This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Woodstock | 29,898 (2017) |
| Canton | 25,469 (2017) |
| Holly Springs | 10,719 (2017) |
| Ball Ground | 1,720 (2017) |
| Waleska | 802 (2017) |
Other Languages:
French:
Comté de Cherokee, Géorgie, États-Unis
German:
Cherokee County, Georgia, Vereinigte Staaten
Italian:
Contea di Cherokee, Georgia, Stati Uniti d'America
Russian:
Чероки, Джорджия, Соединённые Штаты Америки
Simplified Chinese:
切羅基縣, 喬治亞州, 美国
Spanish:
Condado de Cherokee, Georgia, Estados Unidos
Albanian:
Cherokee County, Georgia, Shtetet e Bashkuara të Amerikës
Arabic:
مقاطعة تشيروكي, جورجيا, الولايات المتحدة
Armenian:
Չերոկի շրջան, Ջորջիա, Ամերիկայի Միացյալ Նահանգներ
Basque:
Cherokee konderria, Georgia
Bavarian:
Cherokee County, Georgia, Vaoanigte Stootn
Bishnupriya Manipuri:
চেরুকী কাউন্টি, জর্জিয়া, তিলপারাষ্ট্র
Bulgarian:
Чероки, Джорджия, Съединени американски щати
Cebuano:
Cherokee County, Georgia
Czech:
Cherokee County, Georgie, Spojené státy americké
Dutch:
Cherokee County, Georgia, Verenigde Staten
Esperanto:
Kantono Cherokee, Georgio
Farsi/Persian:
شهرستان چروکی، جورجیا, جورجیا, ایالات متحده آمریکا
Hungarian:
Cherokee megye, Georgia, Amerikai Egyesült Államok
Irish Gaelic:
Contae Cherokee, Georgia, Stáit Aontaithe Mheiriceá
Japanese:
チェロキー郡, ジョージア州, アメリカ合衆国
Latin:
Cherokee Comitatus, Georgia, Civitates Foederatae Americae
Low Saxon/Low German:
Cherokee County, Georgia, USA
Min Dong Chinese:
Cherokee Gông, Georgia
Norwegian:
Cherokee County, Georgia, USA
Polish:
Hrabstwo Cherokee, Georgia, Stany Zjednoczone
Portuguese:
Condado de Cherokee, Geórgia, Estados Unidos
Romanian:
Comitatul Cherokee, Georgia, Statele Unite ale Americii
Serbian:
Округ Чероки, Џорџија, Сједињене Америчке Државе
Serbo-Croatian:
Cherokee County, Georgia, Sjedinjene Američke Države
Swedish:
Cherokee County, Georgia, USA
Turkish:
Cherokee County, Georgia, Amerika Birleşik Devletleri
Ukrainian:
Черокі, Джорджія, Сполучені Штати Америки
Urdu:
چروکی کاؤنٹی، جارجیا, جارجیا, ریاستہائے متحدہ امریکا
Vietnamese:
Quận Cherokee, Georgia, Chủng Quốc Hoa Kỳ
Waray:
Condado han Cherokee, Georgia, Estados Unidos
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities62 valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) Locality: 301 Mine, Cherokee County, Georgia, USA References: |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5(T8O22)W2 |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| ⓘ Anthophyllite Formula: ◻Mg2Mg5(Si8O22)(OH)2 |
| ⓘ Antigorite Formula: Mg3(Si2O5)(OH)4 |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ 'Asbestos' |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Localities: Amphlett Mica Mine (Franklin Mine), Ball Ground, Ball Ground Mining District, Cherokee County, Georgia, USA Cochran Mine, Ball Ground, Ball Ground Mining District, Cherokee County, Georgia, USA Bennett Mica Mine, Sharp Top, Ball Ground Mining District, Cherokee County, Georgia, USA Cherokee County, Georgia, USA Hendrix Mine, Ball Ground, Ball Ground Mining District, Cherokee County, Georgia, USA |
| ⓘ Beryl var. Aquamarine |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ 'Cantonite' |
| ⓘ Cassiterite ? Formula: SnO2 |
| ⓘ Chalcocite Formula: Cu2S Description: Pseudomorphs after galena, also known as "harrisite". |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Chlorite Group' |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 References: |
| ⓘ Clausthalite Formula: PbSe References: |
| ⓘ Columbite-(Fe) Formula: Fe2+Nb2O6 References: |
| ⓘ Corundum Formula: Al2O3 |
| ⓘ Covellite Formula: CuS References: |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Enstatite Formula: Mg2Si2O6 |
| ⓘ 'Fayalite-Forsterite Series' |
| ⓘ 'Feldspar Group' Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Feldspar Group var. Perthite' |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Gahnite Formula: ZnAl2O4 References: |
| ⓘ Galena Formula: PbS References: |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 Localities: Reported from at least 6 localities in this region. |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Graphite Formula: C |
| ⓘ 'Gummite' ? |
| ⓘ Halloysite Formula: Al2Si2O5(OH)4 · n(H2O) |
