Tolland County, Connecticut, USAi
| Regional Level Types | |
|---|---|
| Tolland County | County |
| Connecticut | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Other Languages:
French:
Comté de Tolland, Connecticut, États-Unis
German:
Tolland County, Connecticut, Vereinigte Staaten
Italian:
Contea di Tolland, Connecticut, Stati Uniti d'America
Russian:
Толланд, Коннектикут, Соединённые Штаты Америки
Simplified Chinese:
托兰县, 康乃狄克州, 美国
Spanish:
Condado de Tolland, Connecticut, Estados Unidos
Albanian:
Tolland County, Connecticut, Shtetet e Bashkuara të Amerikës
Arabic:
مقاطعة تولاند, كونيتيكت, الولايات المتحدة
Armenian:
Թոլանդ շրջան, Կոնեկտիկուտ, Ամերիկայի Միացյալ Նահանգներ
Basque:
Tolland konderria, Connecticut
Bavarian:
Tolland County, Connecticut, Vaoanigte Stootn
Bishnupriya Manipuri:
টোলল্যান্ড কাউন্টি, কানেকটিকাট, তিলপারাষ্ট্র
Bulgarian:
Толънд, Кънектикът, Съединени американски щати
Cebuano:
Tolland County, Connecticut
Dutch:
Tolland County, Connecticut, Verenigde Staten
Farsi/Persian:
شهرستان تولند، کنتیکت, کنتیکت, ایالات متحده آمریکا
Finnish:
Tollandin piirikunta, Connecticut, Yhdysvallat
Hungarian:
Tolland megye, Connecticut, Amerikai Egyesült Államok
Irish Gaelic:
Contae Tolland, Connecticut, Stáit Aontaithe Mheiriceá
Japanese:
トランド郡, コネチカット州, アメリカ合衆国
Low Saxon/Low German:
Tolland County, Connecticut, USA
Min Dong Chinese:
Tolland Gông, Connecticut
Norwegian:
Tolland County, Connecticut, USA
Polish:
Hrabstwo Tolland, Connecticut, Stany Zjednoczone
Portuguese:
Condado de Tolland, Connecticut, Estados Unidos
Romanian:
Comitatul Tolland, Connecticut, Statele Unite ale Americii
Serbian:
Округ Таланд, Конектикат, Сједињене Америчке Државе
Serbo-Croatian:
Tolland County, Connecticut, Sjedinjene Američke Države
Swedish:
Tolland County, Connecticut, USA
Turkish:
Tolland County, Connecticut, Amerika Birleşik Devletleri
Ukrainian:
Толленд, Коннектикут, Сполучені Штати Америки
Urdu:
ٹولینڈ کاؤنٹی، کنیکٹیکٹ, کنیکٹیکٹ, ریاستہائے متحدہ امریکا
Vietnamese:
Quận Tolland, Connecticut, Chủng Quốc Hoa Kỳ
Waray:
Condado han Tolland, Connecticut, Estados Unidos
Western Punjabi:
ٹولینڈ کاؤنٹی, کنکٹیکٹ, امریکہ
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities54 valid minerals.
