Lục Yên District, Yên Bái Province, Vietnami
| Regional Level Types | |
|---|---|
| Lục Yên District | District |
| Yên Bái Province | Province |
| Vietnam | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Other Languages:
Simplified Chinese:
陸安縣, 安沛省, 越南
Vietnamese:
Lục Yên, Yên Bái, Việt Nam
Cebuano:
Huyện Lục Yên, Tỉnh Yên Bái, Vietnam
Japanese:
ルックイエン県, イエンバイ省, ベトナム
Korean:
룩옌현, 옌바이성, 베트남
Minnan / Hokkien-Taiwanese:
Lục Yên Koān, Yên Bái, Oa̍t-lâm
There are numerous quarries spread along a 12 km line in this area, all generally labelled "Luc Yen", although some should probably be renamed.
Chauviré et al. (2015) give a good overview of the geology in the Luc Yen area:
The gem deposits are hosted by platform carbonates metamorphosed to the amphibolite facies. Near Luc Yen, these marbles occur in the Lo Gam tectonic zone in the Cambrian Thac Ba and An Phu metasedimentary sequences. The up to 300 m thick marble units are intercalated with biotite-garnet-sillimanite or -kyanite gneisses and granitoids. The Lo Gam zone is limited by two left-lateral faults that belong to the Red River Shear Zone and is intruded by Triassic granitoids.
The marble horizons show different parageneses, and Van Long et al. (2018) publish data showing that the spinel is Permian (256 Ma) and the ruby Triassic (38 Ma), both having seen similar metamorphic conditions. They refer to Hauzenberger et al. (2001), which considered a minimum temperature of about 700 °C for the formation of spinel based on the mineral assemblage Chu-Cal-Fo-Dol-Spl at water-rich fluid composition and compared it to the retrograde temperatures for the formation of ruby between 620 and 670 °C.
Humite-group minerals are found in Mg-rich associations, consisting of calcite, dolomite, spinel, forsterite, clinohumite, apatite, margarite, pargasite, chlorite, ± graphite, ± pyrite, ± pyrrhotite. It is believed (Garnier et al., 2008) that the marble horizons were metamorphosed as closed systems, i.e., that no fluid or metasomatic element influx took place. The Mg, Al, and other elements needed to form the various minerals originated as aluminous clay, mafic volcanics (ash?), and evaporite layers within the Cambrian sediments.
Note on the mineral list: All of the analysed 'fluor-cannilloites' are pargasite (see http://www.mindat.org/mesg-106-259756.html, http://www.mindat.org/mesg-7-69925.html, and http://www.mindat.org/mesg-7-198029.html). Hauzenberger et al. (2005) report intense green pargasite in association with red spinel from Luc Yen. This pargasite has been confirmed by EPMA and single-crystal XRD. Originally, these specimens were sold as 'fluor-cannilloite' coming from Yuang Yang in China.
Chauviré et al. (2015) give a good overview of the geology in the Luc Yen area:
“The rich tectonic history of Southeast Asia is inherited from several deformation episodes related to the closure of the Paleo-Tethys Ocean and, later, to the Himalayan orogeny. The geology of northern Vietnam is dominated by metamorphic rocks inherited from these two major orogenic events. The first one, the Indosinian orogeny, led to the collision of the main shields (Yangtze and Indochina) during the Permo-Triassic at about 240–245 Ma. In the later orogeny, the Himalayan collision during the Tertiary period, the terrains were strongly reworked.”
The gem deposits are hosted by platform carbonates metamorphosed to the amphibolite facies. Near Luc Yen, these marbles occur in the Lo Gam tectonic zone in the Cambrian Thac Ba and An Phu metasedimentary sequences. The up to 300 m thick marble units are intercalated with biotite-garnet-sillimanite or -kyanite gneisses and granitoids. The Lo Gam zone is limited by two left-lateral faults that belong to the Red River Shear Zone and is intruded by Triassic granitoids.
The marble horizons show different parageneses, and Van Long et al. (2018) publish data showing that the spinel is Permian (256 Ma) and the ruby Triassic (38 Ma), both having seen similar metamorphic conditions. They refer to Hauzenberger et al. (2001), which considered a minimum temperature of about 700 °C for the formation of spinel based on the mineral assemblage Chu-Cal-Fo-Dol-Spl at water-rich fluid composition and compared it to the retrograde temperatures for the formation of ruby between 620 and 670 °C.
