This page is currently not sponsored. Click here to sponsor this page.
Area:
457 km2
Type:
Other/historical names associated with this locality:
Eidsvold
Other Languages:
French:
Eidsvoll, Akershus, Norvège
German:
Eidsvoll, Akershus, Norwegen
Italian:
Eidsvoll, Akershus, Norvegia
Norwegian:
Eidsvoll, Akershus, Norge
Russian:
Эйдсволл, Акерсхус, Норвегия
Simplified Chinese:
埃兹伏尔, 阿克什胡斯, 挪威
Spanish:
Eidsvoll, Akershus, Noruega
Afrikaans:
Eidsvoll, Akershus, Noorweë
Albanian:
Eidsvoll, Akershus, Norvegjia
Arabic:
أيدسفول, آكرشوس, النرويج
Armenian:
Էյդսվոլ, Ակերսհուս, Նորվեգիա
Asturian:
Eidsvoll, Akershus, Noruega
Basque:
Eidsvoll, Akershus, Norvegia
Bishnupriya Manipuri:
ঈদসভোল, আকেরশুস, নরৱে
Catalan:
Eidsvoll, Akershus, Noruega
Cebuano:
Eidsvoll, Akershus fylke, Norway
Danish:
Eidsvoll, Akershus, Norge
Dutch:
Eidsvoll, Akershus, Noorwegen
Esperanto:
Eidsvoll, Akershus, Norvegio
Farsi/Persian:
ایدسوول, آکرشوس, نروژ
Finnish:
Eidsvoll, Akershusin lääni, Norja
Galician:
Eidsvoll, Noruega
Hebrew:
איידסבול, אקרסהוס, נורבגיה
Hungarian:
Eidsvoll község, Akershus megye, Norvégia
Icelandic:
Eiðsvöllur, Akurshús, Noregur
Japanese:
アイツヴォル, アーケシュフース県, ノルウェー
Javanese:
Eidsvoll, Norwégia
Latin:
Eidsvoll, Akershus, Norvegia
Limburgian:
Eidsvoll, Akershus, Noorwege
Lithuanian:
Eidsvolas, Akershusas, Norvegija
Low Saxon/Low German:
Kommun Eidsvoll, Amt Akershus, Norwegen
Malay:
Eidsvoll, Akershus, Norway
Minnan / Hokkien-Taiwanese:
Eidsvoll, Akershus, Lo̍k-ui
Northern Sami:
Eidsvoll, Akershusa fylka, Norga
Norwegian (Nynorsk):
Eidsvoll, Akershus fylke, Noreg
Occitan:
Eidsvoll, Akershus, Norvègia
Polish:
Eidsvoll, Akershus, Norwegia
Portuguese:
Eidsvoll, Akershus, Noruega
Romanian:
Eidsvoll, Akershus, Norvegia
Slovenian:
Eidsvoll, Akershus, Norveška
Swahili:
Eidsvoll, Akershus, Norwei
Swedish:
Eidsvoll, Akershus, Norge
Turkish:
Eidsvoll, Akershus, Norveç
Ukrainian:
Ейдсволл, Акерсгус, Норвегія
Vietnamese:
Eidsvoll, Akershus, Na Uy
Waray:
Eidsvoll, Akershus, Noruega
Welsh:
Eidsvoll, Norwy
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities81 valid minerals. 1 (TL) - type locality of valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ Altaite Formula: PbTe |
| ⓘ Anatase Formula: TiO2 |
| ⓘ Andalusite Formula: Al2(SiO4)O |
| ⓘ Anglesite Formula: PbSO4 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Bavenite Formula: Ca4Be2Al2Si9O26(OH)2 Description: Some laumontite has been misidentified as bavenite (Ellingsen 2003) |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ Beryl var. Emerald Formula: Be3Al2(Si6O18) |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Brannerite Formula: UTi2O6 Description: One microscopic grain identified by SEM-EDS (Nordrum & Raade 2006). References: |
| ⓘ Byrudite (TL) Formula: (Be,◻)(V3+,Ti,Cr)3O6 Type Locality: Colour: Black References: Williams, P. A., Hatert, F., Pasero, M., Mills, S. J. (2013) New minerals and nomenclature modifications approved in 2013. CNMNC Newsletter No.17. Mineralogical Magazine, 77 (7) 2997-3005 doi:10.1180/minmag.2013.077.7.09 |
| ⓘ Calcite Formula: CaCO3 Localities: |
| ⓘ Carrollite Formula: CuCo2S4 |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Cerussite Formula: PbCO3 References: |
| ⓘ 'Chabazite' References: |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Cheralite Formula: CaTh(PO4)2 |
| ⓘ 'Chlorite Group' |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Cubanite Formula: CuFe2S3 |
| ⓘ Cuprite Formula: Cu2O Description: Probably found in Gamle-gruben (Neumann 1985) |
| ⓘ Diopside Formula: CaMgSi2O6 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Fluor-schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3F |
| ⓘ Galena Formula: PbS Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 References: |
| ⓘ Gersdorffite Formula: NiAsS References: |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Graphite Formula: C |
| ⓘ Greenalite Formula: (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| ⓘ 'Greenalite-1M' Formula: (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Halite Formula: NaCl |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 7 localities in this region. |