* - Minerals that have never been found, but their existence is inferred in some way (e.g. from pseudomorphs)
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 References: |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Interstate 84 (I-84; I-86; State Route 15; Wilbur Cross Highway), Union, Tolland County, Connecticut, USA Becker Quarry, Willington, Tolland County, Connecticut, USA US Route 6 Willimantic Bypass expressway road cuts, Coventry, Tolland County, Connecticut, USA Stafford, Tolland County, Connecticut, USA Cordierite locality (Bigelow Pond), Union, Tolland County, Connecticut, USA Colour: greenish Description: large plates, translucent and in some cases nearly transparent, of a greenish color |
| ⓘ Albite var. Andesine Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 Localities: Becker Quarry, Willington, Tolland County, Connecticut, USA Burgundy Hill Quarry, Tolland, Tolland County, Connecticut, USA Stafford, Tolland County, Connecticut, USA Gerber Drive road cuts, Tolland, Tolland County, Connecticut, USA State Route 31 and Dockerel Road intersection, Tolland, Tolland County, Connecticut, USA Habit: trapezohedral Colour: red to maroon Description: Pocket crystals with finely striated faces can reach over 7 cm. Compositionally zoned, with up to about 0.2 mole fraction grossular, 0.15 mole fraction pyrope, and 0.05 mole fraction spessartine - more toward the crystals' cores. |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5(T8O22)W2 |
| ⓘ 'Amphibole Supergroup var. Byssolite' Formula: AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 Locality: US Route 6 Willimantic Bypass expressway road cuts, Coventry, Tolland County, Connecticut, USA Habit: capillary Colour: white Description: Scattered capillary crystals in fracture voids. References: |
| ⓘ Anhydrite Formula: CaSO4 Habit: tabular Description: Tabular crystals to 3 cm that were epimorphed or encrusted by drusy quartz before later naturally dissolving away leaving voids. References: |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 Habit: rhombohedral Description: Typical small rhombs <1 cm. Uncertain in the reference if the crystals are true ankerite under the revised definition, or ferroan dolomite, or how to distinguish them from the much more common magnesite. |
| ⓘ Annite Formula: KFe2+3(AlSi3O10)(OH)2 Locality: US Route 6 Willimantic Bypass expressway road cuts, Coventry, Tolland County, Connecticut, USA References: |
| ⓘ Anorthite Formula: Ca(Al2Si2O8) Habit: anhedral Description: component of the host metagabbro, composition An70-80. |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A |
| ⓘ Arsenopyrite Formula: FeAsS References: |
| ✪ Azurite Formula: Cu3(CO3)2(OH)2 Habit: Tabular to tapered groups Colour: Very dark blue Description: Mostly massive, found in massive quartz with massive chalcocite, malachite, fluorite. |
| ⓘ Baddeleyite Formula: ZrO2 |
| ✪ Baryte Formula: BaSO4 Habit: massive tabular, subparallel overgrowths with curved faces, short prismatic to acicular Colour: white, creamy tan, blue, yellow, colorless Fluorescence: rarely yellow-white, or blue-green primarily under SW Description: There appear to be three generations of baryte crystallization: 1) an initial coarse-grained, tabular to massive, opaque white phase in massive quartz and fluorite, 2) a translucent, creamy tan overgrowth phase usually in subparallel orientation on the white barite in voids within the previous matrix, some from the dissolution of fluorite, and 3) a transparent, colorless to blue overgrowth phase on either phase 1 or 2 baryte crystals, or isolated. All three phases of crystals can show varying degrees of surface etching. Small tabular white crystals and yellow, transparent, acicular crystals are also known. |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Habit: tabular Colour: black Description: Mostly as a component of the host metagabbro, but also as euhedral crystals in the open veins to about 1 cm. |
| ⓘ Bonaccorsiite Formula: KK2Na3(Al6Si36)O84 References: Ferrero, Silvio, Ague, Jay J., O’Brien, Patrick J., Wunder, Bernd, Remusat, Laurent, Ziemann, Martin A., Axler, Jennifer (2021) High-pressure, halogen-bearing melt preserved in ultrahigh-temperature felsic granulites of the Central Maine Terrane, Connecticut (U.S.A.) American Mineralogist, 106 (8) 1225-1236 doi:10.2138/am-2021-7690 |
