ⓘ 'K Feldspar' |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 |
| ⓘ Kulanite Formula: Ba(Fe2+,Mn2+,Mg)2(Al,Fe3+)2(PO4)3(OH)3 |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O |
| ⓘ 'Lepidolite' Colour: pale violet |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Manganite Formula: Mn3+O(OH) |
| ⓘ Manjiroite Formula: Na(Mn4+7Mn3+)O16 |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Mawsonite Formula: Cu6Fe2SnS8 |
| ✪ Mcauslanite (TL) Formula: Fe3Al2(PO4)3(PO3OH)F · 18H2O Type Locality: Habit: Fibers and bladed crystals, sprays to 4mm. Colour: Clear yellowish white. Fluorescence: None Description: 3 institutions have HT (& part of HT) and CT specimens including the GSC in Ottawa which has a matrix specimen, two polished sections, one vial and some small fragments.
|
| ⓘ Metatorbernite Formula: Cu(UO2)2(PO4)2 · 8H2O |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ 'Microlite Group' Formula: A2-mTa2X6-wZ-n References: |
| ⓘ Molybdenite Formula: MoS2 Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Monazite Group' Formula: REE(PO4) |
| ⓘ Montebrasite Formula: LiAl(PO4)(OH) |
| ⓘ Morinite Formula: NaCa2Al2(PO4)2(OH)F4 · 2H2O References: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 12 localities in this region. |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ Muscovite var. Phengite Formula: KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Copper Formula: Cu |
| ⓘ Natrojarosite Formula: NaFe3(SO4)2(OH)6 Habit: Earthy to somewhat botryoidal. Colour: Bright yellow. Description: A secondary mineral, likely formed from the breakdown of pyrite. |
| ⓘ Opal Formula: SiO2 · nH2O |
| ⓘ Orthoclase Formula: K(AlSi3O8) Localities: Reported from at least 9 localities in this region. |
| ⓘ 'Parisite' Formula: Ca(Ce/La/Nd/REE)2(CO3)3F2 Description: Interesting brown-cream colored prismatic crystals with excellent cleavage are parisite, a cerium carbonate mineral. Actually, recent microprobe tests have shown that the central parts of the crystals are parisite and the rinds are a cerium phosphate. More identification work is being carried out. These crystals are generally about 5 mm or less, but have been found to about 1 cm. Rarely they will have a dusting of extremely tiny pyrites. Note the undulating growth along the prism and the fat midsection of the rear crystal.
http://nsminerals.atspace.com/EastKemp.html |
| ⓘ Phenakite Formula: Be2SiO4 Habit: Prismatic, with striations along their length. Colour: Colorless Description: Found in a brecciated rock along the northeastern edge of the pit. |
| ⓘ Phosphophyllite Formula: Zn2Fe 2+(PO4)2 · 4H2O |
| ⓘ Pinakiolite Formula: (Mg,Mn2+)2Mn3+(BO3)O2 |
| ⓘ 'Pinite' |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ Proustite Formula: Ag3AsS3 |
| ⓘ 'Psilomelane' |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 9 localities in this region. |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl References: |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 15 localities in this region. |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Rhodochrosite Formula: MnCO3 Localities: Habit: Massive Colour: Colorless |
| ⓘ Roxbyite Formula: Cu58S32 |
| ⓘ Rozenite Formula: FeSO4 · 4H2O |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Rutile var. Niobium-bearing Rutile Formula: (Ti,Nb)O2 Description: Nb up to 8%, Ta up to 2.6%. |
| ⓘ Saléeite Formula: Mg(UO2)2(PO4)2 · 10H2O |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Sekaninaite Formula: (Fe,Mg)2Al3(AlSi5O18) References: |
| ⓘ Siderite Formula: FeCO3 Localities: Habit: A wide variety of shapes. Thin round discs, elongated rhombs with flat terminations, etc. Colour: Tan, light brown, dark brown, reddish-brown. |
| ⓘ Siderophyllite Formula: KFe2+2Al(Al2Si2O10)(OH)2 |
| ⓘ Sphalerite Formula: ZnS Localities: Reeves pit (Reeves tin pit), New Ross, Lunenburg Co., Nova Scotia, Canada Walker Moly prospect (New Russell prospect), New Ross, Lunenburg Co., Nova Scotia, Canada Turner tin prospect, New Ross, Lunenburg Co., Nova Scotia, Canada Millet Brook U-Ag deposit, Windsor, Hants Co., Nova Scotia, Canada East Kemptville Tin-Indium Project (East Kemptville Tin Mine), East Kemptville, Argyle, Yarmouth Co., Nova Scotia, Canada |