| ⓘ Hastingsite Formula: NaCa2(Fe2+4Fe3+)(Si6Al2)O22(OH)2 |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Hematite var. Specularite Formula: Fe2O3 |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ Hydroxylapatite Formula: Ca5(PO4)3(OH) Localities: Description: Occurs in talc-schist. |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ 'Iron oxide' |
| ⓘ Jacobsite Formula: Mn2+Fe3+2O4 References: |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ 'K Feldspar' Localities: Hause Mines, Cherokee County, Georgia, USA J. D. Hillhouse Mines, Toonigh, Cherokee County, Georgia, USA J. F. Hillhouse Prospects, Cherokee County, Georgia, USA Reevis mica prospect, Ball Ground, Ball Ground Mining District, Cherokee County, Georgia, USA South Amphlett prospect, Cherokee County, Georgia, USA |
| ⓘ Kyanite Formula: Al2(SiO4)O Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Lanthanite' ? Formula: REE3+2(CO3)3 · 8H2O Description: Very questionable. |
| ⓘ 'Limonite' Localities: Reported from at least 7 localities in this region. |
| ⓘ Magnesite Formula: MgCO3 |
| ⓘ Magnesite var. Breunnerite Formula: (Mg,Fe)CO3 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 9 localities in this region. |
| ⓘ Magnetite var. Titanium-bearing Magnetite Formula: Fe2+(Fe3+,Ti)2O4 Locality: Lot 56, Cherokee County, Georgia, USA |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Marcasite Formula: FeS2 References: |
| ⓘ Meta-autunite Formula: Ca(UO2)2(PO4)2 · 6H2O References: |
| ⓘ Microcline Formula: K(AlSi3O8) References: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 23 localities in this region. |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Native Gold Formula: Au Localities: Reported from at least 26 localities in this region. |
| ⓘ Native Iron Formula: Fe |
| ⓘ Native Iron var. Kamacite Formula: (Fe,Ni) |
| ⓘ Native Platinum Formula: Pt |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ Plumbogummite Formula: PbAl3(PO4)(PO3OH)(OH)6 |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 15 localities in this region. |
| ⓘ Pyrite var. Gold-bearing Pyrite Formula: FeS2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 33 localities in this region. |
| ⓘ Quartz var. Agate Formula: SiO2 |
| ⓘ Quartz var. Amethyst Formula: SiO2 Colour: pale violet |
| ⓘ Quartz var. Blue Quartz Formula: SiO2 Colour: smoky blue Description: western portion of county in corbin granite |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Quartz var. Milky Quartz Formula: SiO2 |
| ⓘ Quartz var. Rutilated Quartz Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Schreibersite Formula: (Fe,Ni)3P |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 |
| ⓘ 'Soapstone' |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 References: King, Van (2023) Personal Communication. Identified by Van King: Dealer/Collection Label |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Spodumene Formula: LiAlSi2O6 |
| ⓘ Staurolite Formula: Fe2+2Al9Si4O23(OH) Localities: Sharp Mountain Creek, Ball Ground, Ball Ground Mining District, Cherokee County, Georgia, USA J. M. Spear farm, Bluff Creek, Ball Ground, Ball Ground Mining District, Cherokee County, Georgia, USA Ball Ground, Ball Ground Mining District, Cherokee County, Georgia, USA Canton Mine (Rich mine), Canton, Cherokee County, Georgia, USA |
| ⓘ Taenite Formula: (Ni,Fe) |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ Tetradymite Formula: Bi2Te2S |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Iron | 1.AE.05 | Fe |
| ⓘ | var. Kamacite | 1.AE.05 | (Fe,Ni) |
| ⓘ | Taenite | 1.AE.10 | (Ni,Fe) |
| ⓘ | Native Platinum | 1.AF.10 | Pt |
| ⓘ | Schreibersite | 1.BD.05 | (Fe,Ni)3P |
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Clausthalite | 2.CD.10 | PbSe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Tetradymite | 2.DC.05 | Bi2Te2S |
| ⓘ | Pyrite var. Gold-bearing Pyrite | 2.EB.05a | FeS2 |
| ⓘ | 2.EB.05a | FeS2 | |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Gahnite | 4.BB.05 | ZnAl2O4 |
| ⓘ | Jacobsite | 4.BB.05 | Mn2+Fe3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | var. Titanium-bearing Magnetite | 4.BB.05 | Fe2+(Fe3+,Ti)2O4 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Hematite var. Specularite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz var. Agate | 4.DA.05 | SiO2 |
