Cavnic, Maramureș County, Romaniai
| Regional Level Types | |
|---|---|
| Cavnic | Town |
| Maramureș County | County |
| Romania | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Cavnic | 5,072 (2014) |
Other/historical names associated with this locality:
Kapnic; Kapnik
Other Languages:
French:
Cavnic, Marmatie, Roumanie
German:
Cavnic, Maramuresch, Rumänien
Hungarian:
Kapnikbánya, Máramaros, Románia
Italian:
Cavnic, Maramureș, Romania
Romanian:
Cavnic, Maramureș, România
Russian:
Кавник, Марамуреш, Румыния
Simplified Chinese:
卡夫尼克, 馬拉穆列什縣, 羅馬尼亞
Spanish:
Cavnic, Maramureș, Rumania
Ukrainian:
Кавнік, Мармарощина, Румунія
Catalan:
Cavnic, Província de Maramureș, Romania
Cebuano:
Oraș Cavnic, Rumanya
Czech:
Cavnic, Maramureș, Rumunsko
Dutch:
Cavnic, Maramureș, Roemenië
Esperanto:
Cavnic, Maramureŝo, Rumanio
Farsi/Persian:
کوونیک, شهرستان مارامورش, رومانی
Malay:
Cavnic, Wilayah Maramureș, Romania
Minangkabau:
Cavnic
Polish:
Cavnic, Marmarosz, Rumunia
Portuguese:
Cavnic, Maramureș, Romênia
Serbian:
Општина Кавник, Марамуреш, Румунија
Serbo-Croatian:
Opština Cavnic, Maramureș, Rumunija
Slovak:
Cavnic, Maramureș, Rumunsko
Tajik (Cyrillic Script):
Кавник, Вилояти Марамуреш, Руминия
Traditional Chinese:
卡夫尼克, 馬拉穆列什縣, 羅馬尼亞
Vietnamese:
Cavnic, România
Welsh:
Cavnic, Rwmania
An ancient and historic mining town, known since 1336 and, in modern times, extended up to its maximum by Ceausescu's mining policies.
Located 30 km east of Baia Mare and famous for its deposits of lead, zinc, and manganese, as well as small quantities of gold, silver, barium, and antimony.
Samples of exceptional beauty and value have been extracted from the mines of this locality, present in major worldwide collections.
In particular, the mines have produced the world's most beautiful tetrahedrites, by size, arrangement, and lustre.
Current situation: Since 2008 all the mines have been closed; adits are sealed, water pumps are off and the external structures are demolished or about to be demolished.
For several years, rumours have persisted about foreign investors, but they are slow to manifest themselves in reality.
Formerly known as Kapnik, Hungary (during the Austro-Hungarian Empire).
Smoky quartz specimens showing split growth ("artichoke quartz") like the one in the photo are artificially irradiated. Photos of such specimens should be labelled "quartz", not "smoky quartz".
Located 30 km east of Baia Mare and famous for its deposits of lead, zinc, and manganese, as well as small quantities of gold, silver, barium, and antimony.
Samples of exceptional beauty and value have been extracted from the mines of this locality, present in major worldwide collections.
In particular, the mines have produced the world's most beautiful tetrahedrites, by size, arrangement, and lustre.
Current situation: Since 2008 all the mines have been closed; adits are sealed, water pumps are off and the external structures are demolished or about to be demolished.
For several years, rumours have persisted about foreign investors, but they are slow to manifest themselves in reality.
Formerly known as Kapnik, Hungary (during the Austro-Hungarian Empire).