Humite-group minerals are found in Mg-rich associations, consisting of calcite, dolomite, spinel, forsterite, clinohumite, apatite, margarite, pargasite, chlorite, ± graphite, ± pyrite, ± pyrrhotite. It is believed (Garnier et al., 2008) that the marble horizons were metamorphosed as closed systems, i.e., that no fluid or metasomatic element influx took place. The Mg, Al, and other elements needed to form the various minerals originated as aluminous clay, mafic volcanics (ash?), and evaporite layers within the Cambrian sediments.
Note on the mineral list: All of the analysed 'fluor-cannilloites' are pargasite (see http://www.mindat.org/mesg-106-259756.html, http://www.mindat.org/mesg-7-69925.html, and http://www.mindat.org/mesg-7-198029.html). Hauzenberger et al. (2005) report intense green pargasite in association with red spinel from Luc Yen. This pargasite has been confirmed by EPMA and single-crystal XRD. Originally, these specimens were sold as 'fluor-cannilloite' coming from Yuang Yang in China.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities60 valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) References: |
| ⓘ Albite var. Cleavelandite Formula: Na(AlSi3O8) |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5(T8O22)W2 References: Krivovichev, Vladimir G., Kuksa, Katherine A., Sokolov, Pavel B., Marakhovskaya, Olga Yu., Zolotarev, Andrey A., Bocharov, Vladimir N., Semenova, Tatyana F., Klimacheva, Maria E., Gussiås, Geir Atle (2022) Preiswerkite: A First Occurrence in Marble Hosting Gem Spinel Deposits, Luc Yen, Vietnam. Minerals, 12 (8) 1024 doi:10.3390/min12081024 |
| ⓘ Anatase Formula: TiO2 |
| ⓘ Anhydrite Formula: CaSO4 |
| ⓘ Anorthite Formula: Ca(Al2Si2O8) |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A |
| ⓘ Aspidolite Formula: NaMg3(AlSi3O10)(OH)2 References: Krivovichev, Vladimir G., Kuksa, Katherine A., Sokolov, Pavel B., Marakhovskaya, Olga Yu., Zolotarev, Andrey A., Bocharov, Vladimir N., Semenova, Tatyana F., Klimacheva, Maria E., Gussiås, Geir Atle (2022) Preiswerkite: A First Occurrence in Marble Hosting Gem Spinel Deposits, Luc Yen, Vietnam. Minerals, 12 (8) 1024 doi:10.3390/min12081024 |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Böhmite Formula: AlO(OH) |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 7 localities in this region. |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ 'Chlorite Group' |
| ⓘ Chondrodite Formula: Mg5(SiO4)2F2 |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinohumite Formula: Mg9(SiO4)4F2 |
| ⓘ Columbite-(Mn) Formula: Mn2+Nb2O6 |
| ⓘ Corundum Formula: Al2O3 Localities: Reported from at least 9 localities in this region. |
| ⓘ Corundum var. Ruby Formula: Al2O3 Localities: Reported from at least 8 localities in this region. |
| ⓘ Corundum var. Sapphire Formula: Al2O3 Localities: Reported from at least 8 localities in this region. |
| ⓘ Corundum var. Trapiche ruby Formula: Al2O3 References: |
| ⓘ Danburite Formula: CaB2Si2O8 |
| ⓘ Diaspore Formula: AlO(OH) |
| ⓘ Diopside Formula: CaMgSi2O6 References: |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: Reported from at least 7 localities in this region. |
| ⓘ Edenite Formula: NaCa2Mg5(Si7Al)O22(OH)2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Elbaite Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ 'Fayalite-Forsterite Series' |
| ⓘ 'Feldspar Group' |
| ⓘ Fluor-elbaite Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| ⓘ Fluor-liddicoatite Formula: Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| ⓘ Formula: CaCa2(Mg4Al)(Si5Al3)O22F2 |
| ⓘ Forsterite Formula: Mg2(SiO4) |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Graphite Formula: C Localities: Reported from at least 8 localities in this region. |
| ⓘ Halite Formula: NaCl |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Hercynite Formula: Fe2+Al2O4 |
| ⓘ Humite Formula: Mg7(SiO4)3F2 |
| ⓘ 'Humite Group' |
| ⓘ Hydroxylclinohumite Formula: Mg9(SiO4)4(OH)2 References: |
| ⓘ 'Iron oxide' |
| ⓘ 'K Feldspar' |
| ⓘ Kyanite Formula: Al2(SiO4)O |
| ⓘ 'Lepidolite' |
| ⓘ Liddicoatite ? Formula: Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) Description: According to Russo & Escaut (2006) Dr. Pezzotta has analyzed pale red to pastelred colored tourmaline from one pocket found in 2004 and found these to be Ca-rich and consist of liddicoatite (bright pastelred areas) and darker core of elbaite.
