Costabonne mines (Costabona mines), Prats-de-Mollo-la-Preste, Céret, Pyrénées-Orientales, Occitanie, Francei
| Regional Level Types | |
|---|---|
| Costabonne mines (Costabona mines) | Group of Mines |
| Prats-de-Mollo-la-Preste | Commune |
| Céret | Arrondissement |
| Pyrénées-Orientales | Department |
| Occitanie | Region |
| France | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
42° 24' 55'' North , 2° 20' 53'' East
Latitude & Longitude (decimal):
Type:
Group of Mines
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Py | 108 (2016) | 8.8km |
| Molló | 350 (2010) | 8.9km |
| Freixenet | 122 (2010) | 9.2km |
| Vilallonga de Ter | 414 (2012) | 9.8km |
| Prats de Molló | 1,191 (2016) | 10.8km |
Other/historical names associated with this locality:
Languedoc-Roussillon
Name(s) in local language(s):
Mines de Costabonne (mines del Costabona)
Skarn formed by contact metamorphism of Hercynian granite intruded into Cambrian-Ordovician marbles.
Several workings on both sides of the French-Spanish border, in a mountainous area on the southeastern slopes of Costabona Peak (2464 m high). The most important part of the deposit is located on the French side. The two workings developed on the Spanish side are located at Coma de Fra Joan, Setcases, Ripollès, Gerona (Girona), Catalonia and at Roca del Turó, Espinavell, Ripollès, Gerona (Girona), Catalonia.
Has been compared to the Anglade Mine, Salau skarn.
Several workings on both sides of the French-Spanish border, in a mountainous area on the southeastern slopes of Costabona Peak (2464 m high). The most important part of the deposit is located on the French side. The two workings developed on the Spanish side are located at Coma de Fra Joan, Setcases, Ripollès, Gerona (Girona), Catalonia and at Roca del Turó, Espinavell, Ripollès, Gerona (Girona), Catalonia.
Has been compared to the Anglade Mine, Salau skarn.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
98 valid minerals.
Rock Types Recorded
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ Amesite Formula: Mg2Al(AlSiO5)(OH)4 |
| ⓘ Andalusite Formula: Al2(SiO4)O |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 |
| ⓘ Antigorite Formula: Mg3(Si2O5)(OH)4 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Artinite Formula: Mg2(CO3)(OH)2 · 3H2O |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ 'Axinite Group' |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 |
| ⓘ Baddeleyite Formula: ZrO2 |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ Bismutite Formula: (BiO)2CO3 |
| ⓘ Boulangerite Formula: Pb5Sb4S11 |
| ⓘ Bromellite Formula: BeO |
| ⓘ Brucite Formula: Mg(OH)2 |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Chondrodite Formula: Mg5(SiO4)2F2 |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ Chrysotile Formula: Mg3(Si2O5)(OH)4 |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinochlore var. Pennine Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinochlore var. Sheridanite Formula: (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
| ⓘ Clinohumite Formula: Mg9(SiO4)4F2 |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Clintonite Formula: CaAlMg2(SiAl3O10)(OH)2 |
| ⓘ Cordierite Formula: Mg2Al4Si5O18 |
| ⓘ Diaspore Formula: AlO(OH) |
| ⓘ Diopside Formula: CaMgSi2O6 References: |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Eulytine Formula: Bi4(SiO4)3 |
| ⓘ Fluoborite Formula: Mg3(BO3)(F,OH)3 |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Forsterite Formula: Mg2(SiO4) |
| ⓘ Friedelite Formula: Mn2+8Si6O15(OH,Cl)10 |
| ⓘ Galena Formula: PbS |
| ⓘ Galenobismutite Formula: PbBi2S4 |
| ⓘ Geikielite Formula: MgTiO3 |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Graphite Formula: C |
| ⓘ Greenockite Formula: CdS |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Helvine Formula: Be3Mn2+4(SiO4)3S |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O |
| ⓘ Heterogenite Formula: Co3+O(OH) |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ Hydromagnesite Formula: Mg5(CO3)4(OH)2 · 4H2O |
| ⓘ Hydrotalcite Formula: Mg6Al2(CO3)(OH)16 · 4H2O |
| ⓘ 'Hydrotalcite-2H' Formula: Mg6Al2(CO3)(OH)16 · 4H2O |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Johannsenite Formula: CaMn2+Si2O6 |
| ⓘ Karlite Formula: (Mg,Al)6.5(BO3)3(OH)4(◻,Cl)0.5 |
| ⓘ Kotoite Formula: Mg3[BO3]2 |
| ⓘ Ludwigite Formula: Mg2Fe3+(BO3)O2 |
| ⓘ Magnesiotaaffeite-6N’3S Formula: Mg2BeAl6O12 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Margarite Formula: CaAl2(Al2Si2O10)(OH)2 |
