Saint-Gaudens, Haute-Garonne, Occitanie, Francei
| Regional Level Types | |
|---|---|
| Saint-Gaudens | Arrondissement |
| Haute-Garonne | Department |
| Occitanie | Region |
| France | Country |
This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Saint-Gaudens | 12,193 (2016) |
| Bagnères-de-Luchon | 3,380 (2016) |
| Montréjeau | 2,930 (2016) |
| Salies-du-Salat | 2,262 (2016) |
| L’Isle-en-Dodon | 2,034 (2018) |
| Gourdan-Polignan | 1,754 (2016) |
Other Languages:
French:
Saint-Gaudens, Haute-Garonne, Occitanie, France
German:
Arrondissement Saint-Gaudens, Département Haute-Garonne, Okzitanien, Frankreich
Italian:
arrondissement di Saint-Gaudens, Alta Garonna, Occitania, Francia
Russian:
Сен-Годанс, Верхняя Гаронна, Окситания, Франция
Simplified Chinese:
圣戈当, 上加龙省, 奥克西塔尼大区, 法国
Spanish:
Distrito de Saint-Gaudens, Alto Garona, Occitania, Francia
Albanian:
Qarku Saint-Gaudens, Haute-Garonne, Oksitania, Franca
Aragonese:
Sent-Gaudenç, Alta Garona, Occitania, Francia
Armenian:
Սեն Գոդենս, Վերին Գարոն, Օկսիտանիա, Ֆրանսիա
Azeri:
Sen-Qodens , Yuxarı Qaronna, Oksitaniya , Fransa
Basque:
Saint-Gaudenseko barrutia, Garona Garaia, Okzitania, Frantzia
Breton:
Sent-Gaudenç, Garona-Uhel, Okitania, Bro-C'hall
Bulgarian:
Сен-Годенс, От Гарон, Окситания, Франция
Catalan:
Sent-Gaudenç, Alta Garona, Occitània, França
Cebuano:
Arrondissement de Saint-Gaudens, Haute-Garonne, Occitanie, Pransiya
Chechen:
Сен-Годенс , Франци
Chuvash:
Сен-Годенс, Тури Гаронна, Франци
Czech:
Arrondissement Saint-Gaudens, Haute-Garonne, Okcitánie, Francie
Dutch:
Arrondissement Saint-Gaudens, Haute-Garonne, Occitanie, Frankrijk
Farsi/Persian:
سن-گودن, اوت-گارون, اکسیتنی, فرانسه
Georgian:
სენტ-გაუდენსი, ზემო გარონა, საფრანგეთი
Greek:
Διαμέρισμα του Σαιν-Γκωντένς, Ωτ-Γκαρόν, Οξιτανία, Γαλλία
Indonesian:
Arondisemen Saint-Gaudens, Haute-Garonne, Ositania, Perancis
Japanese:
サン＝ゴーダンス, オート＝ガロンヌ県, オクシタニー地域圏, フランス
Luxembourgish:
Arrondissement Saint-Gaudens, Departement Haute-Garonne, Occitanie, Frankräich
Minnan / Hokkien-Taiwanese:
Saint-Gaudens Kūn, Haute-Garonne, Hoat-kok
Occitan:
Sent-Gaudenç, Nauta Garona, Occitània, França
Polish:
Okręg Saint-Gaudens, Górna Garonna, Oksytania, Francja
Romanian:
Arondismentul Saint-Gaudens, Haute-Garonne, Occitania, Franța
Scots:
Arrondissement o Saint-Gaudens, Haute-Garonne, Occitanie, Fraunce
Slovak:
Saint-Gaudens, Haute-Garonne, Occitánia, Francúzsko
Thai:
แซ็ง-โกด็อง, จังหวัดโอต-การอน, แคว้นอ็อกซีตานี, ประเทศฝรั่งเศส
Ukrainian:
Сен-Годенс, Верхня Гаронна, Окситанія, Франція
Urdu:
سینٹ-گودینس, بالائی-گارون, اوکیتانی, فرانس
Vietnamese:
Saint-Gaudens, Haute-Garonne, Occitanie, Pháp
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities78 valid minerals. 1 (TL) - type locality of valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S |
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Andalusite Formula: Al2(SiO4)O |
| ⓘ Anhydrite Formula: CaSO4 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A |
| ⓘ Argutite (TL) Formula: GeO2 Localities: Reported from at least 7 localities in this region. Habit: 10 μm euhedral to subhedral prismatic crystals with a predominance of {111}, {100}, and {101}forms. |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Birnessite Formula: (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| ⓘ Braunite Formula: Mn2+Mn3+6(SiO4)O8 |