Later chemical analyses did not find any tourmaline of liddicoatite composition. It is not known if the analysis where made of samples from the 2004 or the 2005 pockets.
However new analysis are needed to establish correct species according to the new nomenclature of the tourmaline supergrop. References: |
| ⓘ Magnesio-hornblende Formula: ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 References: |
| ⓘ Magnesite Formula: MgCO3 |
| ⓘ Margarite Formula: CaAl2(Al2Si2O10)(OH)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Microcline var. Amazonite Formula: K(AlSi3O8) |
| ⓘ 'Monazite Group' Formula: REE(PO4) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Nepheline Formula: Na3K(Al4Si4O16) |
| ⓘ Nordstrandite Formula: Al(OH)3 |
| ⓘ Orthoclase Formula: K(AlSi3O8) References: Garnier, Virginie; Giuliani, Gaston; Ohnenstetter, Daniel; Fallick, Anthony E.; Dubessy, Jean; Banks, David; Vinh, Hoàng Quang; Lhomme, Thérèse; Maluski, Henri; Pêcher, Arnaud; et al. (2008) Marble-hosted ruby deposits from Central and Southeast Asia: Towards a new genetic model. Ore Geology Reviews, 34 (1-2). 169-191 doi:10.1016/j.oregeorev.2008.03.003 |
| ⓘ Paragonite Formula: NaAl2(AlSi3O10)(OH)2 |
| ⓘ Pargasite Formula: NaCa2(Mg4Al)(Si6Al2)O22(OH)2 Localities: Description: Intense green crystals up to 5 cm large in association with red spinel in calcite-dolomite marble (Hauzenberger et al., 2005).
Ca = 1.97 apfu, Na+K = 0.72 apfu, F = 0.54 apfu.
Full composition:
Si 6.34
Ti 0.03
Al 2.38
Cr 0.04
Fe < 0.01
Mn < 0.01
Mg 4.25
Ca 1.97
Na 0.66
K 0.06
-------
F 0.54
Cl < 0.01
|
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 Localities: Reported from at least 9 localities in this region. |
| ⓘ Preiswerkite Formula: NaMg2Al(Al2Si2O10)(OH)2 References: Krivovichev, Vladimir G., Kuksa, Katherine A., Sokolov, Pavel B., Marakhovskaya, Olga Yu., Zolotarev, Andrey A., Bocharov, Vladimir N., Semenova, Tatyana F., Klimacheva, Maria E., Gussiås, Geir Atle (2022) Preiswerkite: A First Occurrence in Marble Hosting Gem Spinel Deposits, Luc Yen, Vietnam. Minerals, 12 (8) 1024 doi:10.3390/min12081024 |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Rossmanite Formula: ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Rutile Formula: TiO2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Sadanagaite Formula: NaCa2(Mg3Al2)(Si5Al3O22)(OH)2 |
| ⓘ Sassolite Formula: H3BO3 |
| ⓘ 'Scapolite' |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Sillimanite Formula: Al2(SiO4)O |
| ⓘ Spinel Formula: MgAl2O4 Localities: Reported from at least 11 localities in this region. Colour: natural cobalt-blue, pink |
| ⓘ Stokesite Formula: CaSn[Si3O9] · 2H2O |
| ⓘ Thorite Formula: Th(SiO4) |
| ⓘ Titanite Formula: CaTiO(SiO4) |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z Localities: Reported from at least 7 localities in this region. Description: pink and blue |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 References: |
| ⓘ Tschermakite Formula: ◻Ca2(Mg3Al2)(Al2Si6O22)(OH)2 |
| ⓘ Tusionite Formula: Mn2+Sn4+[BO3]2 |
| ⓘ 'Unnamed (Pb-analogue of Fluor-liddicoatite)' Formula: Pb(Li2Al)Al6(Si6O18)(BO3)3(OH)3F References: |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 3 - Halides | |||
| ⓘ | Halite | 3.AA.20 | NaCl |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Hercynite | 4.BB.05 | Fe2+Al2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Corundum var. Ruby | 4.CB.05 | Al2O3 |
| ⓘ | var. Sapphire | 4.CB.05 | Al2O3 |
| ⓘ | var. Trapiche ruby | 4.CB.05 | Al2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Columbite-(Mn) | 4.DB.35 | Mn2+Nb2O6 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Diaspore | 4.FD.10 | AlO(OH) |
| ⓘ | Nordstrandite | 4.FE.10 | Al(OH)3 |
| ⓘ | Böhmite | 4.FE.15 | AlO(OH) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| Group 6 - Borates | |||
| ⓘ | Sassolite | 6.AA.05 | H3BO3 |
| ⓘ | Tusionite | 6.AA.15 | Mn2+Sn4+[BO3]2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| Group 9 - Silicates | |||
| ⓘ | Forsterite | 9.AC.05 | Mg2(SiO4) |
| ⓘ | Thorite | 9.AD.30 | Th(SiO4) |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Chondrodite | 9.AF.45 | Mg5(SiO4)2F2 |
| ⓘ | Humite | 9.AF.50 | Mg7(SiO4)3F2 |
| ⓘ | Clinohumite | 9.AF.55 | Mg9(SiO4)4F2 |
