Brookfield, Fairfield County, Connecticut, USAi
| Regional Level Types | |
|---|---|
| Brookfield | Town |
| Fairfield County | County |
| Connecticut | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Brookfield is a town.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities73 valid minerals.
Detailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 Description: Included in a list of minerals without details, but plausible for the geology. |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Habit: blocky to tabular Colour: white Description: As a coarse-grained component of pegmatites, and fine-grained component of gneiss. Micro-crystals lining Alpine clefts with micro-quartz and fluorite. |
| ⓘ Albite var. Andesine Formula: (Na,Ca)[Al(Si,Al)Si2O8] Description: Included in a list of minerals without details, but plausible for the geology. |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) Description: Included in a list of minerals without details, but plausible for the geology. |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ Anatase Formula: TiO2 Habit: bipyramidal Colour: indigo-blue to pale blue Description: "Found as indigo-blue to pale blue micro-crystals intimately associated with quartz, calcite, and feldspar. The matrix appears to be a brecciated quartz rock." Januzzi (1994). At least one very small crystal was found in Ron's collection. |
| ⓘ Anglesite Formula: PbSO4 Description: "Found as an isolated grayish micro-crystal associated with quartz, feldspar, and dolomite. A brown to brownish black tourmaline (dravite?) occurs in the same environment but is not common." Januzzi (1994). |
| ⓘ Annite Formula: KFe2+3(AlSi3O10)(OH)2 |
| ⓘ Aragonite Formula: CaCO3 Localities: Description: Included in a list of minerals without details, but plausible for the geology. |
| ⓘ Arsenopyrite Formula: FeAsS Description: Included in a list of minerals without details, but plausible for the geology. |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 Localities: Description: Included in a list of minerals without details, but plausible for the geology. |
| ⓘ Bertrandite Formula: Be4(Si2O7)(OH)2 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Localities: Colour: pale green Description: "sparse green beryl crystals up to 3 inches long" |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ 'Calamine' |
| ⓘ Calcite Formula: CaCO3 Localities: U. S. Route 7 Expressway (Brookfield Bypass), Brookfield, Fairfield County, Connecticut, USA Old U. S. Route 7, Brookfield, Fairfield County, Connecticut, USA Condominium development area, Brookfield, Fairfield County, Connecticut, USA U. S. Route 7 Expressway (Danbury line to Iron Works District), Brookfield, Fairfield County, Connecticut, USA Old lead mine, Brookfield, Fairfield County, Connecticut, USA |
| ⓘ Cerussite Formula: PbCO3 Localities: Description: Included in a list of minerals without details, but plausible for the geology. |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Habit: crude tetragonal scalenohedral Colour: golden metallic Description: Microcrystals in Alpine cleft. |
| ⓘ 'Chlorite Group' Localities: Description: Included in a list of minerals without details, but plausible for the geology. |
| ⓘ Chondrodite Formula: Mg5(SiO4)2F2 Localities: Description: Included in a list of minerals without details, but plausible for the geology. |
| ⓘ Chrysoberyl Formula: BeAl2O4 Habit: tabular twinned Colour: pale yellow green to bright lemon-yellow Description: "First collected, by the author, at a granite pegmatite in the Iron Works District of Brookfield. The first crystal was about an eighth of an inch in length and bright lemon-yellow in color; this specimen was consumed at Wesleyan University for confirmation purposes. The chrysoberyl pictured is embedded in feldspar and pale yellow green in color." Januzzi (1994). Two specimens from Januzzi's collection were obtained after he passed away and confirm the occurrence. The better crystal is only 2mm. |
| ⓘ Chrysotile Formula: Mg3(Si2O5)(OH)4 Description: Included in a list of minerals without details, but plausible for the geology. |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) Habit: subhedral elongated prism Colour: pink Description: The pink variety clinothulite (or possibly the zoisite analog thulite) found as small crystals in quartz matrix. |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' References: |
| ⓘ 'Columbite Group' Habit: tabular Colour: black with iridescence Description: Subhedral crystals in pegmatite matrix. References: |
| ⓘ Datolite Formula: CaB(SiO4)(OH) Habit: tabular wedges Colour: chalky white Description: Microcrystals in Alpine cleft with quartz, adularia, chalcopyrite, laumontite. References: |
