Holandsfjorden, Meløy, Nordland, Norwayi
| Regional Level Types | |
|---|---|
| Holandsfjorden | Fjord |
| Meløy | Municipality |
| Nordland | County |
| Norway | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Other/historical names associated with this locality:
Holandsfjord
Other Languages:
Norwegian:
Holandsfjorden, Meløy, Nordland, Norge
Holandsfjorden is a fjord in the southern part of Meløy municipality in Nordland county. The length is approx. 25 kilometers from Forøy to Kilvik.
The fjord is today best known as the access road to Engenbreen, a glacier arm to Svartisen. Engenbreen is visited by tourists throughout the year. Today, the fjord has little communication significance outside of tourism, while it was previously an important artery between many small hamlets along the fjord and the mining community Rendalsvik. The outer part of Holandsfjorden is called Arhaugfjord and empties into Skardsfjord, while the inner part is called Nordfjord. The Nordfjord bottoms in Kilvik where the Svartisen power plant is located and the Svartis tunnel from Fykan empties. Nordfjord is usually partially frozen during periods every winter. Due to the extra supply of freshwater from the power station, icing has increased after production at the power plant started in 1993, and on a rare occasion, the entire Holandsfjord is frozen.
The fjord is today best known as the access road to Engenbreen, a glacier arm to Svartisen. Engenbreen is visited by tourists throughout the year. Today, the fjord has little communication significance outside of tourism, while it was previously an important artery between many small hamlets along the fjord and the mining community Rendalsvik. The outer part of Holandsfjorden is called Arhaugfjord and empties into Skardsfjord, while the inner part is called Nordfjord. The Nordfjord bottoms in Kilvik where the Svartisen power plant is located and the Svartis tunnel from Fykan empties. Nordfjord is usually partially frozen during periods every winter. Due to the extra supply of freshwater from the power station, icing has increased after production at the power plant started in 1993, and on a rare occasion, the entire Holandsfjord is frozen.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities46 valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ Actinolite var. Smaragdite Formula: Ca2(Mg,Fe2+,Cr)5Si8O22(OH)2 |
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Albite var. Cleavelandite Formula: Na(AlSi3O8) |
| ⓘ Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ Amblygonite Formula: LiAl(PO4)F Description: Described by Ihlen as "greyish white, small crystals" |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A Localities: Colour: Bluegreenish |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bismutite Formula: (BiO)2CO3 Description: Roy Kristiansen found bismutite filling small fractures in blue tourmaline. |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Cassiterite Formula: SnO2 Description: Irregular grains to 5 mm. References: |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Columbite-(Mn) Formula: Mn2+Nb2O6 References: |
| ⓘ Cookeite Formula: (LiAl4◻)[AlSi3O10](OH)8 References: |
| ⓘ Diopside Formula: CaMgSi2O6 |
| ⓘ Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) Locality: Ågskardet LCT Pegmatite, Holandsfjorden, Meløy, Nordland, Norway - erroneously reported Description: No new analyses have confirmed elbaite. Kolitsch, U., Andresen, P., Husdal, T. A., Ertl, A., Haugen, A., Ellingsen, H. V. and Larsen, A. O. (2013): Tourmaline-group minerals from Norway, part II: Occurrences of luinaite-(OH) in Tvedalen, Larvik and Porsgrunn, and fluor-liddicoatite, fluor-elbaite and fluor-schorl at Ågskardet, Nordland. Norsk Bergverksmuseet Skrift 50, 23-41. |
| ⓘ Enstatite Formula: Mg2Si2O6 |
| ⓘ Enstatite var. Bronzite Formula: (Mg,Fe2+)2[SiO3]2 |
| ⓘ 'Feldspar Group' |