| ⓘ Hematite var. Specularite Formula: Fe2O3 References: |
| ⓘ Hessite Formula: Ag2Te |
| ⓘ Heulandite-Ca Formula: (Ca,Na)5(Si27Al9)O72 · 26H2O |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ 'K Feldspar' |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O Description: Laumontite samples from Byrud has been erronously labelled as bavenite (Ellingsne 2003) |
| ⓘ 'Lepidolite' References: |
| ⓘ Linnaeite Formula: Co2+Co3+2S4 Description: Cobaltian |
| ⓘ Mackinawite Formula: FeS |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Millerite Formula: NiS Description: Occure in veins and contact metamorphic rocks in the Misteberget area. |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ 'Muscovite-1M' Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Native Gold Formula: Au Localities: Reported from at least 6 localities in this region. |
| ⓘ Native Sulphur Formula: S8 |
| ⓘ Nickeline Formula: NiAs |
| ⓘ Opal Formula: SiO2 · nH2O |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 |
| ⓘ Pretulite Formula: Sc(PO4) Description: Forms as a part of multiphase (solid) inclusions in Emeralds. |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 18 localities in this region. |
| ⓘ Quartz var. Amethyst Formula: SiO2 |
| ⓘ Quartz var. Sceptre Quartz Formula: SiO2 |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Rutile var. Ilmenorutile Formula: (Ti,Nb)O2 |
| ⓘ Rutile var. Strüverite Formula: (Ti,Ta,Fe)O2 |
| ⓘ Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Locality: Byrud Emerald Mines, Minnesund, Eidsvoll, Akershus, Norway - erroneously reported Description: Erronously reported in Kvamsdal & Eldjarn 2006. (L.O.Kvamsdal info 16.03.2016) |
| ⓘ Sellaite Formula: MgF2 |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Sylvite Formula: KCl |
| ⓘ Szomolnokite Formula: FeSO4 · H2O Colour: Pale brown Description: Occure as an alteration product after pyrite, together with fine-grained pyrite on pyrite-bearing quartz. |
| ⓘ Tellurobismuthite Formula: Bi2Te3 |
| ⓘ Tetradymite Formula: Bi2Te2S |
| ⓘ Thorianite Formula: ThO2 |
| ⓘ Thorite Formula: Th(SiO4) References: |
| ⓘ Titanite Formula: CaTiO(SiO4) |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z Colour: Green Description: A XRD of a green mineral showed "tourmaline". Analysis done at NHM, Oslo (L.O.Kvamsdal info 16.03.2016). References: |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Vermiculite Formula: Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ Wollastonite Formula: Ca3(Si3O9) |
| ⓘ Woodwardite Formula: Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Hessite | 2.BA.60 | Ag2Te |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Mackinawite | 2.CC.25 | FeS |
| ⓘ | Altaite | 2.CD.10 | PbTe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Carrollite | 2.DA.05 | CuCo2S4 |
| ⓘ | Linnaeite | 2.DA.05 | Co2+Co3+2S4 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Tellurobismuthite | 2.DC.05 | Bi2Te3 |
| ⓘ | Tetradymite | 2.DC.05 | Bi2Te2S |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| Group 3 - Halides | |||
| ⓘ | Halite | 3.AA.20 | NaCl |
| ⓘ | Sylvite | 3.AA.20 | KCl |
| ⓘ | Sellaite | 3.AB.15 | MgF2 |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Byrudite (TL) | 4.CA. | (Be,◻)(V3+,Ti,Cr)3O6 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | var. Specularite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Sceptre Quartz | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Rutile var. Ilmenorutile | 4.DB.05 | (Ti,Nb)O2 |
| ⓘ | 4.DB.05 | TiO2 | |
| ⓘ | var. Strüverite | 4.DB.05 | (Ti,Ta,Fe)O2 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brannerite | 4.DH.05 | UTi2O6 |