| ⓘ | var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Rutilated Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Milky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Blue Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite ? | 4.DB.05 | SnO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | var. Breunnerite | 5.AB.05 | (Mg,Fe)CO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Plumbogummite | 8.BL.10 | PbAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Hydroxylapatite | 8.BN.05 | Ca5(PO4)3(OH) |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Meta-autunite | 8.EB.10 | Ca(UO2)2(PO4)2 · 6H2O |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Beryl var. Aquamarine | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | 9.CJ.05 | Be3Al2(Si6O18) | |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Enstatite | 9.DA.05 | Mg2Si2O6 |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Spodumene | 9.DA.30 | LiAlSi2O6 |
| ⓘ | Anthophyllite | 9.DD.05 | ◻Mg2Mg5(Si8O22)(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Hastingsite | 9.DE.15 | NaCa2(Fe2+4Fe3+)(Si6Al2)O22(OH)2 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Halloysite | 9.ED.10 | Al2Si2O5(OH)4 · n(H2O) |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Asbestos' | - | |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Gummite' ? | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Feldspar Group var. Perthite' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Soapstone' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Lanthanite' ? | - | REE3+2(CO3)3 · 8H2O |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Iron oxide' | - | |
| ⓘ | 'Cantonite' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| H | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| H | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Lanthanite | REE23+(CO3)3 · 8H2O |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Li | Lithium | |
| Li | ⓘ Spodumene | LiAlSi2O6 |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Magnesite var. Breunnerite | (Mg,Fe)CO3 |
| C | ⓘ Lanthanite | REE23+(CO3)3 · 8H2O |
| O | Oxygen | |
| O | ⓘ Quartz var. Agate | SiO2 |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Enstatite | Mg2Si2O6 |
| O | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Gahnite | ZnAl2O4 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| O | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Jacobsite | Mn2+Fe23+O4 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Quartz var. Rutilated Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Spodumene | LiAlSi2O6 |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Hematite var. Specularite | Fe2O3 |
| O | ⓘ Quartz var. Milky Quartz | SiO2 |
| O | ⓘ Magnesite var. Breunnerite | (Mg,Fe)CO3 |
| O | ⓘ Fayalite-Forsterite Series | |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Lanthanite | REE23+(CO3)3 · 8H2O |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Quartz var. Blue Quartz | SiO2 |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| Na | Sodium | |
| Na | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Enstatite | Mg2Si2O6 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Magnesite var. Breunnerite | (Mg,Fe)CO3 |
| Mg | ⓘ Fayalite-Forsterite Series | |
| Al | Aluminium | |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Gahnite | ZnAl2O4 |
| Al | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| Al | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Spodumene | LiAlSi2O6 |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | ⓘ Quartz var. Agate | SiO2 |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Enstatite | Mg2Si2O6 |
| Si | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| Si | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Quartz var. Rutilated Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Spodumene | LiAlSi2O6 |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Quartz var. Milky Quartz | SiO2 |
| Si | ⓘ Fayalite-Forsterite Series | |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Quartz var. Blue Quartz | SiO2 |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| P | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| P | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Schreibersite | (Fe,Ni)3P |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Pyrite var. Gold-bearing Pyrite | FeS2 |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Covellite | CuS |
