Mammoth-Saint Anthony Mine, St. Anthony deposit, Tiger, Mammoth Mining District, Pinal County, Arizona, USAi
| Regional Level Types | |
|---|---|
| Mammoth-Saint Anthony Mine | Mine |
| St. Anthony deposit | Deposit |
| Tiger | Town (Former) |
| Mammoth Mining District | Mining District |
| Pinal County | County |
| Arizona | State |
| USA | Country |
This page kindly sponsored by Marcus J. Origlieri, Ph.D.
Latitude & Longitude (WGS84):
32° 42' 23'' North , 110° 40' 59'' West
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Mammoth | 1,487 (2017) | 4.4km |
| San Manuel | 3,551 (2011) | 12.8km |
| Oracle | 3,686 (2011) | 13.4km |
| Saddle Brooke | 9,614 (2017) | 26.1km |
| Dudleyville | 959 (2011) | 30.8km |
Other/historical names associated with this locality:
Mammoth-St Anthony Mine; Mammoth Mine; St. Anthony Mine; Tiger property; Mammoth Gold Mines Ltd. property
A former Au-V-Pb-Zn-Mo-Cu-Ag-W-F (fluorspar)-Ba (baryte) mine located in the SW¼ sec. 26, T8S, R16E (Mammoth 7.5-minute topo map), about 50 miles (ca. 80 km) NNE of Tucson and 21 miles (ca. 34 km) south of Winkleman, on the east slope of the Black Hills. The first claims were located in 1879. It started in 1881 and closed in 1912 as the "Mammoth" mine. Later it became the Mammoth-St. Anthony mine and incorporated the Collins mine/vein. Worked 1916-1919 and 1935 to 1953. Owned by the Magma Copper Co. (1953 to end). Prior to that, it was owned by the Mammoth-St. Anthony Mining Ltd. (1935-1953). Additional names that apply to this property are 'Tiger property' and 'Mammoth Gold Mines Ltd. property'.
Mineralization in this district is a series of veins within shear zones that strike WNW-ward and dip steeply SW-ward. Their gangue consists of brecciated country rock cemented and replaced with quartz and calcite, together with some baryte and fluorite. The quartz forms successive bands, of which some of the latest generation show well-developed comb structure and are locally amethystine. Most of the gold occurs in an earlier generation of dense, greenish-yellow quartz. The gold tends to be fine-grained, but in places its particles are visible. Wall rock alteration along the veins consists mainly of chloritization and silicification. Such alteration, together with the texture and mineralogy of the veins, points to deposition in the epithermal zone.
The Mammoth orebody group runs NW to SE (Mammoth, Mohawk & New Year) and appears to be one vein, termed the Mammoth vein. These veins dip steeply SW-ward. With approximately the same strike but a steep NE-ward dip, the Mammoth fault comes to the surface near the Collins vein.
In the Mammoth mine, oxidation is complete to the 700-foot level. The ore on the 760-foot level is reported to be largely oxidized, with some residual bunches of galena. The galena is reported to contain 25 oz. Ag/T and 0.375 oz. Au/T. Apparently, there were 2 steeply SE-ward pitching ore shoots that diverged, branched, and became smaller upwards. Between the 400-foot and 760-foot levels, these shoots ranged from 45 to 150 feet (ca. 46 m) apart, from 7 to 40 feet (ca. 12 m) in width, and from $6.24 to $11.96 (period values) in gold per ton. The NW shoot ranged from 200 to 395 feet (ca. 120 m) in length and the SE from 90 to 220 feet (ca. 67 m). The production of gold from the Mammoth and Collins mines through 1901 was over 150,000 ounces (5.67 t), valued at more than $3,000,000 (period values). The total production of the camp from 1881 through 1947 was 1,889,375 tons of ore yielding 397,201 oz. Au, 983,918 oz. Ag, 3,456,121 lbs. Cu, 74,730,289 lbs. Pb, 48,272,654 lbs. Zn, 6,314,822 lbs. MoO₃, and 2,540,842 lbs. V₂O₅.
The camp was largely active from 1901 until 1915, when the wartime demand for molybdenum and vanadium resulted in the reopening of the mines for a short period. In 1919 the metal prices fell, and the mines closed again.
The increase in the price of gold in 1933 caused renewed activity, and the production of Au-V-Mo ores began in 1934 from the oxidized part of the veins. Mining continued until 1943, when the high prices and the need for base metals resulted in the development of the sulfide orebodies below the 650 level of the Collins vein for Pb & Zn (galena & sphalerite).
The workings included a vertical shaft that was in the middle of the town of Tiger, which was later obliterated by the owners of the nearby San Manuel mining complex. The workings went to 1,125 feet (ca. 343 m) deep. You may still stand on the rim of the pit resulting from the San Manuel mine operators desiring to kill 2 birds with one stone—using the high-silica rock for a smelter flux and recovering the gold value; however, there proved to be too much lead in the mix, and the effort was abandoned. The town is gone; the shaft is filled in and marked with four corner stakes of rebar at the bottom of the 20- to 30-foot-deep pit. Look to the west and observe the cleft in the hill behind the former town as the caved area of the Collins vein. Look in the opposite direction, to the east, and observe the headframe of the former Mohawk mine outlined against the oxide ore leach heaps from the San Manuel oxide mine.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities111 valid minerals. 11 (TL) - type locality of valid minerals.