| ⓘ Calcite Formula: CaCO3 Localities: Becker Quarry, Willington, Tolland County, Connecticut, USA Interstate 84 (I-84; I-86; State Route 15; Wilbur Cross Highway), Union, Tolland County, Connecticut, USA US Route 6 Willimantic Bypass expressway road cuts, Coventry, Tolland County, Connecticut, USA Stafford, Tolland County, Connecticut, USA Habit: flat rhombohedra, usually in rosette aggregates Colour: white to colorless Description: As rosette aggregates to around 5 mm, a late-forming mineral usually found on top of the high P-T assemblage. |
| ⓘ 'Chabazite' Localities: Habit: rhombohedral Colour: white Description: drusy crystals on epidote in fractures in gneiss |
| ⓘ Chalcocite Formula: Cu2S Localities: Habit: massive Colour: black with slight bluish iridescence Description: mm-scale grains and irregular masses with sphalerite in albite/quartz/muscovite host. The sulfide grains are embedded in the silicates suggesting the former are primary. |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Description: A rarer accessory mineral in the vein assemblage. |
| ⓘ 'Chlorite Group' |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 References: |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 Locality: US Route 6 Willimantic Bypass expressway road cuts, Coventry, Tolland County, Connecticut, USA Habit: massive Colour: dark green Description: In matrix near hydrothermally altered fractures. References: |
| ⓘ 'Clinopyroxene Subgroup' Habit: anhedral Colour: black Description: A component of the host metagabbro. |
| ⓘ Cordierite Formula: Mg2Al4Si5O18 |
| ⓘ 'Crichtonite Group' Formula: AD21O38 or A{DE2G6Ti12}O38 |
| ⓘ Cummingtonite Formula: ◻Mg2Mg5(Si8O22)(OH)2 Description: Metamorphic retrograde alteration of pyroxene. |
| ⓘ Davidite-(Ce) Formula: Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: Habit: prismatic Colour: yellow-green to dark green to black Description: drusy crystals in fractures in gneiss, crystallized in two generations, an initial one with elongated, larger and darker crystals and a second one of much finer-grained, short and lighter colored crystals. The second generation coats the first and some other minerals like quartz. |
| ⓘ Epistilbite Formula: CaAl2Si6O16 · 5H2O |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Localities: Habit: elongated prismatic Colour: white to pale green Fluorescence: yellow under short wave UV Description: Small crystals in gneiss. |
| ✪ Fluorite Formula: CaF2 Habit: cubic with tetrahexahedral overgrowths Colour: colorless, pale blue, purple, green |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 Localities: Tolland, Tolland County, Connecticut, USA Bolton Notch, Bolton, Tolland County, Connecticut, USA Becker Quarry, Willington, Tolland County, Connecticut, USA Interstate 84 (I-84; I-86; State Route 15; Wilbur Cross Highway), Union, Tolland County, Connecticut, USA Cordierite locality (Bigelow Pond), Union, Tolland County, Connecticut, USA |
| ⓘ Goethite Formula: Fe3+O(OH) Localities: Baryte locality, Somers, Tolland County, Connecticut, USA Becker Quarry, Willington, Tolland County, Connecticut, USA US Route 6 Willimantic Bypass expressway road cuts, Coventry, Tolland County, Connecticut, USA Diamond Ledge (West Stafford quartz locality; Stafford Springs quartz locality), Stafford, Tolland County, Connecticut, USA Interstate 84 (I-84; I-86; State Route 15; Wilbur Cross Highway), Union, Tolland County, Connecticut, USA Habit: massive, earthy Colour: dark brown |
| ⓘ Graphite Formula: C |
| ⓘ Hematite Formula: Fe2O3 Colour: red Description: earthy red massive material, dissolved in HCl with positive results for iron (as opposed to copper) References: |
| ⓘ 'Heulandite Subgroup' Formula: (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O Localities: Colour: colorless to white Description: micro drusy crystals with epidote and zeolites in fractures in gneiss |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ 'K Feldspar' |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 References: |
| ⓘ Kyanite Formula: Al2(SiO4)O Localities: Habit: elongated bladed prisms flattened parallel to (100), solitary or in feathery aggregates Colour: colorless, gray, light to dark blue blue Description: As free standing crystals to 5 cm in the open vein assemblage - a rarity in the state, typically with ragged edges and coated/partially altered to gray-green sericite/chlorite/clay minerals, though some are well terminated. |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O |
| ⓘ 'Limonite' |
| ⓘ Loveringite Formula: (Ca,Ce,La)(Zr,Fe)(Mg,Fe)2(Ti,Fe,Cr,Al)18O38 |