| ⓘ Mixite Formula: BiCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Molybdite Formula: MoO3 |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Gold Formula: Au |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Pargasite Formula: NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| ⓘ Periclase Formula: MgO |
| ⓘ Perovskite Formula: CaTiO3 |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 |
| ⓘ Piemontite Formula: (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| ⓘ Powellite Formula: Ca(MoO4) |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyrophanite Formula: Mn2+TiO3 |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Sellaite Formula: MgF2 |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Smithsonite Formula: ZnCO3 |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Spinel Formula: MgAl2O4 |
| ⓘ Stilpnomelane Formula: K4Fe2+48[Si64Al8]O164(OH)52 · nH2O |
| ⓘ Suanite Formula: Mg2[B2O5] |
| ⓘ Szaibélyite Formula: MgBO2(OH) References: |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| ⓘ Titanite Formula: CaTiO(SiO4) |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Uraninite Formula: UO2 |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ Wollastonite Formula: Ca3(Si3O9) |
| ⓘ Zircon Formula: Zr(SiO4) |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Galenobismutite | 2.JB.25e | PbBi2S4 |
| Group 3 - Halides | |||
| ⓘ | Sellaite | 3.AB.15 | MgF2 |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Bromellite | 4.AB.20 | BeO |
| ⓘ | Periclase | 4.AB.25 | MgO |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Geikielite | 4.CB.05 | MgTiO3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Pyrophanite | 4.CB.05 | Mn2+TiO3 |
| ⓘ | Perovskite | 4.CC.30 | CaTiO3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Baddeleyite | 4.DE.35 | ZrO2 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | Molybdite | 4.E0.10 | MoO3 |
| ⓘ | Magnesiotaaffeite-6N’3S | 4.FC.25 | Mg2BeAl6O12 |
| ⓘ | Diaspore | 4.FD.10 | AlO(OH) |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| ⓘ | Brucite | 4.FE.05 | Mg(OH)2 |
| ⓘ | Heterogenite | 4.FE.20 | Co3+O(OH) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| ⓘ | Hydromagnesite | 5.DA.05 | Mg5(CO3)4(OH)2 · 4H2O |
| ⓘ | Artinite | 5.DA.10 | Mg2(CO3)(OH)2 · 3H2O |
| ⓘ | 'Hydrotalcite-2H' | 5.DA.45 | Mg6Al2(CO3)(OH)16 · 4H2O |
| ⓘ | Hydrotalcite | 5.DA.50 | Mg6Al2(CO3)(OH)16 · 4H2O |
| Group 6 - Borates | |||
| ⓘ | Kotoite | 6.AA.35 | Mg3[BO3]2 |
| ⓘ | Karlite | 6.AB.25 | (Mg,Al)6.5(BO3)3(OH)4(◻,Cl)0.5 |
| ⓘ | Ludwigite | 6.AB.30 | Mg2Fe3+(BO3)O2 |
| ⓘ | Fluoborite | 6.AB.50 | Mg3(BO3)(F,OH)3 |
| ⓘ | Suanite | 6.BA.05 | Mg2[B2O5] |
| ⓘ | Szaibélyite | 6.BA.15 | MgBO2(OH) |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Powellite | 7.GA.05 | Ca(MoO4) |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Mixite | 8.DL.15 | BiCu6(AsO4)3(OH)6 · 3H2O |
| Group 9 - Silicates | |||
| ⓘ | Chrysotile | 9.00. | Mg3(Si2O5)(OH)4 |
| ⓘ | Forsterite | 9.AC.05 | Mg2(SiO4) |
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Eulytine | 9.AD.40 | Bi4(SiO4)3 |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Chondrodite | 9.AF.45 | Mg5(SiO4)2F2 |
| ⓘ | Clinohumite | 9.AF.55 | Mg9(SiO4)4F2 |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Piemontite | 9.BG.05a | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Cordierite | 9.CJ.10 | Mg2Al4Si5O18 |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Johannsenite | 9.DA.15 | CaMn2+Si2O6 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Pargasite | 9.DE.15 | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Margarite | 9.EC.30 | CaAl2(Al2Si2O10)(OH)2 |
| ⓘ | Clintonite | 9.EC.35 | CaAlMg2(SiAl3O10)(OH)2 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | var. Pennine | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | var. Sheridanite | 9.EC.55 | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
| ⓘ | Amesite | 9.ED.15 | Mg2Al(AlSiO5)(OH)4 |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Friedelite | 9.EE.10 | Mn2+8Si6O15(OH,Cl)10 |
| ⓘ | Stilpnomelane | 9.EG.40 | K4Fe2+48[Si64Al8]O164(OH)52 · nH2O |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Helvine | 9.FB.10 | Be3Mn2+4(SiO4)3S |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Axinite Group' | - | |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Artinite | Mg2(CO3)(OH)2 · 3H2O |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brucite | Mg(OH)2 |
| H | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Clintonite | CaAlMg2(SiAl3O10)(OH)2 |
