Argentera Group, Cuneo Province, Piedmont, Italyi
| Regional Level Types | |
|---|---|
| Argentera Group | Mountain Range |
| Cuneo Province | Province |
| Piedmont | Region |
| Italy | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Other/historical names associated with this locality:
Argentera Massif
Other Languages:
Italian:
Gruppo dell'Argentera (Massiccio dell'Argentera), Provincia di Cuneo, Piemonte, Italia
Mountain group departing from the main Alpine Divide, whose name is due to Monte Argentera (3297 m), the highest peak in the Maritime Alps. It includes 15 peaks higher than 3000 m. The mountain group is located in the upper Valle Gesso, on the boundary between the municipal territories of Entracque and Valdieri.
The mountain group is frequently indicated as the Argentera Massif, but the use of this name is here deprecated in order to avoid confusion with the Argentera crystalline massif (of which the mountain group is part), the southernmost External Crystalline Massif of the Western Alps.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities90 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ 'Aeschynite' References: |
| ⓘ Aeschynite-(Y) Formula: Y(TiNb)O6 |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Lausetto Mine, San Lorenzo, Valdieri, Cuneo Province, Piedmont, Italy Argentera Group, Cuneo Province, Piedmont, Italy Monte Ray, Entracque, Cuneo Province, Piedmont, Italy Nasta Lake area (incl. Cima del Baus west slope), Terme di Valdieri, Valdieri, Cuneo Province, Piedmont, Italy Quartz vein outcrop, Sant'Anna di Valdieri, Valdieri, Cuneo Province, Piedmont, Italy |
| ⓘ Aluminoceladonite Formula: K(MgAl◻)(Si4O10)(OH)2 |
| ⓘ Alunite Formula: KAl3(SO4)2(OH)6 |
| ⓘ Anatase Formula: TiO2 |
| ⓘ Andalusite Formula: Al2(SiO4)O |
| ⓘ Anglesite Formula: PbSO4 References: |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Arsenopyrite Formula: FeAsS References: |
| ⓘ Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ Axinite-(Fe) Formula: Ca2Fe2+Al2BSi4O15OH References: |
| ⓘ 'Axinite Group' |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Bastnäsite-(Ce) Formula: Ce(CO3)F References: |
| ⓘ Berthierine Formula: (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 References: |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Brookite Formula: TiO2 |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Caledonite Formula: Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ Cerussite Formula: PbCO3 |
| ⓘ Cesàrolite Formula: PbMn4+3O6(OH)2 References: |
| ⓘ 'Chabazite' |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O |
| ⓘ Chalcophanite Formula: ZnMn4+3O7 · 3H2O References: |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ 'Chlorite Group' |
| ⓘ Cinnabar Formula: HgS |
| ⓘ 'Clinoptilolite Subgroup' Formula: (Na/Ca/K)3-6[Al6-7Si29-30O72] · 20H2O |
| ⓘ Coronadite Formula: Pb(Mn4+6Mn3+2)O16 References: |
| ⓘ Covellite Formula: CuS |
| ⓘ Cryptomelane Formula: K(Mn4+7Mn3+)O16 References: |
| ⓘ Dickite Formula: Al2(Si2O5)(OH)4 References: |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Edenite Formula: NaCa2Mg5(Si7Al)O22(OH)2 References: |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorite Formula: CaF2 Localities: Lausetto Mine, San Lorenzo, Valdieri, Cuneo Province, Piedmont, Italy Cotella Valley, Entracque, Cuneo Province, Piedmont, Italy Argentera Group, Cuneo Province, Piedmont, Italy Punta Chistafort, Entracque, Cuneo Province, Piedmont, Italy Ciriegia Tunnel exploratory adit, Valdieri, Cuneo Province, Piedmont, Italy |
| ⓘ 'Gadolinite Group' Formula: A2MQ2Si2O8φ2 Description: Y-dominant gadolinite-datolite solid solution, as sprays of colourless acicular crystals to 0.1 mm long on anatase and quartz. |
| ⓘ Galena Formula: PbS Localities: Lausetto Mine, San Lorenzo, Valdieri, Cuneo Province, Piedmont, Italy Argentera Group, Cuneo Province, Piedmont, Italy Monte Ray, Entracque, Cuneo Province, Piedmont, Italy Ciriegia Tunnel exploratory adit, Valdieri, Cuneo Province, Piedmont, Italy Piastra Lake, Entracque, Cuneo Province, Piedmont, Italy |