Detailed Mineral List:
| ⓘ Acanthite Formula: Ag2S |
| ⓘ Alamosite Formula: PbSiO3 |
| ⓘ Allophane Formula: (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ Alunite Formula: KAl3(SO4)2(OH)6 References: |
| ⓘ Amesite Formula: Mg2Al(AlSiO5)(OH)4 |
| ⓘ Anglesite Formula: PbSO4 Localities: Habit: Crystals to ¼ inch (0.62 cm) diameter Description: Encloses plates of mammothite. |
| ⓘ Antigorite Formula: Mg3(Si2O5)(OH)4 Colour: White Description: Occurs as aggregated masses of shining white balls that form a matrix for wulfenite and descloizite. |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A |
| ⓘ Atacamite Formula: Cu2(OH)3Cl Localities: Colour: Deep green Description: As coarse, granular aggregates on the 400 level. |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 Habit: Crystals to 2 inches (5 cm) long. |
| ⓘ Baryte Formula: BaSO4 Habit: Groups of large, tabular crystals References: |
| ⓘ Beaverite-(Cu) Formula: Pb(Fe3+2Cu)(SO4)2(OH)6 Habit: Scales Colour: Golden-yellow Description: Shining scales around the bases of linarite crystals. |
| ⓘ Bideauxite (TL) Formula: Pb2AgCl3(F,OH)2 Type Locality: Habit: Crystals 2 to 7 mm Colour: Colorless |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bobmeyerite (TL) Formula: Pb4(Al3Cu)(Si4O12)(S0.5Si0.5O4)(OH)7Cl(H2O)3 Type Locality: |
| ⓘ Boleite Formula: KPb26Ag9Cu24(OH)48Cl62 Localities: Habit: Cubic Colour: Dark blue |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 |
| ⓘ Bromargyrite Formula: AgBr Habit: Cubes, octahedra, and combinations thereof. Colour: Pale brownish-tan to gray |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Caledonite Formula: Pb5Cu2(SO4)3(CO3)(OH)6 Localities: Habit: Excellent crystals Colour: Deep blue Description: 400 level. |
| ⓘ Cerussite Formula: PbCO3 Localities: Habit: Reticulated Description: Coats nodules of matlockite. |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O |
| ⓘ Chalcocite Formula: Cu2S Localities: Description: Occurs as thin films aqnd replacements of chalcopyrite. |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Chlorargyrite Formula: AgCl Localities: Habit: Tiny, cubo-octahedral Colour: Yellowish Description: Tiny crystals on caledonite. |
| ⓘ Chlorargyrite var. Bromine-bearing Chlorargyrite Formula: Ag(Cl,Br) Habit: Octahedral Description: Occurs as crystals on caledonite. |
| ⓘ 'Chlorite Group' Localities: Collins Mine, Mammoth-Saint Anthony Mine, St. Anthony deposit, Tiger, Mammoth Mining District, Pinal County, Arizona, USA Mammoth-Saint Anthony Mine, St. Anthony deposit, Tiger, Mammoth Mining District, Pinal County, Arizona, USA Mohawk Mine, Mammoth-Saint Anthony Mine, St. Anthony deposit, Tiger, Mammoth Mining District, Pinal County, Arizona, USA Colour: Green Description: As felted masses in lower levels of the vein. |
| ⓘ 'Chromium-bearing Leadhillite' Description: Occurs enclosing pinalite. |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 Description: Occurs as thin shells surrounding black tenorite nodules. |
| ⓘ Clinoatacamite Formula: Cu2(OH)3Cl References: |
| ⓘ Connellite Formula: Cu19(SO4)(OH)32Cl4 · 3H2O Habit: Micro-crystals References: |
| ⓘ Covellite Formula: CuS Description: Occurs replacing chalcopyrite. |
| ⓘ Creaseyite (TL) Formula: Pb2Cu2Fe3+2(Si4.67Al0.33)O15.33(OH)3 · H2O Type Locality: Habit: Fibrous tufts Colour: Pale green Description: Occurs in or on cerussite, wulfenite & fluorite; as radiating fibrous spherules with hisingerite cores. References: Williams, Sidney A., Bideaux, Richard A. (1975) Creaseyite, Cu2Pb2(Fe,Al)2Si5O17·6H2O a new mineral from Arizona and Sonora. Mineralogical Magazine, 40 (311) 227-231 doi:10.1180/minmag.1975.040.311.02 |
| ⓘ Crocoite Formula: PbCr6+O4 |
| ⓘ Cuprite Formula: Cu2O Description: Rare crystalline masses associated with chalcotrichite variety. |
| ⓘ Cuprite var. Chalcotrichite Formula: Cu2O |
| ⓘ Cyanotrichite Formula: Cu4Al2(SO4)(OH)12 · 2H2O References: |
| ⓘ Descloizite Formula: PbZn(VO4)(OH) |
| ⓘ Descloizite var. Copper-bearing Descloizite Formula: Pb(Zn,Cu)VO4OH |
| ⓘ Devilline Formula: CaCu4(SO4)2(OH)6 · 3H2O Description: Occurs as a scaly alteration of powdery djurleite. |
| ⓘ Diaboleite Formula: Pb2CuCl2(OH)4 |
| ⓘ Dioptase Formula: CuSiO3 · H2O |
| ⓘ Djurleite Formula: Cu31S16 Description: Occurs replacing galena and being replaced by devilline. |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ✪ Evanichite (TL) Formula: Pb6Cr3+(Cr6+O4)2(SO4)(OH)7FCl Type Locality: |
| ⓘ Fluorite Formula: CaF2 Localities: Habit: Micro-crystals (lower levels); crystals to 1 inch (2.5 cm) on edge. |
| ⓘ Fornacite Formula: Pb2Cu(CrO4)(AsO4)(OH) Habit: Crystals to several mm long & as fiber-like micro-crystals References: |
| ⓘ Fraipontite Formula: (Zn,Al)3((Si,Al)2O5)(OH)4 Colour: cream to pale green Description: Cuprian |
| ⓘ Galena Formula: PbS Localities: Description: Occurs in both the sulfide and oxidized zones. |
| ✪ Georgerobinsonite (TL) Formula: Pb4(CrO4)2(OH)2FCl Type Locality: References: Cooper, M. A., Ball, N. A., Hawthorne, F. C., Paar, W. H., Roberts, A. C., Moffatt, E. (2011) Georgerobinsonite, Pb4(CrO4)2(OH)2FCl, a new chromate mineral from the Mammoth - St. Anthony mine, Tiger, Pinal County, Arizona: Description and crystal structure. The Canadian Mineralogist, 49 (3) 865-876 doi:10.3749/canmin.49.3.865 |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Hematite Formula: Fe2O3 Localities: Mammoth-Saint Anthony Mine, St. Anthony deposit, Tiger, Mammoth Mining District, Pinal County, Arizona, USA Collins Mine, Mammoth-Saint Anthony Mine, St. Anthony deposit, Tiger, Mammoth Mining District, Pinal County, Arizona, USA Mohawk Mine, Mammoth-Saint Anthony Mine, St. Anthony deposit, Tiger, Mammoth Mining District, Pinal County, Arizona, USA |
