Mackenheim, Abtsteinach, Bergstraße, Darmstadt, Hesse, Germanyi
| Regional Level Types | |
|---|---|
| Mackenheim | Village |
| Abtsteinach | Community |
| Bergstraße | District |
| Darmstadt | Region |
| Hesse | City-State |
| Germany | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
49° 33' 43'' North , 8° 47' 10'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Other Languages:
German:
Mackenheim, Abtsteinach, Bergstraße, Landkreis Bergstraße, Regierungsbezirk Darmstadt, Hessen, Deutschland
Mackenheim is the smallest district ("Ortsteil") of the municipality of Abtsteinach in the Bergstrasse district in southern Hesse. Mackenheim is located in the Odenwald in a high side valley of the Mörlenbach and basically consists of four large, scattered agricultural farms, between which some residential developments have arisen. At the lower end of the Mackenheimer valley, in the north of the district, a sandstone railway viaduct of the disused Überwaldbahn leads over the local road. Here is a quarry for the extraction of granite, migmatite and biotite gneiss.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities64 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Aikinite Formula: PbCuBiS3 |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ Anatase Formula: TiO2 |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 References: |
| ⓘ Annabergite Formula: Ni3(AsO4)2 · 8H2O |
| ⓘ 'Apophyllite Group' Formula: AB4[Si8O22]X · 8H2O References: |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Arseniosiderite Formula: Ca2Fe3+3(AsO4)3O2 · 3H2O |
| ⓘ Arsenolamprite Formula: As |
| ⓘ Arsenolite Formula: As2O3 References: |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 |
| ⓘ Bariopharmacosiderite Formula: Ba0.5Fe3+4(AsO4)3(OH)4 · 5H2O |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Bastnäsite-(Ce) Formula: Ce(CO3)F |
| ⓘ Bismite Formula: Bi2O3 |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ 'Bismuth Ochre' |
| ⓘ Bismutite Formula: (BiO)2CO3 References: |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ 'Chabazite' References: |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Cobaltkoritnigite Formula: Co(AsO3OH) · H2O |
| ⓘ Coffinite Formula: U(SiO4) · nH2O |
| ⓘ Columbite-(Fe) Formula: Fe2+Nb2O6 References: |
| ⓘ Cosalite Formula: Pb2Bi2S5 |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Emplectite Formula: CuBiS2 |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Galena Formula: PbS |
| ⓘ Galenobismutite Formula: PbBi2S4 References: |
| ⓘ Gersdorffite Formula: NiAsS |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ 'K Feldspar' |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 |
| ⓘ 'Limonite' |
| ⓘ Löllingite Formula: FeAs2 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) |
| ⓘ Moorhouseite Formula: Co(SO4) · 6H2O |
| ⓘ Native Arsenic Formula: As |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Gold Formula: Au |
| ⓘ Native Silver Formula: Ag References: |
| ⓘ Nickeline Formula: NiAs |
| ⓘ Pharmacolite Formula: Ca(HAsO4) · 2H2O |
| ⓘ Pumpellyite-(Fe2+) Formula: Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) References: |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Rammelsbergite Formula: NiAs2 References: Burisch, Mathias; Gerdes, Axel; Walter, Benjamin F.; Neumann, Udo; Fettel, Michael; Markl, Gregor (2017) Methane and the origin of five-element veins: Mineralogy, age, fluid inclusion chemistry and ore forming processes in the Odenwald, SW Germany. Ore Geology Reviews, 81. doi:10.1016/j.oregeorev.2016.10.033 |
| ⓘ Roselite Formula: Ca2Co(AsO4)2 · 2H2O References: |
| ⓘ Safflorite Formula: (Co,Ni,Fe)As2 |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Skutterudite Formula: CoAs3 |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Tennantite-(Fe) Formula: Cu6(Cu4Fe2+2)As4S12S References: |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S |
| ⓘ Tetrahedrite-(Zn) Formula: Cu6(Cu4Zn2)Sb4S12S References: |
| ⓘ Titanite Formula: CaTi(SiO4)O References: Burisch, Mathias; Gerdes, Axel; Walter, Benjamin F.; Neumann, Udo; Fettel, Michael; Markl, Gregor (2017) Methane and the origin of five-element veins: Mineralogy, age, fluid inclusion chemistry and ore forming processes in the Odenwald, SW Germany. Ore Geology Reviews, 81. doi:10.1016/j.oregeorev.2016.10.033 |