| ⓘ | Hydroxylclinohumite | 9.AF.55 | Mg9(SiO4)4(OH)2 |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Liddicoatite ? | 9.CK.05 | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Rossmanite | 9.CK.05 | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Fluor-elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| ⓘ | Fluor-liddicoatite | 9.CK.05 | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Magnesio-hornblende | 9.DE.10 | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Tschermakite | 9.DE.10 | ◻Ca2(Mg3Al2)(Al2Si6O22)(OH)2 |
| ⓘ | Fluoro-cannilloite ? | 9.DE.10 | CaCa2(Mg4Al)(Si5Al3)O22F2 |
| ⓘ | Edenite | 9.DE.15 | NaCa2Mg5(Si7Al)O22(OH)2 |
| ⓘ | Pargasite | 9.DE.15 | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| ⓘ | Sadanagaite | 9.DE.15 | NaCa2(Mg3Al2)(Si5Al3O22)(OH)2 |
| ⓘ | Stokesite | 9.DM.05 | CaSn[Si3O9] · 2H2O |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Paragonite | 9.EC.15 | NaAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Preiswerkite | 9.EC.20 | NaMg2Al(Al2Si2O10)(OH)2 |
| ⓘ | Aspidolite | 9.EC.20 | NaMg3(AlSi3O10)(OH)2 |
| ⓘ | Margarite | 9.EC.30 | CaAl2(Al2Si2O10)(OH)2 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Nepheline | 9.FA.05 | Na3K(Al4Si4O16) |
| ⓘ | Microcline var. Amazonite | 9.FA.30 | K(AlSi3O8) |
| ⓘ | 9.FA.30 | K(AlSi3O8) | |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | Albite var. Cleavelandite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Danburite | 9.FA.65 | CaB2Si2O8 |
| Unclassified | |||
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Lepidolite' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Humite Group' | - | |
| ⓘ | 'Unnamed (Pb-analogue of Fluor-liddicoatite)' | - | Pb(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| ⓘ | 'Iron oxide' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Böhmite | AlO(OH) |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Diaspore | AlO(OH) |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| H | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| H | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Nordstrandite | Al(OH)3 |
| H | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| H | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Preiswerkite | NaMg2Al(Al2Si2O10)(OH)2 |
| H | ⓘ Sadanagaite | NaCa2(Mg3Al2)(Si5Al3O22)(OH)2 |
| H | ⓘ Sassolite | H3BO3 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Stokesite | CaSn[Si3O9] · 2H2O |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Tschermakite | ◻Ca2(Mg3Al2)(Al2Si6O22)(OH)2 |
| H | ⓘ Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Hydroxylclinohumite | Mg9(SiO4)4(OH)2 |
| H | ⓘ Aspidolite | NaMg3(AlSi3O10)(OH)2 |
| H | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| H | ⓘ Unnamed (Pb-analogue of Fluor-liddicoatite) | Pb(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| H | ⓘ Fluor-liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| Li | Lithium | |
| Li | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | ⓘ Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | ⓘ Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| Li | ⓘ Unnamed (Pb-analogue of Fluor-liddicoatite) | Pb(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| Li | ⓘ Fluor-liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| B | Boron | |
| B | ⓘ Danburite | CaB2Si2O8 |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Sassolite | H3BO3 |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| B | ⓘ Tusionite | Mn2+Sn4+[BO3]2 |
| B | ⓘ Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| B | ⓘ Unnamed (Pb-analogue of Fluor-liddicoatite) | Pb(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| B | ⓘ Fluor-liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Magnesite | MgCO3 |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Böhmite | AlO(OH) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Danburite | CaB2Si2O8 |
| O | ⓘ Diaspore | AlO(OH) |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| O | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Forsterite | Mg2(SiO4) |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hercynite | Fe2+Al2O4 |
| O | ⓘ Humite | Mg7(SiO4)3F2 |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| O | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| O | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Nepheline | Na3K(Al4Si4O16) |