| ⓘ Fluor-elbaite Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F References: Kolitsch, Uwe, Andresen, Peter, Husdal, Tomas Andersen, Ertl, Andreas, Haugen, Astrid, Ellingsen, Hans Vidar, Larsen, Alf Olav (2013) Tourmaline-group minerals from Norway, part II: Occurrences of luinaite-(OH) in Tvedalen, Larvik and Porsgrunn, and fluor-liddicoatite, fluor-elbaite and fluor-schorl at Ågskardet, Nordland. Norsk Bergverksmuseum Skrift, 50. 23-41 |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Fluor-liddicoatite Formula: Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F References: Kolitsch, Uwe, Andresen, Peter, Husdal, Tomas Andersen, Ertl, Andreas, Haugen, Astrid, Ellingsen, Hans Vidar, Larsen, Alf Olav (2013) Tourmaline-group minerals from Norway, part II: Occurrences of luinaite-(OH) in Tvedalen, Larvik and Porsgrunn, and fluor-liddicoatite, fluor-elbaite and fluor-schorl at Ågskardet, Nordland. Norsk Bergverksmuseum Skrift, 50. 23-41 |
| ⓘ Fluor-schorl ? Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3F Description: Refinement indicates F:OH ration of 1:1. EPMA data necessary for confirmation. References: Kolitsch, Uwe, Husdal, Tomas A., Brandstätter, Franz, Ertl, Andreas (2011) New crystal-chemical data for members of the tourmaline group from Norway: occurences of fluor-schorl and luinaite-(OH). Norsk Bergverksmuseum Skrift, 46. 17-24 Kolitsch, Uwe, Andresen, Peter, Husdal, Tomas Andersen, Ertl, Andreas, Haugen, Astrid, Ellingsen, Hans Vidar, Larsen, Alf Olav (2013) Tourmaline-group minerals from Norway, part II: Occurrences of luinaite-(OH) in Tvedalen, Larvik and Porsgrunn, and fluor-liddicoatite, fluor-elbaite and fluor-schorl at Ågskardet, Nordland. Norsk Bergverksmuseum Skrift, 50. 23-41 |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Graphite Formula: C |
| ⓘ Helvine Formula: Be3Mn2+4(SiO4)3S Habit: minute crystals, tetrahedra up to 1 mm in size Colour: yellow, transparent |
| ⓘ Hureaulite Formula: Mn2+5(PO3OH)2(PO4)2 · 4H2O Description: Occure as colourless agregates on the surface of lithiophilite masses. References: |
| ⓘ 'K Feldspar' |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O References: |
| ⓘ 'Lepidolite' |
| ⓘ Lithiophilite Formula: LiMn2+PO4 Colour: Pale red/salmon-pink. Description: Masses to 2cm, surounded by hureaulite. References: |
| ⓘ Lithiophilite var. Sicklerite Formula: Li1-x(Mn3+xMn2+1-x)PO4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ 'Mica Group' |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ 'Microlite Group' Formula: A2-mTa2X6-wZ1-n |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) |
| ⓘ 'Monazite Group' Formula: REE(PO4) References: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Lithian Muscovite Formula: KAl2(AlSi3O10)(OH)2 Description: 2M1 polytype |
| ⓘ 'Muscovite-2M1' Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ Pollucite Formula: (Cs,Na)2(Al2Si4O12) · 2H2O |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Quartz var. Rose Quartz Formula: SiO2 |
| ⓘ Rossmanite Formula: ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) References: Kolitsch, Uwe, Andresen, Peter, Husdal, Tomas Andersen, Ertl, Andreas, Haugen, Astrid, Ellingsen, Hans Vidar, Larsen, Alf Olav (2013) Tourmaline-group minerals from Norway, part II: Occurrences of luinaite-(OH) in Tvedalen, Larvik and Porsgrunn, and fluor-liddicoatite, fluor-elbaite and fluor-schorl at Ågskardet, Nordland. Norsk Bergverksmuseum Skrift, 50. 23-41 |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Description: A sample of black tourmaline was analyzed by Kolitsch et al. (2011) and found to be a F-rich (OH:F~1:1), Al-rich schorl. |
| ⓘ Sillimanite Formula: Al2(SiO4)O Description: Found ina pegmatite |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Spinel Formula: MgAl2O4 |
| ⓘ Spodumene Formula: LiAlSi2O6 |
| ⓘ Titanite Formula: CaTiO(SiO4) |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
| ⓘ Uraninite Formula: UO2 |
| ⓘ Uvarovite Formula: Ca3Cr3+2(SiO4)3 |
| ⓘ Xenotime-(Y) Formula: Y(PO4) References: |
| ⓘ Zircon Formula: Zr(SiO4) References: |
| ⓘ Zircon var. Alvite Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | 'Microlite Group' | 4.00. | A2-mTa2X6-wZ1-n |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rose Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Columbite-(Mn) | 4.DB.35 | Mn2+Nb2O6 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Lithiophilite | 8.AB.10 | LiMn2+PO4 |
| ⓘ | var. Sicklerite | 8.AB.10 | Li1-x(Mn3+xMn2+1-x)PO4 |