| ⓘ Todorokite Formula: (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| ⓘ Tyrolite Formula: Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| ⓘ Uraninite Formula: UO2 |
| ⓘ Uraninite var. Pitchblende Formula: UO2 |
| ⓘ Zippeite Formula: K3(UO2)4(SO4)2O3(OH) · 3H2O |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Arsenic | 1.CA.05 | As |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Arsenolamprite | 1.CA.10 | As |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Rammelsbergite | 2.EB.15a | NiAs2 |
| ⓘ | Safflorite | 2.EB.15a | (Co,Ni,Fe)As2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Skutterudite | 2.EC.05 | CoAs3 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | Tetrahedrite-(Zn) | 2.GB.05 | Cu6(Cu4Zn2)Sb4S12S |
| ⓘ | Tennantite-(Fe) | 2.GB.05 | Cu6(Cu4Fe2+2)As4S12S |
| ⓘ | Emplectite | 2.HA.05 | CuBiS2 |
| ⓘ | Aikinite | 2.HB.05a | PbCuBiS3 |
| ⓘ | Cosalite | 2.JB.10 | Pb2Bi2S5 |
| ⓘ | Galenobismutite | 2.JC.25e | PbBi2S4 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Arsenolite | 4.CB.50 | As2O3 |
| ⓘ | Bismite | 4.CB.60 | Bi2O3 |
| ⓘ | Quartz var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Todorokite | 4.DK.10 | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| ⓘ | Uraninite var. Pitchblende | 4.DL.05 | UO2 |
| ⓘ | 4.DL.05 | UO2 | |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Bastnäsite-(Ce) | 5.BD.20a | Ce(CO3)F |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Moorhouseite | 7.CB.25 | Co(SO4) · 6H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Zippeite | 7.EC.05 | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Cobaltkoritnigite | 8.CB.20 | Co(AsO3OH) · H2O |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Annabergite | 8.CE.40 | Ni3(AsO4)2 · 8H2O |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Roselite | 8.CG.10 | Ca2Co(AsO4)2 · 2H2O |
| ⓘ | Pharmacolite | 8.CJ.50 | Ca(HAsO4) · 2H2O |
| ⓘ | Arseniosiderite | 8.DH.30 | Ca2Fe3+3(AsO4)3O2 · 3H2O |
| ⓘ | Bariopharmacosiderite | 8.DK.10 | Ba0.5Fe3+4(AsO4)3(OH)4 · 5H2O |
| ⓘ | Tyrolite | 8.DM.10 | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Group 9 - Silicates | |||
| ⓘ | Coffinite | 9.AD.30 | U(SiO4) · nH2O |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Pumpellyite-(Fe2+) | 9.BG.20 | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Apophyllite Group' | - | AB4[Si8O22]X · 8H2O |
| ⓘ | 'Bismuth Ochre' | - | |
| ⓘ | 'Chabazite' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'K Feldspar' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| H | ⓘ Apophyllite Group | AB4[Si8O22]X · 8H2O |
| H | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| H | ⓘ Cobaltkoritnigite | Co(AsO3OH) · H2O |
| H | ⓘ Coffinite | U(SiO4) · nH2O |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Moorhouseite | Co(SO4) · 6H2O |
| H | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| H | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| H | ⓘ Roselite | Ca2Co(AsO4)2 · 2H2O |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| H | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| H | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| O | Oxygen | |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| O | ⓘ Apophyllite Group | AB4[Si8O22]X · 8H2O |
| O | ⓘ Arsenolite | As2O3 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| O | ⓘ Bismite | Bi2O3 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Cobaltkoritnigite | Co(AsO3OH) · H2O |
| O | ⓘ Coffinite | U(SiO4) · nH2O |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Moorhouseite | Co(SO4) · 6H2O |
| O | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| O | ⓘ Uraninite var. Pitchblende | UO2 |
| O | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Roselite | Ca2Co(AsO4)2 · 2H2O |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| O | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| F | Fluorine | |
| F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mg | Magnesium | |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| Al | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Si | Silicon | |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Apophyllite Group | AB4[Si8O22]X · 8H2O |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Coffinite | U(SiO4) · nH2O |
