Fougères-Vitré, Ille-et-Vilaine, Brittany, Francei
| Regional Level Types | |
|---|---|
| Fougères-Vitré | Arrondissement |
| Ille-et-Vilaine | Department |
| Brittany | Region |
| France | Country |
This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Fougères | 23,719 (2016) |
| Vitré | 17,266 (2016) |
| Janzé | 5,927 (2016) |
| Châteaubourg | 5,362 (2016) |
| La Guerche-de-Bretagne | 4,552 (2016) |
| Louvigné-du-Désert | 4,467 (2016) |
Other Languages:
French:
Fougères-Vitré, Ille-et-Vilaine, Bretagne, France
German:
Arrondissement Fougères-Vitré, Département Ille-et-Vilaine, Bretagne, Frankreich
Italian:
arrondissement di Fougères-Vitré, Ille-et-Vilaine, Bretagna, Francia
Russian:
Фужер , Иль и Вилен, Бретань, Франция
Simplified Chinese:
弗热尔区, 伊勒-维莱讷省, 布列塔尼半岛, 法国
Spanish:
Distrito de Fougères-Vitré, Ille y Vilaine, Bretón, Francia
Albanian:
Qarku Fougères-Vitré, Ille-et-Vilaine, Bretagne, Franca
Alemannic:
Arrondissement Fougères-Vitré, Bretagne, Frankreich
Aragonese:
Destrito de Felger-Gwitreg, Il-ha-Gwilen, Bretanya, Francia
Azeri:
Fujer-Vitre , İl və Vilen, Bretan, Fransa
Basque:
Fougèreseko barrutia, Ille-et-Vilaine, Bretainia, Frantzia
Breton:
Felger-Gwitreg, Il-ha-Gwilen, Breizh, Bro-C'hall
Catalan:
Districte de Fougères-Vitré, Ille i Vilaine, Bretanya, França
Cebuano:
Arrondissement de Fougères-Vitré, Ille-et-Vilaine, Bretagne, Pransiya
Czech:
Arrondissement Fougères-Vitré, Ille-et-Vilaine, Bretaň, Francie
Dutch:
Arrondissement Fougères-Vitré, Ille-et-Vilaine, Bretagne, Frankrijk
Farsi/Persian:
بخش فوژر-ویتره, ایل-ا-ویلن, برتاین , فرانسه
Greek:
Διαμέρισμα της Φουζέρ-Βιτρέ, Ιλ-ε-Βιλαίν, Βρετάνη, Γαλλία
Indonesian:
Arondisemen Fougères, Ille-et-Vilaine, Bretagne, Perancis
Luxembourgish:
Arrondissement Fougères-Vitré, Departement Ille-et-Vilaine, Bretagne, Frankräich
Minnan / Hokkien-Taiwanese:
Fougères Kūn, Ille-et-Vilaine, Région Bretagne, Hoat-kok
Polish:
Okręg Fougères-Vitré, Ille-et-Vilaine, Bretania, Francja
Romanian:
Arondismentul Fougères-Vitré, Ille-et-Vilaine, Bretania, Franța
Slovak:
Fougères-Vitré, Ille-et-Vilaine, Bretónsko, Francúzsko
Ukrainian:
Фужер-Вітре, Іль і Вілен, Бретань, Франція
Vietnamese:
Fougères-Vitré, Ille-et-Vilaine, Bretagne, Pháp
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities59 valid minerals. 1 (TL) - type locality of valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Antimony | 1.CA.05 | Sb |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Mackinawite | 2.CC.25 | FeS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Aurostibite | 2.EB.05a | AuSb2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Ullmannite | 2.EB.25 | NiSbS |
| ⓘ | Kermesite | 2.FD.05 | Sb2S2O |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Chalcostibite | 2.HA.05 | CuSbS2 |
| ⓘ | Berthierite | 2.HA.20 | FeSb2S4 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Valentinite | 4.CB.55 | Sb2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | var. Opal-CT | 4.DA.10 | SiO2 · nH2O |
| ⓘ | var. Girasol | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Ferberite | 4.DB.30 | FeWO4 |
| ⓘ | Hübnerite | 4.DB.30 | MnWO4 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | Lepidocrocite | 4.FE.15 | Fe3+O(OH) |
| ⓘ | Tungstite | 4.FJ.10 | WO3 · H2O |