| H | ⓘ Diaspore | AlO(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Fluoborite | Mg3(BO3)(F,OH)3 |
| H | ⓘ Friedelite | Mn82+Si6O15(OH,Cl)10 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Heterogenite | Co3+O(OH) |
| H | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| H | ⓘ Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Karlite | (Mg,Al)6.5(BO3)3(OH)4(◻,Cl)0.5 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Hydrotalcite-2H | Mg6Al2(CO3)(OH)16 · 4H2O |
| H | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| H | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| H | ⓘ Szaibélyite | MgBO2(OH) |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Clinochlore var. Sheridanite | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Be | Beryllium | |
| Be | ⓘ Bromellite | BeO |
| Be | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Be | ⓘ Magnesiotaaffeite-6N’3S | Mg2BeAl6O12 |
| B | Boron | |
| B | ⓘ Fluoborite | Mg3(BO3)(F,OH)3 |
| B | ⓘ Karlite | (Mg,Al)6.5(BO3)3(OH)4(◻,Cl)0.5 |
| B | ⓘ Kotoite | Mg3[BO3]2 |
| B | ⓘ Ludwigite | Mg2Fe3+(BO3)O2 |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Suanite | Mg2[B2O5] |
| B | ⓘ Szaibélyite | MgBO2(OH) |
| C | Carbon | |
| C | ⓘ Artinite | Mg2(CO3)(OH)2 · 3H2O |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| C | ⓘ Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Hydrotalcite-2H | Mg6Al2(CO3)(OH)16 · 4H2O |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Artinite | Mg2(CO3)(OH)2 · 3H2O |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Baddeleyite | ZrO2 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Bromellite | BeO |
| O | ⓘ Brucite | Mg(OH)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Clintonite | CaAlMg2(SiAl3O10)(OH)2 |
| O | ⓘ Cordierite | Mg2Al4Si5O18 |
| O | ⓘ Diaspore | AlO(OH) |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Eulytine | Bi4(SiO4)3 |
| O | ⓘ Fluoborite | Mg3(BO3)(F,OH)3 |
| O | ⓘ Forsterite | Mg2(SiO4) |
| O | ⓘ Friedelite | Mn82+Si6O15(OH,Cl)10 |
| O | ⓘ Geikielite | MgTiO3 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Heterogenite | Co3+O(OH) |
| O | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| O | ⓘ Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Johannsenite | CaMn2+Si2O6 |
| O | ⓘ Karlite | (Mg,Al)6.5(BO3)3(OH)4(◻,Cl)0.5 |
| O | ⓘ Kotoite | Mg3[BO3]2 |
| O | ⓘ Ludwigite | Mg2Fe3+(BO3)O2 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Hydrotalcite-2H | Mg6Al2(CO3)(OH)16 · 4H2O |
| O | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| O | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| O | ⓘ Molybdite | MoO3 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Magnesiotaaffeite-6N’3S | Mg2BeAl6O12 |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| O | ⓘ Periclase | MgO |
| O | ⓘ Perovskite | CaTiO3 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Powellite | Ca(MoO4) |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pyrophanite | Mn2+TiO3 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| O | ⓘ Suanite | Mg2[B2O5] |
| O | ⓘ Szaibélyite | MgBO2(OH) |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Clinochlore var. Sheridanite | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| F | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| F | ⓘ Fluoborite | Mg3(BO3)(F,OH)3 |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Sellaite | MgF2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Artinite | Mg2(CO3)(OH)2 · 3H2O |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Brucite | Mg(OH)2 |
| Mg | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| Mg | ⓘ Clintonite | CaAlMg2(SiAl3O10)(OH)2 |
| Mg | ⓘ Cordierite | Mg2Al4Si5O18 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Fluoborite | Mg3(BO3)(F,OH)3 |
| Mg | ⓘ Forsterite | Mg2(SiO4) |
| Mg | ⓘ Geikielite | MgTiO3 |
| Mg | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| Mg | ⓘ Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| Mg | ⓘ Karlite | (Mg,Al)6.5(BO3)3(OH)4(◻,Cl)0.5 |
| Mg | ⓘ Kotoite | Mg3[BO3]2 |
| Mg | ⓘ Ludwigite | Mg2Fe3+(BO3)O2 |
| Mg | ⓘ Hydrotalcite-2H | Mg6Al2(CO3)(OH)16 · 4H2O |
| Mg | ⓘ Magnesiotaaffeite-6N’3S | Mg2BeAl6O12 |
| Mg | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Mg | ⓘ Periclase | MgO |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Sellaite | MgF2 |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Suanite | Mg2[B2O5] |
| Mg | ⓘ Szaibélyite | MgBO2(OH) |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Mg | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Clinochlore var. Sheridanite | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Clintonite | CaAlMg2(SiAl3O10)(OH)2 |