| ⓘ Dickinsonite-(KMnNa) Formula: (KNa)(Mn2+◻)Ca(Na2Na)Mn2+13Al(PO4)11(PO4)(OH)2 |
| ⓘ Diopside Formula: CaMgSi2O6 Colour: white-gray Description: "In the iron works district of Brookfield (not at construction site) abundant diopside (white-gray) is found showing excellent parting planes." Januzzi (1994). |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Elbaite Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) Habit: anhedral Colour: pink, green, dark green, pink/green/black concentric zones Description: "Photo shows anhedral crystals of pink tourmaline. This discovery, by the author, is of great interest because it has helped to firmly establish the presence of a lithium phase in the pegmatitic intrusions in the Iron Works District of Brookfield." Januzzi (1994). A few macro specimens mostly frozen in matrix were found in his collection. |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Habit: acicular Colour: gray-green Description: Reference includes photo of crystals. |
| ⓘ Eucryptite Formula: LiAlSiO4 References: |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Localities: Description: Included in a list of minerals without details, but plausible for the geology. |
| ⓘ Fluorite Formula: CaF2 Habit: rough octahedron Colour: colorless Description: Micro-crystals in Alpine clefts with micro-albite and quartz. References: |
| ⓘ Forsterite Formula: Mg2(SiO4) Description: Included in a list of minerals without details, but plausible for the geology. |
| ⓘ Galena Formula: PbS Localities: Description: Included in a list of minerals without details, but plausible for the geology. |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Greenockite Formula: CdS Localities: Description: Included in a list of minerals without details, but plausible for the geology. |
| ⓘ 'Gummite' References: |
| ⓘ Hematite ? Formula: Fe2O3 Description: Included in a list of minerals without details. |
| ⓘ Hemimorphite ? Formula: Zn4Si2O7(OH)2 · H2O Localities: Description: Included in a list of minerals without details. |
| ⓘ Heulandite-Ca Formula: (Ca,Na)5(Si27Al9)O72 · 26H2O Habit: blocky Colour: colorless Description: Microcrystal associated with drusy stilbite in a fracture in amphibolite. References: |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(C2+4C3+)(AlSi7O22)W2 Description: Included in a list of minerals without details, but plausible for the geology. |
| ⓘ Hydrozincite ? Formula: Zn5(CO3)2(OH)6 Description: Included in a list of minerals without details. |
| ⓘ Ilmenite Formula: Fe2+TiO3 Description: Included in a list of minerals without details, but plausible for the geology. |
| ⓘ 'K Feldspar' Description: Included in a list of minerals without details. |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 Habit: wedges Colour: cream Description: Microcrystals in Alpine clefts. |
| ⓘ Kyanite Formula: Al2(SiO4)O Description: Included in a list of minerals without details, but plausible for the geology. |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O Colour: chalky white Description: In Alpine cleft with microcrystalline datolite, quartz, adularia, chalcopyrite. References: |
| ⓘ 'Limonite' Localities: U. S. Route 7 Expressway (Brookfield Bypass), Brookfield, Fairfield County, Connecticut, USA U. S. Route 7 Expressway (Danbury line to Iron Works District), Brookfield, Fairfield County, Connecticut, USA Condominium development area, Brookfield, Fairfield County, Connecticut, USA State Route 133, Brookfield, Fairfield County, Connecticut, USA |
| ⓘ Lithiophilite Formula: LiMn2+PO4 Habit: massive Colour: grayish pink Description: Massive material in pegmatite matrix. References: |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Meta-autunite Formula: Ca(UO2)2(PO4)2 · 6H2O References: |
| ⓘ Metaswitzerite Formula: Mn2+3(PO4)2 · 4H2O Habit: angular flakes Colour: golden brown Description: Golden brown flakes and angular partial crystal aggregates to 5mm associated with vivianite on quartz, albite, microcline and spodumene matrix. References: |
| ⓘ Microcline Formula: K(AlSi3O8) Localities: U. S. Route 7 Expressway (Brookfield Bypass), Brookfield, Fairfield County, Connecticut, USA Danbury beryl prospect, Brookfield, Fairfield County, Connecticut, USA State Route 133, Brookfield, Fairfield County, Connecticut, USA U. S. Route 7 Expressway (Danbury line to Iron Works District), Brookfield, Fairfield County, Connecticut, USA |
| ⓘ Mitridatite ? Formula: Ca2Fe3+3(PO4)3O2 · 3H2O Habit: Druzy Description: I'm pretty sure that the yellow druzy mineralization in the pegmatite is Mitridatite. I can't definatively be sure. References: |