| ⓘ Spionkopite Formula: Cu39S28 |
| ⓘ Stannite Formula: Cu2FeSnS4 |
| ⓘ 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O Habit: Commonly found as large surfaces of druses of crystals. The endfaces of the stilbite sheaves was a smooth curved surface and highly lustrous. Often sprinkled with tiny pyrite crystals. Colour: Bright orange, brown. |
| ⓘ Synchysite-(Ce) Formula: CaCe(CO3)2F References: |
| ⓘ 'Tantalite' Formula: (Mn,Fe)(Ta,Nb)2O6 Locality: Keddy prospect (Lantz pegmatite; Keddy pegmatite), New Ross, Lunenburg Co., Nova Scotia, Canada References: |
| ⓘ 'Tapiolite' Formula: (Fe,Mn)(Ta,Nb)2O6 |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| ⓘ Titanite Formula: CaTi(SiO4)O |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 Localities: Keddy prospect (Lantz pegmatite; Keddy pegmatite), New Ross, Lunenburg Co., Nova Scotia, Canada Reeves pit (Reeves tin pit), New Ross, Lunenburg Co., Nova Scotia, Canada Walker Moly prospect (New Russell prospect), New Ross, Lunenburg Co., Nova Scotia, Canada South Mountain batholith, Nova Scotia, Canada East Kemptville Tin-Indium Project (East Kemptville Tin Mine), East Kemptville, Argyle, Yarmouth Co., Nova Scotia, Canada |
| ⓘ Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z Localities: |
| ⓘ Triphylite Formula: LiFe2+PO4 References: |
| ⓘ Triplite Formula: Mn2+2(PO4)F Habit: Massive, rare crude crystals. Colour: Vibrant salmon, reddish-pink. Description: From Mandarino et al: Creamy-pink anhedral grains, 3 to 10 mm in diameter. The main associated minerals are apatite, quartz, pyrite, and sphalerite. First locality in Canada for triplite. |
| ⓘ Triploidite Formula: Mn2+2(PO4)(OH) |
| ⓘ Tungstite Formula: WO3 · H2O References: |
| ⓘ Uraninite Formula: UO2 Localities: Walker Moly prospect (New Russell prospect), New Ross, Lunenburg Co., Nova Scotia, Canada Millet Brook U-Ag deposit, Windsor, Hants Co., Nova Scotia, Canada East Dalhousie, Annapolis Co., Nova Scotia, Canada East Kemptville Tin-Indium Project (East Kemptville Tin Mine), East Kemptville, Argyle, Yarmouth Co., Nova Scotia, Canada |
| ⓘ Uraninite var. Pitchblende Formula: UO2 |
| ⓘ Vivianite Formula: Fe2+Fe2+2(PO4)2 · 8H2O Colour: Gray |
| ⓘ 'White mica' References: Kontak, Daniel J., Ansdell, Kevin, Dostal, Jaroslav, Halter, Werner, Martin, Robert, Williams-Jones, Anthony E. (2001) The nature and origin of pegmatites in a fluorine-rich leucogranite, East Kemptville Tin Deposit, Nova Scotia, Canada. Transactions of the Royal Society of Edinburgh: Earth Sciences, 92 (2) 173-200 doi:10.1017/s0263593300000122 |
| ⓘ Wittichenite Formula: Cu3BiS3 |
| ⓘ 'Wolframite Group' Localities: Reported from at least 6 localities in this region. |
| ⓘ Yarrowite Formula: Cu9S8 |
| ⓘ 'Zinnwaldite' Colour: amber-brown when thick |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Roxbyite | 2.BA.05 | Cu58S32 |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Spionkopite | 2.CA.05c | Cu39S28 |
| ⓘ | Yarrowite | 2.CA.05d | Cu9S8 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Mawsonite | 2.CB.20 | Cu6Fe2SnS8 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Proustite | 2.GA.05 | Ag3AsS3 |
| ⓘ | Wittichenite | 2.GA.20 | Cu3BiS3 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | 'Microlite Group' | 4.00. | A2-mTa2X6-wZ-n |
| ⓘ | Gahnite | 4.BB.05 | ZnAl2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | var. Niobium-bearing Rutile | 4.DB.05 | (Ti,Nb)O2 |
| ⓘ | Ferberite | 4.DB.30 | FeWO4 |
| ⓘ | Hübnerite | 4.DB.30 | MnWO4 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brookite | 4.DD.10 | TiO2 |
| ⓘ | Manjiroite | 4.DK.05a | Na(Mn4+7Mn3+)O16 |
| ⓘ | Uraninite var. Pitchblende | 4.DL.05 | UO2 |
| ⓘ | 4.DL.05 | UO2 | |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Tungstite | 4.FJ.10 | WO3 · H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Synchysite-(Ce) | 5.BD.20c | CaCe(CO3)2F |