| O | ⓘ Nordstrandite | Al(OH)3 |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| O | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Preiswerkite | NaMg2Al(Al2Si2O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Corundum var. Ruby | Al2O3 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Sadanagaite | NaCa2(Mg3Al2)(Si5Al3O22)(OH)2 |
| O | ⓘ Corundum var. Sapphire | Al2O3 |
| O | ⓘ Sassolite | H3BO3 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Stokesite | CaSn[Si3O9] · 2H2O |
| O | ⓘ Thorite | Th(SiO4) |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Tschermakite | ◻Ca2(Mg3Al2)(Al2Si6O22)(OH)2 |
| O | ⓘ Tusionite | Mn2+Sn4+[BO3]2 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Fluoro-cannilloite | CaCa2(Mg4Al)(Si5Al3)O22F2 |
| O | ⓘ Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| O | ⓘ Hydroxylclinohumite | Mg9(SiO4)4(OH)2 |
| O | ⓘ Fayalite-Forsterite Series | |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Aspidolite | NaMg3(AlSi3O10)(OH)2 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| O | ⓘ Unnamed (Pb-analogue of Fluor-liddicoatite) | Pb(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| O | ⓘ Fluor-liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| O | ⓘ Corundum var. Trapiche ruby | Al2O3 |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| F | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| F | ⓘ Humite | Mg7(SiO4)3F2 |
| F | ⓘ Fluoro-cannilloite | CaCa2(Mg4Al)(Si5Al3)O22F2 |
| F | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| F | ⓘ Unnamed (Pb-analogue of Fluor-liddicoatite) | Pb(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| F | ⓘ Fluor-liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Na | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Halite | NaCl |
| Na | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Na | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Na | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Na | ⓘ Preiswerkite | NaMg2Al(Al2Si2O10)(OH)2 |
| Na | ⓘ Sadanagaite | NaCa2(Mg3Al2)(Si5Al3O22)(OH)2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Na | ⓘ Aspidolite | NaMg3(AlSi3O10)(OH)2 |
| Na | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Mg | ⓘ Forsterite | Mg2(SiO4) |
| Mg | ⓘ Humite | Mg7(SiO4)3F2 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Mg | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Preiswerkite | NaMg2Al(Al2Si2O10)(OH)2 |
| Mg | ⓘ Sadanagaite | NaCa2(Mg3Al2)(Si5Al3O22)(OH)2 |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Tschermakite | ◻Ca2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Mg | ⓘ Fluoro-cannilloite | CaCa2(Mg4Al)(Si5Al3)O22F2 |
| Mg | ⓘ Hydroxylclinohumite | Mg9(SiO4)4(OH)2 |
| Mg | ⓘ Fayalite-Forsterite Series | |
| Mg | ⓘ Aspidolite | NaMg3(AlSi3O10)(OH)2 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Böhmite | AlO(OH) |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Diaspore | AlO(OH) |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Al | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Hercynite | Fe2+Al2O4 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Al | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Al | ⓘ Nordstrandite | Al(OH)3 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Preiswerkite | NaMg2Al(Al2Si2O10)(OH)2 |
| Al | ⓘ Corundum var. Ruby | Al2O3 |
| Al | ⓘ Sadanagaite | NaCa2(Mg3Al2)(Si5Al3O22)(OH)2 |
| Al | ⓘ Corundum var. Sapphire | Al2O3 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Tschermakite | ◻Ca2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Al | ⓘ Fluoro-cannilloite | CaCa2(Mg4Al)(Si5Al3)O22F2 |
| Al | ⓘ Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Al | ⓘ Aspidolite | NaMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| Al | ⓘ Unnamed (Pb-analogue of Fluor-liddicoatite) | Pb(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| Al | ⓘ Fluor-liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| Al | ⓘ Corundum var. Trapiche ruby | Al2O3 |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| Si | ⓘ Danburite | CaB2Si2O8 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Si | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Forsterite | Mg2(SiO4) |