Artificially irradiated artichoke quartz
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities68 valid minerals. 1 (TL) - type locality of valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold var. Electrum | 1.AA.05 | (Au,Ag) |
| ⓘ | 1.AA.05 | Au | |
| ⓘ | Native Arsenic | 1.CA.05 | As |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Petzite | 2.BA.75 | Ag3AuTe2 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Wurtzite | 2.CB.45 | (Zn,Fe)S |
| ⓘ | Altaite | 2.CD.10 | PbTe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Metastibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Calaverite | 2.EA.10 | AuTe2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Realgar | 2.FA.15a | As4S4 |
| ⓘ | Orpiment | 2.FA.30 | As2S3 |
| ⓘ | Proustite | 2.GA.05 | Ag3AsS3 |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | Wittichenite | 2.GA.20 | Cu3BiS3 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Tennantite-(Zn) | 2.GB.05 | Cu6(Cu4Zn2)As4S12S |
| ⓘ | Tetrahedrite-(Zn) | 2.GB.05 | Cu6(Cu4Zn2)Sb4S12S |
| ⓘ | Chalcostibite | 2.HA.05 | CuSbS2 |
| ⓘ | Berthierite | 2.HA.20 | FeSb2S4 |
| ⓘ | Fülöppite | 2.HC.10a | Pb3Sb8S15 |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Matildite | 2.JA.20 | AgBiS2 |
| ⓘ | Zinkenite | 2.JB.35a | Pb9Sb22S42 |
| ⓘ | Benleonardite ? | 2.LA.50 | [Ag6(Sb,As)2S6Te][Ag9Cu(S,Te)2Te2] |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | var. Specularite | 4.CB.05 | Fe2O3 |
| ⓘ | Senarmontite | 4.CB.50 | Sb2O3 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Milky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Ferberite | 4.DB.30 | FeWO4 |
| ⓘ | Hübnerite | 4.DB.30 | MnWO4 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | var. Manganese-bearing Calcite | 5.AB.05 | (Ca,Mn)CO3 |
| ⓘ | Rhodochrosite (TL) | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Kutnohorite | 5.AB.10 | CaMn2+(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Argentojarosite | 7.BC.10 | AgFe3+3(SO4)2(OH)6 |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | var. Selenite | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Coquandite | 7.DE.35 | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Krautite | 8.CB.15 | Mn(HAsO4) · H2O |
| ⓘ | Wavellite | 8.DC.50 | Al3(PO4)2(OH)3 · 5H2O |
| Group 9 - Silicates | |||
| ⓘ | Ilvaite | 9.BE.07 | CaFe3+Fe2+2(Si2O7)O(OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Ruizite | 9.BJ.35 | Ca2Mn3+2[Si4O11(OH)2](OH)2 · 2H2O |
| ⓘ | Hubeite | 9.BJ.60 | Ca2Mn2+Fe3+Si4O12(OH) · 2H2O |
| ⓘ | Rhodonite | 9.DK.05 | CaMn3Mn[Si5O15] |
| ⓘ | Inesite | 9.DL.05 | Ca2(Mn,Fe)7Si10O28(OH)2 · 5H2O |
| ⓘ | Fluorapophyllite-(K) | 9.EA.15 | KCa4(Si8O20)(F,OH) · 8H2O |
| ⓘ | Hydroxyapophyllite-(K) ? | 9.EA.15 | KCa4(Si8O20)(OH,F) · 8H2O |
| ⓘ | Muscovite var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Sudoite | 9.EC.55 | Mg2Al3(AlSi3O10)(OH)8 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Andesine | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Helvine | 9.FB.10 | Be3Mn2+4(SiO4)3S |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| Group 10 - Organic Compounds | |||
| ⓘ | Whewellite | 10.AB.45 | Ca(C2O4) · H2O |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Tetrahedrite Group' | - | M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
| ⓘ | 'UM2008-39-S:AgBiPb' | - | PbAg2Bi2S5 |
| ⓘ | 'UM2008-40-S:AgBiPb' | - | Pb8Ag11Bi11S30 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Argentojarosite | AgFe33+(SO4)2(OH)6 |
| H | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hydroxyapophyllite-(K) | KCa4(Si8O20)(OH,F) · 8H2O |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| H | ⓘ Inesite | Ca2(Mn,Fe)7Si10O28(OH)2 · 5H2O |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Krautite | Mn(HAsO4) · H2O |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Ruizite | Ca2Mn23+[Si4O11(OH)2](OH)2 · 2H2O |
| H | ⓘ Sudoite | Mg2Al3(AlSi3O10)(OH)8 |
| H | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| H | ⓘ Whewellite | Ca(C2O4) · H2O |
| H | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| H | ⓘ Hubeite | Ca2Mn2+Fe3+Si4O12(OH) · 2H2O |