| S | ⓘ Galena | PbS |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Tetradymite | Bi2Te2S |
| Cl | Chlorine | |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| Ca | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Mn | Manganese | |
| Mn | ⓘ Jacobsite | Mn2+Fe23+O4 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Fe | Iron | |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Pyrite var. Gold-bearing Pyrite | FeS2 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Native Iron | Fe |
| Fe | ⓘ Jacobsite | Mn2+Fe23+O4 |
| Fe | ⓘ Native Iron var. Kamacite | (Fe,Ni) |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Schreibersite | (Fe,Ni)3P |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Taenite | (Ni,Fe) |
| Fe | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| Fe | ⓘ Hematite var. Specularite | Fe2O3 |
| Fe | ⓘ Magnesite var. Breunnerite | (Mg,Fe)CO3 |
| Fe | ⓘ Fayalite-Forsterite Series | |
| Ni | Nickel | |
| Ni | ⓘ Native Iron var. Kamacite | (Fe,Ni) |
| Ni | ⓘ Schreibersite | (Fe,Ni)3P |
| Ni | ⓘ Taenite | (Ni,Fe) |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Zn | Zinc | |
| Zn | ⓘ Gahnite | ZnAl2O4 |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Se | Selenium | |
| Se | ⓘ Clausthalite | PbSe |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Te | Tellurium | |
| Te | ⓘ Tetradymite | Bi2Te2S |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ce | Cerium | |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Pt | Platinum | |
| Pt | ⓘ Native Platinum | Pt |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Clausthalite | PbSe |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Bi | Bismuth | |
| Bi | ⓘ Tetradymite | Bi2Te2S |
| U | Uranium | |
| U | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Cherokee_County,_Georgia |
|---|---|
| Wikidata ID: | Q486664 |
| GeoNames ID: | 4187535 |
Localities in this Region
- Georgia
- Cherokee County
- 301 Mine
- Altoona Lake
- Andrew Satterfield Prospect
- Bailey Property
- Ball Ground Mining District
- Brady Mine (Southern Talc Mine)
- Burty No. 1 Mine (Richards)
- Canton
- Cherokee Mine
- Chester Prospect (Chester Turner Prospect)
- Coggins Mine
- Conn's Creek School
- Conn Church
- Cook Mine
- Cox Prospect
- Davis Mine
- Davis Mine (Owl Hollow; Davis Mine Owl Hollow; McGill)
- Dean Mine
- Delay prospect
- Dickerson prospect
- Evalee Richards Prospect
- F. M. Williams prospect
- Fourmile Church
- Frank Burt Prospect
- G. I. Teasley Property
- G. P. McFarland Property
- Georgiana mine
- Gober
- Grady Holbert Property (Grady Holbery Property)
- Hause Mines
- Holly Springs
- Cherokee County
- Georgia
- Cherokee County
- Holly Springs
- J. B. Wheeler prospect
- J. C. Casteel Prospect
- J. F. Hillhouse Prospects
- J. T. Haley Mine
- James Higgins Property
- James M.Quarles Property
- Keithsburg
- Kellogg property
- Kelogg Mine (Williams; Old Bell Cut; Kitchen)
- L. L. Spence Property
- L. L. Spence Property (2)
- La Belle Mine
- Latham (Chester; Latham Chester; F. Burt's; Burty No. 2)
- Latham Mine
- Lathamtown
- Lost Town Creek
- Losttown meteorite
- Lot 208 Shaft
- Lot 296
- Lot 56
- M. D. Smith Mine
- M. M. Cole Mine
- Marble Deposit Unnamed
- McRea property
- Mrs Stearne's Property
- Nelson
- Putnam placer
- R. M. Reece prospect
- Richards Mine
- Rudicil placer
- S. R. Smith Mine
- S. S. Densmore prospect
- Sandow Mine
- Sharp Mountain Church
- Shiloh Church
- Sixes Gold Mine
- Smith property
- South Amphlett prospect
- Stansill Mine
- T. N. Westbrook Mine
- Toonigh
- Tripp Mine
- Unnamed Barium Deposit (10144117)
- Unnamed Chattahoochee Fe Property (10083959)
- Unnamed Gold Deposit (10119299)
- Unnamed Gold Deposit (10134967)
- Victoria (Nahenta)
- Waleska
- Waleska deposit
- Waltz & Bates Mines (Iza Clayton Mines)
- White Property
- Woodstock
- Worley Mine
- Worley Mine (2)
- Cherokee County
Other Regions, Features and Areas that Intersect
North AmericaContinent
North America PlateTectonic Plate
- Appalachian BasinBasin
- Great Smoky Mountains Rift BasinBasin
- Laurentides DomainPassive Margin
- PedmontiaAccretionary Complex
- Piedmontia DomainDomain
- SCAB DomainDomain
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions







301 Mine, Cherokee County, Georgia, USA