| Si | ⓘ Humite | Mg7(SiO4)3F2 |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Si | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Preiswerkite | NaMg2Al(Al2Si2O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Sadanagaite | NaCa2(Mg3Al2)(Si5Al3O22)(OH)2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Stokesite | CaSn[Si3O9] · 2H2O |
| Si | ⓘ Thorite | Th(SiO4) |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Tschermakite | ◻Ca2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Fluoro-cannilloite | CaCa2(Mg4Al)(Si5Al3)O22F2 |
| Si | ⓘ Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | ⓘ Hydroxylclinohumite | Mg9(SiO4)4(OH)2 |
| Si | ⓘ Fayalite-Forsterite Series | |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Aspidolite | NaMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| Si | ⓘ Unnamed (Pb-analogue of Fluor-liddicoatite) | Pb(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| Si | ⓘ Fluor-liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| P | Phosphorus | |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| Cl | Chlorine | |
| Cl | ⓘ Halite | NaCl |
| K | Potassium | |
| K | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Nepheline | Na3K(Al4Si4O16) |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Danburite | CaB2Si2O8 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Ca | ⓘ Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Ca | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Ca | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Ca | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Sadanagaite | NaCa2(Mg3Al2)(Si5Al3O22)(OH)2 |
| Ca | ⓘ Stokesite | CaSn[Si3O9] · 2H2O |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Tschermakite | ◻Ca2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Ca | ⓘ Fluoro-cannilloite | CaCa2(Mg4Al)(Si5Al3)O22F2 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ca | ⓘ Fluor-liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Mn | Manganese | |
| Mn | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Mn | ⓘ Tusionite | Mn2+Sn4+[BO3]2 |
| Fe | Iron | |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hercynite | Fe2+Al2O4 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Fayalite-Forsterite Series | |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Stokesite | CaSn[Si3O9] · 2H2O |
| Sn | ⓘ Tusionite | Mn2+Sn4+[BO3]2 |
| Pb | Lead | |
| Pb | ⓘ Unnamed (Pb-analogue of Fluor-liddicoatite) | Pb(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| Th | Thorium | |
| Th | ⓘ Thorite | Th(SiO4) |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/L%E1%BB%A5c_Y%C3%AAn_District |
|---|---|
| Wikidata ID: | Q6695817 |
| GeoNames ID: | 1905666 |
Localities in this Region
- Yên Bái Province
Other Regions, Features and Areas that Intersect
AsiaContinent
Eurasian PlateTectonic Plate
- Song Da TerraneOrogenic Belt
Vietnam
- NE Vietnam Sn-W metallographic beltMineral Belt
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Long, Pham Van, Quang Vinh, Hoàng, Garnier, Virginie, Giuliani, Gaston, Ohnenstetter, Daniel, Lhomme, Thérèse, Schwarz, Dietmar, Fallick, Anthony, Dubessy, Jean, Trinh, Phan Trong (2004) Gem corundum deposits in Vietnam. The Journal of Gemmology, 29 (3) 129-147 doi:10.15506/jog.2004.29.3.129
Garnier, Virginie; Giuliani, Gaston; Ohnenstetter, Daniel; Fallick, Anthony E.; Dubessy, Jean; Banks, David; Vinh, Hoàng Quang; Lhomme, Thérèse; Maluski, Henri; Pêcher, Arnaud; et al. (2008) Marble-hosted ruby deposits from Central and Southeast Asia: Towards a new genetic model. Ore Geology Reviews, 34 (1-2). 169-191 doi:10.1016/j.oregeorev.2008.03.003
Long, Pham Van, Giuliani, Gaston, Fallick, Anthony E., Boyce, Andrian J., Pardieu, Vincent (2018) Trace elements and oxygen isotopes of gem spinels in marble from the Luc Yen - An Phu areas, Yen Bai province, North Vietnam. Vietnam Journal of Earth Sciences, 40 (2) 165-177 doi:10.15625/0866-7187/40/2/12241
Krenn, Kurt, Huong, Le Thi Thu (2019) Fluid characteristics from shallow magmatic environments: A contribution to danburite bearing Luc Yen pegmatites, northern Vietnam. Vietnam Journal of Earth Sciences, 41 (1) 1-9 doi:10.15625/0866-7187/41/1/13541
www.mindat.org (2021) https://www.mindat.org/article.php/4115/Humite-group+minerals+in+carbonate+rocks+and+skarns
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Lục Yên District, Yên Bái Province, Vietnam