| ⓘ Hematite var. Specularite Formula: Fe2O3 |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O Localities: Collins Mine, Mammoth-Saint Anthony Mine, St. Anthony deposit, Tiger, Mammoth Mining District, Pinal County, Arizona, USA Mammoth-Saint Anthony Mine, St. Anthony deposit, Tiger, Mammoth Mining District, Pinal County, Arizona, USA Mohawk Mine, Mammoth-Saint Anthony Mine, St. Anthony deposit, Tiger, Mammoth Mining District, Pinal County, Arizona, USA |
| ⓘ 'Heulandite Subgroup' Formula: (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O Habit: Twinned micro-crystals |
| ⓘ Hisingerite Formula: Fe3+2(Si2O5)(OH)4 · 2H2O Description: Occurs as the cores of radiating, fibrous creaseyite spherules. |
| ⓘ Hollandite Formula: Ba(Mn4+6Mn3+2)O16 Description: Most widespread manganese oxide mineral, |
| ⓘ Hydrocerussite Formula: Pb3(CO3)2(OH)2 Localities: Habit: Hexagonal, pyramidal; crystals to nearly 1 inch long (world's finest !) Colour: Snow-white |
| ⓘ Iodargyrite Formula: AgI Colour: Pale green Description: Occurs as droplets with caledonite & boleite. |
| ⓘ Iranite Formula: Pb10Cu(CrO4)6(SiO4)2(OH)2 Description: Small crystals on older specimens. |
| ⓘ Kegelite Formula: Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| ⓘ 'K Feldspar' |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 |
| ⓘ Lanarkite Formula: Pb2(SO4)O |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O References: |
| ⓘ Leadhillite Formula: Pb4(CO3)2(SO4)(OH)2 Localities: Habit: Crystals to 1 inch, some prismatic, composed of sectors of monoclinic symmetry; other pseudo-rhombohedral or tabular, composed of 2, 3 or 6 individuals twinned after Artini law. Description: 400 level |
| ⓘ Lepidocrocite ? Formula: Fe3+O(OH) Description: A single specimen is on record. |
| ⓘ 'Limonite' |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 Habit: Excellent; small to large euhedral crystals to 4 inches (10 cm) long References: |
| ✪ Macquartite (TL) Formula: Cu2Pb7(CrO4)4(SiO4)2(OH)2 Type Locality: Description: Occurs on early specimens of dioptase. References: |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Habit: Crystals to 4 inches (10 cm) long. Description: Occurs as pseudomorphs after azurite; powdery masses & micro-crystals. |
| ✪ Mammothite (TL) Formula: Pb6Cu4AlSb5+O2(OH)16Cl4(SO4)2 Type Locality: Habit: Sprays of radial, acicular crystals & flat plates Colour: Bright blue Description: Occurs as plates embedded in anglesite and tufts of acicular crystals. References: |
| ⓘ Matlockite Formula: PbFCl Localities: Habit: Minute Description: 400 level. Occurs on boleite. |
| ⓘ Melanotekite Formula: Pb2Fe3+2(Si2O7)O2 Habit: Minute spherules Colour: Brownish Description: Occurs as spherules on diaboleite. References: |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl Habit: Tiny prismatic to tabular. Colour: Bright orange, canery-yellow Description: Occurs as crusts and coatings of crystals. References: |
| ⓘ Minium Formula: Pb3O4 Description: Powdery coatings on wulfenite crystals. |
| ⓘ Mixite Formula: BiCu6(AsO4)3(OH)6 · 3H2O Habit: Radiating sprays Colour: Pale green Description: Occurs associated with wulfenite & mimetite on barite matrix. |
| ⓘ Mottramite Formula: PbCu(VO4)(OH) Habit: Crusts of small pointed crystals. |
| ⓘ Munakataite Formula: Pb2Cu2(Se4+O3)(SO4)(OH)4 Colour: cyan-blue Description: The Munakataite occurs sparsely on a single thumbnail-sized specimen from Tiger as medium cyan-blue acicular crystals, averaging 0.5 mm in length, and possessing a silky to adamantine luster. The crystals occur intimately associated with altered crystals of Boleite and two generations of Leadhillite crystals. Other associates on the same specimen include a third generation of Leadhillite crystals, Quartz, Cerussite, Djurleite, Covellite, and a number of unidentified, or inadequately identified, species, including a bladed microscopic lead sulphate silicate, with small percentages of zinc and copper—possibly a copper-bearing Queitite. The identification was made on the basis of compositional analysis using energy-dispersive X-ray spectroscopy (EDS), augmented with semi-quantitative wavelength-dispersive X-ray spectroscopy (WDS) for sulfur, and because the sample is consistent with the form and appearance of the species as set forth in the published description of Munakataite in 2008. References: |
| ⓘ Murdochite (TL) Formula: Cu12Pb2O15Cl2 Type Locality: Habit: Tiny octahedra Colour: Black Description: Occurs on surfaces of, and embedded in, plates of wulfenite & on surfaces of fluorite crystals with hemimorphite & willemite. |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Native Copper Formula: Cu |
| ⓘ Native Gold Formula: Au |
| ⓘ Native Silver Formula: Ag |
| ⓘ Native Sulphur Formula: S8 Description: Occurs in small amounts in the oxidized zone. |
| ⓘ Opal Formula: SiO2 · nH2O References: |
| ⓘ Opal var. Hyalite Formula: SiO2 · nH2O References: |
| ⓘ Palygorskite Formula: ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O Description: Occurs in some fault gouge. |
| ⓘ Paralaurionite Formula: PbCl(OH) Localities: Habit: Small, slender, isolated crystals; many are bent Colour: Yellowish-white Description: Occurs as crystals in cavities with cerussite and as coarser crystal aggregates. |
| ⓘ Paratacamite Formula: Cu3(Cu,Zn)(OH)6Cl2 |
| ⓘ Phosgenite Formula: Pb2CO3Cl2 Localities: Habit: Slender prismatic |
| ⓘ Phosphohedyphane Formula: Ca2Pb3(PO4)3Cl |
| ✪ Pinalite (TL) Formula: Pb3WO5Cl2 Type Locality: Habit: Typically as isolated crystals & divergent sprays Description: Occurs in irregular cavities that are pseudomorphic molds of an uncertain precursor; in some places enclosed by chromian leadhillite. |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ Plancheite Formula: Cu8(Si8O22)(OH)4 · H2O Description: Occurs as veinlets and as coatings on chrysocolla. |