| ⓘ Goethite Formula: Fe3+O(OH) References: |
| ⓘ Graphite Formula: C |
| ⓘ Greenockite Formula: CdS |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 References: |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Harmotome Formula: Ba2(Si12Al4)O32 · 12H2O |
| ⓘ Hausmannite Formula: Mn2+Mn3+2O4 |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 6 localities in this region. |
| ⓘ Hollandite Formula: Ba(Mn4+6Mn3+2)O16 |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ 'K Feldspar' Localities: Punta Chistafort, Entracque, Cuneo Province, Piedmont, Italy Monte Ray, Entracque, Cuneo Province, Piedmont, Italy Nasta Lake area (incl. Cima del Baus west slope), Terme di Valdieri, Valdieri, Cuneo Province, Piedmont, Italy Quartz vein outcrop, Sant'Anna di Valdieri, Valdieri, Cuneo Province, Piedmont, Italy |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 Localities: Punta Chistafort, Entracque, Cuneo Province, Piedmont, Italy Monte Ray, Entracque, Cuneo Province, Piedmont, Italy Nasta Lake area (incl. Cima del Baus west slope), Terme di Valdieri, Valdieri, Cuneo Province, Piedmont, Italy Quartz vein outcrop, Sant'Anna di Valdieri, Valdieri, Cuneo Province, Piedmont, Italy |
| ⓘ Laurelite Formula: Pb7F12Cl2 |
| ⓘ Leadhillite Formula: Pb4(CO3)2(SO4)(OH)2 |
| ⓘ Lepidocrocite Formula: Fe3+O(OH) References: |
| ⓘ 'Limonite' |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 |
| ⓘ Litharge Formula: PbO |
| ⓘ Magnesite Formula: MgCO3 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ✪ Manganosite Formula: MnO Description: Small lamellar crystals grouped into rosettes. |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Massicot Formula: PbO |
| ⓘ Matlockite Formula: PbFCl References: |
| ⓘ Melanterite Formula: Fe2+(H2O)6SO4 · H2O |
| ⓘ Mesolite Formula: Na2Ca2Si9Al6O30 · 8H2O |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ 'Phillipsite Subgroup' Formula: (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| ⓘ Pickeringite Formula: MgAl2(SO4)4 · 22H2O |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 |
| ⓘ 'Pumpellyite Subgroup' Formula: Ca2XAl2[Si2O6(OH)][SiO4](OH)2A References: |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Pyrochroite Formula: Mn(OH)2 |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl |
| ⓘ Pyrophyllite Formula: Al2Si4O10(OH)2 |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 13 localities in this region. |
| ✪ Quartz var. Amethyst Formula: SiO2 References: |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 References: |
| ⓘ Ramsdellite Formula: Mn4+O2 References: |
| ⓘ 'Rhombohedral Carbonate' Formula: (Ca/Mg/Fe/Mn etc)CO3 |
| ⓘ Romanèchite Formula: (Ba,H2O)2(Mn4+,Mn3+)5O10 References: |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Siderite Formula: FeCO3 References: |
| ⓘ Smithsonite Formula: ZnCO3 |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Stibnite Formula: Sb2S3 |
| ⓘ 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ Sulphur Formula: S8 |
| ⓘ 'Synchysite' Formula: Ca(Ce/Nd/Y/REE)(CO3)2F |
| ⓘ Synchysite-(Ce) Formula: CaCe(CO3)2F |
| ⓘ Tetrahedrite-(Fe) Formula: Cu6(Cu4Fe2+2)Sb4S12S References: |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| ⓘ Titanite Formula: CaTi(SiO4)O |
| ⓘ Todorokite Formula: (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O References: |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Tschermigite Formula: (NH4)Al(SO4)2 · 12H2O |
| ⓘ Wilcoxite Formula: MgAl(SO4)2F · 17H2O References: |
| ⓘ Wulfenite Formula: Pb(MoO4) |
| ⓘ Xenotime-(Y) Formula: Y(PO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Cinnabar | 2.CD.15a | HgS |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Tetrahedrite-(Fe) | 2.GB.05 | Cu6(Cu4Fe2+2)Sb4S12S |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Laurelite | 3.DC.20 | Pb7F12Cl2 |
| ⓘ | Matlockite | 3.DC.25 | PbFCl |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Manganosite | 4.AB.25 | MnO |
