Ilomantsi, North Karelia, Finlandi
| Regional Level Types | |
|---|---|
| Ilomantsi | Municipality |
| North Karelia | Region |
| Finland | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Ilomantsi | 6,408 (2014) |
Other Languages:
Finnish:
Ilomantsi, Pohjois-Karjalan maakunta, Suomi
French:
Ilomantsi, Carélie du Nord, Finlande
German:
Ilomantsi, Nordkarelien, Finnland
Italian:
Ilomantsi, Carelia Settentrionale, Finlandia
Russian:
Иломантси, Северная Карелия, Финляндия
Simplified Chinese:
伊洛曼齊, 北卡累利阿區, 芬兰
Albanian:
Ilomantsi, Karelia Veriore, Finlanda
Asturian:
Ilomantsi, Carelia del Norte, Finlandia
Cebuano:
Ilomantsi, Pohjois-Karjala, Finlandia
Czech:
Ilomantsi, Severní Karélie, Finsko
Dutch:
Ilomantsi, Pohjois-Karjala, Finland
Esperanto:
Ilomantsi, Norda Karelio, Finnlando
Estonian:
Ilomantsi vald, Põhja-Karjala, Soome
Galician:
Ilomantsi, Carelia do Norte, Finlandia
Irish Gaelic:
Ilomantsi, An Fhionlainn
Japanese:
イロマンツィ, 北カルヤラ県, フィンランド
Latin:
Ilomants, Carelia Septentrionalis, Finnia
Northern Sami:
Ilomantsi, Davvi-Gárjila eanangoddi, Suopma
Norwegian:
Ilomants, Norra Karelen, Finland
Polish:
Ilomantsi, Karelia Północna, Finlandia
Romanian:
Ilomantsi, Carelia de Nord, Finlanda
Slovak:
Ilomantsi, Pohjois-Karjala, Fínsko
Swedish:
Ilomants, Norra Karelen, Finland
Turkish:
Ilomantsi, Kuzey Karelya, Finlandiya
A municipality in the former North Karelia region.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities68 valid minerals. 1 (TL) - type locality of valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reported from at least 6 localities in this region. |
| ⓘ Altaite Formula: PbTe |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 References: |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| ⓘ Argentopentlandite Formula: Ag(Fe,Ni)8S8 |
| ⓘ Arsenopyrite Formula: FeAsS Localities: Reported from at least 9 localities in this region. |
| ⓘ Aurostibite Formula: AuSb2 |
| ⓘ Bastnäsite-(Ce) Formula: Ce(CO3)F |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Calaverite Formula: AuTe2 |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Chamosite Formula: (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| ⓘ 'Chlorite Group' |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 References: |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinochlore var. Talc-chlorite Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Cubanite Formula: CuFe2S3 |
| ⓘ Dyscrasite Formula: Ag3Sb |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Feldspar Group' |
| ⓘ Ferrimolybdite Formula: Fe2(MoO4)3 · nH2O References: Stein, H. J., Sundblad, K., Markey, R. J., Morgan, J. W., Motuza, G. (1998) Re-Os ages for Archean molybdenite and pyrite, Kuittila-Kivisuo, Finland and Proterozoic molybdenite, Kabeliai, Lithuania: testing the chronometer in a metamorphic and metasomatic setting. Mineralium Deposita, 33 (4) 329-345 doi:10.1007/s001260050153 |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Frohbergite Formula: FeTe2 |
| ⓘ Galena Formula: PbS |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Gersdorffite Formula: NiAsS |
| ⓘ Glaucophane ? Formula: ◻[Na2][Mg3Al2]Si8O22(OH)2 Description: The listed reference do not contain any reference to glaucophane |
| ⓘ Goethite Formula: Fe3+O(OH) References: |
| ⓘ Grunerite Formula: ◻{Fe2+2}{Fe2+5}(Si8O22)(OH)2 |
| ⓘ Hedleyite Formula: Bi7Te3 |
| ⓘ Hematite Formula: Fe2O3 References: |
| ⓘ Hessite Formula: Ag2Te |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ Ilmenite Formula: Fe2+TiO3 Localities: Reported from at least 6 localities in this region. |
| ⓘ 'K Feldspar' |
| ⓘ Kyanite Formula: Al2(SiO4)O |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O |
| ⓘ Mackinawite Formula: FeS Localities: Reported from at least 6 localities in this region. |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Melonite Formula: NiTe2 |
| ⓘ 'Mica Group' |
| ⓘ Molybdenite Formula: MoS2 Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Monazite Group' Formula: REE(PO4) |
| ⓘ Montbrayite Formula: (Au,Ag,Sb,Bi,Pb)23(Te,Sb,Bi,Pb)38 |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Muscovite var. Fuchsite Formula: K(Al,Cr)3Si3O10(OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Native Bismuth Formula: Bi Localities: Reported from at least 7 localities in this region. |
| ⓘ Native Gold Formula: Au Localities: Reported from at least 10 localities in this region. |