| Group 6 - Borates | |||
| ⓘ | Pinakiolite | 6.AB.35 | (Mg,Mn2+)2Mn3+(BO3)O2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Natrojarosite | 7.BC.10 | NaFe3(SO4)2(OH)6 |
| ⓘ | Rozenite | 7.CB.15 | FeSO4 · 4H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Triphylite | 8.AB.10 | LiFe2+PO4 |
| ⓘ | Amblygonite | 8.BB.05 | LiAl(PO4)F |
| ⓘ | Montebrasite | 8.BB.05 | LiAl(PO4)(OH) |
| ⓘ | Triplite | 8.BB.10 | Mn2+2(PO4)F |
| ⓘ | Triploidite | 8.BB.15 | Mn2+2(PO4)(OH) |
| ⓘ | Durangite | 8.BH.10 | NaAl(AsO4)F |
| ⓘ | Kulanite | 8.BH.20 | Ba(Fe2+,Mn2+,Mg)2(Al,Fe3+)2(PO4)3(OH)3 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Hydroxylapatite | 8.BN.05 | Ca5(PO4)3(OH) |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Fluorapatite var. Manganapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Phosphophyllite | 8.CA.40 | Zn2Fe 2+(PO4)2 · 4H2O |
| ⓘ | Vivianite | 8.CE.40 | Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ | Mcauslanite (TL) | 8.DB.60 | Fe3Al2(PO4)3(PO3OH)F · 18H2O |
| ⓘ | Childrenite | 8.DD.20 | Fe2+Al(PO4)(OH)2 · H2O |
| ⓘ | Eosphorite | 8.DD.20 | Mn2+Al(PO4)(OH)2 · H2O |
| ⓘ | Morinite | 8.DM.05 | NaCa2Al2(PO4)2(OH)F4 · 2H2O |
| ⓘ | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ | Saléeite | 8.EB.05 | Mg(UO2)2(PO4)2 · 10H2O |
| ⓘ | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ | Metatorbernite | 8.EB.10 | Cu(UO2)2(PO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Phenakite | 9.AA.05 | Be2SiO4 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Dumortierite | 9.AJ.10 | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| ⓘ | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Sekaninaite | 9.CJ.10 | (Fe,Mg)2Al3(AlSi5O18) |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | var. Phengite | 9.EC.15 | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Siderophyllite | 9.EC.20 | KFe2+2Al(Al2Si2O10)(OH)2 |
| ⓘ | Dickite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Hisingerite | 9.ED.10 | Fe3+2(Si2O5)(OH)4 · 2H2O |
| ⓘ | Kellyite | 9.ED.15 | Mn2+2Al(AlSiO5)(OH)4 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Heulandite-Ca | 9.GE.05 | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Alkali Feldspar' | - | |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Gummite' | - | |
| ⓘ | 'Heulandite Subgroup' | - | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| ⓘ | 'Lepidolite' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ | 'Tantalite' | - | (Mn,Fe)(Ta,Nb)2O6 |
| ⓘ | 'Tapiolite' | - | (Fe,Mn)(Ta,Nb)2O6 |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Zinnwaldite' | - | |
| ⓘ | 'Feldspar Group var. Perthite' | - | |
| ⓘ | 'Parisite' | - | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Cordierite-Sekaninaite Series' | - | |
| ⓘ | 'Ilmenite-Pyrophanite Series' | - | |
| ⓘ | 'Childrenite-Eosphorite Series' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Pinite' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'White mica' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| H | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| H | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| H | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Kellyite | Mn22+Al(AlSiO5)(OH)4 |
| H | ⓘ Kulanite | Ba(Fe2+,Mn2+,Mg)2(Al,Fe3+)2(PO4)3(OH)3 |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Mcauslanite | Fe3Al2(PO4)3(PO3OH)F · 18H2O |
| H | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| H | ⓘ Montebrasite | LiAl(PO4)(OH) |
| H | ⓘ Morinite | NaCa2Al2(PO4)2(OH)F4 · 2H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Phosphophyllite | Zn2Fe 2+(PO4)2 · 4H2O |
| H | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| H | ⓘ Rozenite | FeSO4 · 4H2O |
| H | ⓘ Saléeite | Mg(UO2)2(PO4)2 · 10H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| H | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | ⓘ Triploidite | Mn22+(PO4)(OH) |
| H | ⓘ Tungstite | WO3 · H2O |