| ✪ Magnesio-hornblende Formula: ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 Habit: elongated prismatic Colour: black Description: Mostly as a metamorphic retrograde alteration of pyroxene in the host metagabbro, but also as an uncommon mineral in the open vein assemblage - a rarity in the state. Crystals to 1 cm. |
| ✪ Magnesite Formula: MgCO3 Habit: rhombohedral Colour: tan to brown Description: Small rhombs <1 cm common, but crystals can reach several cm. Much more common than reported ankerite. Iron typically in the range of 0.05-0.30 apfu, though reportedly a few samples have outer rims grading to pure siderite. |
| ✪ Magnesite var. Iron-bearing Magnesite Formula: (Mg,Fe)CO3 Habit: rhombohedral Colour: tan to light brown Description: Crystals to several cm. Much more common than reported ankerite. Iron typically in the range of 0.05-0.30 apfu, though reportedly a few samples have outer rims grading to pure siderite. |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Habit: radiating acicular, mossy aggregates Colour: green Description: alteration of chalcocite, typically with azurite in massive quartz and fluorite |
| ⓘ Microcline Formula: K(AlSi3O8) Localities: Habit: massive Colour: white Fluorescence: deep red Description: in pegmatites cross-cutting the gneiss within the road cuts |
| ⓘ Molybdenite Formula: MoS2 Locality: US Route 6 Willimantic Bypass expressway road cuts, Coventry, Tolland County, Connecticut, USA Habit: tabular, subhedral Colour: silvery gray Description: crystal 23 mm collected by Fred Schuster during construction References: |
| ⓘ 'Monazite Group' Formula: REE(PO4) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ 'Orthopyroxene Subgroup' Habit: anhedral Description: A major component of the host metagabbro. |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 Localities: Habit: platy aggregates Colour: pale green Description: drusy crystal aggregates with zeolites and epidote in fractures in gneiss |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 8 localities in this region. Habit: cubic Colour: pale brassy Description: A low-temp mineral of the open vein assemblages, typically as druses coating the earlier high P-T assemblage. Rarely as cubes typically about 1 cm, can form complex rosette aggregates to over 5 cm across and 3.5 cm thick. |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 Description: rounded grains in a calcite vein. |
| ✪ Pyrrhotite Formula: Fe1-xS Habit: tabular pseudohexagonal Colour: bronzy Description: A rare accessory mineral of the open vein assemblage. Euhedral crystals to 1.5 cm very rare in Connecticut - this may be the only such locality. References: |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 8 localities in this region. Habit: stubby prismatic, complex parallel-growth, corn cob Colour: colorless to milky (typically in an outer zone) Description: large complex crystals to 10 cm or more, smaller crystals radially encrusted acicular laumontite creating coarse columns of crystals |
| ⓘ Quartz var. Amethyst Formula: SiO2 |
| ✪ Quartz var. Milky Quartz Formula: SiO2 Habit: stubby prismatic, complex parallel-growth, corn cob Colour: colorless to milky Description: large complex crystals to 10 cm or more, smaller crystals radially encrusted acicular laumontite creating coarse columns of crystals |
| ⓘ Quartz var. Rose Quartz Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 Localities: Habit: scepters, reverse scepters, Tessin habit Colour: smoky Description: A common mineral in the open vein assemblage. Mostly small <1-1.5 cm crystals with wide variety of complex forms, Tessin and scepters, reverse scepters and combinations. Many are doubly-terminated. Larger crystals can reach up to 7 cm and are typically Tessin habit showing the various steep positive rhombohedra, such as {20bar21}, {30bar31} and {50bar53} and their negative equivalents {03bar32}, {02bar21}, {03bar31} and {05bar53}. |
| ⓘ Romanèchite Formula: (Ba,H2O)2(Mn4+,Mn3+)5O10 Habit: botryoidal Colour: very dark brown to black Description: As masses with conchoidal fracture and black streak in quartz with azurite and malachite. Analyzed 2016 by Peter Cristofono and Tom Mortimer using EDS. Closest other analytical possibility is hollandite, which has a slightly higher Ba:Mn ratio, and doesn't match the physical properties of this material as well as romanechite does. References: |
| ⓘ Rutile Formula: TiO2 Habit: elongated, striated prisms. Colour: red Description: An accessory mineral in the open vein assemblage, as microcrystals. |