| ⓘ Native Gold var. Electrum Formula: (Au,Ag) |
| ⓘ Native Tellurium Formula: Te |
| ⓘ Pampaloite (TL) Formula: AuSbTe Type Locality: Description: Found in the drill core 315, depth 71.50 m |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 Localities: Reported from at least 7 localities in this region. |
| ⓘ Petzite Formula: Ag3AuTe2 |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 References: |
| ⓘ Powellite Formula: Ca(MoO4) |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Reported from at least 8 localities in this region. |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Rucklidgeite Formula: PbBi2Te4 |
| ⓘ Rutile Formula: TiO2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Scheelite Formula: Ca(WO4) Localities: Reported from at least 8 localities in this region. |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Sillimanite Formula: Al2(SiO4)O |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 7 localities in this region. |
| ⓘ Staurolite Formula: Fe2+2Al9Si4O23(OH) |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ Tellurobismuthite Formula: Bi2Te3 |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| ⓘ Titanite Formula: CaTi(SiO4)O Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z Localities: Reported from at least 7 localities in this region. |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Troilite Formula: FeS |
| ⓘ Tsumoite Formula: BiTe |
| ⓘ Valleriite Formula: (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| ⓘ Volynskite Formula: AgBiTe2 |
| ⓘ 'White mica' |
| ⓘ Zircon Formula: Zr(SiO4) |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold var. Electrum | 1.AA.05 | (Au,Ag) |
| ⓘ | 1.AA.05 | Au | |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Native Tellurium | 1.CC.10 | Te |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Dyscrasite | 2.AA.35 | Ag3Sb |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Hessite | 2.BA.60 | Ag2Te |
| ⓘ | Petzite | 2.BA.75 | Ag3AuTe2 |
| ⓘ | Argentopentlandite | 2.BB.15 | Ag(Fe,Ni)8S8 |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Troilite | 2.CC.10 | FeS |
| ⓘ | Mackinawite | 2.CC.25 | FeS |
| ⓘ | Altaite | 2.CD.10 | PbTe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Montbrayite | 2.DB.20 | (Au,Ag,Sb,Bi,Pb)23(Te,Sb,Bi,Pb)38 |
| ⓘ | Hedleyite | 2.DC.05 | Bi7Te3 |
| ⓘ | Tellurobismuthite | 2.DC.05 | Bi2Te3 |
| ⓘ | Tsumoite | 2.DC.05 | BiTe |
| ⓘ | Calaverite | 2.EA.10 | AuTe2 |
| ⓘ | Melonite | 2.EA.20 | NiTe2 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pampaloite (TL) | 2.EA.40 | AuSbTe |
| ⓘ | Aurostibite | 2.EB.05a | AuSb2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Frohbergite | 2.EB.10a | FeTe2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Valleriite | 2.FD.30 | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Rucklidgeite | 2.GC.40c | PbBi2Te4 |
| ⓘ | Volynskite | 2.JA.20 | AgBiTe2 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Bastnäsite-(Ce) | 5.BD.20a | Ce(CO3)F |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Powellite | 7.GA.05 | Ca(MoO4) |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Ferrimolybdite | 7.GB.30 | Fe2(MoO4)3 · nH2O |
| Group 9 - Silicates | |||
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Grunerite | 9.DE.05 | ◻{Fe2+2}{Fe2+5}(Si8O22)(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Glaucophane ? | 9.DE.25 | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite var. Fuchsite | 9.EC.15 | K(Al,Cr)3Si3O10(OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Chamosite | 9.EC.55 | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | var. Talc-chlorite | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| Unclassified | |||
| ⓘ | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'White mica' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| H | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| H | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Grunerite | ◻{Fe22+}{Fe52+}(Si8O22)(OH)2 |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Clinochlore var. Talc-chlorite | Mg5Al(AlSi3O10)(OH)8 |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| O | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| O | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Grunerite | ◻{Fe22+}{Fe52+}(Si8O22)(OH)2 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Powellite | Ca(MoO4) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Clinochlore var. Talc-chlorite | Mg5Al(AlSi3O10)(OH)8 |