| ⓘ | Litharge | 4.AC.20 | PbO |
| ⓘ | Massicot | 4.AC.25 | PbO |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hausmannite | 4.BB.10 | Mn2+Mn3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Ramsdellite | 4.DB.15a | Mn4+O2 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brookite | 4.DD.10 | TiO2 |
| ⓘ | Aeschynite-(Y) | 4.DF.05 | Y(TiNb)O6 |
| ⓘ | Coronadite | 4.DK.05a | Pb(Mn4+6Mn3+2)O16 |
| ⓘ | Cryptomelane | 4.DK.05a | K(Mn4+7Mn3+)O16 |
| ⓘ | Hollandite | 4.DK.05a | Ba(Mn4+6Mn3+2)O16 |
| ⓘ | Romanèchite | 4.DK.10 | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| ⓘ | Todorokite | 4.DK.10 | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| ⓘ | Pyrochroite | 4.FE.05 | Mn(OH)2 |
| ⓘ | Lepidocrocite | 4.FE.15 | Fe3+O(OH) |
| ⓘ | Cesàrolite | 4.FG.10 | PbMn4+3O6(OH)2 |
| ⓘ | Chalcophanite | 4.FL.20 | ZnMn4+3O7 · 3H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Bastnäsite-(Ce) | 5.BD.20a | Ce(CO3)F |
| ⓘ | Synchysite-(Ce) | 5.BD.20c | CaCe(CO3)2F |
| ⓘ | Leadhillite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Alunite | 7.BC.10 | KAl3(SO4)2(OH)6 |
| ⓘ | Caledonite | 7.BC.50 | Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6SO4 · H2O |
| ⓘ | Pickeringite | 7.CB.85 | MgAl2(SO4)4 · 22H2O |
| ⓘ | Tschermigite | 7.CC.20 | (NH4)Al(SO4)2 · 12H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Wilcoxite | 7.DE.45 | MgAl(SO4)2F · 17H2O |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 · 10-12H2O |
| Group 9 - Silicates | |||
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Axinite-(Fe) | 9.BD.20 | Ca2Fe2+Al2BSi4O15OH |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Edenite | 9.DE.15 | NaCa2Mg5(Si7Al)O22(OH)2 |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Pyrophyllite | 9.EC.10 | Al2Si4O10(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Aluminoceladonite | 9.EC.15 | K(MgAl◻)(Si4O10)(OH)2 |
| ⓘ | Dickite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Berthierine | 9.ED.15 | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Mesolite | 9.GA.05 | Na2Ca2Si9Al6O30 · 8H2O |
| ⓘ | Harmotome | 9.GC.10 | Ba2(Si12Al4)O32 · 12H2O |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Aeschynite' | - | |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chabazite' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Clinoptilolite Subgroup' | - | (Na/Ca/K)3-6[Al6-7Si29-30O72] · 20H2O |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Phillipsite Subgroup' | - | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| ⓘ | 'Pumpellyite Subgroup' | - | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| ⓘ | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ | 'Synchysite' | - | Ca(Ce/Nd/Y/REE)(CO3)2F |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Axinite Group' | - | |
| ⓘ | 'Gadolinite Group' | - | A2MQ2Si2O8φ2 |
| ⓘ | 'Rhombohedral Carbonate' | - | (Ca/Mg/Fe/Mn etc)CO3 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| H | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| H | ⓘ Cesàrolite | PbMn34+O6(OH)2 |
| H | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Clinoptilolite Subgroup | (Na/Ca/K)3-6[Al6-7Si29-30O72] · 20H2O |
| H | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| H | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| H | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Lepidocrocite | Fe3+O(OH) |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| H | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Phillipsite Subgroup | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| H | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| H | ⓘ Pyrochroite | Mn(OH)2 |
| H | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| H | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Tschermigite | (NH4)Al(SO4)2 · 12H2O |
| H | ⓘ Wilcoxite | MgAl(SO4)2F · 17H2O |
| H | ⓘ Aluminoceladonite | K(MgAl◻)(Si4O10)(OH)2 |
| H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| C | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| C | ⓘ Rhombohedral Carbonate | (Ca/Mg/Fe/Mn etc)CO3 |