| ⓘ Brianyoungite Formula: Zn3(CO3,SO4)(OH)4 |
| ⓘ Briartite Formula: Cu2FeGeS4 |
| ⓘ Brunogeierite Formula: Ge4+Fe2+2O4 Localities: Reported from at least 7 localities in this region. |
| ⓘ Calcite Formula: CaCO3 Localities: Bois du Mount quarry, Saint-Béat-Lez, Saint-Gaudens, Haute-Garonne, Occitanie, France Tuc Usclat, Boutx, Saint-Gaudens, Haute-Garonne, Occitanie, France Barcugnas, Bagnères-de-Luchon, Saint-Gaudens, Haute-Garonne, Occitanie, France Mail de la Pique, Baren, Saint-Gaudens, Haute-Garonne, Occitanie, France Ophite quarries, Salies-du-Salat, Saint-Gaudens, Haute-Garonne, Occitanie, France |
| ⓘ Carboirite Formula: Fe2+Al2O(GeO4)(OH)2 |
| ⓘ Cassiterite Formula: SnO2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Celsian Formula: Ba(Al2Si2O8) References: |
| ⓘ 'Chabazite' References: |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 References: |
| ⓘ Chrysotile Formula: Mg3(Si2O5)(OH)4 |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Cryptomelane Formula: K(Mn4+7Mn3+)O16 |
| ⓘ Diopside Formula: CaMgSi2O6 |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ 'Fayalite-Forsterite Series' Description: Olivine composition (Fa23.8)[Grady,2000] & (Fa24.9) [Kessel,2002] is typical for L-group ordinary chondrites References: |
| ⓘ 'Feldspar Group' References: |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ 'Freibergite Subgroup' Formula: (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ Friedelite Formula: Mn2+8Si6O15(OH,Cl)10 |
| ⓘ Galena Formula: PbS |
| ⓘ Gersdorffite Formula: NiAsS References: |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Graphite Formula: C |
| ⓘ Greenockite Formula: CdS |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Hausmannite Formula: Mn2+Mn3+2O4 |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Isocubanite Formula: CuFe2S3 |
| ⓘ Jacobsite Formula: Mn2+Fe3+2O4 |
| ⓘ 'K Feldspar' |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 |
| ⓘ Löllingite Formula: FeAs2 |
| ⓘ Mackinawite Formula: FeS |
| ⓘ Magnesite Formula: MgCO3 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Manganite Formula: Mn3+O(OH) |
| ⓘ 'Mica Group var. Lepidomelane' Description: Ge rich variety. |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Copper Formula: Cu |
| ⓘ Native Gold Formula: Au |
| ⓘ Native Iron Formula: Fe |
| ⓘ Native Iron var. Kamacite Formula: (Fe,Ni) References: |
| ⓘ Native Silver Formula: Ag |
| ⓘ Native Sulphur Formula: S8 |
| ⓘ Nsutite Formula: (Mn4+,Mn2+)(O,OH)2 |
| ⓘ Opal Formula: SiO2 · nH2O |
| ⓘ 'Orthopyroxene Subgroup' Description: Ca-poor orthopyroxene (Fs21.7)[Kessel, 2002] typical for L-group ordinary chondrites. |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 Description: Plagioclase (An21,Ab74) is usually mildly anorthitic for an ordinary chondrite [Kessel,2002], but compositional excursions are present with plagioclase (An 18-25) in selected regions studied by Bischoff & Keil(1984). References: |
| ⓘ 'Plessite' |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 |
