Dartmouth and Teign Valley Mining District, Devon, England, UKi
| Regional Level Types | |
|---|---|
| Dartmouth and Teign Valley Mining District | Mining District |
| Devon | County |
| England | Constituent Country |
| UK | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Newton Abbot | 36,474 (2018) |
| Bovey Tracey | 4,729 (2018) |
| Chudleigh | 4,011 (2018) |
| Buckfastleigh | 3,631 (2018) |
| Ashburton | 3,346 (2018) |
| Ipplepen | 2,143 (2018) |
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities59 valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ Anglesite Formula: PbSO4 References: |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Localities: Haytor Mine, Ilsington, Teignbridge, Devon, England, UK Woolley Farm, Bovey Tracey, Teignbridge, Devon, England, UK Tornewton cave, Denbury and Torbryan, Teignbridge, Devon, England, UK Bittleford Down, Widecombe-in-the-Moor, Teignbridge, Devon, England, UK Leusdon Common, Widecombe-in-the-Moor, Teignbridge, Devon, England, UK |
| ⓘ 'Apatite var. Collophane' Formula: Ca5(PO4)3(Cl/F/OH) |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Arsenolite Formula: As2O3 References: |
| ⓘ Arsenopyrite Formula: FeAsS Localities: Wheal Exmouth, Christow, Teignbridge, Devon, England, UK Whiddon Mine (Whiddon and Brownshill Mine), Ashburton, Teignbridge, Devon, England, UK Yarner Copper Mine, Bovey Tracey, Teignbridge, Devon, England, UK Wrey Consols, West Buckfastleigh, Teignbridge, Devon, England, UK Druid Mine (New Victoria Mine; Arundell Mine), Ashburton, Teignbridge, Devon, England, UK |
| ⓘ Axinite-(Fe) Formula: Ca2Fe2+Al2BSi4O15OH |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ 'Bindheimite' Formula: Pb2Sb2O6O Description: Forms resinous to powdery pale yellow replacements of Tetrahedrite. References: |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Bournonite Formula: PbCuSbS3 References: |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 7 localities in this region. |
| ⓘ Cassiterite Formula: SnO2 Localities: Reported from at least 21 localities in this region. |
| ⓘ Cerussite Formula: PbCO3 |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 11 localities in this region. |
| ⓘ 'Chlorite Group' |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 Description: As small pastel green deposits without any discernable form rarely found between faces in the black shale. I have tried to photograph it but without success. References: |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ Coffinite Formula: U(SiO4) · nH2O References: |
| ⓘ Cordierite Formula: (Mg,Fe)2Al3(AlSi5O18) |
| ⓘ Datolite Formula: CaB(SiO4)(OH) |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Galena Formula: PbS |
| ⓘ Galena var. Silver-bearing Galena Formula: PbS with Ag References: |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 References: |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Gypsum Formula: CaSO4 · 2H2O References: |
| ⓘ Hastingsite Formula: NaCa2(Fe2+4Fe3+)(Si6Al2)O22(OH)2 References: |
| ⓘ Hausmannite Formula: Mn2+Mn3+2O4 References: |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 23 localities in this region. |
| ⓘ Hematite var. Specularite Formula: Fe2O3 Localities: Reported from at least 12 localities in this region. |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 References: |
| ⓘ Formula: CaFe3+Fe2+2(Si2O7)O(OH) Locality: Smallacombe Cutting, Ilsington, Teignbridge, Devon, England, UK - erroneously reported Description: A.W.G. Kingsbury specimen |
| ⓘ Johannsenite Formula: CaMn2+Si2O6 References: |
| ⓘ Leadhillite ? Formula: Pb4(CO3)2(SO4)(OH)2 Description: Forms tiny colourless to white micro-crystals <0.2mm associated with Anglesite and Cerussite in corroded Galena and Quartz. The crystals have not been analysed so could be Susannite. References: |
| ⓘ 'Limonite' |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ 'Manganese Oxides' |
| ⓘ Manganosite Formula: MnO References: |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl References: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 References: |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Gold Formula: Au References: |
| ⓘ Native Sulphur Formula: S8 References: |
| ⓘ Nontronite Formula: Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O Description: as "gramenite". |
| ⓘ Opal Formula: SiO2 · nH2O Locality: Hooten Wheals (Hexworthy Mine), Hexworthy, Dartmoor Forest, West Devon, Devon, England, UK Colour: Yellow White References: |
| ⓘ Orthoclase Formula: K(AlSi3O8) References: |
| ⓘ 'Pinite' |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 9 localities in this region. |