| N | Nitrogen | |
| N | ⓘ Tschermigite | (NH4)Al(SO4)2 · 12H2O |
| O | Oxygen | |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Aeschynite-(Y) | Y(TiNb)O6 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| O | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Brookite | TiO2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Cesàrolite | PbMn34+O6(OH)2 |
| O | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Clinoptilolite Subgroup | (Na/Ca/K)3-6[Al6-7Si29-30O72] · 20H2O |
| O | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| O | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| O | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| O | ⓘ Hausmannite | Mn2+Mn23+O4 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Lepidocrocite | Fe3+O(OH) |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Litharge | PbO |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Manganosite | MnO |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Massicot | PbO |
| O | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| O | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Phillipsite Subgroup | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| O | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| O | ⓘ Pyrochroite | Mn(OH)2 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Ramsdellite | Mn4+O2 |
| O | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Tschermigite | (NH4)Al(SO4)2 · 12H2O |
| O | ⓘ Wilcoxite | MgAl(SO4)2F · 17H2O |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Aluminoceladonite | K(MgAl◻)(Si4O10)(OH)2 |
| O | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Gadolinite Group | A2MQ2Si2O8φ2 |
| O | ⓘ Rhombohedral Carbonate | (Ca/Mg/Fe/Mn etc)CO3 |
| F | Fluorine | |
| F | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Laurelite | Pb7F12Cl2 |
| F | ⓘ Matlockite | PbFCl |
| F | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| F | ⓘ Wilcoxite | MgAl(SO4)2F · 17H2O |
| F | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Clinoptilolite Subgroup | (Na/Ca/K)3-6[Al6-7Si29-30O72] · 20H2O |
| Na | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Na | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Na | ⓘ Phillipsite Subgroup | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| Mg | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Wilcoxite | MgAl(SO4)2F · 17H2O |
| Mg | ⓘ Aluminoceladonite | K(MgAl◻)(Si4O10)(OH)2 |
| Mg | ⓘ Rhombohedral Carbonate | (Ca/Mg/Fe/Mn etc)CO3 |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Clinoptilolite Subgroup | (Na/Ca/K)3-6[Al6-7Si29-30O72] · 20H2O |
| Al | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Al | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Phillipsite Subgroup | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| Al | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| Al | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Al | ⓘ Tschermigite | (NH4)Al(SO4)2 · 12H2O |
| Al | ⓘ Wilcoxite | MgAl(SO4)2F · 17H2O |
| Al | ⓘ Aluminoceladonite | K(MgAl◻)(Si4O10)(OH)2 |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Clinoptilolite Subgroup | (Na/Ca/K)3-6[Al6-7Si29-30O72] · 20H2O |
| Si | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Si | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Phillipsite Subgroup | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| Si | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Aluminoceladonite | K(MgAl◻)(Si4O10)(OH)2 |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Gadolinite Group | A2MQ2Si2O8φ2 |
| P | Phosphorus | |
| P | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Cinnabar | HgS |
| S | ⓘ Covellite | CuS |
| S | ⓘ Galena | PbS |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Sulphur | S8 |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Tschermigite | (NH4)Al(SO4)2 · 12H2O |
| S | ⓘ Wilcoxite | MgAl(SO4)2F · 17H2O |