| Be | Beryllium | |
| Be | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| C | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Whewellite | Ca(C2O4) · H2O |
| O | Oxygen | |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Argentojarosite | AgFe33+(SO4)2(OH)6 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Ferberite | FeWO4 |
| O | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hübnerite | MnWO4 |
| O | ⓘ Hydroxyapophyllite-(K) | KCa4(Si8O20)(OH,F) · 8H2O |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| O | ⓘ Inesite | Ca2(Mn,Fe)7Si10O28(OH)2 · 5H2O |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Krautite | Mn(HAsO4) · H2O |
| O | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| O | ⓘ Ruizite | Ca2Mn23+[Si4O11(OH)2](OH)2 · 2H2O |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Senarmontite | Sb2O3 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Sudoite | Mg2Al3(AlSi3O10)(OH)8 |
| O | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| O | ⓘ Whewellite | Ca(C2O4) · H2O |
| O | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| O | ⓘ Hematite var. Specularite | Fe2O3 |
| O | ⓘ Quartz var. Milky Quartz | SiO2 |
| O | ⓘ Hubeite | Ca2Mn2+Fe3+Si4O12(OH) · 2H2O |
| O | ⓘ Apatite | Ca5(PO4)3A |
| F | Fluorine | |
| F | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Hydroxyapophyllite-(K) | KCa4(Si8O20)(OH,F) · 8H2O |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Mg | Magnesium | |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Sudoite | Mg2Al3(AlSi3O10)(OH)8 |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Sudoite | Mg2Al3(AlSi3O10)(OH)8 |
| Al | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| Si | Silicon | |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| Si | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Si | ⓘ Hydroxyapophyllite-(K) | KCa4(Si8O20)(OH,F) · 8H2O |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Si | ⓘ Inesite | Ca2(Mn,Fe)7Si10O28(OH)2 · 5H2O |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Si | ⓘ Ruizite | Ca2Mn23+[Si4O11(OH)2](OH)2 · 2H2O |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Sudoite | Mg2Al3(AlSi3O10)(OH)8 |
| Si | ⓘ Quartz var. Milky Quartz | SiO2 |
| Si | ⓘ Hubeite | Ca2Mn2+Fe3+Si4O12(OH) · 2H2O |
| P | Phosphorus | |
| P | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Argentojarosite | AgFe33+(SO4)2(OH)6 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Berthierite | FeSb2S4 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Benleonardite | [Ag6(Sb,As)2S6Te][Ag9Cu(S,Te)2Te2] |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcostibite | CuSbS2 |
| S | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| S | ⓘ Covellite | CuS |
| S | ⓘ Fülöppite | Pb3Sb8S15 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Matildite | AgBiS2 |
| S | ⓘ Metastibnite | Sb2S3 |
| S | ⓘ Orpiment | As2S3 |
| S | ⓘ Proustite | Ag3AsS3 |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Realgar | As4S4 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Wittichenite | Cu3BiS3 |
| S | ⓘ Wurtzite | (Zn,Fe)S |
| S | ⓘ Zinkenite | Pb9Sb22S42 |
| S | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| S | ⓘ Tetrahedrite Group | M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
| S | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| S | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| S | ⓘ UM2008-39-S:AgBiPb | PbAg2Bi2S5 |
| S | ⓘ UM2008-40-S:AgBiPb | Pb8Ag11Bi11S30 |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| K | ⓘ Hydroxyapophyllite-(K) | KCa4(Si8O20)(OH,F) · 8H2O |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Hydroxyapophyllite-(K) | KCa4(Si8O20)(OH,F) · 8H2O |
| Ca | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Ca | ⓘ Inesite | Ca2(Mn,Fe)7Si10O28(OH)2 · 5H2O |
| Ca | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Ca | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Ca | ⓘ Ruizite | Ca2Mn23+[Si4O11(OH)2](OH)2 · 2H2O |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Whewellite | Ca(C2O4) · H2O |