| ⓘ | Thorianite | 4.DL.05 | ThO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Szomolnokite | 7.CB.05 | FeSO4 · H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Woodwardite | 7.DD.35 | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Pretulite | 8.AD.35 | Sc(PO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Cheralite | 8.AD.50 | CaTh(PO4)2 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Thorite | 9.AD.30 | Th(SiO4) |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | var. Emerald | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Fluor-schorl | 9.CK. | NaFe2+3Al6(Si6O18)(BO3)3(OH)3F |
| ⓘ | Schorl ? | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Bavenite | 9.DF.25 | Ca4Be2Al2Si9O26(OH)2 |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Muscovite var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Vermiculite | 9.EC.50 | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Greenalite | 9.ED.15 | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| ⓘ | Heulandite-Ca | 9.GE.05 | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Unclassified | |||
| ⓘ | 'Chabazite' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Lepidolite' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Muscovite-1M' | - | KAl2(AlSi3O10)(OH)2 |
| ⓘ | 'Greenalite-1M' | - | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Greenalite | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Szomolnokite | FeSO4 · H2O |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| H | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Fluor-schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3F |
| H | ⓘ Muscovite-1M | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Greenalite-1M | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| Be | Beryllium | |
| Be | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Be | ⓘ Byrudite | (Be,◻)(V3+,Ti,Cr)3O6 |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| B | ⓘ Fluor-schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3F |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Graphite | C |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| O | ⓘ Brannerite | UTi2O6 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Greenalite | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Rutile var. Ilmenorutile | (Ti,Nb)O2 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Rutile var. Strüverite | (Ti,Ta,Fe)O2 |
| O | ⓘ Szomolnokite | FeSO4 · H2O |
| O | ⓘ Thorianite | ThO2 |
| O | ⓘ Thorite | Th(SiO4) |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Hematite var. Specularite | Fe2O3 |
| O | ⓘ Cheralite | CaTh(PO4)2 |
| O | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| O | ⓘ Pretulite | Sc(PO4) |
| O | ⓘ Quartz var. Sceptre Quartz | SiO2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Fluor-schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3F |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Muscovite-1M | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Greenalite-1M | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| O | ⓘ Byrudite | (Be,◻)(V3+,Ti,Cr)3O6 |
| F | Fluorine | |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Sellaite | MgF2 |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Fluor-schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3F |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Halite | NaCl |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Na | ⓘ Fluor-schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3F |
| Mg | Magnesium | |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Sellaite | MgF2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| Al | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Fluor-schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3F |
| Al | ⓘ Muscovite-1M | KAl2(AlSi3O10)(OH)2 |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Greenalite | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Thorite | Th(SiO4) |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Si | ⓘ Quartz var. Sceptre Quartz | SiO2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Fluor-schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3F |
| Si | ⓘ Muscovite-1M | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Greenalite-1M | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Cheralite | CaTh(PO4)2 |