| ⓘ Pyrochroite Formula: Mn(OH)2 Habit: none Description: Green earthy patches with occasional microscopic bright crystals. References: |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl References: |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 27 localities in this region. |
| ⓘ Quartz var. Amethyst Formula: SiO2 |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Quartz var. Haytorite Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 References: |
| ⓘ Rammelsbergite Formula: NiAs2 References: |
| ⓘ Rhodochrosite Formula: MnCO3 References: |
| ⓘ Rhodonite Formula: CaMn3Mn[Si5O15] |
| ⓘ Sabugalite ? Formula: HAl(UO2)4(PO4)4 · 16H2O References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: Reported from at least 7 localities in this region. |
| ⓘ Schulenbergite ? Formula: (Cu,Zn)7(SO4)2(OH)10 · 3H2O Description: Minutely crystalline light blue crusts on corroded Sphalerite, covering ares to a few mm. References: |
| ⓘ Siderite Formula: FeCO3 Localities: Reported from at least 7 localities in this region. Description: Light yellow to brown cleavages to many cms small cavity's are lined with elongated triangular cross section micro-crystals. |
| ⓘ 'Sooty Uraninite' References: |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S Description: Rare as grey metallic masses to a few cms in quartz References: |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z Localities: Hooten Wheals (Hexworthy Mine), Hexworthy, Dartmoor Forest, West Devon, Devon, England, UK North Mine, Brimpts Tin Mines, Dartmoor Forest, West Devon, Devon, England, UK East Vitifer Mine (Hookney Mine; Kingsbarrow Mine; Great Devon Tincroft), Warren House, North Bovey, Teignbridge, Devon, England, UK Ware Weir, Buckfastleigh, Teignbridge, Devon, England, UK Mel Tor, Widecombe-in-the-Moor, Teignbridge, Devon, England, UK |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Tyrolite Formula: Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O References: |
| ⓘ Uraninite Formula: UO2 Habit: Massive, crumbly masses Colour: Black Description: Samples collected Dec 2003 with counts > 1000/sec. |
| ⓘ Uraninite var. Pitchblende Formula: UO2 Habit: Massive, crumbly masses Colour: Black Description: Samples collected Dec 2003 with counts > 1000/sec. |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | var. Silver-bearing Galena | 2.CD.10 | PbS with Ag |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Rammelsbergite | 2.EB.15a | NiAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Manganosite | 4.AB.25 | MnO |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hausmannite | 4.BB.10 | Mn2+Mn3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | var. Specularite | 4.CB.05 | Fe2O3 |
| ⓘ | Arsenolite | 4.CB.50 | As2O3 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Haytorite | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | 'Bindheimite' | 4.DH.20 | Pb2Sb2O6O |
| ⓘ | Uraninite var. Pitchblende | 4.DL.05 | UO2 |
| ⓘ | 4.DL.05 | UO2 | |
| ⓘ | Pyrochroite | 4.FE.05 | Mn(OH)2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Leadhillite ? | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Schulenbergite ? | 7.DD.80 | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Tyrolite | 8.DM.10 | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| ⓘ | Sabugalite ? | 8.EB.55 | HAl(UO2)4(PO4)4 · 16H2O |
| Group 9 - Silicates | |||
| ⓘ | Coffinite | 9.AD.30 | U(SiO4) · nH2O |
| ⓘ | Datolite | 9.AJ.20 | CaB(SiO4)(OH) |
| ⓘ | Axinite-(Fe) | 9.BD.20 | Ca2Fe2+Al2BSi4O15OH |
| ⓘ | Ilvaite ? | 9.BE.07 | CaFe3+Fe2+2(Si2O7)O(OH) |
| ⓘ | Cordierite | 9.CJ.10 | (Mg,Fe)2Al3(AlSi5O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Johannsenite | 9.DA.15 | CaMn2+Si2O6 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Hastingsite | 9.DE.15 | NaCa2(Fe2+4Fe3+)(Si6Al2)O22(OH)2 |
| ⓘ | Rhodonite | 9.DK.05 | CaMn3Mn[Si5O15] |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Nontronite | 9.EC.40 | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Pinite' | - | |
| ⓘ | 'Apatite var. Collophane' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Manganese Oxides' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Sooty Uraninite' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Coffinite | U(SiO4) · nH2O |
| H | ⓘ Datolite | CaB(SiO4)(OH) |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| H | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Pyrochroite | Mn(OH)2 |
| H | ⓘ Sabugalite | HAl(UO2)4(PO4)4 · 16H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| H | ⓘ Apatite var. Collophane | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| B | Boron | |
| B | ⓘ Datolite | CaB(SiO4)(OH) |
| B | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Arsenolite | As2O3 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bindheimite | Pb2Sb2O6O |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Coffinite | U(SiO4) · nH2O |