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Amblygonite | 8.BB.05 | LiAl(PO4)F |
| ⓘ | Hureaulite | 8.CB.10 | Mn2+5(PO3OH)2(PO4)2 · 4H2O |
| Group 9 - Silicates | |||
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Uvarovite | 9.AD.25 | Ca3Cr3+2(SiO4)3 |
| ⓘ | Zircon var. Alvite | 9.AD.30 | Zr(SiO4) |
| ⓘ | 9.AD.30 | Zr(SiO4) | |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Fluor-schorl ? | 9.CK. | NaFe2+3Al6(Si6O18)(BO3)3(OH)3F |
| ⓘ | Elbaite ? | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Rossmanite | 9.CK.05 | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Fluor-elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| ⓘ | Fluor-liddicoatite | 9.CK.05 | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| ⓘ | Enstatite | 9.DA.05 | Mg2Si2O6 |
| ⓘ | var. Bronzite | 9.DA.05 | (Mg,Fe2+)2[SiO3]2 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Spodumene | 9.DA.30 | LiAlSi2O6 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | var. Smaragdite | 9.DE.10 | Ca2(Mg,Fe2+,Cr)5Si8O22(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Lithian Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Cookeite | 9.EC.55 | (LiAl4◻)[AlSi3O10](OH)8 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | var. Cleavelandite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Helvine | 9.FB.10 | Be3Mn2+4(SiO4)3S |
| ⓘ | Pollucite | 9.GB.05 | (Cs,Na)2(Al2Si4O12) · 2H2O |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Lepidolite' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Muscovite-2M1' | - | KAl2(AlSi3O10)(OH)2 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| H | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Hureaulite | Mn52+(PO3OH)2(PO4)2 · 4H2O |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Actinolite var. Smaragdite | Ca2(Mg,Fe2+,Cr)5Si8O22(OH)2 |
| H | ⓘ Muscovite var. Lithian Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Fluor-schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3F |
| H | ⓘ Muscovite-2M1 | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| H | ⓘ Fluor-liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| Li | Lithium | |
| Li | ⓘ Amblygonite | LiAl(PO4)F |
| Li | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Li | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | ⓘ Lithiophilite | LiMn2+PO4 |
| Li | ⓘ Lithiophilite var. Sicklerite | Li1-x(Mnx3+Mn2+1-x)PO4 |
| Li | ⓘ Spodumene | LiAlSi2O6 |
| Li | ⓘ Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| Li | ⓘ Fluor-liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| B | Boron | |
| B | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| B | ⓘ Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Fluor-schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3F |
| B | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| B | ⓘ Fluor-liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| C | Carbon | |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Graphite | C |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Zircon var. Alvite | Zr(SiO4) |
| O | ⓘ Amblygonite | LiAl(PO4)F |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Enstatite | Mg2Si2O6 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| O | ⓘ Hureaulite | Mn52+(PO3OH)2(PO4)2 · 4H2O |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Lithiophilite | LiMn2+PO4 |
| O | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Quartz var. Rose Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Lithiophilite var. Sicklerite | Li1-x(Mnx3+Mn2+1-x)PO4 |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Spodumene | LiAlSi2O6 |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Uvarovite | Ca3Cr23+(SiO4)3 |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Enstatite var. Bronzite | (Mg,Fe2+)2[SiO3]2 |
| O | ⓘ Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Actinolite var. Smaragdite | Ca2(Mg,Fe2+,Cr)5Si8O22(OH)2 |
| O | ⓘ Muscovite var. Lithian Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Fluor-schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3F |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Muscovite-2M1 | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| O | ⓘ Fluor-liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| F | Fluorine | |