| ⓘ Plattnerite Formula: PbO2 |
| ⓘ Plumbonacrite Formula: Pb5O(OH)2(CO3)3 |
| ⓘ Plumbotsumite Formula: Pb13(CO3)6(Si10O27) · 3H2O Colour: White Description: Massive material intergrown with wulfenite. |
| ⓘ Pseudoboleite Formula: Pb31Cu24Cl62(OH)48 |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl Colour: Olive-green Description: Occurs as crystals on mottramite with vanadinite. References: |
| ⓘ Quartz Formula: SiO2 Localities: Description: Occurs as crystals with slender hemimorphite crystals bristling from them on walls of open cavities. |
| ⓘ Quartz var. Agate Formula: SiO2 References: Rolf LuetckeIdentified by Rolf Luetcke: Visual Identification |
| ⓘ Quartz var. Amethyst Formula: SiO2 Habit: Pinacoidal Colour: Dark purple Description: Occurs lining cavities in brecciated country rock. In profile, the massive quartz from the cavity walls to the crystal tips is often banded from snow-white to purple with purple pinacoids. |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 References: |
| ⓘ Queitite Formula: Pb4Zn2(SO4)(SiO4)(Si2O7) Description: Microscopic crystals observed associated with Quartz when analysing samples with an electron microprobe/SEM. Other associates include Leadhillite, Boleite, and Mammothite. References: |
| ⓘ Ramsdellite Formula: Mn4+O2 Description: Occurs as pseudomorphs after groutite micro-crystals. |
| ⓘ Rosasite Formula: (Cu,Zn)2(CO3)(OH)2 |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 |
| ⓘ Serpierite Formula: Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| ⓘ Shattuckite Formula: Cu5(Si2O6)2(OH)2 |
| ⓘ Smithsonite Formula: ZnCO3 Description: Occurs as crusts and porous masses & crude crystals; sometimes occurs with wulfenite. |
| ⓘ Sphalerite Formula: ZnS Localities: Description: Occurs on the lower levels. |
| ⓘ 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ Stolzite Formula: Pb(WO4) Habit: Crystal aggregates up to 1.5 mm across Colour: Yellow Description: Several yellow crystalline aggregates of an unidentified mineral were spotted on a specimen of Azurite and Cerussite from this mine. An SEM-EDS analysis was performed on a grain which detected only Lead and Tungsten. The morphology is consistent with Stolzite. |
| ⓘ Surite Formula: (Pb,Ca)3(Al,Fe2+,Mg)2((Si,Al)4O10)(CO3)2(OH)2 |
| ⓘ Tenorite Formula: CuO Colour: Coal-black Description: As nodules surrounded by thin shells of chrysocolla. References: |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
| ⓘ Tsumebite Formula: Pb2Cu(PO4)(SO4)(OH) Habit: Spherules Colour: Yellow-green |
| ⓘ Vanadinite Formula: Pb5(VO4)3Cl |
| ⓘ Vauquelinite Formula: Pb2Cu(CrO4)(PO4)(OH) References: |
| ✪ Wherryite (TL) Formula: Pb7Cu2(SO4)4(SiO4)2(OH)2 Type Locality: Description: Occurs in small vugs on 760 level with associated minerals. |
| ⓘ Willemite Formula: Zn2SiO4 Habit: Small rhombs; barrel-shaped; acicular Colour: Colorless; bluish Fluorescence: Creamy-yellow (SW UV) Description: Occurs on wulfenite and vanadinite. Also, occurs in cavities lined by amethyst crystals in the zone between oreshoots at surface. |
| ⓘ Wulfenite Formula: Pb(MoO4) Localities: Collins Mine, Mammoth-Saint Anthony Mine, St. Anthony deposit, Tiger, Mammoth Mining District, Pinal County, Arizona, USA Mammoth-Saint Anthony Mine, St. Anthony deposit, Tiger, Mammoth Mining District, Pinal County, Arizona, USA Mohawk Mine, Mammoth-Saint Anthony Mine, St. Anthony deposit, Tiger, Mammoth Mining District, Pinal County, Arizona, USA |
| ⓘ Wulfenite var. Tungsten-bearing Wulfenite Formula: Pb(MoO4) Colour: Light yellow to bright red Description: Occurs as crystals containing tungsten. |
| ⓘ Wurtzite Formula: (Zn,Fe)S Description: Reported to occur below the 900 level. |
| ✪ Yedlinite (TL) Formula: Pb6Cr3+Cl6(O,OH,H2O)8 Type Locality: Habit: Rhombohedral crystals to 1 mm long Colour: Red-violet Description: Occurs on only a few specimens. References: McLean, W. John, Bideaux, Richard A., Thomssen, and Richard W. (1974) Yedlinite, a new mineral from the Mammoth Mine, Tiger, Arizona. American Mineralogist, 59 (11-12) 1157-1159 |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Djurleite | 2.BA.05 | Cu31S16 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Wurtzite | 2.CB.45 | (Zn,Fe)S |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| Group 3 - Halides | |||
| ⓘ | Iodargyrite | 3.AA.10 | AgI |
| ⓘ | Bromargyrite | 3.AA.15 | AgBr |
| ⓘ | Chlorargyrite | 3.AA.15 | AgCl |
| ⓘ | var. Bromine-bearing Chlorargyrite | 3.AA.15 | Ag(Cl,Br) |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Atacamite | 3.DA.10a | Cu2(OH)3Cl |
| ⓘ | Clinoatacamite | 3.DA.10b | Cu2(OH)3Cl |
| ⓘ | Paratacamite | 3.DA.10c | Cu3(Cu,Zn)(OH)6Cl2 |
| ⓘ | Connellite | 3.DA.25 | Cu19(SO4)(OH)32Cl4 · 3H2O |
| ⓘ | Diaboleite | 3.DB.05 | Pb2CuCl2(OH)4 |
| ⓘ | Pseudoboleite | 3.DB.10 | Pb31Cu24Cl62(OH)48 |
| ⓘ | Boleite | 3.DB.15 | KPb26Ag9Cu24(OH)48Cl62 |
| ⓘ | Bideauxite (TL) | 3.DB.25 | Pb2AgCl3(F,OH)2 |
| ⓘ | Murdochite (TL) | 3.DB.45 | Cu12Pb2O15Cl2 |
| ⓘ | Yedlinite (TL) | 3.DB.50 | Pb6Cr3+Cl6(O,OH,H2O)8 |
| ⓘ | Paralaurionite | 3.DC.05 | PbCl(OH) |
| ⓘ | Matlockite | 3.DC.25 | PbFCl |
| ⓘ | Pinalite (TL) | 3.DC.55 | Pb3WO5Cl2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Cuprite var. Chalcotrichite | 4.AA.10 | Cu2O |
| ⓘ | 4.AA.10 | Cu2O | |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Minium | 4.BD.05 | Pb3O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | var. Specularite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz var. Agate | 4.DA.05 | SiO2 |
| ⓘ | var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | var. Hyalite | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Plattnerite | 4.DB.05 | PbO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Ramsdellite | 4.DB.15a | Mn4+O2 |