| ⓘ Molybdenite Formula: MoS2 Localities: Description: Included in a list of minerals without details, but plausible for the geology. |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 Description: Included in a list of minerals without details, but plausible for the geology. |
| ⓘ Native Copper ? Formula: Cu Description: very doubtful, tarnished chalcopyrite can look like copper. Details, photographs needed. References: |
| ⓘ Opal Formula: SiO2 · nH2O Description: Included in a list of minerals without details, but plausible for the geology. |
| ⓘ Opal var. Opal-AN Formula: SiO2 · nH2O Habit: encrustation Colour: brown-stained Fluorescence: bright green under SW UV Description: Coating on quartz from pegmatite. |
| ⓘ Orthoclase Formula: K(AlSi3O8) Localities: Description: Included in a list of minerals without details, but plausible for the geology. |
| ⓘ Palygorskite ? Formula: ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O Habit: fibrous Colour: white Description: Included in a list of minerals without details. Most likely this fibrous mineral is actually sepiolite. TEM-EDS analysis of a similar sample from the marble in Danbury proved to be sepiolite. |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl Localities: Description: Included in a list of minerals without details, but plausible for the geology. |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Description: Included in a list of minerals without details, but plausible for the geology. |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Rutile Formula: TiO2 Habit: equant Colour: black Description: Photo in reference shows crystals from "Kovac's Quarry, Iron Works District, Brookfield, Conn." Januzzi (1994). |
| ⓘ 'Scapolite' Colour: White to pale lilac Description: "White to pale lilac scapolite was found, relatively recently, in numerous small masses distributed in the earth during road construction in the iron works district of Brookfield." Januzzi (1994). |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: Habit: elongated prismatic Colour: black Description: Massive material in pegmatites or in the core of color-zoned elbaite. Micro-crystals in Alpine clefts. |
| ⓘ Sepiolite Formula: Mg4(Si6O15)(OH)2 · 6H2O Habit: fibrous Colour: white Description: Labelled by collector Ronald Januzzi as palygorskite but a similar-looking sample from Danbury https://www.mindat.org/photo-758041.html analyzed via TEM-EDS proved to be sepiolite. |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 |
| ⓘ Sillimanite Formula: Al2(SiO4)O Description: Included in a list of minerals without details, but plausible for the geology. References: |
| ⓘ Smithsonite Formula: ZnCO3 Habit: impalpable powder, pulverulent, and in cellular, bone-like masses Colour: white Description: Shepard (1837) uses the term "calamine" but describes it as a zinc carbonate. |
| ⓘ Sphalerite Formula: ZnS Localities: Habit: tetrahedral, polysynthetically twinned Colour: black, yellow-brown Description: As micro-crystals in voids with clay in a brecciated marble matrix. Crystals show a variety of habits including polysynthetically twinned one similar to those from Thomaston Dam (misidentified as wurtzite). |
| ⓘ Spodumene Formula: LiAlSi2O6 |
| ⓘ Staurolite Formula: Fe2+2Al9Si4O23(OH) Description: Included in a list of minerals without details, but plausible for the geology. |
| ⓘ Stilbite-Ca Formula: NaCa4(Si27Al9)O72 · 28H2O Habit: tabular Colour: pale yellow Description: Microcrystals in a fracture in amphibolite. References: |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 Localities: Description: Included in a list of minerals without details, but plausible for the geology. |
| ⓘ Tantalite-(Mn) Formula: Mn2+Ta2O6 References: |
| ⓘ Titanite Formula: CaTi(SiO4)O Description: Included in a list of minerals without details, but plausible for the geology. |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z Colour: brown to brownish black Description: "A brown to brownish black tourmaline (dravite?) occurs with quartz, feldspar, and dolomite but is not common....This brown tourmaline could possibly be uvite: chemical analysis needed." Januzzi (1994). |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 Description: Included in a list of minerals without details, but plausible for the geology. |
| ⓘ Triphylite Formula: LiFe2+PO4 |
| ⓘ Uraninite Formula: UO2 References: |
| ⓘ Vivianite Formula: Fe2+Fe2+2(PO4)2 · 8H2O Localities: Habit: cleaved masses Colour: dark blue Description: "A new American locality for vivianite has been discovered at an undisclosed site in Brookfield by Mr. Januzzi. The species occurs in a granite pegmatite with tiny oil-green masses of dickinsonite associated with triphylite". Januzzi (1994).