| ⓘ 'Psilomelane' |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Pyrosmalite-(Fe) Formula: Fe2+8Si6O15(OH,Cl)10 |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 References: |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Quartz var. Chalcedony Formula: SiO2 References: |
| ⓘ Rhodochrosite Formula: MnCO3 |
| ⓘ Rhodonite Formula: CaMn3Mn[Si5O15] |
| ⓘ Rutile Formula: TiO2 |
| ⓘ 'Scapolite' |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 9 localities in this region. |
| ⓘ Spinel Formula: MgAl2O4 |
| ⓘ Stannite Formula: Cu2FeSnS4 References: |
| ⓘ Taenite Formula: (Ni,Fe) References: |
| ⓘ 'Tetrahedrite Group' Formula: M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
| ⓘ Tetrataenite Formula: FeNi |
| ⓘ Titanite Formula: CaTiO(SiO4) |
| ⓘ Todorokite Formula: (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Troilite Formula: FeS References: |
| ⓘ Zircon Formula: Zr(SiO4) References: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Iron | 1.AE.05 | Fe |
| ⓘ | var. Kamacite | 1.AE.05 | (Fe,Ni) |
| ⓘ | Taenite | 1.AE.10 | (Ni,Fe) |
| ⓘ | Tetrataenite | 1.AE.10 | FeNi |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Isocubanite | 2.CB.55b | CuFe2S3 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Troilite | 2.CC.10 | FeS |
| ⓘ | Mackinawite | 2.CC.25 | FeS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | 'Freibergite Subgroup' | 2.GB.05 | (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ | Briartite | 2.KA.10 | Cu2FeGeS4 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Jacobsite | 4.BB.05 | Mn2+Fe3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Hausmannite | 4.BB.10 | Mn2+Mn3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Argutite (TL) | 4.DB.05 | GeO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Nsutite | 4.DB.15c | (Mn4+,Mn2+)(O,OH)2 |
| ⓘ | Cryptomelane | 4.DK.05a | K(Mn4+7Mn3+)O16 |
| ⓘ | Todorokite | 4.DK.10 | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Birnessite | 4.FL.45 | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Brianyoungite | 5.BF.30 | Zn3(CO3,SO4)(OH)4 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 · 10-12H2O |
| Group 9 - Silicates | |||
| ⓘ | Chrysotile | 9.00. | Mg3(Si2O5)(OH)4 |
| ⓘ | Brunogeierite | 9.AC.15 | Ge4+Fe2+2O4 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Braunite | 9.AG.05 | Mn2+Mn3+6(SiO4)O8 |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Rhodonite | 9.DK.05 | CaMn3Mn[Si5O15] |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Pyrosmalite-(Fe) | 9.EE.10 | Fe2+8Si6O15(OH,Cl)10 |
| ⓘ | Friedelite | 9.EE.10 | Mn2+8Si6O15(OH,Cl)10 |
| ⓘ | Celsian | 9.FA.30 | Ba(Al2Si2O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Carboirite | 9.J0.05 | Fe2+Al2O(GeO4)(OH)2 |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chabazite' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Mica Group var. Lepidomelane' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Plessite' | - | |
| ⓘ | 'Orthopyroxene Subgroup' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Tetrahedrite Group' | - | M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| H | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| H | ⓘ Carboirite | Fe2+Al2O(GeO4)(OH)2 |