| O | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Datolite | CaB(SiO4)(OH) |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| O | ⓘ Hausmannite | Mn2+Mn23+O4 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| O | ⓘ Johannsenite | CaMn2+Si2O6 |
| O | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Manganosite | MnO |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Uraninite var. Pitchblende | UO2 |
| O | ⓘ Pyrochroite | Mn(OH)2 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| O | ⓘ Sabugalite | HAl(UO2)4(PO4)4 · 16H2O |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Hematite var. Specularite | Fe2O3 |
| O | ⓘ Quartz var. Haytorite | SiO2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Apatite var. Collophane | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Apatite var. Collophane | Ca5(PO4)3(Cl/F/OH) |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Na | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Al | Aluminium | |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Al | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Sabugalite | HAl(UO2)4(PO4)4 · 16H2O |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Coffinite | U(SiO4) · nH2O |
| Si | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Si | ⓘ Datolite | CaB(SiO4)(OH) |
| Si | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Si | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Si | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Si | ⓘ Johannsenite | CaMn2+Si2O6 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Quartz var. Haytorite | SiO2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Sabugalite | HAl(UO2)4(PO4)4 · 16H2O |
| P | ⓘ Apatite var. Collophane | Ca5(PO4)3(Cl/F/OH) |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Cl | Chlorine | |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Apatite var. Collophane | Ca5(PO4)3(Cl/F/OH) |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Datolite | CaB(SiO4)(OH) |
| Ca | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Ca | ⓘ Johannsenite | CaMn2+Si2O6 |
| Ca | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite var. Collophane | Ca5(PO4)3(Cl/F/OH) |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mn | Manganese | |
| Mn | ⓘ Hausmannite | Mn2+Mn23+O4 |
| Mn | ⓘ Johannsenite | CaMn2+Si2O6 |
| Mn | ⓘ Manganosite | MnO |
| Mn | ⓘ Pyrochroite | Mn(OH)2 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Fe | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Hematite var. Specularite | Fe2O3 |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Ni | Nickel | |
| Ni | ⓘ Rammelsbergite | NiAs2 |
| Cu | Copper | |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Zn | Zinc | |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenolite | As2O3 |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Rammelsbergite | NiAs2 |
| As | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Ag | Silver | |
| Ag | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sb | Antimony | |
| Sb | ⓘ Bindheimite | Pb2Sb2O6O |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Bindheimite | Pb2Sb2O6O |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Bi | Bismuth | |
| Bi | ⓘ Native Bismuth | Bi |
| U | Uranium | |
| U | ⓘ Coffinite | U(SiO4) · nH2O |
| U | ⓘ Uraninite var. Pitchblende | UO2 |
| U | ⓘ Sabugalite | HAl(UO2)4(PO4)4 · 16H2O |
| U | ⓘ Uraninite | UO2 |
Fossils
There are 11 fossil localities from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 139 | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Youngest Fossil Listed | 0.01 Ma (Pleistocene) | ||||||||||||||||||
| Oldest Fossil Listed | 388 Ma (Middle Devonian) | ||||||||||||||||||
| Stratigraphic Units |
| ||||||||||||||||||
| Fossils from Region | Click here to show the list. | ||||||||||||||||||
| Fossil Localities | Click to show 11 fossil localities |
Localities in this Region
- England
- Devon
- South Hams
- ⭔Teignbridge
- Ashburton
- Bovey Tracey
- Bridford
- Buckfastleigh
- Christow
- Denbury and Torbryan
- Doddiscombsleigh
- Hennock
- Devon
- England
- Devon
- Teignbridge
- Ilsington
- Kingsteignton
- Moretonhampstead
- Newton Abbot
- North Bovey
- Teigngrace
- West Buckfastleigh
- Widecombe-in-the-Moor
- West Devon
- Teignbridge
- Devon
Other Regions, Features and Areas that Intersect
British and Irish IslesGroup of Islands
Eurasian PlateTectonic Plate
- Rheno-Hercynian BeltOrogenic Belt
UK
- England
- Devon
- DartmoorNational Park
- Teignbridge
- Newton AbbotTown
- Devon and Cornwall metalliferous mining districtMining District
- Devon
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Golden Dagger Mine, Warren House, North Bovey, Teignbridge, Devon, England, UK