| ⓘ | Hollandite | 4.DK.05a | Ba(Mn4+6Mn3+2)O16 |
| ⓘ | Lepidocrocite ? | 4.FE.15 | Fe3+O(OH) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Rosasite | 5.BA.10 | (Cu,Zn)2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Hydrocerussite | 5.BE.10 | Pb3(CO3)2(OH)2 |
| ⓘ | Plumbonacrite | 5.BE.15 | Pb5O(OH)2(CO3)3 |
| ⓘ | Phosgenite | 5.BE.20 | Pb2CO3Cl2 |
| ⓘ | Leadhillite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Alunite | 7.BC.10 | KAl3(SO4)2(OH)6 |
| ⓘ | Beaverite-(Cu) | 7.BC.10 | Pb(Fe3+2Cu)(SO4)2(OH)6 |
| ⓘ | Caledonite | 7.BC.50 | Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ | Wherryite (TL) | 7.BC.55 | Pb7Cu2(SO4)4(SiO4)2(OH)2 |
| ⓘ | Mammothite (TL) | 7.BC.60 | Pb6Cu4AlSb5+O2(OH)16Cl4(SO4)2 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Munakataite | 7.BC.65 | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| ⓘ | Evanichite (TL) | 7.BD. | Pb6Cr3+(Cr6+O4)2(SO4)(OH)7FCl |
| ⓘ | Lanarkite | 7.BD.40 | Pb2(SO4)O |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Devilline | 7.DD.30 | CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Serpierite | 7.DD.30 | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| ⓘ | Cyanotrichite | 7.DE.10 | Cu4Al2(SO4)(OH)12 · 2H2O |
| ⓘ | Crocoite | 7.FA.20 | PbCr6+O4 |
| ⓘ | Georgerobinsonite (TL) | 7.FB.05 | Pb4(CrO4)2(OH)2FCl |
| ⓘ | Vauquelinite | 7.FC.05 | Pb2Cu(CrO4)(PO4)(OH) |
| ⓘ | Fornacite | 7.FC.10 | Pb2Cu(CrO4)(AsO4)(OH) |
| ⓘ | Iranite | 7.FC.15 | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| ⓘ | Stolzite | 7.GA.05 | Pb(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| ⓘ | var. Tungsten-bearing Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Tsumebite | 8.BG.05 | Pb2Cu(PO4)(SO4)(OH) |
| ⓘ | Descloizite var. Copper-bearing Descloizite | 8.BH.40 | Pb(Zn,Cu)VO4OH |
| ⓘ | 8.BH.40 | PbZn(VO4)(OH) | |
| ⓘ | Mottramite | 8.BH.40 | PbCu(VO4)(OH) |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Vanadinite | 8.BN.05 | Pb5(VO4)3Cl |
| ⓘ | Phosphohedyphane | 8.BN.05 | Ca2Pb3(PO4)3Cl |
| ⓘ | Mixite | 8.DL.15 | BiCu6(AsO4)3(OH)6 · 3H2O |
| Group 9 - Silicates | |||
| ⓘ | Willemite | 9.AA.05 | Zn2SiO4 |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Melanotekite | 9.BE.80 | Pb2Fe3+2(Si2O7)O2 |
| ⓘ | Queitite | 9.BF.20 | Pb4Zn2(SO4)(SiO4)(Si2O7) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Bobmeyerite (TL) | 9.CF. | Pb4(Al3Cu)(Si4O12)(S0.5Si0.5O4)(OH)7Cl(H2O)3 |
| ⓘ | Dioptase | 9.CJ.30 | CuSiO3 · H2O |
| ⓘ | Shattuckite | 9.DB.40 | Cu5(Si2O6)2(OH)2 |
| ⓘ | Alamosite | 9.DO.20 | PbSiO3 |
| ⓘ | Plancheite | 9.DP.55 | Cu8(Si8O22)(OH)4 · H2O |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Surite | 9.EC.75 | (Pb,Ca)3(Al,Fe2+,Mg)2((Si,Al)4O10)(CO3)2(OH)2 |
| ⓘ | Kegelite | 9.EC.80 | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| ⓘ | Hisingerite | 9.ED.10 | Fe3+2(Si2O5)(OH)4 · 2H2O |
| ⓘ | Amesite | 9.ED.15 | Mg2Al(AlSiO5)(OH)4 |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Fraipontite | 9.ED.15 | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| ⓘ | Allophane | 9.ED.20 | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Palygorskite | 9.EE.20 | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Macquartite (TL) | 9.HH.05 | Cu2Pb7(CrO4)4(SiO4)2(OH)2 |
| ⓘ | Creaseyite (TL) | 9.HH.15 | Pb2Cu2Fe3+2(Si4.67Al0.33)O15.33(OH)3 · H2O |
| ⓘ | Plumbotsumite | 9.HH.20 | Pb13(CO3)6(Si10O27) · 3H2O |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Heulandite Subgroup' | - | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Chromium-bearing Leadhillite' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| H | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| H | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Atacamite | Cu2(OH)3Cl |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| H | ⓘ Bideauxite | Pb2AgCl3(F,OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinoatacamite | Cu2(OH)3Cl |
| H | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| H | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| H | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| H | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| H | ⓘ Descloizite | PbZn(VO4)(OH) |
| H | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Diaboleite | Pb2CuCl2(OH)4 |
| H | ⓘ Dioptase | CuSiO3 · H2O |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| H | ⓘ Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| H | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| H | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| H | ⓘ Iranite | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| H | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Lepidocrocite | Fe3+O(OH) |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Macquartite | Cu2Pb7(CrO4)4(SiO4)2(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Mammothite | Pb6Cu4AlSb5+O2(OH)16Cl4(SO4)2 |
| H | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| H | ⓘ Mottramite | PbCu(VO4)(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| H | ⓘ Paralaurionite | PbCl(OH) |
| H | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| H | ⓘ Plumbonacrite | Pb5O(OH)2(CO3)3 |
| H | ⓘ Plumbotsumite | Pb13(CO3)6(Si10O27) · 3H2O |
| H | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| H | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| H | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| H | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| H | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | ⓘ Surite | (Pb,Ca)3(Al,Fe2+,Mg)2((Si,Al)4O10)(CO3)2(OH)2 |
| H | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| H | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| H | ⓘ Wherryite | Pb7Cu2(SO4)4(SiO4)2(OH)2 |