| H | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Pyrosmalite-(Fe) | Fe82+Si6O15(OH,Cl)10 |
| H | ⓘ Friedelite | Mn82+Si6O15(OH,Cl)10 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Nsutite | (Mn4+,Mn2+)(O,OH)2 |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Argutite | GeO2 |
| O | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| O | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| O | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| O | ⓘ Brunogeierite | Ge4+Fe22+O4 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Carboirite | Fe2+Al2O(GeO4)(OH)2 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Celsian | Ba(Al2Si2O8) |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Pyrosmalite-(Fe) | Fe82+Si6O15(OH,Cl)10 |
| O | ⓘ Friedelite | Mn82+Si6O15(OH,Cl)10 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hausmannite | Mn2+Mn23+O4 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Jacobsite | Mn2+Fe23+O4 |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Nsutite | (Mn4+,Mn2+)(O,OH)2 |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Fayalite-Forsterite Series | |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Fayalite-Forsterite Series | |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Carboirite | Fe2+Al2O(GeO4)(OH)2 |
| Al | ⓘ Celsian | Ba(Al2Si2O8) |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Celsian | Ba(Al2Si2O8) |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Pyrosmalite-(Fe) | Fe82+Si6O15(OH,Cl)10 |
| Si | ⓘ Friedelite | Mn82+Si6O15(OH,Cl)10 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Fayalite-Forsterite Series | |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| P | Phosphorus | |
| P | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| S | ⓘ Briartite | Cu2FeGeS4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Isocubanite | CuFe2S3 |
| S | ⓘ Mackinawite | FeS |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stannite | Cu2FeSnS4 |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Troilite | FeS |
| S | ⓘ Tetrahedrite Group | M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
| Cl | Chlorine | |
| Cl | ⓘ Pyrosmalite-(Fe) | Fe82+Si6O15(OH,Cl)10 |
| Cl | ⓘ Friedelite | Mn82+Si6O15(OH,Cl)10 |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Mn | Manganese | |
| Mn | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Mn | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Mn | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| Mn | ⓘ Friedelite | Mn82+Si6O15(OH,Cl)10 |
| Mn | ⓘ Hausmannite | Mn2+Mn23+O4 |
| Mn | ⓘ Jacobsite | Mn2+Fe23+O4 |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Nsutite | (Mn4+,Mn2+)(O,OH)2 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Mn | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Briartite | Cu2FeGeS4 |
| Fe | ⓘ Brunogeierite | Ge4+Fe22+O4 |
| Fe | ⓘ Carboirite | Fe2+Al2O(GeO4)(OH)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Pyrosmalite-(Fe) | Fe82+Si6O15(OH,Cl)10 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Native Iron | Fe |
| Fe | ⓘ Isocubanite | CuFe2S3 |
| Fe | ⓘ Jacobsite | Mn2+Fe23+O4 |