| F | Fluorine | |
| F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Mg | ⓘ Clinochlore var. Talc-chlorite | Mg5Al(AlSi3O10)(OH)8 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Al | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Clinochlore var. Talc-chlorite | Mg5Al(AlSi3O10)(OH)8 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Si | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| Si | ⓘ Grunerite | ◻{Fe22+}{Fe52+}(Si8O22)(OH)2 |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Clinochlore var. Talc-chlorite | Mg5Al(AlSi3O10)(OH)8 |
| P | Phosphorus | |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Argentopentlandite | Ag(Fe,Ni)8S8 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Mackinawite | FeS |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Troilite | FeS |
| S | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Cl | Chlorine | |
| Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Powellite | Ca(MoO4) |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Mn | Manganese | |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Argentopentlandite | Ag(Fe,Ni)8S8 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Fe | ⓘ Frohbergite | FeTe2 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Grunerite | ◻{Fe22+}{Fe52+}(Si8O22)(OH)2 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Mackinawite | FeS |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Troilite | FeS |
| Fe | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Ni | Nickel | |
| Ni | ⓘ Argentopentlandite | Ag(Fe,Ni)8S8 |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Melonite | NiTe2 |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Cu | Copper | |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Gersdorffite | NiAsS |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Powellite | Ca(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Argentopentlandite | Ag(Fe,Ni)8S8 |
| Ag | ⓘ Dyscrasite | Ag3Sb |
| Ag | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Ag | ⓘ Hessite | Ag2Te |
| Ag | ⓘ Montbrayite | (Au,Ag,Sb,Bi,Pb)23(Te,Sb,Bi,Pb)38 |
| Ag | ⓘ Petzite | Ag3AuTe2 |
| Ag | ⓘ Volynskite | AgBiTe2 |
| Sb | Antimony | |
| Sb | ⓘ Aurostibite | AuSb2 |
| Sb | ⓘ Dyscrasite | Ag3Sb |
| Sb | ⓘ Montbrayite | (Au,Ag,Sb,Bi,Pb)23(Te,Sb,Bi,Pb)38 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Pampaloite | AuSbTe |
| Te | Tellurium | |
| Te | ⓘ Altaite | PbTe |
| Te | ⓘ Calaverite | AuTe2 |
| Te | ⓘ Frohbergite | FeTe2 |
| Te | ⓘ Hedleyite | Bi7Te3 |
| Te | ⓘ Hessite | Ag2Te |
| Te | ⓘ Melonite | NiTe2 |
| Te | ⓘ Montbrayite | (Au,Ag,Sb,Bi,Pb)23(Te,Sb,Bi,Pb)38 |
| Te | ⓘ Petzite | Ag3AuTe2 |
| Te | ⓘ Rucklidgeite | PbBi2Te4 |
| Te | ⓘ Native Tellurium | Te |
| Te | ⓘ Tellurobismuthite | Bi2Te3 |
| Te | ⓘ Tsumoite | BiTe |
| Te | ⓘ Volynskite | AgBiTe2 |
| Te | ⓘ Pampaloite | AuSbTe |
| Ce | Cerium | |
| Ce | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Aurostibite | AuSb2 |
| Au | ⓘ Calaverite | AuTe2 |
| Au | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Au | ⓘ Native Gold | Au |
| Au | ⓘ Montbrayite | (Au,Ag,Sb,Bi,Pb)23(Te,Sb,Bi,Pb)38 |
| Au | ⓘ Petzite | Ag3AuTe2 |
| Au | ⓘ Pampaloite | AuSbTe |
| Pb | Lead | |
| Pb | ⓘ Altaite | PbTe |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Montbrayite | (Au,Ag,Sb,Bi,Pb)23(Te,Sb,Bi,Pb)38 |
| Pb | ⓘ Rucklidgeite | PbBi2Te4 |
| Bi | Bismuth | |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Hedleyite | Bi7Te3 |
| Bi | ⓘ Montbrayite | (Au,Ag,Sb,Bi,Pb)23(Te,Sb,Bi,Pb)38 |
| Bi | ⓘ Rucklidgeite | PbBi2Te4 |
| Bi | ⓘ Tellurobismuthite | Bi2Te3 |
| Bi | ⓘ Tsumoite | BiTe |
| Bi | ⓘ Volynskite | AgBiTe2 |
Geochronology
Mineralization age: Archean : 2858 Ma to 2683 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | |||||||||
|---|---|---|---|---|---|---|---|---|---|---|
| Precambrian | ||||||||||
| Archean | ||||||||||
| Neoarchean |
| |||||||||
| Mesoarchean |
| |||||||||
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Ilomantsi |
|---|---|
| Wikidata ID: | Q283599 |
| GeoNames ID: | 656709 |
Localities in this Region
- North Karelia
- North Karelia
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
- Baltic Shield
- Karelia CratonCraton
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesGeochronologyFossilsOther DatabasesLocalities in RegionOther RegionsReferences





Pampalo Au deposit, Ilomantsi, North Karelia, Finland