| S | ⓘ Tetrahedrite-(Fe) | Cu6(Cu4Fe22+)Sb4S12S |
| Cl | Chlorine | |
| Cl | ⓘ Laurelite | Pb7F12Cl2 |
| Cl | ⓘ Matlockite | PbFCl |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Clinoptilolite Subgroup | (Na/Ca/K)3-6[Al6-7Si29-30O72] · 20H2O |
| K | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Phillipsite Subgroup | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| K | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| K | ⓘ Aluminoceladonite | K(MgAl◻)(Si4O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Clinoptilolite Subgroup | (Na/Ca/K)3-6[Al6-7Si29-30O72] · 20H2O |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Ca | ⓘ Phillipsite Subgroup | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| Ca | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | ⓘ Rhombohedral Carbonate | (Ca/Mg/Fe/Mn etc)CO3 |
| Ti | Titanium | |
| Ti | ⓘ Aeschynite-(Y) | Y(TiNb)O6 |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brookite | TiO2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Mn | Manganese | |
| Mn | ⓘ Cesàrolite | PbMn34+O6(OH)2 |
| Mn | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| Mn | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Mn | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| Mn | ⓘ Hausmannite | Mn2+Mn23+O4 |
| Mn | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| Mn | ⓘ Manganosite | MnO |
| Mn | ⓘ Pyrochroite | Mn(OH)2 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Ramsdellite | Mn4+O2 |
| Mn | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Mn | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mn | ⓘ Rhombohedral Carbonate | (Ca/Mg/Fe/Mn etc)CO3 |
| Fe | Iron | |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Lepidocrocite | Fe3+O(OH) |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Tetrahedrite-(Fe) | Cu6(Cu4Fe22+)Sb4S12S |
| Fe | ⓘ Rhombohedral Carbonate | (Ca/Mg/Fe/Mn etc)CO3 |
| Cu | Copper | |
| Cu | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Tetrahedrite-(Fe) | Cu6(Cu4Fe22+)Sb4S12S |
| Zn | Zinc | |
| Zn | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Sr | Strontium | |
| Sr | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Y | Yttrium | |
| Y | ⓘ Aeschynite-(Y) | Y(TiNb)O6 |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Y | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| Nb | Niobium | |
| Nb | ⓘ Aeschynite-(Y) | Y(TiNb)O6 |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| Sb | Antimony | |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Tetrahedrite-(Fe) | Cu6(Cu4Fe22+)Sb4S12S |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Ba | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| Ba | ⓘ Phillipsite Subgroup | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| Ba | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Ba | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Ce | Cerium | |
| Ce | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Ce | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ce | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| Nd | Neodymium | |
| Nd | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| Hg | Mercury | |
| Hg | ⓘ Cinnabar | HgS |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Cesàrolite | PbMn34+O6(OH)2 |
| Pb | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Laurelite | Pb7F12Cl2 |
| Pb | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Litharge | PbO |
| Pb | ⓘ Massicot | PbO |
| Pb | ⓘ Matlockite | PbFCl |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| U | Uranium | |
| U | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Localities in this Region
- Piedmont
- Cuneo Province
- Piedmont
- Cuneo Province
- Valdieri
- Cuneo Province
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
- AlpsAccretionary Complex
Europe
- The AlpsMountain Range
Italy
- Piedmont
- Cuneo Province
- Gesso ValleyValley
- Cuneo Province
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Argentera Group, Cuneo Province, Piedmont, Italy