| Fe | ⓘ Native Iron var. Kamacite | (Fe,Ni) |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Mackinawite | FeS |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Fe | ⓘ Taenite | (Ni,Fe) |
| Fe | ⓘ Tetrataenite | FeNi |
| Fe | ⓘ Troilite | FeS |
| Fe | ⓘ Fayalite-Forsterite Series | |
| Ni | Nickel | |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Native Iron var. Kamacite | (Fe,Ni) |
| Ni | ⓘ Taenite | (Ni,Fe) |
| Ni | ⓘ Tetrataenite | FeNi |
| Cu | Copper | |
| Cu | ⓘ Briartite | Cu2FeGeS4 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Cu | ⓘ Isocubanite | CuFe2S3 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Zn | Zinc | |
| Zn | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| Zn | ⓘ Sphalerite | ZnS |
| Ge | Germanium | |
| Ge | ⓘ Argutite | GeO2 |
| Ge | ⓘ Briartite | Cu2FeGeS4 |
| Ge | ⓘ Brunogeierite | Ge4+Fe22+O4 |
| Ge | ⓘ Carboirite | Fe2+Al2O(GeO4)(OH)2 |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Löllingite | FeAs2 |
| Sr | Strontium | |
| Sr | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Ag | ⓘ Native Silver | Ag |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sb | Antimony | |
| Sb | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Ba | Barium | |
| Ba | ⓘ Celsian | Ba(Al2Si2O8) |
| Ba | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
| Bi | Bismuth | |
| Bi | ⓘ Native Bismuth | Bi |
| U | Uranium | |
| U | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
Fossils
There are 105 fossil localities from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 105 |
|---|---|
| Youngest Fossil Listed | 0.13 Ma (Pleistocene) |
| Oldest Fossil Listed | 411 Ma (Early/Lower Devonian) |
| Stratigraphic Units | Click here to view 12 stratigraphic units. |
| Fossils from Region | Click here to show the list. |
| Fossil Localities | Click to show 17 fossil localities |
- Occitanie
- Haute-Garonne
- Late/Upper Cretaceous🐚 Auzas
- Paleocene🐚 Balesta
- Early Jurassic🐚 Chateau de Campels
- Early Jurassic🐚 La Teillède
- Late/Upper Cretaceous🐚 Larcan Quarry
- Late/Upper Cretaceous🐚 Le Jadet Quarry
- Late/Upper Cretaceous🐚 Le Jadet quarry
- Early/Lower Devonian🐚 Locality 136 Devonian athyrid from the top Lebanza Fm
- Haute-Garonne
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Arrondissement_of_Saint-Gaudens |
|---|---|
| Wikidata ID: | Q702334 |
| GeoNames ID: | 2980043 |
Localities in this Region
- Occitanie
- Haute-Garonne
- Saint-Gaudens
- ⭔Agassac
- ⭔Alan
- ⭔Ambax
- ⭔Anan
- ⭔Antichan-de-Frontignes
- ⭔Antignac
- ⭔Arbas
- ⭔Arbon
- ⭔Ardiège
- ⭔Arguenos
- ⭔Argut-Dessous
- ⭔Arlos
- ⭔Arnaud-Guilhem
- ⭔Artigue
- ⭔Aspet
- ⭔Aspret-Sarrat
- ⭔Aulon
- ⭔Aurignac
- ⭔Ausseing
- ⭔Ausson
- ⭔Auzas
- ⭔Bachas
- ⭔Bachos
- ⭔Bagiry
- ⭔Bagnères-de-Luchon
- ⭔Balesta
- ⭔Barbazan
- ⭔Baren
- ⭔Beauchalot
- ⭔Belbèze-en-Comminges
- ⭔Benque-Dessous-et-Dessus
- ⭔Benque
- ⭔Bezins-Garraux
- ⭔Billière
- ⭔Binos
- ⭔Blajan
- ⭔Boissède
- ⭔Bordes-de-Rivière
- ⭔Boudrac
- ⭔Boulogne-sur-Gesse
- ⭔Bourg-d'Oueil
- ⭔Boussan
- ⭔Boutx
- ⭔Bouzin
- ⭔Burgalays
- ⭔Cabanac-Cazaux
- ⭔Cardeilhac
- ⭔Cassagnabère-Tournas
- ⭔Cassagne
- ⭔Castagnède
- ⭔Castelbiague
- ⭔Castelgaillard
- ⭔Castéra-Vignoles
- ⭔Castillon-de-Larboust