| F | ⓘ Amblygonite | LiAl(PO4)F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Fluor-schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3F |
| F | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| F | ⓘ Fluor-liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | ⓘ Fluor-schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3F |
| Na | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Enstatite | Mg2Si2O6 |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Enstatite var. Bronzite | (Mg,Fe2+)2[SiO3]2 |
| Mg | ⓘ Actinolite var. Smaragdite | Ca2(Mg,Fe2+,Cr)5Si8O22(OH)2 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Amblygonite | LiAl(PO4)F |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Al | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Spodumene | LiAlSi2O6 |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Muscovite var. Lithian Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Fluor-schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3F |
| Al | ⓘ Muscovite-2M1 | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| Al | ⓘ Fluor-liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Zircon var. Alvite | Zr(SiO4) |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Enstatite | Mg2Si2O6 |
| Si | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Quartz var. Rose Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Spodumene | LiAlSi2O6 |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Uvarovite | Ca3Cr23+(SiO4)3 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Enstatite var. Bronzite | (Mg,Fe2+)2[SiO3]2 |
| Si | ⓘ Rossmanite | ◻(LiAl2)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Actinolite var. Smaragdite | Ca2(Mg,Fe2+,Cr)5Si8O22(OH)2 |
| Si | ⓘ Muscovite var. Lithian Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Fluor-schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3F |
| Si | ⓘ Muscovite-2M1 | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| Si | ⓘ Fluor-liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| P | Phosphorus | |
| P | ⓘ Amblygonite | LiAl(PO4)F |
| P | ⓘ Hureaulite | Mn52+(PO3OH)2(PO4)2 · 4H2O |
| P | ⓘ Lithiophilite | LiMn2+PO4 |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Lithiophilite var. Sicklerite | Li1-x(Mnx3+Mn2+1-x)PO4 |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite var. Lithian Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite-2M1 | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Uvarovite | Ca3Cr23+(SiO4)3 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Actinolite var. Smaragdite | Ca2(Mg,Fe2+,Cr)5Si8O22(OH)2 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ca | ⓘ Fluor-liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Cr | Chromium | |
| Cr | ⓘ Uvarovite | Ca3Cr23+(SiO4)3 |
| Cr | ⓘ Actinolite var. Smaragdite | Ca2(Mg,Fe2+,Cr)5Si8O22(OH)2 |
| Mn | Manganese | |
| Mn | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Mn | ⓘ Hureaulite | Mn52+(PO3OH)2(PO4)2 · 4H2O |
| Mn | ⓘ Lithiophilite | LiMn2+PO4 |
| Mn | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Mn | ⓘ Lithiophilite var. Sicklerite | Li1-x(Mnx3+Mn2+1-x)PO4 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Enstatite var. Bronzite | (Mg,Fe2+)2[SiO3]2 |
| Fe | ⓘ Actinolite var. Smaragdite | Ca2(Mg,Fe2+,Cr)5Si8O22(OH)2 |
| Fe | ⓘ Fluor-schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3F |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| Y | Yttrium | |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon var. Alvite | Zr(SiO4) |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Cs | Caesium | |
| Cs | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Ce | Cerium | |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Ta | Tantalum | |
| Ta | ⓘ Microlite Group | A2-mTa2X6-wZ1-n |
| Bi | Bismuth | |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| U | Uranium | |
| U | ⓘ Uraninite | UO2 |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://no.wikipedia.org/wiki/Holandsfjorden |
|---|---|
| Wikidata ID: | Q4354538 |
Localities in this Region
- Nordland
- Meløy
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.




Ågskardet LCT Pegmatite, Holandsfjorden, Meløy, Nordland, Norway