Cleaved masses associated with metaswitzerite on quartz, albite, microcline and spodumene matrix. |
| ⓘ Wollastonite Formula: Ca3(Si3O9) Localities: Description: Included in a list of minerals without details, but plausible for the geology. |
| ⓘ Zircon Formula: Zr(SiO4) Description: Included in a list of minerals without details, but plausible for the geology. |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) Colour: pink Description: A pink mass of crystals in quartz could be thulite (or the clinothulite variety of the locally much more common clinozoisite). |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper ? | 1.AA.05 | Cu |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Chrysoberyl | 4.BA.05 | BeAl2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite ? | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Opal var. Opal-AN | 4.DA.10 | SiO2 · nH2O |
| ⓘ | 4.DA.10 | SiO2 · nH2O | |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Tantalite-(Mn) | 4.DB.35 | Mn2+Ta2O6 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Hydrozincite ? | 5.BA.15 | Zn5(CO3)2(OH)6 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Lithiophilite | 8.AB.10 | LiMn2+PO4 |
| ⓘ | Triphylite | 8.AB.10 | LiFe2+PO4 |
| ⓘ | Dickinsonite-(KMnNa) | 8.BF.05 | (KNa)(Mn2+◻)Ca(Na2Na)Mn2+13Al(PO4)11(PO4)(OH)2 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Metaswitzerite | 8.CE.25 | Mn2+3(PO4)2 · 4H2O |
| ⓘ | Vivianite | 8.CE.40 | Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ | Mitridatite ? | 8.DH.30 | Ca2Fe3+3(PO4)3O2 · 3H2O |
| ⓘ | Meta-autunite | 8.EB.10 | Ca(UO2)2(PO4)2 · 6H2O |
| Group 9 - Silicates | |||
| ⓘ | Chrysotile | 9.00. | Mg3(Si2O5)(OH)4 |
| ⓘ | Eucryptite | 9.AA.05 | LiAlSiO4 |
| ⓘ | Forsterite | 9.AC.05 | Mg2(SiO4) |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Chondrodite | 9.AF.45 | Mg5(SiO4)2F2 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Datolite | 9.AJ.20 | CaB(SiO4)(OH) |
| ⓘ | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| ⓘ | Hemimorphite ? | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Spodumene | 9.DA.30 | LiAlSi2O6 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Annite | 9.EC.20 | KFe2+3(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Palygorskite ? | 9.EE.20 | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| ⓘ | Sepiolite | 9.EE.25 | Mg4(Si6O15)(OH)2 · 6H2O |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Andesine | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| ⓘ | Heulandite-Ca | 9.GE.05 | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| ⓘ | Stilbite-Ca | 9.GE.10 | NaCa4(Si27Al9)O72 · 28H2O |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Gummite' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Calamine' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Columbite Group' | - | |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| H | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Dickinsonite-(KMnNa) | (KNa)(Mn2+◻)Ca(Na2Na)Mn132+Al(PO4)11(PO4)(OH)2 |
| H | ⓘ Datolite | CaB(SiO4)(OH) |
| H | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| H | ⓘ Metaswitzerite | Mn32+(PO4)2 · 4H2O |
| H | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| H | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Li | Lithium | |
| Li | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | ⓘ Eucryptite | LiAlSiO4 |
| Li | ⓘ Lithiophilite | LiMn2+PO4 |
| Li | ⓘ Spodumene | LiAlSi2O6 |
| Li | ⓘ Triphylite | LiFe2+PO4 |
| Be | Beryllium | |
| Be | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Chrysoberyl | BeAl2O4 |
| B | Boron | |
| B | ⓘ Datolite | CaB(SiO4)(OH) |
| B | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Smithsonite | ZnCO3 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| O | ⓘ Chrysoberyl | BeAl2O4 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Dickinsonite-(KMnNa) | (KNa)(Mn2+◻)Ca(Na2Na)Mn132+Al(PO4)11(PO4)(OH)2 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Datolite | CaB(SiO4)(OH) |