| ⓘ | Fougèrite (TL) | 4.FL.05 | Fe2+4Fe3+2(OH)12[CO3] · 3H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 · 10-12H2O |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | var. Damourite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Allophane | 9.ED.20 | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Leucoxene' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Petroleum var. Bitumen' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| H | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Lepidocrocite | Fe3+O(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Tungstite | WO3 · H2O |
| H | ⓘ Muscovite var. Damourite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Fougèrite | Fe42+Fe23+(OH)12[CO3] · 3H2O |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Opal var. Opal-CT | SiO2 · nH2O |
| H | ⓘ Opal var. Girasol | SiO2 · nH2O |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Graphite | C |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Fougèrite | Fe42+Fe23+(OH)12[CO3] · 3H2O |
| O | Oxygen | |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Ferberite | FeWO4 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hübnerite | MnWO4 |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Kermesite | Sb2S2O |
| O | ⓘ Lepidocrocite | Fe3+O(OH) |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tungstite | WO3 · H2O |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Valentinite | Sb2O3 |
| O | ⓘ Muscovite var. Damourite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Fougèrite | Fe42+Fe23+(OH)12[CO3] · 3H2O |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Opal var. Opal-CT | SiO2 · nH2O |
| O | ⓘ Opal var. Girasol | SiO2 · nH2O |
| F | Fluorine | |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Muscovite var. Damourite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Muscovite var. Damourite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Opal var. Opal-CT | SiO2 · nH2O |
| Si | ⓘ Opal var. Girasol | SiO2 · nH2O |
| P | Phosphorus | |
| P | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Berthierite | FeSb2S4 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcostibite | CuSbS2 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Kermesite | Sb2S2O |
| S | ⓘ Mackinawite | FeS |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stannite | Cu2FeSnS4 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Ullmannite | NiSbS |
| Cl | Chlorine | |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Muscovite var. Damourite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Mn | Manganese | |
| Mn | ⓘ Hübnerite | MnWO4 |
| Fe | Iron | |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Berthierite | FeSb2S4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Ferberite | FeWO4 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Lepidocrocite | Fe3+O(OH) |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Mackinawite | FeS |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Fe | ⓘ Fougèrite | Fe42+Fe23+(OH)12[CO3] · 3H2O |
| Ni | Nickel | |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Ullmannite | NiSbS |
| Cu | Copper | |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcostibite | CuSbS2 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Löllingite | FeAs2 |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sb | Antimony | |
| Sb | ⓘ Native Antimony | Sb |
| Sb | ⓘ Aurostibite | AuSb2 |