| H | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| H | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| H | ⓘ Childrenite-Eosphorite Series | |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Li | Lithium | |
| Li | ⓘ Amblygonite | LiAl(PO4)F |
| Li | ⓘ Montebrasite | LiAl(PO4)(OH) |
| Li | ⓘ Triphylite | LiFe2+PO4 |
| Be | Beryllium | |
| Be | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Phenakite | Be2SiO4 |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| B | ⓘ Pinakiolite | (Mg,Mn2+)2Mn3+(BO3)O2 |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| C | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| O | Oxygen | |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Amblygonite | LiAl(PO4)F |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Brookite | TiO2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| O | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| O | ⓘ Durangite | NaAl(AsO4)F |
| O | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Ferberite | FeWO4 |
| O | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Gahnite | ZnAl2O4 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| O | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| O | ⓘ Hübnerite | MnWO4 |
| O | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kellyite | Mn22+Al(AlSiO5)(OH)4 |
| O | ⓘ Kulanite | Ba(Fe2+,Mn2+,Mg)2(Al,Fe3+)2(PO4)3(OH)3 |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Manjiroite | Na(Mn74+Mn3+)O16 |
| O | ⓘ Mcauslanite | Fe3Al2(PO4)3(PO3OH)F · 18H2O |
| O | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Montebrasite | LiAl(PO4)(OH) |
| O | ⓘ Morinite | NaCa2Al2(PO4)2(OH)F4 · 2H2O |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Phosphophyllite | Zn2Fe 2+(PO4)2 · 4H2O |
| O | ⓘ Phenakite | Be2SiO4 |
| O | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| O | ⓘ Pinakiolite | (Mg,Mn2+)2Mn3+(BO3)O2 |
| O | ⓘ Uraninite var. Pitchblende | UO2 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rozenite | FeSO4 · 4H2O |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Saléeite | Mg(UO2)2(PO4)2 · 10H2O |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Sekaninaite | (Fe,Mg)2Al3(AlSi5O18) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| O | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| O | ⓘ Tapiolite | (Fe,Mn)(Ta,Nb)2O6 |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Triphylite | LiFe2+PO4 |
| O | ⓘ Triplite | Mn22+(PO4)F |
| O | ⓘ Triploidite | Mn22+(PO4)(OH) |
| O | ⓘ Tungstite | WO3 · H2O |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| O | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| O | ⓘ Cordierite-Sekaninaite Series | |
| O | ⓘ Ilmenite-Pyrophanite Series | |
| O | ⓘ Childrenite-Eosphorite Series | |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Rutile var. Niobium-bearing Rutile | (Ti,Nb)O2 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Fluorapatite var. Manganapatite | Ca5(PO4)3F |
| F | Fluorine | |
| F | ⓘ Amblygonite | LiAl(PO4)F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Durangite | NaAl(AsO4)F |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Mcauslanite | Fe3Al2(PO4)3(PO3OH)F · 18H2O |
| F | ⓘ Morinite | NaCa2Al2(PO4)2(OH)F4 · 2H2O |
| F | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Triplite | Mn22+(PO4)F |
| F | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | ⓘ Fluorapatite var. Manganapatite | Ca5(PO4)3F |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Durangite | NaAl(AsO4)F |
| Na | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Na | ⓘ Manjiroite | Na(Mn74+Mn3+)O16 |
| Na | ⓘ Morinite | NaCa2Al2(PO4)2(OH)F4 · 2H2O |
| Na | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Kulanite | Ba(Fe2+,Mn2+,Mg)2(Al,Fe3+)2(PO4)3(OH)3 |
| Mg | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Mg | ⓘ Pinakiolite | (Mg,Mn2+)2Mn3+(BO3)O2 |
| Mg | ⓘ Saléeite | Mg(UO2)2(PO4)2 · 10H2O |
| Mg | ⓘ Sekaninaite | (Fe,Mg)2Al3(AlSi5O18) |
| Mg | ⓘ Cordierite-Sekaninaite Series | |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Amblygonite | LiAl(PO4)F |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| Al | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Al | ⓘ Durangite | NaAl(AsO4)F |