| ⓘ 'Scapolite' Habit: elongated prismatic to massive Colour: white, pale pink to peach Description: Crude crystals and masses in calc-silicate assemblages in the metamorphic rocks. References: Harold Moritz CollectionIdentified by Harold Moritz: Visual Identification |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Siderite Formula: FeCO3 Habit: rhombohedral Description: As outer rims of a few analyzed magnesite crystals. |
| ⓘ Sillimanite Formula: Al2(SiO4)O Localities: Habit: elongated prisms Colour: brown Description: Crystals to 7 cm in subparallel alignment in quartz-rich segregations, just like at Chester, Norwich and Willimantic - all from exposures of the Tatnic Hill Formation. |
| ⓘ 'Soapstone' |
| ⓘ Sphalerite Formula: ZnS Habit: rounded grains Colour: yellow Description: mm-scale rounded, clear grains with chalcocite in albite/quartz/muscovite. Sulfide grains are embedded in the silicates suggesting the former are primary. References: |
| ⓘ Spinel Formula: MgAl2O4 |
| ⓘ Srilankite Formula: TiO2 |
| ⓘ Staurolite Formula: Fe2+2Al9Si4O23(OH) Localities: Reported from at least 7 localities in this region. Habit: prismatic, twinned Colour: dark brown Description: "in large crystals, often forming the cross" |
| ⓘ 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O Localities: Habit: platy Description: drusy crystals with epidote and zeolites in fractures in gneiss |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ Titanite Formula: CaTiO(SiO4) |
| ✪ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z Habit: trigonal elongated, striated prisms with rhombhedral terminations Colour: black Description: very sharp, lustrous pocket crystals to several cms. Species likely schorl or perhaps dravite. References: |
| ⓘ 'Xenotime' |
| ⓘ Zircon Formula: Zr(SiO4) Localities: Description: A rare accessory mineral in the open vein assemblage. |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Davidite-(Ce) | 4.CC.40 | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| ⓘ | Loveringite | 4.CC.40 | (Ca,Ce,La)(Zr,Fe)(Mg,Fe)2(Ti,Fe,Cr,Al)18O38 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Rose Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Milky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Srilankite | 4.DB.25 | TiO2 |
| ⓘ | Baddeleyite | 4.DE.35 | ZrO2 |
| ⓘ | Romanèchite | 4.DK.10 | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Magnesite var. Iron-bearing Magnesite | 5.AB.05 | (Mg,Fe)CO3 |
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anhydrite ? | 7.AD.30 | CaSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Cordierite | 9.CJ.10 | Mg2Al4Si5O18 |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Cummingtonite | 9.DE.05 | ◻Mg2Mg5(Si8O22)(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Magnesio-hornblende | 9.DE.10 | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Annite | 9.EC.20 | KFe2+3(AlSi3O10)(OH)2 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Bonaccorsiite | 9.FA. | KK2Na3(Al6Si36)O84 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Andesine | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| ⓘ | Epistilbite | 9.GD.45 | CaAl2Si6O16 · 5H2O |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chabazite' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Heulandite Subgroup' | - | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Xenotime' | - | |
| ⓘ | 'Clinopyroxene Subgroup' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Soapstone' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Amphibole Supergroup var. Byssolite' | - | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Orthopyroxene Subgroup' | - | |
| ⓘ | 'Crichtonite Group' | - | AD21O38 or A{DE2G6Ti12}O38 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| H | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Epistilbite | CaAl2Si6O16 · 5H2O |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Magnesite var. Iron-bearing Magnesite | (Mg,Fe)CO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Graphite | C |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Baddeleyite | ZrO2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Magnesite var. Iron-bearing Magnesite | (Mg,Fe)CO3 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Cordierite | Mg2Al4Si5O18 |