| H | ⓘ Yedlinite | Pb6Cr3+Cl6(O,OH,H2O)8 |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| H | ⓘ Opal var. Hyalite | SiO2 · nH2O |
| H | ⓘ Georgerobinsonite | Pb4(CrO4)2(OH)2FCl |
| H | ⓘ Bobmeyerite | Pb4(Al3Cu)(Si4O12)(S0.5Si0.5O4)(OH)7Cl(H2O)3 |
| H | ⓘ Evanichite | Pb6Cr3+(Cr6+O4)2(SO4)(OH)7FCl |
| B | Boron | |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| C | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| C | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Phosgenite | Pb2CO3Cl2 |
| C | ⓘ Plumbonacrite | Pb5O(OH)2(CO3)3 |
| C | ⓘ Plumbotsumite | Pb13(CO3)6(Si10O27) · 3H2O |
| C | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Surite | (Pb,Ca)3(Al,Fe2+,Mg)2((Si,Al)4O10)(CO3)2(OH)2 |
| O | Oxygen | |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Quartz var. Agate | SiO2 |
| O | ⓘ Alamosite | PbSiO3 |
| O | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| O | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| O | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Atacamite | Cu2(OH)3Cl |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| O | ⓘ Bideauxite | Pb2AgCl3(F,OH)2 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinoatacamite | Cu2(OH)3Cl |
| O | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| O | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| O | ⓘ Crocoite | PbCr6+O4 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| O | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| O | ⓘ Descloizite | PbZn(VO4)(OH) |
| O | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Diaboleite | Pb2CuCl2(OH)4 |
| O | ⓘ Dioptase | CuSiO3 · H2O |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| O | ⓘ Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| O | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| O | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| O | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| O | ⓘ Iranite | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| O | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| O | ⓘ Lanarkite | Pb2(SO4)O |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Lepidocrocite | Fe3+O(OH) |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Macquartite | Cu2Pb7(CrO4)4(SiO4)2(OH)2 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Mammothite | Pb6Cu4AlSb5+O2(OH)16Cl4(SO4)2 |
| O | ⓘ Melanotekite | Pb2Fe23+(Si2O7)O2 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Minium | Pb3O4 |
| O | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| O | ⓘ Mottramite | PbCu(VO4)(OH) |
| O | ⓘ Murdochite | Cu12Pb2O15Cl2 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| O | ⓘ Paralaurionite | PbCl(OH) |
| O | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| O | ⓘ Phosgenite | Pb2CO3Cl2 |
| O | ⓘ Pinalite | Pb3WO5Cl2 |
| O | ⓘ Plumbonacrite | Pb5O(OH)2(CO3)3 |
| O | ⓘ Plumbotsumite | Pb13(CO3)6(Si10O27) · 3H2O |
| O | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| O | ⓘ Plattnerite | PbO2 |
| O | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Queitite | Pb4Zn2(SO4)(SiO4)(Si2O7) |
| O | ⓘ Ramsdellite | Mn4+O2 |
| O | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| O | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | ⓘ Stolzite | Pb(WO4) |
| O | ⓘ Surite | (Pb,Ca)3(Al,Fe2+,Mg)2((Si,Al)4O10)(CO3)2(OH)2 |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| O | ⓘ Vanadinite | Pb5(VO4)3Cl |
| O | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| O | ⓘ Wherryite | Pb7Cu2(SO4)4(SiO4)2(OH)2 |
| O | ⓘ Willemite | Zn2SiO4 |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Yedlinite | Pb6Cr3+Cl6(O,OH,H2O)8 |
| O | ⓘ Hematite var. Specularite | Fe2O3 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Wulfenite var. Tungsten-bearing Wulfenite | Pb(MoO4) |
| O | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| O | ⓘ Opal var. Hyalite | SiO2 · nH2O |
| O | ⓘ Georgerobinsonite | Pb4(CrO4)2(OH)2FCl |
| O | ⓘ Bobmeyerite | Pb4(Al3Cu)(Si4O12)(S0.5Si0.5O4)(OH)7Cl(H2O)3 |
| O | ⓘ Evanichite | Pb6Cr3+(Cr6+O4)2(SO4)(OH)7FCl |
| F | Fluorine | |
| F | ⓘ Bideauxite | Pb2AgCl3(F,OH)2 |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Matlockite | PbFCl |
| F | ⓘ Georgerobinsonite | Pb4(CrO4)2(OH)2FCl |
| F | ⓘ Evanichite | Pb6Cr3+(Cr6+O4)2(SO4)(OH)7FCl |
| Na | Sodium | |
| Na | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Mg | ⓘ Surite | (Pb,Ca)3(Al,Fe2+,Mg)2((Si,Al)4O10)(CO3)2(OH)2 |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Al | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| Al | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| Al | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| Al | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Al | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| Al | ⓘ Mammothite | Pb6Cu4AlSb5+O2(OH)16Cl4(SO4)2 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Al | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | ⓘ Surite | (Pb,Ca)3(Al,Fe2+,Mg)2((Si,Al)4O10)(CO3)2(OH)2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Bobmeyerite | Pb4(Al3Cu)(Si4O12)(S0.5Si0.5O4)(OH)7Cl(H2O)3 |
| Si | Silicon | |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Quartz var. Agate | SiO2 |
| Si | ⓘ Alamosite | PbSiO3 |
| Si | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Si | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| Si | ⓘ Dioptase | CuSiO3 · H2O |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Si | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Si | ⓘ Iranite | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| Si | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| Si | ⓘ Macquartite | Cu2Pb7(CrO4)4(SiO4)2(OH)2 |
| Si | ⓘ Melanotekite | Pb2Fe23+(Si2O7)O2 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Si | ⓘ Plumbotsumite | Pb13(CO3)6(Si10O27) · 3H2O |