| Al | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Gahnite | ZnAl2O4 |
| Al | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Kellyite | Mn22+Al(AlSiO5)(OH)4 |
| Al | ⓘ Kulanite | Ba(Fe2+,Mn2+,Mg)2(Al,Fe3+)2(PO4)3(OH)3 |
| Al | ⓘ Mcauslanite | Fe3Al2(PO4)3(PO3OH)F · 18H2O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Montebrasite | LiAl(PO4)(OH) |
| Al | ⓘ Morinite | NaCa2Al2(PO4)2(OH)F4 · 2H2O |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sekaninaite | (Fe,Mg)2Al3(AlSi5O18) |
| Al | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Al | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Al | ⓘ Cordierite-Sekaninaite Series | |
| Al | ⓘ Childrenite-Eosphorite Series | |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Si | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Kellyite | Mn22+Al(AlSiO5)(OH)4 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Phenakite | Be2SiO4 |
| Si | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sekaninaite | (Fe,Mg)2Al3(AlSi5O18) |
| Si | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Si | ⓘ Cordierite-Sekaninaite Series | |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| P | Phosphorus | |
| P | ⓘ Amblygonite | LiAl(PO4)F |
| P | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| P | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| P | ⓘ Kulanite | Ba(Fe2+,Mn2+,Mg)2(Al,Fe3+)2(PO4)3(OH)3 |
| P | ⓘ Mcauslanite | Fe3Al2(PO4)3(PO3OH)F · 18H2O |
| P | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Montebrasite | LiAl(PO4)(OH) |
| P | ⓘ Morinite | NaCa2Al2(PO4)2(OH)F4 · 2H2O |
| P | ⓘ Phosphophyllite | Zn2Fe 2+(PO4)2 · 4H2O |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Saléeite | Mg(UO2)2(PO4)2 · 10H2O |
| P | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | ⓘ Triphylite | LiFe2+PO4 |
| P | ⓘ Triplite | Mn22+(PO4)F |
| P | ⓘ Triploidite | Mn22+(PO4)(OH) |
| P | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| P | ⓘ Childrenite-Eosphorite Series | |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| P | ⓘ Fluorapatite var. Manganapatite | Ca5(PO4)3F |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Covellite | CuS |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Mawsonite | Cu6Fe2SnS8 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| S | ⓘ Proustite | Ag3AsS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Roxbyite | Cu58S32 |
| S | ⓘ Rozenite | FeSO4 · 4H2O |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Spionkopite | Cu39S28 |
| S | ⓘ Stannite | Cu2FeSnS4 |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Wittichenite | Cu3BiS3 |
| S | ⓘ Yarrowite | Cu9S8 |
| Cl | Chlorine | |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| K | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Ca | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| Ca | ⓘ Morinite | NaCa2Al2(PO4)2(OH)F4 · 2H2O |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Ca | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | ⓘ Fluorapatite var. Manganapatite | Ca5(PO4)3F |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brookite | TiO2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Ti | ⓘ Ilmenite-Pyrophanite Series | |
| Ti | ⓘ Rutile var. Niobium-bearing Rutile | (Ti,Nb)O2 |
| Mn | Manganese | |
| Mn | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| Mn | ⓘ Hübnerite | MnWO4 |
| Mn | ⓘ Kellyite | Mn22+Al(AlSiO5)(OH)4 |
| Mn | ⓘ Kulanite | Ba(Fe2+,Mn2+,Mg)2(Al,Fe3+)2(PO4)3(OH)3 |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Manjiroite | Na(Mn74+Mn3+)O16 |
| Mn | ⓘ Pinakiolite | (Mg,Mn2+)2Mn3+(BO3)O2 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Mn | ⓘ Tapiolite | (Fe,Mn)(Ta,Nb)2O6 |
| Mn | ⓘ Triplite | Mn22+(PO4)F |
| Mn | ⓘ Triploidite | Mn22+(PO4)(OH) |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Mn | ⓘ Ilmenite-Pyrophanite Series | |
| Mn | ⓘ Childrenite-Eosphorite Series | |
| Fe | Iron | |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ferberite | FeWO4 |