| Ca | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| Ca | ⓘ Hubeite | Ca2Mn2+Fe3+Si4O12(OH) · 2H2O |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Mn | Manganese | |
| Mn | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Mn | ⓘ Hübnerite | MnWO4 |
| Mn | ⓘ Inesite | Ca2(Mn,Fe)7Si10O28(OH)2 · 5H2O |
| Mn | ⓘ Krautite | Mn(HAsO4) · H2O |
| Mn | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| Mn | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Mn | ⓘ Ruizite | Ca2Mn23+[Si4O11(OH)2](OH)2 · 2H2O |
| Mn | ⓘ Hubeite | Ca2Mn2+Fe3+Si4O12(OH) · 2H2O |
| Fe | Iron | |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Argentojarosite | AgFe33+(SO4)2(OH)6 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Berthierite | FeSb2S4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ferberite | FeWO4 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Fe | ⓘ Inesite | Ca2(Mn,Fe)7Si10O28(OH)2 · 5H2O |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Wurtzite | (Zn,Fe)S |
| Fe | ⓘ Hematite var. Specularite | Fe2O3 |
| Fe | ⓘ Hubeite | Ca2Mn2+Fe3+Si4O12(OH) · 2H2O |
| Cu | Copper | |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Benleonardite | [Ag6(Sb,As)2S6Te][Ag9Cu(S,Te)2Te2] |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcostibite | CuSbS2 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Wittichenite | Cu3BiS3 |
| Cu | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| Cu | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Wurtzite | (Zn,Fe)S |
| Zn | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| Zn | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Native Arsenic | As |
| As | ⓘ Benleonardite | [Ag6(Sb,As)2S6Te][Ag9Cu(S,Te)2Te2] |
| As | ⓘ Krautite | Mn(HAsO4) · H2O |
| As | ⓘ Orpiment | As2S3 |
| As | ⓘ Proustite | Ag3AsS3 |
| As | ⓘ Realgar | As4S4 |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| Ag | Silver | |
| Ag | ⓘ Argentojarosite | AgFe33+(SO4)2(OH)6 |
| Ag | ⓘ Benleonardite | [Ag6(Sb,As)2S6Te][Ag9Cu(S,Te)2Te2] |
| Ag | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Ag | ⓘ Matildite | AgBiS2 |
| Ag | ⓘ Petzite | Ag3AuTe2 |
| Ag | ⓘ Proustite | Ag3AsS3 |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ UM2008-39-S:AgBiPb | PbAg2Bi2S5 |
| Ag | ⓘ UM2008-40-S:AgBiPb | Pb8Ag11Bi11S30 |
| Sb | Antimony | |
| Sb | ⓘ Berthierite | FeSb2S4 |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Benleonardite | [Ag6(Sb,As)2S6Te][Ag9Cu(S,Te)2Te2] |
| Sb | ⓘ Chalcostibite | CuSbS2 |
| Sb | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| Sb | ⓘ Fülöppite | Pb3Sb8S15 |
| Sb | ⓘ Metastibnite | Sb2S3 |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Senarmontite | Sb2O3 |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Zinkenite | Pb9Sb22S42 |
| Sb | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| Te | Tellurium | |
| Te | ⓘ Altaite | PbTe |
| Te | ⓘ Benleonardite | [Ag6(Sb,As)2S6Te][Ag9Cu(S,Te)2Te2] |
| Te | ⓘ Calaverite | AuTe2 |
| Te | ⓘ Petzite | Ag3AuTe2 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| W | Tungsten | |
| W | ⓘ Ferberite | FeWO4 |
| W | ⓘ Hübnerite | MnWO4 |
| W | ⓘ Scheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Calaverite | AuTe2 |
| Au | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Au | ⓘ Native Gold | Au |
| Au | ⓘ Petzite | Ag3AuTe2 |
| Pb | Lead | |
| Pb | ⓘ Altaite | PbTe |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Fülöppite | Pb3Sb8S15 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Zinkenite | Pb9Sb22S42 |
| Pb | ⓘ UM2008-39-S:AgBiPb | PbAg2Bi2S5 |
| Pb | ⓘ UM2008-40-S:AgBiPb | Pb8Ag11Bi11S30 |
| Bi | Bismuth | |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Matildite | AgBiS2 |
| Bi | ⓘ Wittichenite | Cu3BiS3 |
| Bi | ⓘ UM2008-39-S:AgBiPb | PbAg2Bi2S5 |
| Bi | ⓘ UM2008-40-S:AgBiPb | Pb8Ag11Bi11S30 |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Cavnic |
|---|---|
| Wikidata ID: | Q1018184 |
| GeoNames ID: | 682507 |
Localities in this Region
- Maramureș County
Other Regions, Features and Areas that Intersect
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Cavnic, Maramureș County, Romania