| Si | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Queitite | Pb4Zn2(SO4)(SiO4)(Si2O7) |
| Si | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | ⓘ Surite | (Pb,Ca)3(Al,Fe2+,Mg)2((Si,Al)4O10)(CO3)2(OH)2 |
| Si | ⓘ Wherryite | Pb7Cu2(SO4)4(SiO4)2(OH)2 |
| Si | ⓘ Willemite | Zn2SiO4 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Opal var. Hyalite | SiO2 · nH2O |
| Si | ⓘ Bobmeyerite | Pb4(Al3Cu)(Si4O12)(S0.5Si0.5O4)(OH)7Cl(H2O)3 |
| P | Phosphorus | |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| P | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| P | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| S | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Djurleite | Cu31S16 |
| S | ⓘ Galena | PbS |
| S | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| S | ⓘ Lanarkite | Pb2(SO4)O |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Mammothite | Pb6Cu4AlSb5+O2(OH)16Cl4(SO4)2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Queitite | Pb4Zn2(SO4)(SiO4)(Si2O7) |
| S | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| S | ⓘ Wherryite | Pb7Cu2(SO4)4(SiO4)2(OH)2 |
| S | ⓘ Wurtzite | (Zn,Fe)S |
| S | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| S | ⓘ Bobmeyerite | Pb4(Al3Cu)(Si4O12)(S0.5Si0.5O4)(OH)7Cl(H2O)3 |
| S | ⓘ Evanichite | Pb6Cr3+(Cr6+O4)2(SO4)(OH)7FCl |
| Cl | Chlorine | |
| Cl | ⓘ Atacamite | Cu2(OH)3Cl |
| Cl | ⓘ Bideauxite | Pb2AgCl3(F,OH)2 |
| Cl | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Cl | ⓘ Chlorargyrite | AgCl |
| Cl | ⓘ Clinoatacamite | Cu2(OH)3Cl |
| Cl | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cl | ⓘ Diaboleite | Pb2CuCl2(OH)4 |
| Cl | ⓘ Chlorargyrite var. Bromine-bearing Chlorargyrite | Ag(Cl,Br) |
| Cl | ⓘ Mammothite | Pb6Cu4AlSb5+O2(OH)16Cl4(SO4)2 |
| Cl | ⓘ Matlockite | PbFCl |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Murdochite | Cu12Pb2O15Cl2 |
| Cl | ⓘ Paralaurionite | PbCl(OH) |
| Cl | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Cl | ⓘ Phosgenite | Pb2CO3Cl2 |
| Cl | ⓘ Pinalite | Pb3WO5Cl2 |
| Cl | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cl | ⓘ Yedlinite | Pb6Cr3+Cl6(O,OH,H2O)8 |
| Cl | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Cl | ⓘ Georgerobinsonite | Pb4(CrO4)2(OH)2FCl |
| Cl | ⓘ Bobmeyerite | Pb4(Al3Cu)(Si4O12)(S0.5Si0.5O4)(OH)7Cl(H2O)3 |
| Cl | ⓘ Evanichite | Pb6Cr3+(Cr6+O4)2(SO4)(OH)7FCl |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| K | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Ca | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Surite | (Pb,Ca)3(Al,Fe2+,Mg)2((Si,Al)4O10)(CO3)2(OH)2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| V | Vanadium | |
| V | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| V | ⓘ Descloizite | PbZn(VO4)(OH) |
| V | ⓘ Mottramite | PbCu(VO4)(OH) |
| V | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cr | Chromium | |
| Cr | ⓘ Crocoite | PbCr6+O4 |
| Cr | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Cr | ⓘ Iranite | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| Cr | ⓘ Macquartite | Cu2Pb7(CrO4)4(SiO4)2(OH)2 |
| Cr | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| Cr | ⓘ Yedlinite | Pb6Cr3+Cl6(O,OH,H2O)8 |
| Cr | ⓘ Georgerobinsonite | Pb4(CrO4)2(OH)2FCl |
| Cr | ⓘ Evanichite | Pb6Cr3+(Cr6+O4)2(SO4)(OH)7FCl |
| Mn | Manganese | |
| Mn | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Ramsdellite | Mn4+O2 |
| Fe | Iron | |
| Fe | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Fe | ⓘ Lepidocrocite | Fe3+O(OH) |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Melanotekite | Pb2Fe23+(Si2O7)O2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Surite | (Pb,Ca)3(Al,Fe2+,Mg)2((Si,Al)4O10)(CO3)2(OH)2 |
| Fe | ⓘ Wurtzite | (Zn,Fe)S |
| Fe | ⓘ Hematite var. Specularite | Fe2O3 |
| Cu | Copper | |
| Cu | ⓘ Atacamite | Cu2(OH)3Cl |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Cu | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Clinoatacamite | Cu2(OH)3Cl |
| Cu | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| Cu | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Diaboleite | Pb2CuCl2(OH)4 |
| Cu | ⓘ Dioptase | CuSiO3 · H2O |
| Cu | ⓘ Djurleite | Cu31S16 |
| Cu | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Cu | ⓘ Iranite | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Macquartite | Cu2Pb7(CrO4)4(SiO4)2(OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Mammothite | Pb6Cu4AlSb5+O2(OH)16Cl4(SO4)2 |
| Cu | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| Cu | ⓘ Mottramite | PbCu(VO4)(OH) |
| Cu | ⓘ Murdochite | Cu12Pb2O15Cl2 |
| Cu | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Cu | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| Cu | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| Cu | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Cu | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| Cu | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| Cu | ⓘ Wherryite | Pb7Cu2(SO4)4(SiO4)2(OH)2 |
| Cu | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| Cu | ⓘ Bobmeyerite | Pb4(Al3Cu)(Si4O12)(S0.5Si0.5O4)(OH)7Cl(H2O)3 |
| Zn | Zinc | |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| Zn | ⓘ Descloizite | PbZn(VO4)(OH) |
| Zn | ⓘ Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Zn | ⓘ Queitite | Pb4Zn2(SO4)(SiO4)(Si2O7) |
| Zn | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Zn | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Willemite | Zn2SiO4 |
| Zn | ⓘ Wurtzite | (Zn,Fe)S |
| As | Arsenic | |
| As | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| Se | Selenium | |
| Se | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| Br | Bromine | |
| Br | ⓘ Bromargyrite | AgBr |
| Br | ⓘ Chlorargyrite var. Bromine-bearing Chlorargyrite | Ag(Cl,Br) |