- ⭔Castillon-de-Saint-Martory
- ⭔Cathervielle
- ⭔Caubous
- ⭔Cazac
- ⭔Cazaril-Tambourès
- ⭔Cazarilh-Laspènes
- ⭔Cazaunous
- ⭔Cazaux-Layrisse
- ⭔Cazeaux-de-Larboust
- ⭔Cazeneuve-Montaut
- ⭔Charlas
- ⭔Chaum
- ⭔Chein-Dessus
- ⭔Ciadoux
- ⭔Cier-de-Luchon
- ⭔Cier-de-Rivière
- ⭔Cierp-Gaud
- ⭔Cirès
- ⭔Clarac
- ⭔Coueilles
- ⭔Couret
- ⭔Cuguron
- ⭔Encausse-les-Thermes
- ⭔Eoux
- ⭔Escanecrabe
- ⭔Escoulis
- ⭔Esparron
- ⭔Estadens
- ⭔Estancarbon
- ⭔Esténos
- ⭔Eup
- ⭔Fabas
- ⭔Figarol
- ⭔Fos
- ⭔Fougaron
- ⭔Francazal
- ⭔Franquevielle
- ⭔Fronsac
- ⭔Frontignan-de-Comminges
- ⭔Frontignan-Savès
- ⭔Galié
- ⭔Ganties
- ⭔Garin
- ⭔Génos
- ⭔Gensac-de-Boulogne
- Ger Valley
- ⭔Gouaux-de-Larboust
- ⭔Gouaux-de-Luchon
- ⭔Goudex
- ⭔Gourdan-Polignan
- ⭔Guran
- ⭔Herran
- ⭔His
- ⭔Huos
- ⭔Izaut-de-l'Hôtel
- ⭔Jurvielle
- ⭔Juzet-d'Izaut
- ⭔Juzet-de-Luchon
- ⭔L'Isle-en-Dodon
- Saint-Gaudens
- Haute-Garonne
- Occitanie
- Haute-Garonne
- Saint-Gaudens
- ⭔Labarthe-Inard
- ⭔Labarthe-Rivière
- ⭔Labastide-Paumès
- ⭔Labroquère
- ⭔Laffite-Toupière
- ⭔Lalouret-Laffiteau
- ⭔Landorthe
- ⭔Larcan
- ⭔Larroque
- ⭔Latoue
- ⭔Le Cuing
- ⭔Le Fréchet
- ⭔Lécussan
- ⭔Lège
- ⭔Les Tourreilles
- ⭔Lespiteau
- ⭔Lespugue
- ⭔Lestelle-de-Saint-Martory
- ⭔Lieoux
- ⭔Lilhac
- ⭔Lodes
- ⭔Loudet
- ⭔Lourde
- ⭔Luscan
- ⭔Malvezie
- ⭔Mancioux
- ⭔Mane
- ⭔Marignac
- ⭔Marsoulas
- ⭔Martisserre
- ⭔Martres-de-Rivière
- ⭔Mauvezin
- ⭔Mayrègne
- ⭔Mazères-sur-Salat
- ⭔Melles
- ⭔Milhas
- ⭔Mirambeau
- ⭔Miramont-de-Comminges
- ⭔Molas
- ⭔Moncaup
- ⭔Mondilhan
- ⭔Mont-de-Galié
- ⭔Montastruc-de-Salies
- ⭔Montauban-de-Luchon
- ⭔Montbernard
- ⭔Montespan
- ⭔Montesquieu-Guittaut
- ⭔Montgaillard-de-Salies
- ⭔Montgaillard-sur-Save
- ⭔Montmaurin
- ⭔Montoulieu-Saint-Bernard
- ⭔Montréjeau
- ⭔Montsaunès
- ⭔Moustajon
- ⭔Nénigan
- ⭔Nizan-Gesse
- ⭔Oô
- ⭔Ore
- ⭔Payssous
- ⭔Péguilhan
- ⭔Peyrissas
- ⭔Peyrouzet
- ⭔Pointis-de-Rivière
- ⭔Pointis-Inard
- ⭔Ponlat-Taillebourg
- ⭔Portet-d'Aspet
- ⭔Portet-de-Luchon
- ⭔Poubeau
- ⭔Proupiary
- ⭔Puymaurin
- ⭔Razecueillé
- ⭔Régades
- ⭔Rieucazé
- ⭔Riolas
- ⭔Roquefort-sur-Garonne
- ⭔Rouède
- ⭔Saccourvielle
- ⭔Saint-André
- ⭔Saint-Aventin
- ⭔Saint-Béat-Lez
- ⭔Saint-Bertrand-de-Comminges
- ⭔Saint-Élix-Séglan
- ⭔Saint-Ferréol-de-Comminges
- ⭔Saint-Frajou
- ⭔Saint-Gaudens
- ⭔Saint-Ignan
- ⭔Saint-Lary-Boujean
- ⭔Saint-Laurent
- ⭔Saint-Loup-en-Comminges
- ⭔Saint-Mamet
- ⭔Saint-Marcet
- ⭔Saint-Martory
- ⭔Saint-Médard
- ⭔Saint-Paul-d'Oueil
- ⭔Saint-Pé-d'Ardet
- ⭔Saint-Pé-Delbosc
- ⭔Saint-Plancard
- ⭔Saleich
- ⭔Salerm
- ⭔Salies-du-Salat
- ⭔Salles-et-Pratviel
- ⭔Saman
- ⭔Samouillan
- ⭔Sarrecave
- ⭔Sarremezan
- ⭔Sauveterre-de-Comminges
- ⭔Saux-et-Pomarède
- ⭔Savarthès
- ⭔Sédeilhac
- ⭔Seilhan
- ⭔Sengouagnet
- ⭔Sepx
- ⭔Signac
- ⭔Sode
- ⭔Soueich
- ⭔Terrebasse
- ⭔Touille
- ⭔Trébons-de-Luchon
- ⭔Urau
- ⭔Valcabrère
- ⭔Valentine
- ⭔Villeneuve-de-Rivière
- ⭔Villeneuve-Lécussan
- Saint-Gaudens
- Haute-Garonne
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
- Armorican BasinOrogenic Belt
- Cantabrian-Pyrenean BeltOrogenic Belt
EuropeContinent
- PyreneesMountain Range
Iberian PeninsulaPeninsula
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions
Saint-Béat, Saint-Béat-Lez, Saint-Gaudens, Haute-Garonne, Occitanie, France