| Al | ⓘ Cordierite | Mg2Al4Si5O18 |
| Al | ⓘ Diaspore | AlO(OH) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Hydrotalcite | Mg6Al2(CO3)(OH)16 · 4H2O |
| Al | ⓘ Karlite | (Mg,Al)6.5(BO3)3(OH)4(◻,Cl)0.5 |
| Al | ⓘ Hydrotalcite-2H | Mg6Al2(CO3)(OH)16 · 4H2O |
| Al | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Magnesiotaaffeite-6N’3S | Mg2BeAl6O12 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Al | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinochlore var. Sheridanite | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Clintonite | CaAlMg2(SiAl3O10)(OH)2 |
| Si | ⓘ Cordierite | Mg2Al4Si5O18 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Eulytine | Bi4(SiO4)3 |
| Si | ⓘ Forsterite | Mg2(SiO4) |
| Si | ⓘ Friedelite | Mn82+Si6O15(OH,Cl)10 |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Johannsenite | CaMn2+Si2O6 |
| Si | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Clinochlore var. Sheridanite | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Galena | PbS |
| S | ⓘ Galenobismutite | PbBi2S4 |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cl | Chlorine | |
| Cl | ⓘ Friedelite | Mn82+Si6O15(OH,Cl)10 |
| Cl | ⓘ Karlite | (Mg,Al)6.5(BO3)3(OH)4(◻,Cl)0.5 |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Clintonite | CaAlMg2(SiAl3O10)(OH)2 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Johannsenite | CaMn2+Si2O6 |
| Ca | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Ca | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Perovskite | CaTiO3 |
| Ca | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Powellite | Ca(MoO4) |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Geikielite | MgTiO3 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Perovskite | CaTiO3 |
| Ti | ⓘ Pyrophanite | Mn2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Mn | Manganese | |
| Mn | ⓘ Friedelite | Mn82+Si6O15(OH,Cl)10 |
| Mn | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Mn | ⓘ Johannsenite | CaMn2+Si2O6 |
| Mn | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Mn | ⓘ Pyrophanite | Mn2+TiO3 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Ludwigite | Mg2Fe3+(BO3)O2 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Clinochlore var. Sheridanite | (Mg,Al,Fe)6(Si,Al)4O10(OH)8 |
| Co | Cobalt | |
| Co | ⓘ Heterogenite | Co3+O(OH) |
| Cu | Copper | |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Zn | Zinc | |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| Zr | Zirconium | |
| Zr | ⓘ Baddeleyite | ZrO2 |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Molybdite | MoO3 |
| Mo | ⓘ Powellite | Ca(MoO4) |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| Sb | Antimony | |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Galenobismutite | PbBi2S4 |
| Bi | Bismuth | |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Eulytine | Bi4(SiO4)3 |
| Bi | ⓘ Galenobismutite | PbBi2S4 |
| Bi | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| U | Uranium | |
| U | ⓘ Uraninite | UO2 |
Other Regions, Features and Areas containing this locality
Eurasian PlateTectonic Plate
- Cantabrian-Pyrenean BeltOrogenic Belt
EuropeContinent
- PyreneesMountain Range
France
- ⭔Languedoc-RoussillonRegion
Iberian PeninsulaPeninsula
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Guitard, Gérard, Pierrot, Roland (1957) Sur la présence d'eulytite et de mixite dans la minéralisation bismuthifère du Pic de Costabonne (Pyrénées-Orientales) Bulletin de Minéralogie, 80 (4) 229-231 doi:10.3406/bulmi.1957.5162
van Marcke de Lummen, Guy (1985) An Fe-Ti oxides-apatite-biotite (nelsonite) deposit related to the Costabonne granite, eastern Pyrénées, France. Bulletin de Minéralogie, 108 (3) 353-365 doi:10.3406/bulmi.1985.7834
van Marcke de Lummen, G., Verkaeren, J. (1986) Physicochemical study of skarn formation in pelitic rock, Costabonne peak area, eastern Pyrenees, France. Contributions to Mineralogy and Petrology, 93 (1) 77-88 doi:10.1007/bf00963586
Dubru, M., Auwera, J. Vander, Marcke de Lummen, G., Verkaeren, J. (1988) Distribution of Scheelite in Magnesian Skarns at Traversella (Piemontese Alps, Italy) and Costabonne (Eastern Pyrenees, France): Nature of the Associated Magmatism and Influence of Fluid Composition. In Mineral Deposits within the European Community. Springer Berlin Heidelberg. p.117-134. doi:10.1007/978-3-642-51858-4_6




Costabonne mines, Prats-de-Mollo-la-Preste, Céret, Pyrénées-Orientales, Occitanie, France