| Mo | Molybdenum | |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Mo | ⓘ Wulfenite var. Tungsten-bearing Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Bideauxite | Pb2AgCl3(F,OH)2 |
| Ag | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Ag | ⓘ Bromargyrite | AgBr |
| Ag | ⓘ Chlorargyrite | AgCl |
| Ag | ⓘ Chlorargyrite var. Bromine-bearing Chlorargyrite | Ag(Cl,Br) |
| Ag | ⓘ Iodargyrite | AgI |
| Ag | ⓘ Native Silver | Ag |
| Sb | Antimony | |
| Sb | ⓘ Mammothite | Pb6Cu4AlSb5+O2(OH)16Cl4(SO4)2 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| I | Iodine | |
| I | ⓘ Iodargyrite | AgI |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| W | Tungsten | |
| W | ⓘ Pinalite | Pb3WO5Cl2 |
| W | ⓘ Stolzite | Pb(WO4) |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Alamosite | PbSiO3 |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Pb | ⓘ Bideauxite | Pb2AgCl3(F,OH)2 |
| Pb | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Pb | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| Pb | ⓘ Crocoite | PbCr6+O4 |
| Pb | ⓘ Descloizite var. Copper-bearing Descloizite | Pb(Zn,Cu)VO4OH |
| Pb | ⓘ Descloizite | PbZn(VO4)(OH) |
| Pb | ⓘ Diaboleite | Pb2CuCl2(OH)4 |
| Pb | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| Pb | ⓘ Iranite | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| Pb | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| Pb | ⓘ Lanarkite | Pb2(SO4)O |
| Pb | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Macquartite | Cu2Pb7(CrO4)4(SiO4)2(OH)2 |
| Pb | ⓘ Mammothite | Pb6Cu4AlSb5+O2(OH)16Cl4(SO4)2 |
| Pb | ⓘ Matlockite | PbFCl |
| Pb | ⓘ Melanotekite | Pb2Fe23+(Si2O7)O2 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Minium | Pb3O4 |
| Pb | ⓘ Mottramite | PbCu(VO4)(OH) |
| Pb | ⓘ Murdochite | Cu12Pb2O15Cl2 |
| Pb | ⓘ Paralaurionite | PbCl(OH) |
| Pb | ⓘ Phosgenite | Pb2CO3Cl2 |
| Pb | ⓘ Pinalite | Pb3WO5Cl2 |
| Pb | ⓘ Plumbonacrite | Pb5O(OH)2(CO3)3 |
| Pb | ⓘ Plumbotsumite | Pb13(CO3)6(Si10O27) · 3H2O |
| Pb | ⓘ Plattnerite | PbO2 |
| Pb | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Queitite | Pb4Zn2(SO4)(SiO4)(Si2O7) |
| Pb | ⓘ Stolzite | Pb(WO4) |
| Pb | ⓘ Surite | (Pb,Ca)3(Al,Fe2+,Mg)2((Si,Al)4O10)(CO3)2(OH)2 |
| Pb | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| Pb | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Pb | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| Pb | ⓘ Wherryite | Pb7Cu2(SO4)4(SiO4)2(OH)2 |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Yedlinite | Pb6Cr3+Cl6(O,OH,H2O)8 |
| Pb | ⓘ Wulfenite var. Tungsten-bearing Wulfenite | Pb(MoO4) |
| Pb | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Pb | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| Pb | ⓘ Georgerobinsonite | Pb4(CrO4)2(OH)2FCl |
| Pb | ⓘ Bobmeyerite | Pb4(Al3Cu)(Si4O12)(S0.5Si0.5O4)(OH)7Cl(H2O)3 |
| Pb | ⓘ Evanichite | Pb6Cr3+(Cr6+O4)2(SO4)(OH)7FCl |
| Bi | Bismuth | |
| Bi | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
Other Databases
| Link to USGS MRDS: | 10008541 |
|---|
Mindat Articles
A New Occurrence of Munakataite, a Rare Selenium Containing Mineral Species by Robert MeyerLocalities in this Region
- Arizona
- Pinal County
- Mammoth Mining District
- Tiger
- St. Anthony deposit
- Mammoth-Saint Anthony Mine
- St. Anthony deposit
- Tiger
- Mammoth Mining District
- Pinal County
Other Regions, Features and Areas containing this locality
North AmericaContinent
- Sonoran DesertDesert
- San Pedro river valleyValley
North America PlateTectonic Plate
- Basin and Range BasinsBasin
- Mazatzal DomainDomain
- Southern Basin and RangeWide Rift
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Galbraith, F. W., Kuhn, Truman H. (1940) A new occurrence of dioptase in Arizona. American Mineralogist, 25 (10). 708-710
Palache, Charles (1941) Diaboleite from Mammoth Mine, Tiger, Arizona. American Mineralogist, 26 (10) 605-612
Fahey, Joseph J., Daggett, E. B., Gordon, Samuel G. (1950) Wherryite, a new mineral from Mammoth Mine, Arizona. American Mineralogist, 35 (1-2) 93-98
Palache, Charles (1950) Paralaurionite. Mineralogical Magazine and Journal of the Mineralogical Society, 29 (211) 341-345 doi:10.1180/minmag.1950.029.211.10
Fahey, Joseph J. (1955) Murdochite, a new copper lead oxide mineral. American Mineralogist, 40 (9-10) 905-906
Williams, Sidney A. (1970) Bideauxite, a new Arizona mineral. Mineralogical Magazine, 37 (290) 637-640 doi:10.1180/minmag.1970.037.290.01
Kipfer, A. (1974) Ein neues Hobby: Kleinmineralien sammeln und präparieren. Franckh'sche Verlagshandlung, W. Keller & Co., Stuttgart, 64 pp.[cover photo shows prismatic dioptase crystals associated with white cerussite crystals from the locality]
Wood, Michael M., McLean, W. John, Laughon, and Robert B. (1974) The crystal structure and composition of yedlinite. American Mineralogist, 59 (11-12) 1160-1165
McLean, W. John, Bideaux, Richard A., Thomssen, and Richard W. (1974) Yedlinite, a new mineral from the Mammoth Mine, Tiger, Arizona. American Mineralogist, 59 (11-12) 1157-1159
Williams, Sidney A., Bideaux, Richard A. (1975) Creaseyite, Cu2Pb2(Fe,Al)2Si5O17·6H2O a new mineral from Arizona and Sonora. Mineralogical Magazine, 40 (311) 227-231 doi:10.1180/minmag.1975.040.311.02
Panczner, William D. (1982) The Mammoth- St. Anthony Mine Tiger, Arizona. Rocks & Minerals, 57 (1). doi:10.1080/00357529.1982.11764519
Dunn, Pete J., Grice, Joel D., Bideaux, Richard A. (1989) Pinalite, a new lead tungsten chloride mineral from the Mammoth mine, Pinal County, Arizona. American Mineralogist, 74 (7-8) 934-935
Quick NavTopCommoditiesMineral ListOther DatabasesArticlesLocalities in RegionOther RegionsReferences






Mammoth-Saint Anthony Mine, St. Anthony deposit, Tiger, Mammoth Mining District, Pinal County, Arizona, USA