| O | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| O | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Epistilbite | CaAl2Si6O16 · 5H2O |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Loveringite | (Ca,Ce,La)(Zr,Fe)(Mg,Fe)2(Ti,Fe,Cr,Al)18O38 |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| O | ⓘ Quartz var. Rose Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Srilankite | TiO2 |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Quartz var. Milky Quartz | SiO2 |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Crichtonite Group | AD21O38 or A{DE2G6Ti12}O38 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Bonaccorsiite | KK2Na3(Al6Si36)O84 |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | ⓘ Bonaccorsiite | KK2Na3(Al6Si36)O84 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Magnesite var. Iron-bearing Magnesite | (Mg,Fe)CO3 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Cordierite | Mg2Al4Si5O18 |
| Mg | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Loveringite | (Ca,Ce,La)(Zr,Fe)(Mg,Fe)2(Ti,Fe,Cr,Al)18O38 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Cordierite | Mg2Al4Si5O18 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Epistilbite | CaAl2Si6O16 · 5H2O |
| Al | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Loveringite | (Ca,Ce,La)(Zr,Fe)(Mg,Fe)2(Ti,Fe,Cr,Al)18O38 |
| Al | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Bonaccorsiite | KK2Na3(Al6Si36)O84 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Cordierite | Mg2Al4Si5O18 |
| Si | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Epistilbite | CaAl2Si6O16 · 5H2O |
| Si | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Quartz var. Rose Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Quartz var. Milky Quartz | SiO2 |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Bonaccorsiite | KK2Na3(Al6Si36)O84 |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| Cl | Chlorine | |
| Cl | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Bonaccorsiite | KK2Na3(Al6Si36)O84 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Epistilbite | CaAl2Si6O16 · 5H2O |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Loveringite | (Ca,Ce,La)(Zr,Fe)(Mg,Fe)2(Ti,Fe,Cr,Al)18O38 |
| Ca | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Loveringite | (Ca,Ce,La)(Zr,Fe)(Mg,Fe)2(Ti,Fe,Cr,Al)18O38 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Srilankite | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Ti | ⓘ Amphibole Supergroup var. Byssolite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Crichtonite Group | AD21O38 or A{DE2G6Ti12}O38 |
| V | Vanadium | |
| V | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Cr | Chromium | |
| Cr | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Cr | ⓘ Loveringite | (Ca,Ce,La)(Zr,Fe)(Mg,Fe)2(Ti,Fe,Cr,Al)18O38 |
| Mn | Manganese | |
| Mn | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Magnesite var. Iron-bearing Magnesite | (Mg,Fe)CO3 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Loveringite | (Ca,Ce,La)(Zr,Fe)(Mg,Fe)2(Ti,Fe,Cr,Al)18O38 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Cu | Copper | |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| Y | Yttrium | |
| Y | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Zr | Zirconium | |
| Zr | ⓘ Baddeleyite | ZrO2 |
| Zr | ⓘ Loveringite | (Ca,Ce,La)(Zr,Fe)(Mg,Fe)2(Ti,Fe,Cr,Al)18O38 |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| La | Lanthanum | |
| La | ⓘ Loveringite | (Ca,Ce,La)(Zr,Fe)(Mg,Fe)2(Ti,Fe,Cr,Al)18O38 |
| Ce | Cerium | |
| Ce | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Ce | ⓘ Loveringite | (Ca,Ce,La)(Zr,Fe)(Mg,Fe)2(Ti,Fe,Cr,Al)18O38 |
| U | Uranium | |
| U | ⓘ Davidite-(Ce) | Ce(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
Fossils
There are 1 fossil locality from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 1 | ||||||
|---|---|---|---|---|---|---|---|
| Youngest Fossil Listed | 191 Ma (Early Jurassic) | ||||||
| Oldest Fossil Listed | 201 Ma (Early Jurassic) | ||||||
| Stratigraphic Units |
| ||||||
| Fossils from Region | Click here to show the list. | ||||||
| Fossil Localities | Click to show 1 fossil locality |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Tolland_County,_Connecticut |
|---|---|
| Wikidata ID: | Q54246 |
| GeoNames ID: | 4844275 |
Localities in this Region
Other Regions, Features and Areas that Intersect
North AmericaContinent
North America PlateTectonic Plate
- Ganderia DomainDomain
- GranderiaPassive Margin
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions
Diamond Ledge, Stafford, Tolland County, Connecticut, USA