| Sb | ⓘ Berthierite | FeSb2S4 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Chalcostibite | CuSbS2 |
| Sb | ⓘ Kermesite | Sb2S2O |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Ullmannite | NiSbS |
| Sb | ⓘ Valentinite | Sb2O3 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| W | Tungsten | |
| W | ⓘ Ferberite | FeWO4 |
| W | ⓘ Hübnerite | MnWO4 |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Tungstite | WO3 · H2O |
| Au | Gold | |
| Au | ⓘ Aurostibite | AuSb2 |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Galena | PbS |
| Bi | Bismuth | |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| U | Uranium | |
| U | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | ⓘ Uraninite | UO2 |
Fossils
There are 1 fossil locality from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 1 | ||||||
|---|---|---|---|---|---|---|---|
| Youngest Fossil Listed | 450 Ma (Late/Upper Ordovician) | ||||||
| Oldest Fossil Listed | 466 Ma (Middle Ordovician) | ||||||
| Stratigraphic Units |
| ||||||
| Fossils from Region | Click here to show the list. | ||||||
| Fossil Localities | Click to show 1 fossil locality |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Arrondissement_of_Foug%C3%A8res-Vitr%C3%A9 |
|---|---|
| Wikidata ID: | Q701222 |
| GeoNames ID: | 3017608 |
Localities in this Region
- Brittany
- Ille-et-Vilaine
- Fougères-Vitré
- ⭔Amanlis
- ⭔Arbrissel
- ⭔Argentré-du-Plessis
- ⭔Availles-sur-Seiche
- ⭔Bais
- ⭔Balazé
- ⭔Bazouges-la-Pérouse
- ⭔Beaucé
- ⭔Billé
- ⭔Boistrudan
- ⭔Bréal-sous-Vitré
- ⭔Brie
- ⭔Brielles
- ⭔Champeaux
- ⭔Châteaubourg
- ⭔Châtillon-en-Vendelais
- ⭔Chauvigné
- ⭔Chelun
- ⭔Coësmes
- ⭔Combourtillé
- ⭔Cornillé
- ⭔Domagné
- ⭔Domalain
- ⭔Drouges
- ⭔Eancé
- ⭔Erbrée
- ⭔Essé
- ⭔Étrelles
- ⭔Fleurigné
- ⭔Forges-la-Forêt
- ⭔Fougères
- ⭔Gennes-sur-Seiche
- ⭔Janzé
- ⭔Javené
- ⭔La Bazouge-du-Désert
- ⭔La Chapelle-Erbrée
- ⭔La Chapelle-Janson
- ⭔La Chapelle-Saint-Aubert
- ⭔La Guerche-de-Bretagne
- ⭔La Selle-en-Luitré
- ⭔La Selle-Guerchaise
- ⭔Laignelet
- ⭔Landavran
- ⭔Landéan
- ⭔Le Châtellier
- ⭔Le Ferré
- ⭔Le Loroux
- ⭔Le Pertre
- ⭔Le Theil-de-Bretagne
- ⭔Le Tiercent
- ⭔Lécousse
- ⭔Les Portes du Coglais
- Fougères-Vitré
- Ille-et-Vilaine
- Brittany
- Ille-et-Vilaine
- Fougères-Vitré
- ⭔Louvigné-de-Bais
- ⭔Louvigné-du-Désert
- ⭔Luitré-Dompierre
- ⭔Luitré
- ⭔Maen-Roch
- ⭔Marcillé-Raoul
- ⭔Marcillé-Robert
- ⭔Marpiré
- ⭔Martigné-Ferchaud
- ⭔Mecé
- ⭔Mellé
- ⭔Mondevert
- ⭔Montautour
- ⭔Monthault
- ⭔Montreuil-des-Landes
- ⭔Montreuil-sous-Pérouse
- ⭔Moulins
- ⭔Moussé
- ⭔Moutiers
- ⭔Noyal-sous-Bazouges
- ⭔Parcé
- ⭔Parigné
- ⭔Pocé-les-Bois
- ⭔Poilley
- ⭔Princé
- ⭔Rannée
- ⭔Retiers
- ⭔Rimou
- ⭔Rives-du-Couesnon
- ⭔Romagné
- ⭔Romazy
- ⭔Saint-Aubin-des-Landes
- ⭔Saint-Christophe-de-Valains
- ⭔Saint-Christophe-des-Bois
- ⭔Saint-Didier
- ⭔Saint-Georges-de-Reintembault
- ⭔Saint-Germain-du-Pinel
- ⭔Saint-Germain-en-Coglès
- ⭔Saint-Hilaire-des-Landes
- ⭔Saint-Jean-sur-Vilaine
- ⭔Saint-M'Hervé
- ⭔Saint-Marc-le-Blanc
- ⭔Saint-Ouen-des-Alleux
- ⭔Saint-Rémy-du-Plain
- ⭔Saint-Sauveur-des-Landes
- ⭔Sainte-Colombe
- ⭔Taillis
- ⭔Thourie
- ⭔Torcé
- ⭔Val-Couesnon
- ⭔Val-d'Izé
- ⭔Vergéal
- ⭔Villamée
- ⭔Visseiche
- ⭔Vitré
- Fougères-Vitré
- Ille-et-Vilaine
Other Regions, Features and Areas that Intersect
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions
Le Semnon, Martigné-Ferchaud, Fougères-Vitré, Ille-et-Vilaine, Brittany, France