| P | ⓘ Pretulite | Sc(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Carrollite | CuCo2S4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Linnaeite | Co2+Co23+S4 |
| S | ⓘ Mackinawite | FeS |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Millerite | NiS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Szomolnokite | FeSO4 · H2O |
| S | ⓘ Tetradymite | Bi2Te2S |
| S | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| Cl | Chlorine | |
| Cl | ⓘ Halite | NaCl |
| Cl | ⓘ Sylvite | KCl |
| K | Potassium | |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Sylvite | KCl |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite-1M | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Cheralite | CaTh(PO4)2 |
| Ca | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Sc | Scandium | |
| Sc | ⓘ Pretulite | Sc(PO4) |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Brannerite | UTi2O6 |
| Ti | ⓘ Rutile var. Ilmenorutile | (Ti,Nb)O2 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Rutile var. Strüverite | (Ti,Ta,Fe)O2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Ti | ⓘ Byrudite | (Be,◻)(V3+,Ti,Cr)3O6 |
| V | Vanadium | |
| V | ⓘ Byrudite | (Be,◻)(V3+,Ti,Cr)3O6 |
| Cr | Chromium | |
| Cr | ⓘ Byrudite | (Be,◻)(V3+,Ti,Cr)3O6 |
| Fe | Iron | |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Greenalite | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Mackinawite | FeS |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Rutile var. Strüverite | (Ti,Ta,Fe)O2 |
| Fe | ⓘ Szomolnokite | FeSO4 · H2O |
| Fe | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Hematite var. Specularite | Fe2O3 |
| Fe | ⓘ Fluor-schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3F |
| Fe | ⓘ Greenalite-1M | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| Co | Cobalt | |
| Co | ⓘ Carrollite | CuCo2S4 |
| Co | ⓘ Linnaeite | Co2+Co23+S4 |
| Ni | Nickel | |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Nickeline | NiAs |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Cu | Copper | |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Carrollite | CuCo2S4 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Nickeline | NiAs |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Rutile var. Ilmenorutile | (Ti,Nb)O2 |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ag | Silver | |
| Ag | ⓘ Hessite | Ag2Te |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Te | Tellurium | |
| Te | ⓘ Altaite | PbTe |
| Te | ⓘ Hessite | Ag2Te |
| Te | ⓘ Tellurobismuthite | Bi2Te3 |
| Te | ⓘ Tetradymite | Bi2Te2S |
| Ce | Cerium | |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Ta | Tantalum | |
| Ta | ⓘ Rutile var. Strüverite | (Ti,Ta,Fe)O2 |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Altaite | PbTe |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Galena | PbS |
| Bi | Bismuth | |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Tellurobismuthite | Bi2Te3 |
| Bi | ⓘ Tetradymite | Bi2Te2S |
| Th | Thorium | |
| Th | ⓘ Thorianite | ThO2 |
| Th | ⓘ Thorite | Th(SiO4) |
| Th | ⓘ Cheralite | CaTh(PO4)2 |
| U | Uranium | |
| U | ⓘ Brannerite | UTi2O6 |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Eidsvoll |
|---|---|
| Wikidata ID: | Q57080 |
| GeoNames ID: | 3158606 |
Localities in this Region
- Akershus
- Eidsvoll
- Eidsvoll gold mines
- Feiring
- Minnesund
- Mistberget and Feiring Mining Area
- Morskogen station
- Stensby
- Unnamed Mine No. 1
- Unnamed Mine No. 10
- Unnamed Mine No. 11
- Unnamed Mine No. 2
- Unnamed Mine No. 3
- Unnamed Mine No. 4
- Unnamed Mine No. 5
- Unnamed Mine No. 6
- Unnamed Mine No. 7
- Unnamed Mine No. 8
- Unnamed Mine No. 9
- Utsjø Mines
- Eidsvoll
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
- Baltic Shield
- Sveconorwegian BeltShield
EuropeContinent
Norway
- Oslo Volcanic ProvinceVolcanic Province
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions





Feiring, Eidsvoll, Akershus, Norway