| Si | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| P | Phosphorus | |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| S | Sulfur | |
| S | ⓘ Aikinite | PbCuBiS3 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Cosalite | Pb2Bi2S5 |
| S | ⓘ Emplectite | CuBiS2 |
| S | ⓘ Galena | PbS |
| S | ⓘ Galenobismutite | PbBi2S4 |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Moorhouseite | Co(SO4) · 6H2O |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| S | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| S | ⓘ Tennantite-(Fe) | Cu6(Cu4Fe22+)As4S12S |
| Cl | Chlorine | |
| Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| K | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| Ca | Calcium | |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| Ca | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| Ca | ⓘ Roselite | Ca2Co(AsO4)2 · 2H2O |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Ca | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Ti | Titanium | |
| Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Mn | Manganese | |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Fe | Iron | |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Fe | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Tennantite-(Fe) | Cu6(Cu4Fe22+)As4S12S |
| Co | Cobalt | |
| Co | ⓘ Cobaltkoritnigite | Co(AsO3OH) · H2O |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Co | ⓘ Moorhouseite | Co(SO4) · 6H2O |
| Co | ⓘ Roselite | Ca2Co(AsO4)2 · 2H2O |
| Co | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Co | ⓘ Skutterudite | CoAs3 |
| Ni | Nickel | |
| Ni | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Nickeline | NiAs |
| Ni | ⓘ Rammelsbergite | NiAs2 |
| Ni | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Cu | Copper | |
| Cu | ⓘ Aikinite | PbCuBiS3 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Emplectite | CuBiS2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Cu | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| Cu | ⓘ Tennantite-(Fe) | Cu6(Cu4Fe22+)As4S12S |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| As | Arsenic | |
| As | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| As | ⓘ Arsenolite | As2O3 |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Arsenolamprite | As |
| As | ⓘ Native Arsenic | As |
| As | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| As | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| As | ⓘ Cobaltkoritnigite | Co(AsO3OH) · H2O |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Nickeline | NiAs |
| As | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| As | ⓘ Rammelsbergite | NiAs2 |
| As | ⓘ Roselite | Ca2Co(AsO4)2 · 2H2O |
| As | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Skutterudite | CoAs3 |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| As | ⓘ Tennantite-(Fe) | Cu6(Cu4Fe22+)As4S12S |
| Sr | Strontium | |
| Sr | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ag | Silver | |
| Ag | ⓘ Native Silver | Ag |
| Sb | Antimony | |
| Sb | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| Ba | Barium | |
| Ba | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Ce | Cerium | |
| Ce | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Aikinite | PbCuBiS3 |
| Pb | ⓘ Cosalite | Pb2Bi2S5 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Galenobismutite | PbBi2S4 |
| Bi | Bismuth | |
| Bi | ⓘ Aikinite | PbCuBiS3 |
| Bi | ⓘ Bismite | Bi2O3 |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Cosalite | Pb2Bi2S5 |
| Bi | ⓘ Emplectite | CuBiS2 |
| Bi | ⓘ Galenobismutite | PbBi2S4 |
| U | Uranium | |
| U | ⓘ Coffinite | U(SiO4) · nH2O |
| U | ⓘ Uraninite var. Pitchblende | UO2 |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
Other Databases
| Wikipedia: | https://de.wikipedia.org/wiki/Mackenheim_(Abtsteinach) |
|---|---|
| Wikidata ID: | Q1882886 |
Localities in this Region
- Hesse
- Darmstadt
- Bergstraße
- Abtsteinach
- Mackenheim
- Abtsteinach
- Bergstraße
- Darmstadt
Other Regions, Features and Areas containing this locality
Eurasian PlateTectonic Plate
- KupferschieferMining Field
- Saxo-Thuringian BeltOrogenic Belt
EuropeContinent
Germany
- OdenwaldMountain Range
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.





Mackenheim, Abtsteinach, Bergstraße, Darmstadt, Hesse, Germany