| Fe | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Kulanite | Ba(Fe2+,Mn2+,Mg)2(Al,Fe3+)2(PO4)3(OH)3 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Fe | ⓘ Mcauslanite | Fe3Al2(PO4)3(PO3OH)F · 18H2O |
| Fe | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| Fe | ⓘ Phosphophyllite | Zn2Fe 2+(PO4)2 · 4H2O |
| Fe | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Rozenite | FeSO4 · 4H2O |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Sekaninaite | (Fe,Mg)2Al3(AlSi5O18) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Fe | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Fe | ⓘ Tapiolite | (Fe,Mn)(Ta,Nb)2O6 |
| Fe | ⓘ Triphylite | LiFe2+PO4 |
| Fe | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | ⓘ Cordierite-Sekaninaite Series | |
| Fe | ⓘ Ilmenite-Pyrophanite Series | |
| Fe | ⓘ Childrenite-Eosphorite Series | |
| Cu | Copper | |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Cu | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| Cu | ⓘ Roxbyite | Cu58S32 |
| Cu | ⓘ Spionkopite | Cu39S28 |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Cu | ⓘ Wittichenite | Cu3BiS3 |
| Cu | ⓘ Yarrowite | Cu9S8 |
| Zn | Zinc | |
| Zn | ⓘ Gahnite | ZnAl2O4 |
| Zn | ⓘ Phosphophyllite | Zn2Fe 2+(PO4)2 · 4H2O |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Durangite | NaAl(AsO4)F |
| As | ⓘ Proustite | Ag3AsS3 |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Nb | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Nb | ⓘ Tapiolite | (Fe,Mn)(Ta,Nb)2O6 |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Nb | ⓘ Rutile var. Niobium-bearing Rutile | (Ti,Nb)O2 |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ag | Silver | |
| Ag | ⓘ Proustite | Ag3AsS3 |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sb | Antimony | |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Kulanite | Ba(Fe2+,Mn2+,Mg)2(Al,Fe3+)2(PO4)3(OH)3 |
| La | Lanthanum | |
| La | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| Ce | Cerium | |
| Ce | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ce | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| Nd | Neodymium | |
| Nd | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| Ta | Tantalum | |
| Ta | ⓘ Microlite Group | A2-mTa2X6-wZ-n |
| Ta | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Ta | ⓘ Tapiolite | (Fe,Mn)(Ta,Nb)2O6 |
| W | Tungsten | |
| W | ⓘ Ferberite | FeWO4 |
| W | ⓘ Hübnerite | MnWO4 |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Tungstite | WO3 · H2O |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Bi | Bismuth | |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Wittichenite | Cu3BiS3 |
| U | Uranium | |
| U | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| U | ⓘ Uraninite var. Pitchblende | UO2 |
| U | ⓘ Saléeite | Mg(UO2)2(PO4)2 · 10H2O |
| U | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| U | ⓘ Uraninite | UO2 |
Geochronology
Mineralization age: Late/Upper Devonian : 376 ± 3 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | ||||||
|---|---|---|---|---|---|---|---|
| Phanerozoic | |||||||
| Paleozoic | |||||||
| Devonian | |||||||
| Late/Upper Devonian |
| ||||||
Fossils
There are 1 fossil locality from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 1 | ||||||
|---|---|---|---|---|---|---|---|
| Youngest Fossil Listed | 323 Ma (Carboniferous) | ||||||
| Oldest Fossil Listed | 359 Ma (Late/Upper Devonian) | ||||||
| Stratigraphic Units |
| ||||||
| Fossil Localities | Click to show 1 fossil locality |
Localities in this Region
- Nova Scotia
- Nova Scotia
- Hants Co.
- Windsor
- Lunenburg Co.
- Chester
- Long Lake prospect
- New Ross
- Yarmouth Co.
- Argyle
- East Kemptville
- Argyle
- Hants Co.
Other Regions, Features and Areas that Intersect
North AmericaContinent
North America PlateTectonic Plate
- Meguma DomainDomain
- Meguma TerranePassive Margin
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesGeochronologyFossilsLocalities in RegionOther RegionsReferences
New Ross, Lunenburg Co., Nova Scotia, Canada