| O | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Eucryptite | LiAlSiO4 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Forsterite | Mg2(SiO4) |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Lithiophilite | LiMn2+PO4 |
| O | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| O | ⓘ Metaswitzerite | Mn32+(PO4)2 · 4H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Spodumene | LiAlSi2O6 |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Triphylite | LiFe2+PO4 |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| O | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Dickinsonite-(KMnNa) | (KNa)(Mn2+◻)Ca(Na2Na)Mn132+Al(PO4)11(PO4)(OH)2 |
| Na | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Na | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Forsterite | Mg2(SiO4) |
| Mg | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Chrysoberyl | BeAl2O4 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Dickinsonite-(KMnNa) | (KNa)(Mn2+◻)Ca(Na2Na)Mn132+Al(PO4)11(PO4)(OH)2 |
| Al | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Eucryptite | LiAlSiO4 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spodumene | LiAlSi2O6 |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Al | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Datolite | CaB(SiO4)(OH) |
| Si | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Eucryptite | LiAlSiO4 |
| Si | ⓘ Forsterite | Mg2(SiO4) |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Spodumene | LiAlSi2O6 |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Si | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Dickinsonite-(KMnNa) | (KNa)(Mn2+◻)Ca(Na2Na)Mn132+Al(PO4)11(PO4)(OH)2 |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Lithiophilite | LiMn2+PO4 |
| P | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| P | ⓘ Metaswitzerite | Mn32+(PO4)2 · 4H2O |
| P | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Triphylite | LiFe2+PO4 |
| P | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| S | Sulfur | |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Galena | PbS |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| Cl | Chlorine | |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Dickinsonite-(KMnNa) | (KNa)(Mn2+◻)Ca(Na2Na)Mn132+Al(PO4)11(PO4)(OH)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Dickinsonite-(KMnNa) | (KNa)(Mn2+◻)Ca(Na2Na)Mn132+Al(PO4)11(PO4)(OH)2 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Datolite | CaB(SiO4)(OH) |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| Ca | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Ca | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Mn | Manganese | |
| Mn | ⓘ Dickinsonite-(KMnNa) | (KNa)(Mn2+◻)Ca(Na2Na)Mn132+Al(PO4)11(PO4)(OH)2 |
| Mn | ⓘ Lithiophilite | LiMn2+PO4 |
| Mn | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
| Mn | ⓘ Metaswitzerite | Mn32+(PO4)2 · 4H2O |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Mitridatite | Ca2Fe33+(PO4)3O2 · 3H2O |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Triphylite | LiFe2+PO4 |
| Fe | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Native Copper | Cu |
| Zn | Zinc | |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| Ta | Tantalum | |
| Ta | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| U | Uranium | |
| U | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| U | ⓘ Uraninite | UO2 |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Brookfield,_Connecticut |
|---|---|
| Wikidata ID: | Q225389 |
| GeoNames ID: | 5282953 |
Localities in this Region
Other Regions, Features and Areas that Intersect
North AmericaContinent
North America PlateTectonic Plate
- Laurentides DomainPassive Margin
- Piedmontia DomainDomain
- Taconic ArcVolcanic Arc
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.




U. S. Route 7 Expressway, Brookfield, Fairfield County, Connecticut, USA